summaryrefslogtreecommitdiffstats
path: root/src/map/mpm
diff options
context:
space:
mode:
Diffstat (limited to 'src/map/mpm')
-rw-r--r--src/map/mpm/module.make9
-rw-r--r--src/map/mpm/mpm.c55
-rw-r--r--src/map/mpm/mpm.h82
-rw-r--r--src/map/mpm/mpmAbc.c270
-rw-r--r--src/map/mpm/mpmCore.c96
-rw-r--r--src/map/mpm/mpmDsd.c52
-rw-r--r--src/map/mpm/mpmInt.h225
-rw-r--r--src/map/mpm/mpmLib.c74
-rw-r--r--src/map/mpm/mpmMap.c988
-rw-r--r--src/map/mpm/mpmMig.c177
-rw-r--r--src/map/mpm/mpmMig.h353
-rw-r--r--src/map/mpm/mpmPre.c885
-rw-r--r--src/map/mpm/mpmTruth.c52
-rw-r--r--src/map/mpm/mpmUtil.c52
14 files changed, 3370 insertions, 0 deletions
diff --git a/src/map/mpm/module.make b/src/map/mpm/module.make
new file mode 100644
index 00000000..facf3bbf
--- /dev/null
+++ b/src/map/mpm/module.make
@@ -0,0 +1,9 @@
+SRC += src/map/mpm/mpmAbc.c \
+ src/map/mpm/mpmCore.c \
+ src/map/mpm/mpmDsd.c \
+ src/map/mpm/mpmLib.c \
+ src/map/mpm/mpmMap.c \
+ src/map/mpm/mpmMig.c \
+ src/map/mpm/mpmPre.c \
+ src/map/mpm/mpmTruth.c \
+ src/map/mpm/mpmUtil.c
diff --git a/src/map/mpm/mpm.c b/src/map/mpm/mpm.c
new file mode 100644
index 00000000..f56cde8f
--- /dev/null
+++ b/src/map/mpm/mpm.c
@@ -0,0 +1,55 @@
+/**CFile****************************************************************
+
+ FileName [mpm.c]
+
+ SystemName [ABC: Logic synthesis and verification system.]
+
+ PackageName [Configurable technology mapper.]
+
+ Synopsis []
+
+ Author [Alan Mishchenko]
+
+ Affiliation [UC Berkeley]
+
+ Date [Ver. 1.0. Started - June 1, 2013.]
+
+ Revision [$Id: mpm.c,v 1.00 2013/06/01 00:00:00 alanmi Exp $]
+
+***********************************************************************/
+
+#include "mpmInt.h"
+
+ABC_NAMESPACE_IMPL_START
+
+
+////////////////////////////////////////////////////////////////////////
+/// DECLARATIONS ///
+////////////////////////////////////////////////////////////////////////
+
+////////////////////////////////////////////////////////////////////////
+/// FUNCTION DEFINITIONS ///
+////////////////////////////////////////////////////////////////////////
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Mpm_ManTest()
+{
+}
+
+////////////////////////////////////////////////////////////////////////
+/// END OF FILE ///
+////////////////////////////////////////////////////////////////////////
+
+
+ABC_NAMESPACE_IMPL_END
+
diff --git a/src/map/mpm/mpm.h b/src/map/mpm/mpm.h
new file mode 100644
index 00000000..a8a600f4
--- /dev/null
+++ b/src/map/mpm/mpm.h
@@ -0,0 +1,82 @@
+/**CFile****************************************************************
+
+ FileName [mpm.h]
+
+ SystemName [ABC: Logic synthesis and verification system.]
+
+ PackageName [Configurable technology mapper.]
+
+ Synopsis [External declarations.]
+
+ Author [Alan Mishchenko]
+
+ Affiliation [UC Berkeley]
+
+ Date [Ver. 1.0. Started - June 1, 2013.]
+
+ Revision [$Id: mpm.h,v 1.00 2013/06/01 00:00:00 alanmi Exp $]
+
+***********************************************************************/
+
+#ifndef ABC__map__mpm__h
+#define ABC__map__mpm__h
+
+
+////////////////////////////////////////////////////////////////////////
+/// INCLUDES ///
+////////////////////////////////////////////////////////////////////////
+
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include <assert.h>
+
+ABC_NAMESPACE_HEADER_START
+
+////////////////////////////////////////////////////////////////////////
+/// PARAMETERS ///
+////////////////////////////////////////////////////////////////////////
+
+#define MPM_VAR_MAX 32
+
+////////////////////////////////////////////////////////////////////////
+/// BASIC TYPES ///
+////////////////////////////////////////////////////////////////////////
+
+typedef struct Mpm_LibLut_t_ Mpm_LibLut_t;
+struct Mpm_LibLut_t_
+{
+ char * pName; // the name of the LUT library
+ int LutMax; // the maximum LUT size
+ int fVarPinDelays; // set to 1 if variable pin delays are specified
+ int pLutAreas[MPM_VAR_MAX+1]; // the areas of LUTs
+ int pLutDelays[MPM_VAR_MAX+1][MPM_VAR_MAX+1]; // the delays of LUTs
+};
+
+typedef struct Mpm_Par_t_ Mpm_Par_t;
+struct Mpm_Par_t_
+{
+ int DelayTarget;
+ int fVerbose;
+};
+
+////////////////////////////////////////////////////////////////////////
+/// MACRO DEFINITIONS ///
+////////////////////////////////////////////////////////////////////////
+
+
+////////////////////////////////////////////////////////////////////////
+/// FUNCTION DECLARATIONS ///
+////////////////////////////////////////////////////////////////////////
+
+/*=== mpmCore.c ===========================================================*/
+extern void Mpm_ManSetParsDefault( Mpm_Par_t * p );
+
+ABC_NAMESPACE_HEADER_END
+
+#endif
+
+////////////////////////////////////////////////////////////////////////
+/// END OF FILE ///
+////////////////////////////////////////////////////////////////////////
+
diff --git a/src/map/mpm/mpmAbc.c b/src/map/mpm/mpmAbc.c
new file mode 100644
index 00000000..939d7782
--- /dev/null
+++ b/src/map/mpm/mpmAbc.c
@@ -0,0 +1,270 @@
+/**CFile****************************************************************
+
+ FileName [mpmAbc.c]
+
+ SystemName [ABC: Logic synthesis and verification system.]
+
+ PackageName [Configurable technology mapper.]
+
+ Synopsis [Interface with ABC data structures.]
+
+ Author [Alan Mishchenko]
+
+ Affiliation [UC Berkeley]
+
+ Date [Ver. 1.0. Started - June 1, 2013.]
+
+ Revision [$Id: mpmAbc.c,v 1.00 2013/06/01 00:00:00 alanmi Exp $]
+
+***********************************************************************/
+
+#include "aig/gia/gia.h"
+#include "mpmInt.h"
+
+ABC_NAMESPACE_IMPL_START
+
+
+////////////////////////////////////////////////////////////////////////
+/// DECLARATIONS ///
+////////////////////////////////////////////////////////////////////////
+
+////////////////////////////////////////////////////////////////////////
+/// FUNCTION DEFINITIONS ///
+////////////////////////////////////////////////////////////////////////
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+static inline int Mig_ObjFanin0Copy( Gia_Obj_t * pObj ) { return Abc_LitNotCond( Gia_ObjFanin0(pObj)->Value, Gia_ObjFaninC0(pObj) ); }
+static inline int Mig_ObjFanin1Copy( Gia_Obj_t * pObj ) { return Abc_LitNotCond( Gia_ObjFanin1(pObj)->Value, Gia_ObjFaninC1(pObj) ); }
+Mig_Man_t * Mig_ManCreate( void * pGia )
+{
+ Gia_Man_t * p = (Gia_Man_t *)pGia;
+ Mig_Man_t * pNew;
+ Gia_Obj_t * pObj;
+ int i;
+ // create the new manager
+ pNew = Mig_ManStart();
+ pNew->pName = Abc_UtilStrsav( p->pName );
+ Gia_ManConst0(p)->Value = 0;
+ // create objects
+ Gia_ManForEachObj1( p, pObj, i )
+ {
+ if ( Gia_ObjIsAnd(pObj) )
+ pObj->Value = Mig_ManAppendAnd( pNew, Mig_ObjFanin0Copy(pObj), Mig_ObjFanin1Copy(pObj) );
+ else if ( Gia_ObjIsCi(pObj) )
+ pObj->Value = Mig_ManAppendCi( pNew );
+ else if ( Gia_ObjIsCo(pObj) )
+ pObj->Value = Mig_ManAppendCo( pNew, Mig_ObjFanin0Copy(pObj) );
+ else assert( 0 );
+ }
+ Mig_ManSetRegNum( pNew, Gia_ManRegNum(p) );
+ return pNew;
+}
+
+/**Function*************************************************************
+
+ Synopsis [Recursively derives the local AIG for the cut.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+static inline unsigned Mpm_CutDataInt( Mpm_Cut_t * pCut ) { return pCut->hNext; }
+static inline void Mpm_CutSetDataInt( Mpm_Cut_t * pCut, unsigned Data ) { pCut->hNext = Data; }
+int Mpm_ManNodeIfToGia_rec( Gia_Man_t * pNew, Mpm_Man_t * pMan, Mig_Obj_t * pObj, Vec_Ptr_t * vVisited, int fHash )
+{
+ Mig_Obj_t * pTemp;
+ Mpm_Cut_t * pCut;
+ int iFunc, iFunc0, iFunc1;
+ // get the best cut
+ pCut = Mpm_ObjCutBestP( pMan, pObj );
+ // if the cut is visited, return the result
+ if ( Mpm_CutDataInt(pCut) )
+ return Mpm_CutDataInt(pCut);
+ // mark the node as visited
+ Vec_PtrPush( vVisited, pCut );
+ // insert the worst case
+ Mpm_CutSetDataInt( pCut, ~0 );
+ // skip in case of primary input
+ if ( Mig_ObjIsCi(pObj) )
+ return Mpm_CutDataInt(pCut);
+ // compute the functions of the children
+ for ( pTemp = pObj; pTemp; pTemp = Mig_ObjSibl(pTemp) )
+ {
+ iFunc0 = Mpm_ManNodeIfToGia_rec( pNew, pMan, Mig_ObjFanin0(pTemp), vVisited, fHash );
+ if ( iFunc0 == ~0 )
+ continue;
+ iFunc1 = Mpm_ManNodeIfToGia_rec( pNew, pMan, Mig_ObjFanin1(pTemp), vVisited, fHash );
+ if ( iFunc1 == ~0 )
+ continue;
+ // both branches are solved
+ if ( fHash )
+ iFunc = Gia_ManHashAnd( pNew, Abc_LitNotCond(iFunc0, Mig_ObjFaninC0(pTemp)), Abc_LitNotCond(iFunc1, Mig_ObjFaninC1(pTemp)) );
+ else
+ iFunc = Gia_ManAppendAnd( pNew, Abc_LitNotCond(iFunc0, Mig_ObjFaninC0(pTemp)), Abc_LitNotCond(iFunc1, Mig_ObjFaninC1(pTemp)) );
+ if ( Mig_ObjPhase(pTemp) != Mig_ObjPhase(pObj) )
+ iFunc = Abc_LitNot(iFunc);
+ Mpm_CutSetDataInt( pCut, iFunc );
+ break;
+ }
+ return Mpm_CutDataInt(pCut);
+}
+int Mpm_ManNodeIfToGia( Gia_Man_t * pNew, Mpm_Man_t * pMan, Mig_Obj_t * pObj, Vec_Int_t * vLeaves, int fHash )
+{
+ Mpm_Cut_t * pCut;
+ Mig_Obj_t * pFanin;
+ int i, iRes;
+ // get the best cut
+ pCut = Mpm_ObjCutBestP( pMan, pObj );
+ assert( pCut->nLeaves > 1 );
+ // set the leaf variables
+ Mpm_CutForEachLeaf( pMan->pMig, pCut, pFanin, i )
+ Mpm_CutSetDataInt( Mpm_ObjCutBestP(pMan, pFanin), Vec_IntEntry(vLeaves, i) );
+ // recursively compute the function while collecting visited cuts
+ Vec_PtrClear( pMan->vTemp );
+ iRes = Mpm_ManNodeIfToGia_rec( pNew, pMan, pObj, pMan->vTemp, fHash );
+ if ( iRes == ~0 )
+ {
+ Abc_Print( -1, "Mpm_ManNodeIfToGia(): Computing local AIG has failed.\n" );
+ return ~0;
+ }
+ // clean the cuts
+ Mpm_CutForEachLeaf( pMan->pMig, pCut, pFanin, i )
+ Mpm_CutSetDataInt( Mpm_ObjCutBestP(pMan, pFanin), 0 );
+ Vec_PtrForEachEntry( Mpm_Cut_t *, pMan->vTemp, pCut, i )
+ Mpm_CutSetDataInt( pCut, 0 );
+ return iRes;
+}
+void * Mpm_ManFromIfLogic( Mpm_Man_t * pMan )
+{
+ Gia_Man_t * pNew;
+ Mpm_Cut_t * pCutBest;
+ Mig_Obj_t * pObj, * pFanin;
+ Vec_Int_t * vMapping, * vMapping2, * vPacking = NULL;
+ Vec_Int_t * vLeaves, * vLeaves2, * vCover;
+ int i, k, Entry, iLitNew;
+// assert( !pMan->pPars->fDeriveLuts || pMan->pPars->fTruth );
+ // start mapping and packing
+ vMapping = Vec_IntStart( Mig_ManObjNum(pMan->pMig) );
+ vMapping2 = Vec_IntStart( 1 );
+ if ( 0 ) // pMan->pPars->fDeriveLuts && pMan->pPars->pLutStruct )
+ {
+ vPacking = Vec_IntAlloc( 1000 );
+ Vec_IntPush( vPacking, 0 );
+ }
+ // create new manager
+ pNew = Gia_ManStart( Mig_ManObjNum(pMan->pMig) );
+ // iterate through nodes used in the mapping
+ vCover = Vec_IntAlloc( 1 << 16 );
+ vLeaves = Vec_IntAlloc( 16 );
+ vLeaves2 = Vec_IntAlloc( 16 );
+ Mig_ManCleanCopy( pMan->pMig );
+ Mig_ManForEachObj( pMan->pMig, pObj )
+ {
+ if ( !Mpm_ObjMapRef(pMan, pObj) && !Mig_ObjIsTerm(pObj) )
+ continue;
+ if ( Mig_ObjIsNode(pObj) )
+ {
+ // collect leaves of the best cut
+ Vec_IntClear( vLeaves );
+ pCutBest = Mpm_ObjCutBestP( pMan, pObj );
+ Mpm_CutForEachLeaf( pMan->pMig, pCutBest, pFanin, k )
+ Vec_IntPush( vLeaves, Mig_ObjCopy(pFanin) );
+ // perform one of the two types of mapping: with and without structures
+ iLitNew = Mpm_ManNodeIfToGia( pNew, pMan, pObj, vLeaves, 0 );
+ // write mapping
+ Vec_IntSetEntry( vMapping, Abc_Lit2Var(iLitNew), Vec_IntSize(vMapping2) );
+ Vec_IntPush( vMapping2, Vec_IntSize(vLeaves) );
+ Vec_IntForEachEntry( vLeaves, Entry, k )
+ assert( Abc_Lit2Var(Entry) < Abc_Lit2Var(iLitNew) );
+ Vec_IntForEachEntry( vLeaves, Entry, k )
+ Vec_IntPush( vMapping2, Abc_Lit2Var(Entry) );
+ Vec_IntPush( vMapping2, Abc_Lit2Var(iLitNew) );
+ }
+ else if ( Mig_ObjIsCi(pObj) )
+ iLitNew = Gia_ManAppendCi(pNew);
+ else if ( Mig_ObjIsCo(pObj) )
+ iLitNew = Gia_ManAppendCo( pNew, Abc_LitNotCond(Mig_ObjCopy(Mig_ObjFanin0(pObj)), Mig_ObjFaninC0(pObj)) );
+ else if ( Mig_ObjIsConst0(pObj) )
+ {
+ iLitNew = 0;
+ // create const LUT
+ Vec_IntWriteEntry( vMapping, 0, Vec_IntSize(vMapping2) );
+ Vec_IntPush( vMapping2, 0 );
+ Vec_IntPush( vMapping2, 0 );
+ }
+ else assert( 0 );
+ Mig_ObjSetCopy( pObj, iLitNew );
+ }
+ Vec_IntFree( vCover );
+ Vec_IntFree( vLeaves );
+ Vec_IntFree( vLeaves2 );
+// printf( "Mapping array size: IfMan = %d. Gia = %d. Increase = %.2f\n",
+// Mig_ManObjNum(pMan), Gia_ManObjNum(pNew), 1.0 * Gia_ManObjNum(pNew) / Mig_ManObjNum(pMan) );
+ // finish mapping
+ if ( Vec_IntSize(vMapping) > Gia_ManObjNum(pNew) )
+ Vec_IntShrink( vMapping, Gia_ManObjNum(pNew) );
+ else
+ Vec_IntFillExtra( vMapping, Gia_ManObjNum(pNew), 0 );
+ assert( Vec_IntSize(vMapping) == Gia_ManObjNum(pNew) );
+ Vec_IntForEachEntry( vMapping, Entry, i )
+ if ( Entry > 0 )
+ Vec_IntAddToEntry( vMapping, i, Gia_ManObjNum(pNew) );
+ Vec_IntAppend( vMapping, vMapping2 );
+ Vec_IntFree( vMapping2 );
+ // attach mapping and packing
+ assert( pNew->vMapping == NULL );
+ assert( pNew->vPacking == NULL );
+ pNew->vMapping = vMapping;
+ pNew->vPacking = vPacking;
+ // verify that COs have mapping
+ {
+ Gia_Obj_t * pObj;
+ Gia_ManForEachCo( pNew, pObj, i )
+ assert( !Gia_ObjIsAnd(Gia_ObjFanin0(pObj)) || Gia_ObjIsLut(pNew, Gia_ObjFaninId0p(pNew, pObj)) );
+ }
+ return pNew;
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+/*
+void Mig_ManTest2( Gia_Man_t * pGia )
+{
+ extern int Gia_ManSuppSizeTest( Gia_Man_t * p );
+ Mig_Man_t * p;
+ Gia_ManSuppSizeTest( pGia );
+ p = Mig_ManCreate( pGia );
+ Mig_ManSuppSizeTest( p );
+ Mig_ManStop( p );
+}
+*/
+
+////////////////////////////////////////////////////////////////////////
+/// END OF FILE ///
+////////////////////////////////////////////////////////////////////////
+
+
+ABC_NAMESPACE_IMPL_END
+
diff --git a/src/map/mpm/mpmCore.c b/src/map/mpm/mpmCore.c
new file mode 100644
index 00000000..605e716c
--- /dev/null
+++ b/src/map/mpm/mpmCore.c
@@ -0,0 +1,96 @@
+/**CFile****************************************************************
+
+ FileName [mpmCore.c]
+
+ SystemName [ABC: Logic synthesis and verification system.]
+
+ PackageName [Configurable technology mapper.]
+
+ Synopsis [Core procedures.]
+
+ Author [Alan Mishchenko]
+
+ Affiliation [UC Berkeley]
+
+ Date [Ver. 1.0. Started - June 1, 2013.]
+
+ Revision [$Id: mpmCore.c,v 1.00 2013/06/01 00:00:00 alanmi Exp $]
+
+***********************************************************************/
+
+#include "aig/gia/gia.h"
+#include "mpmInt.h"
+
+ABC_NAMESPACE_IMPL_START
+
+
+////////////////////////////////////////////////////////////////////////
+/// DECLARATIONS ///
+////////////////////////////////////////////////////////////////////////
+
+////////////////////////////////////////////////////////////////////////
+/// FUNCTION DEFINITIONS ///
+////////////////////////////////////////////////////////////////////////
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Mpm_ManSetParsDefault( Mpm_Par_t * p )
+{
+ memset( p, 0, sizeof(Mpm_Par_t) );
+ p->DelayTarget = -1; // delay target
+ p->fVerbose = 0; // verbose output
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+Gia_Man_t * Mpm_ManPerformTest( Mig_Man_t * pMig )
+{
+ Gia_Man_t * pNew;
+ Mpm_LibLut_t * pLib;
+ Mpm_Man_t * p;
+ pLib = Mpm_LibLutSetSimple( 6 );
+ p = Mpm_ManStart( pMig, pLib, 8 );
+ Mpm_ManPrintStatsInit( p );
+ Mpm_ManPrepare( p );
+ Mpm_ManPerform( p );
+ Mpm_ManPrintStats( p );
+ pNew = (Gia_Man_t *)Mpm_ManFromIfLogic( p );
+ Mpm_ManStop( p );
+ Mpm_LibLutFree( pLib );
+ return pNew;
+}
+Gia_Man_t * Mpm_ManMappingTest( Gia_Man_t * pGia, Mpm_Par_t * pPars )
+{
+ Mig_Man_t * p;
+ Gia_Man_t * pNew;
+ p = Mig_ManCreate( pGia );
+ pNew = Mpm_ManPerformTest( p );
+ Mig_ManStop( p );
+ return pNew;
+}
+
+////////////////////////////////////////////////////////////////////////
+/// END OF FILE ///
+////////////////////////////////////////////////////////////////////////
+
+
+ABC_NAMESPACE_IMPL_END
+
diff --git a/src/map/mpm/mpmDsd.c b/src/map/mpm/mpmDsd.c
new file mode 100644
index 00000000..0cff45af
--- /dev/null
+++ b/src/map/mpm/mpmDsd.c
@@ -0,0 +1,52 @@
+/**CFile****************************************************************
+
+ FileName [mpmDsd.c]
+
+ SystemName [ABC: Logic synthesis and verification system.]
+
+ PackageName [Configurable technology mapper.]
+
+ Synopsis [DSD manipulation.]
+
+ Author [Alan Mishchenko]
+
+ Affiliation [UC Berkeley]
+
+ Date [Ver. 1.0. Started - June 1, 2013.]
+
+ Revision [$Id: mpmDsd.c,v 1.00 2013/06/01 00:00:00 alanmi Exp $]
+
+***********************************************************************/
+
+#include "mpmInt.h"
+
+ABC_NAMESPACE_IMPL_START
+
+
+////////////////////////////////////////////////////////////////////////
+/// DECLARATIONS ///
+////////////////////////////////////////////////////////////////////////
+
+////////////////////////////////////////////////////////////////////////
+/// FUNCTION DEFINITIONS ///
+////////////////////////////////////////////////////////////////////////
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+
+////////////////////////////////////////////////////////////////////////
+/// END OF FILE ///
+////////////////////////////////////////////////////////////////////////
+
+
+ABC_NAMESPACE_IMPL_END
+
diff --git a/src/map/mpm/mpmInt.h b/src/map/mpm/mpmInt.h
new file mode 100644
index 00000000..bb235833
--- /dev/null
+++ b/src/map/mpm/mpmInt.h
@@ -0,0 +1,225 @@
+/**CFile****************************************************************
+
+ FileName [mpmInt.h]
+
+ SystemName [ABC: Logic synthesis and verification system.]
+
+ PackageName [Configurable technology mapper.]
+
+ Synopsis [Interal declarations.]
+
+ Author [Alan Mishchenko]
+
+ Affiliation [UC Berkeley]
+
+ Date [Ver. 1.0. Started - June 1, 2013.]
+
+ Revision [$Id: mpmInt.h,v 1.00 2013/06/01 00:00:00 alanmi Exp $]
+
+***********************************************************************/
+
+#ifndef ABC__map__mpm_Int_h
+#define ABC__map__mpm_Int_h
+
+
+////////////////////////////////////////////////////////////////////////
+/// INCLUDES ///
+////////////////////////////////////////////////////////////////////////
+
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include <assert.h>
+
+//#include "misc/tim/tim.h"
+#include "misc/vec/vec.h"
+#include "misc/mem/mem2.h"
+#include "mpmMig.h"
+#include "mpm.h"
+
+ABC_NAMESPACE_HEADER_START
+
+////////////////////////////////////////////////////////////////////////
+/// PARAMETERS ///
+////////////////////////////////////////////////////////////////////////
+
+#define MPM_CUT_MAX 64
+
+#define MPM_UNIT_TIME 1
+#define MPM_UNIT_AREA 20
+#define MPM_UNIT_EDGE 50
+#define MPM_UNIT_REFS 100
+
+////////////////////////////////////////////////////////////////////////
+/// BASIC TYPES ///
+////////////////////////////////////////////////////////////////////////
+
+typedef struct Mpm_Cut_t_ Mpm_Cut_t; // 8 bytes + NLeaves * 4 bytes
+struct Mpm_Cut_t_
+{
+ int hNext; // next cut
+ unsigned iFunc : 26; // function
+ unsigned fUseless : 1; // internal flag
+ unsigned nLeaves : 5; // leaves
+ int pLeaves[0]; // leaves
+};
+
+typedef struct Mpm_Inf_t_ Mpm_Inf_t; // 32 bytes
+struct Mpm_Inf_t_
+{
+ int hCut; // cut handle
+ unsigned nLeaves : 6; // the number of leaves
+ unsigned mCost : 26; // area cost of this cut
+ int mTime; // arrival time
+ int mArea; // area (flow)
+ int mEdge; // edge (flow)
+ int mAveRefs; // area references
+ word uSign; // cut signature
+};
+
+typedef struct Mpm_Uni_t_ Mpm_Uni_t; // 48 bytes
+struct Mpm_Uni_t_
+{
+ Mpm_Inf_t Inf; // information
+ unsigned iFunc : 26; // function
+ unsigned fUseless : 1; // internal flag
+ unsigned nLeaves : 5; // leaves
+ int pLeaves[MPM_VAR_MAX]; // leaves
+};
+
+typedef struct Mpm_Man_t_ Mpm_Man_t;
+struct Mpm_Man_t_
+{
+ Mig_Man_t * pMig; // AIG manager
+ // mapping parameters
+ int nLutSize; // LUT size
+ int nNumCuts; // cut count
+ Mpm_LibLut_t * pLibLut; // LUT library
+ // mapping attributes
+ int GloRequired; // global arrival time
+ int GloArea; // total area
+ int GloEdge; // total edge
+ int fMainRun; // after preprocessing is finished
+ // cut management
+ Mmr_Step_t * pManCuts; // cut memory
+ // temporary cut storage
+ int nCutStore; // number of cuts in storage
+ Mpm_Uni_t * pCutStore[MPM_CUT_MAX+1]; // storage for cuts
+ Mpm_Uni_t pCutUnits[MPM_CUT_MAX+1]; // cut info units
+ Vec_Int_t vFreeUnits; // free cut info units
+ Vec_Ptr_t * vTemp; // storage for cuts
+ // object presence
+ unsigned char * pObjPres; // object presence
+ Mpm_Cut_t * pCutTemp; // temporary cut
+ Vec_Str_t vObjShared; // object presence
+ // cut comparison
+ int (* pCutCmp) (Mpm_Inf_t *, Mpm_Inf_t *);// procedure to compare cuts
+ // fanin cuts/signatures
+ int nCuts[3]; // fanin cut counts
+ Mpm_Cut_t * pCuts[3][MPM_CUT_MAX+1]; // fanin cuts
+ word pSigns[3][MPM_CUT_MAX+1]; // fanin cut signatures
+ // functionality
+// Dsd_Man_t * pManDsd;
+ void * pManDsd;
+ int pPerm[MPM_VAR_MAX];
+ // mapping attributes
+ Vec_Int_t vCutBests; // cut best
+ Vec_Int_t vCutLists; // cut list
+ Vec_Int_t vMigRefs; // original references
+ Vec_Int_t vMapRefs; // exact mapping references
+ Vec_Int_t vEstRefs; // estimated mapping references
+ Vec_Int_t vRequireds; // required time
+ Vec_Int_t vTimes; // arrival time
+ Vec_Int_t vAreas; // area
+ Vec_Int_t vEdges; // edge
+ // statistics
+ int nCutsMerged;
+ abctime timeFanin;
+ abctime timeDerive;
+ abctime timeMerge;
+ abctime timeEval;
+ abctime timeCompare;
+ abctime timeStore;
+ abctime timeOther;
+ abctime timeTotal;
+};
+
+////////////////////////////////////////////////////////////////////////
+/// MACRO DEFINITIONS ///
+////////////////////////////////////////////////////////////////////////
+
+static inline int Mpm_ObjCutBest( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Vec_IntEntry(&p->vCutBests, Mig_ObjId(pObj)); }
+static inline void Mpm_ObjSetCutBest( Mpm_Man_t * p, Mig_Obj_t * pObj, int i ) { Vec_IntWriteEntry(&p->vCutBests, Mig_ObjId(pObj), i); }
+
+static inline int Mpm_CutWordNum( int nLeaves ) { return (sizeof(Mpm_Cut_t)/sizeof(int) + nLeaves + 1) >> 1; }
+static inline Mpm_Cut_t * Mpm_CutFetch( Mpm_Man_t * p, int h ) { Mpm_Cut_t * pCut = (Mpm_Cut_t *)Mmr_StepEntry( p->pManCuts, h ); assert( Mpm_CutWordNum(pCut->nLeaves) == (h & p->pManCuts->uMask) ); return pCut; }
+static inline Mpm_Cut_t * Mpm_ObjCutBestP( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Mpm_CutFetch( p, Mpm_ObjCutBest(p, pObj) ); }
+
+static inline int Mpm_ObjCutList( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Vec_IntEntry(&p->vCutLists, Mig_ObjId(pObj)); }
+static inline int * Mpm_ObjCutListP( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Vec_IntEntryP(&p->vCutLists, Mig_ObjId(pObj)); }
+static inline void Mpm_ObjSetCutList( Mpm_Man_t * p, Mig_Obj_t * pObj, int i ) { Vec_IntWriteEntry(&p->vCutLists, Mig_ObjId(pObj), i); }
+
+static inline void Mpm_ManSetMigRefs( Mpm_Man_t * p ) { assert( Vec_IntSize(&p->vMigRefs) == Vec_IntSize(&p->pMig->vRefs) ); memcpy( Vec_IntArray(&p->vMigRefs), Vec_IntArray(&p->pMig->vRefs), sizeof(int) * Mig_ManObjNum(p->pMig) ); }
+static inline int Mig_ObjMigRefNum( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Vec_IntEntry(&p->vMigRefs, Mig_ObjId(pObj)); }
+static inline int Mig_ObjMigRefDec( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Vec_IntAddToEntry(&p->vMigRefs, Mig_ObjId(pObj), -1); }
+
+static inline void Mpm_ManCleanMapRefs( Mpm_Man_t * p ) { Vec_IntFill( &p->vMapRefs, Mig_ManObjNum(p->pMig), 0 ); }
+static inline int Mpm_ObjMapRef( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Vec_IntEntry(&p->vMapRefs, Mig_ObjId(pObj)); }
+static inline void Mpm_ObjSetMapRef( Mpm_Man_t * p, Mig_Obj_t * pObj, int i ) { Vec_IntWriteEntry(&p->vMapRefs, Mig_ObjId(pObj), i); }
+
+static inline int Mpm_ObjEstRef( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Vec_IntEntry(&p->vEstRefs, Mig_ObjId(pObj)); }
+static inline void Mpm_ObjSetEstRef( Mpm_Man_t * p, Mig_Obj_t * pObj, int i ) { Vec_IntWriteEntry(&p->vEstRefs, Mig_ObjId(pObj), i); }
+
+static inline void Mpm_ManCleanRequired( Mpm_Man_t * p ) { Vec_IntFill(&p->vRequireds,Mig_ManObjNum(p->pMig),ABC_INFINITY);}
+static inline int Mpm_ObjRequired( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Vec_IntEntry(&p->vRequireds, Mig_ObjId(pObj)); }
+static inline void Mpm_ObjSetRequired( Mpm_Man_t * p, Mig_Obj_t * pObj, int i ) { Vec_IntWriteEntry(&p->vRequireds, Mig_ObjId(pObj), i); }
+
+static inline int Mpm_ObjTime( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Vec_IntEntry(&p->vTimes, Mig_ObjId(pObj)); }
+static inline void Mpm_ObjSetTime( Mpm_Man_t * p, Mig_Obj_t * pObj, int i ) { Vec_IntWriteEntry(&p->vTimes, Mig_ObjId(pObj), i); }
+
+static inline int Mpm_ObjArea( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Vec_IntEntry(&p->vAreas, Mig_ObjId(pObj)); }
+static inline void Mpm_ObjSetArea( Mpm_Man_t * p, Mig_Obj_t * pObj, int i ) { Vec_IntWriteEntry(&p->vAreas, Mig_ObjId(pObj), i); }
+
+static inline int Mpm_ObjEdge( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Vec_IntEntry(&p->vEdges, Mig_ObjId(pObj)); }
+static inline void Mpm_ObjSetEdge( Mpm_Man_t * p, Mig_Obj_t * pObj, int i ) { Vec_IntWriteEntry(&p->vEdges, Mig_ObjId(pObj), i); }
+
+// iterators over object cuts
+#define Mpm_ObjForEachCut( p, pObj, hCut, pCut ) \
+ for ( hCut = Mpm_ObjCutList(p, pObj); hCut && (pCut = Mpm_CutFetch(p, hCut)); hCut = pCut->hNext )
+#define Mpm_ObjForEachCutSafe( p, pObj, hCut, pCut, hNext ) \
+ for ( hCut = Mpm_ObjCutList(p, pObj); hCut && (pCut = Mpm_CutFetch(p, hCut)) && ((hNext = pCut->hNext), 1); hCut = hNext )
+
+// iterators over cut leaves
+#define Mpm_CutForEachLeafId( pCut, iLeafId, i ) \
+ for ( i = 0; i < (int)pCut->nLeaves && ((iLeafId = Abc_Lit2Var(pCut->pLeaves[i])), 1); i++ )
+#define Mpm_CutForEachLeaf( p, pCut, pLeaf, i ) \
+ for ( i = 0; i < (int)pCut->nLeaves && (pLeaf = Mig_ManObj(p, Abc_Lit2Var(pCut->pLeaves[i]))); i++ )
+
+////////////////////////////////////////////////////////////////////////
+/// FUNCTION DECLARATIONS ///
+////////////////////////////////////////////////////////////////////////
+
+/*=== mpmAbc.c ===========================================================*/
+extern Mig_Man_t * Mig_ManCreate( void * pGia );
+extern void * Mpm_ManFromIfLogic( Mpm_Man_t * pMan );
+/*=== mpmCore.c ===========================================================*/
+extern Mpm_Man_t * Mpm_ManStart( Mig_Man_t * pMig, Mpm_LibLut_t * pLib, int nNumCuts );
+extern void Mpm_ManStop( Mpm_Man_t * p );
+extern void Mpm_ManPrintStatsInit( Mpm_Man_t * p );
+extern void Mpm_ManPrintStats( Mpm_Man_t * p );
+/*=== mpmDsd.c ===========================================================*/
+/*=== mpmLib.c ===========================================================*/
+extern Mpm_LibLut_t * Mpm_LibLutSetSimple( int nLutSize );
+extern void Mpm_LibLutFree( Mpm_LibLut_t * pLib );
+/*=== mpmMap.c ===========================================================*/
+extern void Mpm_ManPrepare( Mpm_Man_t * p );
+extern void Mpm_ManPerform( Mpm_Man_t * p );
+
+ABC_NAMESPACE_HEADER_END
+
+#endif
+
+////////////////////////////////////////////////////////////////////////
+/// END OF FILE ///
+////////////////////////////////////////////////////////////////////////
+
diff --git a/src/map/mpm/mpmLib.c b/src/map/mpm/mpmLib.c
new file mode 100644
index 00000000..14330323
--- /dev/null
+++ b/src/map/mpm/mpmLib.c
@@ -0,0 +1,74 @@
+/**CFile****************************************************************
+
+ FileName [mpmLib.c]
+
+ SystemName [ABC: Logic synthesis and verification system.]
+
+ PackageName [Configurable technology mapper.]
+
+ Synopsis [DSD manipulation for 6-input functions.]
+
+ Author [Alan Mishchenko]
+
+ Affiliation [UC Berkeley]
+
+ Date [Ver. 1.0. Started - June 1, 2013.]
+
+ Revision [$Id: mpmLib.c,v 1.00 2013/06/01 00:00:00 alanmi Exp $]
+
+***********************************************************************/
+
+#include "mpmInt.h"
+
+ABC_NAMESPACE_IMPL_START
+
+
+////////////////////////////////////////////////////////////////////////
+/// DECLARATIONS ///
+////////////////////////////////////////////////////////////////////////
+
+////////////////////////////////////////////////////////////////////////
+/// FUNCTION DEFINITIONS ///
+////////////////////////////////////////////////////////////////////////
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+Mpm_LibLut_t * Mpm_LibLutSetSimple( int nLutSize )
+{
+ Mpm_LibLut_t * pLib;
+ int i, k;
+ assert( nLutSize < MPM_VAR_MAX );
+ pLib = ABC_CALLOC( Mpm_LibLut_t, 1 );
+ pLib->LutMax = nLutSize;
+ for ( i = 1; i <= pLib->LutMax; i++ )
+ {
+ pLib->pLutAreas[i] = MPM_UNIT_AREA;
+ for ( k = 0; k < i; k++ )
+ pLib->pLutDelays[i][k] = MPM_UNIT_TIME;
+ }
+ return pLib;
+}
+void Mpm_LibLutFree( Mpm_LibLut_t * pLib )
+{
+ if ( pLib == NULL )
+ return;
+ ABC_FREE( pLib->pName );
+ ABC_FREE( pLib );
+}
+
+////////////////////////////////////////////////////////////////////////
+/// END OF FILE ///
+////////////////////////////////////////////////////////////////////////
+
+
+ABC_NAMESPACE_IMPL_END
+
diff --git a/src/map/mpm/mpmMap.c b/src/map/mpm/mpmMap.c
new file mode 100644
index 00000000..a876de2c
--- /dev/null
+++ b/src/map/mpm/mpmMap.c
@@ -0,0 +1,988 @@
+/**CFile****************************************************************
+
+ FileName [mpmMap.c]
+
+ SystemName [ABC: Logic synthesis and verification system.]
+
+ PackageName [Configurable technology mapper.]
+
+ Synopsis [Mapping algorithm.]
+
+ Author [Alan Mishchenko]
+
+ Affiliation [UC Berkeley]
+
+ Date [Ver. 1.0. Started - June 1, 2013.]
+
+ Revision [$Id: mpmMap.c,v 1.00 2013/06/01 00:00:00 alanmi Exp $]
+
+***********************************************************************/
+
+#include "mpmInt.h"
+#include "misc/util/utilTruth.h"
+
+ABC_NAMESPACE_IMPL_START
+
+////////////////////////////////////////////////////////////////////////
+/// DECLARATIONS ///
+////////////////////////////////////////////////////////////////////////
+
+////////////////////////////////////////////////////////////////////////
+/// FUNCTION DEFINITIONS ///
+////////////////////////////////////////////////////////////////////////
+
+/*
+ // check special cases
+ if ( fUseFunc )
+ {
+ pCut0 = p->pCuts[0][0]; pCut1 = p->pCuts[1][0];
+ if ( pCut0->iFunc < 2 || pCut1->iFunc < 2 )
+ {
+ assert( Mig_ObjIsAnd(pObj) );
+ if ( Abc_LitNotCond(pCut0->iFunc, Mig_ObjFaninC0(pObj)) == 0 ||
+ Abc_LitNotCond(pCut1->iFunc, Mig_ObjFaninC1(pObj)) == 0 ) // set the resulting cut to 0
+ Mig_ManObj(p, pObj)->hCutList = Mpm_CutCreateZero( p, pObj );
+ else if ( Abc_LitNotCond(pCut0->iFunc, Mig_ObjFaninC0(pObj)) == 1 ) // set the resulting set to be that of Fanin1
+ Mig_ManObj(p, pObj)->hCutList = Mpm_CutCopySet( p, Mig_ObjFanin1(pObj), 0 );
+ else if ( Abc_LitNotCond(pCut1->iFunc, Mig_ObjFaninC1(pObj)) == 1 ) // set the resulting set to be that of Fanin0
+ Mig_ManObj(p, pObj)->hCutList = Mpm_CutCopySet( p, Mig_ObjFanin0(pObj), 0 );
+ else assert( 0 );
+ goto finish;
+ }
+ }
+ // compute cut function
+ if ( fUseFunc )
+ {
+ extern int Mpm_FuncCompute( void * p, int iDsd0, int iDsd1, Vec_Str_t * vShared, int * pPerm, int * pnLeaves );
+ int nLeavesOld = p->pCutTemp->nLeaves;
+ int nLeaves = p->pCutTemp->nLeaves;
+ iDsd0 = Abc_LitNotCond( pCut0->iFunc, Mig_ObjFaninC0(pObj) );
+ iDsd1 = Abc_LitNotCond( pCut1->iFunc, Mig_ObjFaninC1(pObj) );
+ if ( iDsd0 > iDsd1 )
+ {
+ ABC_SWAP( int, iDsd0, iDsd1 );
+ ABC_SWAP( Mpm_Cut_t *, pCut0, pCut1 );
+ }
+ // compute functionality and filter cuts dominated by support-reduced cuts
+ p->pCutTemp->iFunc = Mpm_FuncCompute( p->pManDsd, iDsd0, iDsd1, &p->vObjShared, p->pPerm, &nLeaves );
+ Mpm_ObjUpdateCut( p->pCutTemp, p->pPerm, nLeaves );
+ // consider filtering based on functionality
+ if ( nLeaves == 0 ) // derived const cut
+ {
+ Mig_ManObj(p, pObj)->hCutList = Mpm_CutCreateZero( p, pObj );
+ goto finish;
+ }
+ if ( nLeaves == 1 ) // derived unit cut
+ {
+ pFanin = Mig_ManObj( p->pMig, Abc_Lit2Var(p->pCutTemp->pLeaves[0]) );
+ Mig_ManObj(p, pObj)->hCutList = Mpm_CutCopySet( p, pFanin, Abc_LitIsCompl(p->pCutTemp->pLeaves[0]) );
+ goto finish;
+ }
+ if ( nLeaves < nLeavesOld ) // reduced support of the cut
+ {
+ ArrTime = Mpm_CutGetArrTime( p, p->pCutTemp );
+ if ( ArrTime > pMapObj->mRequired )
+ continue;
+ }
+ }
+*/
+
+
+/**Function*************************************************************
+
+ Synopsis [Cut manipulation.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+static inline int Mpm_CutAlloc( Mpm_Man_t * p, int nLeaves, Mpm_Cut_t ** ppCut )
+{
+ int hHandle = Mmr_StepFetch( p->pManCuts, Mpm_CutWordNum(nLeaves) );
+ *ppCut = (Mpm_Cut_t *)Mmr_StepEntry( p->pManCuts, hHandle );
+ (*ppCut)->nLeaves = nLeaves;
+ (*ppCut)->hNext = 0;
+ (*ppCut)->fUseless = 0;
+ return hHandle;
+}
+static inline int Mpm_CutCreateZero( Mpm_Man_t * p )
+{
+ Mpm_Cut_t * pCut;
+ int hCut = Mpm_CutAlloc( p, 0, &pCut );
+ pCut->iFunc = 0; // const0
+ return hCut;
+}
+static inline int Mpm_CutCreateUnit( Mpm_Man_t * p, int Id )
+{
+ Mpm_Cut_t * pCut;
+ int hCut = Mpm_CutAlloc( p, 1, &pCut );
+ pCut->iFunc = 2; // var
+ pCut->pLeaves[0] = Abc_Var2Lit( Id, 0 );
+ return hCut;
+}
+static inline int Mpm_CutCreate( Mpm_Man_t * p, int * pLeaves, int nLeaves, int fUseless, Mpm_Cut_t ** ppCut )
+{
+ int hCutNew = Mpm_CutAlloc( p, nLeaves, ppCut );
+ (*ppCut)->fUseless = fUseless;
+ (*ppCut)->nLeaves = nLeaves;
+ memcpy( (*ppCut)->pLeaves, pLeaves, sizeof(int) * nLeaves );
+ return hCutNew;
+}
+static inline int Mpm_CutDup( Mpm_Man_t * p, Mpm_Cut_t * pCut, int fCompl )
+{
+ Mpm_Cut_t * pCutNew;
+ int hCutNew = Mpm_CutAlloc( p, pCut->nLeaves, &pCutNew );
+ pCutNew->iFunc = Abc_LitNotCond( pCut->iFunc, fCompl );
+ pCutNew->fUseless = pCut->fUseless;
+ pCutNew->nLeaves = pCut->nLeaves;
+ memcpy( pCutNew->pLeaves, pCut->pLeaves, sizeof(int) * pCut->nLeaves );
+ return hCutNew;
+}
+static inline int Mpm_CutCopySet( Mpm_Man_t * p, Mig_Obj_t * pObj, int fCompl )
+{
+ Mpm_Cut_t * pCut;
+ int hCut, iList = 0, * pList = &iList;
+ Mpm_ObjForEachCut( p, pObj, hCut, pCut )
+ {
+ *pList = Mpm_CutDup( p, pCut, fCompl );
+ pList = &Mpm_CutFetch( p, *pList )->hNext;
+ }
+ *pList = 0;
+ return iList;
+}
+/*
+static inline void Mpm_CutRef( Mpm_Man_t * p, int * pLeaves, int nLeaves )
+{
+ int i;
+ for ( i = 0; i < nLeaves; i++ )
+ Mig_ManObj( p->pMig, Abc_Lit2Var(pLeaves[i]) )->nMapRefs++;
+}
+static inline void Mpm_CutDeref( Mpm_Man_t * p, int * pLeaves, int nLeaves )
+{
+ int i;
+ for ( i = 0; i < nLeaves; i++ )
+ Mig_ManObj( p->pMig, Abc_Lit2Var(pLeaves[i]) )->nMapRefs--;
+}
+*/
+static inline void Mpm_CutPrint( int * pLeaves, int nLeaves )
+{
+ int i;
+ printf( "%d : { ", nLeaves );
+ for ( i = 0; i < nLeaves; i++ )
+ printf( "%d ", pLeaves[i] );
+ printf( "}\n" );
+}
+static inline void Mpm_CutPrintAll( Mpm_Man_t * p )
+{
+ int i;
+ for ( i = 0; i < p->nCutStore; i++ )
+ {
+ printf( "%2d : ", i );
+ Mpm_CutPrint( p->pCutStore[i]->pLeaves, p->pCutStore[i]->nLeaves );
+ }
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+Mpm_Man_t * Mpm_ManStart( Mig_Man_t * pMig, Mpm_LibLut_t * pLib, int nNumCuts )
+{
+ Mpm_Man_t * p;
+ assert( sizeof(Mpm_Inf_t) % sizeof(word) == 0 ); // aligned info to word boundary
+ assert( Mpm_CutWordNum(32) < 32 ); // using 5 bits for word count
+ assert( nNumCuts <= MPM_CUT_MAX );
+ Mig_ManSetRefs( pMig, 1 );
+ // alloc
+ p = ABC_CALLOC( Mpm_Man_t, 1 );
+ p->pMig = pMig;
+ p->pLibLut = pLib;
+ p->nLutSize = pLib->LutMax;
+ p->nNumCuts = nNumCuts;
+ p->timeTotal = Abc_Clock();
+ // cuts
+ p->pManCuts = Mmr_StepStart( 13, Abc_Base2Log(Mpm_CutWordNum(p->nLutSize) + 1) );
+ Vec_IntGrow( &p->vFreeUnits, nNumCuts + 1 );
+ p->pObjPres = ABC_FALLOC( unsigned char, Mig_ManObjNum(pMig) );
+ p->pCutTemp = (Mpm_Cut_t *)ABC_CALLOC( word, Mpm_CutWordNum(p->nLutSize) );
+ Vec_StrGrow( &p->vObjShared, 32 );
+ p->vTemp = Vec_PtrAlloc( 1000 );
+ // mapping attributes
+ Vec_IntFill( &p->vCutBests, Mig_ManObjNum(pMig), 0 );
+ Vec_IntFill( &p->vCutLists, Mig_ManObjNum(pMig), 0 );
+ Vec_IntFill( &p->vMigRefs, Mig_ManObjNum(pMig), 0 );
+ Vec_IntFill( &p->vMapRefs, Mig_ManObjNum(pMig), 0 );
+ Vec_IntFill( &p->vEstRefs, Mig_ManObjNum(pMig), 0 );
+ Vec_IntFill( &p->vRequireds, Mig_ManObjNum(pMig), ABC_INFINITY );
+ Vec_IntFill( &p->vTimes, Mig_ManObjNum(pMig), 0 );
+ Vec_IntFill( &p->vAreas, Mig_ManObjNum(pMig), 0 );
+ Vec_IntFill( &p->vEdges, Mig_ManObjNum(pMig), 0 );
+ // start DSD manager
+ p->pManDsd = NULL;
+ pMig->pMan = p;
+ return p;
+}
+void Mpm_ManStop( Mpm_Man_t * p )
+{
+ Vec_PtrFree( p->vTemp );
+ Mmr_StepStop( p->pManCuts );
+ ABC_FREE( p->vFreeUnits.pArray );
+ ABC_FREE( p->vObjShared.pArray );
+ ABC_FREE( p->pCutTemp );
+ ABC_FREE( p->pObjPres );
+ // mapping attributes
+ ABC_FREE( p->vCutBests.pArray );
+ ABC_FREE( p->vCutLists.pArray );
+ ABC_FREE( p->vMigRefs.pArray );
+ ABC_FREE( p->vMapRefs.pArray );
+ ABC_FREE( p->vEstRefs.pArray );
+ ABC_FREE( p->vRequireds.pArray );
+ ABC_FREE( p->vTimes.pArray );
+ ABC_FREE( p->vAreas.pArray );
+ ABC_FREE( p->vEdges.pArray );
+ ABC_FREE( p );
+}
+void Mpm_ManPrintStatsInit( Mpm_Man_t * p )
+{
+ printf( "K = %d. C = %d. Cands = %d. Choices = %d.\n",
+ p->nLutSize, p->nNumCuts, Mig_ManCiNum(p->pMig) + Mig_ManNodeNum(p->pMig), 0 );
+}
+void Mpm_ManPrintStats( Mpm_Man_t * p )
+{
+ printf( "Memory usage: Mig = %.2f MB Map = %.2f MB Cut = %.2f MB Total = %.2f MB. ",
+ 1.0 * Mig_ManObjNum(p->pMig) * sizeof(Mig_Obj_t) / (1 << 20),
+ 1.0 * Mig_ManObjNum(p->pMig) * 48 / (1 << 20),
+ 1.0 * Mmr_StepMemory(p->pManCuts) / (1 << 17),
+ 1.0 * Mig_ManObjNum(p->pMig) * sizeof(Mig_Obj_t) / (1 << 20) +
+ 1.0 * Mig_ManObjNum(p->pMig) * 48 / (1 << 20) +
+ 1.0 * Mmr_StepMemory(p->pManCuts) / (1 << 17) );
+
+#ifdef MIG_RUNTIME
+ printf( "\n" );
+ p->timeTotal = Abc_Clock() - p->timeTotal;
+ p->timeOther = p->timeTotal - (p->timeFanin + p->timeDerive);
+
+ Abc_Print( 1, "Runtime breakdown:\n" );
+ ABC_PRTP( "Precomputing fanin info ", p->timeFanin , p->timeTotal );
+ ABC_PRTP( "Complete cut computation ", p->timeDerive , p->timeTotal );
+ ABC_PRTP( "- Merging cuts ", p->timeMerge , p->timeTotal );
+ ABC_PRTP( "- Evaluting cut parameters ", p->timeEval , p->timeTotal );
+ ABC_PRTP( "- Checking cut containment ", p->timeCompare, p->timeTotal );
+ ABC_PRTP( "- Adding cuts to storage ", p->timeStore , p->timeTotal );
+ ABC_PRTP( "Other ", p->timeOther , p->timeTotal );
+ ABC_PRTP( "TOTAL ", p->timeTotal , p->timeTotal );
+#else
+ Abc_PrintTime( 1, "Time", Abc_Clock() - p->timeTotal );
+#endif
+}
+
+
+/**Function*************************************************************
+
+ Synopsis [Cut merging.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+static inline void Mig_ManObjPresClean( Mpm_Man_t * p )
+{
+ int i;
+ for ( i = 0; i < (int)p->pCutTemp->nLeaves; i++ )
+ p->pObjPres[Abc_Lit2Var(p->pCutTemp->pLeaves[i])] = (unsigned char)0xFF;
+// for ( i = 0; i < Mig_ManObjNum(p->pMig); i++ )
+// assert( p->pObjPres[i] == (unsigned char)0xFF );
+ Vec_StrClear(&p->vObjShared);
+}
+static inline int Mig_ManObjPres( Mpm_Man_t * p, int k, int iLit )
+{
+ int iObj = Abc_Lit2Var(iLit);
+// assert( iLit > 1 && iLit < 2 * Mig_ManObjNum(p->pMig) );
+ if ( p->pObjPres[iObj] != (unsigned char)0xFF )
+ return 1;
+ if ( (int)p->pCutTemp->nLeaves == p->nLutSize )
+ return 0;
+ p->pObjPres[iObj] = p->pCutTemp->nLeaves;
+ p->pCutTemp->pLeaves[p->pCutTemp->nLeaves++] = iLit;
+ return 1;
+}
+static inline int Mpm_ObjDeriveCut( Mpm_Man_t * p, Mpm_Cut_t ** pCuts, Mpm_Cut_t * pCut )
+{
+ int i, c;
+ pCut->nLeaves = 0;
+ for ( c = 0; pCuts[c] && c < 3; c++ )
+ for ( i = 0; i < (int)pCuts[c]->nLeaves; i++ )
+ if ( !Mig_ManObjPres( p, i, pCuts[c]->pLeaves[i] ) )
+ return 0;
+ pCut->hNext = 0;
+ pCut->iFunc = 0; pCut->iFunc = ~pCut->iFunc;
+ pCut->fUseless = 0;
+ assert( pCut->nLeaves > 0 );
+ p->nCutsMerged++;
+ return 1;
+}
+
+static inline int Mpm_ManSetIsSmaller( Mpm_Man_t * p, int * pLits, int nLits ) // check if pCut is contained in the current one (p->pCutTemp)
+{
+ int i, Index;
+ for ( i = 0; i < nLits; i++ )
+ {
+ Index = (int)p->pObjPres[Abc_Lit2Var(pLits[i])];
+ if ( Index == 0xFF )
+ return 0;
+ assert( Index < (int)p->pCutTemp->nLeaves );
+ }
+ return 1;
+}
+static inline int Mpm_ManSetIsBigger( Mpm_Man_t * p, int * pLits, int nLits ) // check if pCut contains the current one (p->pCutTemp)
+{
+ int i, Index;
+ unsigned uMask = 0;
+ for ( i = 0; i < nLits; i++ )
+ {
+ Index = (int)p->pObjPres[Abc_Lit2Var(pLits[i])];
+ if ( Index == 0xFF )
+ continue;
+ assert( Index < (int)p->pCutTemp->nLeaves );
+ uMask |= (1 << Index);
+ }
+ return uMask == ~(~(unsigned)0 << p->pCutTemp->nLeaves);
+}
+static inline int Mpm_ManSetIsDisjoint( Mpm_Man_t * p, Mpm_Cut_t * pCut ) // check if pCut is disjoint
+{
+ int i;
+ for ( i = 0; i < (int)pCut->nLeaves; i++ )
+ if ( (int)p->pObjPres[Abc_Lit2Var(pCut->pLeaves[i])] != 0xFF )
+ return 0;
+ return 1;
+}
+
+
+/**Function*************************************************************
+
+ Synopsis [Cut attibutes.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+static inline word Mpm_CutGetSign( Mpm_Cut_t * pCut )
+{
+ int i, iLeaf;
+ word uSign = 0;
+ Mpm_CutForEachLeafId( pCut, iLeaf, i )
+ uSign |= ((word)1 << (iLeaf & 0x3F));
+ return uSign;
+}
+static inline int Mpm_CutGetArrTime( Mpm_Man_t * p, Mpm_Cut_t * pCut )
+{
+ int * pmTimes = Vec_IntArray( &p->vTimes );
+ int * pDelays = p->pLibLut->pLutDelays[pCut->nLeaves];
+ int i, iLeaf, ArrTime = 0;
+ Mpm_CutForEachLeafId( pCut, iLeaf, i )
+ ArrTime = Abc_MaxInt( ArrTime, pmTimes[iLeaf] + pDelays[i] );
+ return ArrTime;
+}
+static inline void Mpm_CutSetupInfo( Mpm_Man_t * p, Mpm_Cut_t * pCut, int ArrTime, Mpm_Inf_t * pInfo )
+{
+ int * pMigRefs = Vec_IntArray( &p->vMigRefs );
+ int * pMapRefs = Vec_IntArray( &p->vMapRefs );
+ int * pEstRefs = Vec_IntArray( &p->vEstRefs );
+ int * pmArea = Vec_IntArray( &p->vAreas );
+ int * pmEdge = Vec_IntArray( &p->vEdges );
+ int i, iLeaf;
+ memset( pInfo, 0, sizeof(Mpm_Inf_t) );
+ pInfo->nLeaves = pCut->nLeaves;
+ pInfo->mTime = ArrTime;
+ pInfo->mArea = p->pLibLut->pLutAreas[pCut->nLeaves];
+ pInfo->mEdge = MPM_UNIT_EDGE * pCut->nLeaves;
+ Mpm_CutForEachLeafId( pCut, iLeaf, i )
+ {
+ if ( p->fMainRun && pMapRefs[iLeaf] == 0 ) // not used in the mapping
+ {
+ pInfo->mArea += pmArea[iLeaf];
+ pInfo->mEdge += pmEdge[iLeaf];
+ }
+ else
+ {
+ assert( pEstRefs[iLeaf] > 0 );
+ pInfo->mArea += MPM_UNIT_REFS * pmArea[iLeaf] / pEstRefs[iLeaf];
+ pInfo->mEdge += MPM_UNIT_REFS * pmEdge[iLeaf] / pEstRefs[iLeaf];
+ pInfo->mAveRefs += p->fMainRun ? pMapRefs[iLeaf] : pMigRefs[iLeaf];
+ }
+ pInfo->uSign |= ((word)1 << (iLeaf & 0x3F));
+ }
+ pInfo->mAveRefs = pInfo->mAveRefs * MPM_UNIT_EDGE / pCut->nLeaves;
+}
+
+/**Function*************************************************************
+
+ Synopsis [Cut translation.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+static inline Mpm_Uni_t * Mpm_CutToUnit( Mpm_Man_t * p, Mpm_Cut_t * pCut )
+{
+ Mpm_Uni_t * pUnit = p->pCutUnits + Vec_IntPop(&p->vFreeUnits);
+ pUnit->iFunc = pCut->iFunc;
+ pUnit->fUseless = pCut->fUseless;
+ pUnit->nLeaves = pCut->nLeaves;
+ memcpy( pUnit->pLeaves, pCut->pLeaves, sizeof(int) * pCut->nLeaves );
+ return pUnit;
+}
+static inline void Mpm_UnitRecycle( Mpm_Man_t * p, Mpm_Uni_t * pUnit )
+{
+ Vec_IntPush( &p->vFreeUnits, pUnit - p->pCutUnits );
+}
+static inline void Mpm_ManPrepareCutStore( Mpm_Man_t * p )
+{
+ int i;
+ p->nCutStore = 0;
+ Vec_IntClear( &p->vFreeUnits );
+ for ( i = p->nNumCuts; i >= 0; i-- )
+ Vec_IntPush( &p->vFreeUnits, i );
+ assert( Vec_IntSize(&p->vFreeUnits) == p->nNumCuts + 1 );
+}
+// compares cut against those present in the store
+int Mpm_ObjAddCutToStore( Mpm_Man_t * p, Mpm_Cut_t * pCut, int ArrTime )
+{
+ int fEnableContainment = 1;
+ Mpm_Uni_t * pUnit, * pUnitNew;
+ int k, iPivot, last;
+ // create new unit
+#ifdef MIG_RUNTIME
+ abctime clk;
+clk = Abc_Clock();
+#endif
+ pUnitNew = Mpm_CutToUnit( p, pCut );
+ Mpm_CutSetupInfo( p, pCut, ArrTime, &pUnitNew->Inf );
+#ifdef MIG_RUNTIME
+p->timeEval += Abc_Clock() - clk;
+#endif
+ // special case when the cut store is empty
+ if ( p->nCutStore == 0 )
+ {
+ p->pCutStore[p->nCutStore++] = pUnitNew;
+ return 1;
+ }
+ // special case when the cut store is full and last cut is better than new cut
+ if ( p->nCutStore == p->nNumCuts-1 && p->pCutCmp(&pUnitNew->Inf, &p->pCutStore[p->nCutStore-1]->Inf) > 0 )
+ {
+ Mpm_UnitRecycle( p, pUnitNew );
+ return 0;
+ }
+ // find place of the given cut in the store
+ assert( p->nCutStore <= p->nNumCuts );
+ for ( iPivot = p->nCutStore - 1; iPivot >= 0; iPivot-- )
+ if ( p->pCutCmp(&pUnitNew->Inf, &p->pCutStore[iPivot]->Inf) > 0 ) // iPivot-th cut is better than new cut
+ break;
+
+ if ( fEnableContainment )
+ {
+#ifdef MIG_RUNTIME
+clk = Abc_Clock();
+#endif
+ // filter this cut using other cuts
+ for ( k = 0; k <= iPivot; k++ )
+ {
+ pUnit = p->pCutStore[k];
+ if ( pUnitNew->Inf.nLeaves >= pUnit->Inf.nLeaves &&
+ (pUnitNew->Inf.uSign & pUnit->Inf.uSign) == pUnit->Inf.uSign &&
+ Mpm_ManSetIsSmaller(p, pUnit->pLeaves, pUnit->nLeaves) )
+ {
+// printf( "\n" );
+// Mpm_CutPrint( pUnitNew->pLeaves, pUnitNew->nLeaves );
+// Mpm_CutPrint( pUnit->pLeaves, pUnit->nLeaves );
+ Mpm_UnitRecycle( p, pUnitNew );
+#ifdef MIG_RUNTIME
+p->timeCompare += Abc_Clock() - clk;
+#endif
+ return 0;
+ }
+ }
+ }
+
+ // special case when the best cut is useless while the new cut is not
+ if ( p->pCutStore[0]->fUseless && !pUnitNew->fUseless )
+ iPivot = -1;
+ // insert this cut at location iPivot
+ iPivot++;
+ for ( k = p->nCutStore++; k > iPivot; k-- )
+ p->pCutStore[k] = p->pCutStore[k-1];
+ p->pCutStore[iPivot] = pUnitNew;
+
+ if ( fEnableContainment )
+ {
+ // filter other cuts using this cut
+ for ( k = last = iPivot+1; k < p->nCutStore; k++ )
+ {
+ pUnit = p->pCutStore[k];
+ if ( pUnitNew->Inf.nLeaves <= pUnit->Inf.nLeaves &&
+ (pUnitNew->Inf.uSign & pUnit->Inf.uSign) == pUnitNew->Inf.uSign &&
+ Mpm_ManSetIsBigger(p, pUnit->pLeaves, pUnit->nLeaves) )
+ {
+// printf( "\n" );
+// Mpm_CutPrint( pUnitNew->pLeaves, pUnitNew->nLeaves );
+// Mpm_CutPrint( pUnit->pLeaves, pUnit->nLeaves );
+ Mpm_UnitRecycle( p, pUnit );
+ continue;
+ }
+ p->pCutStore[last++] = p->pCutStore[k];
+ }
+ p->nCutStore = last;
+#ifdef MIG_RUNTIME
+p->timeCompare += Abc_Clock() - clk;
+#endif
+ }
+
+ // remove the last cut if too many
+ if ( p->nCutStore == p->nNumCuts )
+ Mpm_UnitRecycle( p, p->pCutStore[--p->nCutStore] );
+ assert( p->nCutStore < p->nNumCuts );
+ return 1;
+}
+// create storage from cuts at the node
+void Mpm_ObjAddChoiceCutsToStore( Mpm_Man_t * p, Mig_Obj_t * pObj, int ReqTime )
+{
+ Mpm_Cut_t * pCut;
+ int hCut, hNext, ArrTime;
+ assert( p->nCutStore == 0 );
+ assert( Vec_IntSize(&p->vFreeUnits) == p->nNumCuts + 1 );
+ Mpm_ObjForEachCutSafe( p, pObj, hCut, pCut, hNext )
+ {
+ ArrTime = Mpm_CutGetArrTime( p, pCut );
+ if ( ArrTime > ReqTime )
+ continue;
+ Mpm_ObjAddCutToStore( p, pCut, ArrTime );
+ Mmr_StepRecycle( p->pManCuts, hCut );
+ }
+}
+
+// create cuts at the node from storage
+void Mpm_ObjTranslateCutsFromStore( Mpm_Man_t * p, Mig_Obj_t * pObj, int fAddUnit )
+{
+ Mpm_Cut_t * pCut;
+ Mpm_Uni_t * pUnit;
+ int i, *pList = Mpm_ObjCutListP( p, pObj );
+ assert( p->nCutStore > 0 && p->nCutStore <= p->nNumCuts );
+ assert( *pList == 0 );
+ // translate cuts
+ for ( i = 0; i < p->nCutStore; i++ )
+ {
+ pUnit = p->pCutStore[i];
+ *pList = Mpm_CutCreate( p, pUnit->pLeaves, pUnit->nLeaves, pUnit->fUseless, &pCut );
+ pList = &pCut->hNext;
+ Mpm_UnitRecycle( p, pUnit );
+ }
+ *pList = fAddUnit ? Mpm_CutCreateUnit( p, Mig_ObjId(pObj) ) : 0;
+ assert( Vec_IntSize(&p->vFreeUnits) == p->nNumCuts + 1 );
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+static inline void Mpm_ObjUpdateCut( Mpm_Cut_t * pCut, int * pPerm, int nLeaves )
+{
+ int i;
+ assert( nLeaves <= (int)pCut->nLeaves );
+ for ( i = 0; i < nLeaves; i++ )
+ pPerm[i] = Abc_LitNotCond( pCut->pLeaves[Abc_Lit2Var(pPerm[i])], Abc_LitIsCompl(pPerm[i]) );
+ memcpy( pCut->pLeaves, pPerm, sizeof(int) * nLeaves );
+ pCut->nLeaves = nLeaves;
+}
+static inline void Mpm_ObjRecycleCuts( Mpm_Man_t * p, Mig_Obj_t * pObj )
+{
+ Mpm_Cut_t * pCut;
+ int hCut, hNext;
+ Mpm_ObjForEachCutSafe( p, pObj, hCut, pCut, hNext )
+ Mmr_StepRecycle( p->pManCuts, hCut );
+ Mpm_ObjSetCutList( p, pObj, 0 );
+}
+static inline void Mpm_ObjDerefFaninCuts( Mpm_Man_t * p, Mig_Obj_t * pObj )
+{
+ Mig_Obj_t * pFanin;
+ int i;
+ Mig_ObjForEachFanin( pObj, pFanin, i )
+ if ( Mig_ObjIsNode(pFanin) && Mig_ObjMigRefDec(p, pFanin) == 0 )
+ Mpm_ObjRecycleCuts( p, pFanin );
+ if ( Mig_ObjSiblId(pObj) )
+ Mpm_ObjRecycleCuts( p, Mig_ObjSibl(pObj) );
+ if ( Mig_ObjMigRefNum(p, pObj) == 0 )
+ Mpm_ObjRecycleCuts( p, pObj );
+}
+static inline void Mpm_ObjCollectFaninsAndSigns( Mpm_Man_t * p, Mig_Obj_t * pObj, int i )
+{
+ Mpm_Cut_t * pCut;
+ int hCut, nCuts = 0;
+ Mpm_ObjForEachCut( p, pObj, hCut, pCut )
+ {
+ p->pCuts[i][nCuts] = pCut;
+ p->pSigns[i][nCuts++] = Mpm_CutGetSign( pCut );
+ }
+ p->nCuts[i] = nCuts;
+}
+static inline void Mpm_ObjPrepareFanins( Mpm_Man_t * p, Mig_Obj_t * pObj )
+{
+ Mig_Obj_t * pFanin;
+ int i;
+ Mig_ObjForEachFanin( pObj, pFanin, i )
+ Mpm_ObjCollectFaninsAndSigns( p, pFanin, i );
+}
+
+/**Function*************************************************************
+
+ Synopsis [Cut enumeration.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+static inline int Mpm_ManDeriveCutNew( Mpm_Man_t * p, Mpm_Cut_t ** pCuts, int Required )
+{
+// int fUseFunc = 0;
+ Mpm_Cut_t * pCut = p->pCutTemp;
+ int ArrTime;
+#ifdef MIG_RUNTIME
+abctime clk = clock();
+#endif
+
+ Mig_ManObjPresClean( p );
+ if ( !Mpm_ObjDeriveCut( p, pCuts, pCut ) )
+ {
+#ifdef MIG_RUNTIME
+p->timeMerge += clock() - clk;
+#endif
+ return 1;
+ }
+#ifdef MIG_RUNTIME
+p->timeMerge += clock() - clk;
+clk = clock();
+#endif
+ ArrTime = Mpm_CutGetArrTime( p, pCut );
+#ifdef MIG_RUNTIME
+p->timeEval += clock() - clk;
+#endif
+
+ if ( p->fMainRun && ArrTime > Required )
+ return 1;
+#ifdef MIG_RUNTIME
+clk = Abc_Clock();
+#endif
+ Mpm_ObjAddCutToStore( p, pCut, ArrTime );
+#ifdef MIG_RUNTIME
+p->timeStore += Abc_Clock() - clk;
+#endif
+ return 1;
+ // return 0 if const or buffer cut is derived - reset all cuts to contain only one
+}
+int Mpm_ManDeriveCuts( Mpm_Man_t * p, Mig_Obj_t * pObj )
+{
+// static int Flag = 0;
+ Mpm_Cut_t * pCuts[3];
+ int Required = Mpm_ObjRequired( p, pObj );
+ int hCutBest = Mpm_ObjCutBest( p, pObj );
+ int c0, c1, c2;
+#ifdef MIG_RUNTIME
+ abctime clk;
+#endif
+ Mpm_ManPrepareCutStore( p );
+ assert( Mpm_ObjCutList(p, pObj) == 0 );
+ if ( hCutBest > 0 ) // cut list is assigned
+ {
+ Mpm_Cut_t * pCut = Mpm_ObjCutBestP( p, pObj );
+ int Times = Mpm_CutGetArrTime( p, pCut );
+ assert( pCut->hNext == 0 );
+ if ( Times > Required )
+ printf( "Arrival time (%d) exceeds required time (%d) at object %d.\n", Times, Required, Mig_ObjId(pObj) );
+ if ( p->fMainRun )
+ Mpm_ObjAddCutToStore( p, pCut, Times );
+ else
+ Mpm_ObjSetTime( p, pObj, Times );
+ }
+ // start storage with choice cuts
+ if ( p->pMig->vSibls.nSize && Mig_ObjSiblId(pObj) )
+ Mpm_ObjAddChoiceCutsToStore( p, Mig_ObjSibl(pObj), Required );
+ // compute signatures for fanin cuts
+#ifdef MIG_RUNTIME
+clk = Abc_Clock();
+#endif
+ Mpm_ObjPrepareFanins( p, pObj );
+#ifdef MIG_RUNTIME
+p->timeFanin += Abc_Clock() - clk;
+#endif
+ // compute cuts in the internal storage
+#ifdef MIG_RUNTIME
+clk = Abc_Clock();
+#endif
+ if ( Mig_ObjIsNode2(pObj) )
+ {
+ // go through cut pairs
+ pCuts[2] = NULL;
+ for ( c0 = 0; c0 < p->nCuts[0] && (pCuts[0] = p->pCuts[0][c0]); c0++ )
+ for ( c1 = 0; c1 < p->nCuts[1] && (pCuts[1] = p->pCuts[1][c1]); c1++ )
+ if ( Abc_TtCountOnes(p->pSigns[0][c0] | p->pSigns[1][c1]) <= p->nLutSize )
+ if ( !Mpm_ManDeriveCutNew( p, pCuts, Required ) )
+ goto finish;
+ }
+ else if ( Mig_ObjIsNode3(pObj) )
+ {
+ // go through cut triples
+ for ( c0 = 0; c0 < p->nCuts[0] && (pCuts[0] = p->pCuts[0][c0]); c0++ )
+ for ( c1 = 0; c1 < p->nCuts[1] && (pCuts[1] = p->pCuts[1][c1]); c1++ )
+ for ( c2 = 0; c2 < p->nCuts[2] && (pCuts[2] = p->pCuts[2][c2]); c2++ )
+ if ( Abc_TtCountOnes(p->pSigns[0][c0] | p->pSigns[1][c1] | p->pSigns[2][c2]) <= p->nLutSize )
+ if ( !Mpm_ManDeriveCutNew( p, pCuts, Required ) )
+ goto finish;
+ }
+ else assert( 0 );
+#ifdef MIG_RUNTIME
+p->timeDerive += Abc_Clock() - clk;
+#endif
+finish:
+ // transform internal storage into regular cuts
+// if ( Flag == 0 && p->nCutStore == p->nNumCuts - 1 )
+// Flag = 1, Mpm_CutPrintAll( p );
+// printf( "%d ", p->nCutStore );
+ // save best cut
+ assert( p->nCutStore > 0 );
+ if ( p->pCutStore[0]->Inf.mTime <= Required )
+ {
+ Mpm_Cut_t * pCut;
+ if ( hCutBest )
+ Mmr_StepRecycle( p->pManCuts, hCutBest );
+ hCutBest = Mpm_CutCreate( p, p->pCutStore[0]->pLeaves, p->pCutStore[0]->nLeaves, p->pCutStore[0]->fUseless, &pCut );
+ Mpm_ObjSetCutBest( p, pObj, hCutBest );
+ Mpm_ObjSetTime( p, pObj, p->pCutStore[0]->Inf.mTime );
+ Mpm_ObjSetArea( p, pObj, p->pCutStore[0]->Inf.mArea );
+ Mpm_ObjSetEdge( p, pObj, p->pCutStore[0]->Inf.mEdge );
+ }
+ else assert( !p->fMainRun );
+ assert( hCutBest > 0 );
+ // transform internal storage into regular cuts
+ Mpm_ObjTranslateCutsFromStore( p, pObj, Mig_ObjRefNum(pObj) > 0 );
+ // dereference fanin cuts and reference node
+ Mpm_ObjDerefFaninCuts( p, pObj );
+ return 1;
+}
+
+
+/**Function*************************************************************
+
+ Synopsis [Required times.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+static inline int Mpm_ManFindArrivalMax( Mpm_Man_t * p )
+{
+ int * pmTimes = Vec_IntArray( &p->vTimes );
+ Mig_Obj_t * pObj;
+ int i, ArrMax = 0;
+ Mig_ManForEachCo( p->pMig, pObj, i )
+ ArrMax = Abc_MaxInt( ArrMax, pmTimes[ Mig_ObjFaninId0(pObj) ] );
+ return ArrMax;
+}
+static inline void Mpm_ManFinalizeRound( Mpm_Man_t * p )
+{
+ int * pMapRefs = Vec_IntArray( &p->vMapRefs );
+ int * pRequired = Vec_IntArray( &p->vRequireds );
+ Mig_Obj_t * pObj;
+ Mpm_Cut_t * pCut;
+ int * pDelays;
+ int i, iLeaf;
+ p->GloArea = 0;
+ p->GloEdge = 0;
+ p->GloRequired = Mpm_ManFindArrivalMax(p);
+ Mpm_ManCleanMapRefs( p );
+ Mpm_ManCleanRequired( p );
+ Mig_ManForEachObjReverse( p->pMig, pObj )
+ {
+ if ( Mig_ObjIsCo(pObj) )
+ {
+ pRequired[Mig_ObjFaninId0(pObj)] = p->GloRequired;
+ pMapRefs [Mig_ObjFaninId0(pObj)]++;
+ }
+ else if ( Mig_ObjIsNode(pObj) )
+ {
+ int Required = pRequired[Mig_ObjId(pObj)];
+ assert( Required > 0 );
+ if ( pMapRefs[Mig_ObjId(pObj)] > 0 )
+ {
+ pCut = Mpm_ObjCutBestP( p, pObj );
+ pDelays = p->pLibLut->pLutDelays[pCut->nLeaves];
+ Mpm_CutForEachLeafId( pCut, iLeaf, i )
+ {
+ pRequired[iLeaf] = Abc_MinInt( pRequired[iLeaf], Required - pDelays[i] );
+ pMapRefs [iLeaf]++;
+ }
+ p->GloArea += p->pLibLut->pLutAreas[pCut->nLeaves];
+ p->GloEdge += pCut->nLeaves;
+ }
+ }
+ else if ( Mig_ObjIsBuf(pObj) )
+ {
+ }
+ }
+ p->GloArea /= MPM_UNIT_AREA;
+}
+static inline void Mpm_ManComputeEstRefs( Mpm_Man_t * p )
+{
+ int * pMapRefs = Vec_IntArray( &p->vMapRefs );
+ int * pEstRefs = Vec_IntArray( &p->vEstRefs );
+ int i;
+ assert( p->fMainRun );
+// pObj->EstRefs = (float)((2.0 * pObj->EstRefs + pObj->nRefs) / 3.0);
+ for ( i = 0; i < Mig_ManObjNum(p->pMig); i++ )
+ pEstRefs[i] = (1 * pEstRefs[i] + MPM_UNIT_REFS * pMapRefs[i]) / 2;
+}
+
+/**Function*************************************************************
+
+ Synopsis [Cut comparison.]
+
+ Description [Returns positive number if new one is better than old one.]
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+int Mpm_CutCompareDelay( Mpm_Inf_t * pOld, Mpm_Inf_t * pNew )
+{
+ if ( pOld->mTime != pNew->mTime ) return pOld->mTime - pNew->mTime;
+ if ( pOld->nLeaves != pNew->nLeaves ) return pOld->nLeaves - pNew->nLeaves;
+ if ( pOld->mArea != pNew->mArea ) return pOld->mArea - pNew->mArea;
+ if ( pOld->mEdge != pNew->mEdge ) return pOld->mEdge - pNew->mEdge;
+ return 0;
+}
+int Mpm_CutCompareDelay2( Mpm_Inf_t * pOld, Mpm_Inf_t * pNew )
+{
+ if ( pOld->mTime != pNew->mTime ) return pOld->mTime - pNew->mTime;
+ if ( pOld->mArea != pNew->mArea ) return pOld->mArea - pNew->mArea;
+ if ( pOld->mEdge != pNew->mEdge ) return pOld->mEdge - pNew->mEdge;
+ if ( pOld->nLeaves != pNew->nLeaves ) return pOld->nLeaves - pNew->nLeaves;
+ return 0;
+}
+int Mpm_CutCompareArea( Mpm_Inf_t * pOld, Mpm_Inf_t * pNew )
+{
+ if ( pOld->mArea != pNew->mArea ) return pOld->mArea - pNew->mArea;
+ if ( pOld->nLeaves != pNew->nLeaves ) return pOld->nLeaves - pNew->nLeaves;
+ if ( pOld->mEdge != pNew->mEdge ) return pOld->mEdge - pNew->mEdge;
+ if ( pOld->mAveRefs != pNew->mAveRefs ) return pOld->mAveRefs - pNew->mAveRefs;
+ if ( pOld->mTime != pNew->mTime ) return pOld->mTime - pNew->mTime;
+ return 0;
+}
+int Mpm_CutCompareArea2( Mpm_Inf_t * pOld, Mpm_Inf_t * pNew )
+{
+ if ( pOld->mArea != pNew->mArea ) return pOld->mArea - pNew->mArea;
+ if ( pOld->mEdge != pNew->mEdge ) return pOld->mEdge - pNew->mEdge;
+ if ( pOld->mAveRefs != pNew->mAveRefs ) return pOld->mAveRefs - pNew->mAveRefs;
+ if ( pOld->nLeaves != pNew->nLeaves ) return pOld->nLeaves - pNew->nLeaves;
+ if ( pOld->mTime != pNew->mTime ) return pOld->mTime - pNew->mTime;
+ return 0;
+}
+
+/**Function*************************************************************
+
+ Synopsis [Technology mapping experiment.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Mpm_ManPrepare( Mpm_Man_t * p )
+{
+ Mig_Obj_t * pObj;
+ int i, hCut;
+ Mig_ManForEachCi( p->pMig, pObj, i )
+ {
+ hCut = Mpm_CutCreateUnit( p, Mig_ObjId(pObj) );
+ Mpm_ObjSetCutBest( p, pObj, hCut );
+ Mpm_ObjSetCutList( p, pObj, hCut );
+ }
+ Mig_ManForEachCand( p->pMig, pObj )
+ Mpm_ObjSetEstRef( p, pObj, MPM_UNIT_REFS * Mig_ObjRefNum(pObj) );
+}
+void Mpm_ManPerformRound( Mpm_Man_t * p )
+{
+ Mig_Obj_t * pObj;
+ abctime clk = Abc_Clock();
+ p->nCutsMerged = 0;
+ Mpm_ManSetMigRefs( p );
+ Mig_ManForEachNode( p->pMig, pObj )
+ Mpm_ManDeriveCuts( p, pObj );
+ Mpm_ManFinalizeRound( p );
+ printf( "Del =%5d. Ar =%8d. Edge =%8d. Cut =%10d. Max =%10d. Rem =%6d. ",
+ p->GloRequired, p->GloArea, p->GloEdge,
+ p->nCutsMerged, p->pManCuts->nEntriesMax, p->pManCuts->nEntries );
+ Abc_PrintTime( 1, "Time", Abc_Clock() - clk );
+}
+void Mpm_ManPerform( Mpm_Man_t * p )
+{
+ p->pCutCmp = Mpm_CutCompareDelay;
+ Mpm_ManPerformRound( p );
+
+ p->pCutCmp = Mpm_CutCompareDelay2;
+ Mpm_ManPerformRound( p );
+
+ p->pCutCmp = Mpm_CutCompareArea;
+ Mpm_ManPerformRound( p );
+
+ p->fMainRun = 1;
+
+ p->pCutCmp = Mpm_CutCompareArea;
+ Mpm_ManComputeEstRefs( p );
+ Mpm_ManPerformRound( p );
+
+ p->pCutCmp = Mpm_CutCompareArea2;
+ Mpm_ManComputeEstRefs( p );
+ Mpm_ManPerformRound( p );
+}
+
+
+////////////////////////////////////////////////////////////////////////
+/// END OF FILE ///
+////////////////////////////////////////////////////////////////////////
+
+
+ABC_NAMESPACE_IMPL_END
+
diff --git a/src/map/mpm/mpmMig.c b/src/map/mpm/mpmMig.c
new file mode 100644
index 00000000..d5b35beb
--- /dev/null
+++ b/src/map/mpm/mpmMig.c
@@ -0,0 +1,177 @@
+/**CFile****************************************************************
+
+ FileName [mpmMig.c]
+
+ SystemName [ABC: Logic synthesis and verification system.]
+
+ PackageName [Configurable technology mapper.]
+
+ Synopsis [Subject graph data structure.]
+
+ Author [Alan Mishchenko]
+
+ Affiliation [UC Berkeley]
+
+ Date [Ver. 1.0. Started - June 1, 2013.]
+
+ Revision [$Id: mpmMig.c,v 1.00 2013/06/01 00:00:00 alanmi Exp $]
+
+***********************************************************************/
+
+#include "mpmInt.h"
+
+ABC_NAMESPACE_IMPL_START
+
+
+////////////////////////////////////////////////////////////////////////
+/// DECLARATIONS ///
+////////////////////////////////////////////////////////////////////////
+
+////////////////////////////////////////////////////////////////////////
+/// FUNCTION DEFINITIONS ///
+////////////////////////////////////////////////////////////////////////
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+Mig_Man_t * Mig_ManStart()
+{
+ Mig_Man_t * p;
+ assert( sizeof(Mig_Obj_t) >= 16 );
+ assert( (1 << MIG_BASE) == MIG_MASK + 1 );
+ p = ABC_CALLOC( Mig_Man_t, 1 );
+ Vec_IntGrow( &p->vCis, 1024 );
+ Vec_IntGrow( &p->vCos, 1024 );
+ Mig_ManAppendObj( p ); // const0
+ return p;
+}
+void Mig_ManStop( Mig_Man_t * p )
+{
+ if ( 0 )
+ printf( "Subject graph uses %d pages of %d objects with %d entries. Total memory = %.2f MB.\n",
+ Vec_PtrSize(&p->vPages), MIG_MASK + 1, p->nObjs,
+ 1.0 * Vec_PtrSize(&p->vPages) * (MIG_MASK + 1) * 16 / (1 << 20) );
+ // attributes
+ ABC_FREE( p->vTravIds.pArray );
+ ABC_FREE( p->vCopies.pArray );
+ ABC_FREE( p->vLevels.pArray );
+ ABC_FREE( p->vRefs.pArray );
+ ABC_FREE( p->vSibls.pArray );
+ // pages
+ Vec_PtrForEachEntry( Mig_Obj_t *, &p->vPages, p->pPage, p->iPage )
+ --p->pPage, ABC_FREE( p->pPage );
+ // objects
+ ABC_FREE( p->vPages.pArray );
+ ABC_FREE( p->vCis.pArray );
+ ABC_FREE( p->vCos.pArray );
+ ABC_FREE( p->pName );
+ ABC_FREE( p );
+}
+
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Mig_ManSetRefs( Mig_Man_t * p, int fSkipCos )
+{
+ Mig_Obj_t * pObj;
+ int i, iFanin;
+ // increment references
+ Vec_IntFill( &p->vRefs, Mig_ManObjNum(p), 0 );
+ Mig_ManForEachNode( p, pObj )
+ Mig_ObjForEachFaninId( pObj, iFanin, i )
+ Vec_IntAddToEntry( &p->vRefs, iFanin, 1 );
+ if ( !fSkipCos )
+ {
+ // and CO references
+ Mig_ManForEachCo( p, pObj, i )
+ Vec_IntAddToEntry( &p->vRefs, Mig_ObjFaninId(pObj, 0), 1 );
+ // check that internal nodes have fanins
+ Mig_ManForEachNode( p, pObj )
+ assert( Vec_IntEntry(&p->vRefs, Mig_ObjId(pObj)) > 0 );
+ }
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+int Mig_ManSuppSize_rec( Mig_Obj_t * pObj )
+{
+ if ( pObj == NULL )
+ return 0;
+ if ( Mig_ObjIsTravIdCurrent(pObj) )
+ return 0;
+ Mig_ObjSetTravIdCurrent(pObj);
+ if ( Mig_ObjIsCi(pObj) )
+ return 1;
+ assert( Mig_ObjIsNode(pObj) );
+ return Mig_ManSuppSize_rec( Mig_ObjFanin0(pObj) ) +
+ Mig_ManSuppSize_rec( Mig_ObjFanin1(pObj) ) +
+ Mig_ManSuppSize_rec( Mig_ObjFanin2(pObj) );
+}
+int Mig_ManSuppSize2_rec( Mig_Man_t * p, int iObj )
+{
+ Mig_Obj_t * pObj;
+ if ( iObj == MIG_NONE )
+ return 0;
+ if ( Mig_ObjIsTravIdCurrentId(p, iObj) )
+ return 0;
+ Mig_ObjSetTravIdCurrentId(p, iObj);
+ pObj = Mig_ManObj( p, iObj );
+ if ( Mig_ObjIsCi(pObj) )
+ return 1;
+ assert( Mig_ObjIsNode(pObj) );
+ return Mig_ManSuppSize2_rec( p, Mig_ObjFaninId0(pObj) ) +
+ Mig_ManSuppSize2_rec( p, Mig_ObjFaninId1(pObj) ) +
+ Mig_ManSuppSize2_rec( p, Mig_ObjFaninId2(pObj) );
+}
+int Mig_ManSuppSizeOne( Mig_Obj_t * pObj )
+{
+ Mig_ObjIncrementTravId( pObj );
+// return Mig_ManSuppSize_rec( pObj );
+ return Mig_ManSuppSize2_rec( Mig_ObjMan(pObj), Mig_ObjId(pObj) );
+}
+int Mig_ManSuppSizeTest( Mig_Man_t * p )
+{
+ Mig_Obj_t * pObj;
+ int Counter = 0;
+ abctime clk = Abc_Clock();
+ Mig_ManForEachObj( p, pObj )
+ if ( Mig_ObjIsNode(pObj) )
+ Counter += (Mig_ManSuppSizeOne(pObj) <= 16);
+ printf( "Nodes with small support %d (out of %d)\n", Counter, Mig_ManNodeNum(p) );
+ Abc_PrintTime( 1, "Time", Abc_Clock() - clk );
+ return Counter;
+}
+
+////////////////////////////////////////////////////////////////////////
+/// END OF FILE ///
+////////////////////////////////////////////////////////////////////////
+
+
+ABC_NAMESPACE_IMPL_END
+
diff --git a/src/map/mpm/mpmMig.h b/src/map/mpm/mpmMig.h
new file mode 100644
index 00000000..71b0f3ac
--- /dev/null
+++ b/src/map/mpm/mpmMig.h
@@ -0,0 +1,353 @@
+/**CFile****************************************************************
+
+ FileName [mpmMig.h]
+
+ SystemName [ABC: Logic synthesis and verification system.]
+
+ PackageName [Configurable technology mapper.]
+
+ Synopsis [Internal declarations.]
+
+ Author [Alan Mishchenko]
+
+ Affiliation [UC Berkeley]
+
+ Date [Ver. 1.0. Started - June 1, 2013.]
+
+ Revision [$Id: mpmMig.h,v 1.00 2013/06/01 00:00:00 alanmi Exp $]
+
+***********************************************************************/
+
+#ifndef ABC__map__mpm__mig__h
+#define ABC__map__mpm__mig__h
+
+
+////////////////////////////////////////////////////////////////////////
+/// INCLUDES ///
+////////////////////////////////////////////////////////////////////////
+
+#include "misc/vec/vec.h"
+
+ABC_NAMESPACE_HEADER_START
+
+////////////////////////////////////////////////////////////////////////
+/// PARAMETERS ///
+////////////////////////////////////////////////////////////////////////
+
+//#define MIG_RUNTIME
+#define MIG_NONE 0x7FFFFFFF
+//#define MIG_MASK 0x0000FFFF
+//#define MIG_BASE 16
+#define MIG_MASK 0x0000FFF
+#define MIG_BASE 12
+
+////////////////////////////////////////////////////////////////////////
+/// BASIC TYPES ///
+////////////////////////////////////////////////////////////////////////
+
+typedef struct Mig_Fan_t_ Mig_Fan_t;
+struct Mig_Fan_t_
+{
+ unsigned fCompl : 1; // the complemented attribute
+ unsigned Id : 31; // fanin ID
+};
+
+typedef struct Mig_Obj_t_ Mig_Obj_t;
+struct Mig_Obj_t_
+{
+ Mig_Fan_t pFans[4]; // fanins
+};
+
+typedef struct Mig_Man_t_ Mig_Man_t;
+struct Mig_Man_t_
+{
+ char * pName; // name
+ int nObjs; // number of objects
+ int nRegs; // number of flops
+ Vec_Ptr_t vPages; // memory pages
+ Vec_Int_t vCis; // CI IDs
+ Vec_Int_t vCos; // CO IDs
+ // object iterator
+ Mig_Obj_t * pPage; // current page
+ int iPage; // current page index
+ // attributes
+ int nTravIds; // traversal ID counter
+ Vec_Int_t vTravIds; // traversal IDs
+ Vec_Int_t vLevels; // levels
+ Vec_Int_t vSibls; // choice nodes
+ Vec_Int_t vRefs; // ref counters
+ Vec_Int_t vCopies; // copies
+ void * pMan; // mapping manager
+};
+
+/*
+ Usage of fanin atrributes
+ --------------------------------------------------------------------------------------------------------------
+ Const0 Terminal CI CO Buf Node Node2 Node3 And2 XOR2 MUX MAJ Sentinel
+ --------------------------------------------------------------------------------------------------------------
+ 0 - -/fanin0 - fanin0 fanin0 fanin0 fanin0 fanin0 fanin0 fanin1 fanin0 fanin1 -
+ 1 - - - - - fanin1 fanin1 fanin1 fanin1 fanin0 fanin1 fanin0 -
+ 2 - CIO ID CIO ID CIO ID - -/fanin2 - fanin2 - - fanin2 fanin2 -
+ 3 0 ID ID ID ID ID ID ID ID ID ID ID -
+ --------------------------------------------------------------------------------------------------------------
+
+ One memory page contain 2^MIG_BASE+2 16-byte objects.
+ - the first object contains the pointer to the manager (8 bytes)
+ - the next 2^MIG_BASE are potentially used as objects
+ - the last object is a sentinel to signal the end of the page
+*/
+
+static inline int Mig_IdPage( int v ) { return v >> MIG_BASE; }
+static inline int Mig_IdCell( int v ) { return v & MIG_MASK; }
+
+static inline char * Mig_ManName( Mig_Man_t * p ) { return p->pName; }
+static inline int Mig_ManCiNum( Mig_Man_t * p ) { return Vec_IntSize(&p->vCis); }
+static inline int Mig_ManCoNum( Mig_Man_t * p ) { return Vec_IntSize(&p->vCos); }
+static inline int Mig_ManPiNum( Mig_Man_t * p ) { return Vec_IntSize(&p->vCis) - p->nRegs; }
+static inline int Mig_ManPoNum( Mig_Man_t * p ) { return Vec_IntSize(&p->vCos) - p->nRegs; }
+static inline int Mig_ManRegNum( Mig_Man_t * p ) { return p->nRegs; }
+static inline int Mig_ManObjNum( Mig_Man_t * p ) { return p->nObjs; }
+static inline int Mig_ManNodeNum( Mig_Man_t * p ) { return p->nObjs - Vec_IntSize(&p->vCis) - Vec_IntSize(&p->vCos) - 1; }
+static inline int Mig_ManCandNum( Mig_Man_t * p ) { return Mig_ManCiNum(p) + Mig_ManNodeNum(p); }
+static inline void Mig_ManSetRegNum( Mig_Man_t * p, int v ) { p->nRegs = v; }
+
+static inline Mig_Obj_t * Mig_ManPage( Mig_Man_t * p, int v ) { return (Mig_Obj_t *)Vec_PtrEntry(&p->vPages, Mig_IdPage(v)); }
+static inline Mig_Obj_t * Mig_ManObj( Mig_Man_t * p, int v ) { assert(v >= 0 && v < p->nObjs); return Mig_ManPage(p, v) + Mig_IdCell(v); }
+static inline Mig_Obj_t * Mig_ManCi( Mig_Man_t * p, int v ) { return Mig_ManObj( p, Vec_IntEntry(&p->vCis,v) ); }
+static inline Mig_Obj_t * Mig_ManCo( Mig_Man_t * p, int v ) { return Mig_ManObj( p, Vec_IntEntry(&p->vCos,v) ); }
+static inline Mig_Obj_t * Mig_ManPi( Mig_Man_t * p, int v ) { assert( v < Mig_ManPiNum(p) ); return Mig_ManCi( p, v ); }
+static inline Mig_Obj_t * Mig_ManPo( Mig_Man_t * p, int v ) { assert( v < Mig_ManPoNum(p) ); return Mig_ManCo( p, v ); }
+static inline Mig_Obj_t * Mig_ManRo( Mig_Man_t * p, int v ) { assert( v < Mig_ManRegNum(p) ); return Mig_ManCi( p, Mig_ManPiNum(p)+v ); }
+static inline Mig_Obj_t * Mig_ManRi( Mig_Man_t * p, int v ) { assert( v < Mig_ManRegNum(p) ); return Mig_ManCo( p, Mig_ManPoNum(p)+v ); }
+static inline Mig_Obj_t * Mig_ManConst0( Mig_Man_t * p ) { return Mig_ManObj(p, 0); }
+
+static inline int Mig_FanCompl( Mig_Obj_t * p, int i ) { return p->pFans[i].fCompl; }
+static inline int Mig_FanId( Mig_Obj_t * p, int i ) { return p->pFans[i].Id; }
+static inline int Mig_FanIsNone( Mig_Obj_t * p, int i ) { return p->pFans[i].Id == MIG_NONE; }
+static inline int Mig_FanSetCompl( Mig_Obj_t * p, int i, int v ) { assert( !(v >> 1) ); return p->pFans[i].fCompl = v; }
+static inline int Mig_FanSetId( Mig_Obj_t * p, int i, int v ) { assert(v >= 0 && v < MIG_NONE); return p->pFans[i].Id = v; }
+
+static inline int Mig_ObjIsNone( Mig_Obj_t * p ) { return Mig_FanIsNone( p, 3 ); }
+static inline int Mig_ObjIsConst0( Mig_Obj_t * p ) { return Mig_FanId( p, 3 ) == 0; }
+static inline int Mig_ObjIsTerm( Mig_Obj_t * p ) { return Mig_FanIsNone( p, 1 ) && !Mig_FanIsNone( p, 2 ); }
+static inline int Mig_ObjIsCi( Mig_Obj_t * p ) { return Mig_ObjIsTerm(p) && Mig_FanIsNone( p, 0 ); }
+static inline int Mig_ObjIsCo( Mig_Obj_t * p ) { return Mig_ObjIsTerm(p) && !Mig_FanIsNone( p, 0 ); }
+static inline int Mig_ObjIsBuf( Mig_Obj_t * p ) { return Mig_FanIsNone( p, 1 ) && Mig_FanIsNone( p, 2 ) && !Mig_FanIsNone( p, 0 ); }
+static inline int Mig_ObjIsNode( Mig_Obj_t * p ) { return!Mig_FanIsNone( p, 1 ); }
+static inline int Mig_ObjIsNode2( Mig_Obj_t * p ) { return Mig_ObjIsNode( p ) && Mig_FanIsNone( p, 2 ); }
+static inline int Mig_ObjIsNode3( Mig_Obj_t * p ) { return Mig_ObjIsNode( p ) && !Mig_FanIsNone( p, 2 ); }
+static inline int Mig_ObjIsAnd( Mig_Obj_t * p ) { return Mig_ObjIsNode2( p ) && Mig_FanId(p, 0) < Mig_FanId(p, 1); }
+static inline int Mig_ObjIsXor( Mig_Obj_t * p ) { return Mig_ObjIsNode2( p ) && Mig_FanId(p, 0) > Mig_FanId(p, 1); }
+static inline int Mig_ObjIsMux( Mig_Obj_t * p ) { return Mig_ObjIsNode3( p ); }
+static inline int Mig_ObjIsCand( Mig_Obj_t * p ) { return Mig_ObjIsNode(p) || Mig_ObjIsCi(p); }
+
+static inline int Mig_ObjId( Mig_Obj_t * p ) { return Mig_FanId( p, 3 ); }
+static inline void Mig_ObjSetId( Mig_Obj_t * p, int v ) { Mig_FanSetId( p, 3, v ); }
+static inline int Mig_ObjCioId( Mig_Obj_t * p ) { assert( Mig_ObjIsTerm(p) ); return Mig_FanId( p, 2 ); }
+static inline void Mig_ObjSetCioId( Mig_Obj_t * p, int v ) { assert( Mig_FanIsNone(p, 1) ); Mig_FanSetId( p, 2, v ); }
+static inline int Mig_ObjPhase( Mig_Obj_t * p ) { return Mig_FanCompl( p, 3 ); }
+static inline void Mig_ObjSetPhase( Mig_Obj_t * p, int v ) { Mig_FanSetCompl( p, 3, 1 ); }
+
+static inline Mig_Man_t * Mig_ObjMan( Mig_Obj_t * p ) { return *((Mig_Man_t**)(p - Mig_IdCell(Mig_ObjId(p)) - 1)); }
+//static inline Mig_Obj_t ** Mig_ObjPageP( Mig_Obj_t * p ) { return *((Mig_Obj_t***)(p - Mig_IdCell(Mig_ObjId(p))) - 1);}
+static inline Mig_Obj_t * Mig_ObjObj( Mig_Obj_t * p, int i ) { return Mig_ManObj( Mig_ObjMan(p), i ); }
+
+static inline int Mig_ManIdToCioId( Mig_Man_t * p, int Id ) { return Mig_ObjCioId( Mig_ManObj(p, Id) ); }
+static inline int Mig_ManCiIdToId( Mig_Man_t * p, int CiId ) { return Mig_ObjId( Mig_ManCi(p, CiId) ); }
+static inline int Mig_ManCoIdToId( Mig_Man_t * p, int CoId ) { return Mig_ObjId( Mig_ManCo(p, CoId) ); }
+
+static inline int Mig_ObjIsPi( Mig_Obj_t * p ) { return Mig_ObjIsCi(p) && Mig_ObjCioId(p) < Mig_ManPiNum(Mig_ObjMan(p)); }
+static inline int Mig_ObjIsPo( Mig_Obj_t * p ) { return Mig_ObjIsCo(p) && Mig_ObjCioId(p) < Mig_ManPoNum(Mig_ObjMan(p)); }
+static inline int Mig_ObjIsRo( Mig_Obj_t * p ) { return Mig_ObjIsCi(p) && Mig_ObjCioId(p) >= Mig_ManPiNum(Mig_ObjMan(p)); }
+static inline int Mig_ObjIsRi( Mig_Obj_t * p ) { return Mig_ObjIsCo(p) && Mig_ObjCioId(p) >= Mig_ManPoNum(Mig_ObjMan(p)); }
+
+static inline Mig_Obj_t * Mig_ObjRoToRi( Mig_Obj_t * p ) { Mig_Man_t * pMan = Mig_ObjMan(p); assert( Mig_ObjIsRo(p) ); return Mig_ManCo(pMan, Mig_ManCoNum(pMan) - Mig_ManCiNum(pMan) + Mig_ObjCioId(p)); }
+static inline Mig_Obj_t * Mig_ObjRiToRo( Mig_Obj_t * p ) { Mig_Man_t * pMan = Mig_ObjMan(p); assert( Mig_ObjIsRi(p) ); return Mig_ManCi(pMan, Mig_ManCiNum(pMan) - Mig_ManCoNum(pMan) + Mig_ObjCioId(p)); }
+
+static inline int Mig_ObjHasFanin( Mig_Obj_t * p, int i ) { return i < 3 && Mig_FanId(p, i) != MIG_NONE; }
+static inline int Mig_ObjFaninId( Mig_Obj_t * p, int i ) { assert( i < 3 && Mig_FanId(p, i) < Mig_ObjId(p) ); return Mig_FanId( p, i ); }
+static inline int Mig_ObjFaninId0( Mig_Obj_t * p ) { return Mig_FanId( p, 0 ); }
+static inline int Mig_ObjFaninId1( Mig_Obj_t * p ) { return Mig_FanId( p, 1 ); }
+static inline int Mig_ObjFaninId2( Mig_Obj_t * p ) { return Mig_FanId( p, 2 ); }
+static inline Mig_Obj_t * Mig_ObjFanin( Mig_Obj_t * p, int i ) { return Mig_ManObj( Mig_ObjMan(p), Mig_ObjFaninId(p, i) ); }
+//static inline Mig_Obj_t * Mig_ObjFanin( Mig_Obj_t * p, int i ) { return Mig_ObjPageP(p)[Mig_IdPage(Mig_ObjFaninId(p, i))] + Mig_IdCell(Mig_ObjFaninId(p, i)); }
+static inline Mig_Obj_t * Mig_ObjFanin0( Mig_Obj_t * p ) { return Mig_FanIsNone(p, 0) ? NULL: Mig_ObjFanin(p, 0); }
+static inline Mig_Obj_t * Mig_ObjFanin1( Mig_Obj_t * p ) { return Mig_FanIsNone(p, 1) ? NULL: Mig_ObjFanin(p, 1); }
+static inline Mig_Obj_t * Mig_ObjFanin2( Mig_Obj_t * p ) { return Mig_FanIsNone(p, 2) ? NULL: Mig_ObjFanin(p, 2); }
+static inline int Mig_ObjFaninC( Mig_Obj_t * p, int i ) { assert( i < 3 ); return Mig_FanCompl(p, i); }
+static inline int Mig_ObjFaninC0( Mig_Obj_t * p ) { return Mig_FanCompl(p, 0); }
+static inline int Mig_ObjFaninC1( Mig_Obj_t * p ) { return Mig_FanCompl(p, 1); }
+static inline int Mig_ObjFaninC2( Mig_Obj_t * p ) { return Mig_FanCompl(p, 2); }
+static inline int Mig_ObjFaninLit( Mig_Obj_t * p, int i ) { return Abc_Var2Lit( Mig_FanId(p, i), Mig_FanCompl(p, i) ); }
+static inline void Mig_ObjFlipFaninC( Mig_Obj_t * p, int i ) { Mig_FanSetCompl( p, i, !Mig_FanCompl(p, i) ); }
+static inline int Mig_ObjWhatFanin( Mig_Obj_t * p, int i ) { if (Mig_FanId(p, 0) == i) return 0; if (Mig_FanId(p, 1) == i) return 1; if (Mig_FanId(p, 2) == i) return 2; return -1; }
+static inline void Mig_ObjSetFaninLit( Mig_Obj_t * p, int i, int l ) { assert( l >= 0 && (l >> 1) < Mig_ObjId(p) ); Mig_FanSetId(p, i, Abc_Lit2Var(l)); Mig_FanSetCompl(p, i, Abc_LitIsCompl(l)); }
+
+static inline int Mig_ObjSiblId( Mig_Obj_t * p ) { return Vec_IntSize(&Mig_ObjMan(p)->vSibls) == 0 ? 0: Vec_IntEntry(&Mig_ObjMan(p)->vSibls, Mig_ObjId(p)); }
+static inline Mig_Obj_t * Mig_ObjSibl( Mig_Obj_t * p ) { return Mig_ObjSiblId(p) == 0 ? NULL: Mig_ObjObj(p, Mig_ObjSiblId(p)); }
+static inline int Mig_ObjRefNum( Mig_Obj_t * p ) { return Vec_IntEntry(&Mig_ObjMan(p)->vRefs, Mig_ObjId(p)); }
+
+static inline void Mig_ManCleanCopy( Mig_Man_t * p ) { if ( p->vCopies.pArray == NULL ) Vec_IntFill( &p->vCopies, Mig_ManObjNum(p), -1 ); }
+static inline int Mig_ObjCopy( Mig_Obj_t * p ) { return Vec_IntSize(&Mig_ObjMan(p)->vCopies) == 0 ? -1: Vec_IntEntry(&Mig_ObjMan(p)->vCopies, Mig_ObjId(p)); }
+static inline void Mig_ObjSetCopy( Mig_Obj_t * p, int i ) { assert( Vec_IntSize(&Mig_ObjMan(p)->vCopies) != 0 ); Vec_IntWriteEntry(&Mig_ObjMan(p)->vCopies, Mig_ObjId(p), i); }
+
+static inline void Mig_ManIncrementTravId( Mig_Man_t * p ) { if ( p->vTravIds.pArray == NULL ) Vec_IntFill( &p->vTravIds, Mig_ManObjNum(p)+500, 0 ); p->nTravIds++; }
+static inline void Mig_ObjIncrementTravId( Mig_Obj_t * p ) { if ( Mig_ObjMan(p)->vTravIds.pArray == NULL ) Vec_IntFill( &Mig_ObjMan(p)->vTravIds, Mig_ManObjNum(Mig_ObjMan(p))+500, 0 ); Mig_ObjMan(p)->nTravIds++; }
+static inline void Mig_ObjSetTravIdCurrent( Mig_Obj_t * p ) { Vec_IntSetEntry(&Mig_ObjMan(p)->vTravIds, Mig_ObjId(p), Mig_ObjMan(p)->nTravIds ); }
+static inline void Mig_ObjSetTravIdPrevious( Mig_Obj_t * p ) { Vec_IntSetEntry(&Mig_ObjMan(p)->vTravIds, Mig_ObjId(p), Mig_ObjMan(p)->nTravIds-1 ); }
+static inline int Mig_ObjIsTravIdCurrent( Mig_Obj_t * p ) { return (Vec_IntGetEntry(&Mig_ObjMan(p)->vTravIds, Mig_ObjId(p)) == Mig_ObjMan(p)->nTravIds); }
+static inline int Mig_ObjIsTravIdPrevious( Mig_Obj_t * p ) { return (Vec_IntGetEntry(&Mig_ObjMan(p)->vTravIds, Mig_ObjId(p)) == Mig_ObjMan(p)->nTravIds-1); }
+static inline void Mig_ObjSetTravIdCurrentId( Mig_Man_t * p, int Id ) { Vec_IntSetEntry(&p->vTravIds, Id, p->nTravIds ); }
+static inline int Mig_ObjIsTravIdCurrentId( Mig_Man_t * p, int Id ) { return (Vec_IntGetEntry(&p->vTravIds, Id) == p->nTravIds); }
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+static inline Mig_Obj_t * Mig_ManAppendObj( Mig_Man_t * p )
+{
+ Mig_Obj_t * pObj;
+ assert( p->nObjs < MIG_NONE );
+ if ( p->nObjs >= (Vec_PtrSize(&p->vPages) << MIG_BASE) )
+ {
+ Mig_Obj_t * pPage;// int i;
+ assert( p->nObjs == (Vec_PtrSize(&p->vPages) << MIG_BASE) );
+ pPage = ABC_FALLOC( Mig_Obj_t, MIG_MASK + 3 ); // 1 for mask, 1 for prefix, 1 for sentinel
+ *((void **)pPage) = p;
+// *((void ***)(pPage + 1) - 1) = Vec_PtrArray(&p->vPages);
+ Vec_PtrPush( &p->vPages, pPage + 1 );
+// if ( *((void ***)(pPage + 1) - 1) != Vec_PtrArray(&p->vPages) )
+// Vec_PtrForEachEntry( Mig_Obj_t *, &p->vPages, pPage, i )
+// *((void ***)pPage - 1) = Vec_PtrArray(&p->vPages);
+ }
+ pObj = Mig_ManObj( p, p->nObjs++ );
+ assert( Mig_ObjIsNone(pObj) );
+ Mig_ObjSetId( pObj, p->nObjs-1 );
+ return pObj;
+}
+static inline int Mig_ManAppendCi( Mig_Man_t * p )
+{
+ Mig_Obj_t * pObj = Mig_ManAppendObj( p );
+ Mig_ObjSetCioId( pObj, Vec_IntSize(&p->vCis) );
+ Vec_IntPush( &p->vCis, Mig_ObjId(pObj) );
+ return Mig_ObjId(pObj) << 1;
+}
+static inline int Mig_ManAppendCo( Mig_Man_t * p, int iLit0 )
+{
+ Mig_Obj_t * pObj;
+ assert( !Mig_ObjIsCo(Mig_ManObj(p, Abc_Lit2Var(iLit0))) );
+ pObj = Mig_ManAppendObj( p );
+ Mig_ObjSetFaninLit( pObj, 0, iLit0 );
+ Mig_ObjSetCioId( pObj, Vec_IntSize(&p->vCos) );
+ Vec_IntPush( &p->vCos, Mig_ObjId(pObj) );
+ return Mig_ObjId( pObj ) << 1;
+}
+static inline int Mig_ManAppendBuf( Mig_Man_t * p, int iLit0 )
+{
+ Mig_Obj_t * pObj;
+ pObj = Mig_ManAppendObj( p );
+ Mig_ObjSetFaninLit( pObj, 0, iLit0 );
+ return Mig_ObjId( pObj ) << 1;
+}
+static inline int Mig_ManAppendAnd( Mig_Man_t * p, int iLit0, int iLit1 )
+{
+ Mig_Obj_t * pObj = Mig_ManAppendObj( p );
+ assert( iLit0 != iLit1 );
+ Mig_ObjSetFaninLit( pObj, 0, iLit0 < iLit1 ? iLit0 : iLit1 );
+ Mig_ObjSetFaninLit( pObj, 1, iLit0 < iLit1 ? iLit1 : iLit0 );
+ return Mig_ObjId( pObj ) << 1;
+}
+static inline int Mig_ManAppendXor( Mig_Man_t * p, int iLit0, int iLit1 )
+{
+ Mig_Obj_t * pObj = Mig_ManAppendObj( p );
+ assert( iLit0 != iLit1 );
+ assert( !Abc_LitIsCompl(iLit0) && !Abc_LitIsCompl(iLit1) );
+ Mig_ObjSetFaninLit( pObj, 0, iLit0 < iLit1 ? iLit1 : iLit0 );
+ Mig_ObjSetFaninLit( pObj, 1, iLit0 < iLit1 ? iLit0 : iLit1 );
+ return Mig_ObjId( pObj ) << 1;
+}
+static inline int Mig_ManAppendMux( Mig_Man_t * p, int iLit0, int iLit1, int iCtrl )
+{
+ Mig_Obj_t * pObj = Mig_ManAppendObj( p );
+ assert( iLit0 != iLit1 && iLit0 != iCtrl && iLit1 != iCtrl );
+ assert( !Abc_LitIsCompl(iLit0) || !Abc_LitIsCompl(iLit1) );
+ Mig_ObjSetFaninLit( pObj, 0, iLit0 < iLit1 ? iLit0 : iLit1 );
+ Mig_ObjSetFaninLit( pObj, 1, iLit0 < iLit1 ? iLit1 : iLit0 );
+ Mig_ObjSetFaninLit( pObj, 2, iLit0 < iLit1 ? iCtrl : Abc_LitNot(iCtrl) );
+ return Mig_ObjId( pObj ) << 1;
+}
+static inline int Mig_ManAppendMaj( Mig_Man_t * p, int iLit0, int iLit1, int iLit2 )
+{
+ Mig_Obj_t * pObj = Mig_ManAppendObj( p );
+ assert( iLit0 != iLit1 && iLit0 != iLit2 && iLit1 != iLit2 );
+ Mig_ObjSetFaninLit( pObj, 0, iLit0 < iLit1 ? iLit1 : iLit0 );
+ Mig_ObjSetFaninLit( pObj, 1, iLit0 < iLit1 ? iLit0 : iLit1 );
+ Mig_ObjSetFaninLit( pObj, 2, iLit2 );
+ return Mig_ObjId( pObj ) << 1;
+}
+
+////////////////////////////////////////////////////////////////////////
+/// MACRO DEFINITIONS ///
+////////////////////////////////////////////////////////////////////////
+
+// iterators over objects
+#define Mig_ManForEachObj( p, pObj ) \
+ for ( p->iPage = 0; p->iPage < Vec_PtrSize(&p->vPages) && \
+ ((p->pPage) = (Mig_Obj_t *)Vec_PtrEntry(&p->vPages, p->iPage)); p->iPage++ ) \
+ for ( pObj = p->pPage; !Mig_ObjIsNone(pObj); pObj++ )
+#define Mig_ManForEachObj1( p, pObj ) \
+ for ( p->iPage = 0; p->iPage < Vec_PtrSize(&p->vPages) && \
+ ((p->pPage) = (Mig_Obj_t *)Vec_PtrEntry(&p->vPages, p->iPage)); p->iPage++ ) \
+ for ( pObj = p->pPage + (p->iPage == 0); !Mig_ObjIsNone(pObj); pObj++ )
+#define Mig_ManForEachObjReverse( p, pObj ) \
+ for ( p->iPage = Vec_PtrSize(&p->vPages) - 1; p->iPage >= 0 && \
+ ((p->pPage) = (Mig_Obj_t *)Vec_PtrEntry(&p->vPages, p->iPage)); p->iPage-- ) \
+ for ( pObj = (p->iPage == Vec_PtrSize(&p->vPages) - 1) ? \
+ Mig_ManObj(p, Mig_ManObjNum(p)-1) : p->pPage + MIG_MASK; \
+ pObj - p->pPage >= 0; pObj-- )
+
+#define Mig_ManForEachObjVec( vVec, p, pObj, i ) \
+ for ( i = 0; (i < Vec_IntSize(vVec)) && ((pObj) = Mig_ManObj(p, Vec_IntEntry(vVec,i))); i++ )
+
+#define Mig_ManForEachNode( p, pObj ) \
+ Mig_ManForEachObj( p, pObj ) if ( !Mig_ObjIsNode(pObj) ) {} else
+#define Mig_ManForEachCand( p, pObj ) \
+ Mig_ManForEachObj( p, pObj ) if ( !Mig_ObjIsCand(pObj) ) {} else
+
+#define Mig_ManForEachCi( p, pObj, i ) \
+ for ( i = 0; (i < Vec_IntSize(&p->vCis)) && ((pObj) = Mig_ManCi(p, i)); i++ )
+#define Mig_ManForEachCo( p, pObj, i ) \
+ for ( i = 0; (i < Vec_IntSize(&p->vCos)) && ((pObj) = Mig_ManCo(p, i)); i++ )
+
+// iterators over fanins
+#define Mig_ObjForEachFaninId( p, iFanin, i ) \
+ for ( i = 0; Mig_ObjHasFanin(p, i) && ((iFanin) = Mig_ObjFaninId(p, i)); i++ )
+#define Mig_ObjForEachFanin( p, pFanin, i ) \
+ for ( i = 0; Mig_ObjHasFanin(p, i) && ((pFanin) = Mig_ObjFanin(p, i)); i++ )
+
+
+////////////////////////////////////////////////////////////////////////
+/// FUNCTION DECLARATIONS ///
+////////////////////////////////////////////////////////////////////////
+
+/*=== mpmMig.c ===========================================================*/
+extern Mig_Man_t * Mig_ManStart();
+extern void Mig_ManStop( Mig_Man_t * p );
+extern void Mig_ManSetRefs( Mig_Man_t * p, int fSkipCos );
+
+
+ABC_NAMESPACE_HEADER_END
+
+#endif
+
+////////////////////////////////////////////////////////////////////////
+/// END OF FILE ///
+////////////////////////////////////////////////////////////////////////
+
diff --git a/src/map/mpm/mpmPre.c b/src/map/mpm/mpmPre.c
new file mode 100644
index 00000000..e070c71a
--- /dev/null
+++ b/src/map/mpm/mpmPre.c
@@ -0,0 +1,885 @@
+/**CFile****************************************************************
+
+ FileName [mpmPre.c]
+
+ SystemName [ABC: Logic synthesis and verification system.]
+
+ PackageName [Configurable technology mapper.]
+
+ Synopsis [DSD-related precomputations.]
+
+ Author [Alan Mishchenko]
+
+ Affiliation [UC Berkeley]
+
+ Date [Ver. 1.0. Started - June 1, 2013.]
+
+ Revision [$Id: mpmPre.c,v 1.00 2013/06/01 00:00:00 alanmi Exp $]
+
+***********************************************************************/
+
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include <assert.h>
+
+#include "misc/vec/vec.h"
+#include "misc/vec/vecHsh.h"
+#include "misc/extra/extra.h"
+
+ABC_NAMESPACE_IMPL_START
+
+
+////////////////////////////////////////////////////////////////////////
+/// DECLARATIONS ///
+////////////////////////////////////////////////////////////////////////
+
+typedef struct Ifd_Obj_t_ Ifd_Obj_t;
+struct Ifd_Obj_t_
+{
+ unsigned nFreq : 24; // frequency
+ unsigned nSupp : 5; // support size
+ unsigned Type : 2; // type
+ unsigned fWay : 1; // transparent edge
+ unsigned pFans[3]; // fanins
+};
+
+typedef struct Ifd_Man_t_ Ifd_Man_t;
+struct Ifd_Man_t_
+{
+ Ifd_Obj_t * pObjs;
+ int nObjs;
+ int nObjsAlloc;
+ // hashing operations
+ Vec_Int_t * vArgs; // iDsd1 op iDsdC
+ Vec_Int_t * vRes; // result of operation
+ Vec_Int_t * vOffs; // offsets in the array of permutations
+ Vec_Str_t * vPerms; // storage for permutations
+ Hsh_IntMan_t * vHash; // hash table
+ Vec_Int_t * vMarks; // marks where given N begins
+ Vec_Wrd_t * vTruths; // truth tables
+ // other data
+ Vec_Int_t * vSuper;
+
+};
+
+static inline int Ifd_ObjIsVar( Ifd_Obj_t * p ) { return p->Type == 0; }
+static inline int Ifd_ObjIsAnd( Ifd_Obj_t * p ) { return p->Type == 1; }
+static inline int Ifd_ObjIsXor( Ifd_Obj_t * p ) { return p->Type == 2; }
+static inline int Ifd_ObjIsMux( Ifd_Obj_t * p ) { return p->Type == 3; }
+
+static inline Ifd_Obj_t * Ifd_ManObj( Ifd_Man_t * p, int i ) { assert( i >= 0 && i < p->nObjs ); return p->pObjs + i; }
+static inline Ifd_Obj_t * Ifd_ManObjFromLit( Ifd_Man_t * p, int iLit ) { return Ifd_ManObj( p, Abc_Lit2Var(iLit) ); }
+static inline int Ifd_ObjId( Ifd_Man_t * p, Ifd_Obj_t * pObj ) { assert( pObj - p->pObjs >= 0 && pObj - p->pObjs < p->nObjs ); return pObj - p->pObjs; }
+static inline int Ifd_LitSuppSize( Ifd_Man_t * p, int iLit ) { return iLit > 0 ? Ifd_ManObjFromLit(p, iLit)->nSupp : 0; }
+
+#define Ifd_ManForEachNodeWithSupp( p, nVars, pLeaf, i ) \
+ for ( i = Vec_IntEntry(p->vMarks, nVars); (i < Vec_IntEntry(p->vMarks, nVars+1)) && (pLeaf = Ifd_ManObj(p, i)); i++ )
+
+
+////////////////////////////////////////////////////////////////////////
+/// FUNCTION DEFINITIONS ///
+////////////////////////////////////////////////////////////////////////
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+Ifd_Man_t * Ifd_ManStart()
+{
+ Ifd_Man_t * p;
+ p = ABC_CALLOC( Ifd_Man_t, 1 );
+ p->nObjsAlloc = Abc_PrimeCudd( 50000000 );
+ p->nObjs = 2;
+ p->pObjs = ABC_CALLOC( Ifd_Obj_t, p->nObjsAlloc );
+ memset( p->pObjs, 0xFF, sizeof(Ifd_Obj_t) ); // const node
+ (p->pObjs + 1)->nSupp = 1; // variable
+ (p->pObjs + 1)->fWay = 1; // variable
+ // hashing operations
+ p->vArgs = Vec_IntAlloc( 4000 );
+ p->vRes = Vec_IntAlloc( 1000 );
+// p->vOffs = Vec_IntAlloc( 1000 );
+// p->vPerms = Vec_StrAlloc( 1000 );
+ p->vHash = Hsh_IntManStart( p->vArgs, 4, 1000 );
+ p->vMarks = Vec_IntAlloc( 100 );
+ Vec_IntPush( p->vMarks, 0 );
+ Vec_IntPush( p->vMarks, 1 );
+ Vec_IntPush( p->vMarks, p->nObjs );
+ // other data
+ p->vSuper = Vec_IntAlloc( 1000 );
+ p->vTruths = Vec_WrdAlloc( 1000 );
+ return p;
+}
+void Ifd_ManStop( Ifd_Man_t * p )
+{
+ int i, This, Prev = 0;
+ Vec_IntForEachEntryStart( p->vMarks, This, i, 1 )
+ {
+ printf( "%d(%d:%d) ", i-1, This, This - Prev );
+ Prev = This;
+ }
+ printf( "\n" );
+
+ Vec_IntFreeP( &p->vArgs );
+ Vec_IntFreeP( &p->vRes );
+// Vec_IntFree( p->vOffs );
+// Vec_StrFree( p->vPerms );
+ Vec_WrdFreeP( &p->vTruths );
+ Vec_IntFreeP( &p->vMarks );
+ Hsh_IntManStop( p->vHash );
+ Vec_IntFreeP( &p->vSuper );
+ ABC_FREE( p->pObjs );
+ ABC_FREE( p );
+}
+
+/**Function*************************************************************
+
+ Synopsis [Printing structures.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Ifd_ObjPrint_rec( Ifd_Man_t * p, int iLit, int * pCounter, int DiffType )
+{
+ char Symb[2][4] = { {'?','(','[','<'}, {'?',')',']','>'} };
+ Ifd_Obj_t * pDsd;
+ if ( Abc_LitIsCompl(iLit) )
+ printf( "!" ), iLit = Abc_LitNot(iLit);
+ if ( iLit == 2 )
+ { printf( "%c", 'a' + (*pCounter)++ ); return; }
+ pDsd = Ifd_ManObjFromLit( p, iLit );
+ if ( DiffType )
+ printf( "%c", Symb[0][pDsd->Type] );
+ Ifd_ObjPrint_rec( p, pDsd->pFans[0], pCounter, pDsd->Type == 3 || Abc_LitIsCompl(pDsd->pFans[0]) || pDsd->Type != Ifd_ManObjFromLit(p, pDsd->pFans[0])->Type );
+ Ifd_ObjPrint_rec( p, pDsd->pFans[1], pCounter, pDsd->Type == 3 || Abc_LitIsCompl(pDsd->pFans[1]) || pDsd->Type != Ifd_ManObjFromLit(p, pDsd->pFans[1])->Type );
+ if ( pDsd->pFans[2] != -1 )
+ Ifd_ObjPrint_rec( p, pDsd->pFans[2], pCounter, pDsd->Type == 3 || Abc_LitIsCompl(pDsd->pFans[2]) || pDsd->Type != Ifd_ManObjFromLit(p, pDsd->pFans[2])->Type );
+ if ( DiffType )
+ printf( "%c", Symb[1][pDsd->Type] );
+}
+void Ifd_ObjPrint( Ifd_Man_t * p, int iLit )
+{
+ int Counter = 0;
+ if ( iLit == 0 )
+ { printf( "0\n" ); return; }
+ if ( iLit == 1 )
+ { printf( "1\n" ); return; }
+ Ifd_ObjPrint_rec( p, iLit, &Counter, 1 );
+ printf( "\n" );
+}
+void Ifd_ManPrint( Ifd_Man_t * p )
+{
+ int i;
+ for ( i = 0; i < p->nObjs; i++ )
+ {
+ printf( "%4d : ", i );
+ Ifd_ObjPrint( p, Abc_Var2Lit( i, 0 ) );
+ }
+}
+
+
+/**Function*************************************************************
+
+ Synopsis [Computing truth tables.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+word Ifd_ObjTruth_rec( Ifd_Man_t * p, int iLit, int * pCounter )
+{
+ static word s_Truths6[6] = {
+ ABC_CONST(0xAAAAAAAAAAAAAAAA),
+ ABC_CONST(0xCCCCCCCCCCCCCCCC),
+ ABC_CONST(0xF0F0F0F0F0F0F0F0),
+ ABC_CONST(0xFF00FF00FF00FF00),
+ ABC_CONST(0xFFFF0000FFFF0000),
+ ABC_CONST(0xFFFFFFFF00000000)
+ };
+ Ifd_Obj_t * pDsd;
+ word Fun0, Fun1, Fun2;
+ assert( !Abc_LitIsCompl(iLit) );
+ if ( iLit == 2 )
+ return s_Truths6[(*pCounter)++];
+ pDsd = Ifd_ManObjFromLit( p, iLit );
+
+ Fun0 = Ifd_ObjTruth_rec( p, Abc_LitRegular(pDsd->pFans[0]), pCounter );
+ Fun1 = Ifd_ObjTruth_rec( p, Abc_LitRegular(pDsd->pFans[1]), pCounter );
+ if ( pDsd->pFans[2] != -1 )
+ Fun2 = Ifd_ObjTruth_rec( p, Abc_LitRegular(pDsd->pFans[2]), pCounter );
+
+ Fun0 = Abc_LitIsCompl(pDsd->pFans[0]) ? ~Fun0 : Fun0;
+ Fun1 = Abc_LitIsCompl(pDsd->pFans[1]) ? ~Fun1 : Fun1;
+ if ( pDsd->pFans[2] != -1 )
+ Fun2 = Abc_LitIsCompl(pDsd->pFans[2]) ? ~Fun2 : Fun2;
+
+ if ( pDsd->Type == 1 )
+ return Fun0 & Fun1;
+ if ( pDsd->Type == 2 )
+ return Fun0 ^ Fun1;
+ if ( pDsd->Type == 3 )
+ return (Fun2 & Fun1) | (~Fun2 & Fun0);
+ assert( 0 );
+ return -1;
+}
+word Ifd_ObjTruth( Ifd_Man_t * p, int iLit )
+{
+ word Fun;
+ int Counter = 0;
+ if ( iLit == 0 )
+ return 0;
+ if ( iLit == 1 )
+ return ~(word)0;
+ Fun = Ifd_ObjTruth_rec( p, Abc_LitRegular(iLit), &Counter );
+ return Abc_LitIsCompl(iLit) ? ~Fun : Fun;
+}
+void Ifd_ManTruthAll( Ifd_Man_t * p )
+{
+ word Fun;
+ int i;
+ assert( Vec_WrdSize(p->vTruths) == 0 );
+ for ( i = 0; i < p->nObjs; i++ )
+ {
+ Fun = Ifd_ObjTruth( p, Abc_Var2Lit( i, 0 ) );
+ Vec_WrdPush( p->vTruths, Fun );
+// Extra_PrintHex( stdout, (unsigned *)&Fun, 6 ); printf( " " );
+// Kit_DsdPrintFromTruth( (unsigned *)&Fun, 6 ); printf( "\n" );
+ }
+}
+
+/**Function*************************************************************
+
+ Synopsis [Canonicizing DSD structures.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+int Ifd_ManHashLookup( Ifd_Man_t * p, int iDsd0, int iDsd1, int iDsdC, int Type )
+{
+ int pData[4];
+ assert( iDsdC != -1 || iDsd0 >= iDsd1 );
+ assert( iDsdC == -1 || !Abc_LitIsCompl(iDsd1) );
+ pData[0] = iDsd0;
+ pData[1] = iDsd1;
+ pData[2] = iDsdC;
+ pData[3] = Type;
+ return *Hsh_IntManLookup( p->vHash, pData );
+}
+void Ifd_ManHashInsert( Ifd_Man_t * p, int iDsd0, int iDsd1, int iDsdC, int Type, int Res )
+{
+ int iObj;
+ assert( iDsdC != -1 || iDsd0 >= iDsd1 );
+ assert( iDsdC == -1 || !Abc_LitIsCompl(iDsd1) );
+ Vec_IntPush( p->vArgs, iDsd0 );
+ Vec_IntPush( p->vArgs, iDsd1 );
+ Vec_IntPush( p->vArgs, iDsdC );
+ Vec_IntPush( p->vArgs, Type );
+ iObj = Hsh_IntManAdd( p->vHash, Vec_IntSize(p->vRes) );
+ assert( iObj == Vec_IntSize(p->vRes) );
+ Vec_IntPush( p->vRes, Res );
+ assert( 4 * Vec_IntSize(p->vRes) == Vec_IntSize(p->vArgs) );
+}
+int Ifd_ManHashFindOrAdd( Ifd_Man_t * p, int iDsd0, int iDsd1, int iDsdC, int Type )
+{
+ Ifd_Obj_t * pObj;
+ int iObj, Value;
+ assert( iDsdC != -1 || iDsd0 >= iDsd1 );
+ assert( iDsdC == -1 || !Abc_LitIsCompl(iDsd1) );
+ Vec_IntPush( p->vArgs, iDsd0 );
+ Vec_IntPush( p->vArgs, iDsd1 );
+ Vec_IntPush( p->vArgs, iDsdC );
+ Vec_IntPush( p->vArgs, Type );
+ Value = Hsh_IntManAdd( p->vHash, Vec_IntSize(p->vRes) );
+ if ( Value < Vec_IntSize(p->vRes) )
+ {
+ iObj = Vec_IntEntry(p->vRes, Value);
+ Vec_IntShrink( p->vArgs, Vec_IntSize(p->vArgs) - 4 );
+ pObj = Ifd_ManObj( p, iObj );
+ pObj->nFreq++;
+ assert( (int)pObj->Type == Type );
+ assert( (int)pObj->nSupp == Ifd_LitSuppSize(p, iDsd0) + Ifd_LitSuppSize(p, iDsd1) + Ifd_LitSuppSize(p, iDsdC) );
+ }
+ else
+ {
+ if ( p->nObjs == p->nObjsAlloc )
+ printf( "The number of nodes is more than %d\n", p->nObjs );
+ assert( p->nObjs < p->nObjsAlloc );
+ iObj = p->nObjs;
+ pObj = Ifd_ManObj( p, p->nObjs++ );
+ pObj->nFreq = 1;
+ pObj->nSupp = Ifd_LitSuppSize(p, iDsd0) + Ifd_LitSuppSize(p, iDsd1) + Ifd_LitSuppSize(p, iDsdC);
+ pObj->Type = Type;
+ if ( Type == 1 )
+ pObj->fWay = 0;
+ else if ( Type == 2 )
+ pObj->fWay = Ifd_ManObjFromLit(p, iDsd0)->fWay || Ifd_ManObjFromLit(p, iDsd1)->fWay;
+ else if ( Type == 3 )
+// pObj->fWay = (Ifd_ManObjFromLit(p, iDsd0)->fWay && Ifd_ManObjFromLit(p, iDsd1)->fWay) || (Abc_Lit2Var(iDsd0) == Abc_Lit2Var(iDsd1) && Ifd_ManObjFromLit(p, iDsdC)->fWay);
+ pObj->fWay = (Ifd_ManObjFromLit(p, iDsd0)->fWay && Ifd_ManObjFromLit(p, iDsd1)->fWay) || (iDsd0 == Abc_LitNot(iDsd1) && Ifd_ManObjFromLit(p, iDsdC)->fWay);
+ else assert( 0 );
+ pObj->pFans[0] = iDsd0;
+ pObj->pFans[1] = iDsd1;
+ pObj->pFans[2] = iDsdC;
+ Vec_IntPush( p->vRes, iObj );
+ }
+ assert( 4 * Vec_IntSize(p->vRes) == Vec_IntSize(p->vArgs) );
+ return iObj;
+}
+void Ifd_ManOperSuper_rec( Ifd_Man_t * p, int iLit, int Type, Vec_Int_t * vObjs )
+{
+ Ifd_Obj_t * pDsd = Ifd_ManObjFromLit( p, iLit );
+ if ( Abc_LitIsCompl(iLit) || (int)pDsd->Type != Type )
+ Vec_IntPush( vObjs, iLit );
+ else
+ {
+ Ifd_ManOperSuper_rec( p, pDsd->pFans[0], Type, vObjs );
+ Ifd_ManOperSuper_rec( p, pDsd->pFans[1], Type, vObjs );
+ }
+}
+int Ifd_ManOper( Ifd_Man_t * p, int iDsd0, int iDsd1, int iDsdC, int Type )
+{
+ int i, iLit0, iLit1, iThis, fCompl = 0;
+ if ( Type == 1 ) // AND
+ {
+ if ( iDsd0 == 0 || iDsd1 == 0 )
+ return 0;
+ if ( iDsd0 == 1 || iDsd1 == 1 )
+ return (iDsd0 == 1) ? iDsd1 : iDsd0;
+ }
+ else if ( Type == 2 ) // XOR
+ {
+ if ( iDsd0 < 2 )
+ return Abc_LitNotCond( iDsd1, iDsd0 );
+ if ( iDsd1 < 2 )
+ return Abc_LitNotCond( iDsd0, iDsd1 );
+ if ( Abc_LitIsCompl(iDsd0) )
+ fCompl ^= 1, iDsd0 = Abc_LitNot(iDsd0);
+ if ( Abc_LitIsCompl(iDsd1) )
+ fCompl ^= 1, iDsd1 = Abc_LitNot(iDsd1);
+ }
+ else if ( Type == 3 )
+ {
+ if ( Abc_LitIsCompl(iDsdC) )
+ {
+ ABC_SWAP( int, iDsd0, iDsd1 );
+ iDsdC = Abc_LitNot(iDsdC);
+ }
+ if ( Abc_LitIsCompl(iDsd1) )
+ fCompl ^= 1, iDsd0 = Abc_LitNot(iDsd0), iDsd1 = Abc_LitNot(iDsd1);
+ }
+ assert( iDsd0 > 1 && iDsd1 > 1 && Type >= 1 && Type <= 3 );
+/*
+ // check cache
+ iThis = Ifd_ManHashLookup( p, iDsd0, iDsd1, iDsdC, Type );
+ if ( iThis != -1 )
+ return Abc_Var2Lit( iThis, fCompl );
+*/
+ // create new entry
+ if ( Type == 3 )
+ {
+ iThis = Ifd_ManHashFindOrAdd( p, iDsd0, iDsd1, iDsdC, Type );
+ return Abc_Var2Lit( iThis, fCompl );
+ }
+ assert( iDsdC == -1 );
+ Vec_IntClear( p->vSuper );
+ Ifd_ManOperSuper_rec( p, iDsd0, Type, p->vSuper );
+ Ifd_ManOperSuper_rec( p, iDsd1, Type, p->vSuper );
+ Vec_IntSort( p->vSuper, 1 );
+ iLit0 = Vec_IntEntry( p->vSuper, 0 );
+ Vec_IntForEachEntryStart( p->vSuper, iLit1, i, 1 )
+ iLit0 = Abc_Var2Lit( Ifd_ManHashFindOrAdd(p, iLit0, iLit1, -1, Type), 0 );
+ assert( !Abc_LitIsCompl(iLit0) );
+ // insert into cache
+// if ( Vec_IntSize(p->vSuper) > 2 )
+// Ifd_ManHashInsert( p, iDsd0, iDsd1, iDsdC, Type, iLit0 );
+ return Abc_LitNotCond( iLit0, fCompl );
+}
+
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+int Ifd_ManFindDsd_rec( Ifd_Man_t * pMan, char * pStr, char ** p, int * pMatches )
+{
+ int fCompl = 0;
+ if ( **p == '!' )
+ (*p)++, fCompl = 1;
+ if ( **p >= 'a' && **p <= 'f' ) // var
+ {
+ assert( **p - 'a' >= 0 && **p - 'a' < 6 );
+ return Abc_Var2Lit( 1, fCompl );
+ }
+ if ( **p == '(' ) // and/or
+ {
+ char * q = pStr + pMatches[ *p - pStr ];
+ int Lit, Res = 1;
+ assert( **p == '(' && *q == ')' );
+ for ( (*p)++; *p < q; (*p)++ )
+ {
+ Lit = Ifd_ManFindDsd_rec( pMan, pStr, p, pMatches );
+ Res = Ifd_ManOper( pMan, Res, Lit, 0, 1 );
+ }
+ assert( *p == q );
+ return Abc_LitNotCond( Res, fCompl );
+ }
+ if ( **p == '[' ) // xor
+ {
+ char * q = pStr + pMatches[ *p - pStr ];
+ int Lit, Res = 0;
+ assert( **p == '[' && *q == ']' );
+ for ( (*p)++; *p < q; (*p)++ )
+ {
+ Lit = Ifd_ManFindDsd_rec( pMan, pStr, p, pMatches );
+ Res = Ifd_ManOper( pMan, Res, Lit, 0, 2 );
+ }
+ assert( *p == q );
+ return Abc_LitNotCond( Res, fCompl );
+ }
+ if ( **p == '<' ) // mux
+ {
+ int Temp[3], * pTemp = Temp, Res;
+ char * pOld = *p;
+ char * q = pStr + pMatches[ *p - pStr ];
+ assert( **p == '<' && *q == '>' );
+ // derive MAX components
+ for ( (*p)++; *p < q; (*p)++ )
+ *pTemp++ = Ifd_ManFindDsd_rec( pMan, pStr, p, pMatches );
+ assert( pTemp == Temp + 3 );
+ assert( *p == q );
+// Res = (Temp[0] & Temp[1]) | (~Temp[0] & Temp[2]);
+ Res = Ifd_ManOper( pMan, Temp[2], Temp[1], Temp[0], 3 );
+ return Abc_LitNotCond( Res, fCompl );
+ }
+ assert( 0 );
+ return 0;
+}
+#define IFM_MAX_STR 100
+#define IFM_MAX_VAR 16
+int * Ifd_ManComputeMatches( char * p )
+{
+ static int pMatches[IFM_MAX_STR];
+ int pNested[IFM_MAX_VAR];
+ int v, nNested = 0;
+ for ( v = 0; p[v]; v++ )
+ {
+ assert( v < IFM_MAX_STR );
+ pMatches[v] = 0;
+ if ( p[v] == '(' || p[v] == '[' || p[v] == '<' || p[v] == '{' )
+ pNested[nNested++] = v;
+ else if ( p[v] == ')' || p[v] == ']' || p[v] == '>' || p[v] == '}' )
+ pMatches[pNested[--nNested]] = v;
+ assert( nNested < IFM_MAX_VAR );
+ }
+ assert( nNested == 0 );
+ return pMatches;
+}
+int Ifd_ManFindDsd( Ifd_Man_t * pMan, char * p )
+{
+ int Res;
+ if ( *p == '0' && *(p+1) == 0 )
+ Res = 0;
+ else if ( *p == '1' && *(p+1) == 0 )
+ Res = 1;
+ else
+ Res = Ifd_ManFindDsd_rec( pMan, p, &p, Ifd_ManComputeMatches(p) );
+ assert( *++p == 0 );
+ return Res;
+}
+
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Ifd_ManDsdTest2()
+{
+ char * p = "(abc)";
+ char * q = "(a[bc])";
+ char * r = "[<abc>(def)]";
+ Ifd_Man_t * pMan = Ifd_ManStart();
+ int iLit = Ifd_ManFindDsd( pMan, p );
+ Ifd_ObjPrint( pMan, iLit );
+ Ifd_ManStop( pMan );
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+Vec_Wrd_t * Ifd_ManDsdTruths( int nVars )
+{
+ int fUseMux = 1;
+ Vec_Wrd_t * vTruths;
+ Ifd_Man_t * pMan = Ifd_ManStart();
+ Ifd_Obj_t * pLeaf0, * pLeaf1, * pLeaf2;
+ int v, i, j, k, c0, c1, c2;
+ for ( v = 2; v <= nVars; v++ )
+ {
+ // create ANDs/XORs
+ for ( i = 1; i < v; i++ )
+ for ( j = 1; j < v; j++ )
+ if ( i + j == v )
+ {
+ Ifd_ManForEachNodeWithSupp( pMan, i, pLeaf0, c0 )
+ Ifd_ManForEachNodeWithSupp( pMan, j, pLeaf1, c1 )
+ {
+ assert( (int)pLeaf0->nSupp == i );
+ assert( (int)pLeaf1->nSupp == j );
+ Ifd_ManOper( pMan, Abc_Var2Lit(c0, 0), Abc_Var2Lit(c1, 0), -1, 1 );
+ if ( !pLeaf1->fWay )
+ Ifd_ManOper( pMan, Abc_Var2Lit(c0, 0), Abc_Var2Lit(c1, 1), -1, 1 );
+ if ( !pLeaf0->fWay )
+ Ifd_ManOper( pMan, Abc_Var2Lit(c0, 1), Abc_Var2Lit(c1, 0), -1, 1 );
+ if ( !pLeaf0->fWay && !pLeaf1->fWay )
+ Ifd_ManOper( pMan, Abc_Var2Lit(c0, 1), Abc_Var2Lit(c1, 1), -1, 1 );
+ Ifd_ManOper( pMan, Abc_Var2Lit(c0, 0), Abc_Var2Lit(c1, 0), -1, 2 );
+ }
+ }
+ // create MUX
+ if ( fUseMux )
+ for ( i = 1; i < v-1; i++ )
+ for ( j = 1; j < v-1; j++ )
+ for ( k = 1; k < v-1; k++ )
+ if ( i + j + k == v )
+ {
+ Ifd_ManForEachNodeWithSupp( pMan, i, pLeaf0, c0 )
+ Ifd_ManForEachNodeWithSupp( pMan, j, pLeaf1, c1 )
+ Ifd_ManForEachNodeWithSupp( pMan, k, pLeaf2, c2 )
+ {
+ assert( (int)pLeaf0->nSupp == i );
+ assert( (int)pLeaf1->nSupp == j );
+ assert( (int)pLeaf2->nSupp == k );
+//printf( "%d %d %d ", i, j, k );
+//printf( "%d %d %d\n", Ifd_ObjId(pMan, pLeaf0), Ifd_ObjId(pMan, pLeaf1), Ifd_ObjId(pMan, pLeaf2) );
+ if ( pLeaf2->fWay && c0 < c1 )
+ continue;
+ Ifd_ManOper( pMan, Abc_Var2Lit(c0, 0), Abc_Var2Lit(c1, 0), Abc_Var2Lit(c2, 0), 3 );
+ if ( !pLeaf0->fWay && !pLeaf1->fWay )
+ Ifd_ManOper( pMan, Abc_Var2Lit(c0, 1), Abc_Var2Lit(c1, 0), Abc_Var2Lit(c2, 0), 3 );
+ }
+ }
+ // bookmark
+ Vec_IntPush( pMan->vMarks, pMan->nObjs );
+ }
+// Ifd_ManPrint( pMan );
+ Ifd_ManTruthAll( pMan );
+ vTruths = pMan->vTruths; pMan->vTruths = NULL;
+ Ifd_ManStop( pMan );
+ return vTruths;
+}
+
+
+/**Function*************************************************************
+
+ Synopsis [Generating the guided array for minimal permutations.]
+
+ Description [http://icodesnip.com/search/johnson%20trotter/]
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Ifd_ManDsdPermPrint( int * perm, int size )
+{
+ int i;
+ for ( i = 0; i < size; i++ )
+ printf( "%d", perm[i] );
+ printf( "\n" );
+}
+Vec_Int_t * Ifd_ManDsdPermJT( int n )
+{
+ Vec_Int_t * vGuide = Vec_IntAlloc( 100 );
+ int *array, *dir, tmp, tmp2, i, max;
+ array = (int*)malloc(sizeof(int) * n);
+ dir = (int*)calloc(n, sizeof(int));
+ for (i = 0; i < n; i++)
+ array[i] = i;
+ max = n - 1;
+ if (n != 1)
+ do
+ {
+// Ifd_ManDsdPermPrint(array, n);
+ tmp = array[max];
+ tmp2 = dir[max];
+ i = !dir[max] ? max - 1 : max + 1;
+ array[max] = array[i];
+ array[i] = tmp;
+ Vec_IntPush( vGuide, Abc_MinInt(max, i) );
+ dir[max] = dir[i];
+ dir[i] = tmp2;
+ for (i = 0; i < n; i++)
+ if (array[i] > tmp)
+ dir[i] = !dir[i];
+ max = n;
+ for (i = 0; i < n; i++)
+ if (((!dir[i] && i != 0 && array[i] > array[i-1]) || (dir[i] && i != n-1 && array[i] > array[i+1])) && (array[i] > array[max] || max == n))
+ max = i;
+ }
+ while (max < n);
+// Ifd_ManDsdPermPrint(array,n);
+ Vec_IntPush( vGuide, 0 );
+ free(dir);
+ free(array);
+ return vGuide;
+}
+int Ifd_ManDsdTest4()
+{
+ int pPerm[6] = { 0, 1, 2, 3, 4, 5 };
+ Vec_Int_t * vGuide = Ifd_ManDsdPermJT( 6 );
+ int i, Entry;
+ Vec_IntForEachEntry( vGuide, Entry, i )
+ {
+ ABC_SWAP( int, pPerm[Entry], pPerm[Entry+1] );
+ Ifd_ManDsdPermPrint( pPerm, 6 );
+ }
+ Vec_IntFree( vGuide );
+ return 1;
+}
+
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+static inline word Extra_Truth6SwapAdjacent( word t, int iVar )
+{
+ // variable swapping code
+ static word PMasks[5][3] = {
+ { ABC_CONST(0x9999999999999999), ABC_CONST(0x2222222222222222), ABC_CONST(0x4444444444444444) },
+ { ABC_CONST(0xC3C3C3C3C3C3C3C3), ABC_CONST(0x0C0C0C0C0C0C0C0C), ABC_CONST(0x3030303030303030) },
+ { ABC_CONST(0xF00FF00FF00FF00F), ABC_CONST(0x00F000F000F000F0), ABC_CONST(0x0F000F000F000F00) },
+ { ABC_CONST(0xFF0000FFFF0000FF), ABC_CONST(0x0000FF000000FF00), ABC_CONST(0x00FF000000FF0000) },
+ { ABC_CONST(0xFFFF00000000FFFF), ABC_CONST(0x00000000FFFF0000), ABC_CONST(0x0000FFFF00000000) }
+ };
+ assert( iVar < 5 );
+ return (t & PMasks[iVar][0]) | ((t & PMasks[iVar][1]) << (1 << iVar)) | ((t & PMasks[iVar][2]) >> (1 << iVar));
+}
+static inline word Extra_Truth6ChangePhase( word t, int iVar)
+{
+ // elementary truth tables
+ static word Truth6[6] = {
+ ABC_CONST(0xAAAAAAAAAAAAAAAA),
+ ABC_CONST(0xCCCCCCCCCCCCCCCC),
+ ABC_CONST(0xF0F0F0F0F0F0F0F0),
+ ABC_CONST(0xFF00FF00FF00FF00),
+ ABC_CONST(0xFFFF0000FFFF0000),
+ ABC_CONST(0xFFFFFFFF00000000)
+ };
+ assert( iVar < 6 );
+ return ((t & ~Truth6[iVar]) << (1 << iVar)) | ((t & Truth6[iVar]) >> (1 << iVar));
+}
+Vec_Wrd_t * Extra_Truth6AllConfigs2( word t, int * pComp, int * pPerm, int nVars )
+{
+ int nPerms = Extra_Factorial( nVars );
+ int nSwaps = (1 << nVars);
+ Vec_Wrd_t * vTruths = Vec_WrdStart( nPerms * (1 << (nVars+1)) );
+ word tCur, tTemp1, tTemp2;
+ int i, p, c;
+ for ( i = 0; i < 2; i++ )
+ {
+ tCur = i ? t : ~t;
+ tTemp1 = tCur;
+ for ( p = 0; p < nPerms; p++ )
+ {
+ tTemp2 = tCur;
+ for ( c = 0; c < nSwaps; c++ )
+ {
+ Vec_WrdWriteEntry( vTruths, (p << (nVars+1))|(i << nVars)|c, tCur );
+ tCur = Extra_Truth6ChangePhase( tCur, pComp[c] );
+ }
+ assert( tTemp2 == tCur );
+ tCur = Extra_Truth6SwapAdjacent( tCur, pPerm[p] );
+ }
+ assert( tTemp1 == tCur );
+ }
+ if ( t )
+ {
+ int i;
+ word Truth;
+ Vec_WrdForEachEntry( vTruths, Truth, i )
+ assert( Truth );
+ }
+ return vTruths;
+}
+Vec_Wrd_t * Extra_Truth6AllConfigs( word t, int * pComp, int * pPerm, int nVars )
+{
+ int nPerms = Extra_Factorial( nVars );
+ int nSwaps = (1 << nVars);
+ Vec_Wrd_t * vTruths = Vec_WrdStart( nPerms * nSwaps );
+ word tCur, tTemp1, tTemp2;
+ int i, p, c;
+ for ( i = 1; i < 2; i++ )
+ {
+ tCur = i ? ~t : t;
+ tTemp1 = tCur;
+ for ( p = 0; p < nPerms; p++ )
+ {
+ tTemp2 = tCur;
+ for ( c = 0; c < nSwaps; c++ )
+ {
+ Vec_WrdWriteEntry( vTruths, (p << (nVars))|c, tCur );
+ tCur = Extra_Truth6ChangePhase( tCur, pComp[c] );
+ }
+ assert( tTemp2 == tCur );
+ tCur = Extra_Truth6SwapAdjacent( tCur, pPerm[p] );
+ }
+ assert( tTemp1 == tCur );
+ }
+ if ( t )
+ {
+ int i;
+ word Truth;
+ Vec_WrdForEachEntry( vTruths, Truth, i )
+ assert( Truth );
+ }
+ return vTruths;
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+int Ifd_ManDsdTest33()
+{
+ int nVars = 6;
+ FILE * pFile;
+ char pFileName[32];
+ Vec_Wrd_t * vTruths = Ifd_ManDsdTruths( nVars );
+ Vec_Wrd_t * vVariants;
+ Vec_Int_t * vUniques;
+ Vec_Wrd_t * vTruthRes = Vec_WrdAlloc( 4000000 );
+ Vec_Int_t * vConfgRes = Vec_IntAlloc( 4000000 );
+ int * pComp, * pPerm;
+ word Truth, Variant;
+ int i, k, Uniq, Runner, Counter = 0;
+ assert( nVars >= 3 && nVars <= 6 );
+ assert( Vec_WrdSize(vTruths) < (1<<10) );
+ pComp = Extra_GreyCodeSchedule( nVars );
+ pPerm = Extra_PermSchedule( nVars );
+ Vec_WrdForEachEntry( vTruths, Truth, i )
+ {
+ vVariants = Extra_Truth6AllConfigs( Truth, pComp, pPerm, nVars );
+ vUniques = Hsh_WrdManHashArray( vVariants, 1 );
+ Runner = 0;
+ Vec_IntForEachEntry( vUniques, Uniq, k )
+ if ( Runner == Uniq )
+ {
+ Variant = Vec_WrdEntry(vVariants, k);
+ Vec_WrdPush( vTruthRes, Variant );
+ Vec_IntPush( vConfgRes, (Extra_TruthSupportSize((unsigned *)&Variant, 6)<<26)|(i << 16)|k );
+ Runner++;
+ }
+ Vec_IntUniqify( vUniques );
+ assert( Runner == Vec_IntSize(vUniques) );
+ Counter += Vec_IntSize(vUniques);
+//printf( "%5d : ", i ); Kit_DsdPrintFromTruth( &Truth, nVars ), printf( " " ), Vec_IntPrint( vUniques ), printf( "\n" );
+ Vec_IntFree( vUniques );
+ Vec_WrdFree( vVariants );
+ }
+ Vec_WrdFree( vTruths );
+ ABC_FREE( pPerm );
+ ABC_FREE( pComp );
+ printf( "Total = %d.\n", Counter );
+ assert( Vec_WrdSize(vTruthRes) == Counter );
+ // write the data into a file
+ sprintf( pFileName, "dsdfuncs%d.dat", nVars );
+ pFile = fopen( pFileName, "wb" );
+ fwrite( Vec_WrdArray(vTruthRes), sizeof(word), Vec_WrdSize(vTruthRes), pFile );
+ fwrite( Vec_IntArray(vConfgRes), sizeof(int), Vec_IntSize(vConfgRes), pFile );
+ fclose( pFile );
+ printf( "File \"%s\" with %d 6-input functions has been written out.\n", pFileName, Vec_IntSize(vConfgRes) );
+ Vec_WrdFree( vTruthRes );
+ Vec_IntFree( vConfgRes );
+ return 1;
+}
+
+int Ifd_ManDsdTest()
+{
+ abctime clk = Abc_Clock();
+ FILE * pFile;
+ char * pFileName = "dsdfuncs6.dat";
+ int size = Extra_FileSize( pFileName ) / 12; // 3504275
+ Vec_Wrd_t * vTruthRes = Vec_WrdAlloc( size + 1 );
+ Vec_Int_t * vConfgRes = Vec_IntAlloc( size );
+ Hsh_IntMan_t * pHash;
+
+ pFile = fopen( pFileName, "rb" );
+ fread( Vec_WrdArray(vTruthRes), sizeof(word), size, pFile );
+ fread( Vec_IntArray(vConfgRes), sizeof(int), size, pFile );
+ vTruthRes->nSize = size;
+ vConfgRes->nSize = size;
+ // create hash table
+ pHash = Hsh_WrdManHashArrayStart( vTruthRes, 1 );
+ // experiment with functions
+
+ // cleanup
+ Hsh_IntManStop( pHash );
+ Vec_WrdFree( vTruthRes );
+ Vec_IntFree( vConfgRes );
+ Abc_PrintTime( 1, "Reading file", Abc_Clock() - clk );
+ return 1;
+}
+
+
+////////////////////////////////////////////////////////////////////////
+/// END OF FILE ///
+////////////////////////////////////////////////////////////////////////
+
+
+ABC_NAMESPACE_IMPL_END
+
diff --git a/src/map/mpm/mpmTruth.c b/src/map/mpm/mpmTruth.c
new file mode 100644
index 00000000..0f9e877f
--- /dev/null
+++ b/src/map/mpm/mpmTruth.c
@@ -0,0 +1,52 @@
+/**CFile****************************************************************
+
+ FileName [mpmTruth.c]
+
+ SystemName [ABC: Logic synthesis and verification system.]
+
+ PackageName [Configurable technology mapper.]
+
+ Synopsis [Truth table manipulation.]
+
+ Author [Alan Mishchenko]
+
+ Affiliation [UC Berkeley]
+
+ Date [Ver. 1.0. Started - June 1, 2013.]
+
+ Revision [$Id: mpmTruth.c,v 1.00 2013/06/01 00:00:00 alanmi Exp $]
+
+***********************************************************************/
+
+#include "mpmInt.h"
+
+ABC_NAMESPACE_IMPL_START
+
+
+////////////////////////////////////////////////////////////////////////
+/// DECLARATIONS ///
+////////////////////////////////////////////////////////////////////////
+
+////////////////////////////////////////////////////////////////////////
+/// FUNCTION DEFINITIONS ///
+////////////////////////////////////////////////////////////////////////
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+
+////////////////////////////////////////////////////////////////////////
+/// END OF FILE ///
+////////////////////////////////////////////////////////////////////////
+
+
+ABC_NAMESPACE_IMPL_END
+
diff --git a/src/map/mpm/mpmUtil.c b/src/map/mpm/mpmUtil.c
new file mode 100644
index 00000000..223d9ec1
--- /dev/null
+++ b/src/map/mpm/mpmUtil.c
@@ -0,0 +1,52 @@
+/**CFile****************************************************************
+
+ FileName [mpmUtil.c]
+
+ SystemName [ABC: Logic synthesis and verification system.]
+
+ PackageName [Configurable technology mapper.]
+
+ Synopsis [Various utilities.]
+
+ Author [Alan Mishchenko]
+
+ Affiliation [UC Berkeley]
+
+ Date [Ver. 1.0. Started - June 1, 2013.]
+
+ Revision [$Id: mpmUtil.c,v 1.00 2013/06/01 00:00:00 alanmi Exp $]
+
+***********************************************************************/
+
+#include "mpmInt.h"
+
+ABC_NAMESPACE_IMPL_START
+
+
+////////////////////////////////////////////////////////////////////////
+/// DECLARATIONS ///
+////////////////////////////////////////////////////////////////////////
+
+////////////////////////////////////////////////////////////////////////
+/// FUNCTION DEFINITIONS ///
+////////////////////////////////////////////////////////////////////////
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+
+////////////////////////////////////////////////////////////////////////
+/// END OF FILE ///
+////////////////////////////////////////////////////////////////////////
+
+
+ABC_NAMESPACE_IMPL_END
+