From 2650f945986192f78af049fc8c11e4be0b327f8b Mon Sep 17 00:00:00 2001 From: Alan Mishchenko Date: Sun, 31 Mar 2013 23:09:51 -0700 Subject: Shrink for 6-LUTs. --- src/aig/gia/gia.h | 1 + src/aig/gia/giaShrink.c | 3 +- src/aig/gia/giaShrink6.c | 481 ++++++++++++++++++++++++++++++ src/aig/gia/module.make | 1 + src/base/abci/abc.c | 14 +- src/bool/rsb/module.make | 2 + src/bool/rsb/rsb.h | 65 ++++ src/bool/rsb/rsbDec6.c | 733 ++++++++++++++++++++++++++++++++++++++++++++++ src/bool/rsb/rsbInt.h | 84 ++++++ src/bool/rsb/rsbMan.c | 99 +++++++ src/misc/util/utilTruth.h | 140 ++++++++- 11 files changed, 1617 insertions(+), 6 deletions(-) create mode 100644 src/aig/gia/giaShrink6.c create mode 100644 src/bool/rsb/module.make create mode 100644 src/bool/rsb/rsb.h create mode 100644 src/bool/rsb/rsbDec6.c create mode 100644 src/bool/rsb/rsbInt.h create mode 100644 src/bool/rsb/rsbMan.c (limited to 'src') diff --git a/src/aig/gia/gia.h b/src/aig/gia/gia.h index 23afc45e..eb3bedab 100644 --- a/src/aig/gia/gia.h +++ b/src/aig/gia/gia.h @@ -980,6 +980,7 @@ extern Gia_Man_t * Gia_ManSeqCleanup( Gia_Man_t * p ); extern Gia_Man_t * Gia_ManSeqStructSweep( Gia_Man_t * p, int fConst, int fEquiv, int fVerbose ); /*=== giaShrink.c ===========================================================*/ extern Gia_Man_t * Gia_ManPerformMapShrink( Gia_Man_t * p, int fKeepLevel, int fVerbose ); +extern Gia_Man_t * Gia_ManMapShrink6( Gia_Man_t * p, int fKeepLevel, int fVerbose ); /*=== giaSort.c ============================================================*/ extern int * Gia_SortFloats( float * pArray, int * pPerm, int nSize ); /*=== giaSim.c ============================================================*/ diff --git a/src/aig/gia/giaShrink.c b/src/aig/gia/giaShrink.c index 487f9aa6..69dec67c 100644 --- a/src/aig/gia/giaShrink.c +++ b/src/aig/gia/giaShrink.c @@ -85,7 +85,8 @@ Gia_Man_t * Gia_ManPerformMapShrink( Gia_Man_t * p, int fKeepLevel, int fVerbose if ( Gia_ObjIsCi(pObj) ) { pObj->Value = Gia_ManAppendCi( pNew ); - Gia_ObjSetLevel( pNew, Gia_ObjFromLit(pNew, Gia_ObjValue(pObj)), Gia_ObjLevel(p, pObj) ); + if ( p->vLevels ) + Gia_ObjSetLevel( pNew, Gia_ObjFromLit(pNew, Gia_ObjValue(pObj)), Gia_ObjLevel(p, pObj) ); } else if ( Gia_ObjIsCo(pObj) ) { diff --git a/src/aig/gia/giaShrink6.c b/src/aig/gia/giaShrink6.c new file mode 100644 index 00000000..0d7f7541 --- /dev/null +++ b/src/aig/gia/giaShrink6.c @@ -0,0 +1,481 @@ +/**CFile**************************************************************** + + FileName [giaShrink6.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [Scalable AIG package.] + + Synopsis [Implementation of DAG-aware unmapping for 6-input cuts.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 20, 2005.] + + Revision [$Id: giaShrink6.c,v 1.00 2005/06/20 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include "gia.h" +#include "bool/bdc/bdc.h" +#include "bool/rsb/rsb.h" +//#include "misc/util/utilTruth.h" + +ABC_NAMESPACE_IMPL_START + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +static word Truth[8] = { + ABC_CONST(0xAAAAAAAAAAAAAAAA), + ABC_CONST(0xCCCCCCCCCCCCCCCC), + ABC_CONST(0xF0F0F0F0F0F0F0F0), + ABC_CONST(0xFF00FF00FF00FF00), + ABC_CONST(0xFFFF0000FFFF0000), + ABC_CONST(0xFFFFFFFF00000000), + ABC_CONST(0x0000000000000000), + ABC_CONST(0xFFFFFFFFFFFFFFFF) +}; + +// fanout structure +typedef struct Shr_Fan_t_ Shr_Fan_t; +struct Shr_Fan_t_ +{ + int iFan; // fanout ID + int Next; // next structure +}; + +// operation manager +typedef struct Shr_Man_t_ Shr_Man_t; +struct Shr_Man_t_ +{ + Gia_Man_t * pGia; // user's AIG + Gia_Man_t * pNew; // constructed AIG + int nDivMax; // max number of divisors + int nNewSize; // max growth size + // dynamic fanout (can only grow) + Vec_Wrd_t * vFanMem; // fanout memory + Vec_Int_t * vObj2Fan; // fanout + Shr_Fan_t * pFanTemp; // temporary fanout + // divisors + Vec_Int_t * vDivs; // divisors + Vec_Int_t * vPrio; // priority queue + Vec_Int_t * vDivResub; // resubstitution + Vec_Int_t * vLeaves; // cut leaves + // truth tables + Vec_Wrd_t * vTruths; // truth tables + Vec_Wrd_t * vDivTruths; // truth tables + // bidecomposition + Rsb_Man_t * pManRsb; + Bdc_Man_t * pManDec; + Bdc_Par_t Pars; +}; + +#define Shr_ObjForEachFanout( p, iNode, iFan ) \ + for ( iFan = Shr_ManFanIterStart(p, iNode); iFan; iFan = Shr_ManFanIterNext(p) ) + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Shr_Man_t * Shr_ManAlloc( Gia_Man_t * pGia ) +{ + Shr_Man_t * p; + p = ABC_CALLOC( Shr_Man_t, 1 ); + p->nDivMax = 64; + p->nNewSize = 3 * Gia_ManObjNum(pGia) / 2; + p->pGia = pGia; + p->vFanMem = Vec_WrdAlloc( 1000 ); Vec_WrdPush(p->vFanMem, -1); + p->vObj2Fan = Vec_IntStart( p->nNewSize ); + p->vDivs = Vec_IntAlloc( 1000 ); + p->vPrio = Vec_IntAlloc( 1000 ); + p->vTruths = Vec_WrdStart( p->nNewSize ); + p->vDivTruths = Vec_WrdAlloc( 100 ); + p->vDivResub = Vec_IntAlloc( 6 ); + p->vLeaves = Vec_IntAlloc( 6 ); + // start new manager + p->pNew = Gia_ManStart( p->nNewSize ); + p->pNew->pName = Abc_UtilStrsav( pGia->pName ); + p->pNew->pSpec = Abc_UtilStrsav( pGia->pSpec ); + Gia_ManHashAlloc( p->pNew ); + Gia_ManCleanLevels( p->pNew, p->nNewSize ); + // allocate traversal IDs + p->pNew->nObjs = p->nNewSize; + Gia_ManIncrementTravId( p->pNew ); + p->pNew->nObjs = 1; + // start decompostion + p->Pars.nVarsMax = 6; + p->Pars.fVerbose = 0; + p->pManDec = Bdc_ManAlloc( &p->Pars ); + p->pManRsb = Rsb_ManAlloc( 6, p->nDivMax, 4, 1 ); + return p; +} +Gia_Man_t * Shr_ManFree( Shr_Man_t * p ) +{ + // prepare the manager + Gia_Man_t * pTemp; + Gia_ManHashStop( p->pNew ); + Vec_IntFreeP( &p->pNew->vLevels ); + if ( Gia_ManHasDangling(p->pNew) ) + { + p->pNew = Gia_ManCleanup( pTemp = p->pNew ); + if ( Gia_ManAndNum(p->pNew) != Gia_ManAndNum(pTemp) ) + printf( "Gia_ManShrink6() node reduction after sweep %6d -> %6d.\n", Gia_ManAndNum(pTemp), Gia_ManAndNum(p->pNew) ); + Gia_ManStop( pTemp ); + } + Gia_ManSetRegNum( p->pNew, Gia_ManRegNum(p->pGia) ); + pTemp = p->pNew; p->pNew = NULL; + // free data structures + Rsb_ManFree( p->pManRsb ); + Bdc_ManFree( p->pManDec ); + Gia_ManStopP( &p->pNew ); + Vec_WrdFree( p->vFanMem ); + Vec_IntFree( p->vObj2Fan ); + Vec_IntFree( p->vDivs ); + Vec_IntFree( p->vPrio ); + Vec_WrdFree( p->vTruths ); + Vec_WrdFree( p->vDivTruths ); + Vec_IntFree( p->vDivResub ); + Vec_IntFree( p->vLeaves ); + ABC_FREE( p ); + return pTemp; +} + + +/**Function************************************************************* + + Synopsis [Fanout manipulation.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline void Shr_ManAddFanout( Shr_Man_t * p, int iFanin, int iFanout ) +{ + Shr_Fan_t FanStr; + FanStr.iFan = iFanout; + FanStr.Next = Vec_IntEntry(p->vObj2Fan, iFanin); + Vec_IntWriteEntry( p->vObj2Fan, iFanin, Vec_WrdSize(p->vFanMem) ); + Vec_WrdPush(p->vFanMem, *((word *)&FanStr) ); +} +static inline int Shr_ManFanIterStart( Shr_Man_t * p, int iNode ) +{ + if ( Vec_IntEntry(p->vObj2Fan, iNode) == 0 ) + return 0; + p->pFanTemp = (Shr_Fan_t *)Vec_WrdEntryP( p->vFanMem, Vec_IntEntry(p->vObj2Fan, iNode) ); + return p->pFanTemp->iFan; +} +static inline int Shr_ManFanIterNext( Shr_Man_t * p ) +{ + if ( p->pFanTemp->Next == 0 ) + return 0; + p->pFanTemp = (Shr_Fan_t *)Vec_WrdEntryP( p->vFanMem, p->pFanTemp->Next ); + return p->pFanTemp->iFan; +} + +/**Function************************************************************* + + Synopsis [Collect divisors.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline int Shr_ManDivPushOrderByLevel( Shr_Man_t * p, int iDiv ) +{ + int iPlace, * pArray; + Vec_IntPush( p->vPrio, iDiv ); + if ( Vec_IntSize(p->vPrio) == 1 ) + return 0; + pArray = Vec_IntArray(p->vPrio); + for ( iPlace = Vec_IntSize(p->vPrio) - 1; iPlace > 0; iPlace-- ) + if ( Gia_ObjLevel(p->pNew, Gia_ManObj(p->pNew, pArray[iPlace-1])) > + Gia_ObjLevel(p->pNew, Gia_ManObj(p->pNew, pArray[iPlace])) ) + ABC_SWAP( int, pArray[iPlace-1], pArray[iPlace] ) + else + break; + return iPlace; // the place of the new divisor +} +static inline int Shr_ManCollectDivisors( Shr_Man_t * p, Vec_Int_t * vLeaves, int Limit ) +{ + Gia_Obj_t * pFan; + int i, iDiv, iFan, iPlace; + assert( Limit > 6 ); + Vec_IntClear( p->vDivs ); + Vec_IntClear( p->vPrio ); + Gia_ManIncrementTravId( p->pNew ); + Vec_IntForEachEntry( vLeaves, iDiv, i ) + { + Vec_IntPush( p->vDivs, iDiv ); + Shr_ManDivPushOrderByLevel( p, iDiv ); + Gia_ObjSetTravIdCurrentId( p->pNew, iDiv ); + } + Vec_IntForEachEntry( p->vPrio, iDiv, i ) + { + assert( Gia_ObjIsTravIdCurrentId(p->pNew, iDiv) ); + Shr_ObjForEachFanout( p, iDiv, iFan ) + { + if ( Gia_ObjIsTravIdCurrentId(p->pNew, iFan) ) + continue; + pFan = Gia_ManObj( p->pNew, iFan ); + assert( Gia_ObjIsAnd(pFan) ); + assert( Gia_ObjLevel(p->pNew, Gia_ManObj(p->pNew, iDiv)) < Gia_ObjLevel(p->pNew, pFan) ); + if ( !Gia_ObjIsTravIdCurrentId(p->pNew, Gia_ObjFaninId0(pFan, iFan)) || + !Gia_ObjIsTravIdCurrentId(p->pNew, Gia_ObjFaninId1(pFan, iFan)) ) + continue; + Vec_IntPush( p->vDivs, iFan ); + Gia_ObjSetTravIdCurrentId( p->pNew, iFan ); + iPlace = Shr_ManDivPushOrderByLevel( p, iFan ); + assert( i < iPlace ); + if ( Vec_IntSize(p->vDivs) == Limit ) + return Vec_IntSize(p->vDivs); + } + } + return Vec_IntSize(p->vDivs); +} + +/**Function************************************************************* + + Synopsis [Resynthesizes nodes using bi-decomposition.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Shr_ObjPerformBidec( Shr_Man_t * p, Bdc_Man_t * pManDec, Gia_Man_t * pNew, Vec_Int_t * vLeafLits, word uTruth1, word uTruthC ) +{ + Bdc_Fun_t * pFunc; + Gia_Obj_t * pObj; + int i, iVar, iLit, nNodes, iLast; + int nVars = Vec_IntSize(vLeafLits); + assert( uTruth1 != 0 && uTruthC != 0 ); + Bdc_ManDecompose( pManDec, (unsigned *)&uTruth1, (unsigned *)&uTruthC, nVars, NULL, 1000 ); + Bdc_FuncSetCopyInt( Bdc_ManFunc(pManDec, 0), 1 ); + Vec_IntForEachEntry( vLeafLits, iVar, i ) + Bdc_FuncSetCopyInt( Bdc_ManFunc(pManDec, i+1), Abc_Var2Lit(iVar, 0) ); + nNodes = Bdc_ManNodeNum( pManDec ); + for ( i = nVars + 1; i < nNodes; i++ ) + { + pFunc = Bdc_ManFunc( pManDec, i ); + iLast = Gia_ManObjNum(pNew); + iLit = Gia_ManHashAnd( pNew, Bdc_FunFanin0Copy(pFunc), Bdc_FunFanin1Copy(pFunc) ); + Bdc_FuncSetCopyInt( pFunc, iLit ); + if ( iLast == Gia_ManObjNum(pNew) ) + continue; + assert( iLast + 1 == Gia_ManObjNum(pNew) ); + pObj = Gia_ManObj(pNew, Abc_Lit2Var(iLit)); + Gia_ObjSetAndLevel( pNew, pObj ); + Shr_ManAddFanout( p, Gia_ObjFaninId0p(pNew, pObj), Gia_ObjId(pNew, pObj) ); + Shr_ManAddFanout( p, Gia_ObjFaninId1p(pNew, pObj), Gia_ObjId(pNew, pObj) ); + assert( Gia_ManObjNum(pNew) < p->nNewSize ); + } + return Bdc_FunObjCopy( Bdc_ManRoot(pManDec) ); +} + + +/**Function************************************************************* + + Synopsis [Compute truth table.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +word Shr_ManComputeTruth6_rec( Gia_Man_t * p, int iNode, Vec_Wrd_t * vTruths ) +{ + Gia_Obj_t * pObj; + word Truth0, Truth1; + if ( Gia_ObjIsTravIdCurrentId(p, iNode) ) + return Vec_WrdEntry(vTruths, iNode); + Gia_ObjSetTravIdCurrentId(p, iNode); + pObj = Gia_ManObj( p, iNode ); + assert( Gia_ObjIsAnd(pObj) ); + Truth0 = Shr_ManComputeTruth6_rec( p, Gia_ObjFaninId0p(p, pObj), vTruths ); + Truth1 = Shr_ManComputeTruth6_rec( p, Gia_ObjFaninId1p(p, pObj), vTruths ); + if ( Gia_ObjFaninC0(pObj) ) + Truth0 = ~Truth0; + if ( Gia_ObjFaninC1(pObj) ) + Truth1 = ~Truth1; + Vec_WrdWriteEntry( vTruths, iNode, Truth0 & Truth1 ); + return Truth0 & Truth1; +} +word Shr_ManComputeTruth6( Gia_Man_t * p, Gia_Obj_t * pObj, Vec_Int_t * vLeaves, Vec_Wrd_t * vTruths ) +{ + int i, iLeaf; + assert( Gia_ObjIsAnd(pObj) ); + Gia_ManIncrementTravId( p ); + Vec_IntForEachEntry( vLeaves, iLeaf, i ) + { + Gia_ObjSetTravIdCurrentId( p, iLeaf ); + Vec_WrdWriteEntry( vTruths, iLeaf, Truth[i] ); + } + return Shr_ManComputeTruth6_rec( p, Gia_ObjId(p, pObj), vTruths ); +} + +/**Function************************************************************* + + Synopsis [Compute truth table.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Shr_ManComputeTruths( Gia_Man_t * p, int nVars, Vec_Int_t * vDivs, Vec_Wrd_t * vDivTruths, Vec_Wrd_t * vTruths ) +{ + Gia_Obj_t * pObj; + word Truth0, Truth1;//, Truthh; + int i, iDiv; + Vec_WrdClear( vDivTruths ); + Vec_IntForEachEntryStop( vDivs, iDiv, i, nVars ) + { + Vec_WrdWriteEntry( vTruths, iDiv, Truth[i] ); + Vec_WrdPush( vDivTruths, Truth[i] ); + } + Vec_IntForEachEntryStart( vDivs, iDiv, i, nVars ) + { + pObj = Gia_ManObj( p, iDiv ); + Truth0 = Vec_WrdEntry( vTruths, Gia_ObjFaninId0(pObj, iDiv) ); + Truth1 = Vec_WrdEntry( vTruths, Gia_ObjFaninId1(pObj, iDiv) ); + if ( Gia_ObjFaninC0(pObj) ) + Truth0 = ~Truth0; + if ( Gia_ObjFaninC1(pObj) ) + Truth1 = ~Truth1; + Vec_WrdWriteEntry( vTruths, iDiv, Truth0 & Truth1 ); + Vec_WrdPush( vDivTruths, Truth0 & Truth1 ); + +// Truthh = Truth0 & Truth1; +// Abc_TtPrintBinary( &Truthh, nVars ); //printf( "\n" ); +// Kit_DsdPrintFromTruth( &Truthh, nVars ); printf( "\n" ); + } +// printf( "\n" ); +} + + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Gia_Man_t * Gia_ManMapShrink6( Gia_Man_t * p, int fKeepLevel, int fVerbose ) +{ + Shr_Man_t * pMan; + Gia_Obj_t * pObj, * pFanin; + word uTruth, uTruth0, uTruth1; + int i, k, nDivs, iNode; + int RetValue, Counter1 = 0, Counter2 = 0; + clock_t clk = clock(); + assert( p->pMapping != NULL ); + pMan = Shr_ManAlloc( p ); + Gia_ManFillValue( p ); + Gia_ManConst0(p)->Value = 0; + Gia_ManForEachObj1( p, pObj, i ) + { + if ( Gia_ObjIsCi(pObj) ) + { + pObj->Value = Gia_ManAppendCi( pMan->pNew ); + if ( p->vLevels ) + Gia_ObjSetLevel( pMan->pNew, Gia_ObjFromLit(pMan->pNew, Gia_ObjValue(pObj)), Gia_ObjLevel(p, pObj) ); + } + else if ( Gia_ObjIsCo(pObj) ) + { + pObj->Value = Gia_ManAppendCo( pMan->pNew, Gia_ObjFanin0Copy(pObj) ); + } + else if ( Gia_ObjIsLut(p, i) ) + { + // collect leaves of this gate + Vec_IntClear( pMan->vLeaves ); + Gia_LutForEachFanin( p, i, iNode, k ) + Vec_IntPush( pMan->vLeaves, iNode ); + assert( Vec_IntSize(pMan->vLeaves) <= 6 ); + // compute truth table + uTruth = Shr_ManComputeTruth6( pMan->pGia, pObj, pMan->vLeaves, pMan->vTruths ); + assert( pObj->Value == ~0 ); + if ( uTruth == 0 || ~uTruth == 0 ) + pObj->Value = Abc_LitNotCond( 0, ~uTruth == 0 ); + else + Gia_ManForEachObjVec( pMan->vLeaves, p, pFanin, k ) + if ( uTruth == Truth[k] || ~uTruth == Truth[k] ) + pObj->Value = Abc_LitNotCond( pFanin->Value, ~uTruth == Truth[k] ); + if ( pObj->Value != ~0 ) + continue; + // translate into new nodes + Gia_ManForEachObjVec( pMan->vLeaves, p, pFanin, k ) + { + if ( Abc_LitIsCompl(pFanin->Value) ) + uTruth = ((uTruth & Truth[k]) >> (1 << k)) | ((uTruth & ~Truth[k]) << (1 << k)); + Vec_IntWriteEntry( pMan->vLeaves, k, Abc_Lit2Var(pFanin->Value) ); + } + // compute divisors + nDivs = Shr_ManCollectDivisors( pMan, pMan->vLeaves, pMan->nDivMax ); + assert( nDivs <= pMan->nDivMax ); + // compute truth tables + Shr_ManComputeTruths( pMan->pNew, Vec_IntSize(pMan->vLeaves), pMan->vDivs, pMan->vDivTruths, pMan->vTruths ); + // perform resubstitution + RetValue = Rsb_ManPerformResub6( pMan->pManRsb, Vec_IntSize(pMan->vLeaves), uTruth, pMan->vDivTruths, &uTruth0, &uTruth1, 0 ); + if ( RetValue ) // resub exists + { + Vec_Int_t * vResult = Rsb_ManGetFanins(pMan->pManRsb); + Vec_IntClear( pMan->vDivResub ); + Vec_IntForEachEntry( vResult, iNode, k ) + Vec_IntPush( pMan->vDivResub, Vec_IntEntry(pMan->vDivs, iNode) ); + pObj->Value = Shr_ObjPerformBidec( pMan, pMan->pManDec, pMan->pNew, pMan->vDivResub, uTruth1, uTruth0 | uTruth1 ); + Counter1++; + } + else + { + pObj->Value = Shr_ObjPerformBidec( pMan, pMan->pManDec, pMan->pNew, pMan->vLeaves, uTruth, ~(word)0 ); + Counter2++; + } + } + } + if ( fVerbose ) + { + printf( "Performed %d resubs and %d decomps. ", Counter1, Counter2 ); + printf( "Gain in AIG nodes = %d. ", Gia_ManObjNum(p)-Gia_ManObjNum(pMan->pNew) ); + ABC_PRT( "Runtime", clock() - clk ); + } + return Shr_ManFree( pMan ); +} + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + diff --git a/src/aig/gia/module.make b/src/aig/gia/module.make index 17147f49..5cb60633 100644 --- a/src/aig/gia/module.make +++ b/src/aig/gia/module.make @@ -31,6 +31,7 @@ SRC += src/aig/gia/giaAig.c \ src/aig/gia/giaRetime.c \ src/aig/gia/giaScl.c \ src/aig/gia/giaShrink.c \ + src/aig/gia/giaShrink6.c \ src/aig/gia/giaSim.c \ src/aig/gia/giaSim2.c \ src/aig/gia/giaSort.c \ diff --git a/src/base/abci/abc.c b/src/base/abci/abc.c index d972b506..b913e04e 100644 --- a/src/base/abci/abc.c +++ b/src/base/abci/abc.c @@ -26155,7 +26155,8 @@ usage: ***********************************************************************/ int Abc_CommandAbc9Shrink( Abc_Frame_t * pAbc, int argc, char ** argv ) { - Gia_Man_t * pTemp; + Gia_Man_t * pTemp = NULL; + int nLutSize; int c,fVerbose = 0; int fKeepLevel = 0; Extra_UtilGetoptReset(); @@ -26185,8 +26186,15 @@ int Abc_CommandAbc9Shrink( Abc_Frame_t * pAbc, int argc, char ** argv ) Abc_Print( -1, "Abc_CommandAbc9Shrink(): Mapping of the AIG is not defined.\n" ); return 1; } - pTemp = Gia_ManPerformMapShrink( pAbc->pGia, fKeepLevel, fVerbose ); - Abc_FrameUpdateGia( pAbc, pTemp ); + nLutSize = Gia_ManLutSizeMax( pAbc->pGia ); + if ( nLutSize <= 4 ) + pTemp = Gia_ManPerformMapShrink( pAbc->pGia, fKeepLevel, fVerbose ); + else if ( nLutSize <= 6 ) + pTemp = Gia_ManMapShrink6( pAbc->pGia, fKeepLevel, fVerbose ); + else + Abc_Print( -1, "Abc_CommandAbc9Shrink(): Works only for 4-LUTs and 6-LUTs.\n" ); + if ( pTemp ) + Abc_FrameUpdateGia( pAbc, pTemp ); return 0; usage: diff --git a/src/bool/rsb/module.make b/src/bool/rsb/module.make new file mode 100644 index 00000000..0011e6a5 --- /dev/null +++ b/src/bool/rsb/module.make @@ -0,0 +1,2 @@ +SRC += src/bool/rsb/rsbDec6.c \ + src/bool/rsb/rsbMan.c diff --git a/src/bool/rsb/rsb.h b/src/bool/rsb/rsb.h new file mode 100644 index 00000000..e0b92d30 --- /dev/null +++ b/src/bool/rsb/rsb.h @@ -0,0 +1,65 @@ +/**CFile**************************************************************** + + FileName [rsb.h] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [Truth-table based resubstitution.] + + Synopsis [External declarations.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 20, 2005.] + + Revision [$Id: rsb.h,v 1.00 2005/06/20 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#ifndef ABC__bool_Rsb_h +#define ABC__bool_Rsb_h + + +//////////////////////////////////////////////////////////////////////// +/// INCLUDES /// +//////////////////////////////////////////////////////////////////////// + +//////////////////////////////////////////////////////////////////////// +/// PARAMETERS /// +//////////////////////////////////////////////////////////////////////// + +ABC_NAMESPACE_HEADER_START + +//////////////////////////////////////////////////////////////////////// +/// BASIC TYPES /// +//////////////////////////////////////////////////////////////////////// + +typedef struct Rsb_Man_t_ Rsb_Man_t; + +//////////////////////////////////////////////////////////////////////// +/// MACRO DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +/*=== rsbMan.c ==========================================================*/ +extern Rsb_Man_t * Rsb_ManAlloc( int nLeafMax, int nDivMax, int nDecMax, int fVerbose ); +extern void Rsb_ManFree( Rsb_Man_t * p ); +extern Vec_Int_t * Rsb_ManGetFanins( Rsb_Man_t * p ); +extern Vec_Int_t * Rsb_ManGetFaninsOld( Rsb_Man_t * p ); +/*=== rsbDec6.c ==========================================================*/ +extern int Rsb_ManPerformResub6( Rsb_Man_t * p, int nVars, word uTruth, Vec_Wrd_t * vDivTruths, word * puTruth0, word * puTruth1, int fVerbose ); + + +ABC_NAMESPACE_HEADER_END + +#endif + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + diff --git a/src/bool/rsb/rsbDec6.c b/src/bool/rsb/rsbDec6.c new file mode 100644 index 00000000..90f88938 --- /dev/null +++ b/src/bool/rsb/rsbDec6.c @@ -0,0 +1,733 @@ +/**CFile**************************************************************** + + FileName [rsbDec6.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [Truth-table-based resubstitution.] + + Synopsis [Implementation of the algorithm.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 20, 2005.] + + Revision [$Id: rsbDec6.c,v 1.00 2005/06/20 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include "rsbInt.h" + +ABC_NAMESPACE_IMPL_START + + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline unsigned Rsb_DecTry0( word c ) +{ + return (unsigned)(c != 0); +} +static inline unsigned Rsb_DecTry1( word c, word f1 ) +{ + return (Rsb_DecTry0(c&f1) << 1) | Rsb_DecTry0(c&~f1); +} +static inline unsigned Rsb_DecTry2( word c, word f1, word f2 ) +{ + return (Rsb_DecTry1(c&f2, f1) << 2) | Rsb_DecTry1(c&~f2, f1); +} +static inline unsigned Rsb_DecTry3( word c, word f1, word f2, word f3 ) +{ + return (Rsb_DecTry2(c&f3, f1, f2) << 4) | Rsb_DecTry2(c&~f3, f1, f2); +} +static inline unsigned Rsb_DecTry4( word c, word f1, word f2, word f3, word f4 ) +{ + return (Rsb_DecTry3(c&f4, f1, f2, f3) << 8) | Rsb_DecTry3(c&~f4, f1, f2, f3); +} +static inline unsigned Rsb_DecTry5( word c, word f1, word f2, word f3, word f4, word f5 ) +{ + return (Rsb_DecTry4(c&f5, f1, f2, f3, f4) << 16) | Rsb_DecTry4(c&~f5, f1, f2, f3, f4); +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline int Rsb_DecTryCex( word * g, int iCexA, int iCexB ) +{ + return Abc_TtGetBit(g, iCexA) == Abc_TtGetBit(g, iCexB); +} +static inline void Rsb_DecVerifyCex( word * f, word ** g, int nGs, int iCexA, int iCexB ) +{ + int i; + // f distinquished it + if ( Rsb_DecTryCex( f, iCexA, iCexB ) ) + printf( "Verification of CEX has failed: f(A) == f(B)!!!\n" ); + // g do not distinguish it + for ( i = 0; i < nGs; i++ ) + if ( !Rsb_DecTryCex( g[i], iCexA, iCexB ) ) + printf( "Verification of CEX has failed: g[%d](A) != g[%d](B)!!!\n", i, i ); +} +static inline void Rsb_DecRecordCex( word ** g, int nGs, int iCexA, int iCexB, word * pCexes, int nCexes ) +{ + int i; + assert( nCexes < 64 ); + for ( i = 0; i < nGs; i++ ) + if ( Rsb_DecTryCex(g[i], iCexA, iCexB) ) + Abc_TtSetBit( pCexes + i, nCexes ); +} + +/**Function************************************************************* + + Synopsis [Checks decomposability of f with divisors g.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline word Rsb_DecCofactor( word ** g, int nGs, int w, int iMint ) +{ + int i; + word Cof = ~(word)0; + for ( i = 0; i < nGs; i++ ) + Cof &= ((iMint >> i) & 1) ? g[i][w] : ~g[i][w]; + return Cof; +} +unsigned Rsb_DecCheck( int nVars, word * f, word ** g, int nGs, unsigned * pPat, int * pCexA, int * pCexB ) +{ + word CofA, CofB; + int nWords = Abc_TtWordNum( nVars ); + int w, k, iMint, iShift = ( 1 << nGs ); + unsigned uMask = (~(unsigned)0) >> (32-iShift); + unsigned uTotal = 0; + assert( nGs > 0 && nGs < 5 ); + for ( w = 0; w < nWords; w++ ) + { + // generate decomposition pattern + if ( nGs == 1 ) + pPat[w] = Rsb_DecTry2( ~(word)0, g[0][w], f[w] ); + else if ( nGs == 2 ) + pPat[w] = Rsb_DecTry3( ~(word)0, g[0][w], g[1][w], f[w] ); + else if ( nGs == 3 ) + pPat[w] = Rsb_DecTry4( ~(word)0, g[0][w], g[1][w], g[2][w], f[w] ); + else if ( nGs == 4 ) + pPat[w] = Rsb_DecTry5( ~(word)0, g[0][w], g[1][w], g[2][w], g[3][w], f[w] ); + // check if it is consistent + iMint = Abc_Tt6FirstBit( (pPat[w] >> iShift) & pPat[w] & uMask ); + if ( iMint >= 0 ) + { // generate a cex + CofA = Rsb_DecCofactor( g, nGs, w, iMint ); + assert( (~f[w] & CofA) && (f[w] & CofA) ); + *pCexA = w * 64 + Abc_Tt6FirstBit( ~f[w] & CofA ); + *pCexB = w * 64 + Abc_Tt6FirstBit( f[w] & CofA ); + return 0; + } + uTotal |= pPat[w]; + if ( w == 0 ) + continue; + // check if it is consistent with other patterns seen so far + iMint = Abc_Tt6FirstBit( (uTotal >> iShift) & uTotal & uMask ); + if ( iMint == -1 ) + continue; + // find an overlap and generate a cex + for ( k = 0; k < w; k++ ) + { + iMint = Abc_Tt6FirstBit( ((pPat[k] | pPat[w]) >> iShift) & (pPat[k] | pPat[w]) & uMask ); + if ( iMint == -1 ) + continue; + CofA = Rsb_DecCofactor( g, nGs, k, iMint ); + CofB = Rsb_DecCofactor( g, nGs, w, iMint ); + if ( (~f[k] & CofA) && (f[w] & CofB) ) + { + *pCexA = k * 64 + Abc_Tt6FirstBit( ~f[k] & CofA ); + *pCexB = w * 64 + Abc_Tt6FirstBit( f[w] & CofB ); + } + else + { + assert( (f[k] & CofA) && (~f[w] & CofB) ); + *pCexA = k * 64 + Abc_Tt6FirstBit( f[k] & CofA ); + *pCexB = w * 64 + Abc_Tt6FirstBit( ~f[w] & CofB ); + } + return 0; + } + } + return uTotal; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Rsb_DecPrintTable( word * pCexes, int nGs, int nGsAll, Vec_Int_t * vTries ) +{ + int pCands[16], nCands; + int i, c, Cand, iStart = 0; + if ( Vec_IntSize(vTries) == 0 ) + return; + +// printf( "\n" ); + for ( i = 0; i < 4; i++ ) + printf( " " ); + printf( " " ); + for ( i = 0; i < nGs; i++ ) + printf( "%d", (i % 100) / 10 ); + printf( "|" ); + for ( ; i < nGsAll; i++ ) + printf( "%d", (i % 100) / 10 ); + printf( "\n" ); + + for ( i = 0; i < 4; i++ ) + printf( " " ); + printf( " " ); + for ( i = 0; i < nGs; i++ ) + printf( "%d", i % 10 ); + printf( "|" ); + for ( ; i < nGsAll; i++ ) + printf( "%d", i % 10 ); + printf( "\n" ); + printf( "\n" ); + + for ( c = 0; iStart < Vec_IntSize(vTries); c++ ) + { + // collect candidates + for ( i = 0; i < 4; i++ ) + pCands[i] = -1; + nCands = 0; + Vec_IntForEachEntryStart( vTries, Cand, i, iStart ) + if ( Cand == -1 ) + { + iStart = i + 1; + break; + } + else + pCands[nCands++] = Cand; + assert( nCands <= 4 ); + // print them + for ( i = 0; i < 4; i++ ) + if ( pCands[i] >= 0 ) + printf( "%4d", pCands[i] ); + else + printf( " " ); + // print the bit-string + printf( " " ); + for ( i = 0; i < nGs; i++ ) + printf( "%c", Abc_TtGetBit( pCexes + i, c ) ? '.' : '+' ); + printf( "|" ); + for ( ; i < nGsAll; i++ ) + printf( "%c", Abc_TtGetBit( pCexes + i, c ) ? '.' : '+' ); + printf( " %3d\n", c ); + } + printf( "\n" ); + + // write the number of ones + for ( i = 0; i < 4; i++ ) + printf( " " ); + printf( " " ); + for ( i = 0; i < nGs; i++ ) + printf( "%d", Abc_TtCountOnes(pCexes[i]) / 10 ); + printf( "|" ); + for ( ; i < nGsAll; i++ ) + printf( "%d", Abc_TtCountOnes(pCexes[i]) / 10 ); + printf( "\n" ); + + for ( i = 0; i < 4; i++ ) + printf( " " ); + printf( " " ); + for ( i = 0; i < nGs; i++ ) + printf( "%d", Abc_TtCountOnes(pCexes[i]) % 10 ); + printf( "|" ); + for ( ; i < nGsAll; i++ ) + printf( "%d", Abc_TtCountOnes(pCexes[i]) % 10 ); + printf( "\n" ); + printf( "\n" ); +} + +/**Function************************************************************* + + Synopsis [Init ] + + Description [Returns the numbers of the decomposition functions and + the truth table of a function up to 4 variables.] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Rsb_DecInitCexes( int nVars, word * f, word ** g, int nGs, int nGsAll, word * pCexes, Vec_Int_t * vTries ) +{ + int nWords = Abc_TtWordNum( nVars ); + int ValueB = Abc_TtGetBit( f, 0 ); + int ValueE = Abc_TtGetBit( f, 64*nWords-1 ); + int iCexT0, iCexT1, iCexF0, iCexF1; + + iCexT0 = ValueB ? 0 : Abc_TtFindFirstBit( f, nVars ); + iCexT1 = ValueE ? 64*nWords-1 : Abc_TtFindLastBit( f, nVars ); + + iCexF0 = !ValueB ? 0 : Abc_TtFindFirstZero( f, nVars ); + iCexF1 = !ValueE ? 64*nWords-1 : Abc_TtFindLastZero( f, nVars ); + + assert( !Rsb_DecTryCex( f, iCexT0, iCexF0 ) ); + assert( !Rsb_DecTryCex( f, iCexT0, iCexF1 ) ); + assert( !Rsb_DecTryCex( f, iCexT1, iCexF0 ) ); + assert( !Rsb_DecTryCex( f, iCexT1, iCexF1 ) ); + + Rsb_DecRecordCex( g, nGsAll, iCexT0, iCexF0, pCexes, 0 ); + Rsb_DecRecordCex( g, nGsAll, iCexT0, iCexF1, pCexes, 1 ); + Rsb_DecRecordCex( g, nGsAll, iCexT1, iCexF0, pCexes, 2 ); + Rsb_DecRecordCex( g, nGsAll, iCexT1, iCexF1, pCexes, 3 ); + + if ( vTries ) + { + Vec_IntPush( vTries, -1 ); + Vec_IntPush( vTries, -1 ); + Vec_IntPush( vTries, -1 ); + Vec_IntPush( vTries, -1 ); + } + return 4; +} + +/**Function************************************************************* + + Synopsis [Finds a setset of gs to decompose f.] + + Description [Returns the numbers of the decomposition functions and + the truth table of a function up to 4 variables.] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +unsigned Rsb_DecPerformInt( Rsb_Man_t * p, int nVars, word * f, word ** g, int nGs, int nGsAll ) +{ + word * pCexes = Vec_WrdArray(p->vCexes); + unsigned * pPat = (unsigned *)Vec_IntArray(p->vDecPats); + /* + The following filtering hueristic can be used: + after the first round (if there is more than 5 cexes, + remove all the divisors, except fanins of the node + This should lead to a speadup without sacrifying quality. + + Another idea is to precompute several counter-examples + like the first and last 0 and 1 mints of the function + which yields 4 cexes. + */ + + word * pDivs[16]; + unsigned uTruth = 0; + int i, k, j, n, iCexA, iCexB, nCexes = 0; + memset( pCexes, 0, sizeof(word) * nGsAll ); + Vec_IntClear( p->vTries ); + // populate the counter-examples with the three most obvious +// nCexes = Rsb_DecInitCexes( nVars, f, g, nGs, nGsAll, pCexes, vTries ); + // start by checking each function + p->vFanins->nSize = 1; + for ( i = 0; i < nGs; i++ ) + { + if ( pCexes[i] ) + continue; + pDivs[0] = g[i]; p->vFanins->pArray[0] = i; + uTruth = Rsb_DecCheck( nVars, f, pDivs, Vec_IntSize(p->vFanins), pPat, &iCexA, &iCexB ); + if ( uTruth ) + return uTruth; + if ( nCexes == 64 ) + return 0; + Rsb_DecVerifyCex( f, pDivs, Vec_IntSize(p->vFanins), iCexA, iCexB ); + Rsb_DecRecordCex( g, nGsAll, iCexA, iCexB, pCexes, nCexes++ ); + if ( !p->fVerbose ) + continue; + Vec_IntPush( p->vTries, i ); + Vec_IntPush( p->vTries, -1 ); + } + if ( p->nDecMax == 1 ) + return 0; + // continue by checking pairs + p->vFanins->nSize = 2; + for ( i = 1; i < nGs; i++ ) + for ( k = 0; k < i; k++ ) + { + if ( pCexes[i] & pCexes[k] ) + continue; + pDivs[0] = g[i]; p->vFanins->pArray[0] = i; + pDivs[1] = g[k]; p->vFanins->pArray[1] = k; + uTruth = Rsb_DecCheck( nVars, f, pDivs, Vec_IntSize(p->vFanins), pPat, &iCexA, &iCexB ); + if ( uTruth ) + return uTruth; + if ( nCexes == 64 ) + return 0; + Rsb_DecVerifyCex( f, pDivs, Vec_IntSize(p->vFanins), iCexA, iCexB ); + Rsb_DecRecordCex( g, nGsAll, iCexA, iCexB, pCexes, nCexes++ ); + if ( !p->fVerbose ) + continue; + Vec_IntPush( p->vTries, i ); + Vec_IntPush( p->vTries, k ); + Vec_IntPush( p->vTries, -1 ); + } + if ( p->nDecMax == 2 ) + return 0; + // continue by checking triples + p->vFanins->nSize = 3; + for ( i = 2; i < nGs; i++ ) + for ( k = 1; k < i; k++ ) + for ( j = 0; j < k; j++ ) + { + if ( pCexes[i] & pCexes[k] & pCexes[j] ) + continue; + pDivs[0] = g[i]; p->vFanins->pArray[0] = i; + pDivs[1] = g[k]; p->vFanins->pArray[1] = k; + pDivs[2] = g[j]; p->vFanins->pArray[2] = j; + uTruth = Rsb_DecCheck( nVars, f, pDivs, Vec_IntSize(p->vFanins), pPat, &iCexA, &iCexB ); + if ( uTruth ) + return uTruth; + if ( nCexes == 64 ) + return 0; + Rsb_DecVerifyCex( f, pDivs, Vec_IntSize(p->vFanins), iCexA, iCexB ); + Rsb_DecRecordCex( g, nGsAll, iCexA, iCexB, pCexes, nCexes++ ); + if ( !p->fVerbose ) + continue; + Vec_IntPush( p->vTries, i ); + Vec_IntPush( p->vTries, k ); + Vec_IntPush( p->vTries, j ); + Vec_IntPush( p->vTries, -1 ); + } + if ( p->nDecMax == 3 ) + return 0; + // continue by checking quadras + p->vFanins->nSize = 4; + for ( i = 3; i < nGs; i++ ) + for ( k = 2; k < i; k++ ) + for ( j = 1; j < k; j++ ) + for ( n = 0; n < j; n++ ) + { + if ( pCexes[i] & pCexes[k] & pCexes[j] & pCexes[n] ) + continue; + pDivs[0] = g[i]; p->vFanins->pArray[0] = i; + pDivs[1] = g[k]; p->vFanins->pArray[1] = k; + pDivs[2] = g[j]; p->vFanins->pArray[2] = j; + pDivs[3] = g[n]; p->vFanins->pArray[3] = n; + uTruth = Rsb_DecCheck( nVars, f, pDivs, Vec_IntSize(p->vFanins), pPat, &iCexA, &iCexB ); + if ( uTruth ) + return uTruth; + if ( nCexes == 64 ) + return 0; + Rsb_DecVerifyCex( f, pDivs, Vec_IntSize(p->vFanins), iCexA, iCexB ); + Rsb_DecRecordCex( g, nGsAll, iCexA, iCexB, pCexes, nCexes++ ); + if ( !p->fVerbose ) + continue; + Vec_IntPush( p->vTries, i ); + Vec_IntPush( p->vTries, k ); + Vec_IntPush( p->vTries, j ); + Vec_IntPush( p->vTries, n ); + Vec_IntPush( p->vTries, -1 ); + } +// printf( "%d ", nCexes ); + if ( p->nDecMax == 4 ) + return 0; + return 0; +} + +/**Function************************************************************* + + Synopsis [Verifies 4-input decomposition.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Rsb_DecPrintFunc( Rsb_Man_t * p, unsigned Truth4, word * f, word ** ppGs, int nGs, int nVarsAll ) +{ + int nVars = Vec_IntSize(p->vFanins); + word Copy = Truth4; + word wOn = Abc_Tt6Stretch( Copy >> (1 << nVars), nVars ); + word wOnDc = ~Abc_Tt6Stretch( Copy, nVars ); + word wIsop = Abc_Tt6Isop( wOn, wOnDc, nVars ); + int i; + + printf( "Offset : " ); + Abc_TtPrintBinary( &Copy, nVars ); //printf( "\n" ); + Copy >>= (1 << nVars); + printf( "Onset : " ); + Abc_TtPrintBinary( &Copy, nVars ); //printf( "\n" ); + printf( "Result : " ); + Abc_TtPrintBinary( &wIsop, nVars ); //printf( "\n" ); + Kit_DsdPrintFromTruth( (unsigned *)&wIsop, nVars ); printf( "\n" ); + + // print functions + printf( "Func : " ); + Abc_TtPrintBinary( f, nVarsAll ); //printf( "\n" ); + Kit_DsdPrintFromTruth( (unsigned *)f, nVarsAll ); printf( "\n" ); + for ( i = 0; i < nGs; i++ ) + { + printf( "Div%3d : ", i ); + Kit_DsdPrintFromTruth( (unsigned *)ppGs[i], nVarsAll ); printf( "\n" ); + } + printf( "Solution : " ); + for ( i = 0; i < Vec_IntSize(p->vFanins); i++ ) + printf( "%d ", Vec_IntEntry(p->vFanins, i) ); + printf( "\n" ); +} + +/**Function************************************************************* + + Synopsis [Verifies 4-input decomposition.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Rsb_DecVerify( Rsb_Man_t * p, int nVars, word * f, word ** g, int nGs, unsigned Truth4, word * pTemp1, word * pTemp2 ) +{ + word * pFanins[16]; + int b, m, Num, nSuppSize; + int nWords = Abc_TtWordNum(nVars); + Truth4 >>= (1 << Vec_IntSize(p->vFanins)); + Truth4 = (unsigned)Abc_Tt6Stretch( (word)Truth4, Vec_IntSize(p->vFanins) ); +//Kit_DsdPrintFromTruth( (unsigned *)&Truth4, Vec_IntSize(p->vFanins) ); +//printf( "\n" ); +// nSuppSize = Rsb_Word6SupportSize( Truth4 ); +// assert( nSuppSize == Vec_IntSize(p->vFanins) ); + nSuppSize = Vec_IntSize(p->vFanins); + // collect the fanins + Vec_IntForEachEntry( p->vFanins, Num, b ) + { + assert( Num < nGs ); + pFanins[b] = g[Num]; + } + // create the or of ands + Abc_TtClear( pTemp1, nWords ); + for ( m = 0; m < (1<> m) & 1) == 0 ) + continue; + Abc_TtFill( pTemp2, nWords ); + for ( b = 0; b < nSuppSize; b++ ) + if ( (m >> b) & 1 ) + Abc_TtAnd( pTemp2, pTemp2, pFanins[b], nWords, 0 ); + else + Abc_TtSharp( pTemp2, pTemp2, pFanins[b], nWords ); + Abc_TtOr( pTemp1, pTemp1, pTemp2, nWords ); + } + // check the function + if ( !Abc_TtEqual( pTemp1, f, nWords ) ) + printf( "Verification failed.\n" ); +// else +// printf( "Verification passed.\n" ); + return 1; +} + +/**Function************************************************************* + + Synopsis [Finds a setset of gs to decompose f.] + + Description [Returns the numbers of the decomposition functions and + the truth table of a function up to 4 variables.] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +unsigned Rsb_ManPerform( Rsb_Man_t * p, int nVars, word * f, word ** g, int nGs, int nGsAll, int fVerbose0 ) +{ + word * pCexes = Vec_WrdArray(p->vCexes); + unsigned * pPat = (unsigned *)Vec_IntArray(p->vDecPats); + int fVerbose = 0;//(nGs > 40); + Vec_Int_t * vTries = NULL; + unsigned uTruth; + + // verify original decomposition + if ( Vec_IntSize(p->vFaninsOld) && Vec_IntSize(p->vFaninsOld) <= 4 ) + { + word * pDivs[8]; + int i, Entry, iCexA, iCexB; + Vec_IntForEachEntry( p->vFaninsOld, Entry, i ) + pDivs[i] = g[Entry]; + uTruth = Rsb_DecCheck( nVars, f, pDivs, Vec_IntSize(p->vFaninsOld), pPat, &iCexA, &iCexB ); +// assert( uTruth != 0 ); + if ( fVerbose ) + { + printf( "Verified orig decomp with %d vars {", Vec_IntSize(p->vFaninsOld) ); + Vec_IntForEachEntry( p->vFaninsOld, Entry, i ) + printf( " %d", Entry ); + printf( " }\n" ); + } + if ( uTruth ) + { +// if ( fVerbose ) +// Rsb_DecPrintFunc( p, uTruth ); + } + else + { + printf( "Verified orig decomp with %d vars {", Vec_IntSize(p->vFaninsOld) ); + Vec_IntForEachEntry( p->vFaninsOld, Entry, i ) + printf( " %d", Entry ); + printf( " }\n" ); + printf( "Verification FAILED.\n" ); + } + } + // start tries +if ( fVerbose ) +vTries = Vec_IntAlloc( 100 ); + assert( nGs < nGsAll ); + uTruth = Rsb_DecPerformInt( p, nVars, f, g, nGs, nGsAll ); + + if ( uTruth ) + { + if ( fVerbose ) + { + int i, Entry; + printf( "Found decomp with %d vars {", Vec_IntSize(p->vFanins) ); + Vec_IntForEachEntry( p->vFanins, Entry, i ) + printf( " %d", Entry ); + printf( " }\n" ); +// Rsb_DecPrintFunc( p, uTruth ); +// Rsb_DecVerify( nVars, f, g, nGs, p->vFanins, uTruth, g[nGsAll], g[nGsAll+1] ); + } + } + else + { + Vec_IntShrink( p->vFanins, 0 ); + if ( fVerbose ) + printf( "Did not find decomposition with 4 variables.\n" ); + } + +if ( fVerbose ) +Rsb_DecPrintTable( pCexes, nGs, nGsAll, vTries ); +if ( fVerbose ) +Vec_IntFree( vTries ); + if ( fVerbose && Vec_IntSize(p->vFaninsOld) && Vec_IntSize(p->vFaninsOld) <= 4 && Vec_IntSize(p->vFaninsOld) > Vec_IntSize(p->vFanins) ) + { + int s = 0; + } + return uTruth; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Rsb_ManPerformResub6( Rsb_Man_t * p, int nVarsAll, word uTruth, Vec_Wrd_t * vDivTruths, word * puTruth0, word * puTruth1, int fVerbose ) +{ + word * pGs[64]; + unsigned uTruthRes; + int i, nVars, nGs = Vec_WrdSize(vDivTruths); + for ( i = 0; i < nGs; i++ ) + pGs[i] = Vec_WrdEntryP(vDivTruths,i); + uTruthRes = Rsb_DecPerformInt( p, nVarsAll, &uTruth, pGs, nGs, nGs ); + if ( uTruthRes == 0 ) + return 0; + + if ( fVerbose ) + Rsb_DecPrintFunc( p, uTruthRes, &uTruth, pGs, nGs, nVarsAll ); + if ( fVerbose ) + Rsb_DecPrintTable( Vec_WrdArray(p->vCexes), nGs, nGs, p->vTries ); + + nVars = Vec_IntSize(p->vFanins); + *puTruth0 = Abc_Tt6Stretch( uTruthRes, nVars ); + *puTruth1 = Abc_Tt6Stretch( uTruthRes >> (1 << nVars), nVars ); + return 1; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Rsb_ManPerformResub6Test() +{ + Rsb_Man_t * p; + Vec_Wrd_t * vDivTruths; + int RetValue; + word a = s_Truths6[0]; + word b = s_Truths6[1]; + word c = s_Truths6[2]; + word d = s_Truths6[3]; + word e = s_Truths6[4]; + word f = s_Truths6[5]; + word ab = a & b; + word cd = c & d; + word ef = e & f; + word F = ab | cd | ef; + word uTruth0, uTruth1; + + vDivTruths = Vec_WrdAlloc( 100 ); + Vec_WrdPush( vDivTruths, a ); + Vec_WrdPush( vDivTruths, b ); + Vec_WrdPush( vDivTruths, c ); + Vec_WrdPush( vDivTruths, d ); + Vec_WrdPush( vDivTruths, e ); + Vec_WrdPush( vDivTruths, f ); + Vec_WrdPush( vDivTruths, ab ); + Vec_WrdPush( vDivTruths, cd ); + Vec_WrdPush( vDivTruths, ef ); + + p = Rsb_ManAlloc( 6, 64, 4, 1 ); + + RetValue = Rsb_ManPerformResub6( p, 6, F, vDivTruths, &uTruth0, &uTruth1, 1 ); + + Rsb_ManFree( p ); + Vec_WrdFree( vDivTruths ); +} + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + diff --git a/src/bool/rsb/rsbInt.h b/src/bool/rsb/rsbInt.h new file mode 100644 index 00000000..862ce8c7 --- /dev/null +++ b/src/bool/rsb/rsbInt.h @@ -0,0 +1,84 @@ +/**CFile**************************************************************** + + FileName [rsbInt.h] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [Truth-table based resubstitution.] + + Synopsis [Internal declarations.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 20, 2005.] + + Revision [$Id: rsbInt.h,v 1.00 2005/06/20 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#ifndef ABC__bool_RsbInt_h +#define ABC__bool_RsbInt_h + + +//////////////////////////////////////////////////////////////////////// +/// INCLUDES /// +//////////////////////////////////////////////////////////////////////// + +#include +#include +#include +#include + +#include "misc/vec/vec.h" +#include "misc/util/utilTruth.h" +#include "bool/kit/kit.h" +#include "rsb.h" + +//////////////////////////////////////////////////////////////////////// +/// PARAMETERS /// +//////////////////////////////////////////////////////////////////////// + +ABC_NAMESPACE_HEADER_START + +//////////////////////////////////////////////////////////////////////// +/// BASIC TYPES /// +//////////////////////////////////////////////////////////////////////// + +// truth table computation manager +struct Rsb_Man_t_ +{ + // parameters + int nLeafMax; // the max number of leaves of a cut + int nDivMax; // the max number of divisors to collect + int nDecMax; // the max number of decompositions + int fVerbose; // verbosity level + // decomposition + Vec_Wrd_t * vCexes; // counter-examples + Vec_Int_t * vDecPats; // decomposition patterns + Vec_Int_t * vFanins; // the result of decomposition + Vec_Int_t * vFaninsOld; // original fanins + Vec_Int_t * vTries; // intermediate +}; + +//////////////////////////////////////////////////////////////////////// +/// MACRO DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +/*=== rsbMan.c ==========================================================*/ + +ABC_NAMESPACE_HEADER_END + + + +#endif + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + diff --git a/src/bool/rsb/rsbMan.c b/src/bool/rsb/rsbMan.c new file mode 100644 index 00000000..0d91cca4 --- /dev/null +++ b/src/bool/rsb/rsbMan.c @@ -0,0 +1,99 @@ +/**CFile**************************************************************** + + FileName [rsbMan.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [Truth-table based resubstitution.] + + Synopsis [Manager maintenance.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 20, 2005.] + + Revision [$Id: rsbMan.c,v 1.00 2005/06/20 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include "rsbInt.h" + +ABC_NAMESPACE_IMPL_START + + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Rsb_Man_t * Rsb_ManAlloc( int nLeafMax, int nDivMax, int nDecMax, int fVerbose ) +{ + Rsb_Man_t * p; + assert( nLeafMax <= 20 ); + assert( nDivMax <= 200 ); + p = ABC_CALLOC( Rsb_Man_t, 1 ); + p->nLeafMax = nLeafMax; + p->nDivMax = nDivMax; + p->nDecMax = nDecMax; + p->fVerbose = fVerbose; + // decomposition + p->vCexes = Vec_WrdAlloc( nDivMax + 150 ); + p->vDecPats = Vec_IntAlloc( Abc_TtWordNum(nLeafMax) ); + p->vFanins = Vec_IntAlloc( 10 ); + p->vFaninsOld = Vec_IntAlloc( 10 ); + p->vTries = Vec_IntAlloc( 10 ); + return p; +} +void Rsb_ManFree( Rsb_Man_t * p ) +{ + Vec_WrdFree( p->vCexes ); + Vec_IntFree( p->vDecPats ); + Vec_IntFree( p->vFanins ); + Vec_IntFree( p->vFaninsOld ); + Vec_IntFree( p->vTries ); + ABC_FREE( p ); +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Vec_Int_t * Rsb_ManGetFanins( Rsb_Man_t * p ) +{ + return p->vFanins; +} +Vec_Int_t * Rsb_ManGetFaninsOld( Rsb_Man_t * p ) +{ + return p->vFaninsOld; +} + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + diff --git a/src/misc/util/utilTruth.h b/src/misc/util/utilTruth.h index 4275912f..0072a808 100644 --- a/src/misc/util/utilTruth.h +++ b/src/misc/util/utilTruth.h @@ -116,6 +116,18 @@ static inline int Abc_TtHexDigitNum( int nVars ) { return nVars <= 2 ? 1 : 1 << SeeAlso [] ***********************************************************************/ +static inline void Abc_TtClear( word * pOut, int nWords ) +{ + int w; + for ( w = 0; w < nWords; w++ ) + pOut[w] = 0; +} +static inline void Abc_TtFill( word * pOut, int nWords ) +{ + int w; + for ( w = 0; w < nWords; w++ ) + pOut[w] = ~(word)0; +} static inline void Abc_TtNot( word * pOut, int nWords ) { int w; @@ -142,6 +154,18 @@ static inline void Abc_TtAnd( word * pOut, word * pIn1, word * pIn2, int nWords, for ( w = 0; w < nWords; w++ ) pOut[w] = pIn1[w] & pIn2[w]; } +static inline void Abc_TtSharp( word * pOut, word * pIn1, word * pIn2, int nWords ) +{ + int w; + for ( w = 0; w < nWords; w++ ) + pOut[w] = pIn1[w] & ~pIn2[w]; +} +static inline void Abc_TtOr( word * pOut, word * pIn1, word * pIn2, int nWords ) +{ + int w; + for ( w = 0; w < nWords; w++ ) + pOut[w] = pIn1[w] | pIn2[w]; +} static inline void Abc_TtXor( word * pOut, word * pIn1, word * pIn2, int nWords, int fCompl ) { int w; @@ -756,10 +780,10 @@ static inline int Abc_TtReadHex( word * pTruth, char * pString ) static inline void Abc_TtPrintBinary( word * pTruth, int nVars ) { word * pThis, * pLimit = pTruth + Abc_TtWordNum(nVars); - int k; + int k, Limit = Abc_MinInt( 64, (1 << nVars) ); assert( nVars >= 2 ); for ( pThis = pTruth; pThis < pLimit; pThis++ ) - for ( k = 0; k < 64; k++ ) + for ( k = 0; k < Limit; k++ ) printf( "%d", Abc_InfoHasBit( (unsigned *)pThis, k ) ); printf( "\n" ); } @@ -1098,6 +1122,75 @@ static inline int Abc_TtCountOnes( word x ) return (int)(x & 0xFF); } +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline int Abc_Tt6FirstBit( word t ) +{ + int n = 0; + if ( t == 0 ) return -1; + if ( (t & 0x00000000FFFFFFFF) == 0 ) { n += 32; t >>= 32; } + if ( (t & 0x000000000000FFFF) == 0 ) { n += 16; t >>= 16; } + if ( (t & 0x00000000000000FF) == 0 ) { n += 8; t >>= 8; } + if ( (t & 0x000000000000000F) == 0 ) { n += 4; t >>= 4; } + if ( (t & 0x0000000000000003) == 0 ) { n += 2; t >>= 2; } + if ( (t & 0x0000000000000001) == 0 ) { n++; } + return n; +} +static inline int Abc_Tt6LastBit( word t ) +{ + int n = 0; + if ( t == 0 ) return -1; + if ( (t & 0xFFFFFFFF00000000) == 0 ) { n += 32; t <<= 32; } + if ( (t & 0xFFFF000000000000) == 0 ) { n += 16; t <<= 16; } + if ( (t & 0xFF00000000000000) == 0 ) { n += 8; t <<= 8; } + if ( (t & 0xF000000000000000) == 0 ) { n += 4; t <<= 4; } + if ( (t & 0xC000000000000000) == 0 ) { n += 2; t <<= 2; } + if ( (t & 0x8000000000000000) == 0 ) { n++; } + return 63-n; +} +static inline int Abc_TtFindFirstBit( word * pIn, int nVars ) +{ + int w, nWords = Abc_TtWordNum(nVars); + for ( w = 0; w < nWords; w++ ) + if ( pIn[w] ) + return 64*w + Abc_Tt6FirstBit(pIn[w]); + return -1; +} +static inline int Abc_TtFindFirstZero( word * pIn, int nVars ) +{ + int w, nWords = Abc_TtWordNum(nVars); + for ( w = 0; w < nWords; w++ ) + if ( ~pIn[w] ) + return 64*w + Abc_Tt6FirstBit(~pIn[w]); + return -1; +} +static inline int Abc_TtFindLastBit( word * pIn, int nVars ) +{ + int w, nWords = Abc_TtWordNum(nVars); + for ( w = nWords - 1; w >= 0; w-- ) + if ( pIn[w] ) + return 64*w + Abc_Tt6LastBit(pIn[w]); + return -1; +} +static inline int Abc_TtFindLastZero( word * pIn, int nVars ) +{ + int w, nWords = Abc_TtWordNum(nVars); + for ( w = nWords - 1; w >= 0; w-- ) + if ( ~pIn[w] ) + return 64*w + Abc_Tt6LastBit(~pIn[w]); + return -1; +} + + /**Function************************************************************* Synopsis [] @@ -1146,6 +1239,49 @@ static inline void Abc_TtReverseBits( word * pTruth, int nVars ) } +/**Function************************************************************* + + Synopsis [Computes ISOP for 6 variables or less.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline word Abc_Tt6Isop( word uOn, word uOnDc, int nVars ) +{ + word uOn0, uOn1, uOnDc0, uOnDc1, uRes0, uRes1, uRes2; + int Var; + assert( nVars <= 5 ); + assert( (uOn & ~uOnDc) == 0 ); + if ( uOn == 0 ) + return 0; + if ( uOnDc == ~(word)0 ) + return ~(word)0; + assert( nVars > 0 ); + // find the topmost var + for ( Var = nVars-1; Var >= 0; Var-- ) + if ( Abc_Tt6HasVar( uOn, Var ) || Abc_Tt6HasVar( uOnDc, Var ) ) + break; + assert( Var >= 0 ); + // cofactor + uOn0 = Abc_Tt6Cofactor0( uOn, Var ); + uOn1 = Abc_Tt6Cofactor1( uOn , Var ); + uOnDc0 = Abc_Tt6Cofactor0( uOnDc, Var ); + uOnDc1 = Abc_Tt6Cofactor1( uOnDc, Var ); + // solve for cofactors + uRes0 = Abc_Tt6Isop( uOn0 & ~uOnDc1, uOnDc0, Var ); + uRes1 = Abc_Tt6Isop( uOn1 & ~uOnDc0, uOnDc1, Var ); + uRes2 = Abc_Tt6Isop( (uOn0 & ~uRes0) | (uOn1 & ~uRes1), uOnDc0 & uOnDc1, Var ); + // derive the final truth table + uRes2 |= (uRes0 & s_Truths6Neg[Var]) | (uRes1 & s_Truths6[Var]); + assert( (uOn & ~uRes2) == 0 ); + assert( (uRes2 & ~uOnDc) == 0 ); + return uRes2; +} + /*=== utilTruth.c ===========================================================*/ -- cgit v1.2.3