summaryrefslogtreecommitdiffstats
path: root/src/opt/dau/dauNonDsd.c
diff options
context:
space:
mode:
authorAlan Mishchenko <alanmi@berkeley.edu>2013-10-05 22:44:02 -0700
committerAlan Mishchenko <alanmi@berkeley.edu>2013-10-05 22:44:02 -0700
commita4a1053d9851cf9ef52a5b52818e66b9c1bdba4d (patch)
tree3333b0b56ee4e2444df1ef251ca7005516156bed /src/opt/dau/dauNonDsd.c
parentc9635d029ebc27ce8001c6859d2b992e327ceec7 (diff)
downloadabc-a4a1053d9851cf9ef52a5b52818e66b9c1bdba4d.tar.gz
abc-a4a1053d9851cf9ef52a5b52818e66b9c1bdba4d.tar.bz2
abc-a4a1053d9851cf9ef52a5b52818e66b9c1bdba4d.zip
Towards better Boolean matching.
Diffstat (limited to 'src/opt/dau/dauNonDsd.c')
-rw-r--r--src/opt/dau/dauNonDsd.c642
1 files changed, 642 insertions, 0 deletions
diff --git a/src/opt/dau/dauNonDsd.c b/src/opt/dau/dauNonDsd.c
new file mode 100644
index 00000000..65821027
--- /dev/null
+++ b/src/opt/dau/dauNonDsd.c
@@ -0,0 +1,642 @@
+/**CFile****************************************************************
+
+ FileName [dauNonDsd.c]
+
+ SystemName [ABC: Logic synthesis and verification system.]
+
+ PackageName [DAG-aware unmapping.]
+
+ Synopsis []
+
+ Author [Alan Mishchenko]
+
+ Affiliation [UC Berkeley]
+
+ Date [Ver. 1.0. Started - June 20, 2005.]
+
+ Revision [$Id: dauNonDsd.c,v 1.00 2005/06/20 00:00:00 alanmi Exp $]
+
+***********************************************************************/
+
+#include "dauInt.h"
+#include "misc/util/utilTruth.h"
+
+ABC_NAMESPACE_IMPL_START
+
+////////////////////////////////////////////////////////////////////////
+/// DECLARATIONS ///
+////////////////////////////////////////////////////////////////////////
+
+// the bit count for the first 256 integer numbers
+static int BitCount8[256] = {
+ 0,1,1,2,1,2,2,3,1,2,2,3,2,3,3,4,1,2,2,3,2,3,3,4,2,3,3,4,3,4,4,5,
+ 1,2,2,3,2,3,3,4,2,3,3,4,3,4,4,5,2,3,3,4,3,4,4,5,3,4,4,5,4,5,5,6,
+ 1,2,2,3,2,3,3,4,2,3,3,4,3,4,4,5,2,3,3,4,3,4,4,5,3,4,4,5,4,5,5,6,
+ 2,3,3,4,3,4,4,5,3,4,4,5,4,5,5,6,3,4,4,5,4,5,5,6,4,5,5,6,5,6,6,7,
+ 1,2,2,3,2,3,3,4,2,3,3,4,3,4,4,5,2,3,3,4,3,4,4,5,3,4,4,5,4,5,5,6,
+ 2,3,3,4,3,4,4,5,3,4,4,5,4,5,5,6,3,4,4,5,4,5,5,6,4,5,5,6,5,6,6,7,
+ 2,3,3,4,3,4,4,5,3,4,4,5,4,5,5,6,3,4,4,5,4,5,5,6,4,5,5,6,5,6,6,7,
+ 3,4,4,5,4,5,5,6,4,5,5,6,5,6,6,7,4,5,5,6,5,6,6,7,5,6,6,7,6,7,7,8
+};
+static inline BitCount16( int i ) { return BitCount8[i & 0xFF] + BitCount8[i >> 8]; }
+
+////////////////////////////////////////////////////////////////////////
+/// FUNCTION DEFINITIONS ///
+////////////////////////////////////////////////////////////////////////
+
+/**Function*************************************************************
+
+ Synopsis [Checks decomposability with given BS variables.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+static inline void Dau_DecGetMinterm( word * p, int g, int nVarsS, int uMaskAll )
+{
+ int m, c, v;
+ for ( m = c = v = 0; v < nVarsS; v++ )
+ if ( !((uMaskAll >> v) & 1) ) // not shared bound set variable
+ {
+ if ( (g >> v) & 1 )
+ m |= (1 << c);
+ c++;
+ }
+ assert( c >= 2 );
+ p[m>>6] |= (((word)1)<<(m & 63));
+}
+static inline int Dau_DecCheckSet5( word * p, int nVars, int nVarsF, int uMaskAll, int uMaskValue, word * pCof0, word * pCof1, word * pDec )
+{
+ int fFound0 = 0, fFound1 = 0;
+ int g, gMax = (1 << (nVars - nVarsF));
+ int Shift = 6 - nVarsF, Mask = (1 << Shift) - 1;
+ word Mask2 = (((word)1) << (1 << nVarsF)) - 1;
+ word Cof0 = 0, Cof1 = 0, Value;
+ assert( nVarsF >= 1 && nVarsF <= 5 );
+ if ( pDec ) *pDec = 0;
+ for ( g = 0; g < gMax; g++ )
+ if ( (g & uMaskAll) == uMaskValue ) // this minterm g matches shared variable minterm uMaskValue
+ {
+ Value = (p[g>>Shift] >> ((g&Mask)<<nVarsF)) & Mask2;
+ if ( !fFound0 )
+ Cof0 = Value, fFound0 = 1;
+ else if ( Cof0 == Value )
+ continue;
+ else if ( !fFound1 )
+ {
+ Cof1 = Value, fFound1 = 1;
+ if ( pDec ) Dau_DecGetMinterm( pDec, g, nVars-nVarsF, uMaskAll );
+ }
+ else if ( Cof1 == Value )
+ {
+ if ( pDec ) Dau_DecGetMinterm( pDec, g, nVars-nVarsF, uMaskAll );
+ continue;
+ }
+ else
+ return 0;
+ }
+ if ( pCof0 )
+ {
+ assert( fFound0 );
+ Cof1 = fFound1 ? Cof1 : Cof0;
+ *pCof0 = Abc_Tt6Stretch( Cof0, nVarsF );
+ *pCof1 = Abc_Tt6Stretch( Cof1, nVarsF );
+ }
+ return 1;
+}
+static inline int Dau_DecCheckSet6( word * p, int nVars, int nVarsF, int uMaskAll, int uMaskValue, word * pCof0, word * pCof1, word * pDec )
+{
+ int fFound0 = 0, fFound1 = 0;
+ int g, gMax = (1 << (nVars - nVarsF));
+ int nWords = Abc_TtWordNum(nVarsF);
+ word * Cof0 = NULL, * Cof1 = NULL;
+ assert( nVarsF >= 6 && nVarsF <= nVars - 2 );
+ if ( pDec ) *pDec = 0;
+ for ( g = 0; g < gMax; g++ )
+ if ( (g & uMaskAll) == uMaskValue )
+ {
+ if ( !fFound0 )
+ Cof0 = p + g * nWords, fFound0 = 1;
+ else if ( !memcmp(Cof0, p + g * nWords, sizeof(word) * nWords) )
+ continue;
+ else if ( !fFound1 )
+ {
+ Cof1 = p + g * nWords, fFound1 = 1;
+ if ( pDec ) Dau_DecGetMinterm( pDec, g, nVars-nVarsF, uMaskAll );
+ }
+ else if ( !memcmp(Cof1, p + g * nWords, sizeof(word) * nWords) )
+ {
+ if ( pDec ) Dau_DecGetMinterm( pDec, g, nVars-nVarsF, uMaskAll );
+ continue;
+ }
+ else
+ return 0;
+ }
+ if ( pCof0 )
+ {
+ assert( fFound0 );
+ Cof1 = fFound1 ? Cof1 : Cof0;
+ memcpy( pCof0, Cof0, sizeof(word) * nWords );
+ memcpy( pCof1, Cof1, sizeof(word) * nWords );
+ }
+ return 1;
+}
+static inline int Dau_DecCheckSetAny( word * p, int nVars, int nVarsF, int uMaskAll, int uMaskValue, word * pCof0, word * pCof1, word * pDec )
+{
+ assert( nVarsF >= 1 && nVarsF <= nVars - 2 );
+ if ( nVarsF < 6 )
+ return Dau_DecCheckSet5( p, nVars, nVarsF, uMaskAll, uMaskValue, pCof0, pCof1, pDec );
+ else
+ return Dau_DecCheckSet6( p, nVars, nVarsF, uMaskAll, uMaskValue, pCof0, pCof1, pDec );
+}
+int Dau_DecCheckSetTop( word * p, int nVars, int nVarsF, int nVarsB, int nVarsS, int maskS, word ** pCof0, word ** pCof1, word ** pDec )
+{
+ int i, pVarsS[16];
+ int v, m, mMax = (1 << nVarsS), uMaskValue;
+ assert( nVars >= 3 && nVars <= 16 );
+ assert( nVars == nVarsF + nVarsB );
+ assert( nVarsF >= 1 && nVarsF <= nVars - 2 );
+ assert( nVarsB >= 2 && nVarsB <= nVars - 1 );
+ assert( nVarsS >= 0 && nVarsS <= nVarsB - 2 );
+ if ( nVarsS == 0 )
+ return Dau_DecCheckSetAny( p, nVars, nVarsF, 0, 0, pCof0? pCof0[0] : 0, pCof1? pCof1[0] : 0, pDec? pDec[0] : 0 );
+ // collect shared variables
+ assert( maskS > 0 && maskS < (1 << nVarsB) );
+ for ( i = 0, v = 0; v < nVarsB; v++ )
+ if ( (maskS >> v) & 1 )
+ pVarsS[i++] = v;
+ assert( i == nVarsS );
+ // go through shared set minterms
+ for ( m = 0; m < mMax; m++ )
+ {
+ // generate share set mask
+ uMaskValue = 0;
+ for ( v = 0; v < nVarsS; v++ )
+ if ( (m >> v) & 1 )
+ uMaskValue |= (1 << pVarsS[v]);
+ assert( (maskS & uMaskValue) == uMaskValue );
+ // check decomposition
+ if ( !Dau_DecCheckSetAny( p, nVars, nVarsF, maskS, uMaskValue, pCof0? pCof0[m] : 0, pCof1? pCof1[m] : 0, pDec? pDec[m] : 0 ) )
+ return 0;
+ }
+ return 1;
+}
+
+
+/**Function*************************************************************
+
+ Synopsis [Variable sets.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+static inline unsigned Dau_DecCreateSet( int * pVarsB, int sizeB, int maskS )
+{
+ unsigned uSet = 0; int v;
+ for ( v = 0; v < sizeB; v++ )
+ {
+ uSet |= (1 << (pVarsB[v] << 1));
+ if ( (maskS >> v) & 1 )
+ uSet |= (1 << ((pVarsB[v] << 1)+1));
+ }
+ return uSet;
+}
+static inline int Dau_DecSetHas01( unsigned Mask )
+{
+ return (Mask & ((~Mask) >> 1) & 0x55555555);
+}
+static inline int Dau_DecSetIsContained( Vec_Int_t * vSets, unsigned New )
+// Old=abcD contains New=abcDE
+// Old=abcD contains New=abCD
+{
+ unsigned Old;
+ int i, Entry;
+ Vec_IntForEachEntry( vSets, Entry, i )
+ {
+ Old = (unsigned)Entry;
+ if ( (Old & ~New) == 0 && !Dau_DecSetHas01(~Old & New))
+ return 1;
+ }
+ return 0;
+}
+void Dau_DecPrintSet( unsigned set, int nVars, int fNewLine )
+{
+ int v, Counter = 0;
+ int nUnique = 0, nShared = 0, nFree = 0;
+ for ( v = 0; v < nVars; v++ )
+ {
+ int Value = ((set >> (v << 1)) & 3);
+ if ( Value == 1 )
+ nUnique++;
+ else if ( Value == 3 )
+ nShared++;
+ else if ( Value == 0 )
+ nFree++;
+ else assert( 0 );
+ }
+ printf( "S =%2d D =%2d C =%2d ", nShared, nUnique+nShared, nShared+nFree+1 );
+
+ printf( "x=" );
+ for ( v = 0; v < nVars; v++ )
+ {
+ int Value = ((set >> (v << 1)) & 3);
+ if ( Value == 1 )
+ printf( "%c", 'a' + v ), Counter++;
+ else if ( Value == 3 )
+ printf( "%c", 'A' + v ), Counter++;
+ else assert( Value == 0 );
+ }
+ printf( " y=x" );
+ for ( v = 0; v < nVars; v++ )
+ {
+ int Value = ((set >> (v << 1)) & 3);
+ if ( Value == 0 )
+ printf( "%c", 'a' + v ), Counter++;
+ else if ( Value == 3 )
+ printf( "%c", 'A' + v ), Counter++;
+ }
+ for ( ; Counter < 15; Counter++ )
+ printf( " " );
+ if ( fNewLine )
+ printf( "\n" );
+}
+unsigned Dau_DecReadSet( char * pStr )
+{
+ unsigned uSet = 0; int v;
+ for ( v = 0; pStr[v]; v++ )
+ {
+ if ( pStr[v] >= 'a' && pStr[v] <= 'z' )
+ uSet |= (1 << ((pStr[v] - 'a') << 1));
+ else if ( pStr[v] >= 'A' && pStr[v] <= 'Z' )
+ uSet |= (1 << ((pStr[v] - 'a') << 1)) | (1 << (((pStr[v] - 'a') << 1)+1));
+ else break;
+ }
+ return uSet;
+}
+void Dau_DecPrintSets( Vec_Int_t * vSets, int nVars )
+{
+ int i, Entry;
+ printf( "The set contains %d entries:\n", Vec_IntSize(vSets) );
+ Vec_IntForEachEntry( vSets, Entry, i )
+ Dau_DecPrintSet( (unsigned)Entry, nVars, 1 );
+ printf( "\n" );
+}
+
+/**Function*************************************************************
+
+ Synopsis [Find decomposable bound-sets of the given function.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Dau_DecMoveFreeToLSB( word * p, int nVars, int * V2P, int * P2V, int maskB, int sizeB )
+{
+ int v, c = 0;
+ for ( v = 0; v < nVars; v++ )
+ if ( !((maskB >> v) & 1) )
+ Abc_TtMoveVar( p, nVars, V2P, P2V, v, c++ );
+ assert( c == nVars - sizeB );
+}
+Vec_Int_t * Dau_DecFindSets( word * p, int nVars )
+{
+ Vec_Int_t * vSets = Vec_IntAlloc( 32 );
+ int V2P[16], P2V[16], pVarsB[16];
+ int Limit = (1 << nVars);
+ int c, v, sizeB, sizeS, maskB, maskS;
+ unsigned setMixed;
+ for ( v = 0; v < nVars; v++ )
+ assert( Abc_TtHasVar( p, nVars, v ) );
+ // initialize permutation
+ for ( v = 0; v < nVars; v++ )
+ V2P[v] = P2V[v] = v;
+ // iterate through bound sets of each size in increasing order
+ for ( sizeB = 2; sizeB < nVars; sizeB++ ) // bound set size
+ for ( maskB = 0; maskB < Limit; maskB++ ) // bound set
+ if ( BitCount16(maskB) == sizeB )
+ {
+ // permute variables to have bound set on top
+ Dau_DecMoveFreeToLSB( p, nVars, V2P, P2V, maskB, sizeB );
+ // collect bound set vars on levels nVars-sizeB to nVars-1
+ for ( c = 0; c < sizeB; c++ )
+ pVarsB[c] = P2V[nVars-sizeB+c];
+ // check disjoint
+ if ( Dau_DecCheckSetTop(p, nVars, nVars-sizeB, sizeB, 0, 0, NULL, NULL, NULL) )
+ {
+ Vec_IntPush( vSets, Dau_DecCreateSet(pVarsB, sizeB, 0) );
+ continue;
+ }
+ if ( sizeB == 2 )
+ continue;
+ // iterate through shared sets of each size in the increasing order
+ for ( sizeS = 1; sizeS <= sizeB - 2; sizeS++ ) // shared set size
+// sizeS = 1;
+ for ( maskS = 0; maskS < (1 << sizeB); maskS++ ) // shared set
+ if ( BitCount16(maskS) == sizeS )
+ {
+ setMixed = Dau_DecCreateSet( pVarsB, sizeB, maskS );
+// printf( "Considering %10d ", setMixed );
+// Dau_DecPrintSet( setMixed, nVars );
+ // check if it exists
+ if ( Dau_DecSetIsContained(vSets, setMixed) )
+ continue;
+ // check if it can be added
+ if ( Dau_DecCheckSetTop(p, nVars, nVars-sizeB, sizeB, sizeS, maskS, NULL, NULL, NULL) )
+ Vec_IntPush( vSets, setMixed );
+ }
+ }
+ return vSets;
+}
+void Dau_DecFindSetsTest2()
+{
+ Vec_Int_t * vSets;
+ word a0 = (~s_Truths6[1] & s_Truths6[2]) | (s_Truths6[1] & s_Truths6[3]);
+ word a1 = (~s_Truths6[1] & s_Truths6[4]) | (s_Truths6[1] & s_Truths6[5]);
+ word t = (~s_Truths6[0] & a0) | (s_Truths6[0] & a1);
+// word t = ABC_CONST(0x7EFFFFFFFFFFFF7E); // and(gam1,gam2)
+// word t = ABC_CONST(0xB0F0BBFFB0F0BAFE); // some funct
+// word t = ABC_CONST(0x2B0228022B022802); // 5-var non-dec0x0F7700000F770000
+// word t = ABC_CONST(0x0F7700000F770000); // (!<(ab)cd>e)
+// word t = ABC_CONST(0x7F00000000000000); // (!(abc)def)
+ int nVars = 5;
+
+ vSets = Dau_DecFindSets( &t, nVars );
+ Dau_DecPrintSets( vSets, nVars );
+ Vec_IntFree( vSets );
+}
+
+
+/**Function*************************************************************
+
+ Synopsis [Replaces variables in the string.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Dau_DecVarReplace( char * pStr, int * pPerm, int nVars )
+{
+ int v;
+ for ( v = 0; pStr[v]; v++ )
+ if ( pStr[v] >= 'a' && pStr[v] <= 'z' )
+ {
+ assert( pStr[v] - 'a' < nVars );
+ pStr[v] = 'a' + pPerm[pStr[v] - 'a'];
+ }
+}
+
+/**Function*************************************************************
+
+ Synopsis [Decomposes with the given bound-set.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+int Dau_DecDecomposeSet( word * pInit, int nVars, unsigned uSet, word * pComp, word * pDec, int * pPermC, int * pPermD, int * pnVarsC, int * pnVarsD )
+{
+ word p[1<<13], Cof[64], Cof0[64], Cof1[64], Decs[64];
+ word * pCof0[64], * pCof1[64], * pDecs[64], MintC, MintD;
+ int V2P[16], P2V[16], pVarsU[16], pVarsS[16], pVarsF[16];
+ int nVarsU = 0, nVarsS = 0, nVarsF = 0;
+ int nWords = Abc_TtWordNum(nVars);
+ int v, d, c, Status, nDecs;
+ assert( nVars <= 16 );
+ for ( v = 0; v < nVars; v++ )
+ V2P[v] = P2V[v] = v;
+ memcpy( p, pInit, sizeof(word) * nWords );
+ // sort variables
+ for ( v = 0; v < nVars; v++ )
+ {
+ int Value = (uSet >> (v<<1)) & 3;
+ if ( Value == 0 )
+ pVarsF[nVarsF++] = v;
+ else if ( Value == 1 )
+ pVarsU[nVarsU++] = v;
+ else if ( Value == 3 )
+ pVarsS[nVarsS++] = v;
+ else assert(0);
+ }
+ assert( nVarsS >= 0 && nVarsS <= 6 );
+ assert( nVarsF + nVarsS + 1 <= 6 );
+ assert( nVarsU + nVarsS <= 6 );
+ // init space for decomposition functions
+ nDecs = (1 << nVarsS);
+ for ( d = 0; d < nDecs; d++ )
+ {
+ pCof0[d] = Cof0 + d;
+ pCof1[d] = Cof1 + d;
+ pDecs[d] = Decs + d;
+ }
+ // permute variables
+ c = 0;
+ for ( v = 0; v < nVarsF; v++ )
+ Abc_TtMoveVar( p, nVars, V2P, P2V, pVarsF[v], c++ );
+ for ( v = 0; v < nVarsS; v++ )
+ Abc_TtMoveVar( p, nVars, V2P, P2V, pVarsS[v], c++ );
+ for ( v = 0; v < nVarsU; v++ )
+ Abc_TtMoveVar( p, nVars, V2P, P2V, pVarsU[v], c++ );
+ assert( c == nVars );
+ // check decomposition
+ Status = Dau_DecCheckSetTop( p, nVars, nVarsF, nVarsS+nVarsU, nVarsS, Abc_InfoMask(nVarsS), pCof0, pCof1, pDecs );
+ if ( !Status )
+ return 0;
+ // compute cofactors
+ assert( nVarsF + nVarsS < 6 );
+ for ( d = 0; d < nDecs; d++ )
+ {
+ Cof[d] = (pCof1[d][0] & s_Truths6[nVarsF + nVarsS]) | (pCof0[d][0] & ~s_Truths6[nVarsF + nVarsS]);
+ pDecs[d][0] = Abc_Tt6Stretch( pDecs[d][0], nVarsU );
+ }
+ // compute the resulting functions
+ pComp[0] = 0;
+ pDec[0] = 0;
+ for ( d = 0; d < nDecs; d++ )
+ {
+ // compute minterms for composition/decomposition function
+ MintC = MintD = ~((word)0);
+ for ( v = 0; v < nVarsS; v++ )
+ {
+ MintC &= ((d >> v) & 1) ? s_Truths6[nVarsF+v] : ~s_Truths6[nVarsF+v];
+ MintD &= ((d >> v) & 1) ? s_Truths6[nVarsU+v] : ~s_Truths6[nVarsU+v];
+ }
+ // derive functions
+ pComp[0] |= MintC & Cof[d];
+ pDec[0] |= MintD & pDecs[d][0];
+ }
+ // derive variable permutations
+ if ( pPermC )
+ {
+ for ( v = 0; v < nVarsF; v++ )
+ pPermC[v] = pVarsF[v];
+ for ( v = 0; v < nVarsS; v++ )
+ pPermC[nVarsF+v] = pVarsS[v];
+ pPermC[nVarsF + nVarsS] = nVars;
+ }
+ if ( pPermD )
+ {
+ for ( v = 0; v < nVarsU; v++ )
+ pPermD[v] = pVarsU[v];
+ for ( v = 0; v < nVarsS; v++ )
+ pPermD[nVarsU+v] = pVarsS[v];
+ }
+ if ( pnVarsC )
+ *pnVarsC = nVarsF + nVarsS + 1;
+ if ( pnVarsD )
+ *pnVarsD = nVarsU + nVarsS;
+ return 1;
+}
+
+
+/**Function*************************************************************
+
+ Synopsis [Testing procedures.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+int Dau_DecVerify( word * pInit, int nVars, char * pDsdC, char * pDsdD )
+{
+ word pC[1<<13], pD[1<<13], pRes[1<<13]; // max = 16
+ int nWordsC = Abc_TtWordNum(nVars+1);
+ int nWordsD = Abc_TtWordNum(nVars);
+ assert( nVars < 16 );
+ memcpy( pC, Dau_DsdToTruth(pDsdC, nVars+1), sizeof(word) * nWordsC );
+ memcpy( pD, Dau_DsdToTruth(pDsdD, nVars), sizeof(word) * nWordsD );
+// Dau_DsdPrintFromTruth( stdout, pC, nVars+1 ); //printf( "\n" );
+// Dau_DsdPrintFromTruth( stdout, pD, nVars ); //printf( "\n" );
+ if ( nVars >= 6 )
+ {
+ assert( nWordsD >= 1 );
+ assert( nWordsC > 1 );
+ Abc_TtMux( pRes, pD, pC + nWordsD, pC, nWordsD );
+ }
+ else
+ {
+ word pC0 = Abc_Tt6Stretch( pC[0], nVars );
+ word pC1 = Abc_Tt6Stretch( (pC[0] >> (1 << nVars)), nVars );
+ Abc_TtMux( pRes, pD, &pC1, &pC0, nWordsD );
+ }
+ if ( Abc_TtEqual(pInit, pRes, nWordsD) )
+ printf( " Verification successful\n" );
+ else
+ printf( " Verification failed\n" );
+ return 1;
+}
+int Dau_DecPerform( word * p, int nVars, unsigned uSet )
+{
+ word tComp = 0, tDec = 0;
+ char pDsdC[1000], pDsdD[1000];
+ int pPermC[16], pPermD[16], nVarsC, nVarsD;
+ int status, ResC, ResD;
+ status = Dau_DecDecomposeSet( p, nVars, uSet, &tComp, &tDec, pPermC, pPermD, &nVarsC, &nVarsD );
+// Dau_DecPrintSet( uSet, nVars );
+// printf( "Decomposition %s\n", status ? "exists" : "does not exist" );
+ if ( !status )
+ {
+ printf( " Decomposition does not exist\n" );
+ return 0;
+ }
+// Dau_DsdPrintFromTruth( stdout, p, nVars ); //printf( "\n" );
+// Dau_DsdPrintFromTruth( stdout, &tComp, nVars ); //printf( "\n" );
+// Dau_DsdPrintFromTruth( stdout, &tDec, nVars ); //printf( "\n" );
+ // decompose
+ ResC = Dau_DsdDecompose( &tComp, nVarsC, 0, 1, pDsdC );
+ ResD = Dau_DsdDecompose( &tDec, nVarsD, 0, 1, pDsdD );
+/*
+ printf( "%s\n", pDsdC );
+ printf( "%s\n", pDsdD );
+ for ( v = 0; v < nVarsC; v++ )
+ printf( "%d ", pPermC[v] );
+ printf( "\n" );
+ for ( v = 0; v < nVarsD; v++ )
+ printf( "%d ", pPermD[v] );
+ printf( "\n" );
+*/
+ // replace variables
+ Dau_DecVarReplace( pDsdD, pPermD, nVarsD );
+ Dau_DecVarReplace( pDsdC, pPermC, nVarsC );
+ printf( "%24s ", pDsdD );
+ printf( "%24s ", pDsdC );
+ Dau_DecVerify( p, nVars, pDsdC, pDsdD );
+ return 1;
+}
+void Dau_DecTrySets( word * p, int nVars )
+{
+ Vec_Int_t * vSets;
+ word t0 = *p;
+ int i, Entry;
+ vSets = Dau_DecFindSets( p, nVars );
+ Dau_DsdPrintFromTruth( stdout, &t0, nVars );
+ printf( "There are %d support-reducing decompositions:\n", Vec_IntSize(vSets) );
+ Vec_IntForEachEntry( vSets, Entry, i )
+ {
+ unsigned uSet = (unsigned)Entry;
+ Dau_DecPrintSet( uSet, nVars, 0 );
+ Dau_DecPerform( &t0, nVars, uSet );
+ }
+// printf( "\n" );
+ Vec_IntFree( vSets );
+}
+
+void Dau_DecFindSetsTest3()
+{
+ word a0 = (~s_Truths6[1] & s_Truths6[2]) | (s_Truths6[1] & s_Truths6[3]);
+ word a1 = (~s_Truths6[1] & s_Truths6[4]) | (s_Truths6[1] & s_Truths6[5]);
+ word t = (~s_Truths6[0] & a0) | (s_Truths6[0] & a1);
+// word t = ABC_CONST(0x0F7700000F770000); // (!<(ab)cd>e)
+ int nVars = 6;
+ char * pStr = "Bcd";
+// char * pStr = "Abcd";
+// char * pStr = "ab";
+ unsigned uSet = Dau_DecReadSet( pStr );
+ Dau_DecPerform( &t, nVars, uSet );
+}
+
+void Dau_DecFindSetsTest()
+{
+ int nVars = 6;
+// word a0 = (~s_Truths6[1] & s_Truths6[2]) | (s_Truths6[1] & s_Truths6[3]);
+// word a1 = (~s_Truths6[1] & s_Truths6[4]) | (s_Truths6[1] & s_Truths6[5]);
+// word t = (~s_Truths6[0] & a0) | (s_Truths6[0] & a1);
+// word t = ABC_CONST(0x7EFFFFFFFFFFFF7E); // and(gam1,gam2)
+// word t = ABC_CONST(0xB0F0BBFFB0F0BAFE); // some funct
+// word t = ABC_CONST(0x00000000901FFFFF); // some funct
+ word t = ABC_CONST(0x000030F00D0D3FFF); // some funct
+// word t = ABC_CONST(0x00000000690006FF); // some funct
+// word t = ABC_CONST(0x7000F80007FF0FFF); // some funct
+// word t = ABC_CONST(0x4133CB334133CB33); // some funct 5 var
+// word t = ABC_CONST(0x2B0228022B022802); // 5-var non-dec0x0F7700000F770000
+// word t = ABC_CONST(0x0F7700000F770000); // (!<(ab)cd>e)
+// word t = ABC_CONST(0x7F00000000000000); // (!(abc)def)
+ Dau_DecTrySets( &t, nVars );
+}
+
+
+////////////////////////////////////////////////////////////////////////
+/// END OF FILE ///
+////////////////////////////////////////////////////////////////////////
+
+
+ABC_NAMESPACE_IMPL_END
+