diff options
author | Miodrag Milanovic <mmicko@gmail.com> | 2022-11-09 08:42:08 +0100 |
---|---|---|
committer | Miodrag Milanovic <mmicko@gmail.com> | 2022-11-09 08:42:08 +0100 |
commit | be9a35c0363174a7cef21d55ed80d92a9ef95ab1 (patch) | |
tree | 3bf5d3eee39f46d72d3196386eadd8788f742e4b | |
parent | ab5b16ede2ff3a4ab5209df24db2c76700899684 (diff) | |
parent | 70cb339f869e485802159d7f2b886130793556c4 (diff) | |
download | abc-be9a35c0363174a7cef21d55ed80d92a9ef95ab1.tar.gz abc-be9a35c0363174a7cef21d55ed80d92a9ef95ab1.tar.bz2 abc-be9a35c0363174a7cef21d55ed80d92a9ef95ab1.zip |
Merge remote-tracking branch 'upstream/master' into yosys-experimental
32 files changed, 4115 insertions, 81 deletions
@@ -88,10 +88,6 @@ LINK32=link.exe # PROP Default_Filter "cpp;c;cxx;rc;def;r;odl;idl;hpj;bat" # Begin Source File -SOURCE=.\src\aig\gia\giaSif.c -# End Source File -# Begin Source File - SOURCE=.\src\base\main\main.c # End Source File # End Group @@ -5191,6 +5191,10 @@ SOURCE=.\src\aig\gia\giaSatoko.c # End Source File # Begin Source File +SOURCE=.\src\aig\gia\giaSatSyn.c +# End Source File +# Begin Source File + SOURCE=.\src\aig\gia\giaScl.c # End Source File # Begin Source File @@ -5295,6 +5299,10 @@ SOURCE=.\src\aig\gia\giaTsim.c # End Source File # Begin Source File +SOURCE=.\src\aig\gia\giaTtopt.cpp +# End Source File +# Begin Source File + SOURCE=.\src\aig\gia\giaUnate.c # End Source File # Begin Source File diff --git a/src/aig/gia/gia.h b/src/aig/gia/gia.h index 488f12cf..942c9eb7 100644 --- a/src/aig/gia/gia.h +++ b/src/aig/gia/gia.h @@ -527,18 +527,22 @@ static inline int Gia_ObjDiff1( Gia_Obj_t * pObj ) { static inline int Gia_ObjFaninC0( Gia_Obj_t * pObj ) { return pObj->fCompl0; } static inline int Gia_ObjFaninC1( Gia_Obj_t * pObj ) { return pObj->fCompl1; } static inline int Gia_ObjFaninC2( Gia_Man_t * p, Gia_Obj_t * pObj ) { return p->pMuxes && Abc_LitIsCompl(p->pMuxes[Gia_ObjId(p, pObj)]); } +static inline int Gia_ObjFaninC( Gia_Obj_t * pObj, int n ) { return n ? Gia_ObjFaninC1(pObj) : Gia_ObjFaninC0(pObj); } static inline Gia_Obj_t * Gia_ObjFanin0( Gia_Obj_t * pObj ) { return pObj - pObj->iDiff0; } static inline Gia_Obj_t * Gia_ObjFanin1( Gia_Obj_t * pObj ) { return pObj - pObj->iDiff1; } static inline Gia_Obj_t * Gia_ObjFanin2( Gia_Man_t * p, Gia_Obj_t * pObj ) { return p->pMuxes ? Gia_ManObj(p, Abc_Lit2Var(p->pMuxes[Gia_ObjId(p, pObj)])) : NULL; } +static inline Gia_Obj_t * Gia_ObjFanin( Gia_Obj_t * pObj, int n ) { return n ? Gia_ObjFanin1(pObj) : Gia_ObjFanin0(pObj); } static inline Gia_Obj_t * Gia_ObjChild0( Gia_Obj_t * pObj ) { return Gia_NotCond( Gia_ObjFanin0(pObj), Gia_ObjFaninC0(pObj) ); } static inline Gia_Obj_t * Gia_ObjChild1( Gia_Obj_t * pObj ) { return Gia_NotCond( Gia_ObjFanin1(pObj), Gia_ObjFaninC1(pObj) ); } static inline Gia_Obj_t * Gia_ObjChild2( Gia_Man_t * p, Gia_Obj_t * pObj ) { return Gia_NotCond( Gia_ObjFanin2(p, pObj), Gia_ObjFaninC2(p, pObj) ); } static inline int Gia_ObjFaninId0( Gia_Obj_t * pObj, int ObjId ) { return ObjId - pObj->iDiff0; } static inline int Gia_ObjFaninId1( Gia_Obj_t * pObj, int ObjId ) { return ObjId - pObj->iDiff1; } static inline int Gia_ObjFaninId2( Gia_Man_t * p, int ObjId ) { return (p->pMuxes && p->pMuxes[ObjId]) ? Abc_Lit2Var(p->pMuxes[ObjId]) : -1; } +static inline int Gia_ObjFaninId( Gia_Obj_t * pObj, int ObjId, int n ){ return n ? Gia_ObjFaninId1(pObj, ObjId) : Gia_ObjFaninId0(pObj, ObjId); } static inline int Gia_ObjFaninId0p( Gia_Man_t * p, Gia_Obj_t * pObj ) { return Gia_ObjFaninId0( pObj, Gia_ObjId(p, pObj) ); } static inline int Gia_ObjFaninId1p( Gia_Man_t * p, Gia_Obj_t * pObj ) { return Gia_ObjFaninId1( pObj, Gia_ObjId(p, pObj) ); } static inline int Gia_ObjFaninId2p( Gia_Man_t * p, Gia_Obj_t * pObj ) { return (p->pMuxes && p->pMuxes[Gia_ObjId(p, pObj)]) ? Abc_Lit2Var(p->pMuxes[Gia_ObjId(p, pObj)]) : -1; } +static inline int Gia_ObjFaninIdp( Gia_Man_t * p, Gia_Obj_t * pObj, int n){ return n ? Gia_ObjFaninId1p(p, pObj) : Gia_ObjFaninId0p(p, pObj); } static inline int Gia_ObjFaninLit0( Gia_Obj_t * pObj, int ObjId ) { return Abc_Var2Lit( Gia_ObjFaninId0(pObj, ObjId), Gia_ObjFaninC0(pObj) ); } static inline int Gia_ObjFaninLit1( Gia_Obj_t * pObj, int ObjId ) { return Abc_Var2Lit( Gia_ObjFaninId1(pObj, ObjId), Gia_ObjFaninC1(pObj) ); } static inline int Gia_ObjFaninLit2( Gia_Man_t * p, int ObjId ) { return (p->pMuxes && p->pMuxes[ObjId]) ? p->pMuxes[ObjId] : -1; } @@ -1544,6 +1548,9 @@ extern Gia_Man_t * Gia_ManReadMiniAig( char * pFileName, int fGiaSimple extern void Gia_ManWriteMiniAig( Gia_Man_t * pGia, char * pFileName ); extern Gia_Man_t * Gia_ManReadMiniLut( char * pFileName ); extern void Gia_ManWriteMiniLut( Gia_Man_t * pGia, char * pFileName ); +/*=== giaMinLut.c ===========================================================*/ +extern word * Gia_ManCountFraction( Gia_Man_t * p, Vec_Wrd_t * vSimI, Vec_Int_t * vSupp, int Thresh, int fVerbose, int * pCare ); +extern Vec_Int_t * Gia_ManCollectSuppNew( Gia_Man_t * p, int iOut, int nOuts ); /*=== giaMuxes.c ===========================================================*/ extern void Gia_ManCountMuxXor( Gia_Man_t * p, int * pnMuxes, int * pnXors ); extern void Gia_ManPrintMuxStats( Gia_Man_t * p ); @@ -1754,6 +1761,10 @@ extern int Gia_ManCountPosWithNonZeroDrivers( Gia_Man_t * p ); extern void Gia_ManUpdateCopy( Vec_Int_t * vCopy, Gia_Man_t * p ); extern Vec_Int_t * Gia_ManComputeDistance( Gia_Man_t * p, int iObj, Vec_Int_t * vObjs, int fVerbose ); +/*=== giaTtopt.c ===========================================================*/ +extern Gia_Man_t * Gia_ManTtopt( Gia_Man_t * p, int nIns, int nOuts, int nRounds ); +extern Gia_Man_t * Gia_ManTtoptCare( Gia_Man_t * p, int nIns, int nOuts, int nRounds, char * pFileName, int nRarity ); + /*=== giaCTas.c ===========================================================*/ typedef struct Tas_Man_t_ Tas_Man_t; extern Tas_Man_t * Tas_ManAlloc( Gia_Man_t * pAig, int nBTLimit ); @@ -1763,7 +1774,6 @@ extern void Tas_ManSatPrintStats( Tas_Man_t * p ); extern int Tas_ManSolve( Tas_Man_t * p, Gia_Obj_t * pObj, Gia_Obj_t * pObj2 ); extern int Tas_ManSolveArray( Tas_Man_t * p, Vec_Ptr_t * vObjs ); - ABC_NAMESPACE_HEADER_END diff --git a/src/aig/gia/giaCut.c b/src/aig/gia/giaCut.c index 7ee795b6..19e2d8fc 100644 --- a/src/aig/gia/giaCut.c +++ b/src/aig/gia/giaCut.c @@ -20,6 +20,7 @@ #include "gia.h" #include "misc/util/utilTruth.h" +#include "misc/vec/vecHsh.h" ABC_NAMESPACE_IMPL_START @@ -29,7 +30,7 @@ ABC_NAMESPACE_IMPL_START //////////////////////////////////////////////////////////////////////// #define GIA_MAX_CUTSIZE 8 -#define GIA_MAX_CUTNUM 51 +#define GIA_MAX_CUTNUM 65 #define GIA_MAX_TT_WORDS ((GIA_MAX_CUTSIZE > 6) ? 1 << (GIA_MAX_CUTSIZE-6) : 1) #define GIA_CUT_NO_LEAF 0xF @@ -778,6 +779,218 @@ void Gia_ManExtractTest( Gia_Man_t * pGia ) Abc_PrintTime( 0, "Creating windows", Abc_Clock() - clk ); } +/**Function************************************************************* + + Synopsis [Extract a given number of cuts.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Gia_StoCutPrint( int * pCut ) +{ + int v; + printf( "{" ); + for ( v = 1; v <= pCut[0]; v++ ) + printf( " %d", pCut[v] ); + printf( " }\n" ); +} +void Gia_StoPrintCuts( Vec_Int_t * vThis, int iObj, int nCutSize ) +{ + int i, * pCut; + printf( "Cuts of node %d (size = %d):\n", iObj, nCutSize ); + Sdb_ForEachCut( Vec_IntArray(vThis), pCut, i ) + if ( !nCutSize || pCut[0] == nCutSize ) + Gia_StoCutPrint( pCut ); +} +Vec_Wec_t * Gia_ManFilterCuts( Gia_Man_t * pGia, Vec_Wec_t * vStore, int nCutSize, int nCuts ) +{ + abctime clkStart = Abc_Clock(); + Vec_Wec_t * vCutsSel = Vec_WecAlloc( nCuts ); + Vec_Int_t * vLevel, * vCut = Vec_IntAlloc( 10 ); + Vec_Wec_t * vCuts = Vec_WecAlloc( 1000 ); + Hsh_VecMan_t * p = Hsh_VecManStart( 1000 ); int i, s; + Vec_WecForEachLevel( vStore, vLevel, i ) if ( Vec_IntSize(vLevel) ) + { + int v, k, * pCut, Value; + Sdb_ForEachCut( Vec_IntArray(vLevel), pCut, k ) + { + if ( pCut[0] < 2 ) + continue; + + for ( v = 1; v <= pCut[0]; v++ ) + if ( pCut[v] < 9 ) + break; + if ( v <= pCut[0] ) + continue; + + Vec_IntClear( vCut ); + Vec_IntPushArray( vCut, pCut+1, pCut[0] ); + Value = Hsh_VecManAdd( p, vCut ); + if ( Value == Vec_WecSize(vCuts) ) + { + Vec_Int_t * vTemp = Vec_WecPushLevel(vCuts); + Vec_IntPush( vTemp, 0 ); + Vec_IntAppend( vTemp, vCut ); + } + Vec_IntAddToEntry( Vec_WecEntry(vCuts, Value), 0, 1 ); + } + } + printf( "Collected cuts = %d.\n", Vec_WecSize(vCuts) ); + for ( s = 3; s <= nCutSize; s++ ) + Vec_WecForEachLevel( vCuts, vLevel, i ) + if ( Vec_IntSize(vLevel) - 1 == s ) + { + int * pCut = Vec_IntEntryP(vLevel, 1); + int u, v, Value; + for ( u = 0; u < s; u++ ) + { + Vec_IntClear( vCut ); + for ( v = 0; v < s; v++ ) if ( v != u ) + Vec_IntPush( vCut, pCut[v] ); + assert( Vec_IntSize(vCut) == s-1 ); + Value = Hsh_VecManAdd( p, vCut ); + if ( Value < Vec_WecSize(vCuts) ) + Vec_IntAddToEntry( vLevel, 0, Vec_IntEntry(Vec_WecEntry(vCuts, Value), 0) ); + } + } + Hsh_VecManStop( p ); + Vec_IntFree( vCut ); + // collect + Vec_WecSortByFirstInt( vCuts, 1 ); + Vec_WecForEachLevelStop( vCuts, vLevel, i, Abc_MinInt(Vec_WecSize(vCuts), nCuts) ) + Vec_IntAppend( Vec_WecPushLevel(vCutsSel), vLevel ); + Abc_PrintTime( 0, "Cut filtering time", Abc_Clock() - clkStart ); + return vCutsSel; +} +int Gia_ManCountRefs( Gia_Man_t * pGia, Vec_Int_t * vLevel ) +{ + int i, iObj, nRefs = 0; + Vec_IntForEachEntry( vLevel, iObj, i ) + nRefs += Gia_ObjRefNumId(pGia, iObj); + return nRefs; +} +Vec_Wrd_t * Gia_ManGenSims( Gia_Man_t * pGia ) +{ + Vec_Wrd_t * vSims; + Vec_WrdFreeP( &pGia->vSimsPi ); + pGia->vSimsPi = Vec_WrdStartTruthTables( Gia_ManCiNum(pGia) ); + vSims = Gia_ManSimPatSim( pGia ); + return vSims; +} +int Gia_ManFindSatDcs( Gia_Man_t * pGia, Vec_Wrd_t * vSims, Vec_Int_t * vLevel ) +{ + int nWords = Vec_WrdSize(pGia->vSimsPi) / Gia_ManCiNum(pGia); + int i, w, iObj, Res = 0, Pres[256] = {0}, nMints = 1 << Vec_IntSize(vLevel); + for ( w = 0; w < 64*nWords; w++ ) + { + int iInMint = 0; + Vec_IntForEachEntry( vLevel, iObj, i ) + if ( Abc_TtGetBit( Vec_WrdEntryP(vSims, iObj*nWords), w ) ) + iInMint |= 1 << i; + Pres[iInMint]++; + } + for ( i = 0; i < nMints; i++ ) + Res += Pres[i] == 0; + return Res; +} + + +int Gia_ManCollectCutDivs( Gia_Man_t * p, Vec_Int_t * vIns ) +{ + Gia_Obj_t * pObj; int i, Res = 0; + Vec_Int_t * vRes = Vec_IntAlloc( 100 ); + Vec_IntSort( vIns, 0 ); + + Vec_IntPush( vRes, 0 ); + Vec_IntAppend( vRes, vIns ); + + Gia_ManIncrementTravId( p ); + Gia_ManIncrementTravId( p ); + Gia_ManForEachObjVec( vIns, p, pObj, i ) + Gia_ObjSetTravIdCurrent( p, pObj ); + + Gia_ManForEachAnd( p, pObj, i ) + if ( Gia_ObjIsTravIdCurrent(p, pObj) ) + continue; + else if ( Gia_ObjIsTravIdCurrent(p, Gia_ObjFanin0(pObj)) && Gia_ObjIsTravIdCurrent(p, Gia_ObjFanin1(pObj)) ) + { + if ( !Gia_ObjIsTravIdPrevious(p, pObj) ) + Vec_IntPush( vRes, i ); + Gia_ObjSetTravIdCurrent( p, pObj ); + } +// printf( "Divisors: " ); +// Vec_IntPrint( vRes ); + Res = Vec_IntSize(vRes); + Vec_IntFree( vRes ); + return Res; +} + +void Gia_ManConsiderCuts( Gia_Man_t * pGia, Vec_Wec_t * vCuts ) +{ + Vec_Wrd_t * vSims = Gia_ManGenSims( pGia ); + Vec_Int_t * vLevel; int i; + Gia_ManCreateRefs( pGia ); + Vec_WecForEachLevel( vCuts, vLevel, i ) + { + printf( "Cut %3d ", i ); + printf( "Ref = %3d : ", Vec_IntEntry(vLevel, 0) ); + + Vec_IntShift( vLevel, 1 ); + printf( "Ref = %3d : ", Gia_ManCountRefs(pGia, vLevel) ); + printf( "SDC = %3d : ", Gia_ManFindSatDcs(pGia, vSims, vLevel) ); + printf( "Div = %3d : ", Gia_ManCollectCutDivs(pGia, vLevel) ); + Vec_IntPrint( vLevel ); + Vec_IntShift( vLevel, -1 ); + } + Vec_WrdFree( vSims ); +} + + +Vec_Wec_t * Gia_ManExploreCuts( Gia_Man_t * pGia, int nCutSize0, int nCuts0, int fVerbose0 ) +{ + int nCutSize = nCutSize0; + int nCutNum = 64; + int fCutMin = 0; + int fTruthMin = 0; + int fVerbose = fVerbose0; + Vec_Wec_t * vCutsSel; + Gia_Sto_t * p = Gia_StoAlloc( pGia, nCutSize, nCutNum, fCutMin, fTruthMin, fVerbose ); + Gia_Obj_t * pObj; int i, iObj; + assert( nCutSize <= GIA_MAX_CUTSIZE ); + assert( nCutNum < GIA_MAX_CUTNUM ); + // prepare references + Gia_ManForEachObj( p->pGia, pObj, iObj ) + Gia_StoRefObj( p, iObj ); + // compute cuts + Gia_StoComputeCutsConst0( p, 0 ); + Gia_ManForEachCiId( p->pGia, iObj, i ) + Gia_StoComputeCutsCi( p, iObj ); + Gia_ManForEachAnd( p->pGia, pObj, iObj ) + Gia_StoComputeCutsNode( p, iObj ); + if ( p->fVerbose ) + { + printf( "Running cut computation with CutSize = %d CutNum = %d CutMin = %s TruthMin = %s\n", + p->nCutSize, p->nCutNum, p->fCutMin ? "yes":"no", p->fTruthMin ? "yes":"no" ); + printf( "CutPair = %.0f ", p->CutCount[0] ); + printf( "Merge = %.0f (%.2f %%) ", p->CutCount[1], 100.0*p->CutCount[1]/p->CutCount[0] ); + printf( "Eval = %.0f (%.2f %%) ", p->CutCount[2], 100.0*p->CutCount[2]/p->CutCount[0] ); + printf( "Cut = %.0f (%.2f %%) ", p->CutCount[3], 100.0*p->CutCount[3]/p->CutCount[0] ); + printf( "Cut/Node = %.2f ", p->CutCount[3] / Gia_ManAndNum(p->pGia) ); + printf( "\n" ); + printf( "The number of nodes with cut count over the limit (%d cuts) = %d nodes (out of %d). ", + p->nCutNum, p->nCutsOver, Gia_ManAndNum(pGia) ); + Abc_PrintTime( 0, "Time", Abc_Clock() - p->clkStart ); + } + vCutsSel = Gia_ManFilterCuts( pGia, p->vCuts, nCutSize0, nCuts0 ); + Gia_ManConsiderCuts( pGia, vCutsSel ); + Gia_StoFree( p ); + return vCutsSel; +} + //////////////////////////////////////////////////////////////////////// /// END OF FILE /// //////////////////////////////////////////////////////////////////////// diff --git a/src/aig/gia/giaDup.c b/src/aig/gia/giaDup.c index cc501562..c9af8a32 100644 --- a/src/aig/gia/giaDup.c +++ b/src/aig/gia/giaDup.c @@ -860,6 +860,27 @@ Gia_Man_t * Gia_ManDupMap( Gia_Man_t * p, Vec_Int_t * vMap ) Gia_ManSetRegNum( pNew, Gia_ManRegNum(p) ); return pNew; } +Gia_Man_t * Gia_ManDupAddBufs( Gia_Man_t * p ) +{ + Gia_Man_t * pNew; + Gia_Obj_t * pObj; + int i; + pNew = Gia_ManStart( Gia_ManObjNum(p) + Gia_ManCiNum(p) + Gia_ManCoNum(p) ); + Gia_ManHashStart( pNew ); + Gia_ManConst0(p)->Value = 0; + Gia_ManForEachCi( p, pObj, i ) + pObj->Value = Gia_ManAppendCi( pNew ); + Gia_ManForEachCi( p, pObj, i ) + pObj->Value = Gia_ManAppendBuf( pNew, pObj->Value ); + Gia_ManForEachAnd( p, pObj, i ) + pObj->Value = Gia_ManHashAnd( pNew, Gia_ObjFanin0Copy(pObj), Gia_ObjFanin1Copy(pObj) ); + Gia_ManForEachCo( p, pObj, i ) + pObj->Value = Gia_ManAppendBuf( pNew, Gia_ObjFanin0Copy(pObj) ); + Gia_ManForEachCo( p, pObj, i ) + pObj->Value = Gia_ManAppendCo( pNew, pObj->Value ); + Gia_ManHashStop( pNew ); + return pNew; +} /**Function************************************************************* diff --git a/src/aig/gia/giaEquiv.c b/src/aig/gia/giaEquiv.c index 5c82b260..030eaa60 100644 --- a/src/aig/gia/giaEquiv.c +++ b/src/aig/gia/giaEquiv.c @@ -1869,7 +1869,7 @@ void Gia_ManEquivToChoices_rec( Gia_Man_t * pNew, Gia_Man_t * p, Gia_Obj_t * pOb Gia_Obj_t * pRepr, * pReprNew, * pObjNew; if ( ~pObj->Value ) return; - if ( (pRepr = Gia_ObjReprObj(p, Gia_ObjId(p, pObj))) ) + if ( (pRepr = Gia_ObjReprObj(p, Gia_ObjId(p, pObj))) && !Gia_ObjFailed(p,Gia_ObjId(p,pObj)) ) { if ( Gia_ObjIsConst0(pRepr) ) { diff --git a/src/aig/gia/giaIf.c b/src/aig/gia/giaIf.c index ae87277a..8b4e5b12 100644 --- a/src/aig/gia/giaIf.c +++ b/src/aig/gia/giaIf.c @@ -1891,7 +1891,7 @@ Gia_Man_t * Gia_ManFromIfLogic( If_Man_t * pIfMan ) if ( !pIfMan->pPars->fUseTtPerm && !pIfMan->pPars->fDelayOpt && !pIfMan->pPars->fDelayOptLut && !pIfMan->pPars->fDsdBalance && !pIfMan->pPars->pLutStruct && !pIfMan->pPars->fUserRecLib && !pIfMan->pPars->fUserSesLib && !pIfMan->pPars->nGateSize && !pIfMan->pPars->fEnableCheck75 && !pIfMan->pPars->fEnableCheck75u && !pIfMan->pPars->fEnableCheck07 && !pIfMan->pPars->fUseDsdTune && - !pIfMan->pPars->fUseCofVars && !pIfMan->pPars->fUseAndVars ) + !pIfMan->pPars->fUseCofVars && !pIfMan->pPars->fUseAndVars && !pIfMan->pPars->fUseCheck1 && !pIfMan->pPars->fUseCheck2 ) If_CutRotatePins( pIfMan, pCutBest ); // collect leaves of the best cut Vec_IntClear( vLeaves ); diff --git a/src/aig/gia/giaResub2.c b/src/aig/gia/giaResub2.c index 1219526f..10c5a9e0 100644 --- a/src/aig/gia/giaResub2.c +++ b/src/aig/gia/giaResub2.c @@ -733,7 +733,7 @@ void Gia_RsbCiWindowTest( Gia_Man_t * p ) SeeAlso [] ***********************************************************************/ -static inline int Gia_ObjFaninId( Gia_Obj_t * pObj, int iObj, int n ) { return n ? Gia_ObjFaninId1(pObj, iObj) : Gia_ObjFaninId0(pObj, iObj); } +//static inline int Gia_ObjFaninId( Gia_Obj_t * pObj, int iObj, int n ) { return n ? Gia_ObjFaninId1(pObj, iObj) : Gia_ObjFaninId0(pObj, iObj); } static inline int Gia_ObjTravIsTopTwo( Gia_Man_t * p, int iNodeA ) { return (p->pTravIds[iNodeA] >= p->nTravIds - 1); } static inline int Gia_ObjTravIsSame( Gia_Man_t * p, int iNodeA, int iNodeB ) { return (p->pTravIds[iNodeA] == p->pTravIds[iNodeB]); } diff --git a/src/aig/gia/giaSatSyn.c b/src/aig/gia/giaSatSyn.c new file mode 100644 index 00000000..15829f79 --- /dev/null +++ b/src/aig/gia/giaSatSyn.c @@ -0,0 +1,60 @@ +/**CFile**************************************************************** + + FileName [giaSyn.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [Scalable AIG package.] + + Synopsis [High-effort synthesis.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 20, 2005.] + + Revision [$Id: giaSyn.c,v 1.00 2005/06/20 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include "gia.h" +#include "misc/util/utilTruth.h" +#include "sat/glucose/AbcGlucose.h" + +ABC_NAMESPACE_IMPL_START + + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Gia_Man_t * Gia_ManSyn( Gia_Man_t * p, int nNodes, int nOuts, int nTimeLimit, int fUseXor, int fFancy, int fVerbose ) +{ + Gia_Man_t * pNew = NULL; + return pNew; +} + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + diff --git a/src/aig/gia/giaSimBase.c b/src/aig/gia/giaSimBase.c index 002f6bc2..75a6d653 100644 --- a/src/aig/gia/giaSimBase.c +++ b/src/aig/gia/giaSimBase.c @@ -22,6 +22,7 @@ #include "misc/util/utilTruth.h" #include "misc/extra/extra.h" //#include <immintrin.h> +#include "aig/miniaig/miniaig.h" ABC_NAMESPACE_IMPL_START @@ -2717,13 +2718,89 @@ Vec_Ptr_t * Gia_ManPtrWrdReadBin( char * pFileName, int fVerbose ) SeeAlso [] ***********************************************************************/ +Vec_Int_t * Gia_ManProcessBuffs( Gia_Man_t * pHie, Vec_Wrd_t * vSimsH, int nWords, Vec_Mem_t * vStore, Vec_Int_t * vLabels ) +{ + Vec_Int_t * vPoSigs = Vec_IntAlloc( Gia_ManBufNum(pHie) ); + Vec_Int_t * vMap; + Vec_Wec_t * vNodes = Vec_WecStart( Gia_ManBufNum(pHie) ); + Gia_Obj_t * pObj; int i, Sig, Value; + Gia_ManForEachBuf( pHie, pObj, i ) + { + word * pSim = Vec_WrdEntryP(vSimsH, Gia_ObjId(pHie, pObj)*nWords); + int fCompl = pSim[0] & 1; + if ( fCompl ) + Abc_TtNot( pSim, nWords ); + Vec_IntPush( vPoSigs, Vec_MemHashInsert(vStore, pSim) ); + if ( fCompl ) + Abc_TtNot( pSim, nWords ); + } + Vec_IntPrint( vPoSigs ); + vMap = Vec_IntStartFull( Vec_MemEntryNum(vStore) ); + Vec_IntForEachEntry( vPoSigs, Sig, i ) + { + assert( Vec_IntEntry(vMap, Sig) == -1 ); + Vec_IntWriteEntry( vMap, Sig, i ); + } + Vec_IntForEachEntry( vLabels, Sig, i ) + { + if ( Sig < 0 ) + continue; + Value = Vec_IntEntry(vMap, Sig); + if ( Value == -1 ) + continue; + assert( Value >= 0 && Value < Gia_ManBufNum(pHie) ); + Vec_WecPush( vNodes, Value, i ); + } + Vec_WecPrint( vNodes, 0 ); + Vec_WecFree( vNodes ); + Vec_IntFree( vMap ); + Vec_IntFree( vPoSigs ); + return NULL; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Gia_ManUpdateCoPhase( Gia_Man_t * pNew, Gia_Man_t * pOld ) +{ + Gia_Obj_t * pObj; int i; + Gia_ManSetPhase( pNew ); + Gia_ManSetPhase( pOld ); + Gia_ManForEachCo( pNew, pObj, i ) + if ( pObj->fPhase ^ Gia_ManCo(pOld, i)->fPhase ) + { + printf( "Updating out %d.\n", i ); + Gia_ObjFlipFaninC0( pObj ); + } +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ void Gia_ManCompareSims( Gia_Man_t * pHie, Gia_Man_t * pFlat, int nWords, int fVerbose ) { abctime clk = Abc_Clock(); Vec_Wrd_t * vSims = pFlat->vSimsPi = pHie->vSimsPi = Vec_WrdStartRandom( Gia_ManCiNum(pFlat) * nWords ); Vec_Wrd_t * vSims0 = Gia_ManSimPatSim( pFlat ); Vec_Wrd_t * vSims1 = Gia_ManSimPatSim( pHie ); - Gia_Obj_t * pObj; int * pSpot, * pSpot2, i, nC0s = 0, nC1s = 0, nUnique = 0, nFound[3] = {0}, nBoundary = 0, nMatched = 0; + Vec_Int_t * vLabels = Vec_IntStartFull( Gia_ManObjNum(pFlat) ); + Gia_Obj_t * pObj; int fCompl, Value, * pSpot, * pSpot2, i, nC0s = 0, nC1s = 0, nUnique = 0, nFound[3] = {0}, nBoundary = 0, nMatched = 0; Vec_Mem_t * vStore = Vec_MemAlloc( nWords, 12 ); // 2^12 N-word entries per page pFlat->vSimsPi = NULL; pHie->vSimsPi = NULL; @@ -2739,7 +2816,13 @@ void Gia_ManCompareSims( Gia_Man_t * pHie, Gia_Man_t * pFlat, int nWords, int fV word * pSim = Vec_WrdEntryP(vSims0, i*nWords); nC0s += Abc_TtIsConst0(pSim, nWords); nC1s += Abc_TtIsConst1(pSim, nWords); - Vec_MemHashInsert( vStore, pSim ); + fCompl = pSim[0] & 1; + if ( fCompl ) + Abc_TtNot( pSim, nWords ); + Value = Vec_MemHashInsert( vStore, pSim ); + if ( fCompl ) + Abc_TtNot( pSim, nWords ); + Vec_IntWriteEntry( vLabels, i, Value ); } nUnique = Vec_MemEntryNum( vStore ); printf( "Simulating %d patterns through the second (flat) AIG leads to %d unique objects (%.2f %% out of %d). Const0 = %d. Const1 = %d.\n", @@ -2765,10 +2848,12 @@ void Gia_ManCompareSims( Gia_Man_t * pHie, Gia_Man_t * pFlat, int nWords, int fV //if ( Gia_ObjIsBuf(pObj) ) // printf( "%d(%d) ", i, nBoundary-1 ); } + Gia_ManProcessBuffs( pHie, vSims1, nWords, vStore, vLabels ); Vec_MemHashFree( vStore ); Vec_MemFree( vStore ); Vec_WrdFree( vSims0 ); Vec_WrdFree( vSims1 ); + Vec_IntFree( vLabels ); printf( "The first (hierarchical) AIG has %d (%.2f %%) matches, %d (%.2f %%) mismatches, including %d (%.2f %%) on the boundary. ", nMatched, 100.0*nMatched /Abc_MaxInt(1, Gia_ManCandNum(pHie)), @@ -2777,6 +2862,405 @@ void Gia_ManCompareSims( Gia_Man_t * pHie, Gia_Man_t * pFlat, int nWords, int fV Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); } +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Vec_Wec_t * Gia_ManRelTfos( Gia_Man_t * p, Vec_Int_t * vObjs ) +{ + Gia_Obj_t * pObj; + Vec_Wec_t * vNodes = Vec_WecStart( Vec_IntSize(vObjs)+1 ); + Vec_Int_t * vSigns = Vec_IntStart( Gia_ManObjNum(p) ); + int n, k, i, iObj, * pSigns = Vec_IntArray(vSigns); + assert( Vec_IntSize(vObjs) < 32 ); + Vec_IntForEachEntry( vObjs, iObj, i ) + pSigns[iObj] |= 1 << i; + Gia_ManForEachAnd( p, pObj, i ) + { + if ( pSigns[i] == 0 ) + for ( n = 0; n < 2; n++ ) + pSigns[i] |= pSigns[Gia_ObjFaninId(pObj, i, n)]; + if ( pSigns[i] == 0 ) + continue; + Vec_WecPush( vNodes, Vec_IntSize(vObjs), i ); + for ( k = 0; k < Vec_IntSize(vObjs); k++ ) + if ( (pSigns[i] >> k) & 1 ) + Vec_WecPush( vNodes, k, i ); + } + Vec_IntFree( vSigns ); + return vNodes; +} +Vec_Wrd_t * Gia_ManRelDerive( Gia_Man_t * p, Vec_Int_t * vObjs, Vec_Wrd_t * vSims ) +{ + int nWords = Vec_WrdSize(p->vSimsPi) / Gia_ManCiNum(p); Gia_Obj_t * pObj; + int i, m, iVar, iMint = 0, nMints = 1 << Vec_IntSize(vObjs); + Vec_Wrd_t * vCopy = Vec_WrdDup(vSims); Vec_Int_t * vLevel; + Vec_Wrd_t * vRel = Vec_WrdStart( Gia_ManCoNum(p) * nWords * nMints ); + Vec_Wec_t * vNodes = Gia_ManRelTfos( p, vObjs ); + Vec_WecPrint( vNodes, 0 ); + Gia_ManForEachAnd( p, pObj, i ) + assert( pObj->fPhase == 0 ); + Gia_ManForEachObjVec( vObjs, p, pObj, i ) + pObj->fPhase = 1; + vLevel = Vec_WecEntry( vNodes, Vec_IntSize(vObjs) ); + Gia_ManForEachObjVec( vLevel, p, pObj, i ) + if ( pObj->fPhase ) + Abc_TtClear( Vec_WrdEntryP(vCopy, Gia_ObjId(p, pObj)*nWords), nWords ); + else + Gia_ManSimPatSimAnd( p, Gia_ObjId(p, pObj), pObj, nWords, vCopy ); + for ( m = 0; m < nMints; m++ ) + { + Gia_ManForEachCo( p, pObj, i ) + { + word * pSimO = Vec_WrdEntryP(vCopy, Gia_ObjId(p, pObj)*nWords); + word * pSimF = Vec_WrdEntryP(vCopy, Gia_ObjFaninId0p(p, pObj)*nWords); + word * pSimR = Vec_WrdEntryP(vRel, (iMint*Gia_ManCoNum(p) + i)*nWords); + Abc_TtXor( pSimR, pSimF, pSimO, nWords, Gia_ObjFaninC0(pObj) ); + } + if ( m == nMints-1 ) + break; + iVar = Abc_TtSuppFindFirst( (m+1) ^ ((m+1) >> 1) ^ (m) ^ ((m) >> 1) ); + vLevel = Vec_WecEntry( vNodes, iVar ); + assert( Vec_IntEntry(vLevel, 0) == Vec_IntEntry(vObjs, iVar) ); + Abc_TtNot( Vec_WrdEntryP(vCopy, Vec_IntEntry(vObjs, iVar)*nWords), nWords ); + Gia_ManForEachObjVec( vLevel, p, pObj, i ) + if ( !pObj->fPhase ) + Gia_ManSimPatSimAnd( p, Gia_ObjId(p, pObj), pObj, nWords, vCopy ); + iMint ^= 1 << iVar; + } + Gia_ManForEachObjVec( vObjs, p, pObj, i ) + pObj->fPhase = 0; + Vec_WrdFree( vCopy ); + Vec_WecFree( vNodes ); + return vRel; +} +Vec_Wrd_t * Gia_ManRelDerive2( Gia_Man_t * p, Vec_Int_t * vObjs, Vec_Wrd_t * vSims ) +{ + int nWords = Vec_WrdSize(p->vSimsPi) / Gia_ManCiNum(p); Gia_Obj_t * pObj; + int i, Id, m, Index, nMints = 1 << Vec_IntSize(vObjs); + Vec_Wrd_t * vPos, * vRel = Vec_WrdStart( Gia_ManCoNum(p) * nWords * nMints ); + for ( m = 0; m < nMints; m++ ) + { + Gia_Man_t * pNew = Gia_ManDup( p ); + Gia_ManForEachAnd( pNew, pObj, i ) + { + if ( (Index = Vec_IntFind(vObjs, Gia_ObjFaninId0(pObj, i))) >= 0 ) + pObj->iDiff0 = i, pObj->fCompl0 ^= (m >> Index) & 1; + if ( (Index = Vec_IntFind(vObjs, Gia_ObjFaninId1(pObj, i))) >= 0 ) + pObj->iDiff1 = i, pObj->fCompl1 ^= (m >> Index) & 1; + } + vPos = Gia_ManSimPatSimOut( pNew, p->vSimsPi, 1 ); + Gia_ManForEachCoId( p, Id, i ) + Abc_TtXor( Vec_WrdEntryP(vRel, (m*Gia_ManCoNum(p) + i)*nWords), Vec_WrdEntryP(vPos, i*nWords), Vec_WrdEntryP(vSims, Id*nWords), nWords, 0 ); + Vec_WrdFree( vPos ); + Gia_ManStop( pNew ); + } + return vRel; +} +void Gia_ManRelPrint( Gia_Man_t * p, Vec_Int_t * vObjs, Vec_Wrd_t * vSims, Vec_Wrd_t * vRel ) +{ + int w, nWords = Vec_WrdSize(p->vSimsPi) / Gia_ManCiNum(p); + int i, Id, m, nMints = 1 << Vec_IntSize(vObjs); + printf( "Relation has %d inputs and %d outputs:\n", Gia_ManCiNum(p), Vec_IntSize(vObjs) ); + for ( w = 0; w < 64*nWords; w++ ) + { + Gia_ManForEachCiId( p, Id, i ) + printf( "%d", Abc_TtGetBit(Vec_WrdEntryP(vSims, Id*nWords), w) ); + printf( " " ); + Vec_IntForEachEntry( vObjs, Id, i ) + printf( "%d", Abc_TtGetBit(Vec_WrdEntryP(vSims, Id*nWords), w) ); + printf( " " ); + Gia_ManForEachCoId( p, Id, i ) + printf( "%d", Abc_TtGetBit(Vec_WrdEntryP(vSims, Id*nWords), w) ); + printf( " " ); + for ( m = 0; m < nMints; m++ ) + { + printf( " " ); + for ( i = 0; i < Vec_IntSize(vObjs); i++ ) + printf( "%d", (m >> i) & 1 ); + printf( "=" ); + Gia_ManForEachCoId( p, Id, i ) + printf( "%d", Abc_TtGetBit(Vec_WrdEntryP(vRel, (m*Gia_ManCoNum(p)+i)*nWords), w) ); + } + printf( "\n" ); + } +} +void Gia_ManRelPrint2( Gia_Man_t * p, Vec_Int_t * vObjs, Vec_Wrd_t * vSims, Vec_Wrd_t * vRel ) +{ + int w, nWords = Vec_WrdSize(p->vSimsPi) / Gia_ManCiNum(p); + int i, Id, m, nMints = 1 << Vec_IntSize(vObjs); + int nWordsM = Abc_Truth6WordNum(Vec_IntSize(vObjs)); + Vec_Wrd_t * vRes = Vec_WrdStart( 64*nWords * nWordsM ); + printf( "Relation has %d inputs and %d outputs:\n", Gia_ManCiNum(p), Vec_IntSize(vObjs) ); + for ( w = 0; w < 64*nWords; w++ ) + { + int iMint = 0; + int nValid = 0; + Gia_ManForEachCiId( p, Id, i ) + printf( "%d", Abc_TtGetBit(Vec_WrdEntryP(vSims, Id*nWords), w) ); + printf( " " ); + Vec_IntForEachEntry( vObjs, Id, i ) + { + printf( "%d", Abc_TtGetBit(Vec_WrdEntryP(vSims, Id*nWords), w) ); + if ( Abc_TtGetBit(Vec_WrdEntryP(vSims, Id*nWords), w) ) + iMint |= 1 << i; + } + printf( " " ); + Gia_ManForEachCoId( p, Id, i ) + printf( "%d", Abc_TtGetBit(Vec_WrdEntryP(vSims, Id*nWords), w) ); + printf( " " ); + for ( m = 0; m < nMints; m++ ) + { + int Count = 0; + Gia_ManForEachCoId( p, Id, i ) + Count += Abc_TtGetBit(Vec_WrdEntryP(vRel, (m*Gia_ManCoNum(p)+i)*nWords), w); + printf( "%d", Count == 0 ); + nValid += Count > 0; + if ( Count == 0 ) + Abc_TtSetBit( Vec_WrdEntryP(vRes, w*nWordsM), m ); + } + printf( " " ); + for ( m = 0; m < nMints; m++ ) + printf( "%d", Abc_TtGetBit(Vec_WrdEntryP(vRes, w*nWordsM), m) ); + printf( " " ); + assert( Abc_TtGetBit(Vec_WrdEntryP(vRes, w*nWordsM), iMint) ); + for ( i = 0; i < Vec_IntSize(vObjs); i++ ) + if ( Abc_TtGetBit(Vec_WrdEntryP(vRes, w*nWordsM), iMint ^ (1 << i)) ) + printf( "-" ); + else + printf( "%d", (iMint >> i) & 1 ); + printf( " %d", nMints-nValid ); + printf( "\n" ); + } + Vec_WrdFree( vRes ); +} +Vec_Int_t * Gia_ManRelInitObjs() +{ + Vec_Int_t * vRes = Vec_IntAlloc( 10 ); + /* + Vec_IntPush( vRes, 33 ); + Vec_IntPush( vRes, 52 ); + Vec_IntPush( vRes, 53 ); + Vec_IntPush( vRes, 65 ); + Vec_IntPush( vRes, 79 ); + Vec_IntPush( vRes, 81 ); + */ + /* + Vec_IntPush( vRes, 60 ); + Vec_IntPush( vRes, 61 ); + Vec_IntPush( vRes, 71 ); + Vec_IntPush( vRes, 72 ); + */ + /* + Vec_IntPush( vRes, 65 ); + Vec_IntPush( vRes, 79 ); + Vec_IntPush( vRes, 81 ); + */ + Vec_IntPush( vRes, 52 ); + Vec_IntPush( vRes, 54 ); + Vec_IntPrint( vRes ); + return vRes; +} +void Gia_ManRelDeriveTest2( Gia_Man_t * p ) +{ + Vec_Int_t * vObjs = Gia_ManRelInitObjs(); + Vec_Wrd_t * vSims, * vRel, * vRel2; int nWords; + Vec_WrdFreeP( &p->vSimsPi ); + p->vSimsPi = Vec_WrdStartTruthTables( Gia_ManCiNum(p) ); + nWords = Vec_WrdSize(p->vSimsPi) / Gia_ManCiNum(p); + vSims = Gia_ManSimPatSim( p ); + vRel = Gia_ManRelDerive( p, vObjs, vSims ); + vRel2 = Gia_ManRelDerive2( p, vObjs, vSims ); + //assert( !memcmp(vRel2->pArray, vRel->pArray, sizeof(word)*Vec_WrdSize(vRel)) ); + Gia_ManRelPrint2( p, vObjs, vSims, vRel ); + Vec_WrdFree( vRel2 ); + Vec_WrdFree( vRel ); + Vec_WrdFree( vSims ); + Vec_IntFree( vObjs ); +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Vec_Int_t * Gia_ManRelInitIns() +{ + Vec_Int_t * vRes = Vec_IntAlloc( 10 ); + Vec_IntPush( vRes, 12 ); + Vec_IntPush( vRes, 18 ); + Vec_IntPush( vRes, 21 ); + Vec_IntPush( vRes, 34 ); + Vec_IntPush( vRes, 45 ); + Vec_IntPush( vRes, 59 ); + return vRes; +} +Vec_Int_t * Gia_ManRelInitOuts() +{ + Vec_Int_t * vRes = Vec_IntAlloc( 10 ); + Vec_IntPush( vRes, 65 ); + Vec_IntPush( vRes, 66 ); + return vRes; +} +Vec_Int_t * Gia_ManRelInitMffc( Gia_Man_t * p, Vec_Int_t * vOuts ) +{ + Gia_Obj_t * pObj; int i; + Vec_Int_t * vRes = Vec_IntAlloc( 100 ); + Vec_IntSort( vOuts, 0 ); + Gia_ManIncrementTravId( p ); + Gia_ManForEachObjVec( vOuts, p, pObj, i ) + Gia_ObjSetTravIdCurrent( p, pObj ); + Gia_ManIncrementTravId( p ); + Gia_ManForEachCo( p, pObj, i ) + if ( !Gia_ObjIsTravIdPrevious(p, Gia_ObjFanin0(pObj)) ) + Gia_ObjSetTravIdCurrent( p, Gia_ObjFanin0(pObj) ); + Gia_ManForEachAndReverse( p, pObj, i ) + if ( Gia_ObjIsTravIdPrevious(p, pObj) ) + continue; + else if ( Gia_ObjIsTravIdCurrent(p, pObj) ) + { + if ( !Gia_ObjIsTravIdPrevious(p, Gia_ObjFanin0(pObj)) ) + Gia_ObjSetTravIdCurrent( p, Gia_ObjFanin0(pObj) ); + if ( !Gia_ObjIsTravIdPrevious(p, Gia_ObjFanin1(pObj)) ) + Gia_ObjSetTravIdCurrent( p, Gia_ObjFanin1(pObj) ); + } + Gia_ManForEachAnd( p, pObj, i ) + if ( !Gia_ObjIsTravIdCurrent(p, pObj) ) + Vec_IntPush( vRes, i ); + printf( "MFFC: " ); + Vec_IntPrint( vRes ); + return vRes; +} +Vec_Int_t * Gia_ManRelInitDivs( Gia_Man_t * p, Vec_Int_t * vIns, Vec_Int_t * vOuts ) +{ + Gia_Obj_t * pObj; int i; + Vec_Int_t * vMffc = Gia_ManRelInitMffc( p, vOuts ); + Vec_Int_t * vRes = Vec_IntAlloc( 100 ); + Vec_IntSort( vIns, 0 ); + + Gia_ManIncrementTravId( p ); + Gia_ManForEachObjVec( vMffc, p, pObj, i ) + Gia_ObjSetTravIdCurrent( p, pObj ); + Vec_IntFree( vMffc ); + + Vec_IntPush( vRes, 0 ); + Vec_IntAppend( vRes, vIns ); + + Gia_ManIncrementTravId( p ); + Gia_ManForEachObjVec( vIns, p, pObj, i ) + Gia_ObjSetTravIdCurrent( p, pObj ); + + Gia_ManForEachAnd( p, pObj, i ) + if ( Gia_ObjIsTravIdCurrent(p, pObj) ) + continue; + else if ( Gia_ObjIsTravIdCurrent(p, Gia_ObjFanin0(pObj)) && Gia_ObjIsTravIdCurrent(p, Gia_ObjFanin1(pObj)) ) + { + if ( !Gia_ObjIsTravIdPrevious(p, pObj) ) + Vec_IntPush( vRes, i ); + Gia_ObjSetTravIdCurrent( p, pObj ); + } + printf( "Divisors: " ); + Vec_IntPrint( vRes ); + return vRes; +} + +Vec_Int_t * Gia_ManRelDeriveSimple( Gia_Man_t * p, Vec_Wrd_t * vSims, Vec_Int_t * vIns, Vec_Int_t * vOuts ) +{ + Vec_Int_t * vRes = Vec_IntStartFull( 1 << Vec_IntSize(vIns) ); + int w, nWords = Vec_WrdSize(p->vSimsPi) / Gia_ManCiNum(p); + for ( w = 0; w < 64*nWords; w++ ) + { + int i, iObj, iMint = 0, iMint2 = 0; + Vec_IntForEachEntry( vIns, iObj, i ) + if ( Abc_TtGetBit(Vec_WrdEntryP(vSims, iObj*nWords), w) ) + iMint |= 1 << i; + if ( Vec_IntEntry(vRes, iMint) >= 0 ) + continue; + Vec_IntForEachEntry( vOuts, iObj, i ) + if ( Abc_TtGetBit(Vec_WrdEntryP(vSims, iObj*nWords), w) ) + iMint2 |= 1 << i; + Vec_IntWriteEntry( vRes, iMint, iMint2 ); + } + return vRes; +} + +void Gia_ManRelSolve( Gia_Man_t * p, Vec_Wrd_t * vSims, Vec_Int_t * vIns, Vec_Int_t * vOuts, Vec_Int_t * vRel, Vec_Int_t * vDivs ) +{ + extern Mini_Aig_t * Exa4_ManGenTest( Vec_Wrd_t * vSimsIn, Vec_Wrd_t * vSimsOut, int nIns, int nDivs, int nOuts, int nNodes, int TimeOut, int fOnlyAnd, int fFancy, int fOrderNodes, int fUniqFans, int fVerbose ); + + int i, m, iObj, Entry, iMint = 0, nMints = Vec_IntSize(vRel) - Vec_IntCountEntry(vRel, -1); + Vec_Wrd_t * vSimsIn = Vec_WrdStart( nMints ); + Vec_Wrd_t * vSimsOut = Vec_WrdStart( nMints ); + int Entry0 = Vec_IntEntry( vRel, 0 ); + + word Value, Phase = 0; + int nWords = Vec_WrdSize(p->vSimsPi) / Gia_ManCiNum(p); + Vec_IntForEachEntry( vDivs, iObj, i ) + if ( Vec_WrdEntry(vSims, iObj*nWords) & 1 ) + Phase |= 1 << i; + + assert( Entry0 >= 0 ); + printf( "Entry0 = %d\n", Entry0 ); + Entry0 ^= 1; +// for ( m = 0; m < nMints; m++ ) + Vec_IntForEachEntry( vRel, Entry, m ) + { + if ( Entry == -1 ) + continue; + Abc_TtSetBit( Vec_WrdEntryP(vSimsOut, iMint), Entry0 ^ Entry ); + + Value = 0; + Vec_IntForEachEntry( vDivs, iObj, i ) + if ( Abc_TtGetBit(Vec_WrdEntryP(vSims, iObj*nWords), m) ) + Abc_TtSetBit( &Value, i ); + Vec_WrdEntryP(vSimsOut, iMint)[0] = Value ^ Phase; + + iMint++; + } + assert( iMint == nMints ); + printf( "Created %d minterms.\n", iMint ); + Exa4_ManGenTest( vSimsIn, vSimsOut, Vec_IntSize(vIns), Vec_IntSize(vDivs), Vec_IntSize(vOuts), 10, 0, 0, 0, 0, 0, 1 ); + Vec_WrdFree( vSimsIn ); + Vec_WrdFree( vSimsOut ); +} +void Gia_ManRelDeriveTest( Gia_Man_t * p ) +{ + Vec_Int_t * vIns = Gia_ManRelInitIns(); + Vec_Int_t * vOuts = Gia_ManRelInitOuts(); + Vec_Wrd_t * vSims; Vec_Int_t * vRel, * vDivs; int nWords; + Vec_WrdFreeP( &p->vSimsPi ); + p->vSimsPi = Vec_WrdStartTruthTables( Gia_ManCiNum(p) ); + nWords = Vec_WrdSize(p->vSimsPi) / Gia_ManCiNum(p); + vSims = Gia_ManSimPatSim( p ); + vRel = Gia_ManRelDeriveSimple( p, vSims, vIns, vOuts ); + vDivs = Gia_ManRelInitDivs( p, vIns, vOuts ); + //printf( "Neg = %d\n", Vec_IntCountEntry(vRel, -1) ); + + Gia_ManRelSolve( p, vSims, vIns, vOuts, vRel, vDivs ); + + Vec_IntFree( vDivs ); + Vec_IntPrint( vRel ); + Vec_IntFree( vRel ); + Vec_WrdFree( vSims ); + Vec_IntFree( vIns ); + Vec_IntFree( vOuts ); +} + + + //////////////////////////////////////////////////////////////////////// /// END OF FILE /// //////////////////////////////////////////////////////////////////////// diff --git a/src/aig/gia/giaTtopt.cpp b/src/aig/gia/giaTtopt.cpp new file mode 100644 index 00000000..a765633f --- /dev/null +++ b/src/aig/gia/giaTtopt.cpp @@ -0,0 +1,1213 @@ +/**CFile**************************************************************** + + FileName [giaTtopt.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [Scalable AIG package.] + + Synopsis [Truth-table-based logic synthesis.] + + Author [Yukio Miyasaka] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 20, 2005.] + + Revision [$Id: giaTtopt.c,v 1.00 2005/06/20 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#ifdef _WIN32 +#ifndef __MINGW32__ +#pragma warning(disable : 4786) // warning C4786: identifier was truncated to '255' characters in the browser information +#endif +#endif + +#include <vector> +#include <algorithm> +#include <cassert> +#include <bitset> + +#include "gia.h" +#include "misc/vec/vecHash.h" + +ABC_NAMESPACE_IMPL_START + +namespace Ttopt { + +class TruthTable { +public: + static const int ww; // word width + static const int lww; // log word width + typedef std::bitset<64> bsw; + + int nInputs; + int nSize; + int nTotalSize; + int nOutputs; + std::vector<word> t; + + std::vector<std::vector<int> > vvIndices; + std::vector<std::vector<int> > vvRedundantIndices; + std::vector<int> vLevels; + + std::vector<std::vector<word> > savedt; + std::vector<std::vector<std::vector<int> > > vvIndicesSaved; + std::vector<std::vector<std::vector<int> > > vvRedundantIndicesSaved; + std::vector<std::vector<int> > vLevelsSaved; + + static const word ones[]; + static const word swapmask[]; + + TruthTable(int nInputs, int nOutputs): nInputs(nInputs), nOutputs(nOutputs) { + srand(0xABC); + if(nInputs >= lww) { + nSize = 1 << (nInputs - lww); + nTotalSize = nSize * nOutputs; + t.resize(nTotalSize); + } else { + nSize = 0; + nTotalSize = ((1 << nInputs) * nOutputs + ww - 1) / ww; + t.resize(nTotalSize); + } + vLevels.resize(nInputs); + for(int i = 0; i < nInputs; i++) { + vLevels[i] = i; + } + } + + virtual void Save(unsigned i) { + if(savedt.size() < i + 1) { + savedt.resize(i + 1); + vLevelsSaved.resize(i + 1); + } + savedt[i] = t; + vLevelsSaved[i] = vLevels; + } + + virtual void Load(unsigned i) { + assert(i < savedt.size()); + t = savedt[i]; + vLevels = vLevelsSaved[i]; + } + + virtual void SaveIndices(unsigned i) { + if(vvIndicesSaved.size() < i + 1) { + vvIndicesSaved.resize(i + 1); + vvRedundantIndicesSaved.resize(i + 1); + } + vvIndicesSaved[i] = vvIndices; + vvRedundantIndicesSaved[i] = vvRedundantIndices; + } + + virtual void LoadIndices(unsigned i) { + vvIndices = vvIndicesSaved[i]; + vvRedundantIndices = vvRedundantIndicesSaved[i]; + } + + word GetValue(int index_lev, int lev) { + assert(index_lev >= 0); + assert(nInputs - lev <= lww); + int logwidth = nInputs - lev; + int index = index_lev >> (lww - logwidth); + int pos = (index_lev % (1 << (lww - logwidth))) << logwidth; + return (t[index] >> pos) & ones[logwidth]; + } + + int IsEq(int index1, int index2, int lev, bool fCompl = false) { + assert(index1 >= 0); + assert(index2 >= 0); + int logwidth = nInputs - lev; + bool fEq = true; + if(logwidth > lww) { + int nScopeSize = 1 << (logwidth - lww); + for(int i = 0; i < nScopeSize && (fEq || fCompl); i++) { + fEq &= (t[nScopeSize * index1 + i] == t[nScopeSize * index2 + i]); + fCompl &= (t[nScopeSize * index1 + i] == ~t[nScopeSize * index2 + i]); + } + } else { + word value = GetValue(index1, lev) ^ GetValue(index2, lev); + fEq &= !value; + fCompl &= !(value ^ ones[logwidth]); + } + return 2 * fCompl + fEq; + } + + bool Imply(int index1, int index2, int lev) { + assert(index1 >= 0); + assert(index2 >= 0); + int logwidth = nInputs - lev; + if(logwidth > lww) { + int nScopeSize = 1 << (logwidth - lww); + for(int i = 0; i < nScopeSize; i++) { + if(t[nScopeSize * index1 + i] & ~t[nScopeSize * index2 + i]) { + return false; + } + } + return true; + } + return !(GetValue(index1, lev) & (GetValue(index2, lev) ^ ones[logwidth])); + } + + int BDDNodeCountLevel(int lev) { + return vvIndices[lev].size() - vvRedundantIndices[lev].size(); + } + + int BDDNodeCount() { + int count = 1; // const node + for(int i = 0; i < nInputs; i++) { + count += BDDNodeCountLevel(i); + } + return count; + } + + int BDDFind(int index, int lev) { + int logwidth = nInputs - lev; + if(logwidth > lww) { + int nScopeSize = 1 << (logwidth - lww); + bool fZero = true; + bool fOne = true; + for(int i = 0; i < nScopeSize && (fZero || fOne); i++) { + word value = t[nScopeSize * index + i]; + fZero &= !value; + fOne &= !(~value); + } + if(fZero || fOne) { + return -2 ^ (int)fOne; + } + for(unsigned j = 0; j < vvIndices[lev].size(); j++) { + int index2 = vvIndices[lev][j]; + bool fEq = true; + bool fCompl = true; + for(int i = 0; i < nScopeSize && (fEq || fCompl); i++) { + fEq &= (t[nScopeSize * index + i] == t[nScopeSize * index2 + i]); + fCompl &= (t[nScopeSize * index + i] == ~t[nScopeSize * index2 + i]); + } + if(fEq || fCompl) { + return (j << 1) ^ (int)fCompl; + } + } + } else { + word value = GetValue(index, lev); + if(!value) { + return -2; + } + if(!(value ^ ones[logwidth])) { + return -1; + } + for(unsigned j = 0; j < vvIndices[lev].size(); j++) { + int index2 = vvIndices[lev][j]; + word value2 = value ^ GetValue(index2, lev); + if(!(value2)) { + return j << 1; + } + if(!(value2 ^ ones[logwidth])) { + return (j << 1) ^ 1; + } + } + } + return -3; + } + + virtual int BDDBuildOne(int index, int lev) { + int r = BDDFind(index, lev); + if(r >= -2) { + return r; + } + vvIndices[lev].push_back(index); + return (vvIndices[lev].size() - 1) << 1; + } + + virtual void BDDBuildStartup() { + vvIndices.clear(); + vvIndices.resize(nInputs); + vvRedundantIndices.clear(); + vvRedundantIndices.resize(nInputs); + for(int i = 0; i < nOutputs; i++) { + BDDBuildOne(i, 0); + } + } + + virtual void BDDBuildLevel(int lev) { + for(unsigned i = 0; i < vvIndices[lev-1].size(); i++) { + int index = vvIndices[lev-1][i]; + int cof0 = BDDBuildOne(index << 1, lev); + int cof1 = BDDBuildOne((index << 1) ^ 1, lev); + if(cof0 == cof1) { + vvRedundantIndices[lev-1].push_back(index); + } + } + } + + virtual int BDDBuild() { + BDDBuildStartup(); + for(int i = 1; i < nInputs; i++) { + BDDBuildLevel(i); + } + return BDDNodeCount(); + } + + virtual int BDDRebuild(int lev) { + vvIndices[lev].clear(); + vvIndices[lev+1].clear(); + for(int i = lev; i < lev + 2; i++) { + if(!i) { + for(int j = 0; j < nOutputs; j++) { + BDDBuildOne(j, 0); + } + } else { + vvRedundantIndices[i-1].clear(); + BDDBuildLevel(i); + } + } + if(lev < nInputs - 2) { + vvRedundantIndices[lev+1].clear(); + for(unsigned i = 0; i < vvIndices[lev+1].size(); i++) { + int index = vvIndices[lev+1][i]; + if(IsEq(index << 1, (index << 1) ^ 1, lev + 2)) { + vvRedundantIndices[lev+1].push_back(index); + } + } + } + return BDDNodeCount(); + } + + virtual void Swap(int lev) { + assert(lev < nInputs - 1); + std::vector<int>::iterator it0 = std::find(vLevels.begin(), vLevels.end(), lev); + std::vector<int>::iterator it1 = std::find(vLevels.begin(), vLevels.end(), lev + 1); + std::swap(*it0, *it1); + if(nInputs - lev - 1 > lww) { + int nScopeSize = 1 << (nInputs - lev - 2 - lww); + for(int i = nScopeSize; i < nTotalSize; i += (nScopeSize << 2)) { + for(int j = 0; j < nScopeSize; j++) { + std::swap(t[i + j], t[i + nScopeSize + j]); + } + } + } else if(nInputs - lev - 1 == lww) { + for(int i = 0; i < nTotalSize; i += 2) { + t[i+1] ^= t[i] >> (ww / 2); + t[i] ^= t[i+1] << (ww / 2); + t[i+1] ^= t[i] >> (ww / 2); + } + } else { + for(int i = 0; i < nTotalSize; i++) { + int d = nInputs - lev - 2; + int shamt = 1 << d; + t[i] ^= (t[i] >> shamt) & swapmask[d]; + t[i] ^= (t[i] & swapmask[d]) << shamt; + t[i] ^= (t[i] >> shamt) & swapmask[d]; + } + } + } + + void SwapIndex(int &index, int d) { + if((index >> d) % 4 == 1) { + index += 1 << d; + } else if((index >> d) % 4 == 2) { + index -= 1 << d; + } + } + + virtual int BDDSwap(int lev) { + Swap(lev); + for(int i = lev + 2; i < nInputs; i++) { + for(unsigned j = 0; j < vvIndices[i].size(); j++) { + SwapIndex(vvIndices[i][j], i - (lev + 2)); + } + } + // swapping vvRedundantIndices is unnecessary for node counting + return BDDRebuild(lev); + } + + int SiftReo() { + int best = BDDBuild(); + Save(0); + SaveIndices(0); + std::vector<int> vars(nInputs); + int i; + for(i = 0; i < nInputs; i++) { + vars[i] = i; + } + std::vector<unsigned> vCounts(nInputs); + for(i = 0; i < nInputs; i++) { + vCounts[i] = BDDNodeCountLevel(vLevels[i]); + } + for(i = 1; i < nInputs; i++) { + int j = i; + while(j > 0 && vCounts[vars[j-1]] < vCounts[vars[j]]) { + std::swap(vars[j], vars[j-1]); + j--; + } + } + bool turn = true; + unsigned j; + for(j = 0; j < vars.size(); j++) { + int var = vars[j]; + bool updated = false; + int lev = vLevels[var]; + for(int i = lev; i < nInputs - 1; i++) { + int count = BDDSwap(i); + if(best > count) { + best = count; + updated = true; + Save(turn); + SaveIndices(turn); + } + } + if(lev) { + Load(!turn); + LoadIndices(!turn); + for(int i = lev - 1; i >= 0; i--) { + int count = BDDSwap(i); + if(best > count) { + best = count; + updated = true; + Save(turn); + SaveIndices(turn); + } + } + } + turn ^= updated; + Load(!turn); + LoadIndices(!turn); + } + return best; + } + + void Reo(std::vector<int> vLevelsNew) { + for(int i = 0; i < nInputs; i++) { + int var = std::find(vLevelsNew.begin(), vLevelsNew.end(), i) - vLevelsNew.begin(); + int lev = vLevels[var]; + if(lev < i) { + for(int j = lev; j < i; j++) { + Swap(j); + } + } else if(lev > i) { + for(int j = lev - 1; j >= i; j--) { + Swap(j); + } + } + } + assert(vLevels == vLevelsNew); + } + + int RandomSiftReo(int nRound) { + int best = SiftReo(); + Save(2); + for(int i = 0; i < nRound; i++) { + std::vector<int> vLevelsNew(nInputs); + int j; + for(j = 0; j < nInputs; j++) { + vLevelsNew[j] = j; + } + for(j = nInputs - 1; j > 0; j--) { + int d = rand() % j; + std::swap(vLevelsNew[j], vLevelsNew[d]); + } + Reo(vLevelsNew); + int r = SiftReo(); + if(best > r) { + best = r; + Save(2); + } + } + Load(2); + return best; + } + + int BDDGenerateAigRec(Gia_Man_t *pNew, std::vector<int> const &vInputs, std::vector<std::vector<int> > &vvNodes, int index, int lev) { + int r = BDDFind(index, lev); + if(r >= 0) { + return vvNodes[lev][r >> 1] ^ (r & 1); + } + if(r >= -2) { + return r + 2; + } + int cof0 = BDDGenerateAigRec(pNew, vInputs, vvNodes, index << 1, lev + 1); + int cof1 = BDDGenerateAigRec(pNew, vInputs, vvNodes, (index << 1) ^ 1, lev + 1); + if(cof0 == cof1) { + return cof0; + } + int node; + if(Imply(index << 1, (index << 1) ^ 1, lev + 1)) { + node = Gia_ManHashOr(pNew, Gia_ManHashAnd(pNew, vInputs[lev], cof1), cof0); + } else if(Imply((index << 1) ^ 1, index << 1, lev + 1)) { + node = Gia_ManHashOr(pNew, Gia_ManHashAnd(pNew, vInputs[lev] ^ 1, cof0), cof1); + } else { + node = Gia_ManHashMux(pNew, vInputs[lev], cof1, cof0); + } + vvIndices[lev].push_back(index); + vvNodes[lev].push_back(node); + return node; + } + + virtual void BDDGenerateAig(Gia_Man_t *pNew, Vec_Int_t *vSupp) { + vvIndices.clear(); + vvIndices.resize(nInputs); + std::vector<std::vector<int> > vvNodes(nInputs); + std::vector<int> vInputs(nInputs); + int i; + for(i = 0; i < nInputs; i++) { + vInputs[vLevels[i]] = Vec_IntEntry(vSupp, nInputs - i - 1) << 1; + } + for(i = 0; i < nOutputs; i++) { + int node = BDDGenerateAigRec(pNew, vInputs, vvNodes, i, 0); + Gia_ManAppendCo(pNew, node); + } + } +}; + +const int TruthTable::ww = 64; +const int TruthTable::lww = 6; + +const word TruthTable::ones[7] = {ABC_CONST(0x0000000000000001), + ABC_CONST(0x0000000000000003), + ABC_CONST(0x000000000000000f), + ABC_CONST(0x00000000000000ff), + ABC_CONST(0x000000000000ffff), + ABC_CONST(0x00000000ffffffff), + ABC_CONST(0xffffffffffffffff)}; + +const word TruthTable::swapmask[5] = {ABC_CONST(0x2222222222222222), + ABC_CONST(0x0c0c0c0c0c0c0c0c), + ABC_CONST(0x00f000f000f000f0), + ABC_CONST(0x0000ff000000ff00), + ABC_CONST(0x00000000ffff0000)}; + +class TruthTableReo : public TruthTable { +public: + bool fBuilt; + std::vector<std::vector<int> > vvChildren; + std::vector<std::vector<std::vector<int> > > vvChildrenSaved; + + TruthTableReo(int nInputs, int nOutputs): TruthTable(nInputs, nOutputs) { + fBuilt = false; + } + + void Save(unsigned i) { + if(vLevelsSaved.size() < i + 1) { + vLevelsSaved.resize(i + 1); + } + vLevelsSaved[i] = vLevels; + } + + void Load(unsigned i) { + assert(i < vLevelsSaved.size()); + vLevels = vLevelsSaved[i]; + } + + void SaveIndices(unsigned i) { + TruthTable::SaveIndices(i); + if(vvChildrenSaved.size() < i + 1) { + vvChildrenSaved.resize(i + 1); + } + vvChildrenSaved[i] = vvChildren; + } + + void LoadIndices(unsigned i) { + TruthTable::LoadIndices(i); + vvChildren = vvChildrenSaved[i]; + } + + void BDDBuildStartup() { + vvChildren.clear(); + vvChildren.resize(nInputs); + TruthTable::BDDBuildStartup(); + } + + void BDDBuildLevel(int lev) { + for(unsigned i = 0; i < vvIndices[lev-1].size(); i++) { + int index = vvIndices[lev-1][i]; + int cof0 = BDDBuildOne(index << 1, lev); + int cof1 = BDDBuildOne((index << 1) ^ 1, lev); + vvChildren[lev-1].push_back(cof0); + vvChildren[lev-1].push_back(cof1); + if(cof0 == cof1) { + vvRedundantIndices[lev-1].push_back(index); + } + } + } + + int BDDBuild() { + if(fBuilt) { + return BDDNodeCount(); + } + fBuilt = true; + BDDBuildStartup(); + for(int i = 1; i < nInputs + 1; i++) { + BDDBuildLevel(i); + } + return BDDNodeCount(); + } + + int BDDRebuildOne(int index, int cof0, int cof1, int lev, Hash_IntMan_t *unique, std::vector<int> &vChildrenLow) { + if(cof0 < 0 && cof0 == cof1) { + return cof0; + } + bool fCompl = cof0 & 1; + if(fCompl) { + cof0 ^= 1; + cof1 ^= 1; + } + int *place = Hash_Int2ManLookup(unique, cof0, cof1); + if(*place) { + return (Hash_IntObjData2(unique, *place) << 1) ^ (int)fCompl; + } + vvIndices[lev].push_back(index); + Hash_Int2ManInsert(unique, cof0, cof1, vvIndices[lev].size() - 1); + vChildrenLow.push_back(cof0); + vChildrenLow.push_back(cof1); + if(cof0 == cof1) { + vvRedundantIndices[lev].push_back(index); + } + return ((vvIndices[lev].size() - 1) << 1) ^ (int)fCompl; + } + + int BDDRebuild(int lev) { + vvRedundantIndices[lev].clear(); + vvRedundantIndices[lev+1].clear(); + std::vector<int> vChildrenHigh; + std::vector<int> vChildrenLow; + Hash_IntMan_t *unique = Hash_IntManStart(2 * vvIndices[lev+1].size()); + vvIndices[lev+1].clear(); + for(unsigned i = 0; i < vvIndices[lev].size(); i++) { + int index = vvIndices[lev][i]; + int cof0index = vvChildren[lev][i+i] >> 1; + int cof1index = vvChildren[lev][i+i+1] >> 1; + bool cof0c = vvChildren[lev][i+i] & 1; + bool cof1c = vvChildren[lev][i+i+1] & 1; + int cof00, cof01, cof10, cof11; + if(cof0index < 0) { + cof00 = -2 ^ (int)cof0c; + cof01 = -2 ^ (int)cof0c; + } else { + cof00 = vvChildren[lev+1][cof0index+cof0index] ^ (int)cof0c; + cof01 = vvChildren[lev+1][cof0index+cof0index+1] ^ (int)cof0c; + } + if(cof1index < 0) { + cof10 = -2 ^ (int)cof1c; + cof11 = -2 ^ (int)cof1c; + } else { + cof10 = vvChildren[lev+1][cof1index+cof1index] ^ (int)cof1c; + cof11 = vvChildren[lev+1][cof1index+cof1index+1] ^ (int)cof1c; + } + int newcof0 = BDDRebuildOne(index << 1, cof00, cof10, lev + 1, unique, vChildrenLow); + int newcof1 = BDDRebuildOne((index << 1) ^ 1, cof01, cof11, lev + 1, unique, vChildrenLow); + vChildrenHigh.push_back(newcof0); + vChildrenHigh.push_back(newcof1); + if(newcof0 == newcof1) { + vvRedundantIndices[lev].push_back(index); + } + } + Hash_IntManStop(unique); + vvChildren[lev] = vChildrenHigh; + vvChildren[lev+1] = vChildrenLow; + return BDDNodeCount(); + } + + void Swap(int lev) { + assert(lev < nInputs - 1); + std::vector<int>::iterator it0 = std::find(vLevels.begin(), vLevels.end(), lev); + std::vector<int>::iterator it1 = std::find(vLevels.begin(), vLevels.end(), lev + 1); + std::swap(*it0, *it1); + BDDRebuild(lev); + } + + int BDDSwap(int lev) { + Swap(lev); + return BDDNodeCount(); + } + + virtual void BDDGenerateAig(Gia_Man_t *pNew, Vec_Int_t *vSupp) { + abort(); + } +}; + +class TruthTableRewrite : public TruthTable { +public: + TruthTableRewrite(int nInputs, int nOutputs): TruthTable(nInputs, nOutputs) {} + + void SetValue(int index_lev, int lev, word value) { + assert(index_lev >= 0); + assert(nInputs - lev <= lww); + int logwidth = nInputs - lev; + int index = index_lev >> (lww - logwidth); + int pos = (index_lev % (1 << (lww - logwidth))) << logwidth; + t[index] &= ~(ones[logwidth] << pos); + t[index] ^= value << pos; + } + + void CopyFunc(int index1, int index2, int lev, bool fCompl) { + assert(index1 >= 0); + int logwidth = nInputs - lev; + if(logwidth > lww) { + int nScopeSize = 1 << (logwidth - lww); + if(!fCompl) { + if(index2 < 0) { + for(int i = 0; i < nScopeSize; i++) { + t[nScopeSize * index1 + i] = 0; + } + } else { + for(int i = 0; i < nScopeSize; i++) { + t[nScopeSize * index1 + i] = t[nScopeSize * index2 + i]; + } + } + } else { + if(index2 < 0) { + for(int i = 0; i < nScopeSize; i++) { + t[nScopeSize * index1 + i] = ones[lww]; + } + } else { + for(int i = 0; i < nScopeSize; i++) { + t[nScopeSize * index1 + i] = ~t[nScopeSize * index2 + i]; + } + } + } + } else { + word value = 0; + if(index2 >= 0) { + value = GetValue(index2, lev); + } + if(fCompl) { + value ^= ones[logwidth]; + } + SetValue(index1, lev, value); + } + } + + void ShiftToMajority(int index, int lev) { + assert(index >= 0); + int logwidth = nInputs - lev; + int count = 0; + if(logwidth > lww) { + int nScopeSize = 1 << (logwidth - lww); + for(int i = 0; i < nScopeSize; i++) { + count += bsw(t[nScopeSize * index + i]).count(); + } + } else { + count = bsw(GetValue(index, lev)).count(); + } + bool majority = count > (1 << (logwidth - 1)); + CopyFunc(index, -1, lev, majority); + } +}; + +class TruthTableCare : public TruthTableRewrite { +public: + std::vector<word> originalt; + std::vector<word> caret; + std::vector<word> care; + + std::vector<std::vector<std::pair<int, int> > > vvMergedIndices; + + std::vector<std::vector<word> > savedcare; + std::vector<std::vector<std::vector<std::pair<int, int> > > > vvMergedIndicesSaved; + + TruthTableCare(int nInputs, int nOutputs): TruthTableRewrite(nInputs, nOutputs) { + if(nSize) { + care.resize(nSize); + } else { + care.resize(1); + } + } + + void Save(unsigned i) { + TruthTable::Save(i); + if(savedcare.size() < i + 1) { + savedcare.resize(i + 1); + } + savedcare[i] = care; + } + + void Load(unsigned i) { + TruthTable::Load(i); + care = savedcare[i]; + } + + void SaveIndices(unsigned i) { + TruthTable::SaveIndices(i); + if(vvMergedIndicesSaved.size() < i + 1) { + vvMergedIndicesSaved.resize(i + 1); + } + vvMergedIndicesSaved[i] = vvMergedIndices; + } + + void LoadIndices(unsigned i) { + TruthTable::LoadIndices(i); + vvMergedIndices = vvMergedIndicesSaved[i]; + } + + void Swap(int lev) { + TruthTable::Swap(lev); + if(nInputs - lev - 1 > lww) { + int nScopeSize = 1 << (nInputs - lev - 2 - lww); + for(int i = nScopeSize; i < nSize; i += (nScopeSize << 2)) { + for(int j = 0; j < nScopeSize; j++) { + std::swap(care[i + j], care[i + nScopeSize + j]); + } + } + } else if(nInputs - lev - 1 == lww) { + for(int i = 0; i < nSize; i += 2) { + care[i+1] ^= care[i] >> (ww / 2); + care[i] ^= care[i+1] << (ww / 2); + care[i+1] ^= care[i] >> (ww / 2); + } + } else { + for(int i = 0; i < nSize || (i == 0 && !nSize); i++) { + int d = nInputs - lev - 2; + int shamt = 1 << d; + care[i] ^= (care[i] >> shamt) & swapmask[d]; + care[i] ^= (care[i] & swapmask[d]) << shamt; + care[i] ^= (care[i] >> shamt) & swapmask[d]; + } + } + } + + void RestoreCare() { + caret.clear(); + if(nSize) { + for(int i = 0; i < nOutputs; i++) { + caret.insert(caret.end(), care.begin(), care.end()); + } + } else { + caret.resize(nTotalSize); + for(int i = 0; i < nOutputs; i++) { + int padding = i * (1 << nInputs); + caret[padding / ww] |= care[0] << (padding % ww); + } + } + } + + word GetCare(int index_lev, int lev) { + assert(index_lev >= 0); + assert(nInputs - lev <= lww); + int logwidth = nInputs - lev; + int index = index_lev >> (lww - logwidth); + int pos = (index_lev % (1 << (lww - logwidth))) << logwidth; + return (caret[index] >> pos) & ones[logwidth]; + } + + void CopyFuncMasked(int index1, int index2, int lev, bool fCompl) { + assert(index1 >= 0); + assert(index2 >= 0); + int logwidth = nInputs - lev; + if(logwidth > lww) { + int nScopeSize = 1 << (logwidth - lww); + for(int i = 0; i < nScopeSize; i++) { + word value = t[nScopeSize * index2 + i]; + if(fCompl) { + value = ~value; + } + word cvalue = caret[nScopeSize * index2 + i]; + t[nScopeSize * index1 + i] &= ~cvalue; + t[nScopeSize * index1 + i] |= cvalue & value; + } + } else { + word one = ones[logwidth]; + word value1 = GetValue(index1, lev); + word value2 = GetValue(index2, lev); + if(fCompl) { + value2 ^= one; + } + word cvalue = GetCare(index2, lev); + value1 &= cvalue ^ one; + value1 |= cvalue & value2; + SetValue(index1, lev, value1); + } + } + + bool IsDC(int index, int lev) { + if(nInputs - lev > lww) { + int nScopeSize = 1 << (nInputs - lev - lww); + for(int i = 0; i < nScopeSize; i++) { + if(caret[nScopeSize * index + i]) { + return false; + } + } + } else if(GetCare(index, lev)) { + return false; + } + return true; + } + + int Include(int index1, int index2, int lev, bool fCompl) { + assert(index1 >= 0); + assert(index2 >= 0); + int logwidth = nInputs - lev; + bool fEq = true; + if(logwidth > lww) { + int nScopeSize = 1 << (logwidth - lww); + for(int i = 0; i < nScopeSize && (fEq || fCompl); i++) { + word cvalue = caret[nScopeSize * index2 + i]; + if(~caret[nScopeSize * index1 + i] & cvalue) { + return 0; + } + word value = t[nScopeSize * index1 + i] ^ t[nScopeSize * index2 + i]; + fEq &= !(value & cvalue); + fCompl &= !(~value & cvalue); + } + } else { + word cvalue = GetCare(index2, lev); + if((GetCare(index1, lev) ^ ones[logwidth]) & cvalue) { + return 0; + } + word value = GetValue(index1, lev) ^ GetValue(index2, lev); + fEq &= !(value & cvalue); + fCompl &= !((value ^ ones[logwidth]) & cvalue); + } + return 2 * fCompl + fEq; + } + + int Intersect(int index1, int index2, int lev, bool fCompl, bool fEq = true) { + assert(index1 >= 0); + assert(index2 >= 0); + int logwidth = nInputs - lev; + if(logwidth > lww) { + int nScopeSize = 1 << (logwidth - lww); + for(int i = 0; i < nScopeSize && (fEq || fCompl); i++) { + word value = t[nScopeSize * index1 + i] ^ t[nScopeSize * index2 + i]; + word cvalue = caret[nScopeSize * index1 + i] & caret[nScopeSize * index2 + i]; + fEq &= !(value & cvalue); + fCompl &= !(~value & cvalue); + } + } else { + word value = GetValue(index1, lev) ^ GetValue(index2, lev); + word cvalue = GetCare(index1, lev) & GetCare(index2, lev); + fEq &= !(value & cvalue); + fCompl &= !((value ^ ones[logwidth]) & cvalue); + } + return 2 * fCompl + fEq; + } + + void MergeCare(int index1, int index2, int lev) { + assert(index1 >= 0); + assert(index2 >= 0); + int logwidth = nInputs - lev; + if(logwidth > lww) { + int nScopeSize = 1 << (logwidth - lww); + for(int i = 0; i < nScopeSize; i++) { + caret[nScopeSize * index1 + i] |= caret[nScopeSize * index2 + i]; + } + } else { + word value = GetCare(index2, lev); + int index = index1 >> (lww - logwidth); + int pos = (index1 % (1 << (lww - logwidth))) << logwidth; + caret[index] |= value << pos; + } + } + + void Merge(int index1, int index2, int lev, bool fCompl) { + MergeCare(index1, index2, lev); + vvMergedIndices[lev].push_back(std::make_pair((index1 << 1) ^ (int)fCompl, index2)); + } + + int BDDBuildOne(int index, int lev) { + int r = BDDFind(index, lev); + if(r >= -2) { + if(r >= 0) { + Merge(vvIndices[lev][r >> 1], index, lev, r & 1); + } + return r; + } + vvIndices[lev].push_back(index); + return (vvIndices[lev].size() - 1) << 1; + } + + void CompleteMerge() { + for(int i = nInputs - 1; i >= 0; i--) { + for(std::vector<std::pair<int, int> >::reverse_iterator it = vvMergedIndices[i].rbegin(); it != vvMergedIndices[i].rend(); it++) { + CopyFunc((*it).second, (*it).first >> 1, i, (*it).first & 1); + } + } + } + + void BDDBuildStartup() { + RestoreCare(); + vvIndices.clear(); + vvIndices.resize(nInputs); + vvRedundantIndices.clear(); + vvRedundantIndices.resize(nInputs); + vvMergedIndices.clear(); + vvMergedIndices.resize(nInputs); + for(int i = 0; i < nOutputs; i++) { + if(!IsDC(i, 0)) { + BDDBuildOne(i, 0); + } + } + } + + virtual void BDDRebuildByMerge(int lev) { + for(unsigned i = 0; i < vvMergedIndices[lev].size(); i++) { + std::pair<int, int> &p = vvMergedIndices[lev][i]; + MergeCare(p.first >> 1, p.second, lev); + } + } + + int BDDRebuild(int lev) { + RestoreCare(); + int i; + for(i = lev; i < nInputs; i++) { + vvIndices[i].clear(); + vvMergedIndices[i].clear(); + if(i) { + vvRedundantIndices[i-1].clear(); + } + } + for(i = 0; i < lev; i++) { + BDDRebuildByMerge(i); + } + for(i = lev; i < nInputs; i++) { + if(!i) { + for(int j = 0; j < nOutputs; j++) { + if(!IsDC(j, 0)) { + BDDBuildOne(j, 0); + } + } + } else { + BDDBuildLevel(i); + } + } + return BDDNodeCount(); + } + + int BDDSwap(int lev) { + Swap(lev); + return BDDRebuild(lev); + } + + void OptimizationStartup() { + originalt = t; + RestoreCare(); + vvIndices.clear(); + vvIndices.resize(nInputs); + vvMergedIndices.clear(); + vvMergedIndices.resize(nInputs); + for(int i = 0; i < nOutputs; i++) { + if(!IsDC(i, 0)) { + BDDBuildOne(i, 0); + } else { + ShiftToMajority(i, 0); + } + } + } + + virtual void Optimize() { + OptimizationStartup(); + for(int i = 1; i < nInputs; i++) { + for(unsigned j = 0; j < vvIndices[i-1].size(); j++) { + int index = vvIndices[i-1][j]; + BDDBuildOne(index << 1, i); + BDDBuildOne((index << 1) ^ 1, i); + } + } + CompleteMerge(); + } +}; + +class TruthTableLevelTSM : public TruthTableCare { +public: + TruthTableLevelTSM(int nInputs, int nOutputs): TruthTableCare(nInputs, nOutputs) {} + + int BDDFindTSM(int index, int lev) { + int logwidth = nInputs - lev; + if(logwidth > lww) { + int nScopeSize = 1 << (logwidth - lww); + bool fZero = true; + bool fOne = true; + for(int i = 0; i < nScopeSize && (fZero || fOne); i++) { + word value = t[nScopeSize * index + i]; + word cvalue = caret[nScopeSize * index + i]; + fZero &= !(value & cvalue); + fOne &= !(~value & cvalue); + } + if(fZero || fOne) { + return -2 ^ (int)fOne; + } + for(unsigned j = 0; j < vvIndices[lev].size(); j++) { + int index2 = vvIndices[lev][j]; + bool fEq = true; + bool fCompl = true; + for(int i = 0; i < nScopeSize && (fEq || fCompl); i++) { + word value = t[nScopeSize * index + i] ^ t[nScopeSize * index2 + i]; + word cvalue = caret[nScopeSize * index + i] & caret[nScopeSize * index2 + i]; + fEq &= !(value & cvalue); + fCompl &= !(~value & cvalue); + } + if(fEq || fCompl) { + return (index2 << 1) ^ (int)!fEq; + } + } + } else { + word one = ones[logwidth]; + word value = GetValue(index, lev); + word cvalue = GetCare(index, lev); + if(!(value & cvalue)) { + return -2; + } + if(!((value ^ one) & cvalue)) { + return -1; + } + for(unsigned j = 0; j < vvIndices[lev].size(); j++) { + int index2 = vvIndices[lev][j]; + word value2 = value ^ GetValue(index2, lev); + word cvalue2 = cvalue & GetCare(index2, lev); + if(!(value2 & cvalue2)) { + return index2 << 1; + } + if(!((value2 ^ one) & cvalue2)) { + return (index2 << 1) ^ 1; + } + } + } + return -3; + } + + int BDDBuildOne(int index, int lev) { + int r = BDDFindTSM(index, lev); + if(r >= -2) { + if(r >= 0) { + CopyFuncMasked(r >> 1, index, lev, r & 1); + Merge(r >> 1, index, lev, r & 1); + } else { + vvMergedIndices[lev].push_back(std::make_pair(r, index)); + } + return r; + } + vvIndices[lev].push_back(index); + return index << 1; + } + + int BDDBuild() { + TruthTable::Save(3); + int r = TruthTable::BDDBuild(); + TruthTable::Load(3); + return r; + } + + void BDDRebuildByMerge(int lev) { + for(unsigned i = 0; i < vvMergedIndices[lev].size(); i++) { + std::pair<int, int> &p = vvMergedIndices[lev][i]; + if(p.first >= 0) { + CopyFuncMasked(p.first >> 1, p.second, lev, p.first & 1); + MergeCare(p.first >> 1, p.second, lev); + } + } + } + + int BDDRebuild(int lev) { + TruthTable::Save(3); + int r = TruthTableCare::BDDRebuild(lev); + TruthTable::Load(3); + return r; + } +}; + +} + +Gia_Man_t * Gia_ManTtopt( Gia_Man_t * p, int nIns, int nOuts, int nRounds ) +{ + Gia_Man_t * pNew; + Gia_Obj_t * pObj; + Vec_Int_t * vSupp; + word v; + word * pTruth; + int i, g, k, nInputs; + Gia_ManLevelNum( p ); + pNew = Gia_ManStart( Gia_ManObjNum(p) ); + pNew->pName = Abc_UtilStrsav( p->pName ); + pNew->pSpec = Abc_UtilStrsav( p->pSpec ); + Gia_ManForEachCi( p, pObj, k ) + Gia_ManAppendCi( pNew ); + Gia_ObjComputeTruthTableStart( p, nIns ); + Gia_ManHashStart( pNew ); + for ( g = 0; g < Gia_ManCoNum(p); g += nOuts ) + { + vSupp = Gia_ManCollectSuppNew( p, g, nOuts ); + nInputs = Vec_IntSize( vSupp ); + Ttopt::TruthTableReo tt( nInputs, nOuts ); + for ( k = 0; k < nOuts; k++ ) + { + pObj = Gia_ManCo( p, g+k ); + pTruth = Gia_ObjComputeTruthTableCut( p, Gia_ObjFanin0(pObj), vSupp ); + if ( nInputs >= 6 ) + for ( i = 0; i < tt.nSize; i++ ) + tt.t[i + tt.nSize * k] = Gia_ObjFaninC0(pObj)? ~pTruth[i]: pTruth[i]; + else + { + i = k * (1 << nInputs); + v = (Gia_ObjFaninC0(pObj)? ~pTruth[0]: pTruth[0]) & tt.ones[nInputs]; + tt.t[i / tt.ww] |= v << (i % tt.ww); + } + } + tt.RandomSiftReo( nRounds ); + Ttopt::TruthTable tt2( nInputs, nOuts ); + tt2.t = tt.t; + tt2.Reo( tt.vLevels ); + tt2.BDDGenerateAig( pNew, vSupp ); + Vec_IntFree( vSupp ); + } + Gia_ObjComputeTruthTableStop( p ); + Gia_ManHashStop( pNew ); + Gia_ManSetRegNum( pNew, Gia_ManRegNum(p) ); + return pNew; +} + +Gia_Man_t * Gia_ManTtoptCare( Gia_Man_t * p, int nIns, int nOuts, int nRounds, char * pFileName, int nRarity ) +{ + int fVerbose = 0; + Gia_Man_t * pNew; + Gia_Obj_t * pObj; + Vec_Int_t * vSupp; + word v; + word * pTruth, * pCare; + int i, g, k, nInputs; + Vec_Wrd_t * vSimI = Vec_WrdReadBin( pFileName, fVerbose ); + Gia_ManLevelNum( p ); + pNew = Gia_ManStart( Gia_ManObjNum(p) ); + pNew->pName = Abc_UtilStrsav( p->pName ); + pNew->pSpec = Abc_UtilStrsav( p->pSpec ); + Gia_ManForEachCi( p, pObj, k ) + Gia_ManAppendCi( pNew ); + Gia_ObjComputeTruthTableStart( p, nIns ); + Gia_ManHashStart( pNew ); + for ( g = 0; g < Gia_ManCoNum(p); g += nOuts ) + { + vSupp = Gia_ManCollectSuppNew( p, g, nOuts ); + nInputs = Vec_IntSize( vSupp ); + Ttopt::TruthTableLevelTSM tt( nInputs, nOuts ); + for ( k = 0; k < nOuts; k++ ) + { + pObj = Gia_ManCo( p, g+k ); + pTruth = Gia_ObjComputeTruthTableCut( p, Gia_ObjFanin0(pObj), vSupp ); + if ( nInputs >= 6 ) + for ( i = 0; i < tt.nSize; i++ ) + tt.t[i + tt.nSize * k] = Gia_ObjFaninC0(pObj)? ~pTruth[i]: pTruth[i]; + else + { + i = k * (1 << nInputs); + v = (Gia_ObjFaninC0(pObj)? ~pTruth[0]: pTruth[0]) & tt.ones[nInputs]; + tt.t[i / tt.ww] |= v << (i % tt.ww); + } + } + i = 1 << Vec_IntSize( vSupp ); + pCare = Gia_ManCountFraction( p, vSimI, vSupp, nRarity, fVerbose, &i ); + tt.care[0] = pCare[0]; + for ( i = 1; i < tt.nSize; i++ ) + tt.care[i] = pCare[i]; + ABC_FREE( pCare ); + tt.RandomSiftReo( nRounds ); + tt.Optimize(); + tt.BDDGenerateAig( pNew, vSupp ); + Vec_IntFree( vSupp ); + } + Gia_ObjComputeTruthTableStop( p ); + Gia_ManHashStop( pNew ); + Gia_ManSetRegNum( pNew, Gia_ManRegNum(p) ); + Vec_WrdFreeP( &vSimI ); + return pNew; +} + +ABC_NAMESPACE_IMPL_END + diff --git a/src/aig/gia/giaUtil.c b/src/aig/gia/giaUtil.c index d8130550..dfddc693 100644 --- a/src/aig/gia/giaUtil.c +++ b/src/aig/gia/giaUtil.c @@ -3130,6 +3130,37 @@ void Gia_ManWriteResub( Gia_Man_t * p, char * pFileName ) } } + +/**Function************************************************************* + + Synopsis [Transform flops.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Gia_ManPrintArray( Gia_Man_t * p ) +{ + Gia_Obj_t * pObj; int i, nSize = Gia_ManObjNum(p); + printf( "static int s_ArraySize = %d;\n", nSize ); + printf( "static int s_ArrayData[%d] = {\n", 2*nSize ); + printf( " 0, 0," ); + printf( "\n " ); + Gia_ManForEachCi( p, pObj, i ) + printf( "0, 0, " ); + printf( "\n " ); + Gia_ManForEachAnd( p, pObj, i ) + printf( "%d, %d, ", Gia_ObjFaninLit0p(p, pObj), Gia_ObjFaninLit1p(p, pObj) ); + printf( "\n " ); + Gia_ManForEachCo( p, pObj, i ) + printf( "%d, %d, ", Gia_ObjFaninLit0p(p, pObj), Gia_ObjFaninLit0p(p, pObj) ); + printf( "\n" ); + printf( "};\n" ); + +} //////////////////////////////////////////////////////////////////////// /// END OF FILE /// //////////////////////////////////////////////////////////////////////// diff --git a/src/aig/gia/module.make b/src/aig/gia/module.make index 171d8be3..870da208 100644 --- a/src/aig/gia/module.make +++ b/src/aig/gia/module.make @@ -77,6 +77,7 @@ SRC += src/aig/gia/giaAig.c \ src/aig/gia/giaSatLut.c \ src/aig/gia/giaSatMap.c \ src/aig/gia/giaSatoko.c \ + src/aig/gia/giaSatSyn.c \ src/aig/gia/giaSat3.c \ src/aig/gia/giaScl.c \ src/aig/gia/giaScript.c \ @@ -104,5 +105,6 @@ SRC += src/aig/gia/giaAig.c \ src/aig/gia/giaTis.c \ src/aig/gia/giaTruth.c \ src/aig/gia/giaTsim.c \ + src/aig/gia/giaTtopt.cpp \ src/aig/gia/giaUnate.c \ src/aig/gia/giaUtil.c diff --git a/src/aig/miniaig/miniaig.h b/src/aig/miniaig/miniaig.h index 0365b946..9aa41b11 100644 --- a/src/aig/miniaig/miniaig.h +++ b/src/aig/miniaig/miniaig.h @@ -144,6 +144,18 @@ static Mini_Aig_t * Mini_AigStart() Mini_AigPush( p, MINI_AIG_NULL, MINI_AIG_NULL ); return p; } +static Mini_Aig_t * Mini_AigStartSupport( int nIns, int nObjsAlloc ) +{ + Mini_Aig_t * p; int i; + assert( 1+nIns < nObjsAlloc ); + p = MINI_AIG_CALLOC( Mini_Aig_t, 1 ); + p->nCap = 2*nObjsAlloc; + p->nSize = 2*(1+nIns); + p->pArray = MINI_AIG_ALLOC( int, p->nCap ); + for ( i = 0; i < p->nSize; i++ ) + p->pArray[i] = MINI_AIG_NULL; + return p; +} static void Mini_AigStop( Mini_Aig_t * p ) { MINI_AIG_FREE( p->pArray ); @@ -170,6 +182,31 @@ static int Mini_AigAndNum( Mini_Aig_t * p ) nNodes++; return nNodes; } +static int Mini_AigXorNum( Mini_Aig_t * p ) +{ + int i, nNodes = 0; + Mini_AigForEachAnd( p, i ) + nNodes += p->pArray[2*i] > p->pArray[2*i+1]; + return nNodes; +} +static int Mini_AigLevelNum( Mini_Aig_t * p ) +{ + int i, Level = 0; + int * pLevels = MINI_AIG_CALLOC( int, Mini_AigNodeNum(p) ); + Mini_AigForEachAnd( p, i ) + { + int Lel0 = pLevels[Mini_AigLit2Var(Mini_AigNodeFanin0(p, i))]; + int Lel1 = pLevels[Mini_AigLit2Var(Mini_AigNodeFanin1(p, i))]; + pLevels[i] = 1 + (Lel0 > Lel1 ? Lel0 : Lel1); + } + Mini_AigForEachPo( p, i ) + { + int Lel0 = pLevels[Mini_AigLit2Var(Mini_AigNodeFanin0(p, i))]; + Level = Level > Lel0 ? Level : Lel0; + } + MINI_AIG_FREE( pLevels ); + return Level; +} static void Mini_AigPrintStats( Mini_Aig_t * p ) { printf( "MiniAIG stats: PI = %d PO = %d FF = %d AND = %d\n", Mini_AigPiNum(p), Mini_AigPoNum(p), Mini_AigRegNum(p), Mini_AigAndNum(p) ); @@ -648,6 +685,25 @@ int main( int argc, char ** argv ) } */ +/* +#include "aig/miniaig/miniaig.h" + +// this procedure creates a MiniAIG for function F = a*b + ~c and writes it into a file "test.aig" +void Mini_AigTest() +{ + Mini_Aig_t * p = Mini_AigStart(); // create empty AIG manager (contains only const0 node) + int litApos = Mini_AigCreatePi( p ); // create input A (returns pos lit of A) + int litBpos = Mini_AigCreatePi( p ); // create input B (returns pos lit of B) + int litCpos = Mini_AigCreatePi( p ); // create input C (returns pos lit of C) + int litCneg = Mini_AigLitNot( litCpos ); // neg lit of C + int litAnd = Mini_AigAnd( p, litApos, litBpos ); // lit for a*b + int litOr = Mini_AigOr( p, litAnd, litCneg ); // lit for a*b + ~c + Mini_AigCreatePo( p, litOr ); // create primary output + Mini_AigerWrite( "test.aig", p, 1 ); // write the result into a file + Mini_AigStop( p ); // deallocate MiniAIG +} +*/ + //////////////////////////////////////////////////////////////////////// /// FUNCTION DECLARATIONS /// //////////////////////////////////////////////////////////////////////// diff --git a/src/aig/miniaig/ndr.h b/src/aig/miniaig/ndr.h index 68c2779c..19373063 100644 --- a/src/aig/miniaig/ndr.h +++ b/src/aig/miniaig/ndr.h @@ -506,7 +506,7 @@ static inline void Ndr_WriteVerilogModule( FILE * pFile, void * pDesign, int Mod else if ( nArray == 3 && Type == ABC_OPER_ARI_ADD ) fprintf( pFile, "%s + %s + %s;\n", pNames[pArray[0]], pNames[pArray[1]], pNames[pArray[2]] ); else if ( Type == ABC_OPER_BIT_MUX ) - fprintf( pFile, "%s ? %s : %s;\n", pNames[pArray[0]], pNames[pArray[1]], pNames[pArray[2]] ); + fprintf( pFile, "%s ? %s : %s;\n", pNames[pArray[0]], pNames[pArray[2]], pNames[pArray[1]] ); else fprintf( pFile, "<cannot write operation %s>;\n", Abc_OperName(Ndr_ObjReadBody(p, Obj, NDR_OPERTYPE)) ); } diff --git a/src/base/abc/abcUtil.c b/src/base/abc/abcUtil.c index 29753210..88a16e7b 100644 --- a/src/base/abc/abcUtil.c +++ b/src/base/abc/abcUtil.c @@ -3267,6 +3267,91 @@ Gia_Man_t * Abc_SopSynthesizeOne( char * pSop, int fClp ) return Abc_NtkStrashToGia( pNtkNew ); } + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static int s_ArraySize = 145; +static int s_ArrayData[290] = { + 0, 0, + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, + 10, 6, 14, 12, 10, 2, 22, 20, 2, 24, 16, 4, 28, 18, 16, 10, 8, 4, 34, 32, 30, 36, 38, 26, 16, 6, 36, 20, 44, 42, 46, 40, 42, 44, 14, 6, 52, 34, 32, 54, 56, 50, 58, 48, 32, 24, 20, 2, 12, 6, 66, 34, 68, 64, 62, 70, 28, 68, 74, 72, 76, 58, 70, 62, 80, 78, 68, 28, 84, 74, 4, 2, 88, 20, 64, 90, 92, 86, 66, 32, 18, 96, 98, 56, 100, 94, 52, 36, 104, 38, 90, 42, 36, 2, 108, 110, 112, 106, 114, 100, 102, 116, 118, 82, 116, 60, 120, 122, 124, 60, 118, 60, 102, 82, 128, 130, 132, 82, 134, 126, 82, 116, 122, 138, 122, 118, 142, 140, 60, 102, 130, 146, 130, 118, 150, 148, 152, 144, 154, 136, 18, 156, 144, 126, 68, 160, 32, 136, 164, 162, 166, 158, 28, 160, 70, 126, 90, 144, 174, 172, 176, 170, 152, 134, 36, 180, 2, 134, 184, 182, 186, 178, 188, 168, 64, 144, 164, 158, 194, 192, 96, 156, 44, 154, 200, 170, 202, 198, 204, 176, 206, 196, 204, 168, 62, 126, 212, 186, 24, 134, 108, 152, 218, 192, 220, 216, 222, 214, 224, 210, 220, 194, 110, 152, 30, 180, 232, 230, 184, 172, 236, 234, 238, 228, 234, 182, 242, 220, 244, 168, 42, 154, 248, 202, 54, 136, 252, 164, 254, 214, 256, 250, 218, 194, 252, 198, 262, 242, 264, 260, 232, 220, 268, 262, 270, 168, + 191, 191, 209, 209, 226, 226, 240, 240, 246, 246, 259, 259, 267, 267, 272, 272, +}; +int Abc_NtkHasConstNode() +{ + int i; + for ( i = 1; i < s_ArraySize; i++ ) + if ( s_ArrayData[2*i] || s_ArrayData[2*i+1] ) + break; + for ( ; i < s_ArraySize; i++ ) + if ( s_ArrayData[2*i] < 2 && s_ArrayData[2*i+1] < 2 ) + return 1; + return 0; +} +Abc_Ntk_t * Abc_NtkFromArray() +{ + Vec_Ptr_t * vNodes = Vec_PtrAlloc( s_ArraySize ); int i, nPos = 0; + Abc_Ntk_t * pNtkNew = Abc_NtkAlloc( ABC_NTK_LOGIC, ABC_FUNC_SOP, 1 ); + Abc_Obj_t * pObjNew = Abc_NtkHasConstNode() ? Abc_NtkCreateNode(pNtkNew) : NULL; + if ( pObjNew ) pObjNew->pData = Abc_SopCreateConst0((Mem_Flex_t *)pNtkNew->pManFunc); + Vec_PtrPush( vNodes, pObjNew ); + for ( i = 1; i < s_ArraySize; i++ ) + if ( !s_ArrayData[2*i] && !s_ArrayData[2*i+1] ) + Vec_PtrPush( vNodes, Abc_NtkCreatePi(pNtkNew) ); + else + break; + for ( ; i < s_ArraySize; i++ ) + { + char * pSop = NULL; + if ( s_ArrayData[2*i] > s_ArrayData[2*i+1] ) + pSop = Abc_SopCreateXor( (Mem_Flex_t *)pNtkNew->pManFunc, 2 ); + else if ( s_ArrayData[2*i] < s_ArrayData[2*i+1] ) + pSop = Abc_SopCreateAnd( (Mem_Flex_t *)pNtkNew->pManFunc, 2, NULL ); + else + break; + pObjNew = Abc_NtkCreateNode( pNtkNew ); + Abc_ObjAddFanin( pObjNew, (Abc_Obj_t *)Vec_PtrEntry(vNodes, Abc_Lit2Var(s_ArrayData[2*i])) ); + Abc_ObjAddFanin( pObjNew, (Abc_Obj_t *)Vec_PtrEntry(vNodes, Abc_Lit2Var(s_ArrayData[2*i+1])) ); + if ( Abc_LitIsCompl(s_ArrayData[2*i]) ) Abc_SopComplementVar( pSop, 0 ); + if ( Abc_LitIsCompl(s_ArrayData[2*i+1]) ) Abc_SopComplementVar( pSop, 1 ); + pObjNew->pData = pSop; + Vec_PtrPush( vNodes, pObjNew ); + } + for ( ; i < s_ArraySize; i++ ) + { + char * pSop = NULL; + assert( s_ArrayData[2*i] == s_ArrayData[2*i+1] ); + pObjNew = Abc_NtkCreateNode( pNtkNew ); + Abc_ObjAddFanin( pObjNew, (Abc_Obj_t *)Vec_PtrEntry(vNodes, Abc_Lit2Var(s_ArrayData[2*i])) ); + if ( Abc_LitIsCompl(s_ArrayData[2*i]) ) + pSop = Abc_SopCreateInv( (Mem_Flex_t *)pNtkNew->pManFunc ); + else + pSop = Abc_SopCreateBuf( (Mem_Flex_t *)pNtkNew->pManFunc ); + pObjNew->pData = pSop; + Vec_PtrPush( vNodes, pObjNew ); + nPos++; + } + for ( i = 0; i < nPos; i++ ) + Abc_ObjAddFanin( Abc_NtkCreatePo(pNtkNew), (Abc_Obj_t *)Vec_PtrEntry(vNodes, s_ArraySize-nPos+i) ); + Vec_PtrFree( vNodes ); + pNtkNew->pName = Extra_UtilStrsav("test"); + Abc_NtkAddDummyPiNames( pNtkNew ); + Abc_NtkAddDummyPoNames( pNtkNew ); + Abc_NtkAddDummyBoxNames( pNtkNew ); + if ( !Abc_NtkCheck( pNtkNew ) ) + Abc_Print( 1, "Abc_NtkFromArray(): Network check has failed.\n" ); + return pNtkNew; +} + //////////////////////////////////////////////////////////////////////// /// END OF FILE /// //////////////////////////////////////////////////////////////////////// diff --git a/src/base/abci/abc.c b/src/base/abci/abc.c index bb64a3f3..fd677ace 100644 --- a/src/base/abci/abc.c +++ b/src/base/abci/abc.c @@ -499,6 +499,9 @@ static int Abc_CommandAbc9LNetRead ( Abc_Frame_t * pAbc, int argc, cha static int Abc_CommandAbc9LNetSim ( Abc_Frame_t * pAbc, int argc, char ** argv ); static int Abc_CommandAbc9LNetEval ( Abc_Frame_t * pAbc, int argc, char ** argv ); static int Abc_CommandAbc9LNetOpt ( Abc_Frame_t * pAbc, int argc, char ** argv ); +//#ifndef _WIN32 +static int Abc_CommandAbc9Ttopt ( Abc_Frame_t * pAbc, int argc, char ** argv ); +//#endif static int Abc_CommandAbc9LNetMap ( Abc_Frame_t * pAbc, int argc, char ** argv ); static int Abc_CommandAbc9Unmap ( Abc_Frame_t * pAbc, int argc, char ** argv ); static int Abc_CommandAbc9Struct ( Abc_Frame_t * pAbc, int argc, char ** argv ); @@ -561,6 +564,7 @@ static int Abc_CommandAbc9Exorcism ( Abc_Frame_t * pAbc, int argc, cha static int Abc_CommandAbc9Mfs ( Abc_Frame_t * pAbc, int argc, char ** argv ); static int Abc_CommandAbc9Mfsd ( Abc_Frame_t * pAbc, int argc, char ** argv ); static int Abc_CommandAbc9DeepSyn ( Abc_Frame_t * pAbc, int argc, char ** argv ); +static int Abc_CommandAbc9SatSyn ( Abc_Frame_t * pAbc, int argc, char ** argv ); static int Abc_CommandAbc9StochSyn ( Abc_Frame_t * pAbc, int argc, char ** argv ); //static int Abc_CommandAbc9PoPart2 ( Abc_Frame_t * pAbc, int argc, char ** argv ); //static int Abc_CommandAbc9CexCut ( Abc_Frame_t * pAbc, int argc, char ** argv ); @@ -1248,6 +1252,9 @@ void Abc_Init( Abc_Frame_t * pAbc ) Cmd_CommandAdd( pAbc, "ABC9", "&lnetsim", Abc_CommandAbc9LNetSim, 0 ); Cmd_CommandAdd( pAbc, "ABC9", "&lneteval", Abc_CommandAbc9LNetEval, 0 ); Cmd_CommandAdd( pAbc, "ABC9", "&lnetopt", Abc_CommandAbc9LNetOpt, 0 ); +//#ifndef _WIN32 + Cmd_CommandAdd( pAbc, "ABC9", "&ttopt", Abc_CommandAbc9Ttopt, 0 ); +//#endif Cmd_CommandAdd( pAbc, "ABC9", "&lnetmap", Abc_CommandAbc9LNetMap, 0 ); Cmd_CommandAdd( pAbc, "ABC9", "&unmap", Abc_CommandAbc9Unmap, 0 ); Cmd_CommandAdd( pAbc, "ABC9", "&struct", Abc_CommandAbc9Struct, 0 ); @@ -1310,6 +1317,7 @@ void Abc_Init( Abc_Frame_t * pAbc ) Cmd_CommandAdd( pAbc, "ABC9", "&mfs", Abc_CommandAbc9Mfs, 0 ); Cmd_CommandAdd( pAbc, "ABC9", "&mfsd", Abc_CommandAbc9Mfsd, 0 ); Cmd_CommandAdd( pAbc, "ABC9", "&deepsyn", Abc_CommandAbc9DeepSyn, 0 ); + Cmd_CommandAdd( pAbc, "ABC9", "&satsyn", Abc_CommandAbc9SatSyn, 0 ); Cmd_CommandAdd( pAbc, "ABC9", "&stochsyn", Abc_CommandAbc9StochSyn, 0 ); // Cmd_CommandAdd( pAbc, "ABC9", "&popart2", Abc_CommandAbc9PoPart2, 0 ); // Cmd_CommandAdd( pAbc, "ABC9", "&cexcut", Abc_CommandAbc9CexCut, 0 ); @@ -8764,11 +8772,13 @@ int Abc_CommandTwoExact( Abc_Frame_t * pAbc, int argc, char ** argv ) { extern void Exa_ManExactSynthesis( Bmc_EsPar_t * pPars ); extern void Exa_ManExactSynthesis2( Bmc_EsPar_t * pPars ); - int c; + extern void Exa_ManExactSynthesis4( Bmc_EsPar_t * pPars ); + extern void Exa_ManExactSynthesis5( Bmc_EsPar_t * pPars ); + int c, fKissat = 0, fKissat2 = 0; Bmc_EsPar_t Pars, * pPars = &Pars; Bmc_EsParSetDefault( pPars ); Extra_UtilGetoptReset(); - while ( ( c = Extra_UtilGetopt( argc, argv, "INTaogvh" ) ) != EOF ) + while ( ( c = Extra_UtilGetopt( argc, argv, "INTadconugklvh" ) ) != EOF ) { switch ( c ) { @@ -8808,12 +8818,30 @@ int Abc_CommandTwoExact( Abc_Frame_t * pAbc, int argc, char ** argv ) case 'a': pPars->fOnlyAnd ^= 1; break; + case 'd': + pPars->fDynConstr ^= 1; + break; + case 'c': + pPars->fDumpCnf ^= 1; + break; case 'o': pPars->fFewerVars ^= 1; break; + case 'n': + pPars->fOrderNodes ^= 1; + break; + case 'u': + pPars->fUniqFans ^= 1; + break; case 'g': pPars->fGlucose ^= 1; break; + case 'k': + fKissat ^= 1; + break; + case 'l': + fKissat2 ^= 1; + break; case 'v': pPars->fVerbose ^= 1; break; @@ -8845,21 +8873,31 @@ int Abc_CommandTwoExact( Abc_Frame_t * pAbc, int argc, char ** argv ) Abc_Print( -1, "Function should not have more than 10 inputs.\n" ); return 1; } - if ( pPars->fGlucose ) + if ( fKissat ) + Exa_ManExactSynthesis4( pPars ); + else if ( fKissat2 ) + Exa_ManExactSynthesis5( pPars ); + else if ( pPars->fGlucose ) Exa_ManExactSynthesis( pPars ); else Exa_ManExactSynthesis2( pPars ); return 0; usage: - Abc_Print( -2, "usage: twoexact [-INT <num>] [-aogvh] <hex>\n" ); + Abc_Print( -2, "usage: twoexact [-INT <num>] [-adconugklvh] <hex>\n" ); Abc_Print( -2, "\t exact synthesis of multi-input function using two-input gates\n" ); Abc_Print( -2, "\t-I <num> : the number of input variables [default = %d]\n", pPars->nVars ); Abc_Print( -2, "\t-N <num> : the number of two-input nodes [default = %d]\n", pPars->nNodes ); Abc_Print( -2, "\t-T <num> : the runtime limit in seconds [default = %d]\n", pPars->RuntimeLim ); Abc_Print( -2, "\t-a : toggle using only AND-gates (without XOR-gates) [default = %s]\n", pPars->fOnlyAnd ? "yes" : "no" ); + Abc_Print( -2, "\t-d : toggle using dynamic constraint addition [default = %s]\n", pPars->fDynConstr ? "yes" : "no" ); + Abc_Print( -2, "\t-c : toggle dumping CNF into a file [default = %s]\n", pPars->fDumpCnf ? "yes" : "no" ); Abc_Print( -2, "\t-o : toggle using additional optimizations [default = %s]\n", pPars->fFewerVars ? "yes" : "no" ); + Abc_Print( -2, "\t-n : toggle ordering internal nodes [default = %s]\n", pPars->fOrderNodes ? "yes" : "no" ); + Abc_Print( -2, "\t-u : toggle using unique fanouts [default = %s]\n", pPars->fUniqFans ? "yes" : "no" ); Abc_Print( -2, "\t-g : toggle using Glucose 3.0 by Gilles Audemard and Laurent Simon [default = %s]\n", pPars->fGlucose ? "yes" : "no" ); + Abc_Print( -2, "\t-k : toggle using Kissat by Armin Biere [default = %s]\n", fKissat ? "yes" : "no" ); + Abc_Print( -2, "\t-l : toggle using Kissat by Armin Biere [default = %s]\n", fKissat2 ? "yes" : "no" ); Abc_Print( -2, "\t-v : toggle verbose printout [default = %s]\n", pPars->fVerbose ? "yes" : "no" ); Abc_Print( -2, "\t-h : print the command usage\n" ); Abc_Print( -2, "\t<hex> : truth table in hex notation\n" ); @@ -9029,7 +9067,7 @@ int Abc_CommandAllExact( Abc_Frame_t * pAbc, int argc, char ** argv ) Bmc_EsPar_t Pars, * pPars = &Pars; Bmc_EsParSetDefault( pPars ); Extra_UtilGetoptReset(); - while ( ( c = Extra_UtilGetopt( argc, argv, "MINKiaoegvh" ) ) != EOF ) + while ( ( c = Extra_UtilGetopt( argc, argv, "MINKianegvh" ) ) != EOF ) { switch ( c ) { @@ -9083,7 +9121,7 @@ int Abc_CommandAllExact( Abc_Frame_t * pAbc, int argc, char ** argv ) case 'a': pPars->fOnlyAnd ^= 1; break; - case 'o': + case 'n': pPars->fOrderNodes ^= 1; break; case 'e': @@ -9179,7 +9217,7 @@ int Abc_CommandAllExact( Abc_Frame_t * pAbc, int argc, char ** argv ) return 0; usage: - Abc_Print( -2, "usage: allexact [-MIKN <num>] [-iaoevh] <hex>\n" ); + Abc_Print( -2, "usage: allexact [-MIKN <num>] [-ianevh] <hex>\n" ); Abc_Print( -2, "\t exact synthesis of I-input function using N K-input gates\n" ); Abc_Print( -2, "\t-M <num> : the majority support size (overrides -I and -K) [default = %d]\n", pPars->nMajSupp ); Abc_Print( -2, "\t-I <num> : the number of input variables [default = %d]\n", pPars->nVars ); @@ -9187,7 +9225,7 @@ usage: Abc_Print( -2, "\t-N <num> : the number of K-input nodes [default = %d]\n", pPars->nNodes ); Abc_Print( -2, "\t-i : toggle using incremental solving [default = %s]\n", pPars->fUseIncr ? "yes" : "no" ); Abc_Print( -2, "\t-a : toggle using only AND-gates when K = 2 [default = %s]\n", pPars->fOnlyAnd ? "yes" : "no" ); - Abc_Print( -2, "\t-o : toggle using node ordering by fanins [default = %s]\n", pPars->fOrderNodes ? "yes" : "no" ); + Abc_Print( -2, "\t-n : toggle using node ordering by fanins [default = %s]\n", pPars->fOrderNodes ? "yes" : "no" ); Abc_Print( -2, "\t-e : toggle enumerating all solutions [default = %s]\n", pPars->fEnumSols ? "yes" : "no" ); // Abc_Print( -2, "\t-g : toggle using Glucose 3.0 by Gilles Audemard and Laurent Simon [default = %s]\n", pPars->fGlucose ? "yes" : "no" ); Abc_Print( -2, "\t-v : toggle verbose printout [default = %s]\n", pPars->fVerbose ? "yes" : "no" ); @@ -14065,6 +14103,11 @@ int Abc_CommandTest( Abc_Frame_t * pAbc, int argc, char ** argv ) //Extra_SimulationTest( nDivMax, nNumOnes, fNewOrder ); //Mnist_ExperimentWithScaling( nDecMax ); //Gyx_ProblemSolveTest(); + { + extern Abc_Ntk_t * Abc_NtkFromArray(); + Abc_Ntk_t * pNtkRes = Abc_NtkFromArray(); + Abc_FrameReplaceCurrentNetwork( pAbc, pNtkRes ); + } return 0; usage: Abc_Print( -2, "usage: test [-CKDNM] [-aovwh] <file_name>\n" ); @@ -32417,13 +32460,14 @@ int Abc_CommandAbc9Strash( Abc_Frame_t * pAbc, int argc, char ** argv ) Gia_Man_t * pTemp; int c, Limit = 2; int Multi = 0; + int fAddBuffs = 0; int fAddStrash = 0; - int fCollapse = 0; - int fAddMuxes = 0; - int fStrMuxes = 0; + int fCollapse = 0; + int fAddMuxes = 0; + int fStrMuxes = 0; int fRehashMap = 0; Extra_UtilGetoptReset(); - while ( ( c = Extra_UtilGetopt( argc, argv, "LMacmrsh" ) ) != EOF ) + while ( ( c = Extra_UtilGetopt( argc, argv, "LMbacmrsh" ) ) != EOF ) { switch ( c ) { @@ -32449,6 +32493,9 @@ int Abc_CommandAbc9Strash( Abc_Frame_t * pAbc, int argc, char ** argv ) if ( Multi <= 0 ) goto usage; break; + case 'b': + fAddBuffs ^= 1; + break; case 'a': fAddStrash ^= 1; break; @@ -32475,6 +32522,13 @@ int Abc_CommandAbc9Strash( Abc_Frame_t * pAbc, int argc, char ** argv ) Abc_Print( -1, "Abc_CommandAbc9Strash(): There is no AIG.\n" ); return 1; } + if ( fAddBuffs ) + { + extern Gia_Man_t * Gia_ManDupAddBufs( Gia_Man_t * p ); + pTemp = Gia_ManDupAddBufs( pAbc->pGia ); + Abc_FrameUpdateGia( pAbc, pTemp ); + return 0; + } if ( Multi > 0 ) { extern Gia_Man_t * Gia_ManDupAddPis( Gia_Man_t * p, int nMulti ); @@ -32549,8 +32603,9 @@ int Abc_CommandAbc9Strash( Abc_Frame_t * pAbc, int argc, char ** argv ) return 0; usage: - Abc_Print( -2, "usage: &st [-LM num] [-acmrsh]\n" ); + Abc_Print( -2, "usage: &st [-LM num] [-bacmrsh]\n" ); Abc_Print( -2, "\t performs structural hashing\n" ); + Abc_Print( -2, "\t-b : toggle adding buffers at the inputs and outputs [default = %s]\n", fAddBuffs? "yes": "no" ); Abc_Print( -2, "\t-a : toggle additional hashing [default = %s]\n", fAddStrash? "yes": "no" ); Abc_Print( -2, "\t-c : toggle collapsing hierarchical AIG [default = %s]\n", fCollapse? "yes": "no" ); Abc_Print( -2, "\t-m : toggle converting to larger gates [default = %s]\n", fAddMuxes? "yes": "no" ); @@ -39522,7 +39577,8 @@ int Abc_CommandAbc9If( Abc_Frame_t * pAbc, int argc, char ** argv ) pPars->fUse34Spec ^= 1; break; case 'b': - pPars->fUseBat ^= 1; + //pPars->fUseBat ^= 1; + pPars->fUseCheck1 ^= 1; break; case 'g': pPars->fDelayOpt ^= 1; @@ -39543,7 +39599,8 @@ int Abc_CommandAbc9If( Abc_Frame_t * pAbc, int argc, char ** argv ) pPars->fEnableCheck75u ^= 1; break; case 'i': - pPars->fUseCofVars ^= 1; + //pPars->fUseCofVars ^= 1; + pPars->fUseCheck2 ^= 1; break; // case 'j': // pPars->fEnableCheck07 ^= 1; @@ -39656,6 +39713,16 @@ int Abc_CommandAbc9If( Abc_Frame_t * pAbc, int argc, char ** argv ) pPars->pFuncCell = If_CutPerformCheck07; pPars->fCutMin = 1; } + if ( pPars->fUseCheck1 || pPars->fUseCheck2 ) + { + if ( pPars->nLutSize > 6 ) + { + Abc_Print( -1, "This feature only works for no more than 6-LUTs.\n" ); + return 1; + } + pPars->pFuncCell = pPars->fUseCheck2 ? If_MatchCheck2 : If_MatchCheck1; + pPars->fCutMin = 1; + } if ( pPars->fUseCofVars ) { if ( !(pPars->nLutSize & 1) ) @@ -42176,6 +42243,116 @@ usage: SeeAlso [] ***********************************************************************/ +int Abc_CommandAbc9Ttopt( Abc_Frame_t * pAbc, int argc, char ** argv ) +{ + Gia_Man_t * pTemp; + char * pFileName = NULL; + int c, nIns = 6, nOuts = 2, Limit = 0, nRounds = 20, fVerbose = 0; + Extra_UtilGetoptReset(); + while ( ( c = Extra_UtilGetopt( argc, argv, "IORXvh" ) ) != EOF ) + { + switch ( c ) + { + case 'I': + if ( globalUtilOptind >= argc ) + { + Abc_Print( -1, "Command line switch \"-I\" should be followed by a positive integer.\n" ); + goto usage; + } + nIns = atoi(argv[globalUtilOptind]); + globalUtilOptind++; + break; + case 'O': + if ( globalUtilOptind >= argc ) + { + Abc_Print( -1, "Command line switch \"-O\" should be followed by a positive integer.\n" ); + goto usage; + } + nOuts = atoi(argv[globalUtilOptind]); + globalUtilOptind++; + break; + case 'R': + if ( globalUtilOptind >= argc ) + { + Abc_Print( -1, "Command line switch \"-R\" should be followed by a positive integer.\n" ); + goto usage; + } + Limit = atoi(argv[globalUtilOptind]); + globalUtilOptind++; + break; + case 'X': + if ( globalUtilOptind >= argc ) + { + Abc_Print( -1, "Command line switch \"-X\" should be followed by a positive integer.\n" ); + goto usage; + } + nRounds = atoi(argv[globalUtilOptind]); + globalUtilOptind++; + break; + case 'v': + fVerbose ^= 1; + break; + case 'h': + default: + goto usage; + } + } + if ( argc > globalUtilOptind + 1 ) + { + return 0; + } + if ( pAbc->pGia == NULL ) + { + Abc_Print( -1, "Empty GIA network.\n" ); + return 1; + } + if ( argc == globalUtilOptind + 1 ) + { + FILE * pFile = fopen( argv[globalUtilOptind], "rb" ); + if ( pFile == NULL ) + { + Abc_Print( -1, "Abc_CommandAbc9BCore(): Cannot open file \"%s\" for reading the simulation information.\n", argv[globalUtilOptind] ); + return 0; + } + fclose( pFile ); + pFileName = argv[globalUtilOptind]; + } + if ( pFileName ) + pTemp = Gia_ManTtoptCare( pAbc->pGia, nIns, nOuts, nRounds, pFileName, Limit ); + else + pTemp = Gia_ManTtopt( pAbc->pGia, nIns, nOuts, nRounds ); + Abc_FrameUpdateGia( pAbc, pTemp ); + return 0; + +usage: + Abc_Print( -2, "usage: &ttopt [-IORX num] [-vh] <file>\n" ); + Abc_Print( -2, "\t performs specialized AIG optimization\n" ); + Abc_Print( -2, "\t-I num : the input support size [default = %d]\n", nIns ); + Abc_Print( -2, "\t-O num : the output group size [default = %d]\n", nOuts ); + Abc_Print( -2, "\t-R num : patterns are cares starting this value [default = %d]\n", Limit ); + Abc_Print( -2, "\t-X num : the number of optimization rounds [default = %d]\n", nRounds ); + Abc_Print( -2, "\t-v : toggles verbose output [default = %s]\n", fVerbose? "yes": "no" ); + Abc_Print( -2, "\t-h : prints the command usage\n"); + Abc_Print( -2, "\t<file> : file name with simulation information\n"); + Abc_Print( -2, "\t\n" ); + Abc_Print( -2, "\t This command was contributed by Yukio Miyasaka.\n" ); + Abc_Print( -2, "\t The paper describing the method: Y. Miyasaka et al. \"Synthesizing\n" ); + Abc_Print( -2, "\t a class of practical Boolean functions using truth tables\". Proc. IWLS 2022.\n" ); + Abc_Print( -2, "\t https://people.eecs.berkeley.edu/~alanmi/publications/2022/iwls22_reo.pdf\n" ); + return 1; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ int Abc_CommandAbc9LNetMap( Abc_Frame_t * pAbc, int argc, char ** argv ) { extern Abc_Ntk_t * Gia_ManPerformLNetMap( Gia_Man_t * p, int GroupSize, int fUseFixed, int fTryNew, int fVerbose ); @@ -48333,6 +48510,96 @@ usage: SeeAlso [] ***********************************************************************/ +int Abc_CommandAbc9SatSyn( Abc_Frame_t * pAbc, int argc, char ** argv ) +{ + extern Gia_Man_t * Gia_ManSyn( Gia_Man_t * p, int nNodes, int nOuts, int TimeOut, int fUseXor, int fFancy, int fVerbose ); + Gia_Man_t * pTemp; int c, nNodes = 0, nOuts = 0, TimeOut = 0, fUseXor = 0, fFancy = 0, fVerbose = 0; + Extra_UtilGetoptReset(); + while ( ( c = Extra_UtilGetopt( argc, argv, "NTafvh" ) ) != EOF ) + { + switch ( c ) + { + case 'N': + if ( globalUtilOptind >= argc ) + { + Abc_Print( -1, "Command line switch \"-N\" should be followed by an integer.\n" ); + goto usage; + } + nNodes = atoi(argv[globalUtilOptind]); + globalUtilOptind++; + if ( nNodes < 0 ) + goto usage; + break; + case 'O': + if ( globalUtilOptind >= argc ) + { + Abc_Print( -1, "Command line switch \"-O\" should be followed by an integer.\n" ); + goto usage; + } + nOuts = atoi(argv[globalUtilOptind]); + globalUtilOptind++; + if ( nOuts < 0 ) + goto usage; + break; + case 'T': + if ( globalUtilOptind >= argc ) + { + Abc_Print( -1, "Command line switch \"-T\" should be followed by an integer.\n" ); + goto usage; + } + TimeOut = atoi(argv[globalUtilOptind]); + globalUtilOptind++; + if ( TimeOut < 0 ) + goto usage; + break; + case 'a': + fUseXor ^= 1; + break; + case 'f': + fFancy ^= 1; + break; + case 'v': + fVerbose ^= 1; + break; + case 'h': + goto usage; + default: + goto usage; + } + } + if ( pAbc->pGia == NULL ) + { + Abc_Print( -1, "Abc_CommandAbc9SatSyn(): There is no AIG.\n" ); + return 0; + } + pTemp = Gia_ManSyn( pAbc->pGia, nNodes, nOuts, TimeOut, fUseXor, fFancy, fVerbose ); + Abc_FrameUpdateGia( pAbc, pTemp ); + return 0; + +usage: + Abc_Print( -2, "usage: &satsyn [-NOT <num>] [-afvh]\n" ); + Abc_Print( -2, "\t performs synthesis\n" ); + Abc_Print( -2, "\t-N <num> : the number of window nodes [default = %d]\n", nNodes ); + Abc_Print( -2, "\t-O <num> : the number of window outputs [default = %d]\n", nOuts ); + Abc_Print( -2, "\t-T <num> : the timeout in seconds (0 = no timeout) [default = %d]\n", TimeOut ); + Abc_Print( -2, "\t-a : toggle using xor-nodes [default = %s]\n", fUseXor? "yes": "no" ); + Abc_Print( -2, "\t-f : toggle using additional feature [default = %s]\n", fFancy? "yes": "no" ); + Abc_Print( -2, "\t-v : toggle printing optimization summary [default = %s]\n", fVerbose? "yes": "no" ); + Abc_Print( -2, "\t-h : print the command usage\n"); + return 1; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ int Abc_CommandAbc9StochSyn( Abc_Frame_t * pAbc, int argc, char ** argv ) { extern void Gia_ManStochSyn( int nMaxSize, int nIters, int TimeOut, int Seed, int fVerbose, char * pScript ); @@ -50090,6 +50357,7 @@ usage: ***********************************************************************/ int Abc_CommandAbc9Test( Abc_Frame_t * pAbc, int argc, char ** argv ) { + extern void Gia_ManPrintArray( Gia_Man_t * p ); extern Gia_Man_t * Gia_ManPerformNewResub( Gia_Man_t * p, int nWinCount, int nCutSize, int nProcs, int fVerbose ); extern void Gia_RsbEnumerateWindows( Gia_Man_t * p, int nInputsMax, int nLevelsMax ); extern int Gia_ManSumTotalOfSupportSizes( Gia_Man_t * p ); @@ -50154,7 +50422,16 @@ int Abc_CommandAbc9Test( Abc_Frame_t * pAbc, int argc, char ** argv ) Abc_Print( -1, "Abc_CommandAbc9Test(): There is no AIG.\n" ); return 1; } - Abc_FrameUpdateGia( pAbc, Gia_ManPerformNewResub(pAbc->pGia, 100, 6, 1, 1) ); + if ( argc == globalUtilOptind + 1 ) + { + extern void Gia_ManUpdateCoPhase( Gia_Man_t * pNew, Gia_Man_t * pOld ); + Gia_Man_t * pTemp = Gia_AigerRead( argv[globalUtilOptind], 0, 0, 0 ); + Gia_ManUpdateCoPhase( pAbc->pGia, pTemp ); + Gia_ManStop( pTemp ); + return 0; + } + //Abc_FrameUpdateGia( pAbc, Gia_ManPerformNewResub(pAbc->pGia, 100, 6, 1, 1) ); + Gia_ManPrintArray( pAbc->pGia ); // printf( "AIG in \"%s\" has the sum of output support sizes equal to %d.\n", pAbc->pGia->pSpec, Gia_ManSumTotalOfSupportSizes(pAbc->pGia) ); return 0; usage: diff --git a/src/base/wlc/wlcNdr.c b/src/base/wlc/wlcNdr.c index d401281a..a7615c2d 100644 --- a/src/base/wlc/wlcNdr.c +++ b/src/base/wlc/wlcNdr.c @@ -535,10 +535,23 @@ Wlc_Ntk_t * Wlc_NtkFromNdr( void * pData ) SeeAlso [] ***********************************************************************/ +void Ndr_DumpNdr( void * pDesign ) +{ + int i; + char ** pNames = ABC_CALLOC( char *, 10000 ); + for ( i = 0; i < 10000; i++ ) + { + char Buffer[100]; + sprintf( Buffer, "s%d", i ); + pNames[i] = Abc_UtilStrsav( Buffer ); + } + Ndr_WriteVerilog( "temp.v", pDesign, pNames, 0 ); +} Wlc_Ntk_t * Wlc_ReadNdr( char * pFileName ) { void * pData = Ndr_Read( pFileName ); Wlc_Ntk_t * pNtk = Wlc_NtkFromNdr( pData ); + //Ndr_DumpNdr( pData ); //char * ppNames[10] = { NULL, "a", "b", "c", "d", "e", "f", "g", "h", "i" }; //Ndr_WriteVerilog( NULL, pData, ppNames, 0 ); //Ndr_Delete( pData ); diff --git a/src/base/wln/wlnBlast.c b/src/base/wln/wlnBlast.c index a3ac73c0..887412d6 100644 --- a/src/base/wln/wlnBlast.c +++ b/src/base/wln/wlnBlast.c @@ -289,9 +289,17 @@ void Rtl_NtkBlastNode( Gia_Man_t * pNew, int Type, int nIns, Vec_Int_t * vDatas, { int fBooth = 1; int fCla = 0; - int fSigned = fSign0 && fSign1; + int fSigned = fSign0 && fSign1; + //int i, iObj; Vec_IntShrink( vArg0, nSizeArg0 ); Vec_IntShrink( vArg1, nSizeArg1 ); + + //printf( "Adding %d + %d + %d buffers\n", nSizeArg0, nSizeArg1, nRange ); + //Vec_IntForEachEntry( vArg0, iObj, i ) + // Vec_IntWriteEntry( vArg0, i, Gia_ManAppendBuf(pNew, iObj) ); + //Vec_IntForEachEntry( vArg1, iObj, i ) + // Vec_IntWriteEntry( vArg1, i, Gia_ManAppendBuf(pNew, iObj) ); + if ( Wlc_NtkCountConstBits(Vec_IntArray(vArg0), Vec_IntSize(vArg0)) < Wlc_NtkCountConstBits(Vec_IntArray(vArg1), Vec_IntSize(vArg1)) ) ABC_SWAP( Vec_Int_t, *vArg0, *vArg1 ) if ( fBooth ) @@ -303,6 +311,9 @@ void Rtl_NtkBlastNode( Gia_Man_t * pNew, int Type, int nIns, Vec_Int_t * vDatas, else Vec_IntShrink( vRes, nRange ); assert( Vec_IntSize(vRes) == nRange ); + + //Vec_IntForEachEntry( vRes, iObj, i ) + // Vec_IntWriteEntry( vRes, i, Gia_ManAppendBuf(pNew, iObj) ); return; } if ( Type == ABC_OPER_ARI_DIV || Type == ABC_OPER_ARI_MOD ) diff --git a/src/base/wln/wlnCom.c b/src/base/wln/wlnCom.c index eb96132b..09cbe90f 100644 --- a/src/base/wln/wlnCom.c +++ b/src/base/wln/wlnCom.c @@ -92,12 +92,13 @@ void Wln_End( Abc_Frame_t * pAbc ) ******************************************************************************/ int Abc_CommandYosys( Abc_Frame_t * pAbc, int argc, char ** argv ) { - extern Gia_Man_t * Wln_BlastSystemVerilog( char * pFileName, char * pTopModule, int fSkipStrash, int fInvert, int fTechMap, int fVerbose ); - extern Rtl_Lib_t * Wln_ReadSystemVerilog( char * pFileName, char * pTopModule, int fCollapse, int fVerbose ); + extern Gia_Man_t * Wln_BlastSystemVerilog( char * pFileName, char * pTopModule, char * pDefines, int fSkipStrash, int fInvert, int fTechMap, int fVerbose ); + extern Rtl_Lib_t * Wln_ReadSystemVerilog( char * pFileName, char * pTopModule, char * pDefines, int fCollapse, int fVerbose ); FILE * pFile; char * pFileName = NULL; char * pTopModule= NULL; + char * pDefines = NULL; int fBlast = 0; int fInvert = 0; int fTechMap = 1; @@ -105,7 +106,7 @@ int Abc_CommandYosys( Abc_Frame_t * pAbc, int argc, char ** argv ) int fCollapse = 0; int c, fVerbose = 0; Extra_UtilGetoptReset(); - while ( ( c = Extra_UtilGetopt( argc, argv, "Tbismcvh" ) ) != EOF ) + while ( ( c = Extra_UtilGetopt( argc, argv, "TDbismcvh" ) ) != EOF ) { switch ( c ) { @@ -118,6 +119,15 @@ int Abc_CommandYosys( Abc_Frame_t * pAbc, int argc, char ** argv ) pTopModule = argv[globalUtilOptind]; globalUtilOptind++; break; + case 'D': + if ( globalUtilOptind >= argc ) + { + Abc_Print( -1, "Command line switch \"-D\" should be followed by a file name.\n" ); + goto usage; + } + pDefines = argv[globalUtilOptind]; + globalUtilOptind++; + break; case 'b': fBlast ^= 1; break; @@ -164,11 +174,11 @@ int Abc_CommandYosys( Abc_Frame_t * pAbc, int argc, char ** argv ) { Gia_Man_t * pNew = NULL; if ( !strcmp( Extra_FileNameExtension(pFileName), "v" ) ) - pNew = Wln_BlastSystemVerilog( pFileName, pTopModule, fSkipStrash, fInvert, fTechMap, fVerbose ); + pNew = Wln_BlastSystemVerilog( pFileName, pTopModule, pDefines, fSkipStrash, fInvert, fTechMap, fVerbose ); else if ( !strcmp( Extra_FileNameExtension(pFileName), "sv" ) ) - pNew = Wln_BlastSystemVerilog( pFileName, pTopModule, fSkipStrash, fInvert, fTechMap, fVerbose ); + pNew = Wln_BlastSystemVerilog( pFileName, pTopModule, pDefines, fSkipStrash, fInvert, fTechMap, fVerbose ); else if ( !strcmp( Extra_FileNameExtension(pFileName), "rtlil" ) ) - pNew = Wln_BlastSystemVerilog( pFileName, pTopModule, fSkipStrash, fInvert, fTechMap, fVerbose ); + pNew = Wln_BlastSystemVerilog( pFileName, pTopModule, pDefines, fSkipStrash, fInvert, fTechMap, fVerbose ); else { printf( "Abc_CommandYosys(): Unknown file extension.\n" ); @@ -180,11 +190,11 @@ int Abc_CommandYosys( Abc_Frame_t * pAbc, int argc, char ** argv ) { Rtl_Lib_t * pLib = NULL; if ( !strcmp( Extra_FileNameExtension(pFileName), "v" ) ) - pLib = Wln_ReadSystemVerilog( pFileName, pTopModule, fCollapse, fVerbose ); + pLib = Wln_ReadSystemVerilog( pFileName, pTopModule, pDefines, fCollapse, fVerbose ); else if ( !strcmp( Extra_FileNameExtension(pFileName), "sv" ) ) - pLib = Wln_ReadSystemVerilog( pFileName, pTopModule, fCollapse, fVerbose ); + pLib = Wln_ReadSystemVerilog( pFileName, pTopModule, pDefines, fCollapse, fVerbose ); else if ( !strcmp( Extra_FileNameExtension(pFileName), "rtlil" ) ) - pLib = Wln_ReadSystemVerilog( pFileName, pTopModule, fCollapse, fVerbose ); + pLib = Wln_ReadSystemVerilog( pFileName, pTopModule, pDefines, fCollapse, fVerbose ); else { printf( "Abc_CommandYosys(): Unknown file extension.\n" ); @@ -194,11 +204,12 @@ int Abc_CommandYosys( Abc_Frame_t * pAbc, int argc, char ** argv ) } return 0; usage: - Abc_Print( -2, "usage: %%yosys [-T <module>] [-bismcvh] <file_name>\n" ); + Abc_Print( -2, "usage: %%yosys [-T <module>] [-D <defines>] [-bismcvh] <file_name>\n" ); Abc_Print( -2, "\t reads Verilog or SystemVerilog using Yosys\n" ); Abc_Print( -2, "\t-T : specify the top module name (default uses \"-auto-top\"\n" ); + Abc_Print( -2, "\t-D : specify defines to be used by Yosys (default \"not used\")\n" ); Abc_Print( -2, "\t-b : toggle bit-blasting the design into an AIG using Yosys [default = %s]\n", fBlast? "yes": "no" ); - Abc_Print( -2, "\t-i : toggle interting the outputs (useful for miters) [default = %s]\n", fInvert? "yes": "no" ); + Abc_Print( -2, "\t-i : toggle inverting the outputs (useful for miters) [default = %s]\n", fInvert? "yes": "no" ); Abc_Print( -2, "\t-s : toggle no structural hashing during bit-blasting [default = %s]\n", fSkipStrash? "no strash": "strash" ); Abc_Print( -2, "\t-m : toggle using \"techmap\" to blast operators [default = %s]\n", fTechMap? "yes": "no" ); Abc_Print( -2, "\t-c : toggle collapsing design hierarchy using Yosys [default = %s]\n", fCollapse? "yes": "no" ); @@ -330,13 +341,13 @@ usage: ******************************************************************************/ int Abc_CommandCollapse( Abc_Frame_t * pAbc, int argc, char ** argv ) { - extern Gia_Man_t * Rtl_LibCollapse( Rtl_Lib_t * p, char * pTopModule, int fVerbose ); + extern Gia_Man_t * Rtl_LibCollapse( Rtl_Lib_t * p, char * pTopModule, int fRev, int fVerbose ); Gia_Man_t * pNew = NULL; Rtl_Lib_t * pLib = Wln_AbcGetRtl(pAbc); char * pTopModule = NULL; - int c, fInv = 0, fVerbose = 0; + int c, fInv = 0, fRev = 0, fVerbose = 0; Extra_UtilGetoptReset(); - while ( ( c = Extra_UtilGetopt( argc, argv, "Tcvh" ) ) != EOF ) + while ( ( c = Extra_UtilGetopt( argc, argv, "Tcrvh" ) ) != EOF ) { switch ( c ) { @@ -352,6 +363,9 @@ int Abc_CommandCollapse( Abc_Frame_t * pAbc, int argc, char ** argv ) case 'c': fInv ^= 1; break; + case 'r': + fRev ^= 1; + break; case 'v': fVerbose ^= 1; break; @@ -366,16 +380,17 @@ int Abc_CommandCollapse( Abc_Frame_t * pAbc, int argc, char ** argv ) printf( "The design is not entered.\n" ); return 1; } - pNew = Rtl_LibCollapse( pLib, pTopModule, fVerbose ); + pNew = Rtl_LibCollapse( pLib, pTopModule, fRev, fVerbose ); if ( fInv ) Gia_ManInvertPos( pNew ); Abc_FrameUpdateGia( pAbc, pNew ); return 0; usage: - Abc_Print( -2, "usage: %%collapse [-T <module>] [-cvh] <file_name>\n" ); + Abc_Print( -2, "usage: %%collapse [-T <module>] [-crvh] <file_name>\n" ); Abc_Print( -2, "\t collapse hierarchical design into an AIG\n" ); Abc_Print( -2, "\t-T : specify the top module of the design [default = none]\n" ); Abc_Print( -2, "\t-c : toggle complementing miter outputs after collapsing [default = %s]\n", fInv? "yes": "no" ); + Abc_Print( -2, "\t-r : toggle bit order reversal in the word-level IO [default = %s]\n", fRev? "yes": "no" ); Abc_Print( -2, "\t-v : toggle printing verbose information [default = %s]\n", fVerbose? "yes": "no" ); Abc_Print( -2, "\t-h : print the command usage\n"); return 1; diff --git a/src/base/wln/wlnRead.c b/src/base/wln/wlnRead.c index a27d38d2..b45e51f2 100644 --- a/src/base/wln/wlnRead.c +++ b/src/base/wln/wlnRead.c @@ -1736,6 +1736,42 @@ int Rtl_NtkInsertSignalRange( Rtl_Ntk_t * p, int Sig, int * pLits, int nLits ) SeeAlso [] ***********************************************************************/ +Vec_Int_t * Rtl_NtkRevPermInput( Rtl_Ntk_t * p ) +{ + Vec_Int_t * vNew = Vec_IntAlloc( 100 ); int b, i, Count = 0; + for ( i = 0; i < p->nInputs; i++ ) + { + int Width = Rtl_WireWidth( p, i ); + for ( b = 0; b < Width; b++ ) + Vec_IntPush( vNew, Count + Width-1-b ); + Count += Width; + } + return vNew; +} +Vec_Int_t * Rtl_NtkRevPermOutput( Rtl_Ntk_t * p ) +{ + Vec_Int_t * vNew = Vec_IntAlloc( 100 ); int b, i, Count = 0; + for ( i = 0; i < p->nOutputs; i++ ) + { + int Width = Rtl_WireWidth( p, p->nInputs + i ); + for ( b = 0; b < Width; b++ ) + Vec_IntPush( vNew, Count + Width-1-b ); + Count += Width; + } + return vNew; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ void Rtl_NtkBlastInputs( Gia_Man_t * pNew, Rtl_Ntk_t * p ) { int b, i; @@ -2704,6 +2740,41 @@ Gia_Man_t * Rtl_ReduceInverse( Rtl_Lib_t * pLib, Gia_Man_t * p ) SeeAlso [] ***********************************************************************/ +Gia_Man_t * Gia_ManDupPermIO( Gia_Man_t * p, Vec_Int_t * vPermI, Vec_Int_t * vPermO ) +{ + Gia_Man_t * pNew; + Gia_Obj_t * pObj; + int i; + assert( Vec_IntSize(vPermI) == Gia_ManCiNum(p) ); + assert( Vec_IntSize(vPermO) == Gia_ManCoNum(p) ); + pNew = Gia_ManStart( Gia_ManObjNum(p) ); + Gia_ManConst0(p)->Value = 0; + Gia_ManForEachCi( p, pObj, i ) + Gia_ManCi(p, Vec_IntEntry(vPermI, i))->Value = Gia_ManAppendCi(pNew); + Gia_ManForEachAnd( p, pObj, i ) + { + if ( Gia_ObjIsBuf(pObj) ) + pObj->Value = Gia_ManAppendBuf( pNew, Gia_ObjFanin0Copy(pObj) ); + else + pObj->Value = Gia_ManAppendAnd( pNew, Gia_ObjFanin0Copy(pObj), Gia_ObjFanin1Copy(pObj) ); + assert( Abc_Lit2Var(pObj->Value) == i ); + } + Gia_ManForEachCo( p, pObj, i ) + Gia_ManAppendCo( pNew, Gia_ObjFanin0Copy(Gia_ManCo(p, Vec_IntEntry(vPermO, i))) ); + return pNew; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ int Rtl_LibReturnNtk( Rtl_Lib_t * p, char * pModule ) { int NameId = Wln_ReadFindToken( pModule, p->pManName ); @@ -2715,7 +2786,7 @@ int Rtl_LibReturnNtk( Rtl_Lib_t * p, char * pModule ) } return iNtk; } -Gia_Man_t * Rtl_LibCollapse( Rtl_Lib_t * p, char * pTopModule, int fVerbose ) +Gia_Man_t * Rtl_LibCollapse( Rtl_Lib_t * p, char * pTopModule, int fRev, int fVerbose ) { Gia_Man_t * pGia = NULL; int NameId = Wln_ReadFindToken( pTopModule, p->pManName ); @@ -2733,6 +2804,16 @@ Gia_Man_t * Rtl_LibCollapse( Rtl_Lib_t * p, char * pTopModule, int fVerbose ) Vec_IntPush( vRoots, iNtk ); Rtl_LibBlast2( p, vRoots, 1 ); pGia = Gia_ManDup( pTop->pGia ); + if ( fRev ) + { + Gia_Man_t * pTemp; + Vec_Int_t * vPermI = Rtl_NtkRevPermInput( pTop ); + Vec_Int_t * vPermO = Rtl_NtkRevPermOutput( pTop ); + pGia = Gia_ManDupPermIO( pTemp = pGia, vPermI, vPermO ); + Vec_IntFree( vPermI ); + Vec_IntFree( vPermO ); + Gia_ManStop( pTemp ); + } //Gia_AigerWrite( pGia, "temp_miter.aig", 0, 0, 0 ); if ( pTop->pGia->vBarBufs ) pGia->vBarBufs = Vec_IntDup( pTop->pGia->vBarBufs ); diff --git a/src/base/wln/wlnRtl.c b/src/base/wln/wlnRtl.c index 8a8e0a32..391d168c 100644 --- a/src/base/wln/wlnRtl.c +++ b/src/base/wln/wlnRtl.c @@ -139,7 +139,7 @@ int Wln_ConvertToRtl( char * pCommand, char * pFileTemp ) return 1; #endif } -Rtl_Lib_t * Wln_ReadSystemVerilog( char * pFileName, char * pTopModule, int fCollapse, int fVerbose ) +Rtl_Lib_t * Wln_ReadSystemVerilog( char * pFileName, char * pTopModule, char * pDefines, int fCollapse, int fVerbose ) { Rtl_Lib_t * pNtk = NULL; char Command[1000]; @@ -147,8 +147,10 @@ Rtl_Lib_t * Wln_ReadSystemVerilog( char * pFileName, char * pTopModule, int fCol int fSVlog = strstr(pFileName, ".sv") != NULL; if ( strstr(pFileName, ".rtl") ) return Rtl_LibReadFile( pFileName, pFileName ); - sprintf( Command, "%s -qp \"read_verilog %s%s; hierarchy %s%s; %sproc; write_rtlil %s\"", - Wln_GetYosysName(), fSVlog ? "-sv ":"", pFileName, + sprintf( Command, "%s -qp \"read_verilog %s %s%s; hierarchy %s%s; %sproc; write_rtlil %s\"", + Wln_GetYosysName(), + pDefines ? pDefines : "", + fSVlog ? "-sv ":"", pFileName, pTopModule ? "-top " : "", pTopModule ? pTopModule : "", fCollapse ? "flatten; " : "", @@ -167,16 +169,17 @@ Rtl_Lib_t * Wln_ReadSystemVerilog( char * pFileName, char * pTopModule, int fCol unlink( pFileTemp ); return pNtk; } -Gia_Man_t * Wln_BlastSystemVerilog( char * pFileName, char * pTopModule, int fSkipStrash, int fInvert, int fTechMap, int fVerbose ) +Gia_Man_t * Wln_BlastSystemVerilog( char * pFileName, char * pTopModule, char * pDefines, int fSkipStrash, int fInvert, int fTechMap, int fVerbose ) { Gia_Man_t * pGia = NULL; char Command[1000]; char * pFileTemp = "_temp_.aig"; int fRtlil = strstr(pFileName, ".rtl") != NULL; int fSVlog = strstr(pFileName, ".sv") != NULL; - sprintf( Command, "%s -qp \"%s%s%s; hierarchy %s%s; flatten; proc; %saigmap; write_aiger %s\"", + sprintf( Command, "%s -qp \"%s %s%s%s; hierarchy %s%s; flatten; proc; %saigmap; write_aiger %s\"", Wln_GetYosysName(), fRtlil ? "read_rtlil" : "read_verilog", + pDefines ? pDefines : "", fSVlog ? " -sv ":" ", pFileName, pTopModule ? "-top " : "-auto-top", diff --git a/src/map/if/if.h b/src/map/if/if.h index 13fa4108..a72da9b9 100644 --- a/src/map/if/if.h +++ b/src/map/if/if.h @@ -140,6 +140,8 @@ struct If_Par_t_ int fUseCofVars; // use cofactoring variables int fUseAndVars; // use bi-decomposition int fUseTtPerm; // compute truth tables of the cut functions + int fUseCheck1; // compute truth tables of the cut functions + int fUseCheck2; // compute truth tables of the cut functions int fDeriveLuts; // enables deriving LUT structures int fDoAverage; // optimize average rather than maximum level int fHashMapping; // perform AIG hashing after mapping @@ -553,6 +555,8 @@ extern int If_CluCheckExt( void * p, word * pTruth, int nVars, int n char * pLut0, char * pLut1, word * pFunc0, word * pFunc1 ); extern int If_CluCheckExt3( void * p, word * pTruth, int nVars, int nLutLeaf, int nLutLeaf2, int nLutRoot, char * pLut0, char * pLut1, char * pLut2, word * pFunc0, word * pFunc1, word * pFunc2 ); +extern int If_MatchCheck1( If_Man_t * p, unsigned * pTruth, int nVars, int nLeaves, char * pStr ); +extern int If_MatchCheck2( If_Man_t * p, unsigned * pTruth, int nVars, int nLeaves, char * pStr ); /*=== ifDelay.c =============================================================*/ extern int If_CutDelaySop( If_Man_t * p, If_Cut_t * pCut ); extern int If_CutSopBalanceEvalInt( Vec_Int_t * vCover, int * pTimes, int * pFaninLits, Vec_Int_t * vAig, int * piRes, int nSuppAll, int * pArea ); diff --git a/src/map/if/ifCut.c b/src/map/if/ifCut.c index 079781e0..e3d47f1c 100644 --- a/src/map/if/ifCut.c +++ b/src/map/if/ifCut.c @@ -767,7 +767,7 @@ void If_CutSort( If_Man_t * p, If_Set_t * pCutSet, If_Cut_t * pCut ) (p->pPars->fUseDsd || p->pPars->pFuncCell2 || p->pPars->fUseBat || p->pPars->pLutStruct || p->pPars->fUserRecLib || p->pPars->fUserSesLib || p->pPars->fEnableCheck07 || p->pPars->fUseCofVars || p->pPars->fUseAndVars || p->pPars->fUse34Spec || - p->pPars->fUseDsdTune || p->pPars->fEnableCheck75 || p->pPars->fEnableCheck75u) ) + p->pPars->fUseDsdTune || p->pPars->fEnableCheck75 || p->pPars->fEnableCheck75u || p->pPars->fUseCheck1 || p->pPars->fUseCheck2) ) { If_Cut_t * pFirst = pCutSet->ppCuts[0]; if ( pFirst->fUseless || If_ManSortCompare(p, pFirst, pCut) == 1 ) diff --git a/src/map/if/ifDec07.c b/src/map/if/ifDec07.c index 1f3fea3e..b8851e50 100644 --- a/src/map/if/ifDec07.c +++ b/src/map/if/ifDec07.c @@ -1116,6 +1116,36 @@ int If_CutPerformCheck07( If_Man_t * p, unsigned * pTruth, int nVars, int nLeave return 0; } +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int If_MatchCheck1( If_Man_t * p, unsigned * pTruth, int nVars, int nLeaves, char * pStr ) +{ + if ( nLeaves < nVars ) + return 1; + assert( nLeaves == nVars ); + if ( Abc_Tt6Check1( ((word *)pTruth)[0], nLeaves ) ) + return 1; + return 0; +} +int If_MatchCheck2( If_Man_t * p, unsigned * pTruth, int nVars, int nLeaves, char * pStr ) +{ + if ( nLeaves < nVars ) + return 1; + assert( nLeaves == nVars ); + if ( Abc_Tt6Check2( ((word *)pTruth)[0], nLeaves ) ) + return 1; + return 0; +} + //////////////////////////////////////////////////////////////////////// /// END OF FILE /// //////////////////////////////////////////////////////////////////////// diff --git a/src/map/if/ifMap.c b/src/map/if/ifMap.c index f234d354..b3a4caf6 100644 --- a/src/map/if/ifMap.c +++ b/src/map/if/ifMap.c @@ -167,7 +167,7 @@ void If_ObjPerformMappingAnd( If_Man_t * p, If_Obj_t * pObj, int Mode, int fPrep int fFunc0R, fFunc1R; int i, k, v, iCutDsd, fChange; int fSave0 = p->pPars->fDelayOpt || p->pPars->fDelayOptLut || p->pPars->fDsdBalance || p->pPars->fUserRecLib || p->pPars->fUserSesLib || - p->pPars->fUseDsdTune || p->pPars->fUseCofVars || p->pPars->fUseAndVars || p->pPars->fUse34Spec || p->pPars->pLutStruct || p->pPars->pFuncCell2; + p->pPars->fUseDsdTune || p->pPars->fUseCofVars || p->pPars->fUseAndVars || p->pPars->fUse34Spec || p->pPars->pLutStruct || p->pPars->pFuncCell2 || p->pPars->fUseCheck1 || p->pPars->fUseCheck2; int fUseAndCut = (p->pPars->nAndDelay > 0) || (p->pPars->nAndArea > 0); assert( !If_ObjIsAnd(pObj->pFanin0) || pObj->pFanin0->pCutSet->nCuts > 0 ); assert( !If_ObjIsAnd(pObj->pFanin1) || pObj->pFanin1->pCutSet->nCuts > 0 ); diff --git a/src/map/scl/sclLibUtil.c b/src/map/scl/sclLibUtil.c index f57669b7..7197310f 100644 --- a/src/map/scl/sclLibUtil.c +++ b/src/map/scl/sclLibUtil.c @@ -72,6 +72,8 @@ void Abc_SclHashCells( SC_Lib * p ) SC_LibForEachCell( p, pCell, i ) { pPlace = Abc_SclHashLookup( p, pCell->pName ); + if ( *pPlace != -1 && pCell->pName ) + printf( "There are two standard cells with the same name (%s).\n", pCell->pName ); assert( *pPlace == -1 ); *pPlace = i; } diff --git a/src/misc/util/utilTruth.h b/src/misc/util/utilTruth.h index bc8ac3f0..1a771afa 100644 --- a/src/misc/util/utilTruth.h +++ b/src/misc/util/utilTruth.h @@ -1589,7 +1589,31 @@ static inline int Abc_Tt6SupportAndSize( word t, int nVars, int * pSuppSize ) Supp |= (1 << v), (*pSuppSize)++; return Supp; } - +static inline int Abc_Tt6Check1( word t, int nVars ) +{ + int n, v, u; + for ( n = 0; n < 2; n++ ) + for ( v = 0; v < nVars; v++ ) + { + word Cof = n ? Abc_Tt6Cofactor1(t, v) : Abc_Tt6Cofactor0(t, v); + for ( u = 0; u < nVars; u++ ) + if ( v != u && !Abc_Tt6HasVar(Cof, u) ) + return 1; + } + return 0; +} +static inline int Abc_Tt6Check2( word t, int nVars ) +{ + int n, v; + for ( n = 0; n < 2; n++ ) + for ( v = 0; v < nVars; v++ ) + { + word Cof = n ? Abc_Tt6Cofactor1(t, v) : Abc_Tt6Cofactor0(t, v); + if ( Cof == 0 || ~Cof == 0 ) + return 1; + } + return 0; +} /**Function************************************************************* Synopsis [Checks if there is a var whose both cofs have supp <= nSuppLim.] diff --git a/src/proof/cec/cecChoice.c b/src/proof/cec/cecChoice.c index db0059fd..13923511 100644 --- a/src/proof/cec/cecChoice.c +++ b/src/proof/cec/cecChoice.c @@ -418,7 +418,6 @@ Aig_Man_t * Cec_ComputeChoicesNew( Gia_Man_t * pGia, int nConfs, int fVerbose ) Aig_Man_t * pAig; Cec4_ManSimulateTest2( pGia, nConfs, fVerbose ); pGia = Gia_ManEquivToChoices( pGia, 3 ); - Gia_ManSetRegNum( pGia, Gia_ManRegNum(pGia) ); pAig = Gia_ManToAig( pGia, 1 ); Gia_ManStop( pGia ); return pAig; diff --git a/src/proof/cec/cecClass.c b/src/proof/cec/cecClass.c index be88b9be..60fdbc89 100644 --- a/src/proof/cec/cecClass.c +++ b/src/proof/cec/cecClass.c @@ -265,10 +265,13 @@ void Cec_ManSimClassCreate( Gia_Man_t * p, Vec_Int_t * vClass ) SeeAlso [] ***********************************************************************/ -int Cec_ManSimClassRefineOne( Cec_ManSim_t * p, int i ) +static int s_Count = 0; + +int Cec_ManSimClassRefineOne_rec( Cec_ManSim_t * p, int i ) { unsigned * pSim0, * pSim1; int Ent; + s_Count++; Vec_IntClear( p->vClassOld ); Vec_IntClear( p->vClassNew ); Vec_IntPush( p->vClassOld, i ); @@ -290,9 +293,22 @@ int Cec_ManSimClassRefineOne( Cec_ManSim_t * p, int i ) Cec_ManSimClassCreate( p->pAig, p->vClassOld ); Cec_ManSimClassCreate( p->pAig, p->vClassNew ); if ( Vec_IntSize(p->vClassNew) > 1 ) - return 1 + Cec_ManSimClassRefineOne( p, Vec_IntEntry(p->vClassNew,0) ); + return 1 + Cec_ManSimClassRefineOne_rec( p, Vec_IntEntry(p->vClassNew,0) ); return 1; } +int Cec_ManSimClassRefineOne_( Cec_ManSim_t * p, int i ) +{ + int Res; + s_Count = 0; + Res = Cec_ManSimClassRefineOne_rec( p, i ); + if ( s_Count > 10 ) + printf( "%d ", s_Count ); + return Res; +} +int Cec_ManSimClassRefineOne( Cec_ManSim_t * p, int i ) +{ + return Cec_ManSimClassRefineOne_rec( p, i ); +} /**Function************************************************************* diff --git a/src/sat/bmc/bmc.h b/src/sat/bmc/bmc.h index 2c843392..34356359 100644 --- a/src/sat/bmc/bmc.h +++ b/src/sat/bmc/bmc.h @@ -54,10 +54,14 @@ struct Bmc_EsPar_t_ int fMajority; int fUseIncr; int fOnlyAnd; + int fDynConstr; + int fDumpCnf; int fGlucose; int fOrderNodes; int fEnumSols; int fFewerVars; + int fQuadrEnc; + int fUniqFans; int RuntimeLim; int fVerbose; char * pTtStr; @@ -73,10 +77,14 @@ static inline void Bmc_EsParSetDefault( Bmc_EsPar_t * pPars ) pPars->fMajority = 0; pPars->fUseIncr = 0; pPars->fOnlyAnd = 0; + pPars->fDynConstr = 0; + pPars->fDumpCnf = 0; pPars->fGlucose = 0; pPars->fOrderNodes = 0; pPars->fEnumSols = 0; pPars->fFewerVars = 0; + pPars->fQuadrEnc = 0; + pPars->fUniqFans = 0; pPars->RuntimeLim = 0; pPars->fVerbose = 1; } diff --git a/src/sat/bmc/bmcMaj.c b/src/sat/bmc/bmcMaj.c index fc77398a..2525f943 100644 --- a/src/sat/bmc/bmcMaj.c +++ b/src/sat/bmc/bmcMaj.c @@ -22,15 +22,23 @@ #include "misc/extra/extra.h" #include "misc/util/utilTruth.h" #include "sat/glucose/AbcGlucose.h" +#include "aig/miniaig/miniaig.h" ABC_NAMESPACE_IMPL_START +#ifdef WIN32 +#include <process.h> +#define unlink _unlink +#else +#include <unistd.h> +#endif + //////////////////////////////////////////////////////////////////////// /// DECLARATIONS /// //////////////////////////////////////////////////////////////////////// -#define MAJ_NOBJS 32 // Const0 + Const1 + nVars + nNodes +#define MAJ_NOBJS 64 // Const0 + Const1 + nVars + nNodes typedef struct Maj_Man_t_ Maj_Man_t; struct Maj_Man_t_ @@ -422,6 +430,8 @@ struct Exa_Man_t_ int VarVals[MAJ_NOBJS]; // values of the first nVars variables Vec_Wec_t * vOutLits; // output vars bmcg_sat_solver * pSat; // SAT solver + FILE * pFile; + int nCnfClauses; }; static inline word * Exa_ManTruth( Exa_Man_t * p, int v ) { return Vec_WrdEntryP( p->vInfo, p->nWords * v ); } @@ -451,7 +461,7 @@ int Exa_ManMarkup( Exa_Man_t * p ) int i, k, j; assert( p->nObjs <= MAJ_NOBJS ); // assign functionality - p->iVar = 1 + p->nNodes * 3; + p->iVar = 1 + 3*p->nNodes;// // assign connectivity variables for ( i = p->nVars; i < p->nObjs; i++ ) { @@ -502,10 +512,26 @@ Exa_Man_t * Exa_ManAlloc( Bmc_EsPar_t * pPars, word * pTruth ) bmcg_sat_solver_set_nvars( p->pSat, p->iVar ); if ( pPars->RuntimeLim ) bmcg_sat_solver_set_runtime_limit( p->pSat, Abc_Clock() + pPars->RuntimeLim * CLOCKS_PER_SEC ); + if ( pPars->fDumpCnf ) + { + char Buffer[1000]; + sprintf( Buffer, "%s_%d_%d.cnf", p->pPars->pTtStr, 2, p->nNodes ); + p->pFile = fopen( Buffer, "wb" ); + fputs( "p cnf \n", p->pFile ); + } return p; } void Exa_ManFree( Exa_Man_t * p ) { + if ( p->pFile ) + { + char Buffer[1000]; + sprintf( Buffer, "%s_%d_%d.cnf", p->pPars->pTtStr, 2, p->nNodes ); + rewind( p->pFile ); + fprintf( p->pFile, "p cnf %d %d", bmcg_sat_solver_varnum(p->pSat), p->nCnfClauses ); + fclose( p->pFile ); + printf( "CNF was dumped into file \"%s\".\n", Buffer ); + } bmcg_sat_solver_stop( p->pSat ); Vec_WrdFree( p->vInfo ); Vec_WecFree( p->vOutLits ); @@ -542,7 +568,7 @@ static inline int Exa_ManEval( Exa_Man_t * p ) int i, k, iMint; word * pFanins[2]; for ( i = p->nVars; i < p->nObjs; i++ ) { - int iVarStart = 1 + 3*(i - p->nVars); + int iVarStart = 1 + 3*(i - p->nVars);// for ( k = 0; k < 2; k++ ) pFanins[k] = Exa_ManTruth( p, Exa_ManFindFanin(p, i, k) ); Abc_TtConst0( Exa_ManTruth(p, i), p->nWords ); @@ -596,7 +622,7 @@ void Exa_ManDumpBlif( Exa_Man_t * p, int fCompl ) fprintf( pFile, ".outputs F\n" ); for ( i = p->nObjs - 1; i >= p->nVars; i-- ) { - int iVarStart = 1 + 3*(i - p->nVars); + int iVarStart = 1 + 3*(i - p->nVars);// int Val1 = bmcg_sat_solver_read_cex_varvalue(p->pSat, iVarStart); int Val2 = bmcg_sat_solver_read_cex_varvalue(p->pSat, iVarStart+1); int Val3 = bmcg_sat_solver_read_cex_varvalue(p->pSat, iVarStart+2); @@ -634,7 +660,7 @@ void Exa_ManPrintSolution( Exa_Man_t * p, int fCompl ) // for ( i = p->nVars + 2; i < p->nObjs; i++ ) for ( i = p->nObjs - 1; i >= p->nVars; i-- ) { - int iVarStart = 1 + 3*(i - p->nVars); + int iVarStart = 1 + 3*(i - p->nVars);// int Val1 = bmcg_sat_solver_read_cex_varvalue(p->pSat, iVarStart); int Val2 = bmcg_sat_solver_read_cex_varvalue(p->pSat, iVarStart+1); int Val3 = bmcg_sat_solver_read_cex_varvalue(p->pSat, iVarStart+2); @@ -666,43 +692,115 @@ void Exa_ManPrintSolution( Exa_Man_t * p, int fCompl ) SeeAlso [] ***********************************************************************/ -int Exa_ManAddCnfStart( Exa_Man_t * p, int fOnlyAnd ) +static inline int Exa_ManAddClause( Exa_Man_t * p, int * pLits, int nLits ) +{ + int i; + if ( p->pFile ) + { + p->nCnfClauses++; + for ( i = 0; i < nLits; i++ ) + fprintf( p->pFile, "%s%d ", Abc_LitIsCompl(pLits[i]) ? "-" : "", Abc_Lit2Var(pLits[i]) ); + fprintf( p->pFile, "0\n" ); + } + return bmcg_sat_solver_addclause( p->pSat, pLits, nLits ); +} +int Exa_ManAddCnfAdd( Exa_Man_t * p, int * pnAdded ) { int pLits[MAJ_NOBJS], pLits2[2], i, j, k, n, m; - // input constraints + *pnAdded = 0; for ( i = p->nVars; i < p->nObjs; i++ ) { - int iVarStart = 1 + 3*(i - p->nVars); for ( k = 0; k < 2; k++ ) { int nLits = 0; for ( j = 0; j < p->nObjs; j++ ) - if ( p->VarMarks[i][k][j] ) + if ( p->VarMarks[i][k][j] && bmcg_sat_solver_read_cex_varvalue(p->pSat, p->VarMarks[i][k][j]) ) pLits[nLits++] = Abc_Var2Lit( p->VarMarks[i][k][j], 0 ); assert( nLits > 0 ); // input uniqueness - if ( !bmcg_sat_solver_addclause( p->pSat, pLits, nLits ) ) - return 0; for ( n = 0; n < nLits; n++ ) for ( m = n+1; m < nLits; m++ ) { + (*pnAdded)++; pLits2[0] = Abc_LitNot(pLits[n]); pLits2[1] = Abc_LitNot(pLits[m]); - if ( !bmcg_sat_solver_addclause( p->pSat, pLits2, 2 ) ) + if ( !Exa_ManAddClause( p, pLits2, 2 ) ) return 0; } if ( k == 1 ) break; // symmetry breaking - for ( j = 0; j < p->nObjs; j++ ) if ( p->VarMarks[i][k][j] ) - for ( n = j; n < p->nObjs; n++ ) if ( p->VarMarks[i][k+1][n] ) + for ( j = 0; j < p->nObjs; j++ ) if ( p->VarMarks[i][k][j] && bmcg_sat_solver_read_cex_varvalue(p->pSat, p->VarMarks[i][k][j]) ) + for ( n = j; n < p->nObjs; n++ ) if ( p->VarMarks[i][k+1][n] && bmcg_sat_solver_read_cex_varvalue(p->pSat, p->VarMarks[i][k+1][j]) ) { + (*pnAdded)++; pLits2[0] = Abc_Var2Lit( p->VarMarks[i][k][j], 1 ); pLits2[1] = Abc_Var2Lit( p->VarMarks[i][k+1][n], 1 ); - if ( !bmcg_sat_solver_addclause( p->pSat, pLits2, 2 ) ) + if ( !Exa_ManAddClause( p, pLits2, 2 ) ) return 0; } } + } + return 1; +} +int Exa_ManSolverSolve( Exa_Man_t * p ) +{ + int nAdded = 1; + while ( nAdded ) + { + int status = bmcg_sat_solver_solve( p->pSat, NULL, 0 ); + if ( status != GLUCOSE_SAT ) + return status; + status = Exa_ManAddCnfAdd( p, &nAdded ); + //printf( "Added %d clauses.\n", nAdded ); + if ( status != GLUCOSE_SAT ) + return status; + } + return GLUCOSE_SAT; +} +int Exa_ManAddCnfStart( Exa_Man_t * p, int fOnlyAnd ) +{ + int pLits[MAJ_NOBJS], pLits2[3], i, j, k, n, m; + // input constraints + for ( i = p->nVars; i < p->nObjs; i++ ) + { + int iVarStart = 1 + 3*(i - p->nVars);// + for ( k = 0; k < 2; k++ ) + { + int nLits = 0; + for ( j = 0; j < p->nObjs; j++ ) + if ( p->VarMarks[i][k][j] ) + pLits[nLits++] = Abc_Var2Lit( p->VarMarks[i][k][j], 0 ); + assert( nLits > 0 ); + if ( !Exa_ManAddClause( p, pLits, nLits ) ) + return 0; + // input uniqueness + if ( !p->pPars->fDynConstr ) + { + for ( n = 0; n < nLits; n++ ) + for ( m = n+1; m < nLits; m++ ) + { + pLits2[0] = Abc_LitNot(pLits[n]); + pLits2[1] = Abc_LitNot(pLits[m]); + if ( !Exa_ManAddClause( p, pLits2, 2 ) ) + return 0; + } + } + if ( k == 1 ) + break; + // symmetry breaking + if ( !p->pPars->fDynConstr ) + { + for ( j = 0; j < p->nObjs; j++ ) if ( p->VarMarks[i][k][j] ) + for ( n = j; n < p->nObjs; n++ ) if ( p->VarMarks[i][k+1][n] ) + { + pLits2[0] = Abc_Var2Lit( p->VarMarks[i][k][j], 1 ); + pLits2[1] = Abc_Var2Lit( p->VarMarks[i][k+1][n], 1 ); + if ( !Exa_ManAddClause( p, pLits2, 2 ) ) + return 0; + } + } + } #ifdef USE_NODE_ORDER // node ordering for ( j = p->nVars; j < i; j++ ) @@ -711,17 +809,34 @@ int Exa_ManAddCnfStart( Exa_Man_t * p, int fOnlyAnd ) { pLits2[0] = Abc_Var2Lit( p->VarMarks[i][0][n], 1 ); pLits2[1] = Abc_Var2Lit( p->VarMarks[j][0][m], 1 ); - if ( !bmcg_sat_solver_addclause( p->pSat, pLits2, 2 ) ) + if ( !Exa_ManAddClause( p, pLits2, 2 ) ) return 0; } #endif + // unique functions + for ( j = p->nVars; j < i; j++ ) + for ( k = 0; k < 2; k++ ) if ( p->VarMarks[i][k][j] ) + { + pLits2[0] = Abc_Var2Lit( p->VarMarks[i][k][j], 1 ); + for ( n = 0; n < p->nObjs; n++ ) + for ( m = 0; m < 2; m++ ) + { + if ( p->VarMarks[i][!k][n] && p->VarMarks[j][m][n] ) + { + pLits2[1] = Abc_Var2Lit( p->VarMarks[i][!k][n], 1 ); + pLits2[2] = Abc_Var2Lit( p->VarMarks[j][m][n], 1 ); + if ( !Exa_ManAddClause( p, pLits2, 3 ) ) + return 0; + } + } + } // two input functions for ( k = 0; k < 3; k++ ) { pLits[0] = Abc_Var2Lit( iVarStart, k==1 ); pLits[1] = Abc_Var2Lit( iVarStart+1, k==2 ); pLits[2] = Abc_Var2Lit( iVarStart+2, k!=0 ); - if ( !bmcg_sat_solver_addclause( p->pSat, pLits, 3 ) ) + if ( !Exa_ManAddClause( p, pLits, 3 ) ) return 0; } if ( fOnlyAnd ) @@ -729,7 +844,7 @@ int Exa_ManAddCnfStart( Exa_Man_t * p, int fOnlyAnd ) pLits[0] = Abc_Var2Lit( iVarStart, 1 ); pLits[1] = Abc_Var2Lit( iVarStart+1, 1 ); pLits[2] = Abc_Var2Lit( iVarStart+2, 0 ); - if ( !bmcg_sat_solver_addclause( p->pSat, pLits, 3 ) ) + if ( !Exa_ManAddClause( p, pLits, 3 ) ) return 0; } } @@ -738,7 +853,7 @@ int Exa_ManAddCnfStart( Exa_Man_t * p, int fOnlyAnd ) { Vec_Int_t * vArray = Vec_WecEntry(p->vOutLits, i); assert( Vec_IntSize(vArray) > 0 ); - if ( !bmcg_sat_solver_addclause( p->pSat, Vec_IntArray(vArray), Vec_IntSize(vArray) ) ) + if ( !Exa_ManAddClause( p, Vec_IntArray(vArray), Vec_IntSize(vArray) ) ) return 0; } return 1; @@ -754,7 +869,7 @@ int Exa_ManAddCnf( Exa_Man_t * p, int iMint ) for ( i = p->nVars; i < p->nObjs; i++ ) { // fanin connectivity - int iVarStart = 1 + 3*(i - p->nVars); + int iVarStart = 1 + 3*(i - p->nVars);// int iBaseSatVarI = p->iVar + 3*(i - p->nVars); for ( k = 0; k < 2; k++ ) { @@ -770,7 +885,7 @@ int Exa_ManAddCnf( Exa_Man_t * p, int iMint ) pLits[nLits++] = Abc_Var2Lit( iBaseSatVarJ + 2, !n ); else if ( p->VarVals[j] == n ) continue; - if ( !bmcg_sat_solver_addclause( p->pSat, pLits, nLits ) ) + if ( !Exa_ManAddClause( p, pLits, nLits ) ) return 0; } } @@ -790,7 +905,7 @@ int Exa_ManAddCnf( Exa_Man_t * p, int iMint ) if ( i != p->nObjs - 1 ) pLits[nLits++] = Abc_Var2Lit( iBaseSatVarI + 2, !n ); if ( k > 0 ) pLits[nLits++] = Abc_Var2Lit( iVarStart + k-1, n ); assert( nLits <= 4 ); - if ( !bmcg_sat_solver_addclause( p->pSat, pLits, nLits ) ) + if ( !Exa_ManAddClause( p, pLits, nLits ) ) return 0; } } @@ -815,7 +930,10 @@ void Exa_ManExactSynthesis( Bmc_EsPar_t * pPars ) abctime clk = Abc_Clock(); if ( !Exa_ManAddCnf( p, iMint ) ) break; - status = bmcg_sat_solver_solve( p->pSat, NULL, 0 ); + if ( pPars->fDynConstr ) + status = Exa_ManSolverSolve( p ); + else + status = bmcg_sat_solver_solve( p->pSat, NULL, 0 ); if ( pPars->fVerbose ) { printf( "Iter %3d : ", i ); @@ -1141,7 +1259,7 @@ static int Exa3_ManAddCnfStart( Exa3_Man_t * p, int fOnlyAnd ) } //#ifdef USE_NODE_ORDER // node ordering - if ( p->pPars->fUseIncr ) + if ( p->pPars->fOrderNodes ) { for ( j = p->nVars; j < i; j++ ) for ( n = 0; n < p->nObjs; n++ ) if ( p->VarMarks[i][0][n] ) @@ -1349,6 +1467,1260 @@ void Exa3_ManExactSynthesis( Bmc_EsPar_t * pPars ) Abc_PrintTime( 1, "Total runtime", Abc_Clock() - clkTotal ); } +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Exa_ManIsNormalized( Vec_Wrd_t * vSimsIn, Vec_Wrd_t * vSimsOut ) +{ + int i, Count = 0; word Temp; + Vec_WrdForEachEntry( vSimsIn, Temp, i ) + if ( Temp & 1 ) + Count++; + if ( Count ) + printf( "The data for %d divisors are not normalized.\n", Count ); + if ( !(Vec_WrdEntry(vSimsOut, 0) & 1) ) + printf( "The output data is not normalized.\n" ); +// else if ( Count == 0 ) +// printf( "The data is fully normalized.\n" ); +} +static inline void Exa_ManPrintFanin( int nIns, int nDivs, int iNode, int fComp ) +{ + if ( iNode == 0 ) + printf( " %s", fComp ? "const1" : "const0" ); + else if ( iNode > 0 && iNode <= nIns ) + printf( " %s%c", fComp ? "~" : "", 'a'+iNode-1 ); + else if ( iNode > nIns && iNode < nDivs ) + printf( " %s%c", fComp ? "~" : "", 'A'+iNode-nIns-1 ); + else + printf( " %s%d", fComp ? "~" : "", iNode ); +} +void Exa_ManMiniPrint( Mini_Aig_t * p, int nIns ) +{ + int i, nDivs = 1 + Mini_AigPiNum(p), nNodes = Mini_AigAndNum(p); + printf( "This %d-var function (%d divisors) has %d gates (%d xor) and %d levels:\n", + nIns, nDivs, nNodes, Mini_AigXorNum(p), Mini_AigLevelNum(p) ); + for ( i = nDivs + nNodes; i < Mini_AigNodeNum(p); i++ ) + { + int Lit0 = Mini_AigNodeFanin0( p, i ); + printf( "%2d = ", i ); + Exa_ManPrintFanin( nIns, nDivs, Abc_Lit2Var(Lit0), Abc_LitIsCompl(Lit0) ); + printf( "\n" ); + } + for ( i = nDivs + nNodes - 1; i >= nDivs; i-- ) + { + int Lit0 = Mini_AigNodeFanin0( p, i ); + int Lit1 = Mini_AigNodeFanin1( p, i ); + printf( "%2d = ", i ); + if ( Lit0 < Lit1 ) + { + Exa_ManPrintFanin( nIns, nDivs, Abc_Lit2Var(Lit0), Abc_LitIsCompl(Lit0) ); + printf( " &" ); + Exa_ManPrintFanin( nIns, nDivs, Abc_Lit2Var(Lit1), Abc_LitIsCompl(Lit1) ); + } + else + { + Exa_ManPrintFanin( nIns, nDivs, Abc_Lit2Var(Lit1), Abc_LitIsCompl(Lit1) ); + printf( " ^" ); + Exa_ManPrintFanin( nIns, nDivs, Abc_Lit2Var(Lit0), Abc_LitIsCompl(Lit0) ); + } + printf( "\n" ); + } +} +void Exa_ManMiniVerify( Mini_Aig_t * p, Vec_Wrd_t * vSimsIn, Vec_Wrd_t * vSimsOut ) +{ + extern void Extra_BitMatrixTransposeP( Vec_Wrd_t * vSimsIn, int nWordsIn, Vec_Wrd_t * vSimsOut, int nWordsOut ); + int i, nDivs = 1 + Mini_AigPiNum(p), nNodes = Mini_AigAndNum(p); + int k, nOuts = Mini_AigPoNum(p), nErrors = 0; word Outs[6] = {0}; + Vec_Wrd_t * vSimsIn2 = Vec_WrdStart( 64 ); + assert( nOuts <= 6 ); + assert( Vec_WrdSize(vSimsIn) <= 64 ); + assert( Vec_WrdSize(vSimsIn) == Vec_WrdSize(vSimsOut) ); + Vec_WrdFillExtra( vSimsIn, 64, 0 ); + Extra_BitMatrixTransposeP( vSimsIn, 1, vSimsIn2, 1 ); + assert( Mini_AigNodeNum(p) <= 64 ); + for ( i = nDivs; i < nDivs + nNodes; i++ ) + { + int Lit0 = Mini_AigNodeFanin0( p, i ); + int Lit1 = Mini_AigNodeFanin1( p, i ); + word Sim0 = Vec_WrdEntry( vSimsIn2, Abc_Lit2Var(Lit0) ); + word Sim1 = Vec_WrdEntry( vSimsIn2, Abc_Lit2Var(Lit1) ); + Sim0 = Abc_LitIsCompl(Lit0) ? ~Sim0 : Sim0; + Sim1 = Abc_LitIsCompl(Lit1) ? ~Sim1 : Sim1; + Vec_WrdWriteEntry( vSimsIn2, i, Lit0 < Lit1 ? Sim0 & Sim1 : Sim0 ^ Sim1 ); + } + for ( i = nDivs + nNodes; i < Mini_AigNodeNum(p); i++ ) + { + int Lit0 = Mini_AigNodeFanin0( p, i ); + word Sim0 = Vec_WrdEntry( vSimsIn2, Abc_Lit2Var(Lit0) ); + Outs[i - (nDivs + nNodes)] = Abc_LitIsCompl(Lit0) ? ~Sim0 : Sim0; + } + Vec_WrdFree( vSimsIn2 ); + for ( i = 0; i < Vec_WrdSize(vSimsOut); i++ ) + { + int iOutMint = 0; + for ( k = 0; k < nOuts; k++ ) + if ( (Outs[k] >> i) & 1 ) + iOutMint |= 1 << k; + nErrors += !Abc_TtGetBit(Vec_WrdEntryP(vSimsOut, i), iOutMint); + } + if ( nErrors == 0 ) + printf( "Verification successful. " ); + else + printf( "Verification failed for %d (out of %d) minterms.\n", nErrors, Vec_WrdSize(vSimsOut) ); +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Vec_Int_t * Exa4_ManParse( char * pFileName ) +{ + Vec_Int_t * vRes = NULL; + char * pToken, pBuffer[1000]; + FILE * pFile = fopen( pFileName, "rb" ); + if ( pFile == NULL ) + { + Abc_Print( -1, "Cannot open file \"%s\".\n", pFileName ); + return NULL; + } + while ( fgets( pBuffer, 1000, pFile ) != NULL ) + { + if ( pBuffer[0] == 's' ) + { + if ( strncmp(pBuffer+2, "SAT", 3) ) + break; + assert( vRes == NULL ); + vRes = Vec_IntAlloc( 100 ); + } + else if ( pBuffer[0] == 'v' ) + { + pToken = strtok( pBuffer+1, " \n\r\t" ); + while ( pToken ) + { + int Token = atoi(pToken); + if ( Token == 0 ) + break; + Vec_IntSetEntryFull( vRes, Abc_AbsInt(Token), Token > 0 ); + pToken = strtok( NULL, " \n\r\t" ); + } + } + else if ( pBuffer[0] != 'c' ) + assert( 0 ); + } + fclose( pFile ); + unlink( pFileName ); + return vRes; +} +Vec_Int_t * Exa4_ManSolve( char * pFileNameIn, char * pFileNameOut, int TimeOut, int fVerbose ) +{ + int fVerboseSolver = 0; + abctime clkTotal = Abc_Clock(); + Vec_Int_t * vRes = NULL; +#ifdef _WIN32 + char * pKissat = "kissat.exe"; +#else + char * pKissat = "kissat"; +#endif + char Command[1000], * pCommand = (char *)&Command; + { + FILE * pFile = fopen( pKissat, "rb" ); + if ( pFile == NULL ) + { + printf( "Cannot find the Kissat binary \"%s\".\n", pKissat ); + return NULL; + } + fclose( pFile ); + } + if ( TimeOut ) + sprintf( pCommand, "%s --time=%d %s %s > %s", pKissat, TimeOut, fVerboseSolver ? "": "-q", pFileNameIn, pFileNameOut ); + else + sprintf( pCommand, "%s %s %s > %s", pKissat, fVerboseSolver ? "": "-q", pFileNameIn, pFileNameOut ); + if ( system( pCommand ) == -1 ) + { + fprintf( stdout, "Command \"%s\" did not succeed.\n", pCommand ); + return 0; + } + vRes = Exa4_ManParse( pFileNameOut ); + if ( fVerbose ) + { + if ( vRes ) + printf( "The problem has a solution. " ); + else if ( vRes == NULL && TimeOut == 0 ) + printf( "The problem has no solution. " ); + else if ( vRes == NULL ) + printf( "The problem has no solution or timed out after %d sec. ", TimeOut ); + Abc_PrintTime( 1, "SAT solver time", Abc_Clock() - clkTotal ); + } + return vRes; +} + + +typedef struct Exa4_Man_t_ Exa4_Man_t; +struct Exa4_Man_t_ +{ + Vec_Wrd_t * vSimsIn; // input signatures (nWords = 1, nIns <= 64) + Vec_Wrd_t * vSimsOut; // output signatures (nWords = 1, nOuts <= 6) + int fVerbose; + int nIns; + int nDivs; // divisors (const + inputs + tfi + sidedivs) + int nNodes; + int nOuts; + int nObjs; + int VarMarks[MAJ_NOBJS][2][MAJ_NOBJS]; + int nCnfVars; + int nCnfClauses; + FILE * pFile; +}; + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Exa4_ManMarkup( Exa4_Man_t * p ) +{ + int i, k, j, nVars[3] = {1 + 5*p->nNodes, 0, 3*p->nNodes*Vec_WrdSize(p->vSimsIn)}; + assert( p->nObjs <= MAJ_NOBJS ); + for ( i = p->nDivs; i < p->nDivs + p->nNodes; i++ ) + for ( k = 0; k < 2; k++ ) + for ( j = 1+!k; j < i-k; j++ ) + p->VarMarks[i][k][j] = nVars[0] + nVars[1]++; + for ( i = p->nDivs + p->nNodes; i < p->nObjs; i++ ) + for ( j = p->nOuts == 1 ? p->nDivs + p->nNodes - 1 : 0; j < p->nDivs + p->nNodes; j++ ) + p->VarMarks[i][0][j] = nVars[0] + nVars[1]++; + if ( p->fVerbose ) + printf( "Variables: Function = %d. Structure = %d. Internal = %d. Total = %d.\n", + nVars[0], nVars[1], nVars[2], nVars[0] + nVars[1] + nVars[2] ); + if ( 0 ) + { + for ( j = 0; j < 2; j++ ) + { + printf( " : " ); + for ( i = p->nDivs; i < p->nDivs + p->nNodes; i++ ) + { + for ( k = 0; k < 2; k++ ) + printf( "%3d ", j ? k : i ); + printf( " " ); + } + printf( " " ); + for ( i = p->nDivs + p->nNodes; i < p->nObjs; i++ ) + { + printf( "%3d ", j ? 0 : i ); + printf( " " ); + } + printf( "\n" ); + } + for ( j = 0; j < 5 + p->nNodes*9 + p->nOuts*5; j++ ) + printf( "-" ); + printf( "\n" ); + for ( j = p->nObjs - 2; j >= 0; j-- ) + { + if ( j > 0 && j <= p->nIns ) + printf( " %c : ", 'a'+j-1 ); + else + printf( "%2d : ", j ); + for ( i = p->nDivs; i < p->nDivs + p->nNodes; i++ ) + { + for ( k = 0; k < 2; k++ ) + printf( "%3d ", p->VarMarks[i][k][j] ); + printf( " " ); + } + printf( " " ); + for ( i = p->nDivs + p->nNodes; i < p->nObjs; i++ ) + { + printf( "%3d ", p->VarMarks[i][0][j] ); + printf( " " ); + } + printf( "\n" ); + } + } + return nVars[0] + nVars[1] + nVars[2]; +} +Exa4_Man_t * Exa4_ManAlloc( Vec_Wrd_t * vSimsIn, Vec_Wrd_t * vSimsOut, int nIns, int nDivs, int nOuts, int nNodes, int fVerbose ) +{ + Exa4_Man_t * p = ABC_CALLOC( Exa4_Man_t, 1 ); + assert( Vec_WrdSize(vSimsIn) == Vec_WrdSize(vSimsOut) ); + p->vSimsIn = vSimsIn; + p->vSimsOut = vSimsOut; + p->fVerbose = fVerbose; + p->nIns = nIns; + p->nDivs = nDivs; + p->nNodes = nNodes; + p->nOuts = nOuts; + p->nObjs = p->nDivs + p->nNodes + p->nOuts; + p->nCnfVars = Exa4_ManMarkup( p ); + return p; +} +void Exa4_ManFree( Exa4_Man_t * p ) +{ + ABC_FREE( p ); +} + + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline int Exa4_ManAddClause( Exa4_Man_t * p, int * pLits, int nLits ) +{ + int i, k = 0; + for ( i = 0; i < nLits; i++ ) + if ( pLits[i] == 1 ) + return 0; + else if ( pLits[i] == 0 ) + continue; + else if ( pLits[i] <= 2*p->nCnfVars ) + pLits[k++] = pLits[i]; + else assert( 0 ); + nLits = k; + assert( nLits > 0 ); + if ( p->pFile ) + { + p->nCnfClauses++; + for ( i = 0; i < nLits; i++ ) + fprintf( p->pFile, "%s%d ", Abc_LitIsCompl(pLits[i]) ? "-" : "", Abc_Lit2Var(pLits[i]) ); + fprintf( p->pFile, "0\n" ); + } + if ( 0 ) + { + for ( i = 0; i < nLits; i++ ) + fprintf( stdout, "%s%d ", Abc_LitIsCompl(pLits[i]) ? "-" : "", Abc_Lit2Var(pLits[i]) ); + fprintf( stdout, "\n" ); + } + return 1; +} +static inline int Exa4_ManAddClause4( Exa4_Man_t * p, int Lit0, int Lit1, int Lit2, int Lit3 ) +{ + int pLits[4] = { Lit0, Lit1, Lit2, Lit3 }; + return Exa4_ManAddClause( p, pLits, 4 ); +} +int Exa4_ManGenStart( Exa4_Man_t * p, int fOnlyAnd, int fFancy, int fOrderNodes, int fUniqFans ) +{ + int pLits[2*MAJ_NOBJS], i, j, k, n, m, nLits; + for ( i = p->nDivs; i < p->nDivs + p->nNodes; i++ ) + { + int iVarStart = 1 + 5*(i - p->nDivs);// + for ( k = 0; k < 2; k++ ) + { + nLits = 0; + for ( j = 0; j < p->nObjs; j++ ) + if ( p->VarMarks[i][k][j] ) + pLits[nLits++] = Abc_Var2Lit( p->VarMarks[i][k][j], 0 ); + assert( nLits > 0 ); + Exa4_ManAddClause( p, pLits, nLits ); + for ( n = 0; n < nLits; n++ ) + for ( m = n+1; m < nLits; m++ ) + Exa4_ManAddClause4( p, Abc_LitNot(pLits[n]), Abc_LitNot(pLits[m]), 0, 0 ); + if ( k == 1 ) + break; + for ( j = 0; j < p->nObjs; j++ ) if ( p->VarMarks[i][0][j] ) + for ( n = j; n < p->nObjs; n++ ) if ( p->VarMarks[i][1][n] ) + Exa4_ManAddClause4( p, Abc_Var2Lit(p->VarMarks[i][0][j], 1), Abc_Var2Lit(p->VarMarks[i][1][n], 1), 0, 0 ); + } + if ( fOrderNodes ) + for ( j = p->nDivs; j < i; j++ ) + for ( n = 0; n < p->nObjs; n++ ) if ( p->VarMarks[i][0][n] ) + for ( m = n+1; m < p->nObjs; m++ ) if ( p->VarMarks[j][0][m] ) + Exa4_ManAddClause4( p, Abc_Var2Lit(p->VarMarks[i][0][n], 1), Abc_Var2Lit(p->VarMarks[j][0][m], 1), 0, 0 ); + for ( j = p->nDivs; j < i; j++ ) + for ( k = 0; k < 2; k++ ) if ( p->VarMarks[i][k][j] ) + for ( n = 0; n < p->nObjs; n++ ) if ( p->VarMarks[i][!k][n] ) + for ( m = 0; m < 2; m++ ) if ( p->VarMarks[j][m][n] ) + Exa4_ManAddClause4( p, Abc_Var2Lit(p->VarMarks[i][k][j], 1), Abc_Var2Lit(p->VarMarks[i][!k][n], 1), Abc_Var2Lit(p->VarMarks[j][m][n], 1), 0 ); + if ( fFancy ) + { + nLits = 0; + for ( k = 0; k < 5-fOnlyAnd; k++ ) + pLits[nLits++] = Abc_Var2Lit( iVarStart+k, 0 ); + Exa4_ManAddClause( p, pLits, nLits ); + for ( n = 0; n < nLits; n++ ) + for ( m = n+1; m < nLits; m++ ) + Exa4_ManAddClause4( p, Abc_LitNot(pLits[n]), Abc_LitNot(pLits[m]), 0, 0 ); + } + else + { + for ( k = 0; k < 3; k++ ) + Exa4_ManAddClause4( p, Abc_Var2Lit(iVarStart, k==1), Abc_Var2Lit(iVarStart+1, k==2), Abc_Var2Lit(iVarStart+2, k!=0), 0); + if ( fOnlyAnd ) + Exa4_ManAddClause4( p, Abc_Var2Lit(iVarStart, 1), Abc_Var2Lit(iVarStart+1, 1), Abc_Var2Lit(iVarStart+2, 0), 0); + } + } + for ( i = p->nDivs; i < p->nDivs + p->nNodes; i++ ) + { + nLits = 0; + for ( k = 0; k < 2; k++ ) + for ( j = i+1; j < p->nObjs; j++ ) + if ( p->VarMarks[j][k][i] ) + pLits[nLits++] = Abc_Var2Lit( p->VarMarks[j][k][i], 0 ); + Exa4_ManAddClause( p, pLits, nLits ); + if ( fUniqFans ) + for ( n = 0; n < nLits; n++ ) + for ( m = n+1; m < nLits; m++ ) + Exa4_ManAddClause4( p, Abc_LitNot(pLits[n]), Abc_LitNot(pLits[m]), 0, 0 ); + } + for ( i = p->nDivs + p->nNodes; i < p->nObjs; i++ ) + { + nLits = 0; + for ( j = 0; j < p->nDivs + p->nNodes; j++ ) if ( p->VarMarks[i][0][j] ) + pLits[nLits++] = Abc_Var2Lit( p->VarMarks[i][0][j], 0 ); + Exa4_ManAddClause( p, pLits, nLits ); + for ( n = 0; n < nLits; n++ ) + for ( m = n+1; m < nLits; m++ ) + Exa4_ManAddClause4( p, Abc_LitNot(pLits[n]), Abc_LitNot(pLits[m]), 0, 0 ); + } + return 1; +} +void Exa4_ManGenMint( Exa4_Man_t * p, int iMint, int fOnlyAnd, int fFancy ) +{ + int iNodeVar = p->nCnfVars + 3*p->nNodes*(iMint - Vec_WrdSize(p->vSimsIn)); + int iOutMint = Abc_Tt6FirstBit( Vec_WrdEntry(p->vSimsOut, iMint) ); + int i, k, n, j, VarVals[MAJ_NOBJS]; + assert( p->nObjs <= MAJ_NOBJS ); + assert( iMint < Vec_WrdSize(p->vSimsIn) ); + for ( i = 0; i < p->nDivs; i++ ) + VarVals[i] = (Vec_WrdEntry(p->vSimsIn, iMint) >> i) & 1; + for ( i = 0; i < p->nNodes; i++ ) + VarVals[p->nDivs + i] = Abc_Var2Lit(iNodeVar + 3*i + 2, 0); + for ( i = 0; i < p->nOuts; i++ ) + VarVals[p->nDivs + p->nNodes + i] = (iOutMint >> i) & 1; + if ( 0 ) + { + printf( "Adding minterm %d: ", iMint ); + for ( i = 0; i < p->nObjs; i++ ) + printf( " %d=%d", i, VarVals[i] ); + printf( "\n" ); + } + for ( i = p->nDivs; i < p->nDivs + p->nNodes; i++ ) + { + int iVarStart = 1 + 5*(i - p->nDivs);// + int iBaseVarI = iNodeVar + 3*(i - p->nDivs); + for ( k = 0; k < 2; k++ ) + for ( j = 0; j < i; j++ ) if ( p->VarMarks[i][k][j] ) + for ( n = 0; n < 2; n++ ) + Exa4_ManAddClause4( p, Abc_Var2Lit(p->VarMarks[i][k][j], 1), Abc_Var2Lit(iBaseVarI + k, n), Abc_LitNotCond(VarVals[j], !n), 0); + if ( fFancy ) + { + // Clauses for a*b = c + // a + ~c + // b + ~c + // ~a + ~b + c + Exa4_ManAddClause4( p, Abc_Var2Lit(iVarStart + 0, 1), Abc_Var2Lit(iBaseVarI + 0, 0), 0, Abc_Var2Lit(iBaseVarI + 2, 1) ); + Exa4_ManAddClause4( p, Abc_Var2Lit(iVarStart + 0, 1), 0, Abc_Var2Lit(iBaseVarI + 1, 0), Abc_Var2Lit(iBaseVarI + 2, 1) ); + Exa4_ManAddClause4( p, Abc_Var2Lit(iVarStart + 0, 1), Abc_Var2Lit(iBaseVarI + 0, 1), Abc_Var2Lit(iBaseVarI + 1, 1), Abc_Var2Lit(iBaseVarI + 2, 0) ); + + Exa4_ManAddClause4( p, Abc_Var2Lit(iVarStart + 1, 1), Abc_Var2Lit(iBaseVarI + 0, 1), 0, Abc_Var2Lit(iBaseVarI + 2, 1) ); + Exa4_ManAddClause4( p, Abc_Var2Lit(iVarStart + 1, 1), 0, Abc_Var2Lit(iBaseVarI + 1, 0), Abc_Var2Lit(iBaseVarI + 2, 1) ); + Exa4_ManAddClause4( p, Abc_Var2Lit(iVarStart + 1, 1), Abc_Var2Lit(iBaseVarI + 0, 0), Abc_Var2Lit(iBaseVarI + 1, 1), Abc_Var2Lit(iBaseVarI + 2, 0) ); + + Exa4_ManAddClause4( p, Abc_Var2Lit(iVarStart + 2, 1), Abc_Var2Lit(iBaseVarI + 0, 0), 0, Abc_Var2Lit(iBaseVarI + 2, 1) ); + Exa4_ManAddClause4( p, Abc_Var2Lit(iVarStart + 2, 1), 0, Abc_Var2Lit(iBaseVarI + 1, 1), Abc_Var2Lit(iBaseVarI + 2, 1) ); + Exa4_ManAddClause4( p, Abc_Var2Lit(iVarStart + 2, 1), Abc_Var2Lit(iBaseVarI + 0, 1), Abc_Var2Lit(iBaseVarI + 1, 0), Abc_Var2Lit(iBaseVarI + 2, 0) ); + // Clauses for a+b = c + // ~a + c + // ~b + c + // a + b + ~c + Exa4_ManAddClause4( p, Abc_Var2Lit(iVarStart + 3, 1), Abc_Var2Lit(iBaseVarI + 0, 1), 0, Abc_Var2Lit(iBaseVarI + 2, 0) ); + Exa4_ManAddClause4( p, Abc_Var2Lit(iVarStart + 3, 1), 0, Abc_Var2Lit(iBaseVarI + 1, 1), Abc_Var2Lit(iBaseVarI + 2, 0) ); + Exa4_ManAddClause4( p, Abc_Var2Lit(iVarStart + 3, 1), Abc_Var2Lit(iBaseVarI + 0, 0), Abc_Var2Lit(iBaseVarI + 1, 0), Abc_Var2Lit(iBaseVarI + 2, 1) ); + // Clauses for a^b = c + // ~a + ~b + ~c + // ~a + b + c + // a + ~b + c + // a + b + ~c + if ( !fOnlyAnd ) + { + Exa4_ManAddClause4( p, Abc_Var2Lit(iVarStart + 4, 1), Abc_Var2Lit(iBaseVarI + 0, 1), Abc_Var2Lit(iBaseVarI + 1, 1), Abc_Var2Lit(iBaseVarI + 2, 1) ); + Exa4_ManAddClause4( p, Abc_Var2Lit(iVarStart + 4, 1), Abc_Var2Lit(iBaseVarI + 0, 1), Abc_Var2Lit(iBaseVarI + 1, 0), Abc_Var2Lit(iBaseVarI + 2, 0) ); + Exa4_ManAddClause4( p, Abc_Var2Lit(iVarStart + 4, 1), Abc_Var2Lit(iBaseVarI + 0, 0), Abc_Var2Lit(iBaseVarI + 1, 1), Abc_Var2Lit(iBaseVarI + 2, 0) ); + Exa4_ManAddClause4( p, Abc_Var2Lit(iVarStart + 4, 1), Abc_Var2Lit(iBaseVarI + 0, 0), Abc_Var2Lit(iBaseVarI + 1, 0), Abc_Var2Lit(iBaseVarI + 2, 1) ); + } + } + else + { + for ( k = 0; k < 4; k++ ) + for ( n = 0; n < 2; n++ ) + Exa4_ManAddClause4( p, Abc_Var2Lit(iBaseVarI + 0, k&1), Abc_Var2Lit(iBaseVarI + 1, k>>1), Abc_Var2Lit(iBaseVarI + 2, !n), Abc_Var2Lit(k ? iVarStart + k-1 : 0, n)); + } + } + for ( i = p->nDivs + p->nNodes; i < p->nObjs; i++ ) + { + for ( j = 0; j < p->nDivs + p->nNodes; j++ ) if ( p->VarMarks[i][0][j] ) + for ( n = 0; n < 2; n++ ) + Exa4_ManAddClause4( p, Abc_Var2Lit(p->VarMarks[i][0][j], 1), Abc_LitNotCond(VarVals[j], n), Abc_LitNotCond(VarVals[i], !n), 0); + } +} +void Exa4_ManGenCnf( Exa4_Man_t * p, char * pFileName, int fOnlyAnd, int fFancy, int fOrderNodes, int fUniqFans ) +{ + int m; + assert( p->pFile == NULL ); + p->pFile = fopen( pFileName, "wb" ); + fputs( "p cnf \n", p->pFile ); + Exa4_ManGenStart( p, fOnlyAnd, fFancy, fOrderNodes, fUniqFans ); + for ( m = 1; m < Vec_WrdSize(p->vSimsIn); m++ ) + Exa4_ManGenMint( p, m, fOnlyAnd, fFancy ); + rewind( p->pFile ); + fprintf( p->pFile, "p cnf %d %d", p->nCnfVars, p->nCnfClauses ); + fclose( p->pFile ); +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline int Exa4_ManFindFanin( Exa4_Man_t * p, Vec_Int_t * vValues, int i, int k ) +{ + int j, Count = 0, iVar = -1; + for ( j = 0; j < p->nObjs; j++ ) + if ( p->VarMarks[i][k][j] && Vec_IntEntry(vValues, p->VarMarks[i][k][j]) ) + { + iVar = j; + Count++; + } + assert( Count == 1 ); + return iVar; +} +static inline void Exa4_ManPrintFanin( Exa4_Man_t * p, int iNode, int fComp ) +{ + if ( iNode == 0 ) + printf( " %s", fComp ? "const1" : "const0" ); + else if ( iNode > 0 && iNode <= p->nIns ) + printf( " %s%c", fComp ? "~" : "", 'a'+iNode-1 ); + else if ( iNode > p->nIns && iNode < p->nDivs ) + printf( " %s%c", fComp ? "~" : "", 'A'+iNode-p->nIns-1 ); + else + printf( " %s%d", fComp ? "~" : "", iNode ); +} +void Exa4_ManPrintSolution( Exa4_Man_t * p, Vec_Int_t * vValues, int fFancy ) +{ + int i, k; + printf( "Circuit for %d-var function with %d divisors contains %d two-input gates:\n", p->nIns, p->nDivs, p->nNodes ); + for ( i = p->nDivs + p->nNodes; i < p->nObjs; i++ ) + { + int iVar = Exa4_ManFindFanin( p, vValues, i, 0 ); + printf( "%2d = ", i ); + Exa4_ManPrintFanin( p, iVar, 0 ); + printf( "\n" ); + } + for ( i = p->nDivs + p->nNodes - 1; i >= p->nDivs; i-- ) + { + int iVarStart = 1 + 5*(i - p->nDivs);// + if ( fFancy ) + { + int Val1 = Vec_IntEntry(vValues, iVarStart); + int Val2 = Vec_IntEntry(vValues, iVarStart+1); + int Val3 = Vec_IntEntry(vValues, iVarStart+2); + int Val4 = Vec_IntEntry(vValues, iVarStart+3); + //int Val5 = Vec_IntEntry(vValues, iVarStart+4); + printf( "%2d = ", i ); + for ( k = 0; k < 2; k++ ) + { + int iNode = Exa4_ManFindFanin( p, vValues, i, !k ); + int fComp = k ? Val1 | Val3 : Val2 | Val3; + Exa4_ManPrintFanin( p, iNode, fComp ); + if ( k ) break; + printf( " %c", (Val1 || Val2 || Val3) ? '&' : (Val4 ? '|' : '^') ); + } + } + else + { + int Val1 = Vec_IntEntry(vValues, iVarStart); + int Val2 = Vec_IntEntry(vValues, iVarStart+1); + int Val3 = Vec_IntEntry(vValues, iVarStart+2); + printf( "%2d = ", i ); + for ( k = 0; k < 2; k++ ) + { + int iNode = Exa4_ManFindFanin( p, vValues, i, !k ); + int fComp = k ? !Val1 && Val2 && !Val3 : Val1 && !Val2 && !Val3; + Exa4_ManPrintFanin( p, iNode, fComp ); + if ( k ) break; + printf( " %c", (Val1 && Val2) ? (Val3 ? '|' : '^') : '&' ); + } + } + printf( "\n" ); + } +} +Mini_Aig_t * Exa4_ManMiniAig( Exa4_Man_t * p, Vec_Int_t * vValues, int fFancy ) +{ + int i, k, Compl[MAJ_NOBJS] = {0}; + Mini_Aig_t * pMini = Mini_AigStartSupport( p->nDivs-1, p->nObjs ); + for ( i = p->nDivs; i < p->nDivs + p->nNodes; i++ ) + { + int iNodes[2] = {0}; + int iVarStart = 1 + 5*(i - p->nDivs);// + if ( fFancy ) + { + int Val1 = Vec_IntEntry(vValues, iVarStart); + int Val2 = Vec_IntEntry(vValues, iVarStart+1); + int Val3 = Vec_IntEntry(vValues, iVarStart+2); + int Val4 = Vec_IntEntry(vValues, iVarStart+3); + int Val5 = Vec_IntEntry(vValues, iVarStart+4); + for ( k = 0; k < 2; k++ ) + { + int iNode = Exa4_ManFindFanin( p, vValues, i, !k ); + int fComp = k ? Val1 | Val3 : Val2 | Val3; + iNodes[k] = Abc_Var2Lit(iNode, fComp ^ Compl[iNode]); + } + if ( Val1 || Val2 || Val3 ) + Mini_AigAnd( pMini, iNodes[0], iNodes[1] ); + else + { + if ( Val4 ) + Mini_AigOr( pMini, iNodes[0], iNodes[1] ); + else if ( Val5 ) + Mini_AigXorSpecial( pMini, iNodes[0], iNodes[1] ); + else assert( 0 ); + } + } + else + { + int Val1 = Vec_IntEntry(vValues, iVarStart); + int Val2 = Vec_IntEntry(vValues, iVarStart+1); + int Val3 = Vec_IntEntry(vValues, iVarStart+2); + Compl[i] = Val1 && Val2 && Val3; + for ( k = 0; k < 2; k++ ) + { + int iNode = Exa4_ManFindFanin( p, vValues, i, !k ); + int fComp = k ? !Val1 && Val2 && !Val3 : Val1 && !Val2 && !Val3; + iNodes[k] = Abc_Var2Lit(iNode, fComp ^ Compl[iNode]); + } + if ( Val1 && Val2 ) + { + if ( Val3 ) + Mini_AigOr( pMini, iNodes[0], iNodes[1] ); + else + Mini_AigXorSpecial( pMini, iNodes[0], iNodes[1] ); + } + else + Mini_AigAnd( pMini, iNodes[0], iNodes[1] ); + } + } + for ( i = p->nDivs + p->nNodes; i < p->nObjs; i++ ) + { + int iVar = Exa4_ManFindFanin( p, vValues, i, 0 ); + Mini_AigCreatePo( pMini, Abc_Var2Lit(iVar, Compl[iVar]) ); + } + assert( p->nObjs == Mini_AigNodeNum(pMini) ); + return pMini; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Mini_Aig_t * Exa4_ManGenTest( Vec_Wrd_t * vSimsIn, Vec_Wrd_t * vSimsOut, int nIns, int nDivs, int nOuts, int nNodes, int TimeOut, int fOnlyAnd, int fFancy, int fOrderNodes, int fUniqFans, int fVerbose ) +{ + Mini_Aig_t * pMini = NULL; + abctime clkTotal = Abc_Clock(); + Vec_Int_t * vValues = NULL; + char * pFileNameIn = "_temp_.cnf"; + char * pFileNameOut = "_temp_out.cnf"; + Exa4_Man_t * p = Exa4_ManAlloc( vSimsIn, vSimsOut, nIns, nDivs, nOuts, nNodes, fVerbose ); + Exa_ManIsNormalized( vSimsIn, vSimsOut ); + Exa4_ManGenCnf( p, pFileNameIn, fOnlyAnd, fFancy, fOrderNodes, fUniqFans ); + if ( fVerbose ) + printf( "Timeout = %d. OnlyAnd = %d. Fancy = %d. OrderNodes = %d. UniqueFans = %d. Verbose = %d.\n", TimeOut, fOnlyAnd, fFancy, fOrderNodes, fUniqFans, fVerbose ); + if ( fVerbose ) + printf( "CNF with %d variables and %d clauses was dumped into file \"%s\".\n", p->nCnfVars, p->nCnfClauses, pFileNameIn ); + vValues = Exa4_ManSolve( pFileNameIn, pFileNameOut, TimeOut, fVerbose ); + if ( vValues ) pMini = Exa4_ManMiniAig( p, vValues, fFancy ); + //if ( vValues ) Exa4_ManPrintSolution( p, vValues, fFancy ); + if ( vValues ) Exa_ManMiniPrint( pMini, p->nIns ); + if ( vValues ) Exa_ManMiniVerify( pMini, vSimsIn, vSimsOut ); + Vec_IntFreeP( &vValues ); + Exa4_ManFree( p ); + Abc_PrintTime( 1, "Total runtime", Abc_Clock() - clkTotal ); + return pMini; +} +void Exa_ManExactSynthesis4_( Bmc_EsPar_t * pPars ) +{ + Mini_Aig_t * pMini = NULL; + int i, m; + Vec_Wrd_t * vSimsIn = Vec_WrdStart( 8 ); + Vec_Wrd_t * vSimsOut = Vec_WrdStart( 8 ); + int Truths[2] = { 0x96, 0xE8 }; + for ( m = 0; m < 8; m++ ) + { + int iOutMint = 0; + for ( i = 0; i < 2; i++ ) + if ( (Truths[i] >> m) & 1 ) + iOutMint |= 1 << i; + Abc_TtSetBit( Vec_WrdEntryP(vSimsOut, m), iOutMint ); + for ( i = 0; i < 3; i++ ) + if ( (m >> i) & 1 ) + Abc_TtSetBit( Vec_WrdEntryP(vSimsIn, m), 1+i ); + } + pMini = Exa4_ManGenTest( vSimsIn, vSimsOut, 3, 4, 2, pPars->nNodes, pPars->RuntimeLim, pPars->fOnlyAnd, pPars->fFewerVars, pPars->fOrderNodes, pPars->fUniqFans, pPars->fVerbose ); + if ( pMini ) Mini_AigStop( pMini ); + Vec_WrdFree( vSimsIn ); + Vec_WrdFree( vSimsOut ); +} +void Exa_ManExactSynthesis4( Bmc_EsPar_t * pPars ) +{ + Mini_Aig_t * pMini = NULL; + int i, m, nMints = 1 << pPars->nVars, fCompl = 0; + Vec_Wrd_t * vSimsIn = Vec_WrdStart( nMints ); + Vec_Wrd_t * vSimsOut = Vec_WrdStart( nMints ); + word pTruth[16]; Abc_TtReadHex( pTruth, pPars->pTtStr ); + if ( pTruth[0] & 1 ) { fCompl = 1; Abc_TtNot( pTruth, Abc_TtWordNum(pPars->nVars) ); } + assert( pPars->nVars <= 10 ); + for ( m = 0; m < nMints; m++ ) + { + Abc_TtSetBit( Vec_WrdEntryP(vSimsOut, m), Abc_TtGetBit(pTruth, m) ); + for ( i = 0; i < pPars->nVars; i++ ) + if ( (m >> i) & 1 ) + Abc_TtSetBit( Vec_WrdEntryP(vSimsIn, m), 1+i ); + } + assert( Vec_WrdSize(vSimsIn) == (1 << pPars->nVars) ); + pMini = Exa4_ManGenTest( vSimsIn, vSimsOut, pPars->nVars, 1+pPars->nVars, 1, pPars->nNodes, pPars->RuntimeLim, pPars->fOnlyAnd, pPars->fFewerVars, pPars->fOrderNodes, pPars->fUniqFans, pPars->fVerbose ); + if ( pMini ) Mini_AigStop( pMini ); + if ( fCompl ) printf( "The resulting circuit, if computed, will be complemented.\n" ); + Vec_WrdFree( vSimsIn ); + Vec_WrdFree( vSimsOut ); +} + + + +typedef struct Exa5_Man_t_ Exa5_Man_t; +struct Exa5_Man_t_ +{ + Vec_Wrd_t * vSimsIn; + Vec_Wrd_t * vSimsOut; + int fVerbose; + int nIns; + int nDivs; // divisors (const + inputs + tfi + sidedivs) + int nNodes; + int nOuts; + int nObjs; + int VarMarks[MAJ_NOBJS][MAJ_NOBJS]; + int nCnfVars; + int nCnfClauses; + FILE * pFile; + Vec_Int_t * vFans; +}; + + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Exa5_ManMarkup( Exa5_Man_t * p ) +{ + int i, j, k, nVars[3] = {1 + 3*p->nNodes, 0, p->nNodes*Vec_WrdSize(p->vSimsIn)}; + assert( p->nObjs <= MAJ_NOBJS ); + Vec_IntFill( p->vFans, 1 + 3*p->nNodes, 0 ); + for ( i = p->nDivs; i < p->nDivs + p->nNodes; i++ ) + for ( j = 2; j < i; j++ ) + { + p->VarMarks[i][j] = nVars[0] + nVars[1]; + Vec_IntPush( p->vFans, 0 ); + for ( k = 1; k < j; k++ ) + Vec_IntPush( p->vFans, (i << 16) | (j << 8) | k ); + nVars[1] += j; + } + assert( Vec_IntSize(p->vFans) == nVars[0] + nVars[1] ); + for ( i = p->nDivs + p->nNodes; i < p->nObjs; i++ ) + for ( j = p->nOuts == 1 ? p->nDivs + p->nNodes - 1 : 0; j < p->nDivs + p->nNodes; j++ ) + p->VarMarks[i][j] = nVars[0] + nVars[1]++; + if ( p->fVerbose ) + printf( "Variables: Function = %d. Structure = %d. Internal = %d. Total = %d.\n", + nVars[0], nVars[1], nVars[2], nVars[0] + nVars[1] + nVars[2] ); + if ( 0 ) + { + { + printf( " : " ); + for ( i = p->nDivs; i < p->nDivs + p->nNodes; i++ ) + { + printf( "%3d ", i ); + printf( " " ); + } + printf( " " ); + for ( i = p->nDivs + p->nNodes; i < p->nObjs; i++ ) + { + printf( "%3d ", i ); + printf( " " ); + } + printf( "\n" ); + } + for ( j = 0; j < 5 + p->nNodes*5 + p->nOuts*5; j++ ) + printf( "-" ); + printf( "\n" ); + for ( j = p->nObjs - 2; j >= 0; j-- ) + { + if ( j > 0 && j <= p->nIns ) + printf( " %c : ", 'a'+j-1 ); + else + printf( "%2d : ", j ); + for ( i = p->nDivs; i < p->nDivs + p->nNodes; i++ ) + { + printf( "%3d ", p->VarMarks[i][j] ); + printf( " " ); + } + printf( " " ); + for ( i = p->nDivs + p->nNodes; i < p->nObjs; i++ ) + { + printf( "%3d ", p->VarMarks[i][j] ); + printf( " " ); + } + printf( "\n" ); + } + } + return nVars[0] + nVars[1] + nVars[2]; +} +Exa5_Man_t * Exa5_ManAlloc( Vec_Wrd_t * vSimsIn, Vec_Wrd_t * vSimsOut, int nIns, int nDivs, int nOuts, int nNodes, int fVerbose ) +{ + Exa5_Man_t * p = ABC_CALLOC( Exa5_Man_t, 1 ); + assert( Vec_WrdSize(vSimsIn) == Vec_WrdSize(vSimsOut) ); + p->vSimsIn = vSimsIn; + p->vSimsOut = vSimsOut; + p->fVerbose = fVerbose; + p->nIns = nIns; + p->nDivs = nDivs; + p->nNodes = nNodes; + p->nOuts = nOuts; + p->nObjs = p->nDivs + p->nNodes + p->nOuts; + p->vFans = Vec_IntAlloc( 5000 ); + p->nCnfVars = Exa5_ManMarkup( p ); + return p; +} +void Exa5_ManFree( Exa5_Man_t * p ) +{ + Vec_IntFree( p->vFans ); + ABC_FREE( p ); +} + + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline int Exa5_ManAddClause( Exa5_Man_t * p, int * pLits, int nLits ) +{ + int i, k = 0; + for ( i = 0; i < nLits; i++ ) + if ( pLits[i] == 1 ) + return 0; + else if ( pLits[i] == 0 ) + continue; + else if ( pLits[i] <= 2*p->nCnfVars ) + pLits[k++] = pLits[i]; + else assert( 0 ); + nLits = k; + assert( nLits > 0 ); + if ( p->pFile ) + { + p->nCnfClauses++; + for ( i = 0; i < nLits; i++ ) + fprintf( p->pFile, "%s%d ", Abc_LitIsCompl(pLits[i]) ? "-" : "", Abc_Lit2Var(pLits[i]) ); + fprintf( p->pFile, "0\n" ); + } + if ( 0 ) + { + for ( i = 0; i < nLits; i++ ) + fprintf( stdout, "%s%d ", Abc_LitIsCompl(pLits[i]) ? "-" : "", Abc_Lit2Var(pLits[i]) ); + fprintf( stdout, "\n" ); + } + return 1; +} +static inline int Exa5_ManAddClause4( Exa5_Man_t * p, int Lit0, int Lit1, int Lit2, int Lit3, int Lit4 ) +{ + int pLits[5] = { Lit0, Lit1, Lit2, Lit3, Lit4 }; + return Exa5_ManAddClause( p, pLits, 5 ); +} +static inline void Exa5_ManAddOneHot( Exa5_Man_t * p, int * pLits, int nLits ) +{ + int n, m; + for ( n = 0; n < nLits; n++ ) + for ( m = n+1; m < nLits; m++ ) + Exa5_ManAddClause4( p, Abc_LitNot(pLits[n]), Abc_LitNot(pLits[m]), 0, 0, 0 ); +} +static inline void Exa5_ManAddGroup( Exa5_Man_t * p, int iVar, int nVars ) +{ + int i, pLits[MAJ_NOBJS]; + assert( nVars+1 <= MAJ_NOBJS ); + pLits[0] = Abc_Var2Lit( iVar, 1 ); + for ( i = 1; i <= nVars; i++ ) + pLits[i] = Abc_Var2Lit( iVar+i, 0 ); + Exa5_ManAddClause( p, pLits, nVars+1 ); + Exa5_ManAddOneHot( p, pLits+1, nVars ); + for ( i = 1; i <= nVars; i++ ) + Exa5_ManAddClause4( p, Abc_LitNot(pLits[0]), Abc_LitNot(pLits[i]), 0, 0, 0 ); +} +int Exa5_ManGenStart( Exa5_Man_t * p, int fOnlyAnd, int fFancy, int fOrderNodes, int fUniqFans ) +{ + Vec_Int_t * vArray = Vec_IntAlloc( 100 ); + int pLits[MAJ_NOBJS], i, j, k, n, m, nLits, iObj; + for ( i = p->nDivs; i < p->nDivs + p->nNodes; i++ ) + { + int iVarStart = 1 + 3*(i - p->nDivs);// + nLits = 0; + for ( j = 0; j < i; j++ ) if ( p->VarMarks[i][j] ) + Exa5_ManAddGroup( p, p->VarMarks[i][j], j-1 ), pLits[nLits++] = Abc_Var2Lit(p->VarMarks[i][j], 0); + Exa5_ManAddClause( p, pLits, nLits ); + Exa5_ManAddOneHot( p, pLits, nLits ); + if ( fOrderNodes ) + for ( j = p->nDivs; j < i; j++ ) + for ( n = 0; n < p->nObjs; n++ ) if ( p->VarMarks[i][n] ) + for ( m = n+1; m < p->nObjs; m++ ) if ( p->VarMarks[j][m] ) + Exa5_ManAddClause4( p, Abc_Var2Lit(p->VarMarks[i][n], 1), Abc_Var2Lit(p->VarMarks[j][m], 1), 0, 0, 0 ); + for ( j = p->nDivs; j < i; j++ ) if ( p->VarMarks[i][j] ) + { + // go through all variables of i that point to j and k + for ( n = 1; n < j; n++ ) + { + int iVar = p->VarMarks[i][j] + n; // variable of i pointing to j + int iObj = Vec_IntEntry( p->vFans, iVar ); + int iNode0 = (iObj >> 0) & 0xFF; + int iNode1 = (iObj >> 8) & 0xFF; + int iNode2 = (iObj >> 16) & 0xFF; + assert( iObj > 0 ); + assert( iNode1 == j ); + assert( iNode2 == i ); + // go through all variables of j and block those that point to k + assert( p->VarMarks[j][2] > 0 ); + assert( p->VarMarks[j+1][2] > 0 ); + for ( m = p->VarMarks[j][2]+1; m < p->VarMarks[j+1][2]; m++ ) + { + int jObj = Vec_IntEntry( p->vFans, m ); + int jNode0 = (jObj >> 0) & 0xFF; + int jNode1 = (jObj >> 8) & 0xFF; + int jNode2 = (jObj >> 16) & 0xFF; + if ( jObj == 0 ) + continue; + assert( jNode2 == j ); + if ( iNode0 == jNode0 || iNode0 == jNode1 ) + Exa5_ManAddClause4( p, Abc_Var2Lit(iVar, 1), Abc_Var2Lit(m, 1), 0, 0, 0 ); + } + } + } + for ( k = 0; k < 3; k++ ) + Exa5_ManAddClause4( p, Abc_Var2Lit(iVarStart, k==1), Abc_Var2Lit(iVarStart+1, k==2), Abc_Var2Lit(iVarStart+2, k!=0), 0, 0); + if ( fOnlyAnd ) + Exa5_ManAddClause4( p, Abc_Var2Lit(iVarStart, 1), Abc_Var2Lit(iVarStart+1, 1), Abc_Var2Lit(iVarStart+2, 0), 0, 0); + } + for ( i = p->nDivs; i < p->nDivs + p->nNodes; i++ ) + { + Vec_IntClear( vArray ); + Vec_IntForEachEntry( p->vFans, iObj, k ) + if ( iObj && ((iObj & 0xFF) == i || ((iObj >> 8) & 0xFF) == i) ) + Vec_IntPush( vArray, Abc_Var2Lit(k, 0) ); + for ( k = p->nDivs + p->nNodes; k < p->nObjs; k++ ) if ( p->VarMarks[k][i] ) + Vec_IntPush( vArray, Abc_Var2Lit(p->VarMarks[k][i], 0) ); + Exa5_ManAddClause( p, Vec_IntArray(vArray), Vec_IntSize(vArray) ); + if ( fUniqFans ) + Exa5_ManAddOneHot( p, Vec_IntArray(vArray), Vec_IntSize(vArray) ); + } + Vec_IntFree( vArray ); + for ( i = p->nDivs + p->nNodes; i < p->nObjs; i++ ) + { + nLits = 0; + for ( j = 0; j < p->nDivs + p->nNodes; j++ ) if ( p->VarMarks[i][j] ) + pLits[nLits++] = Abc_Var2Lit( p->VarMarks[i][j], 0 ); + Exa5_ManAddClause( p, pLits, nLits ); + Exa5_ManAddOneHot( p, pLits, nLits ); + } + return 1; +} +void Exa5_ManGenMint( Exa5_Man_t * p, int iMint, int fOnlyAnd, int fFancy ) +{ + int iNodeVar = p->nCnfVars + p->nNodes*(iMint - Vec_WrdSize(p->vSimsIn)); + int iOutMint = Abc_Tt6FirstBit( Vec_WrdEntry(p->vSimsOut, iMint) ); + int i, k, n, j, VarVals[MAJ_NOBJS], iNodes[3], iVarStart, iObj; + assert( p->nObjs <= MAJ_NOBJS ); + assert( iMint < Vec_WrdSize(p->vSimsIn) ); + for ( i = 0; i < p->nDivs; i++ ) + VarVals[i] = (Vec_WrdEntry(p->vSimsIn, iMint) >> i) & 1; + for ( i = 0; i < p->nNodes; i++ ) + VarVals[p->nDivs + i] = Abc_Var2Lit(iNodeVar + i, 0); + for ( i = 0; i < p->nOuts; i++ ) + VarVals[p->nDivs + p->nNodes + i] = (iOutMint >> i) & 1; + if ( 0 ) + { + printf( "Adding minterm %d: ", iMint ); + for ( i = 0; i < p->nObjs; i++ ) + printf( " %d=%d", i, VarVals[i] ); + printf( "\n" ); + } + Vec_IntForEachEntry( p->vFans, iObj, i ) + { + if ( iObj == 0 ) continue; + iNodes[1] = (iObj >> 0) & 0xFF; + iNodes[0] = (iObj >> 8) & 0xFF; + iNodes[2] = (iObj >> 16) & 0xFF; + iVarStart = 1 + 3*(iNodes[2] - p->nDivs);// + for ( k = 0; k < 4; k++ ) + for ( n = 0; n < 2; n++ ) + Exa5_ManAddClause4( p, Abc_Var2Lit(i, 1), Abc_LitNotCond(VarVals[iNodes[0]], k&1), Abc_LitNotCond(VarVals[iNodes[1]], k>>1), Abc_LitNotCond(VarVals[iNodes[2]], !n), Abc_Var2Lit(k ? iVarStart + k-1 : 0, n)); + } + for ( i = p->nDivs + p->nNodes; i < p->nObjs; i++ ) + { + for ( j = 0; j < p->nDivs + p->nNodes; j++ ) if ( p->VarMarks[i][j] ) + for ( n = 0; n < 2; n++ ) + Exa5_ManAddClause4( p, Abc_Var2Lit(p->VarMarks[i][j], 1), Abc_LitNotCond(VarVals[j], n), Abc_LitNotCond(VarVals[i], !n), 0, 0); + } +} +void Exa5_ManGenCnf( Exa5_Man_t * p, char * pFileName, int fOnlyAnd, int fFancy, int fOrderNodes, int fUniqFans ) +{ + int m; + assert( p->pFile == NULL ); + p->pFile = fopen( pFileName, "wb" ); + fputs( "p cnf \n", p->pFile ); + Exa5_ManGenStart( p, fOnlyAnd, fFancy, fOrderNodes, fUniqFans ); + for ( m = 1; m < Vec_WrdSize(p->vSimsIn); m++ ) + Exa5_ManGenMint( p, m, fOnlyAnd, fFancy ); + rewind( p->pFile ); + fprintf( p->pFile, "p cnf %d %d", p->nCnfVars, p->nCnfClauses ); + fclose( p->pFile ); +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline int Exa5_ManFindFanin( Exa5_Man_t * p, Vec_Int_t * vValues, int i ) +{ + int j, Count = 0, iVar = -1; + for ( j = 0; j < p->nObjs; j++ ) + if ( p->VarMarks[i][j] && Vec_IntEntry(vValues, p->VarMarks[i][j]) ) + { + iVar = j; + Count++; + } + assert( Count == 1 ); + return iVar; +} +static inline void Exa5_ManPrintFanin( Exa5_Man_t * p, int iNode, int fComp ) +{ + if ( iNode == 0 ) + printf( " %s", fComp ? "const1" : "const0" ); + else if ( iNode > 0 && iNode <= p->nIns ) + printf( " %s%c", fComp ? "~" : "", 'a'+iNode-1 ); + else if ( iNode > p->nIns && iNode < p->nDivs ) + printf( " %s%c", fComp ? "~" : "", 'A'+iNode-p->nIns-1 ); + else + printf( " %s%d", fComp ? "~" : "", iNode ); +} +void Exa5_ManPrintSolution( Exa5_Man_t * p, Vec_Int_t * vValues, int fFancy ) +{ + int Fan0[MAJ_NOBJS] = {0}; + int Fan1[MAJ_NOBJS] = {0}; + int Count[MAJ_NOBJS] = {0}; + int i, k, iObj, iNodes[3]; + printf( "Circuit for %d-var function with %d divisors contains %d two-input gates:\n", p->nIns, p->nDivs, p->nNodes ); + Vec_IntForEachEntry( p->vFans, iObj, i ) + { + if ( iObj == 0 || Vec_IntEntry(vValues, i) == 0 ) + continue; + iNodes[0] = (iObj >> 0) & 0xFF; + iNodes[1] = (iObj >> 8) & 0xFF; + iNodes[2] = (iObj >> 16) & 0xFF; + assert( p->nDivs <= iNodes[2] && iNodes[2] < p->nDivs + p->nNodes ); + Fan0[iNodes[2]] = iNodes[0]; + Fan1[iNodes[2]] = iNodes[1]; + Count[iNodes[2]]++; + } + for ( i = p->nDivs + p->nNodes; i < p->nObjs; i++ ) + { + int iVar = Exa5_ManFindFanin( p, vValues, i ); + printf( "%2d = ", i ); + Exa5_ManPrintFanin( p, iVar, 0 ); + printf( "\n" ); + } + for ( i = p->nDivs + p->nNodes - 1; i >= p->nDivs; i-- ) + { + int iVarStart = 1 + 3*(i - p->nDivs);// + int Val1 = Vec_IntEntry(vValues, iVarStart); + int Val2 = Vec_IntEntry(vValues, iVarStart+1); + int Val3 = Vec_IntEntry(vValues, iVarStart+2); + assert( Count[i] == 1 ); + printf( "%2d = ", i ); + for ( k = 0; k < 2; k++ ) + { + int iNode = k ? Fan1[i] : Fan0[i]; + int fComp = k ? !Val1 && Val2 && !Val3 : Val1 && !Val2 && !Val3; + Exa5_ManPrintFanin( p, iNode, fComp ); + if ( k ) break; + printf( " %c", (Val1 && Val2) ? (Val3 ? '|' : '^') : '&' ); + } + printf( "\n" ); + } +} +Mini_Aig_t * Exa5_ManMiniAig( Exa5_Man_t * p, Vec_Int_t * vValues ) +{ + Mini_Aig_t * pMini = Mini_AigStartSupport( p->nDivs-1, p->nObjs ); + int Compl[MAJ_NOBJS] = {0}; + int Fan0[MAJ_NOBJS] = {0}; + int Fan1[MAJ_NOBJS] = {0}; + int Count[MAJ_NOBJS] = {0}; + int i, k, iObj, iNodes[3]; + Vec_IntForEachEntry( p->vFans, iObj, i ) + { + if ( iObj == 0 || Vec_IntEntry(vValues, i) == 0 ) + continue; + iNodes[0] = (iObj >> 0) & 0xFF; + iNodes[1] = (iObj >> 8) & 0xFF; + iNodes[2] = (iObj >> 16) & 0xFF; + assert( p->nDivs <= iNodes[2] && iNodes[2] < p->nDivs + p->nNodes ); + Fan0[iNodes[2]] = iNodes[0]; + Fan1[iNodes[2]] = iNodes[1]; + Count[iNodes[2]]++; + } + assert( p->nDivs == Mini_AigNodeNum(pMini) ); + for ( i = p->nDivs; i < p->nDivs + p->nNodes; i++ ) + { + int iNodes[2] = {0}; + int iVarStart = 1 + 3*(i - p->nDivs);// + int Val1 = Vec_IntEntry(vValues, iVarStart); + int Val2 = Vec_IntEntry(vValues, iVarStart+1); + int Val3 = Vec_IntEntry(vValues, iVarStart+2); + assert( Count[i] == 1 ); + Compl[i] = Val1 && Val2 && Val3; + for ( k = 0; k < 2; k++ ) + { + int iNode = k ? Fan1[i] : Fan0[i]; + int fComp = k ? !Val1 && Val2 && !Val3 : Val1 && !Val2 && !Val3; + iNodes[k] = Abc_Var2Lit(iNode, fComp ^ Compl[iNode]); + } + if ( Val1 && Val2 ) + { + if ( Val3 ) + Mini_AigOr( pMini, iNodes[0], iNodes[1] ); + else + Mini_AigXorSpecial( pMini, iNodes[0], iNodes[1] ); + } + else + Mini_AigAnd( pMini, iNodes[0], iNodes[1] ); + } + for ( i = p->nDivs + p->nNodes; i < p->nObjs; i++ ) + { + int iVar = Exa5_ManFindFanin( p, vValues, i ); + Mini_AigCreatePo( pMini, Abc_Var2Lit(iVar, Compl[iVar]) ); + } + assert( p->nObjs == Mini_AigNodeNum(pMini) ); + return pMini; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Mini_Aig_t * Exa5_ManGenTest( Vec_Wrd_t * vSimsIn, Vec_Wrd_t * vSimsOut, int nIns, int nDivs, int nOuts, int nNodes, int TimeOut, int fOnlyAnd, int fFancy, int fOrderNodes, int fUniqFans, int fVerbose ) +{ + abctime clkTotal = Abc_Clock(); + Mini_Aig_t * pMini = NULL; + Vec_Int_t * vValues = NULL; + char * pFileNameIn = "_temp_.cnf"; + char * pFileNameOut = "_temp_out.cnf"; + Exa5_Man_t * p = Exa5_ManAlloc( vSimsIn, vSimsOut, nIns, nDivs, nOuts, nNodes, fVerbose ); + Exa_ManIsNormalized( vSimsIn, vSimsOut ); + Exa5_ManGenCnf( p, pFileNameIn, fOnlyAnd, fFancy, fOrderNodes, fUniqFans ); + if ( fVerbose ) + printf( "Timeout = %d. OnlyAnd = %d. Fancy = %d. OrderNodes = %d. UniqueFans = %d. Verbose = %d.\n", TimeOut, fOnlyAnd, fFancy, fOrderNodes, fUniqFans, fVerbose ); + if ( fVerbose ) + printf( "CNF with %d variables and %d clauses was dumped into file \"%s\".\n", p->nCnfVars, p->nCnfClauses, pFileNameIn ); + vValues = Exa4_ManSolve( pFileNameIn, pFileNameOut, TimeOut, fVerbose ); + if ( vValues ) pMini = Exa5_ManMiniAig( p, vValues ); + //if ( vValues ) Exa5_ManPrintSolution( p, vValues, fFancy ); + if ( vValues ) Exa_ManMiniPrint( pMini, p->nIns ); + if ( vValues ) Exa_ManMiniVerify( pMini, vSimsIn, vSimsOut ); + Vec_IntFreeP( &vValues ); + Exa5_ManFree( p ); + Abc_PrintTime( 1, "Total runtime", Abc_Clock() - clkTotal ); + return pMini; +} +void Exa_ManExactSynthesis5( Bmc_EsPar_t * pPars ) +{ + Mini_Aig_t * pMini = NULL; + int i, m, nMints = 1 << pPars->nVars, fCompl = 0; + Vec_Wrd_t * vSimsIn = Vec_WrdStart( nMints ); + Vec_Wrd_t * vSimsOut = Vec_WrdStart( nMints ); + word pTruth[16]; Abc_TtReadHex( pTruth, pPars->pTtStr ); + if ( pTruth[0] & 1 ) { fCompl = 1; Abc_TtNot( pTruth, Abc_TtWordNum(pPars->nVars) ); } + assert( pPars->nVars <= 10 ); + for ( m = 0; m < nMints; m++ ) + { + Abc_TtSetBit( Vec_WrdEntryP(vSimsOut, m), Abc_TtGetBit(pTruth, m) ); + for ( i = 0; i < pPars->nVars; i++ ) + if ( (m >> i) & 1 ) + Abc_TtSetBit( Vec_WrdEntryP(vSimsIn, m), 1+i ); + } + assert( Vec_WrdSize(vSimsIn) == (1 << pPars->nVars) ); + pMini = Exa5_ManGenTest( vSimsIn, vSimsOut, pPars->nVars, 1+pPars->nVars, 1, pPars->nNodes, pPars->RuntimeLim, pPars->fOnlyAnd, pPars->fFewerVars, pPars->fOrderNodes, pPars->fUniqFans, pPars->fVerbose ); + if ( pMini ) Mini_AigStop( pMini ); + if ( fCompl ) printf( "The resulting circuit, if computed, will be complemented.\n" ); + Vec_WrdFree( vSimsIn ); + Vec_WrdFree( vSimsOut ); +} + //////////////////////////////////////////////////////////////////////// /// END OF FILE /// //////////////////////////////////////////////////////////////////////// |