From 24cf8da27eb56a65bf3e4ceb78bbeacdb1864597 Mon Sep 17 00:00:00 2001 From: Aldo Cortesi Date: Wed, 19 Oct 2016 15:25:39 +1300 Subject: Move all tools into mitmproxy.tools, move models/* to top level The primary motivation here (and for all the other moving around) is to present a clean "front of house" to library users, and to migrate primary objects to the top of the module hierarchy. --- docs/scripting/api.rst | 16 +- examples/flowwriter.py | 2 +- examples/redirect_requests.py | 4 +- mitmproxy/addons/clientplayback.py | 1 - mitmproxy/addons/filestreamer.py | 2 +- mitmproxy/addons/state.py | 4 +- mitmproxy/cmdline.py | 897 - mitmproxy/connections.py | 221 + mitmproxy/console/__init__.py | 4 - mitmproxy/console/common.py | 461 - mitmproxy/console/flowdetailview.py | 159 - mitmproxy/console/flowlist.py | 382 - mitmproxy/console/flowview.py | 701 - mitmproxy/console/grideditor/__init__.py | 2 - mitmproxy/console/grideditor/base.py | 413 - mitmproxy/console/grideditor/col_bytes.py | 98 - mitmproxy/console/grideditor/col_subgrid.py | 50 - mitmproxy/console/grideditor/col_text.py | 54 - mitmproxy/console/grideditor/editors.py | 241 - mitmproxy/console/help.py | 97 - mitmproxy/console/master.py | 702 - mitmproxy/console/options.py | 255 - mitmproxy/console/palettepicker.py | 85 - mitmproxy/console/palettes.py | 330 - mitmproxy/console/pathedit.py | 71 - mitmproxy/console/searchable.py | 93 - mitmproxy/console/select.py | 121 - mitmproxy/console/signals.py | 44 - mitmproxy/console/statusbar.py | 262 - mitmproxy/console/tabs.py | 70 - mitmproxy/console/window.py | 111 - mitmproxy/dump.py | 84 - mitmproxy/events.py | 7 +- mitmproxy/flow.py | 190 + mitmproxy/flowfilter.py | 56 +- mitmproxy/http.py | 262 + mitmproxy/io.py | 13 +- mitmproxy/main.py | 142 - mitmproxy/master.py | 17 +- mitmproxy/models/__init__.py | 23 - mitmproxy/models/connections.py | 221 - mitmproxy/models/flow.py | 191 - mitmproxy/models/http.py | 262 - mitmproxy/models/tcp.py | 53 - mitmproxy/protocol/base.py | 12 +- mitmproxy/protocol/http.py | 151 +- mitmproxy/protocol/http1.py | 12 +- mitmproxy/protocol/http2.py | 12 +- mitmproxy/protocol/http_replay.py | 70 +- mitmproxy/protocol/rawtcp.py | 18 +- mitmproxy/protocol/tls.py | 4 +- mitmproxy/proxy/root_context.py | 2 +- mitmproxy/proxy/server.py | 7 +- mitmproxy/tcp.py | 53 + mitmproxy/tools/__init__.py | 0 mitmproxy/tools/cmdline.py | 897 + mitmproxy/tools/console/__init__.py | 4 + mitmproxy/tools/console/common.py | 461 + mitmproxy/tools/console/flowdetailview.py | 159 + mitmproxy/tools/console/flowlist.py | 382 + mitmproxy/tools/console/flowview.py | 701 + mitmproxy/tools/console/grideditor/__init__.py | 2 + mitmproxy/tools/console/grideditor/base.py | 413 + mitmproxy/tools/console/grideditor/col_bytes.py | 98 + mitmproxy/tools/console/grideditor/col_subgrid.py | 50 + mitmproxy/tools/console/grideditor/col_text.py | 54 + mitmproxy/tools/console/grideditor/editors.py | 241 + mitmproxy/tools/console/help.py | 97 + mitmproxy/tools/console/master.py | 702 + mitmproxy/tools/console/options.py | 255 + mitmproxy/tools/console/palettepicker.py | 85 + mitmproxy/tools/console/palettes.py | 330 + mitmproxy/tools/console/pathedit.py | 71 + mitmproxy/tools/console/searchable.py | 93 + mitmproxy/tools/console/select.py | 121 + mitmproxy/tools/console/signals.py | 44 + mitmproxy/tools/console/statusbar.py | 262 + mitmproxy/tools/console/tabs.py | 70 + mitmproxy/tools/console/window.py | 111 + mitmproxy/tools/dump.py | 84 + mitmproxy/tools/main.py | 142 + mitmproxy/tools/web/__init__.py | 2 + mitmproxy/tools/web/app.py | 458 + mitmproxy/tools/web/master.py | 203 + mitmproxy/tools/web/static/app.css | 2 + mitmproxy/tools/web/static/app.js | 9246 ++++ .../tools/web/static/fonts/fontawesome-webfont.eot | Bin 0 -> 56006 bytes .../tools/web/static/fonts/fontawesome-webfont.svg | 520 + .../tools/web/static/fonts/fontawesome-webfont.ttf | Bin 0 -> 112160 bytes .../web/static/fonts/fontawesome-webfont.woff | Bin 0 -> 65452 bytes .../web/static/images/chrome-devtools/LICENSE | 30 + .../images/chrome-devtools/resourceCSSIcon.png | Bin 0 -> 1005 bytes .../chrome-devtools/resourceDocumentIcon.png | Bin 0 -> 951 bytes .../images/chrome-devtools/resourceJSIcon.png | Bin 0 -> 787 bytes .../images/chrome-devtools/resourcePlainIcon.png | Bin 0 -> 295 bytes mitmproxy/tools/web/static/images/favicon.ico | Bin 0 -> 365133 bytes .../web/static/images/resourceExecutableIcon.png | Bin 0 -> 853 bytes .../tools/web/static/images/resourceFlashIcon.png | Bin 0 -> 921 bytes .../tools/web/static/images/resourceImageIcon.png | Bin 0 -> 976 bytes .../tools/web/static/images/resourceJavaIcon.png | Bin 0 -> 861 bytes .../web/static/images/resourceNotModifiedIcon.png | Bin 0 -> 1072 bytes .../web/static/images/resourceRedirectIcon.png | Bin 0 -> 1174 bytes mitmproxy/tools/web/static/vendor.css | 8397 +++ mitmproxy/tools/web/static/vendor.js | 51995 +++++++++++++++++++ mitmproxy/tools/web/templates/index.html | 16 + mitmproxy/web/__init__.py | 2 - mitmproxy/web/app.py | 457 - mitmproxy/web/master.py | 203 - mitmproxy/web/static/app.css | 2 - mitmproxy/web/static/app.js | 9246 ---- mitmproxy/web/static/fonts/fontawesome-webfont.eot | Bin 56006 -> 0 bytes mitmproxy/web/static/fonts/fontawesome-webfont.svg | 520 - mitmproxy/web/static/fonts/fontawesome-webfont.ttf | Bin 112160 -> 0 bytes .../web/static/fonts/fontawesome-webfont.woff | Bin 65452 -> 0 bytes .../web/static/images/chrome-devtools/LICENSE | 30 - .../images/chrome-devtools/resourceCSSIcon.png | Bin 1005 -> 0 bytes .../chrome-devtools/resourceDocumentIcon.png | Bin 951 -> 0 bytes .../images/chrome-devtools/resourceJSIcon.png | Bin 787 -> 0 bytes .../images/chrome-devtools/resourcePlainIcon.png | Bin 295 -> 0 bytes mitmproxy/web/static/images/favicon.ico | Bin 365133 -> 0 bytes .../web/static/images/resourceExecutableIcon.png | Bin 853 -> 0 bytes mitmproxy/web/static/images/resourceFlashIcon.png | Bin 921 -> 0 bytes mitmproxy/web/static/images/resourceImageIcon.png | Bin 976 -> 0 bytes mitmproxy/web/static/images/resourceJavaIcon.png | Bin 861 -> 0 bytes .../web/static/images/resourceNotModifiedIcon.png | Bin 1072 -> 0 bytes .../web/static/images/resourceRedirectIcon.png | Bin 1174 -> 0 bytes mitmproxy/web/static/vendor.css | 8397 --- mitmproxy/web/static/vendor.js | 51995 ------------------- mitmproxy/web/templates/index.html | 16 - setup.py | 6 +- test/mitmproxy/addons/test_dumper.py | 6 +- test/mitmproxy/addons/test_termlog.py | 2 +- test/mitmproxy/console/test_common.py | 2 +- test/mitmproxy/console/test_help.py | 2 +- test/mitmproxy/console/test_master.py | 4 +- test/mitmproxy/console/test_palettes.py | 2 +- test/mitmproxy/console/test_pathedit.py | 2 +- test/mitmproxy/mastertest.py | 7 +- test/mitmproxy/test_cmdline.py | 2 +- test/mitmproxy/test_dump.py | 4 +- test/mitmproxy/test_flow.py | 59 +- test/mitmproxy/test_proxy.py | 8 +- test/mitmproxy/test_server.py | 19 +- test/mitmproxy/test_utils.py | 2 +- test/mitmproxy/test_web_app.py | 4 +- test/mitmproxy/test_web_master.py | 2 +- test/mitmproxy/tutils.py | 29 +- 147 files changed, 77823 insertions(+), 77820 deletions(-) delete mode 100644 mitmproxy/cmdline.py create mode 100644 mitmproxy/connections.py delete mode 100644 mitmproxy/console/__init__.py delete mode 100644 mitmproxy/console/common.py delete mode 100644 mitmproxy/console/flowdetailview.py delete mode 100644 mitmproxy/console/flowlist.py delete mode 100644 mitmproxy/console/flowview.py delete mode 100644 mitmproxy/console/grideditor/__init__.py delete mode 100644 mitmproxy/console/grideditor/base.py delete mode 100644 mitmproxy/console/grideditor/col_bytes.py delete mode 100644 mitmproxy/console/grideditor/col_subgrid.py delete mode 100644 mitmproxy/console/grideditor/col_text.py delete mode 100644 mitmproxy/console/grideditor/editors.py delete mode 100644 mitmproxy/console/help.py delete mode 100644 mitmproxy/console/master.py delete mode 100644 mitmproxy/console/options.py delete mode 100644 mitmproxy/console/palettepicker.py delete mode 100644 mitmproxy/console/palettes.py delete mode 100644 mitmproxy/console/pathedit.py delete mode 100644 mitmproxy/console/searchable.py delete mode 100644 mitmproxy/console/select.py delete mode 100644 mitmproxy/console/signals.py delete mode 100644 mitmproxy/console/statusbar.py delete mode 100644 mitmproxy/console/tabs.py delete mode 100644 mitmproxy/console/window.py delete mode 100644 mitmproxy/dump.py create mode 100644 mitmproxy/flow.py create mode 100644 mitmproxy/http.py delete mode 100644 mitmproxy/main.py delete mode 100644 mitmproxy/models/__init__.py delete mode 100644 mitmproxy/models/connections.py delete mode 100644 mitmproxy/models/flow.py delete mode 100644 mitmproxy/models/http.py delete mode 100644 mitmproxy/models/tcp.py create mode 100644 mitmproxy/tcp.py create mode 100644 mitmproxy/tools/__init__.py create mode 100644 mitmproxy/tools/cmdline.py create mode 100644 mitmproxy/tools/console/__init__.py create mode 100644 mitmproxy/tools/console/common.py create mode 100644 mitmproxy/tools/console/flowdetailview.py create mode 100644 mitmproxy/tools/console/flowlist.py create mode 100644 mitmproxy/tools/console/flowview.py create mode 100644 mitmproxy/tools/console/grideditor/__init__.py create mode 100644 mitmproxy/tools/console/grideditor/base.py create mode 100644 mitmproxy/tools/console/grideditor/col_bytes.py create mode 100644 mitmproxy/tools/console/grideditor/col_subgrid.py create mode 100644 mitmproxy/tools/console/grideditor/col_text.py create mode 100644 mitmproxy/tools/console/grideditor/editors.py create mode 100644 mitmproxy/tools/console/help.py create mode 100644 mitmproxy/tools/console/master.py create mode 100644 mitmproxy/tools/console/options.py create mode 100644 mitmproxy/tools/console/palettepicker.py create mode 100644 mitmproxy/tools/console/palettes.py create mode 100644 mitmproxy/tools/console/pathedit.py create mode 100644 mitmproxy/tools/console/searchable.py create mode 100644 mitmproxy/tools/console/select.py create mode 100644 mitmproxy/tools/console/signals.py create mode 100644 mitmproxy/tools/console/statusbar.py create mode 100644 mitmproxy/tools/console/tabs.py create mode 100644 mitmproxy/tools/console/window.py create mode 100644 mitmproxy/tools/dump.py create mode 100644 mitmproxy/tools/main.py create mode 100644 mitmproxy/tools/web/__init__.py create mode 100644 mitmproxy/tools/web/app.py create mode 100644 mitmproxy/tools/web/master.py create mode 100644 mitmproxy/tools/web/static/app.css create mode 100644 mitmproxy/tools/web/static/app.js create mode 100644 mitmproxy/tools/web/static/fonts/fontawesome-webfont.eot create mode 100644 mitmproxy/tools/web/static/fonts/fontawesome-webfont.svg create mode 100644 mitmproxy/tools/web/static/fonts/fontawesome-webfont.ttf create mode 100644 mitmproxy/tools/web/static/fonts/fontawesome-webfont.woff create mode 100644 mitmproxy/tools/web/static/images/chrome-devtools/LICENSE create mode 100644 mitmproxy/tools/web/static/images/chrome-devtools/resourceCSSIcon.png create mode 100644 mitmproxy/tools/web/static/images/chrome-devtools/resourceDocumentIcon.png create mode 100644 mitmproxy/tools/web/static/images/chrome-devtools/resourceJSIcon.png create mode 100644 mitmproxy/tools/web/static/images/chrome-devtools/resourcePlainIcon.png create mode 100644 mitmproxy/tools/web/static/images/favicon.ico create mode 100644 mitmproxy/tools/web/static/images/resourceExecutableIcon.png create mode 100644 mitmproxy/tools/web/static/images/resourceFlashIcon.png create mode 100644 mitmproxy/tools/web/static/images/resourceImageIcon.png create mode 100644 mitmproxy/tools/web/static/images/resourceJavaIcon.png create mode 100644 mitmproxy/tools/web/static/images/resourceNotModifiedIcon.png create mode 100644 mitmproxy/tools/web/static/images/resourceRedirectIcon.png create mode 100644 mitmproxy/tools/web/static/vendor.css create mode 100644 mitmproxy/tools/web/static/vendor.js create mode 100644 mitmproxy/tools/web/templates/index.html delete mode 100644 mitmproxy/web/__init__.py delete mode 100644 mitmproxy/web/app.py delete mode 100644 mitmproxy/web/master.py delete mode 100644 mitmproxy/web/static/app.css delete mode 100644 mitmproxy/web/static/app.js delete mode 100644 mitmproxy/web/static/fonts/fontawesome-webfont.eot delete mode 100644 mitmproxy/web/static/fonts/fontawesome-webfont.svg delete mode 100644 mitmproxy/web/static/fonts/fontawesome-webfont.ttf delete mode 100644 mitmproxy/web/static/fonts/fontawesome-webfont.woff delete mode 100644 mitmproxy/web/static/images/chrome-devtools/LICENSE delete mode 100644 mitmproxy/web/static/images/chrome-devtools/resourceCSSIcon.png delete mode 100644 mitmproxy/web/static/images/chrome-devtools/resourceDocumentIcon.png delete mode 100644 mitmproxy/web/static/images/chrome-devtools/resourceJSIcon.png delete mode 100644 mitmproxy/web/static/images/chrome-devtools/resourcePlainIcon.png delete mode 100644 mitmproxy/web/static/images/favicon.ico delete mode 100644 mitmproxy/web/static/images/resourceExecutableIcon.png delete mode 100644 mitmproxy/web/static/images/resourceFlashIcon.png delete mode 100644 mitmproxy/web/static/images/resourceImageIcon.png delete mode 100644 mitmproxy/web/static/images/resourceJavaIcon.png delete mode 100644 mitmproxy/web/static/images/resourceNotModifiedIcon.png delete mode 100644 mitmproxy/web/static/images/resourceRedirectIcon.png delete mode 100644 mitmproxy/web/static/vendor.css delete mode 100644 mitmproxy/web/static/vendor.js delete mode 100644 mitmproxy/web/templates/index.html diff --git a/docs/scripting/api.rst b/docs/scripting/api.rst index 59ef8d95..e82afef4 100644 --- a/docs/scripting/api.rst +++ b/docs/scripting/api.rst @@ -5,11 +5,11 @@ API === - Errors - - `mitmproxy.models.flow.Error <#mitmproxy.models.flow.Error>`_ + - `mitmproxy.flow.Error <#mitmproxy.flow.Error>`_ - HTTP - - `mitmproxy.models.http.HTTPRequest <#mitmproxy.models.http.HTTPRequest>`_ - - `mitmproxy.models.http.HTTPResponse <#mitmproxy.models.http.HTTPResponse>`_ - - `mitmproxy.models.http.HTTPFlow <#mitmproxy.models.http.HTTPFlow>`_ + - `mitmproxy.http.HTTPRequest <#mitmproxy.http.HTTPRequest>`_ + - `mitmproxy.http.HTTPResponse <#mitmproxy.http.HTTPResponse>`_ + - `mitmproxy.http.HTTPFlow <#mitmproxy.http.HTTPFlow>`_ - Logging - `mitmproxy.log.Log <#mitmproxy.controller.Log>`_ - `mitmproxy.log.LogEntry <#mitmproxy.controller.LogEntry>`_ @@ -18,19 +18,19 @@ API Errors ------ -.. autoclass:: mitmproxy.models.flow.Error +.. autoclass:: mitmproxy.flow.Error :inherited-members: HTTP ---- -.. autoclass:: mitmproxy.models.http.HTTPRequest +.. autoclass:: mitmproxy.http.HTTPRequest :inherited-members: -.. autoclass:: mitmproxy.models.http.HTTPResponse +.. autoclass:: mitmproxy.http.HTTPResponse :inherited-members: -.. autoclass:: mitmproxy.models.http.HTTPFlow +.. autoclass:: mitmproxy.http.HTTPFlow :inherited-members: Logging diff --git a/examples/flowwriter.py b/examples/flowwriter.py index afce85aa..a9768542 100644 --- a/examples/flowwriter.py +++ b/examples/flowwriter.py @@ -1,6 +1,6 @@ import random import sys -from mimtproxy import io +from mitmproxy import io class Writer: diff --git a/examples/redirect_requests.py b/examples/redirect_requests.py index bbb84e2f..c28042db 100644 --- a/examples/redirect_requests.py +++ b/examples/redirect_requests.py @@ -1,7 +1,7 @@ """ This example shows two ways to redirect flows to other destinations. """ -from mitmproxy.models import HTTPResponse +from mitmproxy import http def request(flow): @@ -11,7 +11,7 @@ def request(flow): # Method 1: Answer with a locally generated response if flow.request.pretty_host.endswith("example.com"): - flow.response = HTTPResponse.make(200, b"Hello World", {"Content-Type": "text/html"}) + flow.response = http.HTTPResponse.make(200, b"Hello World", {"Content-Type": "text/html"}) # Method 2: Redirect the request to a different server if flow.request.pretty_host.endswith("example.org"): diff --git a/mitmproxy/addons/clientplayback.py b/mitmproxy/addons/clientplayback.py index 848d07c3..7f2b53ac 100644 --- a/mitmproxy/addons/clientplayback.py +++ b/mitmproxy/addons/clientplayback.py @@ -3,7 +3,6 @@ from mitmproxy import ctx from mitmproxy import io - class ClientPlayback: def __init__(self): self.flows = None diff --git a/mitmproxy/addons/filestreamer.py b/mitmproxy/addons/filestreamer.py index 552d936f..031b44ab 100644 --- a/mitmproxy/addons/filestreamer.py +++ b/mitmproxy/addons/filestreamer.py @@ -8,7 +8,7 @@ from mitmproxy import io class FileStreamer: def __init__(self): self.stream = None - self.active_flows = set() # type: Set[models.Flow] + self.active_flows = set() # type: Set[flow.Flow] def start_stream_to_path(self, path, mode, flt): path = os.path.expanduser(path) diff --git a/mitmproxy/addons/state.py b/mitmproxy/addons/state.py index bb7460b6..ae7338cc 100644 --- a/mitmproxy/addons/state.py +++ b/mitmproxy/addons/state.py @@ -3,12 +3,12 @@ from abc import abstractmethod, ABCMeta from typing import List # noqa from mitmproxy import flowfilter -from mitmproxy import models # noqa +from mitmproxy import flow # noqa class FlowList(metaclass=ABCMeta): def __init__(self): - self._list = [] # type: List[models.Flow] + self._list = [] # type: List[flow.Flow] def __iter__(self): return iter(self._list) diff --git a/mitmproxy/cmdline.py b/mitmproxy/cmdline.py deleted file mode 100644 index df0b0a2f..00000000 --- a/mitmproxy/cmdline.py +++ /dev/null @@ -1,897 +0,0 @@ -import configargparse -import os -import re -from mitmproxy import exceptions -from mitmproxy import flowfilter -from mitmproxy import options -from mitmproxy import platform -from netlib import human -from netlib import tcp -from netlib import version - - -class ParseException(Exception): - pass - - -def _parse_hook(s): - sep, rem = s[0], s[1:] - parts = rem.split(sep, 2) - if len(parts) == 2: - patt = ".*" - a, b = parts - elif len(parts) == 3: - patt, a, b = parts - else: - raise ParseException( - "Malformed hook specifier - too few clauses: %s" % s - ) - - if not a: - raise ParseException("Empty clause: %s" % str(patt)) - - if not flowfilter.parse(patt): - raise ParseException("Malformed filter pattern: %s" % patt) - - return patt, a, b - - -def parse_replace_hook(s): - """ - Returns a (pattern, regex, replacement) tuple. - - The general form for a replacement hook is as follows: - - /patt/regex/replacement - - The first character specifies the separator. Example: - - :~q:foo:bar - - If only two clauses are specified, the pattern is set to match - universally (i.e. ".*"). Example: - - /foo/bar/ - - Clauses are parsed from left to right. Extra separators are taken to be - part of the final clause. For instance, the replacement clause below is - "foo/bar/": - - /one/two/foo/bar/ - - Checks that pattern and regex are both well-formed. Raises - ParseException on error. - """ - patt, regex, replacement = _parse_hook(s) - try: - re.compile(regex) - except re.error as e: - raise ParseException("Malformed replacement regex: %s" % str(e)) - return patt, regex, replacement - - -def parse_setheader(s): - """ - Returns a (pattern, header, value) tuple. - - The general form for a replacement hook is as follows: - - /patt/header/value - - The first character specifies the separator. Example: - - :~q:foo:bar - - If only two clauses are specified, the pattern is set to match - universally (i.e. ".*"). Example: - - /foo/bar/ - - Clauses are parsed from left to right. Extra separators are taken to be - part of the final clause. For instance, the value clause below is - "foo/bar/": - - /one/two/foo/bar/ - - Checks that pattern and regex are both well-formed. Raises - ParseException on error. - """ - return _parse_hook(s) - - -def get_common_options(args): - stickycookie, stickyauth = None, None - if args.stickycookie_filt: - stickycookie = args.stickycookie_filt - - if args.stickyauth_filt: - stickyauth = args.stickyauth_filt - - stream_large_bodies = args.stream_large_bodies - if stream_large_bodies: - stream_large_bodies = human.parse_size(stream_large_bodies) - - reps = [] - for i in args.replace: - try: - p = parse_replace_hook(i) - except ParseException as e: - raise exceptions.OptionsError(e) - reps.append(p) - for i in args.replace_file: - try: - patt, rex, path = parse_replace_hook(i) - except ParseException as e: - raise exceptions.OptionsError(e) - try: - v = open(path, "rb").read() - except IOError as e: - raise exceptions.OptionsError( - "Could not read replace file: %s" % path - ) - reps.append((patt, rex, v)) - - setheaders = [] - for i in args.setheader: - try: - p = parse_setheader(i) - except ParseException as e: - raise exceptions.OptionsError(e) - setheaders.append(p) - - if args.outfile and args.outfile[0] == args.rfile: - if args.outfile[1] == "wb": - raise exceptions.OptionsError( - "Cannot use '{}' for both reading and writing flows. " - "Are you looking for --afile?".format(args.rfile) - ) - else: - raise exceptions.OptionsError( - "Cannot use '{}' for both reading and appending flows. " - "That would trigger an infinite loop." - ) - - # Proxy config - certs = [] - for i in args.certs: - parts = i.split("=", 1) - if len(parts) == 1: - parts = ["*", parts[0]] - certs.append(parts) - - body_size_limit = args.body_size_limit - if body_size_limit: - try: - body_size_limit = human.parse_size(body_size_limit) - except ValueError as e: - raise exceptions.OptionsError( - "Invalid body size limit specification: %s" % body_size_limit - ) - - # Establish proxy mode - c = 0 - mode, upstream_server = "regular", None - if args.transparent_proxy: - c += 1 - if not platform.resolver: - raise exceptions.OptionsError( - "Transparent mode not supported on this platform." - ) - mode = "transparent" - if args.socks_proxy: - c += 1 - mode = "socks5" - if args.reverse_proxy: - c += 1 - mode = "reverse" - upstream_server = args.reverse_proxy - if args.upstream_proxy: - c += 1 - mode = "upstream" - upstream_server = args.upstream_proxy - if c > 1: - raise exceptions.OptionsError( - "Transparent, SOCKS5, reverse and upstream proxy mode " - "are mutually exclusive. Read the docs on proxy modes " - "to understand why." - ) - if args.add_upstream_certs_to_client_chain and args.no_upstream_cert: - raise exceptions.OptionsError( - "The no-upstream-cert and add-upstream-certs-to-client-chain " - "options are mutually exclusive. If no-upstream-cert is enabled " - "then the upstream certificate is not retrieved before generating " - "the client certificate chain." - ) - - if args.quiet: - args.verbose = 0 - - return dict( - app=args.app, - app_host=args.app_host, - app_port=args.app_port, - - anticache=args.anticache, - anticomp=args.anticomp, - client_replay=args.client_replay, - replay_kill_extra=args.replay_kill_extra, - no_server=args.no_server, - refresh_server_playback=not args.norefresh, - server_replay_use_headers=args.server_replay_use_headers, - rfile=args.rfile, - replacements=reps, - setheaders=setheaders, - server_replay=args.server_replay, - scripts=args.scripts, - stickycookie=stickycookie, - stickyauth=stickyauth, - stream_large_bodies=stream_large_bodies, - showhost=args.showhost, - outfile=args.outfile, - verbosity=args.verbose, - server_replay_nopop=args.server_replay_nopop, - server_replay_ignore_content=args.server_replay_ignore_content, - server_replay_ignore_params=args.server_replay_ignore_params, - server_replay_ignore_payload_params=args.server_replay_ignore_payload_params, - server_replay_ignore_host=args.server_replay_ignore_host, - - auth_nonanonymous = args.auth_nonanonymous, - auth_singleuser = args.auth_singleuser, - auth_htpasswd = args.auth_htpasswd, - add_upstream_certs_to_client_chain = args.add_upstream_certs_to_client_chain, - body_size_limit = body_size_limit, - cadir = args.cadir, - certs = certs, - ciphers_client = args.ciphers_client, - ciphers_server = args.ciphers_server, - clientcerts = args.clientcerts, - http2 = args.http2, - ignore_hosts = args.ignore_hosts, - listen_host = args.addr, - listen_port = args.port, - mode = mode, - no_upstream_cert = args.no_upstream_cert, - spoof_source_address = args.spoof_source_address, - rawtcp = args.rawtcp, - websockets = args.websockets, - upstream_server = upstream_server, - upstream_auth = args.upstream_auth, - ssl_version_client = args.ssl_version_client, - ssl_version_server = args.ssl_version_server, - ssl_insecure = args.ssl_insecure, - ssl_verify_upstream_trusted_cadir = args.ssl_verify_upstream_trusted_cadir, - ssl_verify_upstream_trusted_ca = args.ssl_verify_upstream_trusted_ca, - tcp_hosts = args.tcp_hosts, - ) - - -def basic_options(parser): - parser.add_argument( - '--version', - action='version', - version="%(prog)s" + " " + version.VERSION - ) - parser.add_argument( - '--sysinfo', - action='store_true', - dest='sysinfo', - ) - parser.add_argument( - '--shortversion', - action='version', - help="show program's short version number and exit", - version=version.VERSION - ) - parser.add_argument( - "--anticache", - action="store_true", dest="anticache", default=False, - - help=""" - Strip out request headers that might cause the server to return - 304-not-modified. - """ - ) - parser.add_argument( - "--cadir", - action="store", type=str, dest="cadir", default=options.CA_DIR, - help="Location of the default mitmproxy CA files. (%s)" % options.CA_DIR - ) - parser.add_argument( - "--host", - action="store_true", dest="showhost", default=False, - help="Use the Host header to construct URLs for display." - ) - parser.add_argument( - "-q", "--quiet", - action="store_true", dest="quiet", - help="Quiet." - ) - parser.add_argument( - "-r", "--read-flows", - action="store", dest="rfile", default=None, - help="Read flows from file." - ) - parser.add_argument( - "-s", "--script", - action="append", type=str, dest="scripts", default=[], - metavar='"script.py --bar"', - help=""" - Run a script. Surround with quotes to pass script arguments. Can be - passed multiple times. - """ - ) - parser.add_argument( - "-t", "--stickycookie", - action="store", - dest="stickycookie_filt", - default=None, - metavar="FILTER", - help="Set sticky cookie filter. Matched against requests." - ) - parser.add_argument( - "-u", "--stickyauth", - action="store", dest="stickyauth_filt", default=None, metavar="FILTER", - help="Set sticky auth filter. Matched against requests." - ) - parser.add_argument( - "-v", "--verbose", - action="store_const", dest="verbose", default=2, const=3, - help="Increase log verbosity." - ) - outfile = parser.add_mutually_exclusive_group() - outfile.add_argument( - "-w", "--wfile", - action="store", dest="outfile", type=lambda f: (f, "wb"), - help="Write flows to file." - ) - outfile.add_argument( - "-a", "--afile", - action="store", dest="outfile", type=lambda f: (f, "ab"), - help="Append flows to file." - ) - parser.add_argument( - "-z", "--anticomp", - action="store_true", dest="anticomp", default=False, - help="Try to convince servers to send us un-compressed data." - ) - parser.add_argument( - "-Z", "--body-size-limit", - action="store", dest="body_size_limit", default=None, - metavar="SIZE", - help="Byte size limit of HTTP request and response bodies." - " Understands k/m/g suffixes, i.e. 3m for 3 megabytes." - ) - parser.add_argument( - "--stream", - action="store", dest="stream_large_bodies", default=None, - metavar="SIZE", - help=""" - Stream data to the client if response body exceeds the given - threshold. If streamed, the body will not be stored in any way. - Understands k/m/g suffixes, i.e. 3m for 3 megabytes. - """ - ) - - -def proxy_modes(parser): - group = parser.add_argument_group("Proxy Modes") - group.add_argument( - "-R", "--reverse", - action="store", - type=str, - dest="reverse_proxy", - default=None, - help=""" - Forward all requests to upstream HTTP server: - http[s]://host[:port]. Clients can always connect both - via HTTPS and HTTP, the connection to the server is - determined by the specified scheme. - """ - ) - group.add_argument( - "--socks", - action="store_true", dest="socks_proxy", default=False, - help="Set SOCKS5 proxy mode." - ) - group.add_argument( - "-T", "--transparent", - action="store_true", dest="transparent_proxy", default=False, - help="Set transparent proxy mode." - ) - group.add_argument( - "-U", "--upstream", - action="store", - type=str, - dest="upstream_proxy", - default=None, - help="Forward all requests to upstream proxy server: http://host[:port]" - ) - - -def proxy_options(parser): - group = parser.add_argument_group("Proxy Options") - group.add_argument( - "-b", "--bind-address", - action="store", type=str, dest="addr", default='', - help="Address to bind proxy to (defaults to all interfaces)" - ) - group.add_argument( - "-I", "--ignore", - action="append", type=str, dest="ignore_hosts", default=[], - metavar="HOST", - help=""" - Ignore host and forward all traffic without processing it. In - transparent mode, it is recommended to use an IP address (range), - not the hostname. In regular mode, only SSL traffic is ignored and - the hostname should be used. The supplied value is interpreted as a - regular expression and matched on the ip or the hostname. Can be - passed multiple times. - """ - ) - group.add_argument( - "--tcp", - action="append", type=str, dest="tcp_hosts", default=[], - metavar="HOST", - help=""" - Generic TCP SSL proxy mode for all hosts that match the pattern. - Similar to --ignore, but SSL connections are intercepted. The - communication contents are printed to the log in verbose mode. - """ - ) - group.add_argument( - "-n", "--no-server", - action="store_true", dest="no_server", - help="Don't start a proxy server." - ) - group.add_argument( - "-p", "--port", - action="store", type=int, dest="port", default=options.LISTEN_PORT, - help="Proxy service port." - ) - group.add_argument( - "--no-http2", - action="store_false", dest="http2", - help=""" - Explicitly disable HTTP/2 support. - If your OpenSSL version supports ALPN, HTTP/2 is enabled by default. - """ - ) - parser.add_argument( - "--upstream-auth", - action="store", dest="upstream_auth", default=None, - type=str, - help=""" - Proxy Authentication: - username:password - """ - ) - rawtcp = group.add_mutually_exclusive_group() - rawtcp.add_argument("--raw-tcp", action="store_true", dest="rawtcp") - rawtcp.add_argument("--no-raw-tcp", action="store_false", dest="rawtcp", - help="Explicitly enable/disable experimental raw tcp support. " - "Disabled by default. " - "Default value will change in a future version." - ) - websockets = group.add_mutually_exclusive_group() - websockets.add_argument("--websockets", action="store_true", dest="websockets") - websockets.add_argument("--no-websockets", action="store_false", dest="websockets", - help="Explicitly enable/disable experimental WebSocket support. " - "Disabled by default as messages are only printed to the event log and not retained. " - "Default value will change in a future version." - ) - group.add_argument( - "--spoof-source-address", - action="store_true", dest="spoof_source_address", - help="Use the client's IP for server-side connections" - ) - - -def proxy_ssl_options(parser): - # TODO: Agree to consistently either use "upstream" or "server". - group = parser.add_argument_group("SSL") - group.add_argument( - "--cert", - dest='certs', - default=[], - type=str, - metavar="SPEC", - action="append", - help='Add an SSL certificate. SPEC is of the form "[domain=]path". ' - 'The domain may include a wildcard, and is equal to "*" if not specified. ' - 'The file at path is a certificate in PEM format. If a private key is included ' - 'in the PEM, it is used, else the default key in the conf dir is used. ' - 'The PEM file should contain the full certificate chain, with the leaf certificate ' - 'as the first entry. Can be passed multiple times.') - group.add_argument( - "--ciphers-client", action="store", - type=str, dest="ciphers_client", default=options.DEFAULT_CLIENT_CIPHERS, - help="Set supported ciphers for client connections. (OpenSSL Syntax)" - ) - group.add_argument( - "--ciphers-server", action="store", - type=str, dest="ciphers_server", default=None, - help="Set supported ciphers for server connections. (OpenSSL Syntax)" - ) - group.add_argument( - "--client-certs", action="store", - type=str, dest="clientcerts", default=None, - help="Client certificate file or directory." - ) - group.add_argument( - "--no-upstream-cert", default=False, - action="store_true", dest="no_upstream_cert", - help="Don't connect to upstream server to look up certificate details." - ) - group.add_argument( - "--add-upstream-certs-to-client-chain", default=False, - action="store_true", dest="add_upstream_certs_to_client_chain", - help="Add all certificates of the upstream server to the certificate chain " - "that will be served to the proxy client, as extras." - ) - group.add_argument( - "--insecure", default=False, - action="store_true", dest="ssl_insecure", - help="Do not verify upstream server SSL/TLS certificates." - ) - group.add_argument( - "--upstream-trusted-cadir", default=None, action="store", - dest="ssl_verify_upstream_trusted_cadir", - help="Path to a directory of trusted CA certificates for upstream " - "server verification prepared using the c_rehash tool." - ) - group.add_argument( - "--upstream-trusted-ca", default=None, action="store", - dest="ssl_verify_upstream_trusted_ca", - help="Path to a PEM formatted trusted CA certificate." - ) - group.add_argument( - "--ssl-version-client", dest="ssl_version_client", - default="secure", action="store", - choices=tcp.sslversion_choices.keys(), - help="Set supported SSL/TLS versions for client connections. " - "SSLv2, SSLv3 and 'all' are INSECURE. Defaults to secure, which is TLS1.0+." - ) - group.add_argument( - "--ssl-version-server", dest="ssl_version_server", - default="secure", action="store", - choices=tcp.sslversion_choices.keys(), - help="Set supported SSL/TLS versions for server connections. " - "SSLv2, SSLv3 and 'all' are INSECURE. Defaults to secure, which is TLS1.0+." - ) - - -def onboarding_app(parser): - group = parser.add_argument_group("Onboarding App") - group.add_argument( - "--noapp", - action="store_false", dest="app", default=True, - help="Disable the mitmproxy onboarding app." - ) - group.add_argument( - "--app-host", - action="store", dest="app_host", default=options.APP_HOST, metavar="host", - help=""" - Domain to serve the onboarding app from. For transparent mode, use - an IP when a DNS entry for the app domain is not present. Default: - %s - """ % options.APP_HOST - ) - group.add_argument( - "--app-port", - action="store", - dest="app_port", - default=options.APP_PORT, - type=int, - metavar="80", - help="Port to serve the onboarding app from." - ) - - -def client_replay(parser): - group = parser.add_argument_group("Client Replay") - group.add_argument( - "-c", "--client-replay", - action="append", dest="client_replay", default=None, metavar="PATH", - help="Replay client requests from a saved file." - ) - - -def server_replay(parser): - group = parser.add_argument_group("Server Replay") - group.add_argument( - "-S", "--server-replay", - action="append", dest="server_replay", default=None, metavar="PATH", - help="Replay server responses from a saved file." - ) - group.add_argument( - "-k", "--replay-kill-extra", - action="store_true", dest="replay_kill_extra", default=False, - help="Kill extra requests during replay." - ) - group.add_argument( - "--server-replay-use-header", - action="append", dest="server_replay_use_headers", type=str, - help="Request headers to be considered during replay. " - "Can be passed multiple times." - ) - group.add_argument( - "--norefresh", - action="store_true", dest="norefresh", default=False, - help=""" - Disable response refresh, which updates times in cookies and headers - for replayed responses. - """ - ) - group.add_argument( - "--no-pop", - action="store_true", dest="server_replay_nopop", default=False, - help="Disable response pop from response flow. " - "This makes it possible to replay same response multiple times." - ) - payload = group.add_mutually_exclusive_group() - payload.add_argument( - "--replay-ignore-content", - action="store_true", dest="server_replay_ignore_content", default=False, - help=""" - Ignore request's content while searching for a saved flow to replay - """ - ) - payload.add_argument( - "--replay-ignore-payload-param", - action="append", dest="server_replay_ignore_payload_params", type=str, - help=""" - Request's payload parameters (application/x-www-form-urlencoded or multipart/form-data) to - be ignored while searching for a saved flow to replay. - Can be passed multiple times. - """ - ) - - group.add_argument( - "--replay-ignore-param", - action="append", dest="server_replay_ignore_params", type=str, - help=""" - Request's parameters to be ignored while searching for a saved flow - to replay. Can be passed multiple times. - """ - ) - group.add_argument( - "--replay-ignore-host", - action="store_true", - dest="server_replay_ignore_host", - default=False, - help="Ignore request's destination host while searching for a saved flow to replay") - - -def replacements(parser): - group = parser.add_argument_group( - "Replacements", - """ - Replacements are of the form "/pattern/regex/replacement", where - the separator can be any character. Please see the documentation - for more information. - """.strip() - ) - group.add_argument( - "--replace", - action="append", type=str, dest="replace", default=[], - metavar="PATTERN", - help="Replacement pattern." - ) - group.add_argument( - "--replace-from-file", - action="append", type=str, dest="replace_file", default=[], - metavar="PATH", - help=""" - Replacement pattern, where the replacement clause is a path to a - file. - """ - ) - - -def set_headers(parser): - group = parser.add_argument_group( - "Set Headers", - """ - Header specifications are of the form "/pattern/header/value", - where the separator can be any character. Please see the - documentation for more information. - """.strip() - ) - group.add_argument( - "--setheader", - action="append", type=str, dest="setheader", default=[], - metavar="PATTERN", - help="Header set pattern." - ) - - -def proxy_authentication(parser): - group = parser.add_argument_group( - "Proxy Authentication", - """ - Specify which users are allowed to access the proxy and the method - used for authenticating them. - """ - ).add_mutually_exclusive_group() - group.add_argument( - "--nonanonymous", - action="store_true", dest="auth_nonanonymous", - help="Allow access to any user long as a credentials are specified." - ) - - group.add_argument( - "--singleuser", - action="store", dest="auth_singleuser", type=str, - metavar="USER", - help=""" - Allows access to a a single user, specified in the form - username:password. - """ - ) - group.add_argument( - "--htpasswd", - action="store", dest="auth_htpasswd", type=str, - metavar="PATH", - help="Allow access to users specified in an Apache htpasswd file." - ) - - -def common_options(parser): - basic_options(parser) - proxy_modes(parser) - proxy_options(parser) - proxy_ssl_options(parser) - onboarding_app(parser) - client_replay(parser) - server_replay(parser) - replacements(parser) - set_headers(parser) - proxy_authentication(parser) - - -def mitmproxy(): - # Don't import mitmproxy.console for mitmdump, urwid is not available on all - # platforms. - from .console import palettes - - parser = configargparse.ArgumentParser( - usage="%(prog)s [options]", - args_for_setting_config_path=["--conf"], - default_config_files=[ - os.path.join(options.CA_DIR, "common.conf"), - os.path.join(options.CA_DIR, "mitmproxy.conf") - ], - add_config_file_help=True, - add_env_var_help=True - ) - common_options(parser) - parser.add_argument( - "--palette", type=str, default=palettes.DEFAULT, - action="store", dest="palette", - choices=sorted(palettes.palettes.keys()), - help="Select color palette: " + ", ".join(palettes.palettes.keys()) - ) - parser.add_argument( - "--palette-transparent", - action="store_true", dest="palette_transparent", default=False, - help="Set transparent background for palette." - ) - parser.add_argument( - "-e", "--eventlog", - action="store_true", dest="eventlog", - help="Show event log." - ) - parser.add_argument( - "--follow", - action="store_true", dest="follow", - help="Follow flow list." - ) - parser.add_argument( - "--no-mouse", - action="store_true", dest="no_mouse", - help="Disable mouse interaction." - ) - group = parser.add_argument_group( - "Filters", - "See help in mitmproxy for filter expression syntax." - ) - group.add_argument( - "-i", "--intercept", action="store", - type=str, dest="intercept", default=None, - help="Intercept filter expression." - ) - group.add_argument( - "-f", "--filter", action="store", - type=str, dest="filter", default=None, - help="Filter view expression." - ) - return parser - - -def mitmdump(): - parser = configargparse.ArgumentParser( - usage="%(prog)s [options] [filter]", - args_for_setting_config_path=["--conf"], - default_config_files=[ - os.path.join(options.CA_DIR, "common.conf"), - os.path.join(options.CA_DIR, "mitmdump.conf") - ], - add_config_file_help=True, - add_env_var_help=True - ) - - common_options(parser) - parser.add_argument( - "--keepserving", - action="store_true", dest="keepserving", default=False, - help=""" - Continue serving after client playback or file read. We exit by - default. - """ - ) - parser.add_argument( - "-d", "--detail", - action="count", dest="flow_detail", default=1, - help="Increase flow detail display level. Can be passed multiple times." - ) - parser.add_argument('args', nargs="...") - return parser - - -def mitmweb(): - parser = configargparse.ArgumentParser( - usage="%(prog)s [options]", - args_for_setting_config_path=["--conf"], - default_config_files=[ - os.path.join(options.CA_DIR, "common.conf"), - os.path.join(options.CA_DIR, "mitmweb.conf") - ], - add_config_file_help=True, - add_env_var_help=True - ) - - group = parser.add_argument_group("Mitmweb") - group.add_argument( - "--wport", - action="store", type=int, dest="wport", default=8081, - metavar="PORT", - help="Mitmweb port." - ) - group.add_argument( - "--wiface", - action="store", dest="wiface", default="127.0.0.1", - metavar="IFACE", - help="Mitmweb interface." - ) - group.add_argument( - "--wdebug", - action="store_true", dest="wdebug", - help="Turn on mitmweb debugging" - ) - group.add_argument( - "--wsingleuser", - action="store", dest="wsingleuser", type=str, - metavar="USER", - help=""" - Allows access to a a single user, specified in the form - username:password. - """ - ) - group.add_argument( - "--whtpasswd", - action="store", dest="whtpasswd", type=str, - metavar="PATH", - help="Allow access to users specified in an Apache htpasswd file." - ) - - common_options(parser) - group = parser.add_argument_group( - "Filters", - "See help in mitmproxy for filter expression syntax." - ) - group.add_argument( - "-i", "--intercept", action="store", - type=str, dest="intercept", default=None, - help="Intercept filter expression." - ) - return parser diff --git a/mitmproxy/connections.py b/mitmproxy/connections.py new file mode 100644 index 00000000..bf7a12aa --- /dev/null +++ b/mitmproxy/connections.py @@ -0,0 +1,221 @@ +import time + +import copy +import os + +from mitmproxy import stateobject +from netlib import certutils +from netlib import tcp + + +class ClientConnection(tcp.BaseHandler, stateobject.StateObject): + + """ + A client connection + + Attributes: + address: Remote address + ssl_established: True if TLS is established, False otherwise + clientcert: The TLS client certificate + timestamp_start: Connection start timestamp + timestamp_ssl_setup: TLS established timestamp + timestamp_end: Connection end timestamp + """ + + def __init__(self, client_connection, address, server): + # Eventually, this object is restored from state. We don't have a + # connection then. + if client_connection: + super().__init__(client_connection, address, server) + else: + self.connection = None + self.server = None + self.wfile = None + self.rfile = None + self.address = None + self.clientcert = None + self.ssl_established = None + + self.timestamp_start = time.time() + self.timestamp_end = None + self.timestamp_ssl_setup = None + self.protocol = None + + def __bool__(self): + return bool(self.connection) and not self.finished + + def __repr__(self): + return "".format( + ssl="[ssl] " if self.ssl_established else "", + address=repr(self.address) + ) + + @property + def tls_established(self): + return self.ssl_established + + _stateobject_attributes = dict( + address=tcp.Address, + ssl_established=bool, + clientcert=certutils.SSLCert, + timestamp_start=float, + timestamp_ssl_setup=float, + timestamp_end=float, + ) + + def copy(self): + return copy.copy(self) + + def send(self, message): + if isinstance(message, list): + message = b''.join(message) + self.wfile.write(message) + self.wfile.flush() + + @classmethod + def from_state(cls, state): + f = cls(None, tuple(), None) + f.set_state(state) + return f + + @classmethod + def make_dummy(cls, address): + return cls.from_state(dict( + address=dict(address=address, use_ipv6=False), + clientcert=None, + ssl_established=False, + timestamp_start=None, + timestamp_end=None, + timestamp_ssl_setup=None + )) + + def convert_to_ssl(self, *args, **kwargs): + super().convert_to_ssl(*args, **kwargs) + self.timestamp_ssl_setup = time.time() + + def finish(self): + super().finish() + self.timestamp_end = time.time() + + +class ServerConnection(tcp.TCPClient, stateobject.StateObject): + + """ + A server connection + + Attributes: + address: Remote address. Can be both a domain or an IP address. + ip_address: Resolved remote IP address. + source_address: Local IP address or client's source IP address. + ssl_established: True if TLS is established, False otherwise + cert: The certificate presented by the remote during the TLS handshake + sni: Server Name Indication sent by the proxy during the TLS handshake + via: The underlying server connection (e.g. the connection to the upstream proxy in upstream proxy mode) + timestamp_start: Connection start timestamp + timestamp_tcp_setup: TCP ACK received timestamp + timestamp_ssl_setup: TLS established timestamp + timestamp_end: Connection end timestamp + """ + + def __init__(self, address, source_address=None, spoof_source_address=None): + tcp.TCPClient.__init__(self, address, source_address, spoof_source_address) + + self.via = None + self.timestamp_start = None + self.timestamp_end = None + self.timestamp_tcp_setup = None + self.timestamp_ssl_setup = None + self.protocol = None + + def __bool__(self): + return bool(self.connection) and not self.finished + + def __repr__(self): + if self.ssl_established and self.sni: + ssl = "[ssl: {0}] ".format(self.sni) + elif self.ssl_established: + ssl = "[ssl] " + else: + ssl = "" + return "".format( + ssl=ssl, + address=repr(self.address) + ) + + @property + def tls_established(self): + return self.ssl_established + + _stateobject_attributes = dict( + address=tcp.Address, + ip_address=tcp.Address, + source_address=tcp.Address, + ssl_established=bool, + cert=certutils.SSLCert, + sni=str, + timestamp_start=float, + timestamp_tcp_setup=float, + timestamp_ssl_setup=float, + timestamp_end=float, + ) + + @classmethod + def from_state(cls, state): + f = cls(tuple()) + f.set_state(state) + return f + + @classmethod + def make_dummy(cls, address): + return cls.from_state(dict( + address=dict(address=address, use_ipv6=False), + ip_address=dict(address=address, use_ipv6=False), + cert=None, + sni=None, + source_address=dict(address=('', 0), use_ipv6=False), + ssl_established=False, + timestamp_start=None, + timestamp_tcp_setup=None, + timestamp_ssl_setup=None, + timestamp_end=None, + via=None + )) + + def copy(self): + return copy.copy(self) + + def connect(self): + self.timestamp_start = time.time() + tcp.TCPClient.connect(self) + self.timestamp_tcp_setup = time.time() + + def send(self, message): + if isinstance(message, list): + message = b''.join(message) + self.wfile.write(message) + self.wfile.flush() + + def establish_ssl(self, clientcerts, sni, **kwargs): + if sni and not isinstance(sni, str): + raise ValueError("sni must be str, not " + type(sni).__name__) + clientcert = None + if clientcerts: + if os.path.isfile(clientcerts): + clientcert = clientcerts + else: + path = os.path.join( + clientcerts, + self.address.host.encode("idna").decode()) + ".pem" + if os.path.exists(path): + clientcert = path + + self.convert_to_ssl(cert=clientcert, sni=sni, **kwargs) + self.sni = sni + self.timestamp_ssl_setup = time.time() + + def finish(self): + tcp.TCPClient.finish(self) + self.timestamp_end = time.time() + + +ServerConnection._stateobject_attributes["via"] = ServerConnection diff --git a/mitmproxy/console/__init__.py b/mitmproxy/console/__init__.py deleted file mode 100644 index ae23c694..00000000 --- a/mitmproxy/console/__init__.py +++ /dev/null @@ -1,4 +0,0 @@ -from mitmproxy.console import master - - -__all__ = ["master"] diff --git a/mitmproxy/console/common.py b/mitmproxy/console/common.py deleted file mode 100644 index 91253668..00000000 --- a/mitmproxy/console/common.py +++ /dev/null @@ -1,461 +0,0 @@ -# -*- coding: utf-8 -*- - - -import os - -import urwid -import urwid.util - -import netlib -from mitmproxy import utils -from mitmproxy.console import signals -from mitmproxy import export -from netlib import human - -try: - import pyperclip -except: - pyperclip = False - - -VIEW_FLOW_REQUEST = 0 -VIEW_FLOW_RESPONSE = 1 - -METHOD_OPTIONS = [ - ("get", "g"), - ("post", "p"), - ("put", "u"), - ("head", "h"), - ("trace", "t"), - ("delete", "d"), - ("options", "o"), - ("edit raw", "e"), -] - - -def is_keypress(k): - """ - Is this input event a keypress? - """ - if isinstance(k, str): - return True - - -def highlight_key(str, key, textattr="text", keyattr="key"): - l = [] - parts = str.split(key, 1) - if parts[0]: - l.append((textattr, parts[0])) - l.append((keyattr, key)) - if parts[1]: - l.append((textattr, parts[1])) - return l - - -KEY_MAX = 30 - - -def format_keyvals(lst, key="key", val="text", indent=0): - """ - Format a list of (key, value) tuples. - - If key is None, it's treated specially: - - We assume a sub-value, and add an extra indent. - - The value is treated as a pre-formatted list of directives. - """ - ret = [] - if lst: - maxk = min(max(len(i[0]) for i in lst if i and i[0]), KEY_MAX) - for i, kv in enumerate(lst): - if kv is None: - ret.append(urwid.Text("")) - else: - if isinstance(kv[1], urwid.Widget): - v = kv[1] - elif kv[1] is None: - v = urwid.Text("") - else: - v = urwid.Text([(val, kv[1])]) - ret.append( - urwid.Columns( - [ - ("fixed", indent, urwid.Text("")), - ( - "fixed", - maxk, - urwid.Text([(key, kv[0] or "")]) - ), - v - ], - dividechars = 2 - ) - ) - return ret - - -def shortcuts(k): - if k == " ": - k = "page down" - elif k == "ctrl f": - k = "page down" - elif k == "ctrl b": - k = "page up" - elif k == "j": - k = "down" - elif k == "k": - k = "up" - return k - - -def fcol(s, attr): - s = str(s) - return ( - "fixed", - len(s), - urwid.Text( - [ - (attr, s) - ] - ) - ) - -if urwid.util.detected_encoding: - SYMBOL_REPLAY = u"\u21ba" - SYMBOL_RETURN = u"\u2190" - SYMBOL_MARK = u"\u25cf" -else: - SYMBOL_REPLAY = u"[r]" - SYMBOL_RETURN = u"<-" - SYMBOL_MARK = "[m]" - - -# Save file to disk -def save_data(path, data): - if not path: - return - try: - if isinstance(data, bytes): - mode = "wb" - else: - mode = "w" - with open(path, mode) as f: - f.write(data) - except IOError as v: - signals.status_message.send(message=v.strerror) - - -def ask_save_overwrite(path, data): - if not path: - return - path = os.path.expanduser(path) - if os.path.exists(path): - def save_overwrite(k): - if k == "y": - save_data(path, data) - - signals.status_prompt_onekey.send( - prompt = "'" + path + "' already exists. Overwrite?", - keys = ( - ("yes", "y"), - ("no", "n"), - ), - callback = save_overwrite - ) - else: - save_data(path, data) - - -def ask_save_path(data, prompt="File path"): - signals.status_prompt_path.send( - prompt = prompt, - callback = ask_save_overwrite, - args = (data, ) - ) - - -def ask_scope_and_callback(flow, cb, *args): - request_has_content = flow.request and flow.request.raw_content - response_has_content = flow.response and flow.response.raw_content - - if request_has_content and response_has_content: - signals.status_prompt_onekey.send( - prompt = "Save", - keys = ( - ("request", "q"), - ("response", "s"), - ("both", "b"), - ), - callback = cb, - args = (flow,) + args - ) - elif response_has_content: - cb("s", flow, *args) - else: - cb("q", flow, *args) - - -def copy_to_clipboard_or_prompt(data): - # pyperclip calls encode('utf-8') on data to be copied without checking. - # if data are already encoded that way UnicodeDecodeError is thrown. - if isinstance(data, bytes): - toclip = data.decode("utf8", "replace") - else: - toclip = data - - try: - pyperclip.copy(toclip) - except (RuntimeError, UnicodeDecodeError, AttributeError, TypeError): - def save(k): - if k == "y": - ask_save_path(data, "Save data") - signals.status_prompt_onekey.send( - prompt = "Cannot copy data to clipboard. Save as file?", - keys = ( - ("yes", "y"), - ("no", "n"), - ), - callback = save - ) - - -def format_flow_data(key, scope, flow): - data = b"" - if scope in ("q", "b"): - request = flow.request.copy() - request.decode(strict=False) - if request.content is None: - return None, "Request content is missing" - if key == "h": - data += netlib.http.http1.assemble_request(request) - elif key == "c": - data += request.get_content(strict=False) - else: - raise ValueError("Unknown key: {}".format(key)) - if scope == "b" and flow.request.raw_content and flow.response: - # Add padding between request and response - data += b"\r\n" * 2 - if scope in ("s", "b") and flow.response: - response = flow.response.copy() - response.decode(strict=False) - if response.content is None: - return None, "Response content is missing" - if key == "h": - data += netlib.http.http1.assemble_response(response) - elif key == "c": - data += response.get_content(strict=False) - else: - raise ValueError("Unknown key: {}".format(key)) - return data, False - - -def handle_flow_data(scope, flow, key, writer): - """ - key: _c_ontent, _h_eaders+content, _u_rl - scope: re_q_uest, re_s_ponse, _b_oth - writer: copy_to_clipboard_or_prompt, ask_save_path - """ - data, err = format_flow_data(key, scope, flow) - - if err: - signals.status_message.send(message=err) - return - - if not data: - if scope == "q": - signals.status_message.send(message="No request content.") - elif scope == "s": - signals.status_message.send(message="No response content.") - else: - signals.status_message.send(message="No content.") - return - - writer(data) - - -def ask_save_body(scope, flow): - """ - Save either the request or the response body to disk. - - scope: re_q_uest, re_s_ponse, _b_oth, None (ask user if necessary) - """ - - request_has_content = flow.request and flow.request.raw_content - response_has_content = flow.response and flow.response.raw_content - - if scope is None: - ask_scope_and_callback(flow, ask_save_body) - elif scope == "q" and request_has_content: - ask_save_path( - flow.request.get_content(strict=False), - "Save request content to" - ) - elif scope == "s" and response_has_content: - ask_save_path( - flow.response.get_content(strict=False), - "Save response content to" - ) - elif scope == "b" and request_has_content and response_has_content: - ask_save_path( - (flow.request.get_content(strict=False) + b"\n" + - flow.response.get_content(strict=False)), - "Save request & response content to" - ) - else: - signals.status_message.send(message="No content.") - - -def export_to_clip_or_file(key, scope, flow, writer): - """ - Export selected flow to clipboard or a file. - - key: _c_ontent, _h_eaders+content, _u_rl, - cu_r_l_command, _p_ython_code, - _l_ocust_code, locust_t_ask - scope: None, _a_ll, re_q_uest, re_s_ponse - writer: copy_to_clipboard_or_prompt, ask_save_path - """ - - for _, exp_key, exporter in export.EXPORTERS: - if key == exp_key: - if exporter is None: # 'c' & 'h' - if scope is None: - ask_scope_and_callback(flow, handle_flow_data, key, writer) - else: - handle_flow_data(scope, flow, key, writer) - else: # other keys - writer(exporter(flow)) - -flowcache = utils.LRUCache(800) - - -def raw_format_flow(f): - f = dict(f) - pile = [] - req = [] - if f["extended"]: - req.append( - fcol( - human.format_timestamp(f["req_timestamp"]), - "highlight" - ) - ) - else: - req.append(fcol(">>" if f["focus"] else " ", "focus")) - - if f["marked"]: - req.append(fcol(SYMBOL_MARK, "mark")) - - if f["req_is_replay"]: - req.append(fcol(SYMBOL_REPLAY, "replay")) - req.append(fcol(f["req_method"], "method")) - - preamble = sum(i[1] for i in req) + len(req) - 1 - - if f["intercepted"] and not f["acked"]: - uc = "intercept" - elif "resp_code" in f or "err_msg" in f: - uc = "text" - else: - uc = "title" - - url = f["req_url"] - - if f["max_url_len"] and len(url) > f["max_url_len"]: - url = url[:f["max_url_len"]] + "…" - - if f["req_http_version"] not in ("HTTP/1.0", "HTTP/1.1"): - url += " " + f["req_http_version"] - req.append( - urwid.Text([(uc, url)]) - ) - - pile.append(urwid.Columns(req, dividechars=1)) - - resp = [] - resp.append( - ("fixed", preamble, urwid.Text("")) - ) - - if "resp_code" in f: - codes = { - 2: "code_200", - 3: "code_300", - 4: "code_400", - 5: "code_500", - } - ccol = codes.get(f["resp_code"] // 100, "code_other") - resp.append(fcol(SYMBOL_RETURN, ccol)) - if f["resp_is_replay"]: - resp.append(fcol(SYMBOL_REPLAY, "replay")) - resp.append(fcol(f["resp_code"], ccol)) - if f["extended"]: - resp.append(fcol(f["resp_reason"], ccol)) - if f["intercepted"] and f["resp_code"] and not f["acked"]: - rc = "intercept" - else: - rc = "text" - - if f["resp_ctype"]: - resp.append(fcol(f["resp_ctype"], rc)) - resp.append(fcol(f["resp_clen"], rc)) - resp.append(fcol(f["roundtrip"], rc)) - - elif f["err_msg"]: - resp.append(fcol(SYMBOL_RETURN, "error")) - resp.append( - urwid.Text([ - ( - "error", - f["err_msg"] - ) - ]) - ) - pile.append(urwid.Columns(resp, dividechars=1)) - return urwid.Pile(pile) - - -def format_flow(f, focus, extended=False, hostheader=False, max_url_len=False): - d = dict( - focus=focus, - extended=extended, - max_url_len=max_url_len, - - intercepted = f.intercepted, - acked = f.reply.state == "committed", - - req_timestamp = f.request.timestamp_start, - req_is_replay = f.request.is_replay, - req_method = f.request.method, - req_url = f.request.pretty_url if hostheader else f.request.url, - req_http_version = f.request.http_version, - - err_msg = f.error.msg if f.error else None, - - marked = f.marked, - ) - if f.response: - if f.response.raw_content: - contentdesc = human.pretty_size(len(f.response.raw_content)) - elif f.response.raw_content is None: - contentdesc = "[content missing]" - else: - contentdesc = "[no content]" - duration = 0 - if f.response.timestamp_end and f.request.timestamp_start: - duration = f.response.timestamp_end - f.request.timestamp_start - roundtrip = human.pretty_duration(duration) - - d.update(dict( - resp_code = f.response.status_code, - resp_reason = f.response.reason, - resp_is_replay = f.response.is_replay, - resp_clen = contentdesc, - roundtrip = roundtrip, - )) - t = f.response.headers.get("content-type") - if t: - d["resp_ctype"] = t.split(";")[0] - else: - d["resp_ctype"] = "" - - return flowcache.get(raw_format_flow, tuple(sorted(d.items()))) diff --git a/mitmproxy/console/flowdetailview.py b/mitmproxy/console/flowdetailview.py deleted file mode 100644 index 5c0eaf79..00000000 --- a/mitmproxy/console/flowdetailview.py +++ /dev/null @@ -1,159 +0,0 @@ -import urwid - -from mitmproxy.console import common, searchable -from netlib import human - - -def maybe_timestamp(base, attr): - if base is not None and getattr(base, attr): - return human.format_timestamp_with_milli(getattr(base, attr)) - else: - return "active" - - -def flowdetails(state, flow): - text = [] - - cc = flow.client_conn - sc = flow.server_conn - req = flow.request - resp = flow.response - - if sc is not None: - text.append(urwid.Text([("head", "Server Connection:")])) - parts = [ - ["Address", repr(sc.address)], - ["Resolved Address", repr(sc.ip_address)], - ] - - text.extend( - common.format_keyvals(parts, key="key", val="text", indent=4) - ) - - c = sc.cert - if c: - text.append(urwid.Text([("head", "Server Certificate:")])) - parts = [ - ["Type", "%s, %s bits" % c.keyinfo], - ["SHA1 digest", c.digest("sha1")], - ["Valid to", str(c.notafter)], - ["Valid from", str(c.notbefore)], - ["Serial", str(c.serial)], - [ - "Subject", - urwid.BoxAdapter( - urwid.ListBox( - common.format_keyvals( - c.subject, - key="highlight", - val="text" - ) - ), - len(c.subject) - ) - ], - [ - "Issuer", - urwid.BoxAdapter( - urwid.ListBox( - common.format_keyvals( - c.issuer, key="highlight", val="text" - ) - ), - len(c.issuer) - ) - ] - ] - - if c.altnames: - parts.append( - [ - "Alt names", - ", ".join(str(x) for x in c.altnames) - ] - ) - text.extend( - common.format_keyvals(parts, key="key", val="text", indent=4) - ) - - if cc is not None: - text.append(urwid.Text([("head", "Client Connection:")])) - - parts = [ - ["Address", repr(cc.address)], - ] - - text.extend( - common.format_keyvals(parts, key="key", val="text", indent=4) - ) - - parts = [] - - if cc is not None and cc.timestamp_start: - parts.append( - [ - "Client conn. established", - maybe_timestamp(cc, "timestamp_start") - ] - ) - if cc.ssl_established: - parts.append( - [ - "Client conn. TLS handshake", - maybe_timestamp(cc, "timestamp_ssl_setup") - ] - ) - if sc is not None and sc.timestamp_start: - parts.append( - [ - "Server conn. initiated", - maybe_timestamp(sc, "timestamp_start") - ] - ) - parts.append( - [ - "Server conn. TCP handshake", - maybe_timestamp(sc, "timestamp_tcp_setup") - ] - ) - if sc.ssl_established: - parts.append( - [ - "Server conn. TLS handshake", - maybe_timestamp(sc, "timestamp_ssl_setup") - ] - ) - if req is not None and req.timestamp_start: - parts.append( - [ - "First request byte", - maybe_timestamp(req, "timestamp_start") - ] - ) - parts.append( - [ - "Request complete", - maybe_timestamp(req, "timestamp_end") - ] - ) - if resp is not None and resp.timestamp_start: - parts.append( - [ - "First response byte", - maybe_timestamp(resp, "timestamp_start") - ] - ) - parts.append( - [ - "Response complete", - maybe_timestamp(resp, "timestamp_end") - ] - ) - - if parts: - # sort operations by timestamp - parts = sorted(parts, key=lambda p: p[1]) - - text.append(urwid.Text([("head", "Timing:")])) - text.extend(common.format_keyvals(parts, key="key", val="text", indent=4)) - return searchable.Searchable(state, text) diff --git a/mitmproxy/console/flowlist.py b/mitmproxy/console/flowlist.py deleted file mode 100644 index 09a5d027..00000000 --- a/mitmproxy/console/flowlist.py +++ /dev/null @@ -1,382 +0,0 @@ -import urwid - -import netlib.http.url -from mitmproxy import exceptions -from mitmproxy.console import common -from mitmproxy.console import signals -from mitmproxy import export - - -def _mkhelp(): - text = [] - keys = [ - ("A", "accept all intercepted flows"), - ("a", "accept this intercepted flow"), - ("b", "save request/response body"), - ("C", "export flow to clipboard"), - ("d", "delete flow"), - ("D", "duplicate flow"), - ("e", "toggle eventlog"), - ("E", "export flow to file"), - ("f", "filter view"), - ("F", "toggle follow flow list"), - ("L", "load saved flows"), - ("m", "toggle flow mark"), - ("M", "toggle marked flow view"), - ("n", "create a new request"), - ("r", "replay request"), - ("S", "server replay request/s"), - ("U", "unmark all marked flows"), - ("V", "revert changes to request"), - ("w", "save flows "), - ("W", "stream flows to file"), - ("X", "kill and delete flow, even if it's mid-intercept"), - ("z", "clear flow list or eventlog"), - ("tab", "tab between eventlog and flow list"), - ("enter", "view flow"), - ("|", "run script on this flow"), - ] - text.extend(common.format_keyvals(keys, key="key", val="text", indent=4)) - return text -help_context = _mkhelp() - -footer = [ - ('heading_key', "?"), ":help ", -] - - -class LogBufferBox(urwid.ListBox): - - def __init__(self, master): - self.master = master - urwid.ListBox.__init__(self, master.logbuffer) - - def keypress(self, size, key): - key = common.shortcuts(key) - if key == "z": - self.master.clear_events() - key = None - elif key == "G": - self.set_focus(len(self.master.logbuffer) - 1) - elif key == "g": - self.set_focus(0) - return urwid.ListBox.keypress(self, size, key) - - -class BodyPile(urwid.Pile): - - def __init__(self, master): - h = urwid.Text("Event log") - h = urwid.Padding(h, align="left", width=("relative", 100)) - - self.inactive_header = urwid.AttrWrap(h, "heading_inactive") - self.active_header = urwid.AttrWrap(h, "heading") - - urwid.Pile.__init__( - self, - [ - FlowListBox(master), - urwid.Frame( - LogBufferBox(master), - header = self.inactive_header - ) - ] - ) - self.master = master - - def keypress(self, size, key): - if key == "tab": - self.focus_position = ( - self.focus_position + 1) % len(self.widget_list) - if self.focus_position == 1: - self.widget_list[1].header = self.active_header - else: - self.widget_list[1].header = self.inactive_header - key = None - elif key == "e": - self.master.toggle_eventlog() - key = None - - # This is essentially a copypasta from urwid.Pile's keypress handler. - # So much for "closed for modification, but open for extension". - item_rows = None - if len(size) == 2: - item_rows = self.get_item_rows(size, focus = True) - i = self.widget_list.index(self.focus_item) - tsize = self.get_item_size(size, i, True, item_rows) - return self.focus_item.keypress(tsize, key) - - -class ConnectionItem(urwid.WidgetWrap): - - def __init__(self, master, state, flow, focus): - self.master, self.state, self.flow = master, state, flow - self.f = focus - w = self.get_text() - urwid.WidgetWrap.__init__(self, w) - - def get_text(self): - cols, _ = self.master.ui.get_cols_rows() - return common.format_flow( - self.flow, - self.f, - hostheader=self.master.options.showhost, - max_url_len=cols, - ) - - def selectable(self): - return True - - def save_flows_prompt(self, k): - if k == "l": - signals.status_prompt_path.send( - prompt = "Save listed flows to", - callback = self.master.save_flows - ) - else: - signals.status_prompt_path.send( - prompt = "Save this flow to", - callback = self.master.save_one_flow, - args = (self.flow,) - ) - - def server_replay_prompt(self, k): - a = self.master.addons.get("serverplayback") - if k == "a": - a.load([i.copy() for i in self.master.state.view]) - elif k == "t": - a.load([self.flow.copy()]) - signals.update_settings.send(self) - - def mouse_event(self, size, event, button, col, row, focus): - if event == "mouse press" and button == 1: - if self.flow.request: - self.master.view_flow(self.flow) - return True - - def keypress(self, xxx_todo_changeme, key): - (maxcol,) = xxx_todo_changeme - key = common.shortcuts(key) - if key == "a": - self.flow.resume(self.master) - signals.flowlist_change.send(self) - elif key == "d": - if self.flow.killable: - self.flow.kill(self.master) - self.state.delete_flow(self.flow) - signals.flowlist_change.send(self) - elif key == "D": - f = self.master.state.duplicate_flow(self.flow) - self.master.state.set_focus_flow(f) - signals.flowlist_change.send(self) - elif key == "m": - self.flow.marked = not self.flow.marked - signals.flowlist_change.send(self) - elif key == "M": - if self.state.mark_filter: - self.state.disable_marked_filter() - else: - self.state.enable_marked_filter() - signals.flowlist_change.send(self) - elif key == "r": - try: - self.master.replay_request(self.flow) - except exceptions.ReplayException as e: - signals.add_log("Replay error: %s" % e, "warn") - signals.flowlist_change.send(self) - elif key == "S": - def stop_server_playback(response): - if response == "y": - self.master.options.server_replay = [] - a = self.master.addons.get("serverplayback") - if a.count(): - signals.status_prompt_onekey.send( - prompt = "Stop current server replay?", - keys = ( - ("yes", "y"), - ("no", "n"), - ), - callback = stop_server_playback, - ) - else: - signals.status_prompt_onekey.send( - prompt = "Server Replay", - keys = ( - ("all flows", "a"), - ("this flow", "t"), - ), - callback = self.server_replay_prompt, - ) - elif key == "U": - for f in self.state.flows: - f.marked = False - signals.flowlist_change.send(self) - elif key == "V": - if not self.flow.modified(): - signals.status_message.send(message="Flow not modified.") - return - self.state.revert(self.flow) - signals.flowlist_change.send(self) - signals.status_message.send(message="Reverted.") - elif key == "w": - signals.status_prompt_onekey.send( - self, - prompt = "Save", - keys = ( - ("listed flows", "l"), - ("this flow", "t"), - ), - callback = self.save_flows_prompt, - ) - elif key == "X": - if self.flow.killable: - self.flow.kill(self.master) - elif key == "enter": - if self.flow.request: - self.master.view_flow(self.flow) - elif key == "|": - signals.status_prompt_path.send( - prompt = "Send flow to script", - callback = self.master.run_script_once, - args = (self.flow,) - ) - elif key == "E": - signals.status_prompt_onekey.send( - self, - prompt = "Export to file", - keys = [(e[0], e[1]) for e in export.EXPORTERS], - callback = common.export_to_clip_or_file, - args = (None, self.flow, common.ask_save_path) - ) - elif key == "C": - signals.status_prompt_onekey.send( - self, - prompt = "Export to clipboard", - keys = [(e[0], e[1]) for e in export.EXPORTERS], - callback = common.export_to_clip_or_file, - args = (None, self.flow, common.copy_to_clipboard_or_prompt) - ) - elif key == "b": - common.ask_save_body(None, self.flow) - else: - return key - - -class FlowListWalker(urwid.ListWalker): - - def __init__(self, master, state): - self.master, self.state = master, state - signals.flowlist_change.connect(self.sig_flowlist_change) - - def sig_flowlist_change(self, sender): - self._modified() - - def get_focus(self): - f, i = self.state.get_focus() - f = ConnectionItem(self.master, self.state, f, True) if f else None - return f, i - - def set_focus(self, focus): - ret = self.state.set_focus(focus) - return ret - - def get_next(self, pos): - f, i = self.state.get_next(pos) - f = ConnectionItem(self.master, self.state, f, False) if f else None - return f, i - - def get_prev(self, pos): - f, i = self.state.get_prev(pos) - f = ConnectionItem(self.master, self.state, f, False) if f else None - return f, i - - -class FlowListBox(urwid.ListBox): - - def __init__(self, master: "mitmproxy.console.master.ConsoleMaster"): - self.master = master - super().__init__(FlowListWalker(master, master.state)) - - def get_method_raw(self, k): - if k: - self.get_url(k) - - def get_method(self, k): - if k == "e": - signals.status_prompt.send( - self, - prompt = "Method", - text = "", - callback = self.get_method_raw - ) - else: - method = "" - for i in common.METHOD_OPTIONS: - if i[1] == k: - method = i[0].upper() - self.get_url(method) - - def get_url(self, method): - signals.status_prompt.send( - prompt = "URL", - text = "http://www.example.com/", - callback = self.new_request, - args = (method,) - ) - - def new_request(self, url, method): - parts = netlib.http.url.parse(str(url)) - if not parts: - signals.status_message.send(message="Invalid Url") - return - scheme, host, port, path = parts - f = self.master.create_request(method, scheme, host, port, path) - self.master.state.set_focus_flow(f) - signals.flowlist_change.send(self) - - def keypress(self, size, key): - key = common.shortcuts(key) - if key == "A": - self.master.accept_all() - signals.flowlist_change.send(self) - elif key == "z": - self.master.clear_flows() - elif key == "e": - self.master.toggle_eventlog() - elif key == "g": - self.master.state.set_focus(0) - signals.flowlist_change.send(self) - elif key == "G": - self.master.state.set_focus(self.master.state.flow_count()) - signals.flowlist_change.send(self) - elif key == "f": - signals.status_prompt.send( - prompt = "Filter View", - text = self.master.state.filter_txt, - callback = self.master.set_view_filter - ) - elif key == "L": - signals.status_prompt_path.send( - self, - prompt = "Load flows", - callback = self.master.load_flows_callback - ) - elif key == "n": - signals.status_prompt_onekey.send( - prompt = "Method", - keys = common.METHOD_OPTIONS, - callback = self.get_method - ) - elif key == "F": - self.master.toggle_follow_flows() - elif key == "W": - if self.master.options.outfile: - self.master.options.outfile = None - else: - signals.status_prompt_path.send( - self, - prompt="Stream flows to", - callback= lambda path: self.master.options.update(outfile=(path, "ab")) - ) - else: - return urwid.ListBox.keypress(self, size, key) diff --git a/mitmproxy/console/flowview.py b/mitmproxy/console/flowview.py deleted file mode 100644 index 19afcdbc..00000000 --- a/mitmproxy/console/flowview.py +++ /dev/null @@ -1,701 +0,0 @@ -import math -import os -import sys - -import urwid -from mitmproxy import exceptions -from typing import Optional, Union # noqa - -from mitmproxy import contentviews -from mitmproxy import models -from mitmproxy import utils -from mitmproxy.console import common -from mitmproxy.console import flowdetailview -from mitmproxy.console import grideditor -from mitmproxy.console import searchable -from mitmproxy.console import signals -from mitmproxy.console import tabs -from mitmproxy import export -from netlib.http import Headers -from netlib.http import status_codes - - -class SearchError(Exception): - pass - - -def _mkhelp(): - text = [] - keys = [ - ("A", "accept all intercepted flows"), - ("a", "accept this intercepted flow"), - ("b", "save request/response body"), - ("C", "export flow to clipboard"), - ("D", "duplicate flow"), - ("d", "delete flow"), - ("e", "edit request/response"), - ("f", "load full body data"), - ("m", "change body display mode for this entity\n(default mode can be changed in the options)"), - (None, - common.highlight_key("automatic", "a") + - [("text", ": automatic detection")] - ), - (None, - common.highlight_key("hex", "e") + - [("text", ": Hex")] - ), - (None, - common.highlight_key("html", "h") + - [("text", ": HTML")] - ), - (None, - common.highlight_key("image", "i") + - [("text", ": Image")] - ), - (None, - common.highlight_key("javascript", "j") + - [("text", ": JavaScript")] - ), - (None, - common.highlight_key("json", "s") + - [("text", ": JSON")] - ), - (None, - common.highlight_key("urlencoded", "u") + - [("text", ": URL-encoded data")] - ), - (None, - common.highlight_key("raw", "r") + - [("text", ": raw data")] - ), - (None, - common.highlight_key("xml", "x") + - [("text", ": XML")] - ), - ("E", "export flow to file"), - ("r", "replay request"), - ("V", "revert changes to request"), - ("v", "view body in external viewer"), - ("w", "save all flows matching current view filter"), - ("W", "save this flow"), - ("x", "delete body"), - ("z", "encode/decode a request/response"), - ("tab", "next tab"), - ("h, l", "previous tab, next tab"), - ("space", "next flow"), - ("|", "run script on this flow"), - ("/", "search (case sensitive)"), - ("n", "repeat search forward"), - ("N", "repeat search backwards"), - ] - text.extend(common.format_keyvals(keys, key="key", val="text", indent=4)) - return text -help_context = _mkhelp() - -footer = [ - ('heading_key', "?"), ":help ", - ('heading_key', "q"), ":back ", -] - - -class FlowViewHeader(urwid.WidgetWrap): - - def __init__(self, master: "mitmproxy.console.master.ConsoleMaster", f: models.HTTPFlow): - self.master = master - self.flow = f - self._w = common.format_flow( - f, - False, - extended=True, - hostheader=self.master.options.showhost - ) - signals.flow_change.connect(self.sig_flow_change) - - def sig_flow_change(self, sender, flow): - if flow == self.flow: - self._w = common.format_flow( - flow, - False, - extended=True, - hostheader=self.master.options.showhost - ) - - -cache = utils.LRUCache(200) - -TAB_REQ = 0 -TAB_RESP = 1 - - -class FlowView(tabs.Tabs): - highlight_color = "focusfield" - - def __init__(self, master, state, flow, tab_offset): - self.master, self.state, self.flow = master, state, flow - super().__init__( - [ - (self.tab_request, self.view_request), - (self.tab_response, self.view_response), - (self.tab_details, self.view_details), - ], - tab_offset - ) - - self.show() - self.last_displayed_body = None - signals.flow_change.connect(self.sig_flow_change) - - def tab_request(self): - if self.flow.intercepted and not self.flow.response: - return "Request intercepted" - else: - return "Request" - - def tab_response(self): - if self.flow.intercepted and self.flow.response: - return "Response intercepted" - else: - return "Response" - - def tab_details(self): - return "Detail" - - def view_request(self): - return self.conn_text(self.flow.request) - - def view_response(self): - return self.conn_text(self.flow.response) - - def view_details(self): - return flowdetailview.flowdetails(self.state, self.flow) - - def sig_flow_change(self, sender, flow): - if flow == self.flow: - self.show() - - def content_view(self, viewmode, message): - if message.raw_content is None: - msg, body = "", [urwid.Text([("error", "[content missing]")])] - return msg, body - else: - full = self.state.get_flow_setting( - self.flow, - (self.tab_offset, "fullcontents"), - False - ) - if full: - limit = sys.maxsize - else: - limit = contentviews.VIEW_CUTOFF - - flow_modify_cache_invalidation = hash(( - message.raw_content, - message.headers.fields, - getattr(message, "path", None), - )) - return cache.get( - # We move message into this partial function as it is not hashable. - lambda *args: self._get_content_view(message, *args), - viewmode, - limit, - flow_modify_cache_invalidation - ) - - def _get_content_view(self, message, viewmode, max_lines, _): - description, lines, error = contentviews.get_message_content_view( - viewmode, message - ) - if error: - signals.add_log(error, "error") - # Give hint that you have to tab for the response. - if description == "No content" and isinstance(message, models.HTTPRequest): - description = "No request content (press tab to view response)" - - # If the users has a wide terminal, he gets fewer lines; this should not be an issue. - chars_per_line = 80 - max_chars = max_lines * chars_per_line - total_chars = 0 - text_objects = [] - for line in lines: - txt = [] - for (style, text) in line: - if total_chars + len(text) > max_chars: - text = text[:max_chars - total_chars] - txt.append((style, text)) - total_chars += len(text) - if total_chars == max_chars: - break - - # round up to the next line. - total_chars = int(math.ceil(total_chars / chars_per_line) * chars_per_line) - - text_objects.append(urwid.Text(txt)) - if total_chars == max_chars: - text_objects.append(urwid.Text([ - ("highlight", "Stopped displaying data after %d lines. Press " % max_lines), - ("key", "f"), - ("highlight", " to load all data.") - ])) - break - - return description, text_objects - - def viewmode_get(self): - override = self.state.get_flow_setting( - self.flow, - (self.tab_offset, "prettyview") - ) - return self.state.default_body_view if override is None else override - - def conn_text(self, conn): - if conn: - txt = common.format_keyvals( - [(h + ":", v) for (h, v) in conn.headers.items(multi=True)], - key = "header", - val = "text" - ) - viewmode = self.viewmode_get() - msg, body = self.content_view(viewmode, conn) - - cols = [ - urwid.Text( - [ - ("heading", msg), - ] - ), - urwid.Text( - [ - " ", - ('heading', "["), - ('heading_key', "m"), - ('heading', (":%s]" % viewmode.name)), - ], - align="right" - ) - ] - title = urwid.AttrWrap(urwid.Columns(cols), "heading") - - txt.append(title) - txt.extend(body) - else: - txt = [ - urwid.Text(""), - urwid.Text( - [ - ("highlight", "No response. Press "), - ("key", "e"), - ("highlight", " and edit any aspect to add one."), - ] - ) - ] - return searchable.Searchable(self.state, txt) - - def set_method_raw(self, m): - if m: - self.flow.request.method = m - signals.flow_change.send(self, flow = self.flow) - - def edit_method(self, m): - if m == "e": - signals.status_prompt.send( - prompt = "Method", - text = self.flow.request.method, - callback = self.set_method_raw - ) - else: - for i in common.METHOD_OPTIONS: - if i[1] == m: - self.flow.request.method = i[0].upper() - signals.flow_change.send(self, flow = self.flow) - - def set_url(self, url): - request = self.flow.request - try: - request.url = str(url) - except ValueError: - return "Invalid URL." - signals.flow_change.send(self, flow = self.flow) - - def set_resp_status_code(self, status_code): - try: - status_code = int(status_code) - except ValueError: - return None - self.flow.response.status_code = status_code - if status_code in status_codes.RESPONSES: - self.flow.response.reason = status_codes.RESPONSES[status_code] - signals.flow_change.send(self, flow = self.flow) - - def set_resp_reason(self, reason): - self.flow.response.reason = reason - signals.flow_change.send(self, flow = self.flow) - - def set_headers(self, fields, conn): - conn.headers = Headers(fields) - signals.flow_change.send(self, flow = self.flow) - - def set_query(self, lst, conn): - conn.query = lst - signals.flow_change.send(self, flow = self.flow) - - def set_path_components(self, lst, conn): - conn.path_components = lst - signals.flow_change.send(self, flow = self.flow) - - def set_form(self, lst, conn): - conn.urlencoded_form = lst - signals.flow_change.send(self, flow = self.flow) - - def edit_form(self, conn): - self.master.view_grideditor( - grideditor.URLEncodedFormEditor( - self.master, - conn.urlencoded_form.items(multi=True), - self.set_form, - conn - ) - ) - - def edit_form_confirm(self, key, conn): - if key == "y": - self.edit_form(conn) - - def set_cookies(self, lst, conn): - conn.cookies = lst - signals.flow_change.send(self, flow = self.flow) - - def set_setcookies(self, data, conn): - conn.cookies = data - signals.flow_change.send(self, flow = self.flow) - - def edit(self, part): - if self.tab_offset == TAB_REQ: - message = self.flow.request - else: - if not self.flow.response: - self.flow.response = models.HTTPResponse.make(200, b"") - message = self.flow.response - - self.flow.backup() - if message == self.flow.request and part == "c": - self.master.view_grideditor( - grideditor.CookieEditor( - self.master, - message.cookies.items(multi=True), - self.set_cookies, - message - ) - ) - if message == self.flow.response and part == "c": - self.master.view_grideditor( - grideditor.SetCookieEditor( - self.master, - message.cookies.items(multi=True), - self.set_setcookies, - message - ) - ) - if part == "r": - # Fix an issue caused by some editors when editing a - # request/response body. Many editors make it hard to save a - # file without a terminating newline on the last line. When - # editing message bodies, this can cause problems. For now, I - # just strip the newlines off the end of the body when we return - # from an editor. - c = self.master.spawn_editor(message.get_content(strict=False) or b"") - message.content = c.rstrip(b"\n") - elif part == "f": - if not message.urlencoded_form and message.raw_content: - signals.status_prompt_onekey.send( - prompt = "Existing body is not a URL-encoded form. Clear and edit?", - keys = [ - ("yes", "y"), - ("no", "n"), - ], - callback = self.edit_form_confirm, - args = (message,) - ) - else: - self.edit_form(message) - elif part == "h": - self.master.view_grideditor( - grideditor.HeaderEditor( - self.master, - message.headers.fields, - self.set_headers, - message - ) - ) - elif part == "p": - p = message.path_components - self.master.view_grideditor( - grideditor.PathEditor( - self.master, - p, - self.set_path_components, - message - ) - ) - elif part == "q": - self.master.view_grideditor( - grideditor.QueryEditor( - self.master, - message.query.items(multi=True), - self.set_query, message - ) - ) - elif part == "u": - signals.status_prompt.send( - prompt = "URL", - text = message.url, - callback = self.set_url - ) - elif part == "m" and message == self.flow.request: - signals.status_prompt_onekey.send( - prompt = "Method", - keys = common.METHOD_OPTIONS, - callback = self.edit_method - ) - elif part == "o": - signals.status_prompt.send( - prompt = "Code", - text = str(message.status_code), - callback = self.set_resp_status_code - ) - elif part == "m" and message == self.flow.response: - signals.status_prompt.send( - prompt = "Message", - text = message.reason, - callback = self.set_resp_reason - ) - signals.flow_change.send(self, flow = self.flow) - - def _view_nextprev_flow(self, np, flow): - try: - idx = self.state.view.index(flow) - except IndexError: - return - if np == "next": - new_flow, new_idx = self.state.get_next(idx) - else: - new_flow, new_idx = self.state.get_prev(idx) - if new_flow is None: - signals.status_message.send(message="No more flows!") - else: - signals.pop_view_state.send(self) - self.master.view_flow(new_flow, self.tab_offset) - - def view_next_flow(self, flow): - return self._view_nextprev_flow("next", flow) - - def view_prev_flow(self, flow): - return self._view_nextprev_flow("prev", flow) - - def change_this_display_mode(self, t): - self.state.add_flow_setting( - self.flow, - (self.tab_offset, "prettyview"), - contentviews.get_by_shortcut(t) - ) - signals.flow_change.send(self, flow = self.flow) - - def keypress(self, size, key): - conn = None # type: Optional[Union[models.HTTPRequest, models.HTTPResponse]] - if self.tab_offset == TAB_REQ: - conn = self.flow.request - elif self.tab_offset == TAB_RESP: - conn = self.flow.response - - key = super().keypress(size, key) - - # Special case: Space moves over to the next flow. - # We need to catch that before applying common.shortcuts() - if key == " ": - self.view_next_flow(self.flow) - return - - key = common.shortcuts(key) - if key in ("up", "down", "page up", "page down"): - # Pass scroll events to the wrapped widget - self._w.keypress(size, key) - elif key == "a": - self.flow.resume(self.master) - signals.flow_change.send(self, flow = self.flow) - elif key == "A": - self.master.accept_all() - signals.flow_change.send(self, flow = self.flow) - elif key == "d": - if self.state.flow_count() == 1: - self.master.view_flowlist() - elif self.state.view.index(self.flow) == len(self.state.view) - 1: - self.view_prev_flow(self.flow) - else: - self.view_next_flow(self.flow) - f = self.flow - if f.killable: - f.kill(self.master) - self.state.delete_flow(f) - elif key == "D": - f = self.master.state.duplicate_flow(self.flow) - signals.pop_view_state.send(self) - self.master.view_flow(f) - signals.status_message.send(message="Duplicated.") - elif key == "p": - self.view_prev_flow(self.flow) - elif key == "r": - try: - self.master.replay_request(self.flow) - except exceptions.ReplayException as e: - signals.add_log("Replay error: %s" % e, "warn") - signals.flow_change.send(self, flow = self.flow) - elif key == "V": - if self.flow.modified(): - self.state.revert(self.flow) - signals.flow_change.send(self, flow = self.flow) - signals.status_message.send(message="Reverted.") - else: - signals.status_message.send(message="Flow not modified.") - elif key == "W": - signals.status_prompt_path.send( - prompt = "Save this flow", - callback = self.master.save_one_flow, - args = (self.flow,) - ) - elif key == "|": - signals.status_prompt_path.send( - prompt = "Send flow to script", - callback = self.master.run_script_once, - args = (self.flow,) - ) - elif key == "e": - if self.tab_offset == TAB_REQ: - signals.status_prompt_onekey.send( - prompt="Edit request", - keys=( - ("cookies", "c"), - ("query", "q"), - ("path", "p"), - ("url", "u"), - ("header", "h"), - ("form", "f"), - ("raw body", "r"), - ("method", "m"), - ), - callback=self.edit - ) - elif self.tab_offset == TAB_RESP: - signals.status_prompt_onekey.send( - prompt="Edit response", - keys=( - ("cookies", "c"), - ("code", "o"), - ("message", "m"), - ("header", "h"), - ("raw body", "r"), - ), - callback=self.edit - ) - else: - signals.status_message.send( - message="Tab to the request or response", - expire=1 - ) - elif key in set("bfgmxvzEC") and not conn: - signals.status_message.send( - message = "Tab to the request or response", - expire = 1 - ) - return - elif key == "b": - if self.tab_offset == TAB_REQ: - common.ask_save_body("q", self.flow) - else: - common.ask_save_body("s", self.flow) - elif key == "f": - signals.status_message.send(message="Loading all body data...") - self.state.add_flow_setting( - self.flow, - (self.tab_offset, "fullcontents"), - True - ) - signals.flow_change.send(self, flow = self.flow) - signals.status_message.send(message="") - elif key == "m": - p = list(contentviews.view_prompts) - p.insert(0, ("Clear", "C")) - signals.status_prompt_onekey.send( - self, - prompt = "Display mode", - keys = p, - callback = self.change_this_display_mode - ) - elif key == "E": - if self.tab_offset == TAB_REQ: - scope = "q" - else: - scope = "s" - signals.status_prompt_onekey.send( - self, - prompt = "Export to file", - keys = [(e[0], e[1]) for e in export.EXPORTERS], - callback = common.export_to_clip_or_file, - args = (scope, self.flow, common.ask_save_path) - ) - elif key == "C": - if self.tab_offset == TAB_REQ: - scope = "q" - else: - scope = "s" - signals.status_prompt_onekey.send( - self, - prompt = "Export to clipboard", - keys = [(e[0], e[1]) for e in export.EXPORTERS], - callback = common.export_to_clip_or_file, - args = (scope, self.flow, common.copy_to_clipboard_or_prompt) - ) - elif key == "x": - conn.content = None - signals.flow_change.send(self, flow=self.flow) - elif key == "v": - if conn.raw_content: - t = conn.headers.get("content-type") - if "EDITOR" in os.environ or "PAGER" in os.environ: - self.master.spawn_external_viewer(conn.get_content(strict=False), t) - else: - signals.status_message.send( - message = "Error! Set $EDITOR or $PAGER." - ) - elif key == "z": - self.flow.backup() - e = conn.headers.get("content-encoding", "identity") - if e != "identity": - try: - conn.decode() - except ValueError: - signals.status_message.send( - message = "Could not decode - invalid data?" - ) - else: - signals.status_prompt_onekey.send( - prompt = "Select encoding: ", - keys = ( - ("gzip", "z"), - ("deflate", "d"), - ("brotli", "b"), - ), - callback = self.encode_callback, - args = (conn,) - ) - signals.flow_change.send(self, flow = self.flow) - else: - # Key is not handled here. - return key - - def encode_callback(self, key, conn): - encoding_map = { - "z": "gzip", - "d": "deflate", - "b": "brotli", - } - conn.encode(encoding_map[key]) - signals.flow_change.send(self, flow = self.flow) diff --git a/mitmproxy/console/grideditor/__init__.py b/mitmproxy/console/grideditor/__init__.py deleted file mode 100644 index 894f3d22..00000000 --- a/mitmproxy/console/grideditor/__init__.py +++ /dev/null @@ -1,2 +0,0 @@ -from .editors import * # noqa -from . import base # noqa diff --git a/mitmproxy/console/grideditor/base.py b/mitmproxy/console/grideditor/base.py deleted file mode 100644 index 7b687c3e..00000000 --- a/mitmproxy/console/grideditor/base.py +++ /dev/null @@ -1,413 +0,0 @@ -import abc -import copy -from typing import Any -from typing import Callable -from typing import Container -from typing import Iterable -from typing import Optional -from typing import Sequence -from typing import Tuple - -import urwid -from mitmproxy.console import common -from mitmproxy.console import signals - -FOOTER = [ - ('heading_key', "enter"), ":edit ", - ('heading_key', "q"), ":back ", -] -FOOTER_EDITING = [ - ('heading_key', "esc"), ":stop editing ", -] - - -class Cell(urwid.WidgetWrap): - def get_data(self): - """ - Raises: - ValueError, if the current content is invalid. - """ - raise NotImplementedError() - - def selectable(self): - return True - - -class Column(metaclass=abc.ABCMeta): - subeditor = None - - def __init__(self, heading): - self.heading = heading - - @abc.abstractmethod - def Display(self, data) -> Cell: - pass - - @abc.abstractmethod - def Edit(self, data) -> Cell: - pass - - @abc.abstractmethod - def blank(self) -> Any: - pass - - def keypress(self, key: str, editor: "GridEditor") -> Optional[str]: - return key - - -class GridRow(urwid.WidgetWrap): - def __init__( - self, - focused: Optional[int], - editing: bool, - editor: "GridEditor", - values: Tuple[Iterable[bytes], Container[int]] - ): - self.focused = focused - self.editor = editor - self.edit_col = None # type: Optional[Cell] - - errors = values[1] - self.fields = [] - for i, v in enumerate(values[0]): - if focused == i and editing: - self.edit_col = self.editor.columns[i].Edit(v) - self.fields.append(self.edit_col) - else: - w = self.editor.columns[i].Display(v) - if focused == i: - if i in errors: - w = urwid.AttrWrap(w, "focusfield_error") - else: - w = urwid.AttrWrap(w, "focusfield") - elif i in errors: - w = urwid.AttrWrap(w, "field_error") - self.fields.append(w) - - fspecs = self.fields[:] - if len(self.fields) > 1: - fspecs[0] = ("fixed", self.editor.first_width + 2, fspecs[0]) - w = urwid.Columns( - fspecs, - dividechars=2 - ) - if focused is not None: - w.set_focus_column(focused) - super().__init__(w) - - def keypress(self, s, k): - if self.edit_col: - w = self._w.column_widths(s)[self.focused] - k = self.edit_col.keypress((w,), k) - return k - - def selectable(self): - return True - - -class GridWalker(urwid.ListWalker): - """ - Stores rows as a list of (rows, errors) tuples, where rows is a list - and errors is a set with an entry of each offset in rows that is an - error. - """ - - def __init__( - self, - lst: Iterable[list], - editor: "GridEditor" - ): - self.lst = [(i, set()) for i in lst] - self.editor = editor - self.focus = 0 - self.focus_col = 0 - self.edit_row = None # type: Optional[GridRow] - - def _modified(self): - self.editor.show_empty_msg() - return super()._modified() - - def add_value(self, lst): - self.lst.append( - (lst[:], set()) - ) - self._modified() - - def get_current_value(self): - if self.lst: - return self.lst[self.focus][0][self.focus_col] - - def set_current_value(self, val): - errors = self.lst[self.focus][1] - emsg = self.editor.is_error(self.focus_col, val) - if emsg: - signals.status_message.send(message=emsg, expire=5) - errors.add(self.focus_col) - else: - errors.discard(self.focus_col) - self.set_value(val, self.focus, self.focus_col, errors) - - def set_value(self, val, focus, focus_col, errors=None): - if not errors: - errors = set([]) - row = list(self.lst[focus][0]) - row[focus_col] = val - self.lst[focus] = [tuple(row), errors] - self._modified() - - def delete_focus(self): - if self.lst: - del self.lst[self.focus] - self.focus = min(len(self.lst) - 1, self.focus) - self._modified() - - def _insert(self, pos): - self.focus = pos - self.lst.insert( - self.focus, - ([c.blank() for c in self.editor.columns], set([])) - ) - self.focus_col = 0 - self.start_edit() - - def insert(self): - return self._insert(self.focus) - - def add(self): - return self._insert(min(self.focus + 1, len(self.lst))) - - def start_edit(self): - col = self.editor.columns[self.focus_col] - if self.lst and not col.subeditor: - self.edit_row = GridRow( - self.focus_col, True, self.editor, self.lst[self.focus] - ) - self.editor.master.loop.widget.footer.update(FOOTER_EDITING) - self._modified() - - def stop_edit(self): - if self.edit_row: - self.editor.master.loop.widget.footer.update(FOOTER) - try: - val = self.edit_row.edit_col.get_data() - except ValueError: - return - self.edit_row = None - self.set_current_value(val) - - def left(self): - self.focus_col = max(self.focus_col - 1, 0) - self._modified() - - def right(self): - self.focus_col = min(self.focus_col + 1, len(self.editor.columns) - 1) - self._modified() - - def tab_next(self): - self.stop_edit() - if self.focus_col < len(self.editor.columns) - 1: - self.focus_col += 1 - elif self.focus != len(self.lst) - 1: - self.focus_col = 0 - self.focus += 1 - self._modified() - - def get_focus(self): - if self.edit_row: - return self.edit_row, self.focus - elif self.lst: - return GridRow( - self.focus_col, - False, - self.editor, - self.lst[self.focus] - ), self.focus - else: - return None, None - - def set_focus(self, focus): - self.stop_edit() - self.focus = focus - self._modified() - - def get_next(self, pos): - if pos + 1 >= len(self.lst): - return None, None - return GridRow(None, False, self.editor, self.lst[pos + 1]), pos + 1 - - def get_prev(self, pos): - if pos - 1 < 0: - return None, None - return GridRow(None, False, self.editor, self.lst[pos - 1]), pos - 1 - - -class GridListBox(urwid.ListBox): - def __init__(self, lw): - super().__init__(lw) - - -FIRST_WIDTH_MAX = 40 -FIRST_WIDTH_MIN = 20 - - -class GridEditor(urwid.WidgetWrap): - title = None # type: str - columns = None # type: Sequence[Column] - - def __init__( - self, - master: "mitmproxy.console.master.ConsoleMaster", - value: Any, - callback: Callable[..., None], - *cb_args, - **cb_kwargs - ): - value = self.data_in(copy.deepcopy(value)) - self.master = master - self.value = value - self.callback = callback - self.cb_args = cb_args - self.cb_kwargs = cb_kwargs - - first_width = 20 - if value: - for r in value: - assert len(r) == len(self.columns) - first_width = max(len(r), first_width) - self.first_width = min(first_width, FIRST_WIDTH_MAX) - - title = urwid.Text(self.title) - title = urwid.Padding(title, align="left", width=("relative", 100)) - title = urwid.AttrWrap(title, "heading") - - headings = [] - for i, col in enumerate(self.columns): - c = urwid.Text(col.heading) - if i == 0 and len(self.columns) > 1: - headings.append(("fixed", first_width + 2, c)) - else: - headings.append(c) - h = urwid.Columns( - headings, - dividechars=2 - ) - h = urwid.AttrWrap(h, "heading") - - self.walker = GridWalker(self.value, self) - self.lb = GridListBox(self.walker) - w = urwid.Frame( - self.lb, - header=urwid.Pile([title, h]) - ) - super().__init__(w) - self.master.loop.widget.footer.update("") - self.show_empty_msg() - - def show_empty_msg(self): - if self.walker.lst: - self._w.set_footer(None) - else: - self._w.set_footer( - urwid.Text( - [ - ("highlight", "No values. Press "), - ("key", "a"), - ("highlight", " to add some."), - ] - ) - ) - - def set_subeditor_value(self, val, focus, focus_col): - self.walker.set_value(val, focus, focus_col) - - def keypress(self, size, key): - if self.walker.edit_row: - if key in ["esc"]: - self.walker.stop_edit() - elif key == "tab": - pf, pfc = self.walker.focus, self.walker.focus_col - self.walker.tab_next() - if self.walker.focus == pf and self.walker.focus_col != pfc: - self.walker.start_edit() - else: - self._w.keypress(size, key) - return None - - key = common.shortcuts(key) - column = self.columns[self.walker.focus_col] - if key in ["q", "esc"]: - res = [] - for i in self.walker.lst: - if not i[1] and any([x for x in i[0]]): - res.append(i[0]) - self.callback(self.data_out(res), *self.cb_args, **self.cb_kwargs) - signals.pop_view_state.send(self) - elif key == "g": - self.walker.set_focus(0) - elif key == "G": - self.walker.set_focus(len(self.walker.lst) - 1) - elif key in ["h", "left"]: - self.walker.left() - elif key in ["l", "right"]: - self.walker.right() - elif key == "tab": - self.walker.tab_next() - elif key == "a": - self.walker.add() - elif key == "A": - self.walker.insert() - elif key == "d": - self.walker.delete_focus() - elif column.keypress(key, self) and not self.handle_key(key): - return self._w.keypress(size, key) - - def data_out(self, data: Sequence[list]) -> Any: - """ - Called on raw list data, before data is returned through the - callback. - """ - return data - - def data_in(self, data: Any) -> Iterable[list]: - """ - Called to prepare provided data. - """ - return data - - def is_error(self, col: int, val: Any) -> Optional[str]: - """ - Return None, or a string error message. - """ - return False - - def handle_key(self, key): - return False - - def make_help(self): - text = [ - urwid.Text([("text", "Editor control:\n")]) - ] - keys = [ - ("A", "insert row before cursor"), - ("a", "add row after cursor"), - ("d", "delete row"), - ("e", "spawn external editor on current field"), - ("q", "save changes and exit editor"), - ("r", "read value from file"), - ("R", "read unescaped value from file"), - ("esc", "save changes and exit editor"), - ("tab", "next field"), - ("enter", "edit field"), - ] - text.extend( - common.format_keyvals(keys, key="key", val="text", indent=4) - ) - text.append( - urwid.Text( - [ - "\n", - ("text", "Values are escaped Python-style strings.\n"), - ] - ) - ) - return text diff --git a/mitmproxy/console/grideditor/col_bytes.py b/mitmproxy/console/grideditor/col_bytes.py deleted file mode 100644 index 8956de88..00000000 --- a/mitmproxy/console/grideditor/col_bytes.py +++ /dev/null @@ -1,98 +0,0 @@ -import os -from typing import Callable, Optional - -import urwid -from mitmproxy.console import signals -from mitmproxy.console.grideditor import base -from netlib import strutils - - -def read_file(filename: str, callback: Callable[..., None], escaped: bool) -> Optional[str]: - if not filename: - return - - filename = os.path.expanduser(filename) - try: - with open(filename, "r" if escaped else "rb") as f: - d = f.read() - except IOError as v: - return str(v) - - if escaped: - try: - d = strutils.escaped_str_to_bytes(d) - except ValueError: - return "Invalid Python-style string encoding." - # TODO: Refactor the status_prompt_path signal so that we - # can raise exceptions here and return the content instead. - callback(d) - - -class Column(base.Column): - def Display(self, data): - return Display(data) - - def Edit(self, data): - return Edit(data) - - def blank(self): - return b"" - - def keypress(self, key, editor): - if key == "r": - if editor.walker.get_current_value() is not None: - signals.status_prompt_path.send( - self, - prompt="Read file", - callback=read_file, - args=(editor.walker.set_current_value, True) - ) - elif key == "R": - if editor.walker.get_current_value() is not None: - signals.status_prompt_path.send( - self, - prompt="Read unescaped file", - callback=read_file, - args=(editor.walker.set_current_value, False) - ) - elif key == "e": - o = editor.walker.get_current_value() - if o is not None: - n = editor.master.spawn_editor(o) - n = strutils.clean_hanging_newline(n) - editor.walker.set_current_value(n) - elif key in ["enter"]: - editor.walker.start_edit() - else: - return key - - -class Display(base.Cell): - def __init__(self, data: bytes): - self.data = data - escaped = strutils.bytes_to_escaped_str(data) - w = urwid.Text(escaped, wrap="any") - super().__init__(w) - - def get_data(self) -> bytes: - return self.data - - -class Edit(base.Cell): - def __init__(self, data: bytes): - data = strutils.bytes_to_escaped_str(data) - w = urwid.Edit(edit_text=data, wrap="any", multiline=True) - w = urwid.AttrWrap(w, "editfield") - super().__init__(w) - - def get_data(self) -> bytes: - txt = self._w.get_text()[0].strip() - try: - return strutils.escaped_str_to_bytes(txt) - except ValueError: - signals.status_message.send( - self, - message="Invalid Python-style string encoding.", - expire=1000 - ) - raise diff --git a/mitmproxy/console/grideditor/col_subgrid.py b/mitmproxy/console/grideditor/col_subgrid.py deleted file mode 100644 index 8a08f838..00000000 --- a/mitmproxy/console/grideditor/col_subgrid.py +++ /dev/null @@ -1,50 +0,0 @@ -import urwid -from mitmproxy.console.grideditor import base -from mitmproxy.console import signals -from netlib.http import cookies - - -class Column(base.Column): - def __init__(self, heading, subeditor): - super().__init__(heading) - self.subeditor = subeditor - - def Edit(self, data): - raise RuntimeError("SubgridColumn should handle edits itself") - - def Display(self, data): - return Display(data) - - def blank(self): - return [] - - def keypress(self, key, editor): - if key in "rRe": - signals.status_message.send( - self, - message="Press enter to edit this field.", - expire=1000 - ) - return - elif key in ["enter"]: - editor.master.view_grideditor( - self.subeditor( - editor.master, - editor.walker.get_current_value(), - editor.set_subeditor_value, - editor.walker.focus, - editor.walker.focus_col - ) - ) - else: - return key - - -class Display(base.Cell): - def __init__(self, data): - p = cookies._format_pairs(data, sep="\n") - w = urwid.Text(p) - super().__init__(w) - - def get_data(self): - pass diff --git a/mitmproxy/console/grideditor/col_text.py b/mitmproxy/console/grideditor/col_text.py deleted file mode 100644 index ae15374c..00000000 --- a/mitmproxy/console/grideditor/col_text.py +++ /dev/null @@ -1,54 +0,0 @@ -""" -Welcome to the encoding dance! - -In a nutshell, text columns are actually a proxy class for byte columns, -which just encode/decodes contents. -""" - -from mitmproxy.console import signals -from mitmproxy.console.grideditor import col_bytes - - -class Column(col_bytes.Column): - def __init__(self, heading, encoding="utf8", errors="surrogateescape"): - super().__init__(heading) - self.encoding_args = encoding, errors - - def Display(self, data): - return TDisplay(data, self.encoding_args) - - def Edit(self, data): - return TEdit(data, self.encoding_args) - - def blank(self): - return u"" - - -# This is the same for both edit and display. -class EncodingMixin: - def __init__(self, data, encoding_args): - # type: (str) -> TDisplay - self.encoding_args = encoding_args - data = data.encode(*self.encoding_args) - super().__init__(data) - - def get_data(self) -> str: - data = super().get_data() - try: - return data.decode(*self.encoding_args) - except ValueError: - signals.status_message.send( - self, - message="Invalid encoding.", - expire=1000 - ) - raise - - -# urwid forces a different name for a subclass. -class TDisplay(EncodingMixin, col_bytes.Display): - pass - - -class TEdit(EncodingMixin, col_bytes.Edit): - pass diff --git a/mitmproxy/console/grideditor/editors.py b/mitmproxy/console/grideditor/editors.py deleted file mode 100644 index 512c2416..00000000 --- a/mitmproxy/console/grideditor/editors.py +++ /dev/null @@ -1,241 +0,0 @@ -import re -import urwid -from mitmproxy import exceptions -from mitmproxy import flowfilter -from mitmproxy.addons import script -from mitmproxy.console import common -from mitmproxy.console.grideditor import base -from mitmproxy.console.grideditor import col_bytes -from mitmproxy.console.grideditor import col_text -from mitmproxy.console.grideditor import col_subgrid -from mitmproxy.console import signals -from netlib.http import user_agents - - -class QueryEditor(base.GridEditor): - title = "Editing query" - columns = [ - col_text.Column("Key"), - col_text.Column("Value") - ] - - -class HeaderEditor(base.GridEditor): - title = "Editing headers" - columns = [ - col_bytes.Column("Key"), - col_bytes.Column("Value") - ] - - def make_help(self): - h = super().make_help() - text = [ - urwid.Text([("text", "Special keys:\n")]) - ] - keys = [ - ("U", "add User-Agent header"), - ] - text.extend( - common.format_keyvals(keys, key="key", val="text", indent=4) - ) - text.append(urwid.Text([("text", "\n")])) - text.extend(h) - return text - - def set_user_agent(self, k): - ua = user_agents.get_by_shortcut(k) - if ua: - self.walker.add_value( - [ - b"User-Agent", - ua[2].encode() - ] - ) - - def handle_key(self, key): - if key == "U": - signals.status_prompt_onekey.send( - prompt="Add User-Agent header:", - keys=[(i[0], i[1]) for i in user_agents.UASTRINGS], - callback=self.set_user_agent, - ) - return True - - -class URLEncodedFormEditor(base.GridEditor): - title = "Editing URL-encoded form" - columns = [ - col_bytes.Column("Key"), - col_bytes.Column("Value") - ] - - -class ReplaceEditor(base.GridEditor): - title = "Editing replacement patterns" - columns = [ - col_text.Column("Filter"), - col_bytes.Column("Regex"), - col_bytes.Column("Replacement"), - ] - - def is_error(self, col, val): - if col == 0: - if not flowfilter.parse(val): - return "Invalid filter specification." - elif col == 1: - try: - re.compile(val) - except re.error: - return "Invalid regular expression." - return False - - -class SetHeadersEditor(base.GridEditor): - title = "Editing header set patterns" - columns = [ - col_text.Column("Filter"), - col_bytes.Column("Header"), - col_bytes.Column("Value"), - ] - - def is_error(self, col, val): - if col == 0: - if not flowfilter.parse(val): - return "Invalid filter specification" - return False - - def make_help(self): - h = super().make_help() - text = [ - urwid.Text([("text", "Special keys:\n")]) - ] - keys = [ - ("U", "add User-Agent header"), - ] - text.extend( - common.format_keyvals(keys, key="key", val="text", indent=4) - ) - text.append(urwid.Text([("text", "\n")])) - text.extend(h) - return text - - def set_user_agent(self, k): - ua = user_agents.get_by_shortcut(k) - if ua: - self.walker.add_value( - [ - ".*", - b"User-Agent", - ua[2].encode() - ] - ) - - def handle_key(self, key): - if key == "U": - signals.status_prompt_onekey.send( - prompt="Add User-Agent header:", - keys=[(i[0], i[1]) for i in user_agents.UASTRINGS], - callback=self.set_user_agent, - ) - return True - - -class PathEditor(base.GridEditor): - # TODO: Next row on enter? - - title = "Editing URL path components" - columns = [ - col_text.Column("Component"), - ] - - def data_in(self, data): - return [[i] for i in data] - - def data_out(self, data): - return [i[0] for i in data] - - -class ScriptEditor(base.GridEditor): - title = "Editing scripts" - columns = [ - col_text.Column("Command"), - ] - - def is_error(self, col, val): - try: - script.parse_command(val) - except exceptions.AddonError as e: - return str(e) - - -class HostPatternEditor(base.GridEditor): - title = "Editing host patterns" - columns = [ - col_text.Column("Regex (matched on hostname:port / ip:port)") - ] - - def is_error(self, col, val): - try: - re.compile(val, re.IGNORECASE) - except re.error as e: - return "Invalid regex: %s" % str(e) - - def data_in(self, data): - return [[i] for i in data] - - def data_out(self, data): - return [i[0] for i in data] - - -class CookieEditor(base.GridEditor): - title = "Editing request Cookie header" - columns = [ - col_text.Column("Name"), - col_text.Column("Value"), - ] - - -class CookieAttributeEditor(base.GridEditor): - title = "Editing Set-Cookie attributes" - columns = [ - col_text.Column("Name"), - col_text.Column("Value"), - ] - - def data_in(self, data): - return [(k, v or "") for k, v in data] - - def data_out(self, data): - ret = [] - for i in data: - if not i[1]: - ret.append([i[0], None]) - else: - ret.append(i) - return ret - - -class SetCookieEditor(base.GridEditor): - title = "Editing response SetCookie header" - columns = [ - col_text.Column("Name"), - col_text.Column("Value"), - col_subgrid.Column("Attributes", CookieAttributeEditor), - ] - - def data_in(self, data): - flattened = [] - for key, (value, attrs) in data: - flattened.append([key, value, attrs.items(multi=True)]) - return flattened - - def data_out(self, data): - vals = [] - for key, value, attrs in data: - vals.append( - [ - key, - (value, attrs) - ] - ) - return vals diff --git a/mitmproxy/console/help.py b/mitmproxy/console/help.py deleted file mode 100644 index 5ee03f36..00000000 --- a/mitmproxy/console/help.py +++ /dev/null @@ -1,97 +0,0 @@ -import platform - -import urwid - -from mitmproxy import flowfilter -from mitmproxy.console import common -from mitmproxy.console import signals - -from netlib import version - -footer = [ - ("heading", 'mitmproxy {} (Python {}) '.format(version.VERSION, platform.python_version())), - ('heading_key', "q"), ":back ", -] - - -class HelpView(urwid.ListBox): - - def __init__(self, help_context): - self.help_context = help_context or [] - urwid.ListBox.__init__( - self, - self.helptext() - ) - - def helptext(self): - text = [] - text.append(urwid.Text([("head", "This view:\n")])) - text.extend(self.help_context) - - text.append(urwid.Text([("head", "\n\nMovement:\n")])) - keys = [ - ("j, k", "down, up"), - ("h, l", "left, right (in some contexts)"), - ("g, G", "go to beginning, end"), - ("space", "page down"), - ("pg up/down", "page up/down"), - ("ctrl+b/ctrl+f", "page up/down"), - ("arrows", "up, down, left, right"), - ] - text.extend( - common.format_keyvals( - keys, - key="key", - val="text", - indent=4)) - - text.append(urwid.Text([("head", "\n\nGlobal keys:\n")])) - keys = [ - ("i", "set interception pattern"), - ("o", "options"), - ("q", "quit / return to previous page"), - ("Q", "quit without confirm prompt"), - ("R", "replay of requests/responses from file"), - ] - text.extend( - common.format_keyvals(keys, key="key", val="text", indent=4) - ) - - text.append(urwid.Text([("head", "\n\nFilter expressions:\n")])) - text.extend(common.format_keyvals(flowfilter.help, key="key", val="text", indent=4)) - - text.append( - urwid.Text( - [ - "\n", - ("text", " Regexes are Python-style.\n"), - ("text", " Regexes can be specified as quoted strings.\n"), - ("text", " Header matching (~h, ~hq, ~hs) is against a string of the form \"name: value\".\n"), - ("text", " Expressions with no operators are regex matches against URL.\n"), - ("text", " Default binary operator is &.\n"), - ("head", "\n Examples:\n"), - ] - ) - ) - examples = [ - ("google\.com", "Url containing \"google.com"), - ("~q ~b test", "Requests where body contains \"test\""), - ("!(~q & ~t \"text/html\")", "Anything but requests with a text/html content type."), - ] - text.extend( - common.format_keyvals(examples, key="key", val="text", indent=4) - ) - return text - - def keypress(self, size, key): - key = common.shortcuts(key) - if key == "q": - signals.pop_view_state.send(self) - return None - elif key == "?": - key = None - elif key == "g": - self.set_focus(0) - elif key == "G": - self.set_focus(len(self.body.contents)) - return urwid.ListBox.keypress(self, size, key) diff --git a/mitmproxy/console/master.py b/mitmproxy/console/master.py deleted file mode 100644 index 4921373f..00000000 --- a/mitmproxy/console/master.py +++ /dev/null @@ -1,702 +0,0 @@ -import mailcap -import mimetypes -import os -import os.path -import shlex -import signal -import stat -import subprocess -import sys -import tempfile -import traceback -import weakref - -import urwid -from typing import Optional - -from mitmproxy import addons -from mitmproxy import contentviews -from mitmproxy import controller -from mitmproxy import exceptions -from mitmproxy import master -from mitmproxy import io -from mitmproxy import flowfilter -from mitmproxy import utils -from mitmproxy.addons import state -import mitmproxy.options -from mitmproxy.console import flowlist -from mitmproxy.console import flowview -from mitmproxy.console import grideditor -from mitmproxy.console import help -from mitmproxy.console import options -from mitmproxy.console import palettepicker -from mitmproxy.console import palettes -from mitmproxy.console import signals -from mitmproxy.console import statusbar -from mitmproxy.console import window -from mitmproxy.flowfilter import FMarked -from netlib import tcp, strutils - -EVENTLOG_SIZE = 500 - - -class ConsoleState(state.State): - - def __init__(self): - state.State.__init__(self) - self.focus = None - self.follow_focus = None - self.default_body_view = contentviews.get("Auto") - self.flowsettings = weakref.WeakKeyDictionary() - self.last_search = None - self.last_filter = "" - self.mark_filter = False - - def __setattr__(self, name, value): - self.__dict__[name] = value - signals.update_settings.send(self) - - def add_flow_setting(self, flow, key, value): - d = self.flowsettings.setdefault(flow, {}) - d[key] = value - - def get_flow_setting(self, flow, key, default=None): - d = self.flowsettings.get(flow, {}) - return d.get(key, default) - - def add_flow(self, f): - super().add_flow(f) - signals.flowlist_change.send(self) - self.update_focus() - return f - - def update_flow(self, f): - super().update_flow(f) - signals.flowlist_change.send(self) - self.update_focus() - return f - - def set_view_filter(self, txt): - ret = super().set_view_filter(txt) - self.set_focus(self.focus) - return ret - - def get_focus(self): - if not self.view or self.focus is None: - return None, None - return self.view[self.focus], self.focus - - def set_focus(self, idx): - if self.view: - if idx is None or idx < 0: - idx = 0 - elif idx >= len(self.view): - idx = len(self.view) - 1 - self.focus = idx - else: - self.focus = None - - def update_focus(self): - if self.focus is None: - self.set_focus(0) - elif self.follow_focus: - self.set_focus(len(self.view) - 1) - - def set_focus_flow(self, f): - self.set_focus(self.view.index(f)) - - def get_from_pos(self, pos): - if len(self.view) <= pos or pos < 0: - return None, None - return self.view[pos], pos - - def get_next(self, pos): - return self.get_from_pos(pos + 1) - - def get_prev(self, pos): - return self.get_from_pos(pos - 1) - - def delete_flow(self, f): - if f in self.view and self.view.index(f) <= self.focus: - self.focus -= 1 - if self.focus < 0: - self.focus = None - ret = super().delete_flow(f) - self.set_focus(self.focus) - return ret - - def get_nearest_matching_flow(self, flow, flt): - fidx = self.view.index(flow) - dist = 1 - - fprev = fnext = True - while fprev or fnext: - fprev, _ = self.get_from_pos(fidx - dist) - fnext, _ = self.get_from_pos(fidx + dist) - - if fprev and flowfilter.match(flt, fprev): - return fprev - elif fnext and flowfilter.match(flt, fnext): - return fnext - - dist += 1 - - return None - - def enable_marked_filter(self): - marked_flows = [f for f in self.flows if f.marked] - if not marked_flows: - return - - marked_filter = "~%s" % FMarked.code - - # Save Focus - last_focus, _ = self.get_focus() - nearest_marked = self.get_nearest_matching_flow(last_focus, marked_filter) - - self.last_filter = self.filter_txt - self.set_view_filter(marked_filter) - - # Restore Focus - if last_focus.marked: - self.set_focus_flow(last_focus) - else: - self.set_focus_flow(nearest_marked) - - self.mark_filter = True - - def disable_marked_filter(self): - marked_filter = "~%s" % FMarked.code - - # Save Focus - last_focus, _ = self.get_focus() - nearest_marked = self.get_nearest_matching_flow(last_focus, marked_filter) - - self.set_view_filter(self.last_filter) - self.last_filter = "" - - # Restore Focus - if last_focus.marked: - self.set_focus_flow(last_focus) - else: - self.set_focus_flow(nearest_marked) - - self.mark_filter = False - - def clear(self): - marked_flows = [f for f in self.view if f.marked] - super().clear() - - for f in marked_flows: - self.add_flow(f) - f.marked = True - - if len(self.flows.views) == 0: - self.focus = None - else: - self.focus = 0 - self.set_focus(self.focus) - - -class Options(mitmproxy.options.Options): - def __init__( - self, - eventlog: bool = False, - follow: bool = False, - intercept: bool = False, - filter: Optional[str] = None, - palette: Optional[str] = None, - palette_transparent: bool = False, - no_mouse: bool = False, - **kwargs - ): - self.eventlog = eventlog - self.follow = follow - self.intercept = intercept - self.filter = filter - self.palette = palette - self.palette_transparent = palette_transparent - self.no_mouse = no_mouse - super().__init__(**kwargs) - - -class ConsoleMaster(master.Master): - palette = [] - - def __init__(self, options, server): - master.Master.__init__(self, options, server) - self.state = ConsoleState() - self.stream_path = None - # This line is just for type hinting - self.options = self.options # type: Options - self.options.errored.connect(self.options_error) - - r = self.set_intercept(options.intercept) - if r: - print("Intercept error: {}".format(r), file=sys.stderr) - sys.exit(1) - - if options.filter: - self.set_view_filter(options.filter) - - self.palette = options.palette - self.palette_transparent = options.palette_transparent - - self.logbuffer = urwid.SimpleListWalker([]) - self.follow = options.follow - - self.view_stack = [] - - signals.call_in.connect(self.sig_call_in) - signals.pop_view_state.connect(self.sig_pop_view_state) - signals.replace_view_state.connect(self.sig_replace_view_state) - signals.push_view_state.connect(self.sig_push_view_state) - signals.sig_add_log.connect(self.sig_add_log) - self.addons.add(*addons.default_addons()) - self.addons.add(self.state) - - def __setattr__(self, name, value): - self.__dict__[name] = value - signals.update_settings.send(self) - - def options_error(self, opts, exc): - signals.status_message.send( - message=str(exc), - expire=1 - ) - - def sig_add_log(self, sender, e, level): - if self.options.verbosity < utils.log_tier(level): - return - - if level in ("error", "warn"): - signals.status_message.send( - message = "{}: {}".format(level.title(), e) - ) - e = urwid.Text((level, str(e))) - else: - e = urwid.Text(str(e)) - self.logbuffer.append(e) - if len(self.logbuffer) > EVENTLOG_SIZE: - self.logbuffer.pop(0) - self.logbuffer.set_focus(len(self.logbuffer) - 1) - - def add_log(self, e, level): - signals.add_log(e, level) - - def sig_call_in(self, sender, seconds, callback, args=()): - def cb(*_): - return callback(*args) - self.loop.set_alarm_in(seconds, cb) - - def sig_replace_view_state(self, sender): - """ - A view has been pushed onto the stack, and is intended to replace - the current view rather tha creating a new stack entry. - """ - if len(self.view_stack) > 1: - del self.view_stack[1] - - def sig_pop_view_state(self, sender): - """ - Pop the top view off the view stack. If no more views will be left - after this, prompt for exit. - """ - if len(self.view_stack) > 1: - self.view_stack.pop() - self.loop.widget = self.view_stack[-1] - else: - signals.status_prompt_onekey.send( - self, - prompt = "Quit", - keys = ( - ("yes", "y"), - ("no", "n"), - ), - callback = self.quit, - ) - - def sig_push_view_state(self, sender, window): - """ - Push a new view onto the view stack. - """ - self.view_stack.append(window) - self.loop.widget = window - self.loop.draw_screen() - - def run_script_once(self, command, f): - sc = self.addons.get("scriptloader") - try: - with self.handlecontext(): - sc.run_once(command, [f]) - except mitmproxy.exceptions.AddonError as e: - signals.add_log("Script error: %s" % e, "warn") - - def toggle_eventlog(self): - self.options.eventlog = not self.options.eventlog - self.view_flowlist() - signals.replace_view_state.send(self) - - def _readflows(self, path): - """ - Utitility function that reads a list of flows - or prints an error to the UI if that fails. - Returns - - None, if there was an error. - - a list of flows, otherwise. - """ - try: - return io.read_flows_from_paths(path) - except exceptions.FlowReadException as e: - signals.status_message.send(message=str(e)) - - def spawn_editor(self, data): - text = not isinstance(data, bytes) - fd, name = tempfile.mkstemp('', "mproxy", text=text) - with open(fd, "w" if text else "wb") as f: - f.write(data) - # if no EDITOR is set, assume 'vi' - c = os.environ.get("EDITOR") or "vi" - cmd = shlex.split(c) - cmd.append(name) - self.ui.stop() - try: - subprocess.call(cmd) - except: - signals.status_message.send( - message="Can't start editor: %s" % " ".join(c) - ) - else: - with open(name, "r" if text else "rb") as f: - data = f.read() - self.ui.start() - os.unlink(name) - return data - - def spawn_external_viewer(self, data, contenttype): - if contenttype: - contenttype = contenttype.split(";")[0] - ext = mimetypes.guess_extension(contenttype) or "" - else: - ext = "" - fd, name = tempfile.mkstemp(ext, "mproxy") - os.write(fd, data) - os.close(fd) - - # read-only to remind the user that this is a view function - os.chmod(name, stat.S_IREAD) - - cmd = None - shell = False - - if contenttype: - c = mailcap.getcaps() - cmd, _ = mailcap.findmatch(c, contenttype, filename=name) - if cmd: - shell = True - if not cmd: - # hm which one should get priority? - c = os.environ.get("PAGER") or os.environ.get("EDITOR") - if not c: - c = "less" - cmd = shlex.split(c) - cmd.append(name) - self.ui.stop() - try: - subprocess.call(cmd, shell=shell) - except: - signals.status_message.send( - message="Can't start external viewer: %s" % " ".join(c) - ) - self.ui.start() - os.unlink(name) - - def set_palette(self, name): - self.palette = name - self.ui.register_palette( - palettes.palettes[name].palette(self.palette_transparent) - ) - self.ui.clear() - - def ticker(self, *userdata): - changed = self.tick(timeout=0) - if changed: - self.loop.draw_screen() - signals.update_settings.send() - self.loop.set_alarm_in(0.01, self.ticker) - - def run(self): - self.ui = urwid.raw_display.Screen() - self.ui.set_terminal_properties(256) - self.set_palette(self.palette) - self.loop = urwid.MainLoop( - urwid.SolidFill("x"), - screen = self.ui, - handle_mouse = not self.options.no_mouse, - ) - self.ab = statusbar.ActionBar() - - if self.options.rfile: - ret = self.load_flows_path(self.options.rfile) - if ret and self.state.flow_count(): - signals.add_log( - "File truncated or corrupted. " - "Loaded as many flows as possible.", - "error" - ) - elif ret and not self.state.flow_count(): - self.shutdown() - print("Could not load file: {}".format(ret), file=sys.stderr) - sys.exit(1) - - self.loop.set_alarm_in(0.01, self.ticker) - if self.options.http2 and not tcp.HAS_ALPN: # pragma: no cover - def http2err(*args, **kwargs): - signals.status_message.send( - message = "HTTP/2 disabled - OpenSSL 1.0.2+ required." - " Use --no-http2 to silence this warning.", - expire=5 - ) - self.loop.set_alarm_in(0.01, http2err) - - # It's not clear why we need to handle this explicitly - without this, - # mitmproxy hangs on keyboard interrupt. Remove if we ever figure it - # out. - def exit(s, f): - raise urwid.ExitMainLoop - signal.signal(signal.SIGINT, exit) - - self.loop.set_alarm_in( - 0.0001, - lambda *args: self.view_flowlist() - ) - - self.start() - try: - self.loop.run() - except Exception: - self.loop.stop() - sys.stdout.flush() - print(traceback.format_exc(), file=sys.stderr) - print("mitmproxy has crashed!", file=sys.stderr) - print("Please lodge a bug report at:", file=sys.stderr) - print("\thttps://github.com/mitmproxy/mitmproxy", file=sys.stderr) - print("Shutting down...", file=sys.stderr) - sys.stderr.flush() - self.shutdown() - - def view_help(self, helpctx): - signals.push_view_state.send( - self, - window = window.Window( - self, - help.HelpView(helpctx), - None, - statusbar.StatusBar(self, help.footer), - None - ) - ) - - def view_options(self): - for i in self.view_stack: - if isinstance(i["body"], options.Options): - return - signals.push_view_state.send( - self, - window = window.Window( - self, - options.Options(self), - None, - statusbar.StatusBar(self, options.footer), - options.help_context, - ) - ) - - def view_palette_picker(self): - signals.push_view_state.send( - self, - window = window.Window( - self, - palettepicker.PalettePicker(self), - None, - statusbar.StatusBar(self, palettepicker.footer), - palettepicker.help_context, - ) - ) - - def view_grideditor(self, ge): - signals.push_view_state.send( - self, - window = window.Window( - self, - ge, - None, - statusbar.StatusBar(self, grideditor.base.FOOTER), - ge.make_help() - ) - ) - - def view_flowlist(self): - if self.ui.started: - self.ui.clear() - if self.state.follow_focus: - self.state.set_focus(self.state.flow_count()) - - if self.options.eventlog: - body = flowlist.BodyPile(self) - else: - body = flowlist.FlowListBox(self) - - if self.follow: - self.toggle_follow_flows() - - signals.push_view_state.send( - self, - window = window.Window( - self, - body, - None, - statusbar.StatusBar(self, flowlist.footer), - flowlist.help_context - ) - ) - - def view_flow(self, flow, tab_offset=0): - self.state.set_focus_flow(flow) - signals.push_view_state.send( - self, - window = window.Window( - self, - flowview.FlowView(self, self.state, flow, tab_offset), - flowview.FlowViewHeader(self, flow), - statusbar.StatusBar(self, flowview.footer), - flowview.help_context - ) - ) - - def _write_flows(self, path, flows): - if not path: - return - path = os.path.expanduser(path) - try: - f = open(path, "wb") - fw = io.FlowWriter(f) - for i in flows: - fw.add(i) - f.close() - except IOError as v: - signals.status_message.send(message=v.strerror) - - def save_one_flow(self, path, flow): - return self._write_flows(path, [flow]) - - def save_flows(self, path): - return self._write_flows(path, self.state.view) - - def load_flows_callback(self, path): - if not path: - return - ret = self.load_flows_path(path) - return ret or "Flows loaded from %s" % path - - def load_flows_path(self, path): - reterr = None - try: - master.Master.load_flows_file(self, path) - except exceptions.FlowReadException as e: - reterr = str(e) - signals.flowlist_change.send(self) - return reterr - - def accept_all(self): - self.state.accept_all(self) - - def set_view_filter(self, txt): - v = self.state.set_view_filter(txt) - signals.flowlist_change.send(self) - return v - - def set_intercept(self, txt): - return self.state.set_intercept(txt) - - def change_default_display_mode(self, t): - v = contentviews.get_by_shortcut(t) - self.state.default_body_view = v - self.refresh_focus() - - def edit_scripts(self, scripts): - self.options.scripts = [x[0] for x in scripts] - - def quit(self, a): - if a != "n": - raise urwid.ExitMainLoop - - def shutdown(self): - self.state.killall(self) - master.Master.shutdown(self) - - def clear_flows(self): - self.state.clear() - signals.flowlist_change.send(self) - - def toggle_follow_flows(self): - # toggle flow follow - self.state.follow_focus = not self.state.follow_focus - # jump to most recent flow if follow is now on - if self.state.follow_focus: - self.state.set_focus(self.state.flow_count()) - signals.flowlist_change.send(self) - - def delete_flow(self, f): - self.state.delete_flow(f) - signals.flowlist_change.send(self) - - def refresh_focus(self): - if self.state.view: - signals.flow_change.send( - self, - flow = self.state.view[self.state.focus] - ) - - def process_flow(self, f): - should_intercept = any( - [ - self.state.intercept and flowfilter.match(self.state.intercept, f) and not f.request.is_replay, - f.intercepted, - ] - ) - if should_intercept: - f.intercept(self) - signals.flowlist_change.send(self) - signals.flow_change.send(self, flow=f) - - def clear_events(self): - self.logbuffer[:] = [] - - # Handlers - @controller.handler - def error(self, f): - super().error(f) - self.process_flow(f) - - @controller.handler - def request(self, f): - super().request(f) - self.process_flow(f) - - @controller.handler - def response(self, f): - super().response(f) - self.process_flow(f) - - @controller.handler - def tcp_message(self, f): - super().tcp_message(f) - message = f.messages[-1] - direction = "->" if message.from_client else "<-" - self.add_log("{client} {direction} tcp {direction} {server}".format( - client=repr(f.client_conn.address), - server=repr(f.server_conn.address), - direction=direction, - ), "info") - self.add_log(strutils.bytes_to_escaped_str(message.content), "debug") diff --git a/mitmproxy/console/options.py b/mitmproxy/console/options.py deleted file mode 100644 index d0f64713..00000000 --- a/mitmproxy/console/options.py +++ /dev/null @@ -1,255 +0,0 @@ -import urwid - -from mitmproxy import contentviews -from mitmproxy.console import common -from mitmproxy.console import grideditor -from mitmproxy.console import palettes -from mitmproxy.console import select -from mitmproxy.console import signals - -footer = [ - ('heading_key', "enter/space"), ":toggle ", - ('heading_key', "C"), ":clear all ", -] - - -def _mkhelp(): - text = [] - keys = [ - ("enter/space", "activate option"), - ("C", "clear all options"), - ] - text.extend(common.format_keyvals(keys, key="key", val="text", indent=4)) - return text -help_context = _mkhelp() - - -class Options(urwid.WidgetWrap): - - def __init__(self, master): - self.master = master - self.lb = select.Select( - [ - select.Heading("Traffic Manipulation"), - select.Option( - "Header Set Patterns", - "H", - lambda: len(master.options.setheaders), - self.setheaders - ), - select.Option( - "Ignore Patterns", - "I", - lambda: master.options.ignore_hosts, - self.ignore_hosts - ), - select.Option( - "Replacement Patterns", - "R", - lambda: len(master.options.replacements), - self.replacepatterns - ), - select.Option( - "Scripts", - "S", - lambda: master.options.scripts, - self.scripts - ), - - select.Heading("Interface"), - select.Option( - "Default Display Mode", - "M", - self.has_default_displaymode, - self.default_displaymode - ), - select.Option( - "Palette", - "P", - lambda: self.master.palette != palettes.DEFAULT, - self.palette - ), - select.Option( - "Show Host", - "w", - lambda: master.options.showhost, - master.options.toggler("showhost") - ), - - select.Heading("Network"), - select.Option( - "No Upstream Certs", - "U", - lambda: master.options.no_upstream_cert, - master.options.toggler("no_upstream_cert") - ), - select.Option( - "TCP Proxying", - "T", - lambda: master.options.tcp_hosts, - self.tcp_hosts - ), - select.Option( - "Don't Verify SSL/TLS Certificates", - "V", - lambda: master.options.ssl_insecure, - master.options.toggler("ssl_insecure") - ), - - select.Heading("Utility"), - select.Option( - "Anti-Cache", - "a", - lambda: master.options.anticache, - master.options.toggler("anticache") - ), - select.Option( - "Anti-Compression", - "o", - lambda: master.options.anticomp, - master.options.toggler("anticomp") - ), - select.Option( - "Kill Extra", - "x", - lambda: master.options.replay_kill_extra, - master.options.toggler("replay_kill_extra") - ), - select.Option( - "No Refresh", - "f", - lambda: not master.options.refresh_server_playback, - master.options.toggler("refresh_server_playback") - ), - select.Option( - "Sticky Auth", - "A", - lambda: master.options.stickyauth, - self.sticky_auth - ), - select.Option( - "Sticky Cookies", - "t", - lambda: master.options.stickycookie, - self.sticky_cookie - ), - ] - ) - title = urwid.Text("Options") - title = urwid.Padding(title, align="left", width=("relative", 100)) - title = urwid.AttrWrap(title, "heading") - w = urwid.Frame( - self.lb, - header = title - ) - super().__init__(w) - - self.master.loop.widget.footer.update("") - signals.update_settings.connect(self.sig_update_settings) - master.options.changed.connect(self.sig_update_settings) - - def sig_update_settings(self, sender, updated=None): - self.lb.walker._modified() - - def keypress(self, size, key): - if key == "C": - self.clearall() - return None - return super().keypress(size, key) - - def clearall(self): - self.master.options.update( - anticache = False, - anticomp = False, - ignore_hosts = (), - tcp_hosts = (), - replay_kill_extra = False, - no_upstream_cert = False, - refresh_server_playback = True, - replacements = [], - scripts = [], - setheaders = [], - showhost = False, - stickyauth = None, - stickycookie = None, - ) - - self.master.state.default_body_view = contentviews.get("Auto") - - signals.update_settings.send(self) - signals.status_message.send( - message = "All select.Options cleared", - expire = 1 - ) - - def setheaders(self): - self.master.view_grideditor( - grideditor.SetHeadersEditor( - self.master, - self.master.options.setheaders, - self.master.options.setter("setheaders") - ) - ) - - def tcp_hosts(self): - self.master.view_grideditor( - grideditor.HostPatternEditor( - self.master, - self.master.options.tcp_hosts, - self.master.options.setter("tcp_hosts") - ) - ) - - def ignore_hosts(self): - self.master.view_grideditor( - grideditor.HostPatternEditor( - self.master, - self.master.options.ignore_hosts, - self.master.options.setter("ignore_hosts") - ) - ) - - def replacepatterns(self): - self.master.view_grideditor( - grideditor.ReplaceEditor( - self.master, - self.master.options.replacements, - self.master.options.setter("replacements") - ) - ) - - def scripts(self): - self.master.view_grideditor( - grideditor.ScriptEditor( - self.master, - [[i] for i in self.master.options.scripts], - self.master.edit_scripts - ) - ) - - def default_displaymode(self): - signals.status_prompt_onekey.send( - prompt = "Global default display mode", - keys = contentviews.view_prompts, - callback = self.master.change_default_display_mode - ) - - def has_default_displaymode(self): - return self.master.state.default_body_view.name != "Auto" - - def sticky_auth(self): - signals.status_prompt.send( - prompt = "Sticky auth filter", - text = self.master.options.stickyauth, - callback = self.master.options.setter("stickyauth") - ) - - def sticky_cookie(self): - signals.status_prompt.send( - prompt = "Sticky cookie filter", - text = self.master.options.stickycookie, - callback = self.master.options.setter("stickycookie") - ) - - def palette(self): - self.master.view_palette_picker() diff --git a/mitmproxy/console/palettepicker.py b/mitmproxy/console/palettepicker.py deleted file mode 100644 index b0840d8b..00000000 --- a/mitmproxy/console/palettepicker.py +++ /dev/null @@ -1,85 +0,0 @@ -import urwid - -from mitmproxy.console import common -from mitmproxy.console import palettes -from mitmproxy.console import select -from mitmproxy.console import signals - -footer = [ - ('heading_key', "enter/space"), ":select", -] - - -def _mkhelp(): - text = [] - keys = [ - ("enter/space", "select"), - ] - text.extend(common.format_keyvals(keys, key="key", val="text", indent=4)) - return text -help_context = _mkhelp() - - -class PalettePicker(urwid.WidgetWrap): - - def __init__(self, master): - self.master = master - low, high = [], [] - for k, v in palettes.palettes.items(): - if v.high: - high.append(k) - else: - low.append(k) - high.sort() - low.sort() - - options = [ - select.Heading("High Colour") - ] - - def mkopt(name): - return select.Option( - i, - None, - lambda: self.master.palette == name, - lambda: self.select(name) - ) - - for i in high: - options.append(mkopt(i)) - options.append(select.Heading("Low Colour")) - for i in low: - options.append(mkopt(i)) - - options.extend( - [ - select.Heading("Options"), - select.Option( - "Transparent", - "T", - lambda: master.palette_transparent, - self.toggle_palette_transparent - ) - ] - ) - - self.lb = select.Select(options) - title = urwid.Text("Palettes") - title = urwid.Padding(title, align="left", width=("relative", 100)) - title = urwid.AttrWrap(title, "heading") - self._w = urwid.Frame( - self.lb, - header = title - ) - signals.update_settings.connect(self.sig_update_settings) - - def sig_update_settings(self, sender): - self.lb.walker._modified() - - def select(self, name): - self.master.set_palette(name) - - def toggle_palette_transparent(self): - self.master.palette_transparent = not self.master.palette_transparent - self.master.set_palette(self.master.palette) - signals.update_settings.send(self) diff --git a/mitmproxy/console/palettes.py b/mitmproxy/console/palettes.py deleted file mode 100644 index 7b15f98f..00000000 --- a/mitmproxy/console/palettes.py +++ /dev/null @@ -1,330 +0,0 @@ -# Low-color themes should ONLY use the standard foreground and background -# colours listed here: -# -# http://urwid.org/manual/displayattributes.html -# - - -class Palette: - _fields = [ - 'background', - 'title', - - # Status bar & heading - 'heading', 'heading_key', 'heading_inactive', - - # Help - 'key', 'head', 'text', - - # Options - 'option_selected', 'option_active', 'option_active_selected', - 'option_selected_key', - - # List and Connections - 'method', 'focus', - 'code_200', 'code_300', 'code_400', 'code_500', 'code_other', - 'error', "warn", - 'header', 'highlight', 'intercept', 'replay', 'mark', - - # Hex view - 'offset', - - # Grid Editor - 'focusfield', 'focusfield_error', 'field_error', 'editfield', - ] - high = None - - def palette(self, transparent): - l = [] - highback, lowback = None, None - if not transparent: - if self.high and self.high.get("background"): - highback = self.high["background"][1] - lowback = self.low["background"][1] - - for i in self._fields: - if transparent and i == "background": - l.append(["background", "default", "default"]) - else: - v = [i] - low = list(self.low[i]) - if lowback and low[1] == "default": - low[1] = lowback - v.extend(low) - if self.high and i in self.high: - v.append(None) - high = list(self.high[i]) - if highback and high[1] == "default": - high[1] = highback - v.extend(high) - elif highback and self.low[i][1] == "default": - high = [None, low[0], highback] - v.extend(high) - l.append(tuple(v)) - return l - - -class LowDark(Palette): - - """ - Low-color dark background - """ - low = dict( - background = ('white', 'black'), - title = ('white,bold', 'default'), - - # Status bar & heading - heading = ('white', 'dark blue'), - heading_key = ('light cyan', 'dark blue'), - heading_inactive = ('dark gray', 'light gray'), - - # Help - key = ('light cyan', 'default'), - head = ('white,bold', 'default'), - text = ('light gray', 'default'), - - # Options - option_selected = ('black', 'light gray'), - option_selected_key = ('light cyan', 'light gray'), - option_active = ('light red', 'default'), - option_active_selected = ('light red', 'light gray'), - - # List and Connections - method = ('dark cyan', 'default'), - focus = ('yellow', 'default'), - - code_200 = ('dark green', 'default'), - code_300 = ('light blue', 'default'), - code_400 = ('light red', 'default'), - code_500 = ('light red', 'default'), - code_other = ('dark red', 'default'), - - warn = ('brown', 'default'), - error = ('light red', 'default'), - - header = ('dark cyan', 'default'), - highlight = ('white,bold', 'default'), - intercept = ('brown', 'default'), - replay = ('light green', 'default'), - mark = ('light red', 'default'), - - # Hex view - offset = ('dark cyan', 'default'), - - # Grid Editor - focusfield = ('black', 'light gray'), - focusfield_error = ('dark red', 'light gray'), - field_error = ('dark red', 'default'), - editfield = ('white', 'default'), - ) - - -class Dark(LowDark): - high = dict( - heading_inactive = ('g58', 'g11'), - intercept = ('#f60', 'default'), - - option_selected = ('g85', 'g45'), - option_selected_key = ('light cyan', 'g50'), - option_active_selected = ('light red', 'g50'), - ) - - -class LowLight(Palette): - - """ - Low-color light background - """ - low = dict( - background = ('black', 'white'), - title = ('dark magenta', 'default'), - - # Status bar & heading - heading = ('white', 'black'), - heading_key = ('dark blue', 'black'), - heading_inactive = ('black', 'light gray'), - - # Help - key = ('dark blue', 'default'), - head = ('black', 'default'), - text = ('dark gray', 'default'), - - # Options - option_selected = ('black', 'light gray'), - option_selected_key = ('dark blue', 'light gray'), - option_active = ('light red', 'default'), - option_active_selected = ('light red', 'light gray'), - - # List and Connections - method = ('dark cyan', 'default'), - focus = ('black', 'default'), - - code_200 = ('dark green', 'default'), - code_300 = ('light blue', 'default'), - code_400 = ('dark red', 'default'), - code_500 = ('dark red', 'default'), - code_other = ('light red', 'default'), - - error = ('light red', 'default'), - warn = ('brown', 'default'), - - header = ('dark blue', 'default'), - highlight = ('black,bold', 'default'), - intercept = ('brown', 'default'), - replay = ('dark green', 'default'), - mark = ('dark red', 'default'), - - # Hex view - offset = ('dark blue', 'default'), - - # Grid Editor - focusfield = ('black', 'light gray'), - focusfield_error = ('dark red', 'light gray'), - field_error = ('dark red', 'black'), - editfield = ('black', 'default'), - ) - - -class Light(LowLight): - high = dict( - background = ('black', 'g100'), - heading = ('g99', '#08f'), - heading_key = ('#0ff,bold', '#08f'), - heading_inactive = ('g35', 'g85'), - replay = ('#0a0,bold', 'default'), - - option_selected = ('black', 'g85'), - option_selected_key = ('dark blue', 'g85'), - option_active_selected = ('light red', 'g85'), - ) - - -# Solarized palette in Urwid-style terminal high-colour offsets -# See: http://ethanschoonover.com/solarized -sol_base03 = "h234" -sol_base02 = "h235" -sol_base01 = "h240" -sol_base00 = "h241" -sol_base0 = "h244" -sol_base1 = "h245" -sol_base2 = "h254" -sol_base3 = "h230" -sol_yellow = "h136" -sol_orange = "h166" -sol_red = "h160" -sol_magenta = "h125" -sol_violet = "h61" -sol_blue = "h33" -sol_cyan = "h37" -sol_green = "h64" - - -class SolarizedLight(LowLight): - high = dict( - background = (sol_base00, sol_base3), - title = (sol_cyan, 'default'), - text = (sol_base00, 'default'), - - # Status bar & heading - heading = (sol_base2, sol_base02), - heading_key = (sol_blue, sol_base03), - heading_inactive = (sol_base03, sol_base1), - - # Help - key = (sol_blue, 'default',), - head = (sol_base00, 'default'), - - # Options - option_selected = (sol_base03, sol_base2), - option_selected_key = (sol_blue, sol_base2), - option_active = (sol_orange, 'default'), - option_active_selected = (sol_orange, sol_base2), - - # List and Connections - method = (sol_cyan, 'default'), - focus = (sol_base01, 'default'), - - code_200 = (sol_green, 'default'), - code_300 = (sol_blue, 'default'), - code_400 = (sol_orange, 'default',), - code_500 = (sol_red, 'default'), - code_other = (sol_magenta, 'default'), - - error = (sol_red, 'default'), - warn = (sol_orange, 'default'), - - header = (sol_blue, 'default'), - highlight = (sol_base01, 'default'), - intercept = (sol_red, 'default',), - replay = (sol_green, 'default',), - - # Hex view - offset = (sol_cyan, 'default'), - - # Grid Editor - focusfield = (sol_base00, sol_base2), - focusfield_error = (sol_red, sol_base2), - field_error = (sol_red, 'default'), - editfield = (sol_base01, 'default'), - ) - - -class SolarizedDark(LowDark): - high = dict( - background = (sol_base2, sol_base03), - title = (sol_blue, 'default'), - text = (sol_base1, 'default'), - - # Status bar & heading - heading = (sol_base2, sol_base01), - heading_key = (sol_blue + ",bold", sol_base01), - heading_inactive = (sol_base1, sol_base02), - - # Help - key = (sol_blue, 'default',), - head = (sol_base2, 'default'), - - # Options - option_selected = (sol_base03, sol_base00), - option_selected_key = (sol_blue, sol_base00), - option_active = (sol_orange, 'default'), - option_active_selected = (sol_orange, sol_base00), - - # List and Connections - method = (sol_cyan, 'default'), - focus = (sol_base1, 'default'), - - code_200 = (sol_green, 'default'), - code_300 = (sol_blue, 'default'), - code_400 = (sol_orange, 'default',), - code_500 = (sol_red, 'default'), - code_other = (sol_magenta, 'default'), - - error = (sol_red, 'default'), - warn = (sol_orange, 'default'), - - header = (sol_blue, 'default'), - highlight = (sol_base01, 'default'), - intercept = (sol_red, 'default',), - replay = (sol_green, 'default',), - - # Hex view - offset = (sol_cyan, 'default'), - - # Grid Editor - focusfield = (sol_base0, sol_base02), - focusfield_error = (sol_red, sol_base02), - field_error = (sol_red, 'default'), - editfield = (sol_base1, 'default'), - ) - - -DEFAULT = "dark" -palettes = { - "lowlight": LowLight(), - "lowdark": LowDark(), - "light": Light(), - "dark": Dark(), - "solarized_light": SolarizedLight(), - "solarized_dark": SolarizedDark(), -} diff --git a/mitmproxy/console/pathedit.py b/mitmproxy/console/pathedit.py deleted file mode 100644 index 4447070b..00000000 --- a/mitmproxy/console/pathedit.py +++ /dev/null @@ -1,71 +0,0 @@ -import glob -import os.path - -import urwid - - -class _PathCompleter: - - def __init__(self, _testing=False): - """ - _testing: disables reloading of the lookup table to make testing - possible. - """ - self.lookup, self.offset = None, None - self.final = None - self._testing = _testing - - def reset(self): - self.lookup = None - self.offset = -1 - - def complete(self, txt): - """ - Returns the next completion for txt, or None if there is no - completion. - """ - path = os.path.expanduser(txt) - if not self.lookup: - if not self._testing: - # Lookup is a set of (display value, actual value) tuples. - self.lookup = [] - if os.path.isdir(path): - files = glob.glob(os.path.join(path, "*")) - prefix = txt - else: - files = glob.glob(path + "*") - prefix = os.path.dirname(txt) - prefix = prefix or "./" - for f in files: - display = os.path.join(prefix, os.path.basename(f)) - if os.path.isdir(f): - display += "/" - self.lookup.append((display, f)) - if not self.lookup: - self.final = path - return path - self.lookup.sort() - self.offset = -1 - self.lookup.append((txt, txt)) - self.offset += 1 - if self.offset >= len(self.lookup): - self.offset = 0 - ret = self.lookup[self.offset] - self.final = ret[1] - return ret[0] - - -class PathEdit(urwid.Edit, _PathCompleter): - - def __init__(self, *args, **kwargs): - urwid.Edit.__init__(self, *args, **kwargs) - _PathCompleter.__init__(self) - - def keypress(self, size, key): - if key == "tab": - comp = self.complete(self.get_edit_text()) - self.set_edit_text(comp) - self.set_edit_pos(len(comp)) - else: - self.reset() - return urwid.Edit.keypress(self, size, key) diff --git a/mitmproxy/console/searchable.py b/mitmproxy/console/searchable.py deleted file mode 100644 index f8766908..00000000 --- a/mitmproxy/console/searchable.py +++ /dev/null @@ -1,93 +0,0 @@ -import urwid - -from mitmproxy.console import signals - - -class Highlight(urwid.AttrMap): - - def __init__(self, t): - urwid.AttrMap.__init__( - self, - urwid.Text(t.text), - "focusfield", - ) - self.backup = t - - -class Searchable(urwid.ListBox): - - def __init__(self, state, contents): - self.walker = urwid.SimpleFocusListWalker(contents) - urwid.ListBox.__init__(self, self.walker) - self.state = state - self.search_offset = 0 - self.current_highlight = None - self.search_term = None - - def keypress(self, size, key): - if key == "/": - signals.status_prompt.send( - prompt = "Search for", - text = "", - callback = self.set_search - ) - elif key == "n": - self.find_next(False) - elif key == "N": - self.find_next(True) - elif key == "g": - self.set_focus(0) - self.walker._modified() - elif key == "G": - self.set_focus(len(self.walker) - 1) - self.walker._modified() - else: - return super().keypress(size, key) - - def set_search(self, text): - self.state.last_search = text - self.search_term = text or None - self.find_next(False) - - def set_highlight(self, offset): - if self.current_highlight is not None: - old = self.body[self.current_highlight] - self.body[self.current_highlight] = old.backup - if offset is None: - self.current_highlight = None - else: - self.body[offset] = Highlight(self.body[offset]) - self.current_highlight = offset - - def get_text(self, w): - if isinstance(w, urwid.Text): - return w.text - elif isinstance(w, Highlight): - return w.backup.text - else: - return None - - def find_next(self, backwards): - if not self.search_term: - if self.state.last_search: - self.search_term = self.state.last_search - else: - self.set_highlight(None) - return - # Start search at focus + 1 - if backwards: - rng = range(len(self.body) - 1, -1, -1) - else: - rng = range(1, len(self.body) + 1) - for i in rng: - off = (self.focus_position + i) % len(self.body) - w = self.body[off] - txt = self.get_text(w) - if txt and self.search_term in txt: - self.set_highlight(off) - self.set_focus(off, coming_from="above") - self.body._modified() - return - else: - self.set_highlight(None) - signals.status_message.send(message="Search not found.", expire=1) diff --git a/mitmproxy/console/select.py b/mitmproxy/console/select.py deleted file mode 100644 index 9f6a4cad..00000000 --- a/mitmproxy/console/select.py +++ /dev/null @@ -1,121 +0,0 @@ -import urwid - -from mitmproxy.console import common - - -class _OptionWidget(urwid.WidgetWrap): - - def __init__(self, option, text, shortcut, active, focus): - self.option = option - textattr = "text" - keyattr = "key" - if focus and active: - textattr = "option_active_selected" - keyattr = "option_selected_key" - elif focus: - textattr = "option_selected" - keyattr = "option_selected_key" - elif active: - textattr = "option_active" - if shortcut: - text = common.highlight_key( - text, - shortcut, - textattr = textattr, - keyattr = keyattr - ) - opt = urwid.Text(text, align="left") - opt = urwid.AttrWrap(opt, textattr) - opt = urwid.Padding(opt, align = "center", width = 40) - urwid.WidgetWrap.__init__(self, opt) - - def keypress(self, size, key): - return key - - def selectable(self): - return True - - -class OptionWalker(urwid.ListWalker): - - def __init__(self, options): - urwid.ListWalker.__init__(self) - self.options = options - self.focus = 0 - - def set_focus(self, pos): - self.focus = pos - - def get_focus(self): - return self.options[self.focus].render(True), self.focus - - def get_next(self, pos): - if pos >= len(self.options) - 1: - return None, None - return self.options[pos + 1].render(False), pos + 1 - - def get_prev(self, pos): - if pos <= 0: - return None, None - return self.options[pos - 1].render(False), pos - 1 - - -class Heading: - - def __init__(self, text): - self.text = text - - def render(self, focus): - opt = urwid.Text("\n" + self.text, align="left") - opt = urwid.AttrWrap(opt, "title") - opt = urwid.Padding(opt, align = "center", width = 40) - return opt - - -def _neg(*args): - return False - - -class Option: - - def __init__(self, text, shortcut, getstate=None, activate=None): - self.text = text - self.shortcut = shortcut - self.getstate = getstate or _neg - self.activate = activate or _neg - - def render(self, focus): - return _OptionWidget( - self, - self.text, - self.shortcut, - self.getstate(), - focus) - - -class Select(urwid.ListBox): - - def __init__(self, options): - self.walker = OptionWalker(options) - urwid.ListBox.__init__( - self, - self.walker - ) - self.options = options - self.keymap = {} - for i in options: - if hasattr(i, "shortcut") and i.shortcut: - if i.shortcut in self.keymap: - raise ValueError("Duplicate shortcut key: %s" % i.shortcut) - self.keymap[i.shortcut] = i - - def keypress(self, size, key): - if key == "enter" or key == " ": - self.get_focus()[0].option.activate() - return None - key = common.shortcuts(key) - if key in self.keymap: - self.keymap[key].activate() - self.set_focus(self.options.index(self.keymap[key])) - return None - return super().keypress(size, key) diff --git a/mitmproxy/console/signals.py b/mitmproxy/console/signals.py deleted file mode 100644 index 3cd8bc4b..00000000 --- a/mitmproxy/console/signals.py +++ /dev/null @@ -1,44 +0,0 @@ -import blinker - -# Show a status message in the action bar -sig_add_log = blinker.Signal() - - -def add_log(e, level): - sig_add_log.send( - None, - e=e, - level=level - ) - -# Show a status message in the action bar -status_message = blinker.Signal() - -# Prompt for input -status_prompt = blinker.Signal() - -# Prompt for a path -status_prompt_path = blinker.Signal() - -# Prompt for a single keystroke -status_prompt_onekey = blinker.Signal() - -# Call a callback in N seconds -call_in = blinker.Signal() - -# Focus the body, footer or header of the main window -focus = blinker.Signal() - -# Fired when settings change -update_settings = blinker.Signal() - -# Fired when a flow changes -flow_change = blinker.Signal() - -# Fired when the flow list or focus changes -flowlist_change = blinker.Signal() - -# Pop and push view state onto a stack -pop_view_state = blinker.Signal() -push_view_state = blinker.Signal() -replace_view_state = blinker.Signal() diff --git a/mitmproxy/console/statusbar.py b/mitmproxy/console/statusbar.py deleted file mode 100644 index e7944a9e..00000000 --- a/mitmproxy/console/statusbar.py +++ /dev/null @@ -1,262 +0,0 @@ -import os.path - -import urwid - -import netlib.http.url -from mitmproxy.console import common -from mitmproxy.console import pathedit -from mitmproxy.console import signals -from netlib import human - - -class ActionBar(urwid.WidgetWrap): - - def __init__(self): - urwid.WidgetWrap.__init__(self, None) - self.clear() - signals.status_message.connect(self.sig_message) - signals.status_prompt.connect(self.sig_prompt) - signals.status_prompt_path.connect(self.sig_path_prompt) - signals.status_prompt_onekey.connect(self.sig_prompt_onekey) - - self.last_path = "" - - self.prompting = False - self.onekey = False - self.pathprompt = False - - def sig_message(self, sender, message, expire=None): - if self.prompting: - return - w = urwid.Text(message) - self._w = w - if expire: - def cb(*args): - if w == self._w: - self.clear() - signals.call_in.send(seconds=expire, callback=cb) - - def prep_prompt(self, p): - return p.strip() + ": " - - def sig_prompt(self, sender, prompt, text, callback, args=()): - signals.focus.send(self, section="footer") - self._w = urwid.Edit(self.prep_prompt(prompt), text or "") - self.prompting = (callback, args) - - def sig_path_prompt(self, sender, prompt, callback, args=()): - signals.focus.send(self, section="footer") - self._w = pathedit.PathEdit( - self.prep_prompt(prompt), - os.path.dirname(self.last_path) - ) - self.pathprompt = True - self.prompting = (callback, args) - - def sig_prompt_onekey(self, sender, prompt, keys, callback, args=()): - """ - Keys are a set of (word, key) tuples. The appropriate key in the - word is highlighted. - """ - signals.focus.send(self, section="footer") - prompt = [prompt, " ("] - mkup = [] - for i, e in enumerate(keys): - mkup.extend(common.highlight_key(e[0], e[1])) - if i < len(keys) - 1: - mkup.append(",") - prompt.extend(mkup) - prompt.append(")? ") - self.onekey = set(i[1] for i in keys) - self._w = urwid.Edit(prompt, "") - self.prompting = (callback, args) - - def selectable(self): - return True - - def keypress(self, size, k): - if self.prompting: - if k == "esc": - self.prompt_done() - elif self.onekey: - if k == "enter": - self.prompt_done() - elif k in self.onekey: - self.prompt_execute(k) - elif k == "enter": - self.prompt_execute(self._w.get_edit_text()) - else: - if common.is_keypress(k): - self._w.keypress(size, k) - else: - return k - - def clear(self): - self._w = urwid.Text("") - self.prompting = False - - def prompt_done(self): - self.prompting = False - self.onekey = False - self.pathprompt = False - signals.status_message.send(message="") - signals.focus.send(self, section="body") - - def prompt_execute(self, txt): - if self.pathprompt: - self.last_path = txt - p, args = self.prompting - self.prompt_done() - msg = p(txt, *args) - if msg: - signals.status_message.send(message=msg, expire=1) - - -class StatusBar(urwid.WidgetWrap): - - def __init__(self, master: "mitmproxy.console.master.ConsoleMaster", helptext): - self.master = master - self.helptext = helptext - self.ib = urwid.WidgetWrap(urwid.Text("")) - super().__init__(urwid.Pile([self.ib, self.master.ab])) - signals.update_settings.connect(self.sig_update_settings) - signals.flowlist_change.connect(self.sig_update_settings) - master.options.changed.connect(self.sig_update_settings) - self.redraw() - - def sig_update_settings(self, sender, updated=None): - self.redraw() - - def keypress(self, *args, **kwargs): - return self.master.ab.keypress(*args, **kwargs) - - def get_status(self): - r = [] - - sreplay = self.master.addons.get("serverplayback") - creplay = self.master.addons.get("clientplayback") - - if len(self.master.options.setheaders): - r.append("[") - r.append(("heading_key", "H")) - r.append("eaders]") - if len(self.master.options.replacements): - r.append("[") - r.append(("heading_key", "R")) - r.append("eplacing]") - if creplay.count(): - r.append("[") - r.append(("heading_key", "cplayback")) - r.append(":%s]" % creplay.count()) - if sreplay.count(): - r.append("[") - r.append(("heading_key", "splayback")) - r.append(":%s]" % sreplay.count()) - if self.master.options.ignore_hosts: - r.append("[") - r.append(("heading_key", "I")) - r.append("gnore:%d]" % len(self.master.options.ignore_hosts)) - if self.master.options.tcp_hosts: - r.append("[") - r.append(("heading_key", "T")) - r.append("CP:%d]" % len(self.master.options.tcp_hosts)) - if self.master.state.intercept_txt: - r.append("[") - r.append(("heading_key", "i")) - r.append(":%s]" % self.master.state.intercept_txt) - if self.master.state.filter_txt: - r.append("[") - r.append(("heading_key", "f")) - r.append(":%s]" % self.master.state.filter_txt) - if self.master.options.stickycookie: - r.append("[") - r.append(("heading_key", "t")) - r.append(":%s]" % self.master.options.stickycookie) - if self.master.options.stickyauth: - r.append("[") - r.append(("heading_key", "u")) - r.append(":%s]" % self.master.options.stickyauth) - if self.master.state.default_body_view.name != "Auto": - r.append("[") - r.append(("heading_key", "M")) - r.append(":%s]" % self.master.state.default_body_view.name) - - opts = [] - if self.master.options.anticache: - opts.append("anticache") - if self.master.options.anticomp: - opts.append("anticomp") - if self.master.options.showhost: - opts.append("showhost") - if not self.master.options.refresh_server_playback: - opts.append("norefresh") - if self.master.options.replay_kill_extra: - opts.append("killextra") - if self.master.options.no_upstream_cert: - opts.append("no-upstream-cert") - if self.master.state.follow_focus: - opts.append("following") - if self.master.options.stream_large_bodies: - opts.append( - "stream:%s" % human.pretty_size( - self.master.options.stream_large_bodies - ) - ) - - if opts: - r.append("[%s]" % (":".join(opts))) - - if self.master.options.mode in ["reverse", "upstream"]: - dst = self.master.server.config.upstream_server - r.append("[dest:%s]" % netlib.http.url.unparse( - dst.scheme, - dst.address.host, - dst.address.port - )) - if self.master.options.scripts: - r.append("[") - r.append(("heading_key", "s")) - r.append("cripts:%s]" % len(self.master.options.scripts)) - - if self.master.options.outfile: - r.append("[W:%s]" % self.master.options.outfile[0]) - - return r - - def redraw(self): - fc = self.master.state.flow_count() - if self.master.state.focus is None: - offset = 0 - else: - offset = min(self.master.state.focus + 1, fc) - t = [ - ('heading', ("[%s/%s]" % (offset, fc)).ljust(9)) - ] - - if self.master.server.bound: - host = self.master.server.address.host - if host == "0.0.0.0": - host = "*" - boundaddr = "[%s:%s]" % (host, self.master.server.address.port) - else: - boundaddr = "" - t.extend(self.get_status()) - status = urwid.AttrWrap(urwid.Columns([ - urwid.Text(t), - urwid.Text( - [ - self.helptext, - boundaddr - ], - align="right" - ), - ]), "heading") - self.ib._w = status - - def update(self, text): - self.helptext = text - self.redraw() - self.master.loop.draw_screen() - - def selectable(self): - return True diff --git a/mitmproxy/console/tabs.py b/mitmproxy/console/tabs.py deleted file mode 100644 index a2d5e719..00000000 --- a/mitmproxy/console/tabs.py +++ /dev/null @@ -1,70 +0,0 @@ -import urwid - - -class Tab(urwid.WidgetWrap): - - def __init__(self, offset, content, attr, onclick): - """ - onclick is called on click with the tab offset as argument - """ - p = urwid.Text(content, align="center") - p = urwid.Padding(p, align="center", width=("relative", 100)) - p = urwid.AttrWrap(p, attr) - urwid.WidgetWrap.__init__(self, p) - self.offset = offset - self.onclick = onclick - - def mouse_event(self, size, event, button, col, row, focus): - if event == "mouse press" and button == 1: - self.onclick(self.offset) - return True - - -class Tabs(urwid.WidgetWrap): - - def __init__(self, tabs, tab_offset=0): - super().__init__("") - self.tab_offset = tab_offset - self.tabs = tabs - self.show() - - def change_tab(self, offset): - self.tab_offset = offset - self.show() - - def keypress(self, size, key): - n = len(self.tabs) - if key in ["tab", "l"]: - self.change_tab((self.tab_offset + 1) % n) - elif key == "h": - self.change_tab((self.tab_offset - 1) % n) - return self._w.keypress(size, key) - - def show(self): - headers = [] - for i in range(len(self.tabs)): - txt = self.tabs[i][0]() - if i == self.tab_offset: - headers.append( - Tab( - i, - txt, - "heading", - self.change_tab - ) - ) - else: - headers.append( - Tab( - i, - txt, - "heading_inactive", - self.change_tab - ) - ) - headers = urwid.Columns(headers, dividechars=1) - self._w = urwid.Frame( - body = self.tabs[self.tab_offset][1](), - header = headers - ) - self._w.set_focus("body") diff --git a/mitmproxy/console/window.py b/mitmproxy/console/window.py deleted file mode 100644 index b972208e..00000000 --- a/mitmproxy/console/window.py +++ /dev/null @@ -1,111 +0,0 @@ -import urwid - -from mitmproxy.console import signals - - -class Window(urwid.Frame): - - def __init__(self, master, body, header, footer, helpctx): - urwid.Frame.__init__( - self, - urwid.AttrWrap(body, "background"), - header = urwid.AttrWrap(header, "background") if header else None, - footer = urwid.AttrWrap(footer, "background") if footer else None - ) - self.master = master - self.helpctx = helpctx - signals.focus.connect(self.sig_focus) - - def sig_focus(self, sender, section): - self.focus_position = section - - def mouse_event(self, *args, **kwargs): - # args: (size, event, button, col, row) - k = super().mouse_event(*args, **kwargs) - if not k: - if args[1] == "mouse drag": - signals.status_message.send( - message = "Hold down fn, shift, alt or ctrl to select text or use the --no-mouse parameter.", - expire = 1 - ) - elif args[1] == "mouse press" and args[2] == 4: - self.keypress(args[0], "up") - elif args[1] == "mouse press" and args[2] == 5: - self.keypress(args[0], "down") - else: - return False - return True - - def handle_replay(self, k): - if k == "c": - creplay = self.master.addons.get("clientplayback") - if self.master.options.client_replay and creplay.count(): - def stop_client_playback_prompt(a): - if a != "n": - self.master.options.client_replay = None - signals.status_prompt_onekey.send( - self, - prompt = "Stop current client replay?", - keys = ( - ("yes", "y"), - ("no", "n"), - ), - callback = stop_client_playback_prompt - ) - else: - signals.status_prompt_path.send( - self, - prompt = "Client replay path", - callback = lambda x: self.master.options.setter("client_replay")([x]) - ) - elif k == "s": - a = self.master.addons.get("serverplayback") - if a.count(): - def stop_server_playback(response): - if response == "y": - self.master.options.server_replay = [] - signals.status_prompt_onekey.send( - self, - prompt = "Stop current server replay?", - keys = ( - ("yes", "y"), - ("no", "n"), - ), - callback = stop_server_playback - ) - else: - signals.status_prompt_path.send( - self, - prompt = "Server playback path", - callback = lambda x: self.master.options.setter("server_replay")([x]) - ) - - def keypress(self, size, k): - k = super().keypress(size, k) - if k == "?": - self.master.view_help(self.helpctx) - elif k == "i": - signals.status_prompt.send( - self, - prompt = "Intercept filter", - text = self.master.state.intercept_txt, - callback = self.master.set_intercept - ) - elif k == "o": - self.master.view_options() - elif k == "Q": - raise urwid.ExitMainLoop - elif k == "q": - signals.pop_view_state.send(self) - elif k == "R": - signals.status_prompt_onekey.send( - self, - prompt = "Replay", - keys = ( - ("client", "c"), - ("server", "s"), - ), - callback = self.handle_replay, - ) - else: - return k diff --git a/mitmproxy/dump.py b/mitmproxy/dump.py deleted file mode 100644 index 47f69303..00000000 --- a/mitmproxy/dump.py +++ /dev/null @@ -1,84 +0,0 @@ -import typing -from typing import Optional - -from mitmproxy import controller -from mitmproxy import exceptions -from mitmproxy import addons -from mitmproxy import io -from mitmproxy import options -from mitmproxy import master -from mitmproxy.addons import dumper, termlog -from netlib import tcp - - -class DumpError(Exception): - pass - - -class Options(options.Options): - def __init__( - self, - keepserving: bool = False, - filtstr: Optional[str] = None, - flow_detail: int = 1, - tfile: Optional[typing.io.TextIO] = None, - **kwargs - ): - self.filtstr = filtstr - self.flow_detail = flow_detail - self.keepserving = keepserving - self.tfile = tfile - super().__init__(**kwargs) - - -class DumpMaster(master.Master): - - def __init__(self, options, server): - master.Master.__init__(self, options, server) - self.has_errored = False - self.addons.add(termlog.TermLog()) - self.addons.add(*addons.default_addons()) - self.addons.add(dumper.Dumper()) - # This line is just for type hinting - self.options = self.options # type: Options - - if not self.options.no_server: - self.add_log( - "Proxy server listening at http://{}".format(server.address), - "info" - ) - - if self.server and self.options.http2 and not tcp.HAS_ALPN: # pragma: no cover - self.add_log( - "ALPN support missing (OpenSSL 1.0.2+ required)!\n" - "HTTP/2 is disabled. Use --no-http2 to silence this warning.", - "error" - ) - - if options.rfile: - try: - self.load_flows_file(options.rfile) - except exceptions.FlowReadException as v: - self.add_log("Flow file corrupted.", "error") - raise DumpError(v) - - def _readflow(self, paths): - """ - Utitility function that reads a list of flows - or raises a DumpError if that fails. - """ - try: - return io.read_flows_from_paths(paths) - except exceptions.FlowReadException as e: - raise DumpError(str(e)) - - @controller.handler - def log(self, e): - if e.level == "error": - self.has_errored = True - - def run(self): # pragma: no cover - if self.options.rfile and not self.options.keepserving: - self.addons.done() - return - super().run() diff --git a/mitmproxy/events.py b/mitmproxy/events.py index 0e512aae..56f1a45b 100644 --- a/mitmproxy/events.py +++ b/mitmproxy/events.py @@ -1,5 +1,6 @@ from mitmproxy import controller -from mitmproxy import models +from mitmproxy import http +from mitmproxy import tcp Events = frozenset([ "clientconnect", @@ -34,7 +35,7 @@ Events = frozenset([ def event_sequence(f): - if isinstance(f, models.HTTPFlow): + if isinstance(f, http.HTTPFlow): if f.request: yield "requestheaders", f yield "request", f @@ -43,7 +44,7 @@ def event_sequence(f): yield "response", f if f.error: yield "error", f - elif isinstance(f, models.TCPFlow): + elif isinstance(f, tcp.TCPFlow): messages = f.messages f.messages = [] f.reply = controller.DummyReply() diff --git a/mitmproxy/flow.py b/mitmproxy/flow.py new file mode 100644 index 00000000..13b852ef --- /dev/null +++ b/mitmproxy/flow.py @@ -0,0 +1,190 @@ +import time +import copy +import uuid + +from mitmproxy import stateobject +from mitmproxy import connections + +from netlib import version +from typing import Optional # noqa + + +class Error(stateobject.StateObject): + + """ + An Error. + + This is distinct from an protocol error response (say, a HTTP code 500), + which is represented by a normal HTTPResponse object. This class is + responsible for indicating errors that fall outside of normal protocol + communications, like interrupted connections, timeouts, protocol errors. + + Exposes the following attributes: + + msg: Message describing the error + timestamp: Seconds since the epoch + """ + + def __init__(self, msg, timestamp=None): + """ + @type msg: str + @type timestamp: float + """ + self.msg = msg + self.timestamp = timestamp or time.time() + + _stateobject_attributes = dict( + msg=str, + timestamp=float + ) + + def __str__(self): + return self.msg + + def __repr__(self): + return self.msg + + @classmethod + def from_state(cls, state): + # the default implementation assumes an empty constructor. Override + # accordingly. + f = cls(None) + f.set_state(state) + return f + + def copy(self): + c = copy.copy(self) + return c + + +class Flow(stateobject.StateObject): + + """ + A Flow is a collection of objects representing a single transaction. + This class is usually subclassed for each protocol, e.g. HTTPFlow. + """ + + def __init__( + self, + type: str, + client_conn: connections.ClientConnection, + server_conn: connections.ServerConnection, + live=None + ): + self.type = type + self.id = str(uuid.uuid4()) + self.client_conn = client_conn + self.server_conn = server_conn + self.live = live + + self.error = None # type: Optional[Error] + self.intercepted = False # type: bool + self._backup = None # type: Optional[Flow] + self.reply = None + self.marked = False # type: bool + + _stateobject_attributes = dict( + id=str, + error=Error, + client_conn=connections.ClientConnection, + server_conn=connections.ServerConnection, + type=str, + intercepted=bool, + marked=bool, + ) + + def get_state(self): + d = super().get_state() + d.update(version=version.IVERSION) + if self._backup and self._backup != d: + d.update(backup=self._backup) + return d + + def set_state(self, state): + state.pop("version") + if "backup" in state: + self._backup = state.pop("backup") + super().set_state(state) + + @classmethod + def from_state(cls, state): + f = cls(None, None) + f.set_state(state) + return f + + def copy(self): + f = copy.copy(self) + + f.id = str(uuid.uuid4()) + f.live = False + f.client_conn = self.client_conn.copy() + f.server_conn = self.server_conn.copy() + + if self.error: + f.error = self.error.copy() + return f + + def modified(self): + """ + Has this Flow been modified? + """ + if self._backup: + return self._backup != self.get_state() + else: + return False + + def backup(self, force=False): + """ + Save a backup of this Flow, which can be reverted to using a + call to .revert(). + """ + if not self._backup: + self._backup = self.get_state() + + def revert(self): + """ + Revert to the last backed up state. + """ + if self._backup: + self.set_state(self._backup) + self._backup = None + + @property + def killable(self): + return self.reply and self.reply.state in {"handled", "taken"} + + def kill(self, master): + """ + Kill this request. + """ + self.error = Error("Connection killed") + self.intercepted = False + # reply.state should only be "handled" or "taken" here. + # if none of this is the case, .take() will raise an exception. + if self.reply.state != "taken": + self.reply.take() + self.reply.kill(force=True) + self.reply.commit() + master.error(self) + + def intercept(self, master): + """ + Intercept this Flow. Processing will stop until resume is + called. + """ + if self.intercepted: + return + self.intercepted = True + self.reply.take() + master.addons("intercept", self) + + def resume(self, master): + """ + Continue with the flow - called after an intercept(). + """ + if not self.intercepted: + return + self.intercepted = False + self.reply.ack() + self.reply.commit() + master.addons("intercept", self) diff --git a/mitmproxy/flowfilter.py b/mitmproxy/flowfilter.py index b63c27d9..f1454fd1 100644 --- a/mitmproxy/flowfilter.py +++ b/mitmproxy/flowfilter.py @@ -36,9 +36,9 @@ import re import sys import functools -from mitmproxy.models.http import HTTPFlow -from mitmproxy.models.tcp import TCPFlow -from mitmproxy.models.flow import Flow +from mitmproxy import http +from mitmproxy import tcp +from mitmproxy import flow from netlib import strutils @@ -94,7 +94,7 @@ class FHTTP(_Action): code = "http" help = "Match HTTP flows" - @only(HTTPFlow) + @only(http.HTTPFlow) def __call__(self, f): return True @@ -103,7 +103,7 @@ class FTCP(_Action): code = "tcp" help = "Match TCP flows" - @only(TCPFlow) + @only(tcp.TCPFlow) def __call__(self, f): return True @@ -112,7 +112,7 @@ class FReq(_Action): code = "q" help = "Match request with no response" - @only(HTTPFlow) + @only(http.HTTPFlow) def __call__(self, f): if not f.response: return True @@ -122,7 +122,7 @@ class FResp(_Action): code = "s" help = "Match response" - @only(HTTPFlow) + @only(http.HTTPFlow) def __call__(self, f): return bool(f.response) @@ -162,7 +162,7 @@ class FAsset(_Action): ] ASSET_TYPES = [re.compile(x) for x in ASSET_TYPES] - @only(HTTPFlow) + @only(http.HTTPFlow) def __call__(self, f): if f.response: for i in self.ASSET_TYPES: @@ -175,7 +175,7 @@ class FContentType(_Rex): code = "t" help = "Content-type header" - @only(HTTPFlow) + @only(http.HTTPFlow) def __call__(self, f): if _check_content_type(self.re, f.request): return True @@ -188,7 +188,7 @@ class FContentTypeRequest(_Rex): code = "tq" help = "Request Content-Type header" - @only(HTTPFlow) + @only(http.HTTPFlow) def __call__(self, f): return _check_content_type(self.re, f.request) @@ -197,7 +197,7 @@ class FContentTypeResponse(_Rex): code = "ts" help = "Response Content-Type header" - @only(HTTPFlow) + @only(http.HTTPFlow) def __call__(self, f): if f.response: return _check_content_type(self.re, f.response) @@ -209,7 +209,7 @@ class FHead(_Rex): help = "Header" flags = re.MULTILINE - @only(HTTPFlow) + @only(http.HTTPFlow) def __call__(self, f): if f.request and self.re.search(bytes(f.request.headers)): return True @@ -223,7 +223,7 @@ class FHeadRequest(_Rex): help = "Request header" flags = re.MULTILINE - @only(HTTPFlow) + @only(http.HTTPFlow) def __call__(self, f): if f.request and self.re.search(bytes(f.request.headers)): return True @@ -234,7 +234,7 @@ class FHeadResponse(_Rex): help = "Response header" flags = re.MULTILINE - @only(HTTPFlow) + @only(http.HTTPFlow) def __call__(self, f): if f.response and self.re.search(bytes(f.response.headers)): return True @@ -245,16 +245,16 @@ class FBod(_Rex): help = "Body" flags = re.DOTALL - @only(HTTPFlow, TCPFlow) + @only(http.HTTPFlow, tcp.TCPFlow) def __call__(self, f): - if isinstance(f, HTTPFlow): + if isinstance(f, http.HTTPFlow): if f.request and f.request.raw_content: if self.re.search(f.request.get_content(strict=False)): return True if f.response and f.response.raw_content: if self.re.search(f.response.get_content(strict=False)): return True - elif isinstance(f, TCPFlow): + elif isinstance(f, tcp.TCPFlow): for msg in f.messages: if self.re.search(msg.content): return True @@ -266,13 +266,13 @@ class FBodRequest(_Rex): help = "Request body" flags = re.DOTALL - @only(HTTPFlow, TCPFlow) + @only(http.HTTPFlow, tcp.TCPFlow) def __call__(self, f): - if isinstance(f, HTTPFlow): + if isinstance(f, http.HTTPFlow): if f.request and f.request.raw_content: if self.re.search(f.request.get_content(strict=False)): return True - elif isinstance(f, TCPFlow): + elif isinstance(f, tcp.TCPFlow): for msg in f.messages: if msg.from_client and self.re.search(msg.content): return True @@ -283,13 +283,13 @@ class FBodResponse(_Rex): help = "Response body" flags = re.DOTALL - @only(HTTPFlow, TCPFlow) + @only(http.HTTPFlow, tcp.TCPFlow) def __call__(self, f): - if isinstance(f, HTTPFlow): + if isinstance(f, http.HTTPFlow): if f.response and f.response.raw_content: if self.re.search(f.response.get_content(strict=False)): return True - elif isinstance(f, TCPFlow): + elif isinstance(f, tcp.TCPFlow): for msg in f.messages: if not msg.from_client and self.re.search(msg.content): return True @@ -300,7 +300,7 @@ class FMethod(_Rex): help = "Method" flags = re.IGNORECASE - @only(HTTPFlow) + @only(http.HTTPFlow) def __call__(self, f): return bool(self.re.search(f.request.data.method)) @@ -310,7 +310,7 @@ class FDomain(_Rex): help = "Domain" flags = re.IGNORECASE - @only(HTTPFlow) + @only(http.HTTPFlow) def __call__(self, f): return bool(self.re.search(f.request.data.host)) @@ -327,7 +327,7 @@ class FUrl(_Rex): toks = toks[1:] return klass(*toks) - @only(HTTPFlow) + @only(http.HTTPFlow) def __call__(self, f): return self.re.search(f.request.url) @@ -360,7 +360,7 @@ class FCode(_Int): code = "c" help = "HTTP response code" - @only(HTTPFlow) + @only(http.HTTPFlow) def __call__(self, f): if f.response and f.response.status_code == self.num: return True @@ -485,7 +485,7 @@ def _make(): bnf = _make() -TFilter = Callable[[Flow], bool] +TFilter = Callable[[flow.Flow], bool] def parse(s: str) -> TFilter: diff --git a/mitmproxy/http.py b/mitmproxy/http.py new file mode 100644 index 00000000..7fe70f9b --- /dev/null +++ b/mitmproxy/http.py @@ -0,0 +1,262 @@ +import cgi + +from mitmproxy import flow +from netlib import http +from netlib import version +from netlib import tcp + + +class HTTPRequest(http.Request): + + """ + A mitmproxy HTTP request. + """ + + # This is a very thin wrapper on top of :py:class:`netlib.http.Request` and + # may be removed in the future. + + def __init__( + self, + first_line_format, + method, + scheme, + host, + port, + path, + http_version, + headers, + content, + timestamp_start=None, + timestamp_end=None, + is_replay=False, + stickycookie=False, + stickyauth=False, + ): + http.Request.__init__( + self, + first_line_format, + method, + scheme, + host, + port, + path, + http_version, + headers, + content, + timestamp_start, + timestamp_end, + ) + + # Have this request's cookies been modified by sticky cookies or auth? + self.stickycookie = stickycookie + self.stickyauth = stickyauth + + # Is this request replayed? + self.is_replay = is_replay + self.stream = None + + def get_state(self): + state = super().get_state() + state.update( + stickycookie=self.stickycookie, + stickyauth=self.stickyauth, + is_replay=self.is_replay, + ) + return state + + def set_state(self, state): + self.stickycookie = state.pop("stickycookie") + self.stickyauth = state.pop("stickyauth") + self.is_replay = state.pop("is_replay") + super().set_state(state) + + @classmethod + def wrap(self, request): + """ + Wraps an existing :py:class:`netlib.http.Request`. + """ + req = HTTPRequest( + first_line_format=request.data.first_line_format, + method=request.data.method, + scheme=request.data.scheme, + host=request.data.host, + port=request.data.port, + path=request.data.path, + http_version=request.data.http_version, + headers=request.data.headers, + content=request.data.content, + timestamp_start=request.data.timestamp_start, + timestamp_end=request.data.timestamp_end, + ) + return req + + def __hash__(self): + return id(self) + + +class HTTPResponse(http.Response): + + """ + A mitmproxy HTTP response. + """ + # This is a very thin wrapper on top of :py:class:`netlib.http.Response` and + # may be removed in the future. + + def __init__( + self, + http_version, + status_code, + reason, + headers, + content, + timestamp_start=None, + timestamp_end=None, + is_replay=False + ): + http.Response.__init__( + self, + http_version, + status_code, + reason, + headers, + content, + timestamp_start=timestamp_start, + timestamp_end=timestamp_end, + ) + + # Is this request replayed? + self.is_replay = is_replay + self.stream = None + + @classmethod + def wrap(self, response): + """ + Wraps an existing :py:class:`netlib.http.Response`. + """ + resp = HTTPResponse( + http_version=response.data.http_version, + status_code=response.data.status_code, + reason=response.data.reason, + headers=response.data.headers, + content=response.data.content, + timestamp_start=response.data.timestamp_start, + timestamp_end=response.data.timestamp_end, + ) + return resp + + +class HTTPFlow(flow.Flow): + + """ + An HTTPFlow is a collection of objects representing a single HTTP + transaction. + """ + + def __init__(self, client_conn, server_conn, live=None): + super().__init__("http", client_conn, server_conn, live) + + self.request = None + """ :py:class:`HTTPRequest` object """ + self.response = None + """ :py:class:`HTTPResponse` object """ + self.error = None + """ :py:class:`Error` object + + Note that it's possible for a Flow to have both a response and an error + object. This might happen, for instance, when a response was received + from the server, but there was an error sending it back to the client. + """ + self.server_conn = server_conn + """ :py:class:`ServerConnection` object """ + self.client_conn = client_conn + """:py:class:`ClientConnection` object """ + self.intercepted = False + """ Is this flow currently being intercepted? """ + + _stateobject_attributes = flow.Flow._stateobject_attributes.copy() + _stateobject_attributes.update( + request=HTTPRequest, + response=HTTPResponse + ) + + def __repr__(self): + s = " + + %d %s + + %s + + """.strip() % (status_code, response, cgi.escape(message)) + body = body.encode("utf8", "replace") + + if not headers: + headers = http.Headers( + Server=version.MITMPROXY, + Connection="close", + Content_Length=str(len(body)), + Content_Type="text/html" + ) + + return HTTPResponse( + b"HTTP/1.1", + status_code, + response, + headers, + body, + ) + + +def make_connect_request(address): + address = tcp.Address.wrap(address) + return HTTPRequest( + "authority", b"CONNECT", None, address.host, address.port, None, b"HTTP/1.1", + http.Headers(), b"" + ) + + +def make_connect_response(http_version): + # Do not send any response headers as it breaks proxying non-80 ports on + # Android emulators using the -http-proxy option. + return HTTPResponse( + http_version, + 200, + b"Connection established", + http.Headers(), + b"", + ) + +expect_continue_response = HTTPResponse( + b"HTTP/1.1", 100, b"Continue", http.Headers(), b"" +) diff --git a/mitmproxy/io.py b/mitmproxy/io.py index c1b7168b..27ffa036 100644 --- a/mitmproxy/io.py +++ b/mitmproxy/io.py @@ -2,11 +2,18 @@ import os from mitmproxy import exceptions from mitmproxy import flowfilter -from mitmproxy import models +from mitmproxy import http +from mitmproxy import tcp from mitmproxy.contrib import tnetstring from mitmproxy import io_compat +FLOW_TYPES = dict( + http=http.HTTPFlow, + tcp=tcp.TCPFlow, +) + + class FlowWriter: def __init__(self, fo): self.fo = fo @@ -31,9 +38,9 @@ class FlowReader: data = io_compat.migrate_flow(data) except ValueError as e: raise exceptions.FlowReadException(str(e)) - if data["type"] not in models.FLOW_TYPES: + if data["type"] not in FLOW_TYPES: raise exceptions.FlowReadException("Unknown flow type: {}".format(data["type"])) - yield models.FLOW_TYPES[data["type"]].from_state(data) + yield FLOW_TYPES[data["type"]].from_state(data) except ValueError as e: if str(e) == "not a tnetstring: empty file": return # Error is due to EOF diff --git a/mitmproxy/main.py b/mitmproxy/main.py deleted file mode 100644 index 19ee5027..00000000 --- a/mitmproxy/main.py +++ /dev/null @@ -1,142 +0,0 @@ -import os -import signal -import sys - -from mitmproxy import cmdline -from mitmproxy import exceptions -from mitmproxy.proxy import config -from mitmproxy.proxy import server -from netlib import version_check -from netlib import debug - - -def assert_utf8_env(): - spec = "" - for i in ["LANG", "LC_CTYPE", "LC_ALL"]: - spec += os.environ.get(i, "").lower() - if "utf" not in spec: - print( - "Error: mitmproxy requires a UTF console environment.", - file=sys.stderr - ) - print( - "Set your LANG enviroment variable to something like en_US.UTF-8", - file=sys.stderr - ) - sys.exit(1) - - -def process_options(parser, options, args): - if args.sysinfo: - print(debug.sysinfo()) - sys.exit(0) - debug.register_info_dumpers() - pconf = config.ProxyConfig(options) - if options.no_server: - return server.DummyServer(pconf) - else: - try: - return server.ProxyServer(pconf) - except exceptions.ServerException as v: - print(str(v), file=sys.stderr) - sys.exit(1) - - -def mitmproxy(args=None): # pragma: no cover - if os.name == "nt": - print("Error: mitmproxy's console interface is not supported on Windows. " - "You can run mitmdump or mitmweb instead.", file=sys.stderr) - sys.exit(1) - from . import console - - version_check.check_pyopenssl_version() - assert_utf8_env() - - parser = cmdline.mitmproxy() - args = parser.parse_args(args) - - try: - console_options = console.master.Options( - **cmdline.get_common_options(args) - ) - console_options.palette = args.palette - console_options.palette_transparent = args.palette_transparent - console_options.eventlog = args.eventlog - console_options.follow = args.follow - console_options.intercept = args.intercept - console_options.filter = args.filter - console_options.no_mouse = args.no_mouse - - server = process_options(parser, console_options, args) - m = console.master.ConsoleMaster(server, console_options) - except exceptions.OptionsError as e: - print("mitmproxy: %s" % e, file=sys.stderr) - sys.exit(1) - try: - m.run() - except (KeyboardInterrupt, RuntimeError): - pass - - -def mitmdump(args=None): # pragma: no cover - from . import dump - - version_check.check_pyopenssl_version() - - parser = cmdline.mitmdump() - args = parser.parse_args(args) - if args.quiet: - args.flow_detail = 0 - - master = None - try: - dump_options = dump.Options(**cmdline.get_common_options(args)) - dump_options.flow_detail = args.flow_detail - dump_options.keepserving = args.keepserving - dump_options.filtstr = " ".join(args.args) if args.args else None - server = process_options(parser, dump_options, args) - master = dump.DumpMaster(dump_options, server) - - def cleankill(*args, **kwargs): - master.shutdown() - - signal.signal(signal.SIGTERM, cleankill) - master.run() - except (dump.DumpError, exceptions.OptionsError) as e: - print("mitmdump: %s" % e, file=sys.stderr) - sys.exit(1) - except (KeyboardInterrupt, RuntimeError): - pass - if master is None or master.has_errored: - print("mitmdump: errors occurred during run", file=sys.stderr) - sys.exit(1) - - -def mitmweb(args=None): # pragma: no cover - from . import web - - version_check.check_pyopenssl_version() - - parser = cmdline.mitmweb() - - args = parser.parse_args(args) - - try: - web_options = web.master.Options(**cmdline.get_common_options(args)) - web_options.intercept = args.intercept - web_options.wdebug = args.wdebug - web_options.wiface = args.wiface - web_options.wport = args.wport - web_options.wsingleuser = args.wsingleuser - web_options.whtpasswd = args.whtpasswd - web_options.process_web_options(parser) - - server = process_options(parser, web_options, args) - m = web.master.WebMaster(web_options, server) - except exceptions.OptionsError as e: - print("mitmweb: %s" % e, file=sys.stderr) - sys.exit(1) - try: - m.run() - except (KeyboardInterrupt, RuntimeError): - pass diff --git a/mitmproxy/master.py b/mitmproxy/master.py index dd98c04c..672ff1e8 100644 --- a/mitmproxy/master.py +++ b/mitmproxy/master.py @@ -9,12 +9,13 @@ from mitmproxy import options from mitmproxy import controller from mitmproxy import events from mitmproxy import exceptions -from mitmproxy import models +from mitmproxy import connections +from mitmproxy import http from mitmproxy import log from mitmproxy import io from mitmproxy.protocol import http_replay from netlib import basethread -from netlib import http +import netlib.http from . import ctx as mitmproxy_ctx @@ -117,13 +118,13 @@ class Master: """ this method creates a new artificial and minimalist request also adds it to flowlist """ - c = models.ClientConnection.make_dummy(("", 0)) - s = models.ServerConnection.make_dummy((host, port)) + c = connections.ClientConnection.make_dummy(("", 0)) + s = connections.ServerConnection.make_dummy((host, port)) - f = models.HTTPFlow(c, s) - headers = http.Headers() + f = http.HTTPFlow(c, s) + headers = netlib.http.Headers() - req = models.HTTPRequest( + req = http.HTTPRequest( "absolute", method, scheme, @@ -142,7 +143,7 @@ class Master: """ Loads a flow """ - if isinstance(f, models.HTTPFlow): + if isinstance(f, http.HTTPFlow): if self.server and self.options.mode == "reverse": f.request.host = self.server.config.upstream_server.address.host f.request.port = self.server.config.upstream_server.address.port diff --git a/mitmproxy/models/__init__.py b/mitmproxy/models/__init__.py deleted file mode 100644 index 0dcc73a0..00000000 --- a/mitmproxy/models/__init__.py +++ /dev/null @@ -1,23 +0,0 @@ -from netlib.http import decoded -from .connections import ClientConnection, ServerConnection -from .flow import Flow, Error -from .http import ( - HTTPFlow, HTTPRequest, HTTPResponse, - make_error_response, make_connect_request, make_connect_response, expect_continue_response -) -from .tcp import TCPFlow - -FLOW_TYPES = dict( - http=HTTPFlow, - tcp=TCPFlow, -) - -__all__ = [ - "HTTPFlow", "HTTPRequest", "HTTPResponse", "decoded", - "make_error_response", "make_connect_request", - "make_connect_response", "expect_continue_response", - "ClientConnection", "ServerConnection", - "Flow", "Error", - "TCPFlow", - "FLOW_TYPES", -] diff --git a/mitmproxy/models/connections.py b/mitmproxy/models/connections.py deleted file mode 100644 index bf7a12aa..00000000 --- a/mitmproxy/models/connections.py +++ /dev/null @@ -1,221 +0,0 @@ -import time - -import copy -import os - -from mitmproxy import stateobject -from netlib import certutils -from netlib import tcp - - -class ClientConnection(tcp.BaseHandler, stateobject.StateObject): - - """ - A client connection - - Attributes: - address: Remote address - ssl_established: True if TLS is established, False otherwise - clientcert: The TLS client certificate - timestamp_start: Connection start timestamp - timestamp_ssl_setup: TLS established timestamp - timestamp_end: Connection end timestamp - """ - - def __init__(self, client_connection, address, server): - # Eventually, this object is restored from state. We don't have a - # connection then. - if client_connection: - super().__init__(client_connection, address, server) - else: - self.connection = None - self.server = None - self.wfile = None - self.rfile = None - self.address = None - self.clientcert = None - self.ssl_established = None - - self.timestamp_start = time.time() - self.timestamp_end = None - self.timestamp_ssl_setup = None - self.protocol = None - - def __bool__(self): - return bool(self.connection) and not self.finished - - def __repr__(self): - return "".format( - ssl="[ssl] " if self.ssl_established else "", - address=repr(self.address) - ) - - @property - def tls_established(self): - return self.ssl_established - - _stateobject_attributes = dict( - address=tcp.Address, - ssl_established=bool, - clientcert=certutils.SSLCert, - timestamp_start=float, - timestamp_ssl_setup=float, - timestamp_end=float, - ) - - def copy(self): - return copy.copy(self) - - def send(self, message): - if isinstance(message, list): - message = b''.join(message) - self.wfile.write(message) - self.wfile.flush() - - @classmethod - def from_state(cls, state): - f = cls(None, tuple(), None) - f.set_state(state) - return f - - @classmethod - def make_dummy(cls, address): - return cls.from_state(dict( - address=dict(address=address, use_ipv6=False), - clientcert=None, - ssl_established=False, - timestamp_start=None, - timestamp_end=None, - timestamp_ssl_setup=None - )) - - def convert_to_ssl(self, *args, **kwargs): - super().convert_to_ssl(*args, **kwargs) - self.timestamp_ssl_setup = time.time() - - def finish(self): - super().finish() - self.timestamp_end = time.time() - - -class ServerConnection(tcp.TCPClient, stateobject.StateObject): - - """ - A server connection - - Attributes: - address: Remote address. Can be both a domain or an IP address. - ip_address: Resolved remote IP address. - source_address: Local IP address or client's source IP address. - ssl_established: True if TLS is established, False otherwise - cert: The certificate presented by the remote during the TLS handshake - sni: Server Name Indication sent by the proxy during the TLS handshake - via: The underlying server connection (e.g. the connection to the upstream proxy in upstream proxy mode) - timestamp_start: Connection start timestamp - timestamp_tcp_setup: TCP ACK received timestamp - timestamp_ssl_setup: TLS established timestamp - timestamp_end: Connection end timestamp - """ - - def __init__(self, address, source_address=None, spoof_source_address=None): - tcp.TCPClient.__init__(self, address, source_address, spoof_source_address) - - self.via = None - self.timestamp_start = None - self.timestamp_end = None - self.timestamp_tcp_setup = None - self.timestamp_ssl_setup = None - self.protocol = None - - def __bool__(self): - return bool(self.connection) and not self.finished - - def __repr__(self): - if self.ssl_established and self.sni: - ssl = "[ssl: {0}] ".format(self.sni) - elif self.ssl_established: - ssl = "[ssl] " - else: - ssl = "" - return "".format( - ssl=ssl, - address=repr(self.address) - ) - - @property - def tls_established(self): - return self.ssl_established - - _stateobject_attributes = dict( - address=tcp.Address, - ip_address=tcp.Address, - source_address=tcp.Address, - ssl_established=bool, - cert=certutils.SSLCert, - sni=str, - timestamp_start=float, - timestamp_tcp_setup=float, - timestamp_ssl_setup=float, - timestamp_end=float, - ) - - @classmethod - def from_state(cls, state): - f = cls(tuple()) - f.set_state(state) - return f - - @classmethod - def make_dummy(cls, address): - return cls.from_state(dict( - address=dict(address=address, use_ipv6=False), - ip_address=dict(address=address, use_ipv6=False), - cert=None, - sni=None, - source_address=dict(address=('', 0), use_ipv6=False), - ssl_established=False, - timestamp_start=None, - timestamp_tcp_setup=None, - timestamp_ssl_setup=None, - timestamp_end=None, - via=None - )) - - def copy(self): - return copy.copy(self) - - def connect(self): - self.timestamp_start = time.time() - tcp.TCPClient.connect(self) - self.timestamp_tcp_setup = time.time() - - def send(self, message): - if isinstance(message, list): - message = b''.join(message) - self.wfile.write(message) - self.wfile.flush() - - def establish_ssl(self, clientcerts, sni, **kwargs): - if sni and not isinstance(sni, str): - raise ValueError("sni must be str, not " + type(sni).__name__) - clientcert = None - if clientcerts: - if os.path.isfile(clientcerts): - clientcert = clientcerts - else: - path = os.path.join( - clientcerts, - self.address.host.encode("idna").decode()) + ".pem" - if os.path.exists(path): - clientcert = path - - self.convert_to_ssl(cert=clientcert, sni=sni, **kwargs) - self.sni = sni - self.timestamp_ssl_setup = time.time() - - def finish(self): - tcp.TCPClient.finish(self) - self.timestamp_end = time.time() - - -ServerConnection._stateobject_attributes["via"] = ServerConnection diff --git a/mitmproxy/models/flow.py b/mitmproxy/models/flow.py deleted file mode 100644 index 2596165b..00000000 --- a/mitmproxy/models/flow.py +++ /dev/null @@ -1,191 +0,0 @@ -import time -import copy -import uuid - -from mitmproxy import stateobject -from mitmproxy.models.connections import ClientConnection -from mitmproxy.models.connections import ServerConnection - -from netlib import version -from typing import Optional # noqa - - -class Error(stateobject.StateObject): - - """ - An Error. - - This is distinct from an protocol error response (say, a HTTP code 500), - which is represented by a normal HTTPResponse object. This class is - responsible for indicating errors that fall outside of normal protocol - communications, like interrupted connections, timeouts, protocol errors. - - Exposes the following attributes: - - msg: Message describing the error - timestamp: Seconds since the epoch - """ - - def __init__(self, msg, timestamp=None): - """ - @type msg: str - @type timestamp: float - """ - self.msg = msg - self.timestamp = timestamp or time.time() - - _stateobject_attributes = dict( - msg=str, - timestamp=float - ) - - def __str__(self): - return self.msg - - def __repr__(self): - return self.msg - - @classmethod - def from_state(cls, state): - # the default implementation assumes an empty constructor. Override - # accordingly. - f = cls(None) - f.set_state(state) - return f - - def copy(self): - c = copy.copy(self) - return c - - -class Flow(stateobject.StateObject): - - """ - A Flow is a collection of objects representing a single transaction. - This class is usually subclassed for each protocol, e.g. HTTPFlow. - """ - - def __init__( - self, - type: str, - client_conn: ClientConnection, - server_conn: ServerConnection, - live=None - ): - self.type = type - self.id = str(uuid.uuid4()) - self.client_conn = client_conn - self.server_conn = server_conn - self.live = live - - self.error = None # type: Optional[Error] - self.intercepted = False # type: bool - self._backup = None # type: Optional[Flow] - self.reply = None - self.marked = False # type: bool - - _stateobject_attributes = dict( - id=str, - error=Error, - client_conn=ClientConnection, - server_conn=ServerConnection, - type=str, - intercepted=bool, - marked=bool, - ) - - def get_state(self): - d = super().get_state() - d.update(version=version.IVERSION) - if self._backup and self._backup != d: - d.update(backup=self._backup) - return d - - def set_state(self, state): - state.pop("version") - if "backup" in state: - self._backup = state.pop("backup") - super().set_state(state) - - @classmethod - def from_state(cls, state): - f = cls(None, None) - f.set_state(state) - return f - - def copy(self): - f = copy.copy(self) - - f.id = str(uuid.uuid4()) - f.live = False - f.client_conn = self.client_conn.copy() - f.server_conn = self.server_conn.copy() - - if self.error: - f.error = self.error.copy() - return f - - def modified(self): - """ - Has this Flow been modified? - """ - if self._backup: - return self._backup != self.get_state() - else: - return False - - def backup(self, force=False): - """ - Save a backup of this Flow, which can be reverted to using a - call to .revert(). - """ - if not self._backup: - self._backup = self.get_state() - - def revert(self): - """ - Revert to the last backed up state. - """ - if self._backup: - self.set_state(self._backup) - self._backup = None - - @property - def killable(self): - return self.reply and self.reply.state in {"handled", "taken"} - - def kill(self, master): - """ - Kill this request. - """ - self.error = Error("Connection killed") - self.intercepted = False - # reply.state should only be "handled" or "taken" here. - # if none of this is the case, .take() will raise an exception. - if self.reply.state != "taken": - self.reply.take() - self.reply.kill(force=True) - self.reply.commit() - master.error(self) - - def intercept(self, master): - """ - Intercept this Flow. Processing will stop until resume is - called. - """ - if self.intercepted: - return - self.intercepted = True - self.reply.take() - master.addons("intercept", self) - - def resume(self, master): - """ - Continue with the flow - called after an intercept(). - """ - if not self.intercepted: - return - self.intercepted = False - self.reply.ack() - self.reply.commit() - master.addons("intercept", self) diff --git a/mitmproxy/models/http.py b/mitmproxy/models/http.py deleted file mode 100644 index 91263b95..00000000 --- a/mitmproxy/models/http.py +++ /dev/null @@ -1,262 +0,0 @@ -import cgi - -from mitmproxy.models import flow -from netlib import http -from netlib import version -from netlib import tcp - - -class HTTPRequest(http.Request): - - """ - A mitmproxy HTTP request. - """ - - # This is a very thin wrapper on top of :py:class:`netlib.http.Request` and - # may be removed in the future. - - def __init__( - self, - first_line_format, - method, - scheme, - host, - port, - path, - http_version, - headers, - content, - timestamp_start=None, - timestamp_end=None, - is_replay=False, - stickycookie=False, - stickyauth=False, - ): - http.Request.__init__( - self, - first_line_format, - method, - scheme, - host, - port, - path, - http_version, - headers, - content, - timestamp_start, - timestamp_end, - ) - - # Have this request's cookies been modified by sticky cookies or auth? - self.stickycookie = stickycookie - self.stickyauth = stickyauth - - # Is this request replayed? - self.is_replay = is_replay - self.stream = None - - def get_state(self): - state = super().get_state() - state.update( - stickycookie=self.stickycookie, - stickyauth=self.stickyauth, - is_replay=self.is_replay, - ) - return state - - def set_state(self, state): - self.stickycookie = state.pop("stickycookie") - self.stickyauth = state.pop("stickyauth") - self.is_replay = state.pop("is_replay") - super().set_state(state) - - @classmethod - def wrap(self, request): - """ - Wraps an existing :py:class:`netlib.http.Request`. - """ - req = HTTPRequest( - first_line_format=request.data.first_line_format, - method=request.data.method, - scheme=request.data.scheme, - host=request.data.host, - port=request.data.port, - path=request.data.path, - http_version=request.data.http_version, - headers=request.data.headers, - content=request.data.content, - timestamp_start=request.data.timestamp_start, - timestamp_end=request.data.timestamp_end, - ) - return req - - def __hash__(self): - return id(self) - - -class HTTPResponse(http.Response): - - """ - A mitmproxy HTTP response. - """ - # This is a very thin wrapper on top of :py:class:`netlib.http.Response` and - # may be removed in the future. - - def __init__( - self, - http_version, - status_code, - reason, - headers, - content, - timestamp_start=None, - timestamp_end=None, - is_replay=False - ): - http.Response.__init__( - self, - http_version, - status_code, - reason, - headers, - content, - timestamp_start=timestamp_start, - timestamp_end=timestamp_end, - ) - - # Is this request replayed? - self.is_replay = is_replay - self.stream = None - - @classmethod - def wrap(self, response): - """ - Wraps an existing :py:class:`netlib.http.Response`. - """ - resp = HTTPResponse( - http_version=response.data.http_version, - status_code=response.data.status_code, - reason=response.data.reason, - headers=response.data.headers, - content=response.data.content, - timestamp_start=response.data.timestamp_start, - timestamp_end=response.data.timestamp_end, - ) - return resp - - -class HTTPFlow(flow.Flow): - - """ - An HTTPFlow is a collection of objects representing a single HTTP - transaction. - """ - - def __init__(self, client_conn, server_conn, live=None): - super().__init__("http", client_conn, server_conn, live) - - self.request = None - """ :py:class:`HTTPRequest` object """ - self.response = None - """ :py:class:`HTTPResponse` object """ - self.error = None - """ :py:class:`Error` object - - Note that it's possible for a Flow to have both a response and an error - object. This might happen, for instance, when a response was received - from the server, but there was an error sending it back to the client. - """ - self.server_conn = server_conn - """ :py:class:`ServerConnection` object """ - self.client_conn = client_conn - """:py:class:`ClientConnection` object """ - self.intercepted = False - """ Is this flow currently being intercepted? """ - - _stateobject_attributes = flow.Flow._stateobject_attributes.copy() - _stateobject_attributes.update( - request=HTTPRequest, - response=HTTPResponse - ) - - def __repr__(self): - s = " - - %d %s - - %s - - """.strip() % (status_code, response, cgi.escape(message)) - body = body.encode("utf8", "replace") - - if not headers: - headers = http.Headers( - Server=version.MITMPROXY, - Connection="close", - Content_Length=str(len(body)), - Content_Type="text/html" - ) - - return HTTPResponse( - b"HTTP/1.1", - status_code, - response, - headers, - body, - ) - - -def make_connect_request(address): - address = tcp.Address.wrap(address) - return HTTPRequest( - "authority", b"CONNECT", None, address.host, address.port, None, b"HTTP/1.1", - http.Headers(), b"" - ) - - -def make_connect_response(http_version): - # Do not send any response headers as it breaks proxying non-80 ports on - # Android emulators using the -http-proxy option. - return HTTPResponse( - http_version, - 200, - b"Connection established", - http.Headers(), - b"", - ) - -expect_continue_response = HTTPResponse( - b"HTTP/1.1", 100, b"Continue", http.Headers(), b"" -) diff --git a/mitmproxy/models/tcp.py b/mitmproxy/models/tcp.py deleted file mode 100644 index ae30730e..00000000 --- a/mitmproxy/models/tcp.py +++ /dev/null @@ -1,53 +0,0 @@ -import time - -from typing import List - -import netlib.basetypes -from mitmproxy.models.flow import Flow - - -class TCPMessage(netlib.basetypes.Serializable): - - def __init__(self, from_client, content, timestamp=None): - self.content = content - self.from_client = from_client - if timestamp is None: - timestamp = time.time() - self.timestamp = timestamp - - @classmethod - def from_state(cls, state): - return cls(*state) - - def get_state(self): - return self.from_client, self.content, self.timestamp - - def set_state(self, state): - self.from_client = state.pop("from_client") - self.content = state.pop("content") - self.timestamp = state.pop("timestamp") - - def __repr__(self): - return "{direction} {content}".format( - direction="->" if self.from_client else "<-", - content=repr(self.content) - ) - - -class TCPFlow(Flow): - - """ - A TCPFlow is a simplified representation of a TCP session. - """ - - def __init__(self, client_conn, server_conn, live=None): - super().__init__("tcp", client_conn, server_conn, live) - self.messages = [] # type: List[TCPMessage] - - _stateobject_attributes = Flow._stateobject_attributes.copy() - _stateobject_attributes.update( - messages=List[TCPMessage] - ) - - def __repr__(self): - return "".format(len(self.messages)) diff --git a/mitmproxy/protocol/base.py b/mitmproxy/protocol/base.py index d280b69c..53cfd137 100644 --- a/mitmproxy/protocol/base.py +++ b/mitmproxy/protocol/base.py @@ -1,6 +1,6 @@ import netlib.exceptions from mitmproxy import exceptions -from mitmproxy import models +from mitmproxy import connections class _LayerCodeCompletion: @@ -16,9 +16,9 @@ class _LayerCodeCompletion: self.config = None """@type: mitmproxy.proxy.ProxyConfig""" self.client_conn = None - """@type: mitmproxy.models.ClientConnection""" + """@type: mitmproxy.connections.ClientConnection""" self.server_conn = None - """@type: mitmproxy.models.ServerConnection""" + """@type: mitmproxy.connections.ServerConnection""" self.channel = None """@type: mitmproxy.controller.Channel""" self.ctx = None @@ -111,10 +111,10 @@ class ServerConnectionMixin: self.server_conn = None if self.config.options.spoof_source_address: - self.server_conn = models.ServerConnection( + self.server_conn = connections.ServerConnection( server_address, (self.ctx.client_conn.address.host, 0), True) else: - self.server_conn = models.ServerConnection( + self.server_conn = connections.ServerConnection( server_address, (self.config.options.listen_host, 0)) self.__check_self_connect() @@ -157,7 +157,7 @@ class ServerConnectionMixin: self.server_conn.close() self.channel.tell("serverdisconnect", self.server_conn) - self.server_conn = models.ServerConnection( + self.server_conn = connections.ServerConnection( address, (self.server_conn.source_address.host, 0), self.config.options.spoof_source_address diff --git a/mitmproxy/protocol/http.py b/mitmproxy/protocol/http.py index b9abfb4c..325bf815 100644 --- a/mitmproxy/protocol/http.py +++ b/mitmproxy/protocol/http.py @@ -3,10 +3,11 @@ import netlib.exceptions import time import traceback from mitmproxy import exceptions -from mitmproxy import models +from mitmproxy import http +from mitmproxy import flow from mitmproxy.protocol import base from mitmproxy.protocol import websockets as pwebsockets -from netlib import http +import netlib.http from netlib import tcp from netlib import websockets @@ -55,7 +56,7 @@ class _HttpTransmissionLayer(base.Layer): def send_response_body(self, response, chunks): raise NotImplementedError() - def check_close_connection(self, flow): + def check_close_connection(self, f): raise NotImplementedError() @@ -140,9 +141,9 @@ class HttpLayer(base.Layer): self.__initial_server_tls = self.server_tls self.__initial_server_conn = self.server_conn while True: - flow = models.HTTPFlow(self.client_conn, self.server_conn, live=self) + f = http.HTTPFlow(self.client_conn, self.server_conn, live=self) try: - request = self.get_request_from_client(flow) + request = self.get_request_from_client(f) # Make sure that the incoming request matches our expectations self.validate_request(request) except netlib.exceptions.HttpReadDisconnect: @@ -165,7 +166,7 @@ class HttpLayer(base.Layer): if not (self.http_authenticated or self.authenticate(request)): return - flow.request = request + f.request = request try: # Regular Proxy Mode: Handle CONNECT @@ -176,74 +177,74 @@ class HttpLayer(base.Layer): # HTTPS tasting means that ordinary errors like resolution and # connection errors can happen here. self.send_error_response(502, repr(e)) - flow.error = models.Error(str(e)) - self.channel.ask("error", flow) + f.error = flow.Error(str(e)) + self.channel.ask("error", f) return # update host header in reverse proxy mode if self.config.options.mode == "reverse": - flow.request.headers["Host"] = self.config.upstream_server.address.host + f.request.headers["Host"] = self.config.upstream_server.address.host # set upstream auth if self.mode == "upstream" and self.config.upstream_auth is not None: - flow.request.headers["Proxy-Authorization"] = self.config.upstream_auth - self.process_request_hook(flow) + f.request.headers["Proxy-Authorization"] = self.config.upstream_auth + self.process_request_hook(f) try: if websockets.check_handshake(request.headers) and websockets.check_client_version(request.headers): # We only support RFC6455 with WebSockets version 13 # allow inline scripts to manipulate the client handshake - self.channel.ask("websocket_handshake", flow) + self.channel.ask("websocket_handshake", f) - if not flow.response: + if not f.response: self.establish_server_connection( - flow.request.host, - flow.request.port, - flow.request.scheme + f.request.host, + f.request.port, + f.request.scheme ) - self.get_response_from_server(flow) + self.get_response_from_server(f) else: # response was set by an inline script. # we now need to emulate the responseheaders hook. - self.channel.ask("responseheaders", flow) + self.channel.ask("responseheaders", f) - self.log("response", "debug", [repr(flow.response)]) - self.channel.ask("response", flow) - self.send_response_to_client(flow) + self.log("response", "debug", [repr(f.response)]) + self.channel.ask("response", f) + self.send_response_to_client(f) - if self.check_close_connection(flow): + if self.check_close_connection(f): return # Handle 101 Switching Protocols - if flow.response.status_code == 101: - return self.handle_101_switching_protocols(flow) + if f.response.status_code == 101: + return self.handle_101_switching_protocols(f) # Upstream Proxy Mode: Handle CONNECT - if flow.request.first_line_format == "authority" and flow.response.status_code == 200: - self.handle_upstream_mode_connect(flow.request.copy()) + if f.request.first_line_format == "authority" and f.response.status_code == 200: + self.handle_upstream_mode_connect(f.request.copy()) return except (exceptions.ProtocolException, netlib.exceptions.NetlibException) as e: self.send_error_response(502, repr(e)) - if not flow.response: - flow.error = models.Error(str(e)) - self.channel.ask("error", flow) + if not f.response: + f.error = flow.Error(str(e)) + self.channel.ask("error", f) return else: raise exceptions.ProtocolException( "Error in HTTP connection: %s" % repr(e) ) finally: - if flow: - flow.live = False + if f: + f.live = False - def get_request_from_client(self, flow): + def get_request_from_client(self, f): request = self.read_request() - flow.request = request - self.channel.ask("requestheaders", flow) + f.request = request + self.channel.ask("requestheaders", f) if request.headers.get("expect", "").lower() == "100-continue": # TODO: We may have to use send_response_headers for HTTP2 here. - self.send_response(models.expect_continue_response) + self.send_response(http.expect_continue_response) request.headers.pop("expect") request.body = b"".join(self.read_request_body(request)) request.timestamp_end = time.time() @@ -251,7 +252,7 @@ class HttpLayer(base.Layer): def send_error_response(self, code, message, headers=None): try: - response = models.make_error_response(code, message, headers) + response = http.make_error_response(code, message, headers) self.send_response(response) except (netlib.exceptions.NetlibException, h2.exceptions.H2Error, exceptions.Http2ProtocolException): self.log(traceback.format_exc(), "debug") @@ -265,7 +266,7 @@ class HttpLayer(base.Layer): def handle_regular_mode_connect(self, request): self.http_authenticated = True self.set_server((request.host, request.port)) - self.send_response(models.make_connect_response(request.data.http_version)) + self.send_response(http.make_connect_response(request.data.http_version)) layer = self.ctx.next_layer(self) layer() @@ -273,29 +274,29 @@ class HttpLayer(base.Layer): layer = UpstreamConnectLayer(self, connect_request) layer() - def send_response_to_client(self, flow): - if not flow.response.stream: + def send_response_to_client(self, f): + if not f.response.stream: # no streaming: # we already received the full response from the server and can # send it to the client straight away. - self.send_response(flow.response) + self.send_response(f.response) else: # streaming: # First send the headers and then transfer the response incrementally - self.send_response_headers(flow.response) + self.send_response_headers(f.response) chunks = self.read_response_body( - flow.request, - flow.response + f.request, + f.response ) - if callable(flow.response.stream): - chunks = flow.response.stream(chunks) - self.send_response_body(flow.response, chunks) - flow.response.timestamp_end = time.time() + if callable(f.response.stream): + chunks = f.response.stream(chunks) + self.send_response_body(f.response, chunks) + f.response.timestamp_end = time.time() - def get_response_from_server(self, flow): + def get_response_from_server(self, f): def get_response(): - self.send_request(flow.request) - flow.response = self.read_response_headers() + self.send_request(f.request) + f.response = self.read_response_headers() try: get_response() @@ -325,23 +326,23 @@ class HttpLayer(base.Layer): get_response() # call the appropriate script hook - this is an opportunity for an - # inline script to set flow.stream = True - self.channel.ask("responseheaders", flow) + # inline script to set f.stream = True + self.channel.ask("responseheaders", f) - if flow.response.stream: - flow.response.data.content = None + if f.response.stream: + f.response.data.content = None else: - flow.response.data.content = b"".join(self.read_response_body( - flow.request, - flow.response + f.response.data.content = b"".join(self.read_response_body( + f.request, + f.response )) - flow.response.timestamp_end = time.time() + f.response.timestamp_end = time.time() # no further manipulation of self.server_conn beyond this point # we can safely set it as the final attribute value here. - flow.server_conn = self.server_conn + f.server_conn = self.server_conn - def process_request_hook(self, flow): + def process_request_hook(self, f): # Determine .scheme, .host and .port attributes for inline scripts. # For absolute-form requests, they are directly given in the request. # For authority-form requests, we only need to determine the request scheme. @@ -353,13 +354,13 @@ class HttpLayer(base.Layer): pass else: # Setting request.host also updates the host header, which we want to preserve - host_header = flow.request.headers.get("host", None) - flow.request.host = self.__initial_server_conn.address.host - flow.request.port = self.__initial_server_conn.address.port + host_header = f.request.headers.get("host", None) + f.request.host = self.__initial_server_conn.address.host + f.request.port = self.__initial_server_conn.address.port if host_header: - flow.request.headers["host"] = host_header - flow.request.scheme = "https" if self.__initial_server_tls else "http" - self.channel.ask("request", flow) + f.request.headers["host"] = host_header + f.request.scheme = "https" if self.__initial_server_tls else "http" + self.channel.ask("request", f) def establish_server_connection(self, host, port, scheme): address = tcp.Address((host, port)) @@ -419,29 +420,29 @@ class HttpLayer(base.Layer): self.config.authenticator.clean(request.headers) else: if self.mode == "transparent": - self.send_response(models.make_error_response( + self.send_response(http.make_error_response( 401, "Authentication Required", - http.Headers(**self.config.authenticator.auth_challenge_headers()) + netlib.http.Headers(**self.config.authenticator.auth_challenge_headers()) )) else: - self.send_response(models.make_error_response( + self.send_response(http.make_error_response( 407, "Proxy Authentication Required", - http.Headers(**self.config.authenticator.auth_challenge_headers()) + netlib.http.Headers(**self.config.authenticator.auth_challenge_headers()) )) return False return True - def handle_101_switching_protocols(self, flow): + def handle_101_switching_protocols(self, f): """ Handle a successful HTTP 101 Switching Protocols Response, received after e.g. a WebSocket upgrade request. """ # Check for WebSockets handshake is_websockets = ( - flow and - websockets.check_handshake(flow.request.headers) and - websockets.check_handshake(flow.response.headers) + f and + websockets.check_handshake(f.request.headers) and + websockets.check_handshake(f.response.headers) ) if is_websockets and not self.config.options.websockets: self.log( @@ -450,7 +451,7 @@ class HttpLayer(base.Layer): ) if is_websockets and self.config.options.websockets: - layer = pwebsockets.WebSocketsLayer(self, flow) + layer = pwebsockets.WebSocketsLayer(self, f) else: layer = self.ctx.next_layer(self) diff --git a/mitmproxy/protocol/http1.py b/mitmproxy/protocol/http1.py index 46839c58..c0084804 100644 --- a/mitmproxy/protocol/http1.py +++ b/mitmproxy/protocol/http1.py @@ -1,16 +1,16 @@ -from mitmproxy import models -from mitmproxy.protocol import http +from mitmproxy import http +from mitmproxy.protocol import http as httpbase from netlib.http import http1 -class Http1Layer(http._HttpTransmissionLayer): +class Http1Layer(httpbase._HttpTransmissionLayer): def __init__(self, ctx, mode): super().__init__(ctx) self.mode = mode def read_request_headers(self): - return models.HTTPRequest.wrap( + return http.HTTPRequest.wrap( http1.read_request_head(self.client_conn.rfile) ) @@ -28,7 +28,7 @@ class Http1Layer(http._HttpTransmissionLayer): def read_response_headers(self): resp = http1.read_response_head(self.server_conn.rfile) - return models.HTTPResponse.wrap(resp) + return http.HTTPResponse.wrap(resp) def read_response_body(self, request, response): expected_size = http1.expected_http_body_size(request, response) @@ -68,5 +68,5 @@ class Http1Layer(http._HttpTransmissionLayer): return close_connection def __call__(self): - layer = http.HttpLayer(self, self.mode) + layer = httpbase.HttpLayer(self, self.mode) layer() diff --git a/mitmproxy/protocol/http2.py b/mitmproxy/protocol/http2.py index 04d2b608..a3ec03f4 100644 --- a/mitmproxy/protocol/http2.py +++ b/mitmproxy/protocol/http2.py @@ -10,9 +10,9 @@ import queue import netlib.exceptions from mitmproxy import exceptions -from mitmproxy import models +from mitmproxy import http from mitmproxy.protocol import base -from mitmproxy.protocol import http +from mitmproxy.protocol import http as httpbase import netlib.http from netlib import tcp from netlib import basethread @@ -358,7 +358,7 @@ def detect_zombie_stream(func): return wrapper -class Http2SingleStreamLayer(http._HttpTransmissionLayer, basethread.BaseThread): +class Http2SingleStreamLayer(httpbase._HttpTransmissionLayer, basethread.BaseThread): def __init__(self, ctx, h2_connection, stream_id, request_headers): super().__init__( @@ -451,7 +451,7 @@ class Http2SingleStreamLayer(http._HttpTransmissionLayer, basethread.BaseThread) self.request_arrived.wait() self.raise_zombie() first_line_format, method, scheme, host, port, path = http2.parse_headers(self.request_headers) - return models.HTTPRequest( + return http.HTTPRequest( first_line_format, method, scheme, @@ -547,7 +547,7 @@ class Http2SingleStreamLayer(http._HttpTransmissionLayer, basethread.BaseThread) headers = self.response_headers.copy() headers.pop(":status", None) - return models.HTTPResponse( + return http.HTTPResponse( http_version=b"HTTP/2.0", status_code=status_code, reason=b'', @@ -597,7 +597,7 @@ class Http2SingleStreamLayer(http._HttpTransmissionLayer, basethread.BaseThread) raise EnvironmentError('Http2SingleStreamLayer must be run as thread') def run(self): - layer = http.HttpLayer(self, self.mode) + layer = httpbase.HttpLayer(self, self.mode) try: layer() diff --git a/mitmproxy/protocol/http_replay.py b/mitmproxy/protocol/http_replay.py index 6f9340b5..952c1817 100644 --- a/mitmproxy/protocol/http_replay.py +++ b/mitmproxy/protocol/http_replay.py @@ -1,9 +1,12 @@ import traceback import netlib.exceptions +from mitmproxy import log from mitmproxy import controller from mitmproxy import exceptions -from mitmproxy import models +from mitmproxy import http +from mitmproxy import flow +from mitmproxy import connections from netlib.http import http1 from netlib import basethread @@ -14,42 +17,42 @@ from netlib import basethread class RequestReplayThread(basethread.BaseThread): name = "RequestReplayThread" - def __init__(self, config, flow, event_queue, should_exit): + def __init__(self, config, f, event_queue, should_exit): """ event_queue can be a queue or None, if no scripthooks should be processed. """ - self.config, self.flow = config, flow - flow.live = True + self.config, self.f = config, f + f.live = True if event_queue: self.channel = controller.Channel(event_queue, should_exit) else: self.channel = None super().__init__( - "RequestReplay (%s)" % flow.request.url + "RequestReplay (%s)" % f.request.url ) def run(self): - r = self.flow.request + r = self.f.request first_line_format_backup = r.first_line_format server = None try: - self.flow.response = None + self.f.response = None # If we have a channel, run script hooks. if self.channel: - request_reply = self.channel.ask("request", self.flow) - if isinstance(request_reply, models.HTTPResponse): - self.flow.response = request_reply + request_reply = self.channel.ask("request", self.f) + if isinstance(request_reply, http.HTTPResponse): + self.f.response = request_reply - if not self.flow.response: + if not self.f.response: # In all modes, we directly connect to the server displayed if self.config.options.mode == "upstream": server_address = self.config.upstream_server.address - server = models.ServerConnection(server_address, (self.config.options.listen_host, 0)) + server = connections.ServerConnection(server_address, (self.config.options.listen_host, 0)) server.connect() if r.scheme == "https": - connect_request = models.make_connect_request((r.data.host, r.port)) + connect_request = http.make_connect_request((r.data.host, r.port)) server.wfile.write(http1.assemble_request(connect_request)) server.wfile.flush() resp = http1.read_response( @@ -61,46 +64,57 @@ class RequestReplayThread(basethread.BaseThread): raise exceptions.ReplayException("Upstream server refuses CONNECT request") server.establish_ssl( self.config.clientcerts, - sni=self.flow.server_conn.sni + sni=self.f.server_conn.sni ) r.first_line_format = "relative" else: r.first_line_format = "absolute" else: server_address = (r.host, r.port) - server = models.ServerConnection(server_address, (self.config.options.listen_host, 0)) + server = connections.ServerConnection( + server_address, + (self.config.options.listen_host, 0) + ) server.connect() if r.scheme == "https": server.establish_ssl( self.config.clientcerts, - sni=self.flow.server_conn.sni + sni=self.f.server_conn.sni ) r.first_line_format = "relative" server.wfile.write(http1.assemble_request(r)) server.wfile.flush() - self.flow.server_conn = server - self.flow.response = models.HTTPResponse.wrap(http1.read_response( - server.rfile, - r, - body_size_limit=self.config.options.body_size_limit - )) + self.f.server_conn = server + self.f.response = http.HTTPResponse.wrap( + http1.read_response( + server.rfile, + r, + body_size_limit=self.config.options.body_size_limit + ) + ) if self.channel: - response_reply = self.channel.ask("response", self.flow) + response_reply = self.channel.ask("response", self.f) if response_reply == exceptions.Kill: raise exceptions.Kill() except (exceptions.ReplayException, netlib.exceptions.NetlibException) as e: - self.flow.error = models.Error(str(e)) + self.f.error = flow.Error(str(e)) if self.channel: - self.channel.ask("error", self.flow) + self.channel.ask("error", self.f) except exceptions.Kill: # Kill should only be raised if there's a channel in the # first place. - self.channel.tell("log", controller.LogEntry("Connection killed", "info")) + self.channel.tell( + "log", + log.LogEntry("Connection killed", "info") + ) except Exception: - self.channel.tell("log", controller.LogEntry(traceback.format_exc(), "error")) + self.channel.tell( + "log", + log.LogEntry(traceback.format_exc(), "error") + ) finally: r.first_line_format = first_line_format_backup - self.flow.live = False + self.f.live = False if server: server.finish() diff --git a/mitmproxy/protocol/rawtcp.py b/mitmproxy/protocol/rawtcp.py index de9f3c24..3bd7b162 100644 --- a/mitmproxy/protocol/rawtcp.py +++ b/mitmproxy/protocol/rawtcp.py @@ -4,8 +4,8 @@ from OpenSSL import SSL import netlib.exceptions import netlib.tcp -from mitmproxy import models -from mitmproxy.models import tcp +from mitmproxy import tcp +from mitmproxy import flow from mitmproxy.protocol import base @@ -20,8 +20,8 @@ class RawTCPLayer(base.Layer): self.connect() if not self.ignore: - flow = models.TCPFlow(self.client_conn, self.server_conn, self) - self.channel.ask("tcp_start", flow) + f = tcp.TCPFlow(self.client_conn, self.server_conn, self) + self.channel.ask("tcp_start", f) buf = memoryview(bytearray(self.chunk_size)) @@ -52,14 +52,14 @@ class RawTCPLayer(base.Layer): tcp_message = tcp.TCPMessage(dst == server, buf[:size].tobytes()) if not self.ignore: - flow.messages.append(tcp_message) - self.channel.ask("tcp_message", flow) + f.messages.append(tcp_message) + self.channel.ask("tcp_message", f) dst.sendall(tcp_message.content) except (socket.error, netlib.exceptions.TcpException, SSL.Error) as e: if not self.ignore: - flow.error = models.Error("TCP connection closed unexpectedly: {}".format(repr(e))) - self.channel.tell("tcp_error", flow) + f.error = flow.Error("TCP connection closed unexpectedly: {}".format(repr(e))) + self.channel.tell("tcp_error", f) finally: if not self.ignore: - self.channel.tell("tcp_end", flow) + self.channel.tell("tcp_end", f) diff --git a/mitmproxy/protocol/tls.py b/mitmproxy/protocol/tls.py index 265e9086..b287bb51 100644 --- a/mitmproxy/protocol/tls.py +++ b/mitmproxy/protocol/tls.py @@ -224,7 +224,7 @@ def get_client_hello(client_conn): Peek into the socket and read all records that contain the initial client hello message. client_conn: - The :py:class:`client connection `. + The :py:class:`client connection `. Returns: The raw handshake packet bytes, without TLS record header(s). @@ -281,7 +281,7 @@ class TlsClientHello: """ Peek into the connection, read the initial client hello and parse it to obtain ALPN values. client_conn: - The :py:class:`client connection `. + The :py:class:`client connection `. Returns: :py:class:`client hello `. """ diff --git a/mitmproxy/proxy/root_context.py b/mitmproxy/proxy/root_context.py index 8064f12d..fa4fae47 100644 --- a/mitmproxy/proxy/root_context.py +++ b/mitmproxy/proxy/root_context.py @@ -13,7 +13,7 @@ class RootContext: Attributes: client_conn: - The :py:class:`client connection `. + The :py:class:`client connection `. channel: A :py:class:`~mitmproxy.controller.Channel` to communicate with the FlowMaster. Provides :py:meth:`.ask() ` and diff --git a/mitmproxy/proxy/server.py b/mitmproxy/proxy/server.py index c2a6a5c3..b876f9ce 100644 --- a/mitmproxy/proxy/server.py +++ b/mitmproxy/proxy/server.py @@ -4,7 +4,8 @@ import traceback import netlib.exceptions from mitmproxy import exceptions -from mitmproxy import models +from mitmproxy import connections +from mitmproxy import http from mitmproxy import log from mitmproxy.proxy import modes from mitmproxy.proxy import root_context @@ -66,7 +67,7 @@ class ConnectionHandler: def __init__(self, client_conn, client_address, config, channel): self.config = config """@type: mitmproxy.proxy.config.ProxyConfig""" - self.client_conn = models.ClientConnection( + self.client_conn = connections.ClientConnection( client_conn, client_address, None) @@ -135,7 +136,7 @@ class ConnectionHandler: # we send an HTTP error response, which is both # understandable by HTTP clients and humans. try: - error_response = models.make_error_response(502, repr(e)) + error_response = http.make_error_response(502, repr(e)) self.client_conn.send(http1.assemble_response(error_response)) except netlib.exceptions.TcpException: pass diff --git a/mitmproxy/tcp.py b/mitmproxy/tcp.py new file mode 100644 index 00000000..af54c9d4 --- /dev/null +++ b/mitmproxy/tcp.py @@ -0,0 +1,53 @@ +import time + +from typing import List + +import netlib.basetypes +from mitmproxy import flow + + +class TCPMessage(netlib.basetypes.Serializable): + + def __init__(self, from_client, content, timestamp=None): + self.content = content + self.from_client = from_client + if timestamp is None: + timestamp = time.time() + self.timestamp = timestamp + + @classmethod + def from_state(cls, state): + return cls(*state) + + def get_state(self): + return self.from_client, self.content, self.timestamp + + def set_state(self, state): + self.from_client = state.pop("from_client") + self.content = state.pop("content") + self.timestamp = state.pop("timestamp") + + def __repr__(self): + return "{direction} {content}".format( + direction="->" if self.from_client else "<-", + content=repr(self.content) + ) + + +class TCPFlow(flow.Flow): + + """ + A TCPFlow is a simplified representation of a TCP session. + """ + + def __init__(self, client_conn, server_conn, live=None): + super().__init__("tcp", client_conn, server_conn, live) + self.messages = [] # type: List[TCPMessage] + + _stateobject_attributes = flow.Flow._stateobject_attributes.copy() + _stateobject_attributes.update( + messages=List[TCPMessage] + ) + + def __repr__(self): + return "".format(len(self.messages)) diff --git a/mitmproxy/tools/__init__.py b/mitmproxy/tools/__init__.py new file mode 100644 index 00000000..e69de29b diff --git a/mitmproxy/tools/cmdline.py b/mitmproxy/tools/cmdline.py new file mode 100644 index 00000000..ddc4a5ce --- /dev/null +++ b/mitmproxy/tools/cmdline.py @@ -0,0 +1,897 @@ +import configargparse +import os +import re +from mitmproxy import exceptions +from mitmproxy import flowfilter +from mitmproxy import options +from mitmproxy import platform +from netlib import human +from netlib import tcp +from netlib import version + + +class ParseException(Exception): + pass + + +def _parse_hook(s): + sep, rem = s[0], s[1:] + parts = rem.split(sep, 2) + if len(parts) == 2: + patt = ".*" + a, b = parts + elif len(parts) == 3: + patt, a, b = parts + else: + raise ParseException( + "Malformed hook specifier - too few clauses: %s" % s + ) + + if not a: + raise ParseException("Empty clause: %s" % str(patt)) + + if not flowfilter.parse(patt): + raise ParseException("Malformed filter pattern: %s" % patt) + + return patt, a, b + + +def parse_replace_hook(s): + """ + Returns a (pattern, regex, replacement) tuple. + + The general form for a replacement hook is as follows: + + /patt/regex/replacement + + The first character specifies the separator. Example: + + :~q:foo:bar + + If only two clauses are specified, the pattern is set to match + universally (i.e. ".*"). Example: + + /foo/bar/ + + Clauses are parsed from left to right. Extra separators are taken to be + part of the final clause. For instance, the replacement clause below is + "foo/bar/": + + /one/two/foo/bar/ + + Checks that pattern and regex are both well-formed. Raises + ParseException on error. + """ + patt, regex, replacement = _parse_hook(s) + try: + re.compile(regex) + except re.error as e: + raise ParseException("Malformed replacement regex: %s" % str(e)) + return patt, regex, replacement + + +def parse_setheader(s): + """ + Returns a (pattern, header, value) tuple. + + The general form for a replacement hook is as follows: + + /patt/header/value + + The first character specifies the separator. Example: + + :~q:foo:bar + + If only two clauses are specified, the pattern is set to match + universally (i.e. ".*"). Example: + + /foo/bar/ + + Clauses are parsed from left to right. Extra separators are taken to be + part of the final clause. For instance, the value clause below is + "foo/bar/": + + /one/two/foo/bar/ + + Checks that pattern and regex are both well-formed. Raises + ParseException on error. + """ + return _parse_hook(s) + + +def get_common_options(args): + stickycookie, stickyauth = None, None + if args.stickycookie_filt: + stickycookie = args.stickycookie_filt + + if args.stickyauth_filt: + stickyauth = args.stickyauth_filt + + stream_large_bodies = args.stream_large_bodies + if stream_large_bodies: + stream_large_bodies = human.parse_size(stream_large_bodies) + + reps = [] + for i in args.replace: + try: + p = parse_replace_hook(i) + except ParseException as e: + raise exceptions.OptionsError(e) + reps.append(p) + for i in args.replace_file: + try: + patt, rex, path = parse_replace_hook(i) + except ParseException as e: + raise exceptions.OptionsError(e) + try: + v = open(path, "rb").read() + except IOError as e: + raise exceptions.OptionsError( + "Could not read replace file: %s" % path + ) + reps.append((patt, rex, v)) + + setheaders = [] + for i in args.setheader: + try: + p = parse_setheader(i) + except ParseException as e: + raise exceptions.OptionsError(e) + setheaders.append(p) + + if args.outfile and args.outfile[0] == args.rfile: + if args.outfile[1] == "wb": + raise exceptions.OptionsError( + "Cannot use '{}' for both reading and writing flows. " + "Are you looking for --afile?".format(args.rfile) + ) + else: + raise exceptions.OptionsError( + "Cannot use '{}' for both reading and appending flows. " + "That would trigger an infinite loop." + ) + + # Proxy config + certs = [] + for i in args.certs: + parts = i.split("=", 1) + if len(parts) == 1: + parts = ["*", parts[0]] + certs.append(parts) + + body_size_limit = args.body_size_limit + if body_size_limit: + try: + body_size_limit = human.parse_size(body_size_limit) + except ValueError as e: + raise exceptions.OptionsError( + "Invalid body size limit specification: %s" % body_size_limit + ) + + # Establish proxy mode + c = 0 + mode, upstream_server = "regular", None + if args.transparent_proxy: + c += 1 + if not platform.resolver: + raise exceptions.OptionsError( + "Transparent mode not supported on this platform." + ) + mode = "transparent" + if args.socks_proxy: + c += 1 + mode = "socks5" + if args.reverse_proxy: + c += 1 + mode = "reverse" + upstream_server = args.reverse_proxy + if args.upstream_proxy: + c += 1 + mode = "upstream" + upstream_server = args.upstream_proxy + if c > 1: + raise exceptions.OptionsError( + "Transparent, SOCKS5, reverse and upstream proxy mode " + "are mutually exclusive. Read the docs on proxy modes " + "to understand why." + ) + if args.add_upstream_certs_to_client_chain and args.no_upstream_cert: + raise exceptions.OptionsError( + "The no-upstream-cert and add-upstream-certs-to-client-chain " + "options are mutually exclusive. If no-upstream-cert is enabled " + "then the upstream certificate is not retrieved before generating " + "the client certificate chain." + ) + + if args.quiet: + args.verbose = 0 + + return dict( + app=args.app, + app_host=args.app_host, + app_port=args.app_port, + + anticache=args.anticache, + anticomp=args.anticomp, + client_replay=args.client_replay, + replay_kill_extra=args.replay_kill_extra, + no_server=args.no_server, + refresh_server_playback=not args.norefresh, + server_replay_use_headers=args.server_replay_use_headers, + rfile=args.rfile, + replacements=reps, + setheaders=setheaders, + server_replay=args.server_replay, + scripts=args.scripts, + stickycookie=stickycookie, + stickyauth=stickyauth, + stream_large_bodies=stream_large_bodies, + showhost=args.showhost, + outfile=args.outfile, + verbosity=args.verbose, + server_replay_nopop=args.server_replay_nopop, + server_replay_ignore_content=args.server_replay_ignore_content, + server_replay_ignore_params=args.server_replay_ignore_params, + server_replay_ignore_payload_params=args.server_replay_ignore_payload_params, + server_replay_ignore_host=args.server_replay_ignore_host, + + auth_nonanonymous = args.auth_nonanonymous, + auth_singleuser = args.auth_singleuser, + auth_htpasswd = args.auth_htpasswd, + add_upstream_certs_to_client_chain = args.add_upstream_certs_to_client_chain, + body_size_limit = body_size_limit, + cadir = args.cadir, + certs = certs, + ciphers_client = args.ciphers_client, + ciphers_server = args.ciphers_server, + clientcerts = args.clientcerts, + http2 = args.http2, + ignore_hosts = args.ignore_hosts, + listen_host = args.addr, + listen_port = args.port, + mode = mode, + no_upstream_cert = args.no_upstream_cert, + spoof_source_address = args.spoof_source_address, + rawtcp = args.rawtcp, + websockets = args.websockets, + upstream_server = upstream_server, + upstream_auth = args.upstream_auth, + ssl_version_client = args.ssl_version_client, + ssl_version_server = args.ssl_version_server, + ssl_insecure = args.ssl_insecure, + ssl_verify_upstream_trusted_cadir = args.ssl_verify_upstream_trusted_cadir, + ssl_verify_upstream_trusted_ca = args.ssl_verify_upstream_trusted_ca, + tcp_hosts = args.tcp_hosts, + ) + + +def basic_options(parser): + parser.add_argument( + '--version', + action='version', + version="%(prog)s" + " " + version.VERSION + ) + parser.add_argument( + '--sysinfo', + action='store_true', + dest='sysinfo', + ) + parser.add_argument( + '--shortversion', + action='version', + help="show program's short version number and exit", + version=version.VERSION + ) + parser.add_argument( + "--anticache", + action="store_true", dest="anticache", default=False, + + help=""" + Strip out request headers that might cause the server to return + 304-not-modified. + """ + ) + parser.add_argument( + "--cadir", + action="store", type=str, dest="cadir", default=options.CA_DIR, + help="Location of the default mitmproxy CA files. (%s)" % options.CA_DIR + ) + parser.add_argument( + "--host", + action="store_true", dest="showhost", default=False, + help="Use the Host header to construct URLs for display." + ) + parser.add_argument( + "-q", "--quiet", + action="store_true", dest="quiet", + help="Quiet." + ) + parser.add_argument( + "-r", "--read-flows", + action="store", dest="rfile", default=None, + help="Read flows from file." + ) + parser.add_argument( + "-s", "--script", + action="append", type=str, dest="scripts", default=[], + metavar='"script.py --bar"', + help=""" + Run a script. Surround with quotes to pass script arguments. Can be + passed multiple times. + """ + ) + parser.add_argument( + "-t", "--stickycookie", + action="store", + dest="stickycookie_filt", + default=None, + metavar="FILTER", + help="Set sticky cookie filter. Matched against requests." + ) + parser.add_argument( + "-u", "--stickyauth", + action="store", dest="stickyauth_filt", default=None, metavar="FILTER", + help="Set sticky auth filter. Matched against requests." + ) + parser.add_argument( + "-v", "--verbose", + action="store_const", dest="verbose", default=2, const=3, + help="Increase log verbosity." + ) + outfile = parser.add_mutually_exclusive_group() + outfile.add_argument( + "-w", "--wfile", + action="store", dest="outfile", type=lambda f: (f, "wb"), + help="Write flows to file." + ) + outfile.add_argument( + "-a", "--afile", + action="store", dest="outfile", type=lambda f: (f, "ab"), + help="Append flows to file." + ) + parser.add_argument( + "-z", "--anticomp", + action="store_true", dest="anticomp", default=False, + help="Try to convince servers to send us un-compressed data." + ) + parser.add_argument( + "-Z", "--body-size-limit", + action="store", dest="body_size_limit", default=None, + metavar="SIZE", + help="Byte size limit of HTTP request and response bodies." + " Understands k/m/g suffixes, i.e. 3m for 3 megabytes." + ) + parser.add_argument( + "--stream", + action="store", dest="stream_large_bodies", default=None, + metavar="SIZE", + help=""" + Stream data to the client if response body exceeds the given + threshold. If streamed, the body will not be stored in any way. + Understands k/m/g suffixes, i.e. 3m for 3 megabytes. + """ + ) + + +def proxy_modes(parser): + group = parser.add_argument_group("Proxy Modes") + group.add_argument( + "-R", "--reverse", + action="store", + type=str, + dest="reverse_proxy", + default=None, + help=""" + Forward all requests to upstream HTTP server: + http[s]://host[:port]. Clients can always connect both + via HTTPS and HTTP, the connection to the server is + determined by the specified scheme. + """ + ) + group.add_argument( + "--socks", + action="store_true", dest="socks_proxy", default=False, + help="Set SOCKS5 proxy mode." + ) + group.add_argument( + "-T", "--transparent", + action="store_true", dest="transparent_proxy", default=False, + help="Set transparent proxy mode." + ) + group.add_argument( + "-U", "--upstream", + action="store", + type=str, + dest="upstream_proxy", + default=None, + help="Forward all requests to upstream proxy server: http://host[:port]" + ) + + +def proxy_options(parser): + group = parser.add_argument_group("Proxy Options") + group.add_argument( + "-b", "--bind-address", + action="store", type=str, dest="addr", default='', + help="Address to bind proxy to (defaults to all interfaces)" + ) + group.add_argument( + "-I", "--ignore", + action="append", type=str, dest="ignore_hosts", default=[], + metavar="HOST", + help=""" + Ignore host and forward all traffic without processing it. In + transparent mode, it is recommended to use an IP address (range), + not the hostname. In regular mode, only SSL traffic is ignored and + the hostname should be used. The supplied value is interpreted as a + regular expression and matched on the ip or the hostname. Can be + passed multiple times. + """ + ) + group.add_argument( + "--tcp", + action="append", type=str, dest="tcp_hosts", default=[], + metavar="HOST", + help=""" + Generic TCP SSL proxy mode for all hosts that match the pattern. + Similar to --ignore, but SSL connections are intercepted. The + communication contents are printed to the log in verbose mode. + """ + ) + group.add_argument( + "-n", "--no-server", + action="store_true", dest="no_server", + help="Don't start a proxy server." + ) + group.add_argument( + "-p", "--port", + action="store", type=int, dest="port", default=options.LISTEN_PORT, + help="Proxy service port." + ) + group.add_argument( + "--no-http2", + action="store_false", dest="http2", + help=""" + Explicitly disable HTTP/2 support. + If your OpenSSL version supports ALPN, HTTP/2 is enabled by default. + """ + ) + parser.add_argument( + "--upstream-auth", + action="store", dest="upstream_auth", default=None, + type=str, + help=""" + Proxy Authentication: + username:password + """ + ) + rawtcp = group.add_mutually_exclusive_group() + rawtcp.add_argument("--raw-tcp", action="store_true", dest="rawtcp") + rawtcp.add_argument("--no-raw-tcp", action="store_false", dest="rawtcp", + help="Explicitly enable/disable experimental raw tcp support. " + "Disabled by default. " + "Default value will change in a future version." + ) + websockets = group.add_mutually_exclusive_group() + websockets.add_argument("--websockets", action="store_true", dest="websockets") + websockets.add_argument("--no-websockets", action="store_false", dest="websockets", + help="Explicitly enable/disable experimental WebSocket support. " + "Disabled by default as messages are only printed to the event log and not retained. " + "Default value will change in a future version." + ) + group.add_argument( + "--spoof-source-address", + action="store_true", dest="spoof_source_address", + help="Use the client's IP for server-side connections" + ) + + +def proxy_ssl_options(parser): + # TODO: Agree to consistently either use "upstream" or "server". + group = parser.add_argument_group("SSL") + group.add_argument( + "--cert", + dest='certs', + default=[], + type=str, + metavar="SPEC", + action="append", + help='Add an SSL certificate. SPEC is of the form "[domain=]path". ' + 'The domain may include a wildcard, and is equal to "*" if not specified. ' + 'The file at path is a certificate in PEM format. If a private key is included ' + 'in the PEM, it is used, else the default key in the conf dir is used. ' + 'The PEM file should contain the full certificate chain, with the leaf certificate ' + 'as the first entry. Can be passed multiple times.') + group.add_argument( + "--ciphers-client", action="store", + type=str, dest="ciphers_client", default=options.DEFAULT_CLIENT_CIPHERS, + help="Set supported ciphers for client connections. (OpenSSL Syntax)" + ) + group.add_argument( + "--ciphers-server", action="store", + type=str, dest="ciphers_server", default=None, + help="Set supported ciphers for server connections. (OpenSSL Syntax)" + ) + group.add_argument( + "--client-certs", action="store", + type=str, dest="clientcerts", default=None, + help="Client certificate file or directory." + ) + group.add_argument( + "--no-upstream-cert", default=False, + action="store_true", dest="no_upstream_cert", + help="Don't connect to upstream server to look up certificate details." + ) + group.add_argument( + "--add-upstream-certs-to-client-chain", default=False, + action="store_true", dest="add_upstream_certs_to_client_chain", + help="Add all certificates of the upstream server to the certificate chain " + "that will be served to the proxy client, as extras." + ) + group.add_argument( + "--insecure", default=False, + action="store_true", dest="ssl_insecure", + help="Do not verify upstream server SSL/TLS certificates." + ) + group.add_argument( + "--upstream-trusted-cadir", default=None, action="store", + dest="ssl_verify_upstream_trusted_cadir", + help="Path to a directory of trusted CA certificates for upstream " + "server verification prepared using the c_rehash tool." + ) + group.add_argument( + "--upstream-trusted-ca", default=None, action="store", + dest="ssl_verify_upstream_trusted_ca", + help="Path to a PEM formatted trusted CA certificate." + ) + group.add_argument( + "--ssl-version-client", dest="ssl_version_client", + default="secure", action="store", + choices=tcp.sslversion_choices.keys(), + help="Set supported SSL/TLS versions for client connections. " + "SSLv2, SSLv3 and 'all' are INSECURE. Defaults to secure, which is TLS1.0+." + ) + group.add_argument( + "--ssl-version-server", dest="ssl_version_server", + default="secure", action="store", + choices=tcp.sslversion_choices.keys(), + help="Set supported SSL/TLS versions for server connections. " + "SSLv2, SSLv3 and 'all' are INSECURE. Defaults to secure, which is TLS1.0+." + ) + + +def onboarding_app(parser): + group = parser.add_argument_group("Onboarding App") + group.add_argument( + "--noapp", + action="store_false", dest="app", default=True, + help="Disable the mitmproxy onboarding app." + ) + group.add_argument( + "--app-host", + action="store", dest="app_host", default=options.APP_HOST, metavar="host", + help=""" + Domain to serve the onboarding app from. For transparent mode, use + an IP when a DNS entry for the app domain is not present. Default: + %s + """ % options.APP_HOST + ) + group.add_argument( + "--app-port", + action="store", + dest="app_port", + default=options.APP_PORT, + type=int, + metavar="80", + help="Port to serve the onboarding app from." + ) + + +def client_replay(parser): + group = parser.add_argument_group("Client Replay") + group.add_argument( + "-c", "--client-replay", + action="append", dest="client_replay", default=None, metavar="PATH", + help="Replay client requests from a saved file." + ) + + +def server_replay(parser): + group = parser.add_argument_group("Server Replay") + group.add_argument( + "-S", "--server-replay", + action="append", dest="server_replay", default=None, metavar="PATH", + help="Replay server responses from a saved file." + ) + group.add_argument( + "-k", "--replay-kill-extra", + action="store_true", dest="replay_kill_extra", default=False, + help="Kill extra requests during replay." + ) + group.add_argument( + "--server-replay-use-header", + action="append", dest="server_replay_use_headers", type=str, + help="Request headers to be considered during replay. " + "Can be passed multiple times." + ) + group.add_argument( + "--norefresh", + action="store_true", dest="norefresh", default=False, + help=""" + Disable response refresh, which updates times in cookies and headers + for replayed responses. + """ + ) + group.add_argument( + "--no-pop", + action="store_true", dest="server_replay_nopop", default=False, + help="Disable response pop from response flow. " + "This makes it possible to replay same response multiple times." + ) + payload = group.add_mutually_exclusive_group() + payload.add_argument( + "--replay-ignore-content", + action="store_true", dest="server_replay_ignore_content", default=False, + help=""" + Ignore request's content while searching for a saved flow to replay + """ + ) + payload.add_argument( + "--replay-ignore-payload-param", + action="append", dest="server_replay_ignore_payload_params", type=str, + help=""" + Request's payload parameters (application/x-www-form-urlencoded or multipart/form-data) to + be ignored while searching for a saved flow to replay. + Can be passed multiple times. + """ + ) + + group.add_argument( + "--replay-ignore-param", + action="append", dest="server_replay_ignore_params", type=str, + help=""" + Request's parameters to be ignored while searching for a saved flow + to replay. Can be passed multiple times. + """ + ) + group.add_argument( + "--replay-ignore-host", + action="store_true", + dest="server_replay_ignore_host", + default=False, + help="Ignore request's destination host while searching for a saved flow to replay") + + +def replacements(parser): + group = parser.add_argument_group( + "Replacements", + """ + Replacements are of the form "/pattern/regex/replacement", where + the separator can be any character. Please see the documentation + for more information. + """.strip() + ) + group.add_argument( + "--replace", + action="append", type=str, dest="replace", default=[], + metavar="PATTERN", + help="Replacement pattern." + ) + group.add_argument( + "--replace-from-file", + action="append", type=str, dest="replace_file", default=[], + metavar="PATH", + help=""" + Replacement pattern, where the replacement clause is a path to a + file. + """ + ) + + +def set_headers(parser): + group = parser.add_argument_group( + "Set Headers", + """ + Header specifications are of the form "/pattern/header/value", + where the separator can be any character. Please see the + documentation for more information. + """.strip() + ) + group.add_argument( + "--setheader", + action="append", type=str, dest="setheader", default=[], + metavar="PATTERN", + help="Header set pattern." + ) + + +def proxy_authentication(parser): + group = parser.add_argument_group( + "Proxy Authentication", + """ + Specify which users are allowed to access the proxy and the method + used for authenticating them. + """ + ).add_mutually_exclusive_group() + group.add_argument( + "--nonanonymous", + action="store_true", dest="auth_nonanonymous", + help="Allow access to any user long as a credentials are specified." + ) + + group.add_argument( + "--singleuser", + action="store", dest="auth_singleuser", type=str, + metavar="USER", + help=""" + Allows access to a a single user, specified in the form + username:password. + """ + ) + group.add_argument( + "--htpasswd", + action="store", dest="auth_htpasswd", type=str, + metavar="PATH", + help="Allow access to users specified in an Apache htpasswd file." + ) + + +def common_options(parser): + basic_options(parser) + proxy_modes(parser) + proxy_options(parser) + proxy_ssl_options(parser) + onboarding_app(parser) + client_replay(parser) + server_replay(parser) + replacements(parser) + set_headers(parser) + proxy_authentication(parser) + + +def mitmproxy(): + # Don't import mitmproxy.tools.console for mitmdump, urwid is not available on all + # platforms. + from .console import palettes + + parser = configargparse.ArgumentParser( + usage="%(prog)s [options]", + args_for_setting_config_path=["--conf"], + default_config_files=[ + os.path.join(options.CA_DIR, "common.conf"), + os.path.join(options.CA_DIR, "mitmproxy.conf") + ], + add_config_file_help=True, + add_env_var_help=True + ) + common_options(parser) + parser.add_argument( + "--palette", type=str, default=palettes.DEFAULT, + action="store", dest="palette", + choices=sorted(palettes.palettes.keys()), + help="Select color palette: " + ", ".join(palettes.palettes.keys()) + ) + parser.add_argument( + "--palette-transparent", + action="store_true", dest="palette_transparent", default=False, + help="Set transparent background for palette." + ) + parser.add_argument( + "-e", "--eventlog", + action="store_true", dest="eventlog", + help="Show event log." + ) + parser.add_argument( + "--follow", + action="store_true", dest="follow", + help="Follow flow list." + ) + parser.add_argument( + "--no-mouse", + action="store_true", dest="no_mouse", + help="Disable mouse interaction." + ) + group = parser.add_argument_group( + "Filters", + "See help in mitmproxy for filter expression syntax." + ) + group.add_argument( + "-i", "--intercept", action="store", + type=str, dest="intercept", default=None, + help="Intercept filter expression." + ) + group.add_argument( + "-f", "--filter", action="store", + type=str, dest="filter", default=None, + help="Filter view expression." + ) + return parser + + +def mitmdump(): + parser = configargparse.ArgumentParser( + usage="%(prog)s [options] [filter]", + args_for_setting_config_path=["--conf"], + default_config_files=[ + os.path.join(options.CA_DIR, "common.conf"), + os.path.join(options.CA_DIR, "mitmdump.conf") + ], + add_config_file_help=True, + add_env_var_help=True + ) + + common_options(parser) + parser.add_argument( + "--keepserving", + action="store_true", dest="keepserving", default=False, + help=""" + Continue serving after client playback or file read. We exit by + default. + """ + ) + parser.add_argument( + "-d", "--detail", + action="count", dest="flow_detail", default=1, + help="Increase flow detail display level. Can be passed multiple times." + ) + parser.add_argument('args', nargs="...") + return parser + + +def mitmweb(): + parser = configargparse.ArgumentParser( + usage="%(prog)s [options]", + args_for_setting_config_path=["--conf"], + default_config_files=[ + os.path.join(options.CA_DIR, "common.conf"), + os.path.join(options.CA_DIR, "mitmweb.conf") + ], + add_config_file_help=True, + add_env_var_help=True + ) + + group = parser.add_argument_group("Mitmweb") + group.add_argument( + "--wport", + action="store", type=int, dest="wport", default=8081, + metavar="PORT", + help="Mitmweb port." + ) + group.add_argument( + "--wiface", + action="store", dest="wiface", default="127.0.0.1", + metavar="IFACE", + help="Mitmweb interface." + ) + group.add_argument( + "--wdebug", + action="store_true", dest="wdebug", + help="Turn on mitmweb debugging" + ) + group.add_argument( + "--wsingleuser", + action="store", dest="wsingleuser", type=str, + metavar="USER", + help=""" + Allows access to a a single user, specified in the form + username:password. + """ + ) + group.add_argument( + "--whtpasswd", + action="store", dest="whtpasswd", type=str, + metavar="PATH", + help="Allow access to users specified in an Apache htpasswd file." + ) + + common_options(parser) + group = parser.add_argument_group( + "Filters", + "See help in mitmproxy for filter expression syntax." + ) + group.add_argument( + "-i", "--intercept", action="store", + type=str, dest="intercept", default=None, + help="Intercept filter expression." + ) + return parser diff --git a/mitmproxy/tools/console/__init__.py b/mitmproxy/tools/console/__init__.py new file mode 100644 index 00000000..947258c9 --- /dev/null +++ b/mitmproxy/tools/console/__init__.py @@ -0,0 +1,4 @@ +from mitmproxy.tools.console import master + + +__all__ = ["master"] diff --git a/mitmproxy/tools/console/common.py b/mitmproxy/tools/console/common.py new file mode 100644 index 00000000..d10d9321 --- /dev/null +++ b/mitmproxy/tools/console/common.py @@ -0,0 +1,461 @@ +# -*- coding: utf-8 -*- + + +import os + +import urwid +import urwid.util + +import netlib +from mitmproxy import utils +from mitmproxy.tools.console import signals +from mitmproxy import export +from netlib import human + +try: + import pyperclip +except: + pyperclip = False + + +VIEW_FLOW_REQUEST = 0 +VIEW_FLOW_RESPONSE = 1 + +METHOD_OPTIONS = [ + ("get", "g"), + ("post", "p"), + ("put", "u"), + ("head", "h"), + ("trace", "t"), + ("delete", "d"), + ("options", "o"), + ("edit raw", "e"), +] + + +def is_keypress(k): + """ + Is this input event a keypress? + """ + if isinstance(k, str): + return True + + +def highlight_key(str, key, textattr="text", keyattr="key"): + l = [] + parts = str.split(key, 1) + if parts[0]: + l.append((textattr, parts[0])) + l.append((keyattr, key)) + if parts[1]: + l.append((textattr, parts[1])) + return l + + +KEY_MAX = 30 + + +def format_keyvals(lst, key="key", val="text", indent=0): + """ + Format a list of (key, value) tuples. + + If key is None, it's treated specially: + - We assume a sub-value, and add an extra indent. + - The value is treated as a pre-formatted list of directives. + """ + ret = [] + if lst: + maxk = min(max(len(i[0]) for i in lst if i and i[0]), KEY_MAX) + for i, kv in enumerate(lst): + if kv is None: + ret.append(urwid.Text("")) + else: + if isinstance(kv[1], urwid.Widget): + v = kv[1] + elif kv[1] is None: + v = urwid.Text("") + else: + v = urwid.Text([(val, kv[1])]) + ret.append( + urwid.Columns( + [ + ("fixed", indent, urwid.Text("")), + ( + "fixed", + maxk, + urwid.Text([(key, kv[0] or "")]) + ), + v + ], + dividechars = 2 + ) + ) + return ret + + +def shortcuts(k): + if k == " ": + k = "page down" + elif k == "ctrl f": + k = "page down" + elif k == "ctrl b": + k = "page up" + elif k == "j": + k = "down" + elif k == "k": + k = "up" + return k + + +def fcol(s, attr): + s = str(s) + return ( + "fixed", + len(s), + urwid.Text( + [ + (attr, s) + ] + ) + ) + +if urwid.util.detected_encoding: + SYMBOL_REPLAY = u"\u21ba" + SYMBOL_RETURN = u"\u2190" + SYMBOL_MARK = u"\u25cf" +else: + SYMBOL_REPLAY = u"[r]" + SYMBOL_RETURN = u"<-" + SYMBOL_MARK = "[m]" + + +# Save file to disk +def save_data(path, data): + if not path: + return + try: + if isinstance(data, bytes): + mode = "wb" + else: + mode = "w" + with open(path, mode) as f: + f.write(data) + except IOError as v: + signals.status_message.send(message=v.strerror) + + +def ask_save_overwrite(path, data): + if not path: + return + path = os.path.expanduser(path) + if os.path.exists(path): + def save_overwrite(k): + if k == "y": + save_data(path, data) + + signals.status_prompt_onekey.send( + prompt = "'" + path + "' already exists. Overwrite?", + keys = ( + ("yes", "y"), + ("no", "n"), + ), + callback = save_overwrite + ) + else: + save_data(path, data) + + +def ask_save_path(data, prompt="File path"): + signals.status_prompt_path.send( + prompt = prompt, + callback = ask_save_overwrite, + args = (data, ) + ) + + +def ask_scope_and_callback(flow, cb, *args): + request_has_content = flow.request and flow.request.raw_content + response_has_content = flow.response and flow.response.raw_content + + if request_has_content and response_has_content: + signals.status_prompt_onekey.send( + prompt = "Save", + keys = ( + ("request", "q"), + ("response", "s"), + ("both", "b"), + ), + callback = cb, + args = (flow,) + args + ) + elif response_has_content: + cb("s", flow, *args) + else: + cb("q", flow, *args) + + +def copy_to_clipboard_or_prompt(data): + # pyperclip calls encode('utf-8') on data to be copied without checking. + # if data are already encoded that way UnicodeDecodeError is thrown. + if isinstance(data, bytes): + toclip = data.decode("utf8", "replace") + else: + toclip = data + + try: + pyperclip.copy(toclip) + except (RuntimeError, UnicodeDecodeError, AttributeError, TypeError): + def save(k): + if k == "y": + ask_save_path(data, "Save data") + signals.status_prompt_onekey.send( + prompt = "Cannot copy data to clipboard. Save as file?", + keys = ( + ("yes", "y"), + ("no", "n"), + ), + callback = save + ) + + +def format_flow_data(key, scope, flow): + data = b"" + if scope in ("q", "b"): + request = flow.request.copy() + request.decode(strict=False) + if request.content is None: + return None, "Request content is missing" + if key == "h": + data += netlib.http.http1.assemble_request(request) + elif key == "c": + data += request.get_content(strict=False) + else: + raise ValueError("Unknown key: {}".format(key)) + if scope == "b" and flow.request.raw_content and flow.response: + # Add padding between request and response + data += b"\r\n" * 2 + if scope in ("s", "b") and flow.response: + response = flow.response.copy() + response.decode(strict=False) + if response.content is None: + return None, "Response content is missing" + if key == "h": + data += netlib.http.http1.assemble_response(response) + elif key == "c": + data += response.get_content(strict=False) + else: + raise ValueError("Unknown key: {}".format(key)) + return data, False + + +def handle_flow_data(scope, flow, key, writer): + """ + key: _c_ontent, _h_eaders+content, _u_rl + scope: re_q_uest, re_s_ponse, _b_oth + writer: copy_to_clipboard_or_prompt, ask_save_path + """ + data, err = format_flow_data(key, scope, flow) + + if err: + signals.status_message.send(message=err) + return + + if not data: + if scope == "q": + signals.status_message.send(message="No request content.") + elif scope == "s": + signals.status_message.send(message="No response content.") + else: + signals.status_message.send(message="No content.") + return + + writer(data) + + +def ask_save_body(scope, flow): + """ + Save either the request or the response body to disk. + + scope: re_q_uest, re_s_ponse, _b_oth, None (ask user if necessary) + """ + + request_has_content = flow.request and flow.request.raw_content + response_has_content = flow.response and flow.response.raw_content + + if scope is None: + ask_scope_and_callback(flow, ask_save_body) + elif scope == "q" and request_has_content: + ask_save_path( + flow.request.get_content(strict=False), + "Save request content to" + ) + elif scope == "s" and response_has_content: + ask_save_path( + flow.response.get_content(strict=False), + "Save response content to" + ) + elif scope == "b" and request_has_content and response_has_content: + ask_save_path( + (flow.request.get_content(strict=False) + b"\n" + + flow.response.get_content(strict=False)), + "Save request & response content to" + ) + else: + signals.status_message.send(message="No content.") + + +def export_to_clip_or_file(key, scope, flow, writer): + """ + Export selected flow to clipboard or a file. + + key: _c_ontent, _h_eaders+content, _u_rl, + cu_r_l_command, _p_ython_code, + _l_ocust_code, locust_t_ask + scope: None, _a_ll, re_q_uest, re_s_ponse + writer: copy_to_clipboard_or_prompt, ask_save_path + """ + + for _, exp_key, exporter in export.EXPORTERS: + if key == exp_key: + if exporter is None: # 'c' & 'h' + if scope is None: + ask_scope_and_callback(flow, handle_flow_data, key, writer) + else: + handle_flow_data(scope, flow, key, writer) + else: # other keys + writer(exporter(flow)) + +flowcache = utils.LRUCache(800) + + +def raw_format_flow(f): + f = dict(f) + pile = [] + req = [] + if f["extended"]: + req.append( + fcol( + human.format_timestamp(f["req_timestamp"]), + "highlight" + ) + ) + else: + req.append(fcol(">>" if f["focus"] else " ", "focus")) + + if f["marked"]: + req.append(fcol(SYMBOL_MARK, "mark")) + + if f["req_is_replay"]: + req.append(fcol(SYMBOL_REPLAY, "replay")) + req.append(fcol(f["req_method"], "method")) + + preamble = sum(i[1] for i in req) + len(req) - 1 + + if f["intercepted"] and not f["acked"]: + uc = "intercept" + elif "resp_code" in f or "err_msg" in f: + uc = "text" + else: + uc = "title" + + url = f["req_url"] + + if f["max_url_len"] and len(url) > f["max_url_len"]: + url = url[:f["max_url_len"]] + "…" + + if f["req_http_version"] not in ("HTTP/1.0", "HTTP/1.1"): + url += " " + f["req_http_version"] + req.append( + urwid.Text([(uc, url)]) + ) + + pile.append(urwid.Columns(req, dividechars=1)) + + resp = [] + resp.append( + ("fixed", preamble, urwid.Text("")) + ) + + if "resp_code" in f: + codes = { + 2: "code_200", + 3: "code_300", + 4: "code_400", + 5: "code_500", + } + ccol = codes.get(f["resp_code"] // 100, "code_other") + resp.append(fcol(SYMBOL_RETURN, ccol)) + if f["resp_is_replay"]: + resp.append(fcol(SYMBOL_REPLAY, "replay")) + resp.append(fcol(f["resp_code"], ccol)) + if f["extended"]: + resp.append(fcol(f["resp_reason"], ccol)) + if f["intercepted"] and f["resp_code"] and not f["acked"]: + rc = "intercept" + else: + rc = "text" + + if f["resp_ctype"]: + resp.append(fcol(f["resp_ctype"], rc)) + resp.append(fcol(f["resp_clen"], rc)) + resp.append(fcol(f["roundtrip"], rc)) + + elif f["err_msg"]: + resp.append(fcol(SYMBOL_RETURN, "error")) + resp.append( + urwid.Text([ + ( + "error", + f["err_msg"] + ) + ]) + ) + pile.append(urwid.Columns(resp, dividechars=1)) + return urwid.Pile(pile) + + +def format_flow(f, focus, extended=False, hostheader=False, max_url_len=False): + d = dict( + focus=focus, + extended=extended, + max_url_len=max_url_len, + + intercepted = f.intercepted, + acked = f.reply.state == "committed", + + req_timestamp = f.request.timestamp_start, + req_is_replay = f.request.is_replay, + req_method = f.request.method, + req_url = f.request.pretty_url if hostheader else f.request.url, + req_http_version = f.request.http_version, + + err_msg = f.error.msg if f.error else None, + + marked = f.marked, + ) + if f.response: + if f.response.raw_content: + contentdesc = human.pretty_size(len(f.response.raw_content)) + elif f.response.raw_content is None: + contentdesc = "[content missing]" + else: + contentdesc = "[no content]" + duration = 0 + if f.response.timestamp_end and f.request.timestamp_start: + duration = f.response.timestamp_end - f.request.timestamp_start + roundtrip = human.pretty_duration(duration) + + d.update(dict( + resp_code = f.response.status_code, + resp_reason = f.response.reason, + resp_is_replay = f.response.is_replay, + resp_clen = contentdesc, + roundtrip = roundtrip, + )) + t = f.response.headers.get("content-type") + if t: + d["resp_ctype"] = t.split(";")[0] + else: + d["resp_ctype"] = "" + + return flowcache.get(raw_format_flow, tuple(sorted(d.items()))) diff --git a/mitmproxy/tools/console/flowdetailview.py b/mitmproxy/tools/console/flowdetailview.py new file mode 100644 index 00000000..f13f9a1d --- /dev/null +++ b/mitmproxy/tools/console/flowdetailview.py @@ -0,0 +1,159 @@ +import urwid + +from mitmproxy.tools.console import common, searchable +from netlib import human + + +def maybe_timestamp(base, attr): + if base is not None and getattr(base, attr): + return human.format_timestamp_with_milli(getattr(base, attr)) + else: + return "active" + + +def flowdetails(state, flow): + text = [] + + cc = flow.client_conn + sc = flow.server_conn + req = flow.request + resp = flow.response + + if sc is not None: + text.append(urwid.Text([("head", "Server Connection:")])) + parts = [ + ["Address", repr(sc.address)], + ["Resolved Address", repr(sc.ip_address)], + ] + + text.extend( + common.format_keyvals(parts, key="key", val="text", indent=4) + ) + + c = sc.cert + if c: + text.append(urwid.Text([("head", "Server Certificate:")])) + parts = [ + ["Type", "%s, %s bits" % c.keyinfo], + ["SHA1 digest", c.digest("sha1")], + ["Valid to", str(c.notafter)], + ["Valid from", str(c.notbefore)], + ["Serial", str(c.serial)], + [ + "Subject", + urwid.BoxAdapter( + urwid.ListBox( + common.format_keyvals( + c.subject, + key="highlight", + val="text" + ) + ), + len(c.subject) + ) + ], + [ + "Issuer", + urwid.BoxAdapter( + urwid.ListBox( + common.format_keyvals( + c.issuer, key="highlight", val="text" + ) + ), + len(c.issuer) + ) + ] + ] + + if c.altnames: + parts.append( + [ + "Alt names", + ", ".join(str(x) for x in c.altnames) + ] + ) + text.extend( + common.format_keyvals(parts, key="key", val="text", indent=4) + ) + + if cc is not None: + text.append(urwid.Text([("head", "Client Connection:")])) + + parts = [ + ["Address", repr(cc.address)], + ] + + text.extend( + common.format_keyvals(parts, key="key", val="text", indent=4) + ) + + parts = [] + + if cc is not None and cc.timestamp_start: + parts.append( + [ + "Client conn. established", + maybe_timestamp(cc, "timestamp_start") + ] + ) + if cc.ssl_established: + parts.append( + [ + "Client conn. TLS handshake", + maybe_timestamp(cc, "timestamp_ssl_setup") + ] + ) + if sc is not None and sc.timestamp_start: + parts.append( + [ + "Server conn. initiated", + maybe_timestamp(sc, "timestamp_start") + ] + ) + parts.append( + [ + "Server conn. TCP handshake", + maybe_timestamp(sc, "timestamp_tcp_setup") + ] + ) + if sc.ssl_established: + parts.append( + [ + "Server conn. TLS handshake", + maybe_timestamp(sc, "timestamp_ssl_setup") + ] + ) + if req is not None and req.timestamp_start: + parts.append( + [ + "First request byte", + maybe_timestamp(req, "timestamp_start") + ] + ) + parts.append( + [ + "Request complete", + maybe_timestamp(req, "timestamp_end") + ] + ) + if resp is not None and resp.timestamp_start: + parts.append( + [ + "First response byte", + maybe_timestamp(resp, "timestamp_start") + ] + ) + parts.append( + [ + "Response complete", + maybe_timestamp(resp, "timestamp_end") + ] + ) + + if parts: + # sort operations by timestamp + parts = sorted(parts, key=lambda p: p[1]) + + text.append(urwid.Text([("head", "Timing:")])) + text.extend(common.format_keyvals(parts, key="key", val="text", indent=4)) + return searchable.Searchable(state, text) diff --git a/mitmproxy/tools/console/flowlist.py b/mitmproxy/tools/console/flowlist.py new file mode 100644 index 00000000..31624229 --- /dev/null +++ b/mitmproxy/tools/console/flowlist.py @@ -0,0 +1,382 @@ +import urwid + +import netlib.http.url +from mitmproxy import exceptions +from mitmproxy.tools.console import common +from mitmproxy.tools.console import signals +from mitmproxy import export + + +def _mkhelp(): + text = [] + keys = [ + ("A", "accept all intercepted flows"), + ("a", "accept this intercepted flow"), + ("b", "save request/response body"), + ("C", "export flow to clipboard"), + ("d", "delete flow"), + ("D", "duplicate flow"), + ("e", "toggle eventlog"), + ("E", "export flow to file"), + ("f", "filter view"), + ("F", "toggle follow flow list"), + ("L", "load saved flows"), + ("m", "toggle flow mark"), + ("M", "toggle marked flow view"), + ("n", "create a new request"), + ("r", "replay request"), + ("S", "server replay request/s"), + ("U", "unmark all marked flows"), + ("V", "revert changes to request"), + ("w", "save flows "), + ("W", "stream flows to file"), + ("X", "kill and delete flow, even if it's mid-intercept"), + ("z", "clear flow list or eventlog"), + ("tab", "tab between eventlog and flow list"), + ("enter", "view flow"), + ("|", "run script on this flow"), + ] + text.extend(common.format_keyvals(keys, key="key", val="text", indent=4)) + return text +help_context = _mkhelp() + +footer = [ + ('heading_key', "?"), ":help ", +] + + +class LogBufferBox(urwid.ListBox): + + def __init__(self, master): + self.master = master + urwid.ListBox.__init__(self, master.logbuffer) + + def keypress(self, size, key): + key = common.shortcuts(key) + if key == "z": + self.master.clear_events() + key = None + elif key == "G": + self.set_focus(len(self.master.logbuffer) - 1) + elif key == "g": + self.set_focus(0) + return urwid.ListBox.keypress(self, size, key) + + +class BodyPile(urwid.Pile): + + def __init__(self, master): + h = urwid.Text("Event log") + h = urwid.Padding(h, align="left", width=("relative", 100)) + + self.inactive_header = urwid.AttrWrap(h, "heading_inactive") + self.active_header = urwid.AttrWrap(h, "heading") + + urwid.Pile.__init__( + self, + [ + FlowListBox(master), + urwid.Frame( + LogBufferBox(master), + header = self.inactive_header + ) + ] + ) + self.master = master + + def keypress(self, size, key): + if key == "tab": + self.focus_position = ( + self.focus_position + 1) % len(self.widget_list) + if self.focus_position == 1: + self.widget_list[1].header = self.active_header + else: + self.widget_list[1].header = self.inactive_header + key = None + elif key == "e": + self.master.toggle_eventlog() + key = None + + # This is essentially a copypasta from urwid.Pile's keypress handler. + # So much for "closed for modification, but open for extension". + item_rows = None + if len(size) == 2: + item_rows = self.get_item_rows(size, focus = True) + i = self.widget_list.index(self.focus_item) + tsize = self.get_item_size(size, i, True, item_rows) + return self.focus_item.keypress(tsize, key) + + +class ConnectionItem(urwid.WidgetWrap): + + def __init__(self, master, state, flow, focus): + self.master, self.state, self.flow = master, state, flow + self.f = focus + w = self.get_text() + urwid.WidgetWrap.__init__(self, w) + + def get_text(self): + cols, _ = self.master.ui.get_cols_rows() + return common.format_flow( + self.flow, + self.f, + hostheader=self.master.options.showhost, + max_url_len=cols, + ) + + def selectable(self): + return True + + def save_flows_prompt(self, k): + if k == "l": + signals.status_prompt_path.send( + prompt = "Save listed flows to", + callback = self.master.save_flows + ) + else: + signals.status_prompt_path.send( + prompt = "Save this flow to", + callback = self.master.save_one_flow, + args = (self.flow,) + ) + + def server_replay_prompt(self, k): + a = self.master.addons.get("serverplayback") + if k == "a": + a.load([i.copy() for i in self.master.state.view]) + elif k == "t": + a.load([self.flow.copy()]) + signals.update_settings.send(self) + + def mouse_event(self, size, event, button, col, row, focus): + if event == "mouse press" and button == 1: + if self.flow.request: + self.master.view_flow(self.flow) + return True + + def keypress(self, xxx_todo_changeme, key): + (maxcol,) = xxx_todo_changeme + key = common.shortcuts(key) + if key == "a": + self.flow.resume(self.master) + signals.flowlist_change.send(self) + elif key == "d": + if self.flow.killable: + self.flow.kill(self.master) + self.state.delete_flow(self.flow) + signals.flowlist_change.send(self) + elif key == "D": + f = self.master.state.duplicate_flow(self.flow) + self.master.state.set_focus_flow(f) + signals.flowlist_change.send(self) + elif key == "m": + self.flow.marked = not self.flow.marked + signals.flowlist_change.send(self) + elif key == "M": + if self.state.mark_filter: + self.state.disable_marked_filter() + else: + self.state.enable_marked_filter() + signals.flowlist_change.send(self) + elif key == "r": + try: + self.master.replay_request(self.flow) + except exceptions.ReplayException as e: + signals.add_log("Replay error: %s" % e, "warn") + signals.flowlist_change.send(self) + elif key == "S": + def stop_server_playback(response): + if response == "y": + self.master.options.server_replay = [] + a = self.master.addons.get("serverplayback") + if a.count(): + signals.status_prompt_onekey.send( + prompt = "Stop current server replay?", + keys = ( + ("yes", "y"), + ("no", "n"), + ), + callback = stop_server_playback, + ) + else: + signals.status_prompt_onekey.send( + prompt = "Server Replay", + keys = ( + ("all flows", "a"), + ("this flow", "t"), + ), + callback = self.server_replay_prompt, + ) + elif key == "U": + for f in self.state.flows: + f.marked = False + signals.flowlist_change.send(self) + elif key == "V": + if not self.flow.modified(): + signals.status_message.send(message="Flow not modified.") + return + self.state.revert(self.flow) + signals.flowlist_change.send(self) + signals.status_message.send(message="Reverted.") + elif key == "w": + signals.status_prompt_onekey.send( + self, + prompt = "Save", + keys = ( + ("listed flows", "l"), + ("this flow", "t"), + ), + callback = self.save_flows_prompt, + ) + elif key == "X": + if self.flow.killable: + self.flow.kill(self.master) + elif key == "enter": + if self.flow.request: + self.master.view_flow(self.flow) + elif key == "|": + signals.status_prompt_path.send( + prompt = "Send flow to script", + callback = self.master.run_script_once, + args = (self.flow,) + ) + elif key == "E": + signals.status_prompt_onekey.send( + self, + prompt = "Export to file", + keys = [(e[0], e[1]) for e in export.EXPORTERS], + callback = common.export_to_clip_or_file, + args = (None, self.flow, common.ask_save_path) + ) + elif key == "C": + signals.status_prompt_onekey.send( + self, + prompt = "Export to clipboard", + keys = [(e[0], e[1]) for e in export.EXPORTERS], + callback = common.export_to_clip_or_file, + args = (None, self.flow, common.copy_to_clipboard_or_prompt) + ) + elif key == "b": + common.ask_save_body(None, self.flow) + else: + return key + + +class FlowListWalker(urwid.ListWalker): + + def __init__(self, master, state): + self.master, self.state = master, state + signals.flowlist_change.connect(self.sig_flowlist_change) + + def sig_flowlist_change(self, sender): + self._modified() + + def get_focus(self): + f, i = self.state.get_focus() + f = ConnectionItem(self.master, self.state, f, True) if f else None + return f, i + + def set_focus(self, focus): + ret = self.state.set_focus(focus) + return ret + + def get_next(self, pos): + f, i = self.state.get_next(pos) + f = ConnectionItem(self.master, self.state, f, False) if f else None + return f, i + + def get_prev(self, pos): + f, i = self.state.get_prev(pos) + f = ConnectionItem(self.master, self.state, f, False) if f else None + return f, i + + +class FlowListBox(urwid.ListBox): + + def __init__(self, master: "mitmproxy.console.master.ConsoleMaster"): + self.master = master + super().__init__(FlowListWalker(master, master.state)) + + def get_method_raw(self, k): + if k: + self.get_url(k) + + def get_method(self, k): + if k == "e": + signals.status_prompt.send( + self, + prompt = "Method", + text = "", + callback = self.get_method_raw + ) + else: + method = "" + for i in common.METHOD_OPTIONS: + if i[1] == k: + method = i[0].upper() + self.get_url(method) + + def get_url(self, method): + signals.status_prompt.send( + prompt = "URL", + text = "http://www.example.com/", + callback = self.new_request, + args = (method,) + ) + + def new_request(self, url, method): + parts = netlib.http.url.parse(str(url)) + if not parts: + signals.status_message.send(message="Invalid Url") + return + scheme, host, port, path = parts + f = self.master.create_request(method, scheme, host, port, path) + self.master.state.set_focus_flow(f) + signals.flowlist_change.send(self) + + def keypress(self, size, key): + key = common.shortcuts(key) + if key == "A": + self.master.accept_all() + signals.flowlist_change.send(self) + elif key == "z": + self.master.clear_flows() + elif key == "e": + self.master.toggle_eventlog() + elif key == "g": + self.master.state.set_focus(0) + signals.flowlist_change.send(self) + elif key == "G": + self.master.state.set_focus(self.master.state.flow_count()) + signals.flowlist_change.send(self) + elif key == "f": + signals.status_prompt.send( + prompt = "Filter View", + text = self.master.state.filter_txt, + callback = self.master.set_view_filter + ) + elif key == "L": + signals.status_prompt_path.send( + self, + prompt = "Load flows", + callback = self.master.load_flows_callback + ) + elif key == "n": + signals.status_prompt_onekey.send( + prompt = "Method", + keys = common.METHOD_OPTIONS, + callback = self.get_method + ) + elif key == "F": + self.master.toggle_follow_flows() + elif key == "W": + if self.master.options.outfile: + self.master.options.outfile = None + else: + signals.status_prompt_path.send( + self, + prompt="Stream flows to", + callback= lambda path: self.master.options.update(outfile=(path, "ab")) + ) + else: + return urwid.ListBox.keypress(self, size, key) diff --git a/mitmproxy/tools/console/flowview.py b/mitmproxy/tools/console/flowview.py new file mode 100644 index 00000000..64caf474 --- /dev/null +++ b/mitmproxy/tools/console/flowview.py @@ -0,0 +1,701 @@ +import math +import os +import sys + +import urwid +from mitmproxy import exceptions +from typing import Optional, Union # noqa + +from mitmproxy import contentviews +from mitmproxy import http +from mitmproxy import utils +from mitmproxy.tools.console import common +from mitmproxy.tools.console import flowdetailview +from mitmproxy.tools.console import grideditor +from mitmproxy.tools.console import searchable +from mitmproxy.tools.console import signals +from mitmproxy.tools.console import tabs +from mitmproxy import export +from netlib.http import Headers +from netlib.http import status_codes + + +class SearchError(Exception): + pass + + +def _mkhelp(): + text = [] + keys = [ + ("A", "accept all intercepted flows"), + ("a", "accept this intercepted flow"), + ("b", "save request/response body"), + ("C", "export flow to clipboard"), + ("D", "duplicate flow"), + ("d", "delete flow"), + ("e", "edit request/response"), + ("f", "load full body data"), + ("m", "change body display mode for this entity\n(default mode can be changed in the options)"), + (None, + common.highlight_key("automatic", "a") + + [("text", ": automatic detection")] + ), + (None, + common.highlight_key("hex", "e") + + [("text", ": Hex")] + ), + (None, + common.highlight_key("html", "h") + + [("text", ": HTML")] + ), + (None, + common.highlight_key("image", "i") + + [("text", ": Image")] + ), + (None, + common.highlight_key("javascript", "j") + + [("text", ": JavaScript")] + ), + (None, + common.highlight_key("json", "s") + + [("text", ": JSON")] + ), + (None, + common.highlight_key("urlencoded", "u") + + [("text", ": URL-encoded data")] + ), + (None, + common.highlight_key("raw", "r") + + [("text", ": raw data")] + ), + (None, + common.highlight_key("xml", "x") + + [("text", ": XML")] + ), + ("E", "export flow to file"), + ("r", "replay request"), + ("V", "revert changes to request"), + ("v", "view body in external viewer"), + ("w", "save all flows matching current view filter"), + ("W", "save this flow"), + ("x", "delete body"), + ("z", "encode/decode a request/response"), + ("tab", "next tab"), + ("h, l", "previous tab, next tab"), + ("space", "next flow"), + ("|", "run script on this flow"), + ("/", "search (case sensitive)"), + ("n", "repeat search forward"), + ("N", "repeat search backwards"), + ] + text.extend(common.format_keyvals(keys, key="key", val="text", indent=4)) + return text +help_context = _mkhelp() + +footer = [ + ('heading_key', "?"), ":help ", + ('heading_key', "q"), ":back ", +] + + +class FlowViewHeader(urwid.WidgetWrap): + + def __init__(self, master: "mitmproxy.console.master.ConsoleMaster", f: http.HTTPFlow): + self.master = master + self.flow = f + self._w = common.format_flow( + f, + False, + extended=True, + hostheader=self.master.options.showhost + ) + signals.flow_change.connect(self.sig_flow_change) + + def sig_flow_change(self, sender, flow): + if flow == self.flow: + self._w = common.format_flow( + flow, + False, + extended=True, + hostheader=self.master.options.showhost + ) + + +cache = utils.LRUCache(200) + +TAB_REQ = 0 +TAB_RESP = 1 + + +class FlowView(tabs.Tabs): + highlight_color = "focusfield" + + def __init__(self, master, state, flow, tab_offset): + self.master, self.state, self.flow = master, state, flow + super().__init__( + [ + (self.tab_request, self.view_request), + (self.tab_response, self.view_response), + (self.tab_details, self.view_details), + ], + tab_offset + ) + + self.show() + self.last_displayed_body = None + signals.flow_change.connect(self.sig_flow_change) + + def tab_request(self): + if self.flow.intercepted and not self.flow.response: + return "Request intercepted" + else: + return "Request" + + def tab_response(self): + if self.flow.intercepted and self.flow.response: + return "Response intercepted" + else: + return "Response" + + def tab_details(self): + return "Detail" + + def view_request(self): + return self.conn_text(self.flow.request) + + def view_response(self): + return self.conn_text(self.flow.response) + + def view_details(self): + return flowdetailview.flowdetails(self.state, self.flow) + + def sig_flow_change(self, sender, flow): + if flow == self.flow: + self.show() + + def content_view(self, viewmode, message): + if message.raw_content is None: + msg, body = "", [urwid.Text([("error", "[content missing]")])] + return msg, body + else: + full = self.state.get_flow_setting( + self.flow, + (self.tab_offset, "fullcontents"), + False + ) + if full: + limit = sys.maxsize + else: + limit = contentviews.VIEW_CUTOFF + + flow_modify_cache_invalidation = hash(( + message.raw_content, + message.headers.fields, + getattr(message, "path", None), + )) + return cache.get( + # We move message into this partial function as it is not hashable. + lambda *args: self._get_content_view(message, *args), + viewmode, + limit, + flow_modify_cache_invalidation + ) + + def _get_content_view(self, message, viewmode, max_lines, _): + description, lines, error = contentviews.get_message_content_view( + viewmode, message + ) + if error: + signals.add_log(error, "error") + # Give hint that you have to tab for the response. + if description == "No content" and isinstance(message, http.HTTPRequest): + description = "No request content (press tab to view response)" + + # If the users has a wide terminal, he gets fewer lines; this should not be an issue. + chars_per_line = 80 + max_chars = max_lines * chars_per_line + total_chars = 0 + text_objects = [] + for line in lines: + txt = [] + for (style, text) in line: + if total_chars + len(text) > max_chars: + text = text[:max_chars - total_chars] + txt.append((style, text)) + total_chars += len(text) + if total_chars == max_chars: + break + + # round up to the next line. + total_chars = int(math.ceil(total_chars / chars_per_line) * chars_per_line) + + text_objects.append(urwid.Text(txt)) + if total_chars == max_chars: + text_objects.append(urwid.Text([ + ("highlight", "Stopped displaying data after %d lines. Press " % max_lines), + ("key", "f"), + ("highlight", " to load all data.") + ])) + break + + return description, text_objects + + def viewmode_get(self): + override = self.state.get_flow_setting( + self.flow, + (self.tab_offset, "prettyview") + ) + return self.state.default_body_view if override is None else override + + def conn_text(self, conn): + if conn: + txt = common.format_keyvals( + [(h + ":", v) for (h, v) in conn.headers.items(multi=True)], + key = "header", + val = "text" + ) + viewmode = self.viewmode_get() + msg, body = self.content_view(viewmode, conn) + + cols = [ + urwid.Text( + [ + ("heading", msg), + ] + ), + urwid.Text( + [ + " ", + ('heading', "["), + ('heading_key', "m"), + ('heading', (":%s]" % viewmode.name)), + ], + align="right" + ) + ] + title = urwid.AttrWrap(urwid.Columns(cols), "heading") + + txt.append(title) + txt.extend(body) + else: + txt = [ + urwid.Text(""), + urwid.Text( + [ + ("highlight", "No response. Press "), + ("key", "e"), + ("highlight", " and edit any aspect to add one."), + ] + ) + ] + return searchable.Searchable(self.state, txt) + + def set_method_raw(self, m): + if m: + self.flow.request.method = m + signals.flow_change.send(self, flow = self.flow) + + def edit_method(self, m): + if m == "e": + signals.status_prompt.send( + prompt = "Method", + text = self.flow.request.method, + callback = self.set_method_raw + ) + else: + for i in common.METHOD_OPTIONS: + if i[1] == m: + self.flow.request.method = i[0].upper() + signals.flow_change.send(self, flow = self.flow) + + def set_url(self, url): + request = self.flow.request + try: + request.url = str(url) + except ValueError: + return "Invalid URL." + signals.flow_change.send(self, flow = self.flow) + + def set_resp_status_code(self, status_code): + try: + status_code = int(status_code) + except ValueError: + return None + self.flow.response.status_code = status_code + if status_code in status_codes.RESPONSES: + self.flow.response.reason = status_codes.RESPONSES[status_code] + signals.flow_change.send(self, flow = self.flow) + + def set_resp_reason(self, reason): + self.flow.response.reason = reason + signals.flow_change.send(self, flow = self.flow) + + def set_headers(self, fields, conn): + conn.headers = Headers(fields) + signals.flow_change.send(self, flow = self.flow) + + def set_query(self, lst, conn): + conn.query = lst + signals.flow_change.send(self, flow = self.flow) + + def set_path_components(self, lst, conn): + conn.path_components = lst + signals.flow_change.send(self, flow = self.flow) + + def set_form(self, lst, conn): + conn.urlencoded_form = lst + signals.flow_change.send(self, flow = self.flow) + + def edit_form(self, conn): + self.master.view_grideditor( + grideditor.URLEncodedFormEditor( + self.master, + conn.urlencoded_form.items(multi=True), + self.set_form, + conn + ) + ) + + def edit_form_confirm(self, key, conn): + if key == "y": + self.edit_form(conn) + + def set_cookies(self, lst, conn): + conn.cookies = lst + signals.flow_change.send(self, flow = self.flow) + + def set_setcookies(self, data, conn): + conn.cookies = data + signals.flow_change.send(self, flow = self.flow) + + def edit(self, part): + if self.tab_offset == TAB_REQ: + message = self.flow.request + else: + if not self.flow.response: + self.flow.response = http.HTTPResponse.make(200, b"") + message = self.flow.response + + self.flow.backup() + if message == self.flow.request and part == "c": + self.master.view_grideditor( + grideditor.CookieEditor( + self.master, + message.cookies.items(multi=True), + self.set_cookies, + message + ) + ) + if message == self.flow.response and part == "c": + self.master.view_grideditor( + grideditor.SetCookieEditor( + self.master, + message.cookies.items(multi=True), + self.set_setcookies, + message + ) + ) + if part == "r": + # Fix an issue caused by some editors when editing a + # request/response body. Many editors make it hard to save a + # file without a terminating newline on the last line. When + # editing message bodies, this can cause problems. For now, I + # just strip the newlines off the end of the body when we return + # from an editor. + c = self.master.spawn_editor(message.get_content(strict=False) or b"") + message.content = c.rstrip(b"\n") + elif part == "f": + if not message.urlencoded_form and message.raw_content: + signals.status_prompt_onekey.send( + prompt = "Existing body is not a URL-encoded form. Clear and edit?", + keys = [ + ("yes", "y"), + ("no", "n"), + ], + callback = self.edit_form_confirm, + args = (message,) + ) + else: + self.edit_form(message) + elif part == "h": + self.master.view_grideditor( + grideditor.HeaderEditor( + self.master, + message.headers.fields, + self.set_headers, + message + ) + ) + elif part == "p": + p = message.path_components + self.master.view_grideditor( + grideditor.PathEditor( + self.master, + p, + self.set_path_components, + message + ) + ) + elif part == "q": + self.master.view_grideditor( + grideditor.QueryEditor( + self.master, + message.query.items(multi=True), + self.set_query, message + ) + ) + elif part == "u": + signals.status_prompt.send( + prompt = "URL", + text = message.url, + callback = self.set_url + ) + elif part == "m" and message == self.flow.request: + signals.status_prompt_onekey.send( + prompt = "Method", + keys = common.METHOD_OPTIONS, + callback = self.edit_method + ) + elif part == "o": + signals.status_prompt.send( + prompt = "Code", + text = str(message.status_code), + callback = self.set_resp_status_code + ) + elif part == "m" and message == self.flow.response: + signals.status_prompt.send( + prompt = "Message", + text = message.reason, + callback = self.set_resp_reason + ) + signals.flow_change.send(self, flow = self.flow) + + def _view_nextprev_flow(self, np, flow): + try: + idx = self.state.view.index(flow) + except IndexError: + return + if np == "next": + new_flow, new_idx = self.state.get_next(idx) + else: + new_flow, new_idx = self.state.get_prev(idx) + if new_flow is None: + signals.status_message.send(message="No more flows!") + else: + signals.pop_view_state.send(self) + self.master.view_flow(new_flow, self.tab_offset) + + def view_next_flow(self, flow): + return self._view_nextprev_flow("next", flow) + + def view_prev_flow(self, flow): + return self._view_nextprev_flow("prev", flow) + + def change_this_display_mode(self, t): + self.state.add_flow_setting( + self.flow, + (self.tab_offset, "prettyview"), + contentviews.get_by_shortcut(t) + ) + signals.flow_change.send(self, flow = self.flow) + + def keypress(self, size, key): + conn = None # type: Optional[Union[http.HTTPRequest, http.HTTPResponse]] + if self.tab_offset == TAB_REQ: + conn = self.flow.request + elif self.tab_offset == TAB_RESP: + conn = self.flow.response + + key = super().keypress(size, key) + + # Special case: Space moves over to the next flow. + # We need to catch that before applying common.shortcuts() + if key == " ": + self.view_next_flow(self.flow) + return + + key = common.shortcuts(key) + if key in ("up", "down", "page up", "page down"): + # Pass scroll events to the wrapped widget + self._w.keypress(size, key) + elif key == "a": + self.flow.resume(self.master) + signals.flow_change.send(self, flow = self.flow) + elif key == "A": + self.master.accept_all() + signals.flow_change.send(self, flow = self.flow) + elif key == "d": + if self.state.flow_count() == 1: + self.master.view_flowlist() + elif self.state.view.index(self.flow) == len(self.state.view) - 1: + self.view_prev_flow(self.flow) + else: + self.view_next_flow(self.flow) + f = self.flow + if f.killable: + f.kill(self.master) + self.state.delete_flow(f) + elif key == "D": + f = self.master.state.duplicate_flow(self.flow) + signals.pop_view_state.send(self) + self.master.view_flow(f) + signals.status_message.send(message="Duplicated.") + elif key == "p": + self.view_prev_flow(self.flow) + elif key == "r": + try: + self.master.replay_request(self.flow) + except exceptions.ReplayException as e: + signals.add_log("Replay error: %s" % e, "warn") + signals.flow_change.send(self, flow = self.flow) + elif key == "V": + if self.flow.modified(): + self.state.revert(self.flow) + signals.flow_change.send(self, flow = self.flow) + signals.status_message.send(message="Reverted.") + else: + signals.status_message.send(message="Flow not modified.") + elif key == "W": + signals.status_prompt_path.send( + prompt = "Save this flow", + callback = self.master.save_one_flow, + args = (self.flow,) + ) + elif key == "|": + signals.status_prompt_path.send( + prompt = "Send flow to script", + callback = self.master.run_script_once, + args = (self.flow,) + ) + elif key == "e": + if self.tab_offset == TAB_REQ: + signals.status_prompt_onekey.send( + prompt="Edit request", + keys=( + ("cookies", "c"), + ("query", "q"), + ("path", "p"), + ("url", "u"), + ("header", "h"), + ("form", "f"), + ("raw body", "r"), + ("method", "m"), + ), + callback=self.edit + ) + elif self.tab_offset == TAB_RESP: + signals.status_prompt_onekey.send( + prompt="Edit response", + keys=( + ("cookies", "c"), + ("code", "o"), + ("message", "m"), + ("header", "h"), + ("raw body", "r"), + ), + callback=self.edit + ) + else: + signals.status_message.send( + message="Tab to the request or response", + expire=1 + ) + elif key in set("bfgmxvzEC") and not conn: + signals.status_message.send( + message = "Tab to the request or response", + expire = 1 + ) + return + elif key == "b": + if self.tab_offset == TAB_REQ: + common.ask_save_body("q", self.flow) + else: + common.ask_save_body("s", self.flow) + elif key == "f": + signals.status_message.send(message="Loading all body data...") + self.state.add_flow_setting( + self.flow, + (self.tab_offset, "fullcontents"), + True + ) + signals.flow_change.send(self, flow = self.flow) + signals.status_message.send(message="") + elif key == "m": + p = list(contentviews.view_prompts) + p.insert(0, ("Clear", "C")) + signals.status_prompt_onekey.send( + self, + prompt = "Display mode", + keys = p, + callback = self.change_this_display_mode + ) + elif key == "E": + if self.tab_offset == TAB_REQ: + scope = "q" + else: + scope = "s" + signals.status_prompt_onekey.send( + self, + prompt = "Export to file", + keys = [(e[0], e[1]) for e in export.EXPORTERS], + callback = common.export_to_clip_or_file, + args = (scope, self.flow, common.ask_save_path) + ) + elif key == "C": + if self.tab_offset == TAB_REQ: + scope = "q" + else: + scope = "s" + signals.status_prompt_onekey.send( + self, + prompt = "Export to clipboard", + keys = [(e[0], e[1]) for e in export.EXPORTERS], + callback = common.export_to_clip_or_file, + args = (scope, self.flow, common.copy_to_clipboard_or_prompt) + ) + elif key == "x": + conn.content = None + signals.flow_change.send(self, flow=self.flow) + elif key == "v": + if conn.raw_content: + t = conn.headers.get("content-type") + if "EDITOR" in os.environ or "PAGER" in os.environ: + self.master.spawn_external_viewer(conn.get_content(strict=False), t) + else: + signals.status_message.send( + message = "Error! Set $EDITOR or $PAGER." + ) + elif key == "z": + self.flow.backup() + e = conn.headers.get("content-encoding", "identity") + if e != "identity": + try: + conn.decode() + except ValueError: + signals.status_message.send( + message = "Could not decode - invalid data?" + ) + else: + signals.status_prompt_onekey.send( + prompt = "Select encoding: ", + keys = ( + ("gzip", "z"), + ("deflate", "d"), + ("brotli", "b"), + ), + callback = self.encode_callback, + args = (conn,) + ) + signals.flow_change.send(self, flow = self.flow) + else: + # Key is not handled here. + return key + + def encode_callback(self, key, conn): + encoding_map = { + "z": "gzip", + "d": "deflate", + "b": "brotli", + } + conn.encode(encoding_map[key]) + signals.flow_change.send(self, flow = self.flow) diff --git a/mitmproxy/tools/console/grideditor/__init__.py b/mitmproxy/tools/console/grideditor/__init__.py new file mode 100644 index 00000000..894f3d22 --- /dev/null +++ b/mitmproxy/tools/console/grideditor/__init__.py @@ -0,0 +1,2 @@ +from .editors import * # noqa +from . import base # noqa diff --git a/mitmproxy/tools/console/grideditor/base.py b/mitmproxy/tools/console/grideditor/base.py new file mode 100644 index 00000000..4505bb97 --- /dev/null +++ b/mitmproxy/tools/console/grideditor/base.py @@ -0,0 +1,413 @@ +import abc +import copy +from typing import Any +from typing import Callable +from typing import Container +from typing import Iterable +from typing import Optional +from typing import Sequence +from typing import Tuple + +import urwid +from mitmproxy.tools.console import common +from mitmproxy.tools.console import signals + +FOOTER = [ + ('heading_key', "enter"), ":edit ", + ('heading_key', "q"), ":back ", +] +FOOTER_EDITING = [ + ('heading_key', "esc"), ":stop editing ", +] + + +class Cell(urwid.WidgetWrap): + def get_data(self): + """ + Raises: + ValueError, if the current content is invalid. + """ + raise NotImplementedError() + + def selectable(self): + return True + + +class Column(metaclass=abc.ABCMeta): + subeditor = None + + def __init__(self, heading): + self.heading = heading + + @abc.abstractmethod + def Display(self, data) -> Cell: + pass + + @abc.abstractmethod + def Edit(self, data) -> Cell: + pass + + @abc.abstractmethod + def blank(self) -> Any: + pass + + def keypress(self, key: str, editor: "GridEditor") -> Optional[str]: + return key + + +class GridRow(urwid.WidgetWrap): + def __init__( + self, + focused: Optional[int], + editing: bool, + editor: "GridEditor", + values: Tuple[Iterable[bytes], Container[int]] + ): + self.focused = focused + self.editor = editor + self.edit_col = None # type: Optional[Cell] + + errors = values[1] + self.fields = [] + for i, v in enumerate(values[0]): + if focused == i and editing: + self.edit_col = self.editor.columns[i].Edit(v) + self.fields.append(self.edit_col) + else: + w = self.editor.columns[i].Display(v) + if focused == i: + if i in errors: + w = urwid.AttrWrap(w, "focusfield_error") + else: + w = urwid.AttrWrap(w, "focusfield") + elif i in errors: + w = urwid.AttrWrap(w, "field_error") + self.fields.append(w) + + fspecs = self.fields[:] + if len(self.fields) > 1: + fspecs[0] = ("fixed", self.editor.first_width + 2, fspecs[0]) + w = urwid.Columns( + fspecs, + dividechars=2 + ) + if focused is not None: + w.set_focus_column(focused) + super().__init__(w) + + def keypress(self, s, k): + if self.edit_col: + w = self._w.column_widths(s)[self.focused] + k = self.edit_col.keypress((w,), k) + return k + + def selectable(self): + return True + + +class GridWalker(urwid.ListWalker): + """ + Stores rows as a list of (rows, errors) tuples, where rows is a list + and errors is a set with an entry of each offset in rows that is an + error. + """ + + def __init__( + self, + lst: Iterable[list], + editor: "GridEditor" + ): + self.lst = [(i, set()) for i in lst] + self.editor = editor + self.focus = 0 + self.focus_col = 0 + self.edit_row = None # type: Optional[GridRow] + + def _modified(self): + self.editor.show_empty_msg() + return super()._modified() + + def add_value(self, lst): + self.lst.append( + (lst[:], set()) + ) + self._modified() + + def get_current_value(self): + if self.lst: + return self.lst[self.focus][0][self.focus_col] + + def set_current_value(self, val): + errors = self.lst[self.focus][1] + emsg = self.editor.is_error(self.focus_col, val) + if emsg: + signals.status_message.send(message=emsg, expire=5) + errors.add(self.focus_col) + else: + errors.discard(self.focus_col) + self.set_value(val, self.focus, self.focus_col, errors) + + def set_value(self, val, focus, focus_col, errors=None): + if not errors: + errors = set([]) + row = list(self.lst[focus][0]) + row[focus_col] = val + self.lst[focus] = [tuple(row), errors] + self._modified() + + def delete_focus(self): + if self.lst: + del self.lst[self.focus] + self.focus = min(len(self.lst) - 1, self.focus) + self._modified() + + def _insert(self, pos): + self.focus = pos + self.lst.insert( + self.focus, + ([c.blank() for c in self.editor.columns], set([])) + ) + self.focus_col = 0 + self.start_edit() + + def insert(self): + return self._insert(self.focus) + + def add(self): + return self._insert(min(self.focus + 1, len(self.lst))) + + def start_edit(self): + col = self.editor.columns[self.focus_col] + if self.lst and not col.subeditor: + self.edit_row = GridRow( + self.focus_col, True, self.editor, self.lst[self.focus] + ) + self.editor.master.loop.widget.footer.update(FOOTER_EDITING) + self._modified() + + def stop_edit(self): + if self.edit_row: + self.editor.master.loop.widget.footer.update(FOOTER) + try: + val = self.edit_row.edit_col.get_data() + except ValueError: + return + self.edit_row = None + self.set_current_value(val) + + def left(self): + self.focus_col = max(self.focus_col - 1, 0) + self._modified() + + def right(self): + self.focus_col = min(self.focus_col + 1, len(self.editor.columns) - 1) + self._modified() + + def tab_next(self): + self.stop_edit() + if self.focus_col < len(self.editor.columns) - 1: + self.focus_col += 1 + elif self.focus != len(self.lst) - 1: + self.focus_col = 0 + self.focus += 1 + self._modified() + + def get_focus(self): + if self.edit_row: + return self.edit_row, self.focus + elif self.lst: + return GridRow( + self.focus_col, + False, + self.editor, + self.lst[self.focus] + ), self.focus + else: + return None, None + + def set_focus(self, focus): + self.stop_edit() + self.focus = focus + self._modified() + + def get_next(self, pos): + if pos + 1 >= len(self.lst): + return None, None + return GridRow(None, False, self.editor, self.lst[pos + 1]), pos + 1 + + def get_prev(self, pos): + if pos - 1 < 0: + return None, None + return GridRow(None, False, self.editor, self.lst[pos - 1]), pos - 1 + + +class GridListBox(urwid.ListBox): + def __init__(self, lw): + super().__init__(lw) + + +FIRST_WIDTH_MAX = 40 +FIRST_WIDTH_MIN = 20 + + +class GridEditor(urwid.WidgetWrap): + title = None # type: str + columns = None # type: Sequence[Column] + + def __init__( + self, + master: "mitmproxy.console.master.ConsoleMaster", + value: Any, + callback: Callable[..., None], + *cb_args, + **cb_kwargs + ): + value = self.data_in(copy.deepcopy(value)) + self.master = master + self.value = value + self.callback = callback + self.cb_args = cb_args + self.cb_kwargs = cb_kwargs + + first_width = 20 + if value: + for r in value: + assert len(r) == len(self.columns) + first_width = max(len(r), first_width) + self.first_width = min(first_width, FIRST_WIDTH_MAX) + + title = urwid.Text(self.title) + title = urwid.Padding(title, align="left", width=("relative", 100)) + title = urwid.AttrWrap(title, "heading") + + headings = [] + for i, col in enumerate(self.columns): + c = urwid.Text(col.heading) + if i == 0 and len(self.columns) > 1: + headings.append(("fixed", first_width + 2, c)) + else: + headings.append(c) + h = urwid.Columns( + headings, + dividechars=2 + ) + h = urwid.AttrWrap(h, "heading") + + self.walker = GridWalker(self.value, self) + self.lb = GridListBox(self.walker) + w = urwid.Frame( + self.lb, + header=urwid.Pile([title, h]) + ) + super().__init__(w) + self.master.loop.widget.footer.update("") + self.show_empty_msg() + + def show_empty_msg(self): + if self.walker.lst: + self._w.set_footer(None) + else: + self._w.set_footer( + urwid.Text( + [ + ("highlight", "No values. Press "), + ("key", "a"), + ("highlight", " to add some."), + ] + ) + ) + + def set_subeditor_value(self, val, focus, focus_col): + self.walker.set_value(val, focus, focus_col) + + def keypress(self, size, key): + if self.walker.edit_row: + if key in ["esc"]: + self.walker.stop_edit() + elif key == "tab": + pf, pfc = self.walker.focus, self.walker.focus_col + self.walker.tab_next() + if self.walker.focus == pf and self.walker.focus_col != pfc: + self.walker.start_edit() + else: + self._w.keypress(size, key) + return None + + key = common.shortcuts(key) + column = self.columns[self.walker.focus_col] + if key in ["q", "esc"]: + res = [] + for i in self.walker.lst: + if not i[1] and any([x for x in i[0]]): + res.append(i[0]) + self.callback(self.data_out(res), *self.cb_args, **self.cb_kwargs) + signals.pop_view_state.send(self) + elif key == "g": + self.walker.set_focus(0) + elif key == "G": + self.walker.set_focus(len(self.walker.lst) - 1) + elif key in ["h", "left"]: + self.walker.left() + elif key in ["l", "right"]: + self.walker.right() + elif key == "tab": + self.walker.tab_next() + elif key == "a": + self.walker.add() + elif key == "A": + self.walker.insert() + elif key == "d": + self.walker.delete_focus() + elif column.keypress(key, self) and not self.handle_key(key): + return self._w.keypress(size, key) + + def data_out(self, data: Sequence[list]) -> Any: + """ + Called on raw list data, before data is returned through the + callback. + """ + return data + + def data_in(self, data: Any) -> Iterable[list]: + """ + Called to prepare provided data. + """ + return data + + def is_error(self, col: int, val: Any) -> Optional[str]: + """ + Return None, or a string error message. + """ + return False + + def handle_key(self, key): + return False + + def make_help(self): + text = [ + urwid.Text([("text", "Editor control:\n")]) + ] + keys = [ + ("A", "insert row before cursor"), + ("a", "add row after cursor"), + ("d", "delete row"), + ("e", "spawn external editor on current field"), + ("q", "save changes and exit editor"), + ("r", "read value from file"), + ("R", "read unescaped value from file"), + ("esc", "save changes and exit editor"), + ("tab", "next field"), + ("enter", "edit field"), + ] + text.extend( + common.format_keyvals(keys, key="key", val="text", indent=4) + ) + text.append( + urwid.Text( + [ + "\n", + ("text", "Values are escaped Python-style strings.\n"), + ] + ) + ) + return text diff --git a/mitmproxy/tools/console/grideditor/col_bytes.py b/mitmproxy/tools/console/grideditor/col_bytes.py new file mode 100644 index 00000000..c951ce44 --- /dev/null +++ b/mitmproxy/tools/console/grideditor/col_bytes.py @@ -0,0 +1,98 @@ +import os +from typing import Callable, Optional + +import urwid +from mitmproxy.tools.console import signals +from mitmproxy.tools.console.grideditor import base +from netlib import strutils + + +def read_file(filename: str, callback: Callable[..., None], escaped: bool) -> Optional[str]: + if not filename: + return + + filename = os.path.expanduser(filename) + try: + with open(filename, "r" if escaped else "rb") as f: + d = f.read() + except IOError as v: + return str(v) + + if escaped: + try: + d = strutils.escaped_str_to_bytes(d) + except ValueError: + return "Invalid Python-style string encoding." + # TODO: Refactor the status_prompt_path signal so that we + # can raise exceptions here and return the content instead. + callback(d) + + +class Column(base.Column): + def Display(self, data): + return Display(data) + + def Edit(self, data): + return Edit(data) + + def blank(self): + return b"" + + def keypress(self, key, editor): + if key == "r": + if editor.walker.get_current_value() is not None: + signals.status_prompt_path.send( + self, + prompt="Read file", + callback=read_file, + args=(editor.walker.set_current_value, True) + ) + elif key == "R": + if editor.walker.get_current_value() is not None: + signals.status_prompt_path.send( + self, + prompt="Read unescaped file", + callback=read_file, + args=(editor.walker.set_current_value, False) + ) + elif key == "e": + o = editor.walker.get_current_value() + if o is not None: + n = editor.master.spawn_editor(o) + n = strutils.clean_hanging_newline(n) + editor.walker.set_current_value(n) + elif key in ["enter"]: + editor.walker.start_edit() + else: + return key + + +class Display(base.Cell): + def __init__(self, data: bytes): + self.data = data + escaped = strutils.bytes_to_escaped_str(data) + w = urwid.Text(escaped, wrap="any") + super().__init__(w) + + def get_data(self) -> bytes: + return self.data + + +class Edit(base.Cell): + def __init__(self, data: bytes): + data = strutils.bytes_to_escaped_str(data) + w = urwid.Edit(edit_text=data, wrap="any", multiline=True) + w = urwid.AttrWrap(w, "editfield") + super().__init__(w) + + def get_data(self) -> bytes: + txt = self._w.get_text()[0].strip() + try: + return strutils.escaped_str_to_bytes(txt) + except ValueError: + signals.status_message.send( + self, + message="Invalid Python-style string encoding.", + expire=1000 + ) + raise diff --git a/mitmproxy/tools/console/grideditor/col_subgrid.py b/mitmproxy/tools/console/grideditor/col_subgrid.py new file mode 100644 index 00000000..3147e63d --- /dev/null +++ b/mitmproxy/tools/console/grideditor/col_subgrid.py @@ -0,0 +1,50 @@ +import urwid +from mitmproxy.tools.console.grideditor import base +from mitmproxy.tools.console import signals +from netlib.http import cookies + + +class Column(base.Column): + def __init__(self, heading, subeditor): + super().__init__(heading) + self.subeditor = subeditor + + def Edit(self, data): + raise RuntimeError("SubgridColumn should handle edits itself") + + def Display(self, data): + return Display(data) + + def blank(self): + return [] + + def keypress(self, key, editor): + if key in "rRe": + signals.status_message.send( + self, + message="Press enter to edit this field.", + expire=1000 + ) + return + elif key in ["enter"]: + editor.master.view_grideditor( + self.subeditor( + editor.master, + editor.walker.get_current_value(), + editor.set_subeditor_value, + editor.walker.focus, + editor.walker.focus_col + ) + ) + else: + return key + + +class Display(base.Cell): + def __init__(self, data): + p = cookies._format_pairs(data, sep="\n") + w = urwid.Text(p) + super().__init__(w) + + def get_data(self): + pass diff --git a/mitmproxy/tools/console/grideditor/col_text.py b/mitmproxy/tools/console/grideditor/col_text.py new file mode 100644 index 00000000..2d5192ae --- /dev/null +++ b/mitmproxy/tools/console/grideditor/col_text.py @@ -0,0 +1,54 @@ +""" +Welcome to the encoding dance! + +In a nutshell, text columns are actually a proxy class for byte columns, +which just encode/decodes contents. +""" + +from mitmproxy.tools.console import signals +from mitmproxy.tools.console.grideditor import col_bytes + + +class Column(col_bytes.Column): + def __init__(self, heading, encoding="utf8", errors="surrogateescape"): + super().__init__(heading) + self.encoding_args = encoding, errors + + def Display(self, data): + return TDisplay(data, self.encoding_args) + + def Edit(self, data): + return TEdit(data, self.encoding_args) + + def blank(self): + return u"" + + +# This is the same for both edit and display. +class EncodingMixin: + def __init__(self, data, encoding_args): + # type: (str) -> TDisplay + self.encoding_args = encoding_args + data = data.encode(*self.encoding_args) + super().__init__(data) + + def get_data(self) -> str: + data = super().get_data() + try: + return data.decode(*self.encoding_args) + except ValueError: + signals.status_message.send( + self, + message="Invalid encoding.", + expire=1000 + ) + raise + + +# urwid forces a different name for a subclass. +class TDisplay(EncodingMixin, col_bytes.Display): + pass + + +class TEdit(EncodingMixin, col_bytes.Edit): + pass diff --git a/mitmproxy/tools/console/grideditor/editors.py b/mitmproxy/tools/console/grideditor/editors.py new file mode 100644 index 00000000..64361af7 --- /dev/null +++ b/mitmproxy/tools/console/grideditor/editors.py @@ -0,0 +1,241 @@ +import re +import urwid +from mitmproxy import exceptions +from mitmproxy import flowfilter +from mitmproxy.addons import script +from mitmproxy.tools.console import common +from mitmproxy.tools.console.grideditor import base +from mitmproxy.tools.console.grideditor import col_bytes +from mitmproxy.tools.console.grideditor import col_text +from mitmproxy.tools.console.grideditor import col_subgrid +from mitmproxy.tools.console import signals +from netlib.http import user_agents + + +class QueryEditor(base.GridEditor): + title = "Editing query" + columns = [ + col_text.Column("Key"), + col_text.Column("Value") + ] + + +class HeaderEditor(base.GridEditor): + title = "Editing headers" + columns = [ + col_bytes.Column("Key"), + col_bytes.Column("Value") + ] + + def make_help(self): + h = super().make_help() + text = [ + urwid.Text([("text", "Special keys:\n")]) + ] + keys = [ + ("U", "add User-Agent header"), + ] + text.extend( + common.format_keyvals(keys, key="key", val="text", indent=4) + ) + text.append(urwid.Text([("text", "\n")])) + text.extend(h) + return text + + def set_user_agent(self, k): + ua = user_agents.get_by_shortcut(k) + if ua: + self.walker.add_value( + [ + b"User-Agent", + ua[2].encode() + ] + ) + + def handle_key(self, key): + if key == "U": + signals.status_prompt_onekey.send( + prompt="Add User-Agent header:", + keys=[(i[0], i[1]) for i in user_agents.UASTRINGS], + callback=self.set_user_agent, + ) + return True + + +class URLEncodedFormEditor(base.GridEditor): + title = "Editing URL-encoded form" + columns = [ + col_bytes.Column("Key"), + col_bytes.Column("Value") + ] + + +class ReplaceEditor(base.GridEditor): + title = "Editing replacement patterns" + columns = [ + col_text.Column("Filter"), + col_bytes.Column("Regex"), + col_bytes.Column("Replacement"), + ] + + def is_error(self, col, val): + if col == 0: + if not flowfilter.parse(val): + return "Invalid filter specification." + elif col == 1: + try: + re.compile(val) + except re.error: + return "Invalid regular expression." + return False + + +class SetHeadersEditor(base.GridEditor): + title = "Editing header set patterns" + columns = [ + col_text.Column("Filter"), + col_bytes.Column("Header"), + col_bytes.Column("Value"), + ] + + def is_error(self, col, val): + if col == 0: + if not flowfilter.parse(val): + return "Invalid filter specification" + return False + + def make_help(self): + h = super().make_help() + text = [ + urwid.Text([("text", "Special keys:\n")]) + ] + keys = [ + ("U", "add User-Agent header"), + ] + text.extend( + common.format_keyvals(keys, key="key", val="text", indent=4) + ) + text.append(urwid.Text([("text", "\n")])) + text.extend(h) + return text + + def set_user_agent(self, k): + ua = user_agents.get_by_shortcut(k) + if ua: + self.walker.add_value( + [ + ".*", + b"User-Agent", + ua[2].encode() + ] + ) + + def handle_key(self, key): + if key == "U": + signals.status_prompt_onekey.send( + prompt="Add User-Agent header:", + keys=[(i[0], i[1]) for i in user_agents.UASTRINGS], + callback=self.set_user_agent, + ) + return True + + +class PathEditor(base.GridEditor): + # TODO: Next row on enter? + + title = "Editing URL path components" + columns = [ + col_text.Column("Component"), + ] + + def data_in(self, data): + return [[i] for i in data] + + def data_out(self, data): + return [i[0] for i in data] + + +class ScriptEditor(base.GridEditor): + title = "Editing scripts" + columns = [ + col_text.Column("Command"), + ] + + def is_error(self, col, val): + try: + script.parse_command(val) + except exceptions.AddonError as e: + return str(e) + + +class HostPatternEditor(base.GridEditor): + title = "Editing host patterns" + columns = [ + col_text.Column("Regex (matched on hostname:port / ip:port)") + ] + + def is_error(self, col, val): + try: + re.compile(val, re.IGNORECASE) + except re.error as e: + return "Invalid regex: %s" % str(e) + + def data_in(self, data): + return [[i] for i in data] + + def data_out(self, data): + return [i[0] for i in data] + + +class CookieEditor(base.GridEditor): + title = "Editing request Cookie header" + columns = [ + col_text.Column("Name"), + col_text.Column("Value"), + ] + + +class CookieAttributeEditor(base.GridEditor): + title = "Editing Set-Cookie attributes" + columns = [ + col_text.Column("Name"), + col_text.Column("Value"), + ] + + def data_in(self, data): + return [(k, v or "") for k, v in data] + + def data_out(self, data): + ret = [] + for i in data: + if not i[1]: + ret.append([i[0], None]) + else: + ret.append(i) + return ret + + +class SetCookieEditor(base.GridEditor): + title = "Editing response SetCookie header" + columns = [ + col_text.Column("Name"), + col_text.Column("Value"), + col_subgrid.Column("Attributes", CookieAttributeEditor), + ] + + def data_in(self, data): + flattened = [] + for key, (value, attrs) in data: + flattened.append([key, value, attrs.items(multi=True)]) + return flattened + + def data_out(self, data): + vals = [] + for key, value, attrs in data: + vals.append( + [ + key, + (value, attrs) + ] + ) + return vals diff --git a/mitmproxy/tools/console/help.py b/mitmproxy/tools/console/help.py new file mode 100644 index 00000000..752ebf00 --- /dev/null +++ b/mitmproxy/tools/console/help.py @@ -0,0 +1,97 @@ +import platform + +import urwid + +from mitmproxy import flowfilter +from mitmproxy.tools.console import common +from mitmproxy.tools.console import signals + +from netlib import version + +footer = [ + ("heading", 'mitmproxy {} (Python {}) '.format(version.VERSION, platform.python_version())), + ('heading_key', "q"), ":back ", +] + + +class HelpView(urwid.ListBox): + + def __init__(self, help_context): + self.help_context = help_context or [] + urwid.ListBox.__init__( + self, + self.helptext() + ) + + def helptext(self): + text = [] + text.append(urwid.Text([("head", "This view:\n")])) + text.extend(self.help_context) + + text.append(urwid.Text([("head", "\n\nMovement:\n")])) + keys = [ + ("j, k", "down, up"), + ("h, l", "left, right (in some contexts)"), + ("g, G", "go to beginning, end"), + ("space", "page down"), + ("pg up/down", "page up/down"), + ("ctrl+b/ctrl+f", "page up/down"), + ("arrows", "up, down, left, right"), + ] + text.extend( + common.format_keyvals( + keys, + key="key", + val="text", + indent=4)) + + text.append(urwid.Text([("head", "\n\nGlobal keys:\n")])) + keys = [ + ("i", "set interception pattern"), + ("o", "options"), + ("q", "quit / return to previous page"), + ("Q", "quit without confirm prompt"), + ("R", "replay of requests/responses from file"), + ] + text.extend( + common.format_keyvals(keys, key="key", val="text", indent=4) + ) + + text.append(urwid.Text([("head", "\n\nFilter expressions:\n")])) + text.extend(common.format_keyvals(flowfilter.help, key="key", val="text", indent=4)) + + text.append( + urwid.Text( + [ + "\n", + ("text", " Regexes are Python-style.\n"), + ("text", " Regexes can be specified as quoted strings.\n"), + ("text", " Header matching (~h, ~hq, ~hs) is against a string of the form \"name: value\".\n"), + ("text", " Expressions with no operators are regex matches against URL.\n"), + ("text", " Default binary operator is &.\n"), + ("head", "\n Examples:\n"), + ] + ) + ) + examples = [ + ("google\.com", "Url containing \"google.com"), + ("~q ~b test", "Requests where body contains \"test\""), + ("!(~q & ~t \"text/html\")", "Anything but requests with a text/html content type."), + ] + text.extend( + common.format_keyvals(examples, key="key", val="text", indent=4) + ) + return text + + def keypress(self, size, key): + key = common.shortcuts(key) + if key == "q": + signals.pop_view_state.send(self) + return None + elif key == "?": + key = None + elif key == "g": + self.set_focus(0) + elif key == "G": + self.set_focus(len(self.body.contents)) + return urwid.ListBox.keypress(self, size, key) diff --git a/mitmproxy/tools/console/master.py b/mitmproxy/tools/console/master.py new file mode 100644 index 00000000..e80cb0af --- /dev/null +++ b/mitmproxy/tools/console/master.py @@ -0,0 +1,702 @@ +import mailcap +import mimetypes +import os +import os.path +import shlex +import signal +import stat +import subprocess +import sys +import tempfile +import traceback +import weakref + +import urwid +from typing import Optional + +from mitmproxy import addons +from mitmproxy import contentviews +from mitmproxy import controller +from mitmproxy import exceptions +from mitmproxy import master +from mitmproxy import io +from mitmproxy import flowfilter +from mitmproxy import utils +from mitmproxy.addons import state +import mitmproxy.options +from mitmproxy.tools.console import flowlist +from mitmproxy.tools.console import flowview +from mitmproxy.tools.console import grideditor +from mitmproxy.tools.console import help +from mitmproxy.tools.console import options +from mitmproxy.tools.console import palettepicker +from mitmproxy.tools.console import palettes +from mitmproxy.tools.console import signals +from mitmproxy.tools.console import statusbar +from mitmproxy.tools.console import window +from mitmproxy.flowfilter import FMarked +from netlib import tcp, strutils + +EVENTLOG_SIZE = 500 + + +class ConsoleState(state.State): + + def __init__(self): + state.State.__init__(self) + self.focus = None + self.follow_focus = None + self.default_body_view = contentviews.get("Auto") + self.flowsettings = weakref.WeakKeyDictionary() + self.last_search = None + self.last_filter = "" + self.mark_filter = False + + def __setattr__(self, name, value): + self.__dict__[name] = value + signals.update_settings.send(self) + + def add_flow_setting(self, flow, key, value): + d = self.flowsettings.setdefault(flow, {}) + d[key] = value + + def get_flow_setting(self, flow, key, default=None): + d = self.flowsettings.get(flow, {}) + return d.get(key, default) + + def add_flow(self, f): + super().add_flow(f) + signals.flowlist_change.send(self) + self.update_focus() + return f + + def update_flow(self, f): + super().update_flow(f) + signals.flowlist_change.send(self) + self.update_focus() + return f + + def set_view_filter(self, txt): + ret = super().set_view_filter(txt) + self.set_focus(self.focus) + return ret + + def get_focus(self): + if not self.view or self.focus is None: + return None, None + return self.view[self.focus], self.focus + + def set_focus(self, idx): + if self.view: + if idx is None or idx < 0: + idx = 0 + elif idx >= len(self.view): + idx = len(self.view) - 1 + self.focus = idx + else: + self.focus = None + + def update_focus(self): + if self.focus is None: + self.set_focus(0) + elif self.follow_focus: + self.set_focus(len(self.view) - 1) + + def set_focus_flow(self, f): + self.set_focus(self.view.index(f)) + + def get_from_pos(self, pos): + if len(self.view) <= pos or pos < 0: + return None, None + return self.view[pos], pos + + def get_next(self, pos): + return self.get_from_pos(pos + 1) + + def get_prev(self, pos): + return self.get_from_pos(pos - 1) + + def delete_flow(self, f): + if f in self.view and self.view.index(f) <= self.focus: + self.focus -= 1 + if self.focus < 0: + self.focus = None + ret = super().delete_flow(f) + self.set_focus(self.focus) + return ret + + def get_nearest_matching_flow(self, flow, flt): + fidx = self.view.index(flow) + dist = 1 + + fprev = fnext = True + while fprev or fnext: + fprev, _ = self.get_from_pos(fidx - dist) + fnext, _ = self.get_from_pos(fidx + dist) + + if fprev and flowfilter.match(flt, fprev): + return fprev + elif fnext and flowfilter.match(flt, fnext): + return fnext + + dist += 1 + + return None + + def enable_marked_filter(self): + marked_flows = [f for f in self.flows if f.marked] + if not marked_flows: + return + + marked_filter = "~%s" % FMarked.code + + # Save Focus + last_focus, _ = self.get_focus() + nearest_marked = self.get_nearest_matching_flow(last_focus, marked_filter) + + self.last_filter = self.filter_txt + self.set_view_filter(marked_filter) + + # Restore Focus + if last_focus.marked: + self.set_focus_flow(last_focus) + else: + self.set_focus_flow(nearest_marked) + + self.mark_filter = True + + def disable_marked_filter(self): + marked_filter = "~%s" % FMarked.code + + # Save Focus + last_focus, _ = self.get_focus() + nearest_marked = self.get_nearest_matching_flow(last_focus, marked_filter) + + self.set_view_filter(self.last_filter) + self.last_filter = "" + + # Restore Focus + if last_focus.marked: + self.set_focus_flow(last_focus) + else: + self.set_focus_flow(nearest_marked) + + self.mark_filter = False + + def clear(self): + marked_flows = [f for f in self.view if f.marked] + super().clear() + + for f in marked_flows: + self.add_flow(f) + f.marked = True + + if len(self.flows.views) == 0: + self.focus = None + else: + self.focus = 0 + self.set_focus(self.focus) + + +class Options(mitmproxy.options.Options): + def __init__( + self, + eventlog: bool = False, + follow: bool = False, + intercept: bool = False, + filter: Optional[str] = None, + palette: Optional[str] = None, + palette_transparent: bool = False, + no_mouse: bool = False, + **kwargs + ): + self.eventlog = eventlog + self.follow = follow + self.intercept = intercept + self.filter = filter + self.palette = palette + self.palette_transparent = palette_transparent + self.no_mouse = no_mouse + super().__init__(**kwargs) + + +class ConsoleMaster(master.Master): + palette = [] + + def __init__(self, options, server): + master.Master.__init__(self, options, server) + self.state = ConsoleState() + self.stream_path = None + # This line is just for type hinting + self.options = self.options # type: Options + self.options.errored.connect(self.options_error) + + r = self.set_intercept(options.intercept) + if r: + print("Intercept error: {}".format(r), file=sys.stderr) + sys.exit(1) + + if options.filter: + self.set_view_filter(options.filter) + + self.palette = options.palette + self.palette_transparent = options.palette_transparent + + self.logbuffer = urwid.SimpleListWalker([]) + self.follow = options.follow + + self.view_stack = [] + + signals.call_in.connect(self.sig_call_in) + signals.pop_view_state.connect(self.sig_pop_view_state) + signals.replace_view_state.connect(self.sig_replace_view_state) + signals.push_view_state.connect(self.sig_push_view_state) + signals.sig_add_log.connect(self.sig_add_log) + self.addons.add(*addons.default_addons()) + self.addons.add(self.state) + + def __setattr__(self, name, value): + self.__dict__[name] = value + signals.update_settings.send(self) + + def options_error(self, opts, exc): + signals.status_message.send( + message=str(exc), + expire=1 + ) + + def sig_add_log(self, sender, e, level): + if self.options.verbosity < utils.log_tier(level): + return + + if level in ("error", "warn"): + signals.status_message.send( + message = "{}: {}".format(level.title(), e) + ) + e = urwid.Text((level, str(e))) + else: + e = urwid.Text(str(e)) + self.logbuffer.append(e) + if len(self.logbuffer) > EVENTLOG_SIZE: + self.logbuffer.pop(0) + self.logbuffer.set_focus(len(self.logbuffer) - 1) + + def add_log(self, e, level): + signals.add_log(e, level) + + def sig_call_in(self, sender, seconds, callback, args=()): + def cb(*_): + return callback(*args) + self.loop.set_alarm_in(seconds, cb) + + def sig_replace_view_state(self, sender): + """ + A view has been pushed onto the stack, and is intended to replace + the current view rather tha creating a new stack entry. + """ + if len(self.view_stack) > 1: + del self.view_stack[1] + + def sig_pop_view_state(self, sender): + """ + Pop the top view off the view stack. If no more views will be left + after this, prompt for exit. + """ + if len(self.view_stack) > 1: + self.view_stack.pop() + self.loop.widget = self.view_stack[-1] + else: + signals.status_prompt_onekey.send( + self, + prompt = "Quit", + keys = ( + ("yes", "y"), + ("no", "n"), + ), + callback = self.quit, + ) + + def sig_push_view_state(self, sender, window): + """ + Push a new view onto the view stack. + """ + self.view_stack.append(window) + self.loop.widget = window + self.loop.draw_screen() + + def run_script_once(self, command, f): + sc = self.addons.get("scriptloader") + try: + with self.handlecontext(): + sc.run_once(command, [f]) + except mitmproxy.exceptions.AddonError as e: + signals.add_log("Script error: %s" % e, "warn") + + def toggle_eventlog(self): + self.options.eventlog = not self.options.eventlog + self.view_flowlist() + signals.replace_view_state.send(self) + + def _readflows(self, path): + """ + Utitility function that reads a list of flows + or prints an error to the UI if that fails. + Returns + - None, if there was an error. + - a list of flows, otherwise. + """ + try: + return io.read_flows_from_paths(path) + except exceptions.FlowReadException as e: + signals.status_message.send(message=str(e)) + + def spawn_editor(self, data): + text = not isinstance(data, bytes) + fd, name = tempfile.mkstemp('', "mproxy", text=text) + with open(fd, "w" if text else "wb") as f: + f.write(data) + # if no EDITOR is set, assume 'vi' + c = os.environ.get("EDITOR") or "vi" + cmd = shlex.split(c) + cmd.append(name) + self.ui.stop() + try: + subprocess.call(cmd) + except: + signals.status_message.send( + message="Can't start editor: %s" % " ".join(c) + ) + else: + with open(name, "r" if text else "rb") as f: + data = f.read() + self.ui.start() + os.unlink(name) + return data + + def spawn_external_viewer(self, data, contenttype): + if contenttype: + contenttype = contenttype.split(";")[0] + ext = mimetypes.guess_extension(contenttype) or "" + else: + ext = "" + fd, name = tempfile.mkstemp(ext, "mproxy") + os.write(fd, data) + os.close(fd) + + # read-only to remind the user that this is a view function + os.chmod(name, stat.S_IREAD) + + cmd = None + shell = False + + if contenttype: + c = mailcap.getcaps() + cmd, _ = mailcap.findmatch(c, contenttype, filename=name) + if cmd: + shell = True + if not cmd: + # hm which one should get priority? + c = os.environ.get("PAGER") or os.environ.get("EDITOR") + if not c: + c = "less" + cmd = shlex.split(c) + cmd.append(name) + self.ui.stop() + try: + subprocess.call(cmd, shell=shell) + except: + signals.status_message.send( + message="Can't start external viewer: %s" % " ".join(c) + ) + self.ui.start() + os.unlink(name) + + def set_palette(self, name): + self.palette = name + self.ui.register_palette( + palettes.palettes[name].palette(self.palette_transparent) + ) + self.ui.clear() + + def ticker(self, *userdata): + changed = self.tick(timeout=0) + if changed: + self.loop.draw_screen() + signals.update_settings.send() + self.loop.set_alarm_in(0.01, self.ticker) + + def run(self): + self.ui = urwid.raw_display.Screen() + self.ui.set_terminal_properties(256) + self.set_palette(self.palette) + self.loop = urwid.MainLoop( + urwid.SolidFill("x"), + screen = self.ui, + handle_mouse = not self.options.no_mouse, + ) + self.ab = statusbar.ActionBar() + + if self.options.rfile: + ret = self.load_flows_path(self.options.rfile) + if ret and self.state.flow_count(): + signals.add_log( + "File truncated or corrupted. " + "Loaded as many flows as possible.", + "error" + ) + elif ret and not self.state.flow_count(): + self.shutdown() + print("Could not load file: {}".format(ret), file=sys.stderr) + sys.exit(1) + + self.loop.set_alarm_in(0.01, self.ticker) + if self.options.http2 and not tcp.HAS_ALPN: # pragma: no cover + def http2err(*args, **kwargs): + signals.status_message.send( + message = "HTTP/2 disabled - OpenSSL 1.0.2+ required." + " Use --no-http2 to silence this warning.", + expire=5 + ) + self.loop.set_alarm_in(0.01, http2err) + + # It's not clear why we need to handle this explicitly - without this, + # mitmproxy hangs on keyboard interrupt. Remove if we ever figure it + # out. + def exit(s, f): + raise urwid.ExitMainLoop + signal.signal(signal.SIGINT, exit) + + self.loop.set_alarm_in( + 0.0001, + lambda *args: self.view_flowlist() + ) + + self.start() + try: + self.loop.run() + except Exception: + self.loop.stop() + sys.stdout.flush() + print(traceback.format_exc(), file=sys.stderr) + print("mitmproxy has crashed!", file=sys.stderr) + print("Please lodge a bug report at:", file=sys.stderr) + print("\thttps://github.com/mitmproxy/mitmproxy", file=sys.stderr) + print("Shutting down...", file=sys.stderr) + sys.stderr.flush() + self.shutdown() + + def view_help(self, helpctx): + signals.push_view_state.send( + self, + window = window.Window( + self, + help.HelpView(helpctx), + None, + statusbar.StatusBar(self, help.footer), + None + ) + ) + + def view_options(self): + for i in self.view_stack: + if isinstance(i["body"], options.Options): + return + signals.push_view_state.send( + self, + window = window.Window( + self, + options.Options(self), + None, + statusbar.StatusBar(self, options.footer), + options.help_context, + ) + ) + + def view_palette_picker(self): + signals.push_view_state.send( + self, + window = window.Window( + self, + palettepicker.PalettePicker(self), + None, + statusbar.StatusBar(self, palettepicker.footer), + palettepicker.help_context, + ) + ) + + def view_grideditor(self, ge): + signals.push_view_state.send( + self, + window = window.Window( + self, + ge, + None, + statusbar.StatusBar(self, grideditor.base.FOOTER), + ge.make_help() + ) + ) + + def view_flowlist(self): + if self.ui.started: + self.ui.clear() + if self.state.follow_focus: + self.state.set_focus(self.state.flow_count()) + + if self.options.eventlog: + body = flowlist.BodyPile(self) + else: + body = flowlist.FlowListBox(self) + + if self.follow: + self.toggle_follow_flows() + + signals.push_view_state.send( + self, + window = window.Window( + self, + body, + None, + statusbar.StatusBar(self, flowlist.footer), + flowlist.help_context + ) + ) + + def view_flow(self, flow, tab_offset=0): + self.state.set_focus_flow(flow) + signals.push_view_state.send( + self, + window = window.Window( + self, + flowview.FlowView(self, self.state, flow, tab_offset), + flowview.FlowViewHeader(self, flow), + statusbar.StatusBar(self, flowview.footer), + flowview.help_context + ) + ) + + def _write_flows(self, path, flows): + if not path: + return + path = os.path.expanduser(path) + try: + f = open(path, "wb") + fw = io.FlowWriter(f) + for i in flows: + fw.add(i) + f.close() + except IOError as v: + signals.status_message.send(message=v.strerror) + + def save_one_flow(self, path, flow): + return self._write_flows(path, [flow]) + + def save_flows(self, path): + return self._write_flows(path, self.state.view) + + def load_flows_callback(self, path): + if not path: + return + ret = self.load_flows_path(path) + return ret or "Flows loaded from %s" % path + + def load_flows_path(self, path): + reterr = None + try: + master.Master.load_flows_file(self, path) + except exceptions.FlowReadException as e: + reterr = str(e) + signals.flowlist_change.send(self) + return reterr + + def accept_all(self): + self.state.accept_all(self) + + def set_view_filter(self, txt): + v = self.state.set_view_filter(txt) + signals.flowlist_change.send(self) + return v + + def set_intercept(self, txt): + return self.state.set_intercept(txt) + + def change_default_display_mode(self, t): + v = contentviews.get_by_shortcut(t) + self.state.default_body_view = v + self.refresh_focus() + + def edit_scripts(self, scripts): + self.options.scripts = [x[0] for x in scripts] + + def quit(self, a): + if a != "n": + raise urwid.ExitMainLoop + + def shutdown(self): + self.state.killall(self) + master.Master.shutdown(self) + + def clear_flows(self): + self.state.clear() + signals.flowlist_change.send(self) + + def toggle_follow_flows(self): + # toggle flow follow + self.state.follow_focus = not self.state.follow_focus + # jump to most recent flow if follow is now on + if self.state.follow_focus: + self.state.set_focus(self.state.flow_count()) + signals.flowlist_change.send(self) + + def delete_flow(self, f): + self.state.delete_flow(f) + signals.flowlist_change.send(self) + + def refresh_focus(self): + if self.state.view: + signals.flow_change.send( + self, + flow = self.state.view[self.state.focus] + ) + + def process_flow(self, f): + should_intercept = any( + [ + self.state.intercept and flowfilter.match(self.state.intercept, f) and not f.request.is_replay, + f.intercepted, + ] + ) + if should_intercept: + f.intercept(self) + signals.flowlist_change.send(self) + signals.flow_change.send(self, flow=f) + + def clear_events(self): + self.logbuffer[:] = [] + + # Handlers + @controller.handler + def error(self, f): + super().error(f) + self.process_flow(f) + + @controller.handler + def request(self, f): + super().request(f) + self.process_flow(f) + + @controller.handler + def response(self, f): + super().response(f) + self.process_flow(f) + + @controller.handler + def tcp_message(self, f): + super().tcp_message(f) + message = f.messages[-1] + direction = "->" if message.from_client else "<-" + self.add_log("{client} {direction} tcp {direction} {server}".format( + client=repr(f.client_conn.address), + server=repr(f.server_conn.address), + direction=direction, + ), "info") + self.add_log(strutils.bytes_to_escaped_str(message.content), "debug") diff --git a/mitmproxy/tools/console/options.py b/mitmproxy/tools/console/options.py new file mode 100644 index 00000000..04a0d08c --- /dev/null +++ b/mitmproxy/tools/console/options.py @@ -0,0 +1,255 @@ +import urwid + +from mitmproxy import contentviews +from mitmproxy.tools.console import common +from mitmproxy.tools.console import grideditor +from mitmproxy.tools.console import palettes +from mitmproxy.tools.console import select +from mitmproxy.tools.console import signals + +footer = [ + ('heading_key', "enter/space"), ":toggle ", + ('heading_key', "C"), ":clear all ", +] + + +def _mkhelp(): + text = [] + keys = [ + ("enter/space", "activate option"), + ("C", "clear all options"), + ] + text.extend(common.format_keyvals(keys, key="key", val="text", indent=4)) + return text +help_context = _mkhelp() + + +class Options(urwid.WidgetWrap): + + def __init__(self, master): + self.master = master + self.lb = select.Select( + [ + select.Heading("Traffic Manipulation"), + select.Option( + "Header Set Patterns", + "H", + lambda: len(master.options.setheaders), + self.setheaders + ), + select.Option( + "Ignore Patterns", + "I", + lambda: master.options.ignore_hosts, + self.ignore_hosts + ), + select.Option( + "Replacement Patterns", + "R", + lambda: len(master.options.replacements), + self.replacepatterns + ), + select.Option( + "Scripts", + "S", + lambda: master.options.scripts, + self.scripts + ), + + select.Heading("Interface"), + select.Option( + "Default Display Mode", + "M", + self.has_default_displaymode, + self.default_displaymode + ), + select.Option( + "Palette", + "P", + lambda: self.master.palette != palettes.DEFAULT, + self.palette + ), + select.Option( + "Show Host", + "w", + lambda: master.options.showhost, + master.options.toggler("showhost") + ), + + select.Heading("Network"), + select.Option( + "No Upstream Certs", + "U", + lambda: master.options.no_upstream_cert, + master.options.toggler("no_upstream_cert") + ), + select.Option( + "TCP Proxying", + "T", + lambda: master.options.tcp_hosts, + self.tcp_hosts + ), + select.Option( + "Don't Verify SSL/TLS Certificates", + "V", + lambda: master.options.ssl_insecure, + master.options.toggler("ssl_insecure") + ), + + select.Heading("Utility"), + select.Option( + "Anti-Cache", + "a", + lambda: master.options.anticache, + master.options.toggler("anticache") + ), + select.Option( + "Anti-Compression", + "o", + lambda: master.options.anticomp, + master.options.toggler("anticomp") + ), + select.Option( + "Kill Extra", + "x", + lambda: master.options.replay_kill_extra, + master.options.toggler("replay_kill_extra") + ), + select.Option( + "No Refresh", + "f", + lambda: not master.options.refresh_server_playback, + master.options.toggler("refresh_server_playback") + ), + select.Option( + "Sticky Auth", + "A", + lambda: master.options.stickyauth, + self.sticky_auth + ), + select.Option( + "Sticky Cookies", + "t", + lambda: master.options.stickycookie, + self.sticky_cookie + ), + ] + ) + title = urwid.Text("Options") + title = urwid.Padding(title, align="left", width=("relative", 100)) + title = urwid.AttrWrap(title, "heading") + w = urwid.Frame( + self.lb, + header = title + ) + super().__init__(w) + + self.master.loop.widget.footer.update("") + signals.update_settings.connect(self.sig_update_settings) + master.options.changed.connect(self.sig_update_settings) + + def sig_update_settings(self, sender, updated=None): + self.lb.walker._modified() + + def keypress(self, size, key): + if key == "C": + self.clearall() + return None + return super().keypress(size, key) + + def clearall(self): + self.master.options.update( + anticache = False, + anticomp = False, + ignore_hosts = (), + tcp_hosts = (), + replay_kill_extra = False, + no_upstream_cert = False, + refresh_server_playback = True, + replacements = [], + scripts = [], + setheaders = [], + showhost = False, + stickyauth = None, + stickycookie = None, + ) + + self.master.state.default_body_view = contentviews.get("Auto") + + signals.update_settings.send(self) + signals.status_message.send( + message = "All select.Options cleared", + expire = 1 + ) + + def setheaders(self): + self.master.view_grideditor( + grideditor.SetHeadersEditor( + self.master, + self.master.options.setheaders, + self.master.options.setter("setheaders") + ) + ) + + def tcp_hosts(self): + self.master.view_grideditor( + grideditor.HostPatternEditor( + self.master, + self.master.options.tcp_hosts, + self.master.options.setter("tcp_hosts") + ) + ) + + def ignore_hosts(self): + self.master.view_grideditor( + grideditor.HostPatternEditor( + self.master, + self.master.options.ignore_hosts, + self.master.options.setter("ignore_hosts") + ) + ) + + def replacepatterns(self): + self.master.view_grideditor( + grideditor.ReplaceEditor( + self.master, + self.master.options.replacements, + self.master.options.setter("replacements") + ) + ) + + def scripts(self): + self.master.view_grideditor( + grideditor.ScriptEditor( + self.master, + [[i] for i in self.master.options.scripts], + self.master.edit_scripts + ) + ) + + def default_displaymode(self): + signals.status_prompt_onekey.send( + prompt = "Global default display mode", + keys = contentviews.view_prompts, + callback = self.master.change_default_display_mode + ) + + def has_default_displaymode(self): + return self.master.state.default_body_view.name != "Auto" + + def sticky_auth(self): + signals.status_prompt.send( + prompt = "Sticky auth filter", + text = self.master.options.stickyauth, + callback = self.master.options.setter("stickyauth") + ) + + def sticky_cookie(self): + signals.status_prompt.send( + prompt = "Sticky cookie filter", + text = self.master.options.stickycookie, + callback = self.master.options.setter("stickycookie") + ) + + def palette(self): + self.master.view_palette_picker() diff --git a/mitmproxy/tools/console/palettepicker.py b/mitmproxy/tools/console/palettepicker.py new file mode 100644 index 00000000..4554a1b6 --- /dev/null +++ b/mitmproxy/tools/console/palettepicker.py @@ -0,0 +1,85 @@ +import urwid + +from mitmproxy.tools.console import common +from mitmproxy.tools.console import palettes +from mitmproxy.tools.console import select +from mitmproxy.tools.console import signals + +footer = [ + ('heading_key', "enter/space"), ":select", +] + + +def _mkhelp(): + text = [] + keys = [ + ("enter/space", "select"), + ] + text.extend(common.format_keyvals(keys, key="key", val="text", indent=4)) + return text +help_context = _mkhelp() + + +class PalettePicker(urwid.WidgetWrap): + + def __init__(self, master): + self.master = master + low, high = [], [] + for k, v in palettes.palettes.items(): + if v.high: + high.append(k) + else: + low.append(k) + high.sort() + low.sort() + + options = [ + select.Heading("High Colour") + ] + + def mkopt(name): + return select.Option( + i, + None, + lambda: self.master.palette == name, + lambda: self.select(name) + ) + + for i in high: + options.append(mkopt(i)) + options.append(select.Heading("Low Colour")) + for i in low: + options.append(mkopt(i)) + + options.extend( + [ + select.Heading("Options"), + select.Option( + "Transparent", + "T", + lambda: master.palette_transparent, + self.toggle_palette_transparent + ) + ] + ) + + self.lb = select.Select(options) + title = urwid.Text("Palettes") + title = urwid.Padding(title, align="left", width=("relative", 100)) + title = urwid.AttrWrap(title, "heading") + self._w = urwid.Frame( + self.lb, + header = title + ) + signals.update_settings.connect(self.sig_update_settings) + + def sig_update_settings(self, sender): + self.lb.walker._modified() + + def select(self, name): + self.master.set_palette(name) + + def toggle_palette_transparent(self): + self.master.palette_transparent = not self.master.palette_transparent + self.master.set_palette(self.master.palette) + signals.update_settings.send(self) diff --git a/mitmproxy/tools/console/palettes.py b/mitmproxy/tools/console/palettes.py new file mode 100644 index 00000000..7b15f98f --- /dev/null +++ b/mitmproxy/tools/console/palettes.py @@ -0,0 +1,330 @@ +# Low-color themes should ONLY use the standard foreground and background +# colours listed here: +# +# http://urwid.org/manual/displayattributes.html +# + + +class Palette: + _fields = [ + 'background', + 'title', + + # Status bar & heading + 'heading', 'heading_key', 'heading_inactive', + + # Help + 'key', 'head', 'text', + + # Options + 'option_selected', 'option_active', 'option_active_selected', + 'option_selected_key', + + # List and Connections + 'method', 'focus', + 'code_200', 'code_300', 'code_400', 'code_500', 'code_other', + 'error', "warn", + 'header', 'highlight', 'intercept', 'replay', 'mark', + + # Hex view + 'offset', + + # Grid Editor + 'focusfield', 'focusfield_error', 'field_error', 'editfield', + ] + high = None + + def palette(self, transparent): + l = [] + highback, lowback = None, None + if not transparent: + if self.high and self.high.get("background"): + highback = self.high["background"][1] + lowback = self.low["background"][1] + + for i in self._fields: + if transparent and i == "background": + l.append(["background", "default", "default"]) + else: + v = [i] + low = list(self.low[i]) + if lowback and low[1] == "default": + low[1] = lowback + v.extend(low) + if self.high and i in self.high: + v.append(None) + high = list(self.high[i]) + if highback and high[1] == "default": + high[1] = highback + v.extend(high) + elif highback and self.low[i][1] == "default": + high = [None, low[0], highback] + v.extend(high) + l.append(tuple(v)) + return l + + +class LowDark(Palette): + + """ + Low-color dark background + """ + low = dict( + background = ('white', 'black'), + title = ('white,bold', 'default'), + + # Status bar & heading + heading = ('white', 'dark blue'), + heading_key = ('light cyan', 'dark blue'), + heading_inactive = ('dark gray', 'light gray'), + + # Help + key = ('light cyan', 'default'), + head = ('white,bold', 'default'), + text = ('light gray', 'default'), + + # Options + option_selected = ('black', 'light gray'), + option_selected_key = ('light cyan', 'light gray'), + option_active = ('light red', 'default'), + option_active_selected = ('light red', 'light gray'), + + # List and Connections + method = ('dark cyan', 'default'), + focus = ('yellow', 'default'), + + code_200 = ('dark green', 'default'), + code_300 = ('light blue', 'default'), + code_400 = ('light red', 'default'), + code_500 = ('light red', 'default'), + code_other = ('dark red', 'default'), + + warn = ('brown', 'default'), + error = ('light red', 'default'), + + header = ('dark cyan', 'default'), + highlight = ('white,bold', 'default'), + intercept = ('brown', 'default'), + replay = ('light green', 'default'), + mark = ('light red', 'default'), + + # Hex view + offset = ('dark cyan', 'default'), + + # Grid Editor + focusfield = ('black', 'light gray'), + focusfield_error = ('dark red', 'light gray'), + field_error = ('dark red', 'default'), + editfield = ('white', 'default'), + ) + + +class Dark(LowDark): + high = dict( + heading_inactive = ('g58', 'g11'), + intercept = ('#f60', 'default'), + + option_selected = ('g85', 'g45'), + option_selected_key = ('light cyan', 'g50'), + option_active_selected = ('light red', 'g50'), + ) + + +class LowLight(Palette): + + """ + Low-color light background + """ + low = dict( + background = ('black', 'white'), + title = ('dark magenta', 'default'), + + # Status bar & heading + heading = ('white', 'black'), + heading_key = ('dark blue', 'black'), + heading_inactive = ('black', 'light gray'), + + # Help + key = ('dark blue', 'default'), + head = ('black', 'default'), + text = ('dark gray', 'default'), + + # Options + option_selected = ('black', 'light gray'), + option_selected_key = ('dark blue', 'light gray'), + option_active = ('light red', 'default'), + option_active_selected = ('light red', 'light gray'), + + # List and Connections + method = ('dark cyan', 'default'), + focus = ('black', 'default'), + + code_200 = ('dark green', 'default'), + code_300 = ('light blue', 'default'), + code_400 = ('dark red', 'default'), + code_500 = ('dark red', 'default'), + code_other = ('light red', 'default'), + + error = ('light red', 'default'), + warn = ('brown', 'default'), + + header = ('dark blue', 'default'), + highlight = ('black,bold', 'default'), + intercept = ('brown', 'default'), + replay = ('dark green', 'default'), + mark = ('dark red', 'default'), + + # Hex view + offset = ('dark blue', 'default'), + + # Grid Editor + focusfield = ('black', 'light gray'), + focusfield_error = ('dark red', 'light gray'), + field_error = ('dark red', 'black'), + editfield = ('black', 'default'), + ) + + +class Light(LowLight): + high = dict( + background = ('black', 'g100'), + heading = ('g99', '#08f'), + heading_key = ('#0ff,bold', '#08f'), + heading_inactive = ('g35', 'g85'), + replay = ('#0a0,bold', 'default'), + + option_selected = ('black', 'g85'), + option_selected_key = ('dark blue', 'g85'), + option_active_selected = ('light red', 'g85'), + ) + + +# Solarized palette in Urwid-style terminal high-colour offsets +# See: http://ethanschoonover.com/solarized +sol_base03 = "h234" +sol_base02 = "h235" +sol_base01 = "h240" +sol_base00 = "h241" +sol_base0 = "h244" +sol_base1 = "h245" +sol_base2 = "h254" +sol_base3 = "h230" +sol_yellow = "h136" +sol_orange = "h166" +sol_red = "h160" +sol_magenta = "h125" +sol_violet = "h61" +sol_blue = "h33" +sol_cyan = "h37" +sol_green = "h64" + + +class SolarizedLight(LowLight): + high = dict( + background = (sol_base00, sol_base3), + title = (sol_cyan, 'default'), + text = (sol_base00, 'default'), + + # Status bar & heading + heading = (sol_base2, sol_base02), + heading_key = (sol_blue, sol_base03), + heading_inactive = (sol_base03, sol_base1), + + # Help + key = (sol_blue, 'default',), + head = (sol_base00, 'default'), + + # Options + option_selected = (sol_base03, sol_base2), + option_selected_key = (sol_blue, sol_base2), + option_active = (sol_orange, 'default'), + option_active_selected = (sol_orange, sol_base2), + + # List and Connections + method = (sol_cyan, 'default'), + focus = (sol_base01, 'default'), + + code_200 = (sol_green, 'default'), + code_300 = (sol_blue, 'default'), + code_400 = (sol_orange, 'default',), + code_500 = (sol_red, 'default'), + code_other = (sol_magenta, 'default'), + + error = (sol_red, 'default'), + warn = (sol_orange, 'default'), + + header = (sol_blue, 'default'), + highlight = (sol_base01, 'default'), + intercept = (sol_red, 'default',), + replay = (sol_green, 'default',), + + # Hex view + offset = (sol_cyan, 'default'), + + # Grid Editor + focusfield = (sol_base00, sol_base2), + focusfield_error = (sol_red, sol_base2), + field_error = (sol_red, 'default'), + editfield = (sol_base01, 'default'), + ) + + +class SolarizedDark(LowDark): + high = dict( + background = (sol_base2, sol_base03), + title = (sol_blue, 'default'), + text = (sol_base1, 'default'), + + # Status bar & heading + heading = (sol_base2, sol_base01), + heading_key = (sol_blue + ",bold", sol_base01), + heading_inactive = (sol_base1, sol_base02), + + # Help + key = (sol_blue, 'default',), + head = (sol_base2, 'default'), + + # Options + option_selected = (sol_base03, sol_base00), + option_selected_key = (sol_blue, sol_base00), + option_active = (sol_orange, 'default'), + option_active_selected = (sol_orange, sol_base00), + + # List and Connections + method = (sol_cyan, 'default'), + focus = (sol_base1, 'default'), + + code_200 = (sol_green, 'default'), + code_300 = (sol_blue, 'default'), + code_400 = (sol_orange, 'default',), + code_500 = (sol_red, 'default'), + code_other = (sol_magenta, 'default'), + + error = (sol_red, 'default'), + warn = (sol_orange, 'default'), + + header = (sol_blue, 'default'), + highlight = (sol_base01, 'default'), + intercept = (sol_red, 'default',), + replay = (sol_green, 'default',), + + # Hex view + offset = (sol_cyan, 'default'), + + # Grid Editor + focusfield = (sol_base0, sol_base02), + focusfield_error = (sol_red, sol_base02), + field_error = (sol_red, 'default'), + editfield = (sol_base1, 'default'), + ) + + +DEFAULT = "dark" +palettes = { + "lowlight": LowLight(), + "lowdark": LowDark(), + "light": Light(), + "dark": Dark(), + "solarized_light": SolarizedLight(), + "solarized_dark": SolarizedDark(), +} diff --git a/mitmproxy/tools/console/pathedit.py b/mitmproxy/tools/console/pathedit.py new file mode 100644 index 00000000..4447070b --- /dev/null +++ b/mitmproxy/tools/console/pathedit.py @@ -0,0 +1,71 @@ +import glob +import os.path + +import urwid + + +class _PathCompleter: + + def __init__(self, _testing=False): + """ + _testing: disables reloading of the lookup table to make testing + possible. + """ + self.lookup, self.offset = None, None + self.final = None + self._testing = _testing + + def reset(self): + self.lookup = None + self.offset = -1 + + def complete(self, txt): + """ + Returns the next completion for txt, or None if there is no + completion. + """ + path = os.path.expanduser(txt) + if not self.lookup: + if not self._testing: + # Lookup is a set of (display value, actual value) tuples. + self.lookup = [] + if os.path.isdir(path): + files = glob.glob(os.path.join(path, "*")) + prefix = txt + else: + files = glob.glob(path + "*") + prefix = os.path.dirname(txt) + prefix = prefix or "./" + for f in files: + display = os.path.join(prefix, os.path.basename(f)) + if os.path.isdir(f): + display += "/" + self.lookup.append((display, f)) + if not self.lookup: + self.final = path + return path + self.lookup.sort() + self.offset = -1 + self.lookup.append((txt, txt)) + self.offset += 1 + if self.offset >= len(self.lookup): + self.offset = 0 + ret = self.lookup[self.offset] + self.final = ret[1] + return ret[0] + + +class PathEdit(urwid.Edit, _PathCompleter): + + def __init__(self, *args, **kwargs): + urwid.Edit.__init__(self, *args, **kwargs) + _PathCompleter.__init__(self) + + def keypress(self, size, key): + if key == "tab": + comp = self.complete(self.get_edit_text()) + self.set_edit_text(comp) + self.set_edit_pos(len(comp)) + else: + self.reset() + return urwid.Edit.keypress(self, size, key) diff --git a/mitmproxy/tools/console/searchable.py b/mitmproxy/tools/console/searchable.py new file mode 100644 index 00000000..650b75a0 --- /dev/null +++ b/mitmproxy/tools/console/searchable.py @@ -0,0 +1,93 @@ +import urwid + +from mitmproxy.tools.console import signals + + +class Highlight(urwid.AttrMap): + + def __init__(self, t): + urwid.AttrMap.__init__( + self, + urwid.Text(t.text), + "focusfield", + ) + self.backup = t + + +class Searchable(urwid.ListBox): + + def __init__(self, state, contents): + self.walker = urwid.SimpleFocusListWalker(contents) + urwid.ListBox.__init__(self, self.walker) + self.state = state + self.search_offset = 0 + self.current_highlight = None + self.search_term = None + + def keypress(self, size, key): + if key == "/": + signals.status_prompt.send( + prompt = "Search for", + text = "", + callback = self.set_search + ) + elif key == "n": + self.find_next(False) + elif key == "N": + self.find_next(True) + elif key == "g": + self.set_focus(0) + self.walker._modified() + elif key == "G": + self.set_focus(len(self.walker) - 1) + self.walker._modified() + else: + return super().keypress(size, key) + + def set_search(self, text): + self.state.last_search = text + self.search_term = text or None + self.find_next(False) + + def set_highlight(self, offset): + if self.current_highlight is not None: + old = self.body[self.current_highlight] + self.body[self.current_highlight] = old.backup + if offset is None: + self.current_highlight = None + else: + self.body[offset] = Highlight(self.body[offset]) + self.current_highlight = offset + + def get_text(self, w): + if isinstance(w, urwid.Text): + return w.text + elif isinstance(w, Highlight): + return w.backup.text + else: + return None + + def find_next(self, backwards): + if not self.search_term: + if self.state.last_search: + self.search_term = self.state.last_search + else: + self.set_highlight(None) + return + # Start search at focus + 1 + if backwards: + rng = range(len(self.body) - 1, -1, -1) + else: + rng = range(1, len(self.body) + 1) + for i in rng: + off = (self.focus_position + i) % len(self.body) + w = self.body[off] + txt = self.get_text(w) + if txt and self.search_term in txt: + self.set_highlight(off) + self.set_focus(off, coming_from="above") + self.body._modified() + return + else: + self.set_highlight(None) + signals.status_message.send(message="Search not found.", expire=1) diff --git a/mitmproxy/tools/console/select.py b/mitmproxy/tools/console/select.py new file mode 100644 index 00000000..a990dff8 --- /dev/null +++ b/mitmproxy/tools/console/select.py @@ -0,0 +1,121 @@ +import urwid + +from mitmproxy.tools.console import common + + +class _OptionWidget(urwid.WidgetWrap): + + def __init__(self, option, text, shortcut, active, focus): + self.option = option + textattr = "text" + keyattr = "key" + if focus and active: + textattr = "option_active_selected" + keyattr = "option_selected_key" + elif focus: + textattr = "option_selected" + keyattr = "option_selected_key" + elif active: + textattr = "option_active" + if shortcut: + text = common.highlight_key( + text, + shortcut, + textattr = textattr, + keyattr = keyattr + ) + opt = urwid.Text(text, align="left") + opt = urwid.AttrWrap(opt, textattr) + opt = urwid.Padding(opt, align = "center", width = 40) + urwid.WidgetWrap.__init__(self, opt) + + def keypress(self, size, key): + return key + + def selectable(self): + return True + + +class OptionWalker(urwid.ListWalker): + + def __init__(self, options): + urwid.ListWalker.__init__(self) + self.options = options + self.focus = 0 + + def set_focus(self, pos): + self.focus = pos + + def get_focus(self): + return self.options[self.focus].render(True), self.focus + + def get_next(self, pos): + if pos >= len(self.options) - 1: + return None, None + return self.options[pos + 1].render(False), pos + 1 + + def get_prev(self, pos): + if pos <= 0: + return None, None + return self.options[pos - 1].render(False), pos - 1 + + +class Heading: + + def __init__(self, text): + self.text = text + + def render(self, focus): + opt = urwid.Text("\n" + self.text, align="left") + opt = urwid.AttrWrap(opt, "title") + opt = urwid.Padding(opt, align = "center", width = 40) + return opt + + +def _neg(*args): + return False + + +class Option: + + def __init__(self, text, shortcut, getstate=None, activate=None): + self.text = text + self.shortcut = shortcut + self.getstate = getstate or _neg + self.activate = activate or _neg + + def render(self, focus): + return _OptionWidget( + self, + self.text, + self.shortcut, + self.getstate(), + focus) + + +class Select(urwid.ListBox): + + def __init__(self, options): + self.walker = OptionWalker(options) + urwid.ListBox.__init__( + self, + self.walker + ) + self.options = options + self.keymap = {} + for i in options: + if hasattr(i, "shortcut") and i.shortcut: + if i.shortcut in self.keymap: + raise ValueError("Duplicate shortcut key: %s" % i.shortcut) + self.keymap[i.shortcut] = i + + def keypress(self, size, key): + if key == "enter" or key == " ": + self.get_focus()[0].option.activate() + return None + key = common.shortcuts(key) + if key in self.keymap: + self.keymap[key].activate() + self.set_focus(self.options.index(self.keymap[key])) + return None + return super().keypress(size, key) diff --git a/mitmproxy/tools/console/signals.py b/mitmproxy/tools/console/signals.py new file mode 100644 index 00000000..3cd8bc4b --- /dev/null +++ b/mitmproxy/tools/console/signals.py @@ -0,0 +1,44 @@ +import blinker + +# Show a status message in the action bar +sig_add_log = blinker.Signal() + + +def add_log(e, level): + sig_add_log.send( + None, + e=e, + level=level + ) + +# Show a status message in the action bar +status_message = blinker.Signal() + +# Prompt for input +status_prompt = blinker.Signal() + +# Prompt for a path +status_prompt_path = blinker.Signal() + +# Prompt for a single keystroke +status_prompt_onekey = blinker.Signal() + +# Call a callback in N seconds +call_in = blinker.Signal() + +# Focus the body, footer or header of the main window +focus = blinker.Signal() + +# Fired when settings change +update_settings = blinker.Signal() + +# Fired when a flow changes +flow_change = blinker.Signal() + +# Fired when the flow list or focus changes +flowlist_change = blinker.Signal() + +# Pop and push view state onto a stack +pop_view_state = blinker.Signal() +push_view_state = blinker.Signal() +replace_view_state = blinker.Signal() diff --git a/mitmproxy/tools/console/statusbar.py b/mitmproxy/tools/console/statusbar.py new file mode 100644 index 00000000..99f73727 --- /dev/null +++ b/mitmproxy/tools/console/statusbar.py @@ -0,0 +1,262 @@ +import os.path + +import urwid + +import netlib.http.url +from mitmproxy.tools.console import common +from mitmproxy.tools.console import pathedit +from mitmproxy.tools.console import signals +from netlib import human + + +class ActionBar(urwid.WidgetWrap): + + def __init__(self): + urwid.WidgetWrap.__init__(self, None) + self.clear() + signals.status_message.connect(self.sig_message) + signals.status_prompt.connect(self.sig_prompt) + signals.status_prompt_path.connect(self.sig_path_prompt) + signals.status_prompt_onekey.connect(self.sig_prompt_onekey) + + self.last_path = "" + + self.prompting = False + self.onekey = False + self.pathprompt = False + + def sig_message(self, sender, message, expire=None): + if self.prompting: + return + w = urwid.Text(message) + self._w = w + if expire: + def cb(*args): + if w == self._w: + self.clear() + signals.call_in.send(seconds=expire, callback=cb) + + def prep_prompt(self, p): + return p.strip() + ": " + + def sig_prompt(self, sender, prompt, text, callback, args=()): + signals.focus.send(self, section="footer") + self._w = urwid.Edit(self.prep_prompt(prompt), text or "") + self.prompting = (callback, args) + + def sig_path_prompt(self, sender, prompt, callback, args=()): + signals.focus.send(self, section="footer") + self._w = pathedit.PathEdit( + self.prep_prompt(prompt), + os.path.dirname(self.last_path) + ) + self.pathprompt = True + self.prompting = (callback, args) + + def sig_prompt_onekey(self, sender, prompt, keys, callback, args=()): + """ + Keys are a set of (word, key) tuples. The appropriate key in the + word is highlighted. + """ + signals.focus.send(self, section="footer") + prompt = [prompt, " ("] + mkup = [] + for i, e in enumerate(keys): + mkup.extend(common.highlight_key(e[0], e[1])) + if i < len(keys) - 1: + mkup.append(",") + prompt.extend(mkup) + prompt.append(")? ") + self.onekey = set(i[1] for i in keys) + self._w = urwid.Edit(prompt, "") + self.prompting = (callback, args) + + def selectable(self): + return True + + def keypress(self, size, k): + if self.prompting: + if k == "esc": + self.prompt_done() + elif self.onekey: + if k == "enter": + self.prompt_done() + elif k in self.onekey: + self.prompt_execute(k) + elif k == "enter": + self.prompt_execute(self._w.get_edit_text()) + else: + if common.is_keypress(k): + self._w.keypress(size, k) + else: + return k + + def clear(self): + self._w = urwid.Text("") + self.prompting = False + + def prompt_done(self): + self.prompting = False + self.onekey = False + self.pathprompt = False + signals.status_message.send(message="") + signals.focus.send(self, section="body") + + def prompt_execute(self, txt): + if self.pathprompt: + self.last_path = txt + p, args = self.prompting + self.prompt_done() + msg = p(txt, *args) + if msg: + signals.status_message.send(message=msg, expire=1) + + +class StatusBar(urwid.WidgetWrap): + + def __init__(self, master: "mitmproxy.console.master.ConsoleMaster", helptext): + self.master = master + self.helptext = helptext + self.ib = urwid.WidgetWrap(urwid.Text("")) + super().__init__(urwid.Pile([self.ib, self.master.ab])) + signals.update_settings.connect(self.sig_update_settings) + signals.flowlist_change.connect(self.sig_update_settings) + master.options.changed.connect(self.sig_update_settings) + self.redraw() + + def sig_update_settings(self, sender, updated=None): + self.redraw() + + def keypress(self, *args, **kwargs): + return self.master.ab.keypress(*args, **kwargs) + + def get_status(self): + r = [] + + sreplay = self.master.addons.get("serverplayback") + creplay = self.master.addons.get("clientplayback") + + if len(self.master.options.setheaders): + r.append("[") + r.append(("heading_key", "H")) + r.append("eaders]") + if len(self.master.options.replacements): + r.append("[") + r.append(("heading_key", "R")) + r.append("eplacing]") + if creplay.count(): + r.append("[") + r.append(("heading_key", "cplayback")) + r.append(":%s]" % creplay.count()) + if sreplay.count(): + r.append("[") + r.append(("heading_key", "splayback")) + r.append(":%s]" % sreplay.count()) + if self.master.options.ignore_hosts: + r.append("[") + r.append(("heading_key", "I")) + r.append("gnore:%d]" % len(self.master.options.ignore_hosts)) + if self.master.options.tcp_hosts: + r.append("[") + r.append(("heading_key", "T")) + r.append("CP:%d]" % len(self.master.options.tcp_hosts)) + if self.master.state.intercept_txt: + r.append("[") + r.append(("heading_key", "i")) + r.append(":%s]" % self.master.state.intercept_txt) + if self.master.state.filter_txt: + r.append("[") + r.append(("heading_key", "f")) + r.append(":%s]" % self.master.state.filter_txt) + if self.master.options.stickycookie: + r.append("[") + r.append(("heading_key", "t")) + r.append(":%s]" % self.master.options.stickycookie) + if self.master.options.stickyauth: + r.append("[") + r.append(("heading_key", "u")) + r.append(":%s]" % self.master.options.stickyauth) + if self.master.state.default_body_view.name != "Auto": + r.append("[") + r.append(("heading_key", "M")) + r.append(":%s]" % self.master.state.default_body_view.name) + + opts = [] + if self.master.options.anticache: + opts.append("anticache") + if self.master.options.anticomp: + opts.append("anticomp") + if self.master.options.showhost: + opts.append("showhost") + if not self.master.options.refresh_server_playback: + opts.append("norefresh") + if self.master.options.replay_kill_extra: + opts.append("killextra") + if self.master.options.no_upstream_cert: + opts.append("no-upstream-cert") + if self.master.state.follow_focus: + opts.append("following") + if self.master.options.stream_large_bodies: + opts.append( + "stream:%s" % human.pretty_size( + self.master.options.stream_large_bodies + ) + ) + + if opts: + r.append("[%s]" % (":".join(opts))) + + if self.master.options.mode in ["reverse", "upstream"]: + dst = self.master.server.config.upstream_server + r.append("[dest:%s]" % netlib.http.url.unparse( + dst.scheme, + dst.address.host, + dst.address.port + )) + if self.master.options.scripts: + r.append("[") + r.append(("heading_key", "s")) + r.append("cripts:%s]" % len(self.master.options.scripts)) + + if self.master.options.outfile: + r.append("[W:%s]" % self.master.options.outfile[0]) + + return r + + def redraw(self): + fc = self.master.state.flow_count() + if self.master.state.focus is None: + offset = 0 + else: + offset = min(self.master.state.focus + 1, fc) + t = [ + ('heading', ("[%s/%s]" % (offset, fc)).ljust(9)) + ] + + if self.master.server.bound: + host = self.master.server.address.host + if host == "0.0.0.0": + host = "*" + boundaddr = "[%s:%s]" % (host, self.master.server.address.port) + else: + boundaddr = "" + t.extend(self.get_status()) + status = urwid.AttrWrap(urwid.Columns([ + urwid.Text(t), + urwid.Text( + [ + self.helptext, + boundaddr + ], + align="right" + ), + ]), "heading") + self.ib._w = status + + def update(self, text): + self.helptext = text + self.redraw() + self.master.loop.draw_screen() + + def selectable(self): + return True diff --git a/mitmproxy/tools/console/tabs.py b/mitmproxy/tools/console/tabs.py new file mode 100644 index 00000000..a2d5e719 --- /dev/null +++ b/mitmproxy/tools/console/tabs.py @@ -0,0 +1,70 @@ +import urwid + + +class Tab(urwid.WidgetWrap): + + def __init__(self, offset, content, attr, onclick): + """ + onclick is called on click with the tab offset as argument + """ + p = urwid.Text(content, align="center") + p = urwid.Padding(p, align="center", width=("relative", 100)) + p = urwid.AttrWrap(p, attr) + urwid.WidgetWrap.__init__(self, p) + self.offset = offset + self.onclick = onclick + + def mouse_event(self, size, event, button, col, row, focus): + if event == "mouse press" and button == 1: + self.onclick(self.offset) + return True + + +class Tabs(urwid.WidgetWrap): + + def __init__(self, tabs, tab_offset=0): + super().__init__("") + self.tab_offset = tab_offset + self.tabs = tabs + self.show() + + def change_tab(self, offset): + self.tab_offset = offset + self.show() + + def keypress(self, size, key): + n = len(self.tabs) + if key in ["tab", "l"]: + self.change_tab((self.tab_offset + 1) % n) + elif key == "h": + self.change_tab((self.tab_offset - 1) % n) + return self._w.keypress(size, key) + + def show(self): + headers = [] + for i in range(len(self.tabs)): + txt = self.tabs[i][0]() + if i == self.tab_offset: + headers.append( + Tab( + i, + txt, + "heading", + self.change_tab + ) + ) + else: + headers.append( + Tab( + i, + txt, + "heading_inactive", + self.change_tab + ) + ) + headers = urwid.Columns(headers, dividechars=1) + self._w = urwid.Frame( + body = self.tabs[self.tab_offset][1](), + header = headers + ) + self._w.set_focus("body") diff --git a/mitmproxy/tools/console/window.py b/mitmproxy/tools/console/window.py new file mode 100644 index 00000000..b20d2e33 --- /dev/null +++ b/mitmproxy/tools/console/window.py @@ -0,0 +1,111 @@ +import urwid + +from mitmproxy.tools.console import signals + + +class Window(urwid.Frame): + + def __init__(self, master, body, header, footer, helpctx): + urwid.Frame.__init__( + self, + urwid.AttrWrap(body, "background"), + header = urwid.AttrWrap(header, "background") if header else None, + footer = urwid.AttrWrap(footer, "background") if footer else None + ) + self.master = master + self.helpctx = helpctx + signals.focus.connect(self.sig_focus) + + def sig_focus(self, sender, section): + self.focus_position = section + + def mouse_event(self, *args, **kwargs): + # args: (size, event, button, col, row) + k = super().mouse_event(*args, **kwargs) + if not k: + if args[1] == "mouse drag": + signals.status_message.send( + message = "Hold down fn, shift, alt or ctrl to select text or use the --no-mouse parameter.", + expire = 1 + ) + elif args[1] == "mouse press" and args[2] == 4: + self.keypress(args[0], "up") + elif args[1] == "mouse press" and args[2] == 5: + self.keypress(args[0], "down") + else: + return False + return True + + def handle_replay(self, k): + if k == "c": + creplay = self.master.addons.get("clientplayback") + if self.master.options.client_replay and creplay.count(): + def stop_client_playback_prompt(a): + if a != "n": + self.master.options.client_replay = None + signals.status_prompt_onekey.send( + self, + prompt = "Stop current client replay?", + keys = ( + ("yes", "y"), + ("no", "n"), + ), + callback = stop_client_playback_prompt + ) + else: + signals.status_prompt_path.send( + self, + prompt = "Client replay path", + callback = lambda x: self.master.options.setter("client_replay")([x]) + ) + elif k == "s": + a = self.master.addons.get("serverplayback") + if a.count(): + def stop_server_playback(response): + if response == "y": + self.master.options.server_replay = [] + signals.status_prompt_onekey.send( + self, + prompt = "Stop current server replay?", + keys = ( + ("yes", "y"), + ("no", "n"), + ), + callback = stop_server_playback + ) + else: + signals.status_prompt_path.send( + self, + prompt = "Server playback path", + callback = lambda x: self.master.options.setter("server_replay")([x]) + ) + + def keypress(self, size, k): + k = super().keypress(size, k) + if k == "?": + self.master.view_help(self.helpctx) + elif k == "i": + signals.status_prompt.send( + self, + prompt = "Intercept filter", + text = self.master.state.intercept_txt, + callback = self.master.set_intercept + ) + elif k == "o": + self.master.view_options() + elif k == "Q": + raise urwid.ExitMainLoop + elif k == "q": + signals.pop_view_state.send(self) + elif k == "R": + signals.status_prompt_onekey.send( + self, + prompt = "Replay", + keys = ( + ("client", "c"), + ("server", "s"), + ), + callback = self.handle_replay, + ) + else: + return k diff --git a/mitmproxy/tools/dump.py b/mitmproxy/tools/dump.py new file mode 100644 index 00000000..47f69303 --- /dev/null +++ b/mitmproxy/tools/dump.py @@ -0,0 +1,84 @@ +import typing +from typing import Optional + +from mitmproxy import controller +from mitmproxy import exceptions +from mitmproxy import addons +from mitmproxy import io +from mitmproxy import options +from mitmproxy import master +from mitmproxy.addons import dumper, termlog +from netlib import tcp + + +class DumpError(Exception): + pass + + +class Options(options.Options): + def __init__( + self, + keepserving: bool = False, + filtstr: Optional[str] = None, + flow_detail: int = 1, + tfile: Optional[typing.io.TextIO] = None, + **kwargs + ): + self.filtstr = filtstr + self.flow_detail = flow_detail + self.keepserving = keepserving + self.tfile = tfile + super().__init__(**kwargs) + + +class DumpMaster(master.Master): + + def __init__(self, options, server): + master.Master.__init__(self, options, server) + self.has_errored = False + self.addons.add(termlog.TermLog()) + self.addons.add(*addons.default_addons()) + self.addons.add(dumper.Dumper()) + # This line is just for type hinting + self.options = self.options # type: Options + + if not self.options.no_server: + self.add_log( + "Proxy server listening at http://{}".format(server.address), + "info" + ) + + if self.server and self.options.http2 and not tcp.HAS_ALPN: # pragma: no cover + self.add_log( + "ALPN support missing (OpenSSL 1.0.2+ required)!\n" + "HTTP/2 is disabled. Use --no-http2 to silence this warning.", + "error" + ) + + if options.rfile: + try: + self.load_flows_file(options.rfile) + except exceptions.FlowReadException as v: + self.add_log("Flow file corrupted.", "error") + raise DumpError(v) + + def _readflow(self, paths): + """ + Utitility function that reads a list of flows + or raises a DumpError if that fails. + """ + try: + return io.read_flows_from_paths(paths) + except exceptions.FlowReadException as e: + raise DumpError(str(e)) + + @controller.handler + def log(self, e): + if e.level == "error": + self.has_errored = True + + def run(self): # pragma: no cover + if self.options.rfile and not self.options.keepserving: + self.addons.done() + return + super().run() diff --git a/mitmproxy/tools/main.py b/mitmproxy/tools/main.py new file mode 100644 index 00000000..05ae780e --- /dev/null +++ b/mitmproxy/tools/main.py @@ -0,0 +1,142 @@ +import os +import signal +import sys + +from mitmproxy.tools import cmdline +from mitmproxy import exceptions +from mitmproxy.proxy import config +from mitmproxy.proxy import server +from netlib import version_check +from netlib import debug + + +def assert_utf8_env(): + spec = "" + for i in ["LANG", "LC_CTYPE", "LC_ALL"]: + spec += os.environ.get(i, "").lower() + if "utf" not in spec: + print( + "Error: mitmproxy requires a UTF console environment.", + file=sys.stderr + ) + print( + "Set your LANG enviroment variable to something like en_US.UTF-8", + file=sys.stderr + ) + sys.exit(1) + + +def process_options(parser, options, args): + if args.sysinfo: + print(debug.sysinfo()) + sys.exit(0) + debug.register_info_dumpers() + pconf = config.ProxyConfig(options) + if options.no_server: + return server.DummyServer(pconf) + else: + try: + return server.ProxyServer(pconf) + except exceptions.ServerException as v: + print(str(v), file=sys.stderr) + sys.exit(1) + + +def mitmproxy(args=None): # pragma: no cover + if os.name == "nt": + print("Error: mitmproxy's console interface is not supported on Windows. " + "You can run mitmdump or mitmweb instead.", file=sys.stderr) + sys.exit(1) + from mitmproxy.tools import console + + version_check.check_pyopenssl_version() + assert_utf8_env() + + parser = cmdline.mitmproxy() + args = parser.parse_args(args) + + try: + console_options = console.master.Options( + **cmdline.get_common_options(args) + ) + console_options.palette = args.palette + console_options.palette_transparent = args.palette_transparent + console_options.eventlog = args.eventlog + console_options.follow = args.follow + console_options.intercept = args.intercept + console_options.filter = args.filter + console_options.no_mouse = args.no_mouse + + server = process_options(parser, console_options, args) + m = console.master.ConsoleMaster(server, console_options) + except exceptions.OptionsError as e: + print("mitmproxy: %s" % e, file=sys.stderr) + sys.exit(1) + try: + m.run() + except (KeyboardInterrupt, RuntimeError): + pass + + +def mitmdump(args=None): # pragma: no cover + from mitmproxy.tools import dump + + version_check.check_pyopenssl_version() + + parser = cmdline.mitmdump() + args = parser.parse_args(args) + if args.quiet: + args.flow_detail = 0 + + master = None + try: + dump_options = dump.Options(**cmdline.get_common_options(args)) + dump_options.flow_detail = args.flow_detail + dump_options.keepserving = args.keepserving + dump_options.filtstr = " ".join(args.args) if args.args else None + server = process_options(parser, dump_options, args) + master = dump.DumpMaster(dump_options, server) + + def cleankill(*args, **kwargs): + master.shutdown() + + signal.signal(signal.SIGTERM, cleankill) + master.run() + except (dump.DumpError, exceptions.OptionsError) as e: + print("mitmdump: %s" % e, file=sys.stderr) + sys.exit(1) + except (KeyboardInterrupt, RuntimeError): + pass + if master is None or master.has_errored: + print("mitmdump: errors occurred during run", file=sys.stderr) + sys.exit(1) + + +def mitmweb(args=None): # pragma: no cover + from mitmproxy.tools import web + + version_check.check_pyopenssl_version() + + parser = cmdline.mitmweb() + + args = parser.parse_args(args) + + try: + web_options = web.master.Options(**cmdline.get_common_options(args)) + web_options.intercept = args.intercept + web_options.wdebug = args.wdebug + web_options.wiface = args.wiface + web_options.wport = args.wport + web_options.wsingleuser = args.wsingleuser + web_options.whtpasswd = args.whtpasswd + web_options.process_web_options(parser) + + server = process_options(parser, web_options, args) + m = web.master.WebMaster(web_options, server) + except exceptions.OptionsError as e: + print("mitmweb: %s" % e, file=sys.stderr) + sys.exit(1) + try: + m.run() + except (KeyboardInterrupt, RuntimeError): + pass diff --git a/mitmproxy/tools/web/__init__.py b/mitmproxy/tools/web/__init__.py new file mode 100644 index 00000000..c2252af3 --- /dev/null +++ b/mitmproxy/tools/web/__init__.py @@ -0,0 +1,2 @@ +from mitmproxy.tools.web import master +__all__ = ["master"] diff --git a/mitmproxy/tools/web/app.py b/mitmproxy/tools/web/app.py new file mode 100644 index 00000000..89b42186 --- /dev/null +++ b/mitmproxy/tools/web/app.py @@ -0,0 +1,458 @@ +import base64 +import json +import logging +import os.path +import re +import hashlib + + +import tornado.websocket +import tornado.web +from io import BytesIO + +from mitmproxy import flowfilter +from mitmproxy import flow +from mitmproxy import http +from mitmproxy import contentviews +from mitmproxy import io +from netlib import version + + +def convert_flow_to_json_dict(flow: flow.Flow) -> dict: + """ + Remove flow message content and cert to save transmission space. + + Args: + flow: The original flow. + """ + f = { + "id": flow.id, + "intercepted": flow.intercepted, + "client_conn": flow.client_conn.get_state(), + "server_conn": flow.server_conn.get_state(), + "type": flow.type + } + if flow.error: + f["error"] = flow.error.get_state() + + if isinstance(flow, http.HTTPFlow): + if flow.request: + f["request"] = { + "method": flow.request.method, + "scheme": flow.request.scheme, + "host": flow.request.host, + "port": flow.request.port, + "path": flow.request.path, + "http_version": flow.request.http_version, + "headers": tuple(flow.request.headers.items(True)), + "contentLength": len(flow.request.raw_content) if flow.request.raw_content is not None else None, + "contentHash": hashlib.sha256(flow.request.raw_content).hexdigest() if flow.request.raw_content is not None else None, + "timestamp_start": flow.request.timestamp_start, + "timestamp_end": flow.request.timestamp_end, + "is_replay": flow.request.is_replay, + } + if flow.response: + f["response"] = { + "http_version": flow.response.http_version, + "status_code": flow.response.status_code, + "reason": flow.response.reason, + "headers": tuple(flow.response.headers.items(True)), + "contentLength": len(flow.response.raw_content) if flow.response.raw_content is not None else None, + "contentHash": hashlib.sha256(flow.response.raw_content).hexdigest() if flow.response.raw_content is not None else None, + "timestamp_start": flow.response.timestamp_start, + "timestamp_end": flow.response.timestamp_end, + "is_replay": flow.response.is_replay, + } + f.get("server_conn", {}).pop("cert", None) + + return f + + +class APIError(tornado.web.HTTPError): + pass + + +class BasicAuth: + + def set_auth_headers(self): + self.set_status(401) + self.set_header('WWW-Authenticate', 'Basic realm=MITMWeb') + self._transforms = [] + self.finish() + + def prepare(self): + wauthenticator = self.application.settings['wauthenticator'] + if wauthenticator: + auth_header = self.request.headers.get('Authorization') + if auth_header is None or not auth_header.startswith('Basic '): + self.set_auth_headers() + else: + self.auth_decoded = base64.decodestring(auth_header[6:]) + self.username, self.password = self.auth_decoded.split(':', 2) + if not wauthenticator.test(self.username, self.password): + self.set_auth_headers() + raise APIError(401, "Invalid username or password.") + + +class RequestHandler(BasicAuth, tornado.web.RequestHandler): + + def set_default_headers(self): + super().set_default_headers() + self.set_header("Server", version.MITMPROXY) + self.set_header("X-Frame-Options", "DENY") + self.add_header("X-XSS-Protection", "1; mode=block") + self.add_header("X-Content-Type-Options", "nosniff") + self.add_header( + "Content-Security-Policy", + "default-src 'self'; " + "connect-src 'self' ws://* ; " + "style-src 'self' 'unsafe-inline'" + ) + + @property + def json(self): + if not self.request.headers.get("Content-Type").startswith("application/json"): + return None + return json.loads(self.request.body.decode()) + + @property + def state(self): + return self.application.master.state + + @property + def master(self) -> "mitmproxy.tools.web.master.WebMaster": + return self.application.master + + @property + def flow(self): + flow_id = str(self.path_kwargs["flow_id"]) + flow = self.state.flows.get(flow_id) + if flow: + return flow + else: + raise APIError(400, "Flow not found.") + + def write_error(self, status_code, **kwargs): + if "exc_info" in kwargs and isinstance(kwargs["exc_info"][1], APIError): + self.finish(kwargs["exc_info"][1].log_message) + else: + super().write_error(status_code, **kwargs) + + +class IndexHandler(RequestHandler): + + def get(self): + token = self.xsrf_token # https://github.com/tornadoweb/tornado/issues/645 + assert token + self.render("index.html") + + +class FilterHelp(RequestHandler): + + def get(self): + self.write(dict( + commands=flowfilter.help + )) + + +class WebSocketEventBroadcaster(BasicAuth, tornado.websocket.WebSocketHandler): + # raise an error if inherited class doesn't specify its own instance. + connections = None + + def open(self): + self.connections.add(self) + + def on_close(self): + self.connections.remove(self) + + @classmethod + def broadcast(cls, **kwargs): + message = json.dumps(kwargs, ensure_ascii=False) + + for conn in cls.connections: + try: + conn.write_message(message) + except: + logging.error("Error sending message", exc_info=True) + + +class ClientConnection(WebSocketEventBroadcaster): + connections = set() + + +class Flows(RequestHandler): + + def get(self): + self.write(dict( + data=[convert_flow_to_json_dict(f) for f in self.state.flows] + )) + + +class DumpFlows(RequestHandler): + def get(self): + self.set_header("Content-Disposition", "attachment; filename=flows") + self.set_header("Content-Type", "application/octet-stream") + + bio = BytesIO() + fw = io.FlowWriter(bio) + for f in self.state.flows: + fw.add(f) + + self.write(bio.getvalue()) + bio.close() + + def post(self): + self.state.clear() + + content = self.request.files.values()[0][0].body + bio = BytesIO(content) + self.state.load_flows(io.FlowReader(bio).stream()) + bio.close() + + +class ClearAll(RequestHandler): + + def post(self): + self.state.clear() + + +class AcceptFlows(RequestHandler): + + def post(self): + self.state.flows.accept_all(self.master) + + +class AcceptFlow(RequestHandler): + + def post(self, flow_id): + self.flow.resume(self.master) + + +class FlowHandler(RequestHandler): + + def delete(self, flow_id): + if self.flow.killable: + self.flow.kill(self.master) + self.state.delete_flow(self.flow) + + def put(self, flow_id): + flow = self.flow + flow.backup() + for a, b in self.json.items(): + if a == "request": + request = flow.request + for k, v in b.items(): + if k in ["method", "scheme", "host", "path", "http_version"]: + setattr(request, k, str(v)) + elif k == "port": + request.port = int(v) + elif k == "headers": + request.headers.set_state(v) + elif k == "content": + request.text = v + else: + print("Warning: Unknown update {}.{}: {}".format(a, k, v)) + + elif a == "response": + response = flow.response + for k, v in b.items(): + if k == "msg": + response.msg = str(v) + elif k == "code": + response.status_code = int(v) + elif k == "http_version": + response.http_version = str(v) + elif k == "headers": + response.headers.set_state(v) + elif k == "content": + response.text = v + else: + print("Warning: Unknown update {}.{}: {}".format(a, k, v)) + else: + print("Warning: Unknown update {}: {}".format(a, b)) + self.state.update_flow(flow) + + +class DuplicateFlow(RequestHandler): + + def post(self, flow_id): + self.master.state.duplicate_flow(self.flow) + + +class RevertFlow(RequestHandler): + + def post(self, flow_id): + self.state.revert(self.flow) + + +class ReplayFlow(RequestHandler): + + def post(self, flow_id): + self.flow.backup() + self.flow.response = None + self.state.update_flow(self.flow) + + r = self.master.replay_request(self.flow) + if r: + raise APIError(400, r) + + +class FlowContent(RequestHandler): + + def post(self, flow_id, message): + self.flow.backup() + message = getattr(self.flow, message) + message.content = self.request.files.values()[0][0].body + self.state.update_flow(self.flow) + + def get(self, flow_id, message): + message = getattr(self.flow, message) + + if not message.raw_content: + raise APIError(400, "No content.") + + content_encoding = message.headers.get("Content-Encoding", None) + if content_encoding: + content_encoding = re.sub(r"[^\w]", "", content_encoding) + self.set_header("Content-Encoding", content_encoding) + + original_cd = message.headers.get("Content-Disposition", None) + filename = None + if original_cd: + filename = re.search("filename=([\w\" \.\-\(\)]+)", original_cd) + if filename: + filename = filename.group(1) + if not filename: + filename = self.flow.request.path.split("?")[0].split("/")[-1] + + filename = re.sub(r"[^\w\" \.\-\(\)]", "", filename) + cd = "attachment; filename={}".format(filename) + self.set_header("Content-Disposition", cd) + self.set_header("Content-Type", "application/text") + self.set_header("X-Content-Type-Options", "nosniff") + self.set_header("X-Frame-Options", "DENY") + self.write(message.raw_content) + + +class FlowContentView(RequestHandler): + + def get(self, flow_id, message, content_view): + message = getattr(self.flow, message) + + description, lines, error = contentviews.get_message_content_view( + contentviews.get(content_view.replace('_', ' ')), message + ) +# if error: +# add event log + + self.write(dict( + lines=list(lines), + description=description + )) + + +class Events(RequestHandler): + + def get(self): + self.write(dict( + data=list(self.state.events) + )) + + +class Settings(RequestHandler): + + def get(self): + + self.write(dict( + data=dict( + version=version.VERSION, + mode=str(self.master.options.mode), + intercept=self.master.options.intercept, + showhost=self.master.options.showhost, + no_upstream_cert=self.master.options.no_upstream_cert, + rawtcp=self.master.options.rawtcp, + http2=self.master.options.http2, + anticache=self.master.options.anticache, + anticomp=self.master.options.anticomp, + stickyauth=self.master.options.stickyauth, + stickycookie=self.master.options.stickycookie, + stream= self.master.options.stream_large_bodies, + contentViews= [v.name.replace(' ', '_') for v in contentviews.views] + ) + )) + + def put(self): + update = {} + for k, v in self.json.items(): + if k == "intercept": + self.master.options.intercept = v + update[k] = v + elif k == "showhost": + self.master.options.showhost = v + update[k] = v + elif k == "no_upstream_cert": + self.master.options.no_upstream_cert = v + update[k] = v + elif k == "rawtcp": + self.master.options.rawtcp = v + update[k] = v + elif k == "http2": + self.master.options.http2 = v + update[k] = v + elif k == "anticache": + self.master.options.anticache = v + update[k] = v + elif k == "anticomp": + self.master.options.anticomp = v + update[k] = v + elif k == "stickycookie": + self.master.options.stickycookie = v + update[k] = v + elif k == "stickyauth": + self.master.options.stickyauth = v + update[k] = v + elif k == "stream": + self.master.options.stream_large_bodies = v + update[k] = v + else: + print("Warning: Unknown setting {}: {}".format(k, v)) + + ClientConnection.broadcast( + type="UPDATE_SETTINGS", + cmd="update", + data=update + ) + + +class Application(tornado.web.Application): + + def __init__(self, master, debug, wauthenticator): + self.master = master + handlers = [ + (r"/", IndexHandler), + (r"/filter-help", FilterHelp), + (r"/updates", ClientConnection), + (r"/events", Events), + (r"/flows", Flows), + (r"/flows/dump", DumpFlows), + (r"/flows/accept", AcceptFlows), + (r"/flows/(?P[0-9a-f\-]+)", FlowHandler), + (r"/flows/(?P[0-9a-f\-]+)/accept", AcceptFlow), + (r"/flows/(?P[0-9a-f\-]+)/duplicate", DuplicateFlow), + (r"/flows/(?P[0-9a-f\-]+)/replay", ReplayFlow), + (r"/flows/(?P[0-9a-f\-]+)/revert", RevertFlow), + (r"/flows/(?P[0-9a-f\-]+)/(?Prequest|response)/content", FlowContent), + (r"/flows/(?P[0-9a-f\-]+)/(?Prequest|response)/content/(?P[0-9a-zA-Z\-\_]+)", FlowContentView), + (r"/settings", Settings), + (r"/clear", ClearAll), + ] + settings = dict( + template_path=os.path.join(os.path.dirname(__file__), "templates"), + static_path=os.path.join(os.path.dirname(__file__), "static"), + xsrf_cookies=True, + cookie_secret=os.urandom(256), + debug=debug, + autoreload=False, + wauthenticator=wauthenticator, + ) + super().__init__(handlers, **settings) diff --git a/mitmproxy/tools/web/master.py b/mitmproxy/tools/web/master.py new file mode 100644 index 00000000..2bca4555 --- /dev/null +++ b/mitmproxy/tools/web/master.py @@ -0,0 +1,203 @@ +import sys +import collections + +import tornado.httpserver +import tornado.ioloop + +from typing import Optional + +from mitmproxy import addons +from mitmproxy import controller +from mitmproxy import exceptions +from mitmproxy.addons import state +from mitmproxy import options +from mitmproxy import master +from mitmproxy.tools.web import app +from netlib.http import authentication + + +class Stop(Exception): + pass + + +class WebFlowView(state.FlowView): + + def __init__(self, store): + super().__init__(store, None) + + def _add(self, f): + super()._add(f) + app.ClientConnection.broadcast( + type="UPDATE_FLOWS", + cmd="add", + data=app.convert_flow_to_json_dict(f) + ) + + def _update(self, f): + super()._update(f) + app.ClientConnection.broadcast( + type="UPDATE_FLOWS", + cmd="update", + data=app.convert_flow_to_json_dict(f) + ) + + def _remove(self, f): + super()._remove(f) + app.ClientConnection.broadcast( + type="UPDATE_FLOWS", + cmd="remove", + data=dict(id=f.id) + ) + + def _recalculate(self, flows): + super()._recalculate(flows) + app.ClientConnection.broadcast( + type="UPDATE_FLOWS", + cmd="reset" + ) + + +class WebState(state.State): + + def __init__(self): + super().__init__() + self.view._close() + self.view = WebFlowView(self.flows) + + self._last_event_id = 0 + self.events = collections.deque(maxlen=1000) + + def add_log(self, e, level): + self._last_event_id += 1 + entry = { + "id": self._last_event_id, + "message": e, + "level": level + } + self.events.append(entry) + app.ClientConnection.broadcast( + type="UPDATE_EVENTLOG", + cmd="add", + data=entry + ) + + def clear(self): + super().clear() + self.events.clear() + app.ClientConnection.broadcast( + type="UPDATE_EVENTLOG", + cmd="reset", + data=[] + ) + + +class Options(options.Options): + def __init__( + self, + intercept: Optional[str] = None, + wdebug: bool = bool, + wport: int = 8081, + wiface: str = "127.0.0.1", + wauthenticator: Optional[authentication.PassMan] = None, + wsingleuser: Optional[str] = None, + whtpasswd: Optional[str] = None, + **kwargs + ): + self.wdebug = wdebug + self.wport = wport + self.wiface = wiface + self.wauthenticator = wauthenticator + self.wsingleuser = wsingleuser + self.whtpasswd = whtpasswd + self.intercept = intercept + super().__init__(**kwargs) + + # TODO: This doesn't belong here. + def process_web_options(self, parser): + if self.wsingleuser or self.whtpasswd: + if self.wsingleuser: + if len(self.wsingleuser.split(':')) != 2: + return parser.error( + "Invalid single-user specification. Please use the format username:password" + ) + username, password = self.wsingleuser.split(':') + self.wauthenticator = authentication.PassManSingleUser(username, password) + elif self.whtpasswd: + try: + self.wauthenticator = authentication.PassManHtpasswd(self.whtpasswd) + except ValueError as v: + return parser.error(v.message) + else: + self.wauthenticator = None + + +class WebMaster(master.Master): + + def __init__(self, options, server): + super().__init__(options, server) + self.state = WebState() + self.addons.add(*addons.default_addons()) + self.addons.add(self.state) + self.app = app.Application( + self, self.options.wdebug, self.options.wauthenticator + ) + # This line is just for type hinting + self.options = self.options # type: Options + if options.rfile: + try: + self.load_flows_file(options.rfile) + except exceptions.FlowReadException as v: + self.add_log( + "Could not read flow file: %s" % v, + "error" + ) + + if options.outfile: + err = self.start_stream_to_path( + options.outfile[0], + options.outfile[1] + ) + if err: + print("Stream file error: {}".format(err), file=sys.stderr) + sys.exit(1) + + def run(self): # pragma: no cover + + iol = tornado.ioloop.IOLoop.instance() + + http_server = tornado.httpserver.HTTPServer(self.app) + http_server.listen(self.options.wport) + + iol.add_callback(self.start) + tornado.ioloop.PeriodicCallback(lambda: self.tick(timeout=0), 5).start() + try: + print("Server listening at http://{}:{}".format( + self.options.wiface, self.options.wport), file=sys.stderr) + iol.start() + except (Stop, KeyboardInterrupt): + self.shutdown() + + def _process_flow(self, f): + if self.state.intercept and self.state.intercept( + f) and not f.request.is_replay: + f.intercept(self) + return f + + @controller.handler + def request(self, f): + super().request(f) + return self._process_flow(f) + + @controller.handler + def response(self, f): + super().response(f) + return self._process_flow(f) + + @controller.handler + def error(self, f): + super().error(f) + return self._process_flow(f) + + def add_log(self, e, level="info"): + super().add_log(e, level) + return self.state.add_log(e, level) diff --git a/mitmproxy/tools/web/static/app.css b/mitmproxy/tools/web/static/app.css new file mode 100644 index 00000000..c2dd139f --- /dev/null +++ b/mitmproxy/tools/web/static/app.css @@ -0,0 +1,2 @@ +html{box-sizing:border-box}*,:after,:before{box-sizing:inherit}.resource-icon{width:32px;height:32px}.resource-icon-css{background-image:url(images/chrome-devtools/resourceCSSIcon.png)}.resource-icon-document{background-image:url(images/chrome-devtools/resourceDocumentIcon.png)}.resource-icon-js{background-image:url(images/chrome-devtools/resourceJSIcon.png)}.resource-icon-plain{background-image:url(images/chrome-devtools/resourcePlainIcon.png)}.resource-icon-executable{background-image:url(images/resourceExecutableIcon.png)}.resource-icon-flash{background-image:url(images/resourceFlashIcon.png)}.resource-icon-image{background-image:url(images/resourceImageIcon.png)}.resource-icon-java{background-image:url(images/resourceJavaIcon.png)}.resource-icon-not-modified{background-image:url(images/resourceNotModifiedIcon.png)}.resource-icon-redirect{background-image:url(images/resourceRedirectIcon.png)}#container,#mitmproxy,body,html{height:100%;margin:0;overflow:hidden}#container{display:flex;flex-direction:column;outline:0}#container>.eventlog,#container>footer,#container>header,.eventlog{flex:0 0 auto}.main-view{flex:1 1 auto;height:0;display:flex;flex-direction:row}.main-view.vertical{flex-direction:column}.main-view .flow-detail,.main-view .flow-table{flex:1 1 auto}.splitter{flex:0 0 1px;background-color:#aaa;position:relative}.splitter>div{position:absolute}.splitter.splitter-x{cursor:col-resize}.splitter.splitter-x>div{margin-left:-1px;width:4px;height:100%}.splitter.splitter-y{cursor:row-resize}.splitter.splitter-y>div{margin-top:-1px;height:4px;width:100%}.nav-tabs{border-bottom:solid #a6a6a6 1px}.nav-tabs a{display:inline-block;border:1px solid transparent;text-decoration:none}.nav-tabs a.active{background-color:#fff;border-color:#a6a6a6 #a6a6a6 #fff}.nav-tabs a.special{color:#fff;background-color:#396cad;border-bottom-color:#396cad}.nav-tabs a.special:hover{background-color:#5386c6}.nav-tabs-lg a{padding:3px 14px;margin:0 2px -1px}.nav-tabs-sm a{padding:0 7px;margin:2px 2px -1px}.nav-tabs-sm a.nav-action{float:right;padding:0;margin:1px 0 0}header{padding-top:.5em;background-color:#fff}header .menu{padding:10px;border-bottom:solid #a6a6a6 1px}.menu-row{margin-left:-2px;margin-right:-3px}.filter-input{position:relative;min-height:1px;padding-left:2.5px;padding-right:2.5px;margin-bottom:5px}@media (min-width:768px){.filter-input{float:left;width:25%}}.filter-input .popover{top:27px;display:block;max-width:none;opacity:.9}.filter-input .popover .popover-content{max-height:500px;overflow-y:auto}.flow-table{width:100%;overflow-y:scroll;overflow-x:hidden}.flow-table table{width:100%;table-layout:fixed}.flow-table thead{background-color:#F2F2F2;line-height:23px}.flow-table th{font-weight:400;box-shadow:0 1px 0 #a6a6a6;position:relative!important;padding-left:1px;-webkit-touch-callout:none;-webkit-user-select:none;-khtml-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.prompt-content,footer{box-shadow:0 -1px 3px #d3d3d3}.flow-table th.sort-asc,.flow-table th.sort-desc{background-color:#fafafa}.flow-table th.sort-asc:after,.flow-table th.sort-desc:after{font:normal normal normal 14px/1 FontAwesome;position:absolute;right:3px;top:3px;padding:2px;background-color:rgba(250,250,250,.8)}.flow-detail .first-line,.flow-detail table{font-family:Menlo,Monaco,Consolas,"Courier New",monospace;word-break:break-all}.prompt-content,.prompt-dialog{position:fixed;bottom:0;left:0;right:0}.flow-table th.sort-asc:after{content:"\f0de"}.flow-table th.sort-desc:after{content:"\f0dd"}.flow-table tr{cursor:pointer}.flow-table tr:nth-child(even){background-color:rgba(0,0,0,.05)}.flow-table tr.selected{background-color:rgba(193,215,235,.5)!important}.flow-table tr.highlighted{background-color:rgba(255,204,0,.4)}.flow-table tr.highlighted:nth-child(even){background-color:rgba(255,204,0,.5)}.flow-table td{overflow:hidden;white-space:nowrap;text-overflow:ellipsis}.flow-table tr.intercepted.has-response .col-size,.flow-table tr.intercepted.has-response .col-status,.flow-table tr.intercepted.has-response .col-time,.flow-table tr.intercepted:not(.has-response) .col-method,.flow-table tr.intercepted:not(.has-response) .col-path{color:#ff8000}.flow-table .fa{line-height:inherit}.flow-table .fa.pull-right{margin-left:0}.flow-table .col-tls{width:10px}.flow-table .col-tls-https{background-color:rgba(0,185,0,.5)}.flow-table .col-icon{width:32px}.flow-table .col-path .fa-repeat{color:green}.flow-table .col-path .fa-pause{color:#ff8000}.flow-table .col-method{width:60px}.flow-table .col-status{width:50px}.flow-table .col-size{width:70px}.flow-table .col-time{width:50px}.flow-table td.col-size,.flow-table td.col-time{text-align:right}.flow-detail{width:100%;overflow-x:auto;overflow-y:scroll}.flow-detail nav{background-color:#F2F2F2}.flow-detail section{padding:5px 12px}.flow-detail .first-line{background-color:#428bca;color:#fff;margin:0 -8px;padding:4px 8px;border-radius:5px;max-height:100px;overflow-y:auto}.flow-detail .request-line{margin-bottom:2px}.flow-detail hr{margin:0 0 5px}.inline-input{margin:0 -5px;padding:0 5px}.inline-input[contenteditable]{background-color:rgba(255,255,255,.2)}.inline-input[contenteditable].has-warning{color:#ffb8b8}.view-options{margin-top:10px}.flow-detail table{width:100%;table-layout:fixed}.flow-detail table tr:not(:first-child){border-top:1px solid #f7f7f7}.flow-detail table td{vertical-align:top}.connection-table td:first-child{width:50%;padding-right:1em}.header-table td{line-height:1.3em}.header-table .header-name{width:33%;padding-right:1em}.connection-table td,.timing-table td{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.flowview-image{text-align:center}.flowview-image img{max-width:100%;max-height:100%}.prompt-dialog{top:0;z-index:100;background-color:rgba(0,0,0,.1)}.prompt-content{height:25px;padding:2px 5px;background-color:#fff}.prompt-content .option{cursor:pointer}.prompt-content .option:not(:last-child)::after{content:", "}.eventlog{height:200px;display:flex;flex-direction:column}.eventlog>div{background-color:#F2F2F2;padding:0 5px;flex:0 0 auto;border-top:1px solid #aaa;cursor:row-resize}.eventlog>pre{flex:1 1 auto;margin:0;border-radius:0;overflow-x:auto;overflow-y:scroll;background-color:#fcfcfc}.eventlog .fa-close{cursor:pointer;float:right;color:grey;padding:3px 0 3px 10px}.eventlog .fa-close:hover{color:#000}.eventlog .btn-toggle{margin-top:-2px;margin-left:3px;padding:2px;font-size:10px;line-height:10px;border-radius:2px}.eventlog .label{cursor:pointer;vertical-align:middle;display:inline-block;margin-top:-2px;margin-left:3px}footer{padding:0 10px 3px}footer .label{margin-right:3px} +/*# sourceMappingURL=app.css.map */ diff --git a/mitmproxy/tools/web/static/app.js b/mitmproxy/tools/web/static/app.js new file mode 100644 index 00000000..9ff76104 --- /dev/null +++ b/mitmproxy/tools/web/static/app.js @@ -0,0 +1,9246 @@ +(function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o 1) { + for (var i = 1; i < arguments.length; i++) { + args[i - 1] = arguments[i]; + } + } + queue.push(new Item(fun, args)); + if (queue.length === 1 && !draining) { + runTimeout(drainQueue); + } +}; + +// v8 likes predictible objects +function Item(fun, array) { + this.fun = fun; + this.array = array; +} +Item.prototype.run = function () { + this.fun.apply(null, this.array); +}; +process.title = 'browser'; +process.browser = true; +process.env = {}; +process.argv = []; +process.version = ''; // empty string to avoid regexp issues +process.versions = {}; + +function noop() {} + +process.on = noop; +process.addListener = noop; +process.once = noop; +process.off = noop; +process.removeListener = noop; +process.removeAllListeners = noop; +process.emit = noop; + +process.binding = function (name) { + throw new Error('process.binding is not supported'); +}; + +process.cwd = function () { return '/' }; +process.chdir = function (dir) { + throw new Error('process.chdir is not supported'); +}; +process.umask = function() { return 0; }; + +},{}],2:[function(require,module,exports){ +"use strict"; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.Query = exports.ConnectionActions = exports.StoreCmds = exports.ActionTypes = undefined; + +var _dispatcher = require("./dispatcher.js"); + +var ActionTypes = exports.ActionTypes = { + // Connection + CONNECTION_OPEN: "connection_open", + CONNECTION_CLOSE: "connection_close", + CONNECTION_ERROR: "connection_error", + + // Stores + SETTINGS_STORE: "settings", + EVENT_STORE: "events", + FLOW_STORE: "flows" +}; + +var StoreCmds = exports.StoreCmds = { + ADD: "add", + UPDATE: "update", + REMOVE: "remove", + RESET: "reset" +}; + +var ConnectionActions = exports.ConnectionActions = { + open: function open() { + _dispatcher.AppDispatcher.dispatchViewAction({ + type: ActionTypes.CONNECTION_OPEN + }); + }, + close: function close() { + _dispatcher.AppDispatcher.dispatchViewAction({ + type: ActionTypes.CONNECTION_CLOSE + }); + }, + error: function error() { + _dispatcher.AppDispatcher.dispatchViewAction({ + type: ActionTypes.CONNECTION_ERROR + }); + } +}; + +var Query = exports.Query = { + SEARCH: "s", + HIGHLIGHT: "h", + SHOW_EVENTLOG: "e" +}; + +},{"./dispatcher.js":48}],3:[function(require,module,exports){ +(function (process){ +'use strict'; + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactDom = require('react-dom'); + +var _redux = require('redux'); + +var _reactRedux = require('react-redux'); + +var _reduxThunk = require('redux-thunk'); + +var _reduxThunk2 = _interopRequireDefault(_reduxThunk); + +var _ProxyApp = require('./components/ProxyApp'); + +var _ProxyApp2 = _interopRequireDefault(_ProxyApp); + +var _index = require('./ducks/index'); + +var _index2 = _interopRequireDefault(_index); + +var _eventLog = require('./ducks/eventLog'); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +var middlewares = [_reduxThunk2.default]; + +if (process.env.NODE_ENV !== 'production') { + var createLogger = require('redux-logger'); + middlewares.push(createLogger()); +} + +// logger must be last +var store = (0, _redux.createStore)(_index2.default, _redux.applyMiddleware.apply(undefined, middlewares)); + +// @todo move to ProxyApp +window.addEventListener('error', function (msg) { + store.dispatch((0, _eventLog.add)(msg)); +}); + +// @todo remove this +document.addEventListener('DOMContentLoaded', function () { + (0, _reactDom.render)(_react2.default.createElement( + _reactRedux.Provider, + { store: store }, + _react2.default.createElement(_ProxyApp2.default, null) + ), document.getElementById("mitmproxy")); +}); + +}).call(this,require('_process')) + +},{"./components/ProxyApp":37,"./ducks/eventLog":50,"./ducks/index":53,"_process":1,"react":"react","react-dom":"react-dom","react-redux":"react-redux","redux":"redux","redux-logger":"redux-logger","redux-thunk":"redux-thunk"}],4:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactRedux = require('react-redux'); + +var _ContentViews = require('./ContentView/ContentViews'); + +var ContentViews = _interopRequireWildcard(_ContentViews); + +var _MetaViews = require('./ContentView/MetaViews'); + +var MetaViews = _interopRequireWildcard(_MetaViews); + +var _ShowFullContentButton = require('./ContentView/ShowFullContentButton'); + +var _ShowFullContentButton2 = _interopRequireDefault(_ShowFullContentButton); + +var _flow = require('../ducks/ui/flow'); + +function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +ContentView.propTypes = { + // It may seem a bit weird at the first glance: + // Every view takes the flow and the message as props, e.g. + // + flow: _react2.default.PropTypes.object.isRequired, + message: _react2.default.PropTypes.object.isRequired +}; + +ContentView.isContentTooLarge = function (msg) { + return msg.contentLength > 1024 * 1024 * (ContentViews.ViewImage.matches(msg) ? 10 : 0.2); +}; + +function ContentView(props) { + var flow = props.flow; + var message = props.message; + var contentView = props.contentView; + var isDisplayLarge = props.isDisplayLarge; + var displayLarge = props.displayLarge; + var onContentChange = props.onContentChange; + var readonly = props.readonly; + + + if (message.contentLength === 0 && readonly) { + return _react2.default.createElement(MetaViews.ContentEmpty, props); + } + + if (message.contentLength === null && readonly) { + return _react2.default.createElement(MetaViews.ContentMissing, props); + } + + if (!isDisplayLarge && ContentView.isContentTooLarge(message)) { + return _react2.default.createElement(MetaViews.ContentTooLarge, _extends({}, props, { onClick: displayLarge })); + } + + var View = ContentViews[contentView] || ContentViews['ViewServer']; + return _react2.default.createElement( + 'div', + { className: 'contentview' }, + _react2.default.createElement(View, { flow: flow, message: message, contentView: contentView, readonly: readonly, onChange: onContentChange }), + _react2.default.createElement(_ShowFullContentButton2.default, null) + ); +} + +exports.default = (0, _reactRedux.connect)(function (state) { + return { + contentView: state.ui.flow.contentView, + isDisplayLarge: state.ui.flow.displayLarge + }; +}, { + displayLarge: _flow.displayLarge, + updateEdit: _flow.updateEdit +})(ContentView); + +},{"../ducks/ui/flow":56,"./ContentView/ContentViews":8,"./ContentView/MetaViews":10,"./ContentView/ShowFullContentButton":11,"react":"react","react-redux":"react-redux"}],5:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.default = CodeEditor; + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactCodemirror = require('react-codemirror'); + +var _reactCodemirror2 = _interopRequireDefault(_reactCodemirror); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +CodeEditor.propTypes = { + content: _react.PropTypes.string.isRequired, + onChange: _react.PropTypes.func.isRequired +}; + +function CodeEditor(_ref) { + var content = _ref.content; + var onChange = _ref.onChange; + + + var options = { + lineNumbers: true + }; + return _react2.default.createElement( + 'div', + { className: 'codeeditor', onKeyDown: function onKeyDown(e) { + return e.stopPropagation(); + } }, + _react2.default.createElement(_reactCodemirror2.default, { value: content, onChange: onChange, options: options }) + ); +} + +},{"react":"react","react-codemirror":"react-codemirror"}],6:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _utils = require('../../flow/utils.js'); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; } + +function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; } + +exports.default = function (View) { + var _class, _temp; + + return _temp = _class = function (_React$Component) { + _inherits(_class, _React$Component); + + function _class(props) { + _classCallCheck(this, _class); + + var _this = _possibleConstructorReturn(this, Object.getPrototypeOf(_class).call(this, props)); + + _this.state = { + content: undefined, + request: undefined + }; + return _this; + } + + _createClass(_class, [{ + key: 'componentWillMount', + value: function componentWillMount() { + this.updateContent(this.props); + } + }, { + key: 'componentWillReceiveProps', + value: function componentWillReceiveProps(nextProps) { + if (nextProps.message.content !== this.props.message.content || nextProps.message.contentHash !== this.props.message.contentHash || nextProps.contentView !== this.props.contentView) { + this.updateContent(nextProps); + } + } + }, { + key: 'componentWillUnmount', + value: function componentWillUnmount() { + if (this.state.request) { + this.state.request.abort(); + } + } + }, { + key: 'updateContent', + value: function updateContent(props) { + if (this.state.request) { + this.state.request.abort(); + } + // We have a few special cases where we do not need to make an HTTP request. + if (props.message.content !== undefined) { + return this.setState({ request: undefined, content: props.message.content }); + } + if (props.message.contentLength === 0 || props.message.contentLength === null) { + return this.setState({ request: undefined, content: "" }); + } + + var requestUrl = _utils.MessageUtils.getContentURL(props.flow, props.message, View.name == 'ViewServer' ? props.contentView : undefined); + + // We use XMLHttpRequest instead of fetch() because fetch() is not (yet) abortable. + var request = new XMLHttpRequest(); + request.addEventListener("load", this.requestComplete.bind(this, request)); + request.addEventListener("error", this.requestFailed.bind(this, request)); + request.open("GET", requestUrl); + request.send(); + this.setState({ request: request, content: undefined }); + } + }, { + key: 'requestComplete', + value: function requestComplete(request, e) { + if (request !== this.state.request) { + return; // Stale request + } + this.setState({ + content: request.responseText, + request: undefined + }); + } + }, { + key: 'requestFailed', + value: function requestFailed(request, e) { + if (request !== this.state.request) { + return; // Stale request + } + console.error(e); + // FIXME: Better error handling + this.setState({ + content: "Error getting content.", + request: undefined + }); + } + }, { + key: 'render', + value: function render() { + return this.state.content !== undefined ? _react2.default.createElement(View, _extends({ content: this.state.content }, this.props)) : _react2.default.createElement( + 'div', + { className: 'text-center' }, + _react2.default.createElement('i', { className: 'fa fa-spinner fa-spin' }) + ); + } + }]); + + return _class; + }(_react2.default.Component), _class.displayName = View.displayName || View.name, _class.matches = View.matches, _class.propTypes = _extends({}, View.propTypes, { + content: _react.PropTypes.string, // mark as non-required + flow: _react.PropTypes.object.isRequired, + message: _react.PropTypes.object.isRequired + }), _temp; +}; + +},{"../../flow/utils.js":64,"react":"react"}],7:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactRedux = require('react-redux'); + +var _ViewSelector = require('./ViewSelector'); + +var _ViewSelector2 = _interopRequireDefault(_ViewSelector); + +var _UploadContentButton = require('./UploadContentButton'); + +var _UploadContentButton2 = _interopRequireDefault(_UploadContentButton); + +var _DownloadContentButton = require('./DownloadContentButton'); + +var _DownloadContentButton2 = _interopRequireDefault(_DownloadContentButton); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +ContentViewOptions.propTypes = { + flow: _react2.default.PropTypes.object.isRequired, + message: _react2.default.PropTypes.object.isRequired +}; + +function ContentViewOptions(props) { + var flow = props.flow; + var message = props.message; + var uploadContent = props.uploadContent; + var readonly = props.readonly; + var contentViewDescription = props.contentViewDescription; + + return _react2.default.createElement( + 'div', + { className: 'view-options' }, + _react2.default.createElement(_ViewSelector2.default, { message: message }), + ' ', + _react2.default.createElement(_DownloadContentButton2.default, { flow: flow, message: message }), + ' ', + _react2.default.createElement(_UploadContentButton2.default, { uploadContent: uploadContent }), + ' ', + _react2.default.createElement( + 'span', + null, + contentViewDescription + ) + ); +} + +exports.default = (0, _reactRedux.connect)(function (state) { + return { + contentViewDescription: state.ui.flow.viewDescription + }; +})(ContentViewOptions); + +},{"./DownloadContentButton":9,"./UploadContentButton":12,"./ViewSelector":13,"react":"react","react-redux":"react-redux"}],8:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.ViewImage = exports.ViewServer = exports.Edit = undefined; + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactRedux = require('react-redux'); + +var _flow = require('../../ducks/ui/flow'); + +var _ContentLoader = require('./ContentLoader'); + +var _ContentLoader2 = _interopRequireDefault(_ContentLoader); + +var _utils = require('../../flow/utils'); + +var _CodeEditor = require('./CodeEditor'); + +var _CodeEditor2 = _interopRequireDefault(_CodeEditor); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; } + +function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; } + +var isImage = /^image\/(png|jpe?g|gif|vnc.microsoft.icon|x-icon)$/i; +ViewImage.matches = function (msg) { + return isImage.test(_utils.MessageUtils.getContentType(msg)); +}; +ViewImage.propTypes = { + flow: _react.PropTypes.object.isRequired, + message: _react.PropTypes.object.isRequired +}; +function ViewImage(_ref) { + var flow = _ref.flow; + var message = _ref.message; + + return _react2.default.createElement( + 'div', + { className: 'flowview-image' }, + _react2.default.createElement('img', { src: _utils.MessageUtils.getContentURL(flow, message), alt: 'preview', className: 'img-thumbnail' }) + ); +} + +Edit.propTypes = { + content: _react2.default.PropTypes.string.isRequired +}; + +function Edit(_ref2) { + var content = _ref2.content; + var onChange = _ref2.onChange; + + return _react2.default.createElement(_CodeEditor2.default, { content: content, onChange: onChange }); +} +exports.Edit = Edit = (0, _ContentLoader2.default)(Edit); + +var ViewServer = function (_Component) { + _inherits(ViewServer, _Component); + + function ViewServer() { + _classCallCheck(this, ViewServer); + + return _possibleConstructorReturn(this, Object.getPrototypeOf(ViewServer).apply(this, arguments)); + } + + _createClass(ViewServer, [{ + key: 'componentWillMount', + value: function componentWillMount() { + this.setContentView(this.props); + } + }, { + key: 'componentWillReceiveProps', + value: function componentWillReceiveProps(nextProps) { + if (nextProps.content != this.props.content) { + this.setContentView(nextProps); + } + } + }, { + key: 'setContentView', + value: function setContentView(props) { + try { + this.data = JSON.parse(props.content); + } catch (err) { + this.data = { lines: [], description: err.message }; + } + + props.setContentViewDescription(props.contentView != this.data.description ? this.data.description : ''); + props.setContent(this.data.lines); + } + }, { + key: 'render', + value: function render() { + var _props = this.props; + var content = _props.content; + var contentView = _props.contentView; + var message = _props.message; + var maxLines = _props.maxLines; + + var lines = this.props.showFullContent ? this.data.lines : this.data.lines.slice(0, maxLines); + return _react2.default.createElement( + 'div', + null, + _react2.default.createElement( + 'pre', + null, + lines.map(function (line, i) { + return _react2.default.createElement( + 'div', + { key: 'line' + i }, + line.map(function (element, j) { + var style = void 0, + text = element; + return _react2.default.createElement( + 'span', + { key: 'tuple' + j, className: style }, + element + ); + }) + ); + }) + ), + ViewImage.matches(message) && _react2.default.createElement(ViewImage, this.props) + ); + } + }]); + + return ViewServer; +}(_react.Component); + +ViewServer.propTypes = { + showFullContent: _react.PropTypes.bool.isRequired, + maxLines: _react.PropTypes.number.isRequired, + setContentViewDescription: _react.PropTypes.func.isRequired, + setContent: _react.PropTypes.func.isRequired +}; + + +exports.ViewServer = ViewServer = (0, _reactRedux.connect)(function (state) { + return { + showFullContent: state.ui.flow.showFullContent, + maxLines: state.ui.flow.maxContentLines + }; +}, { + setContentViewDescription: _flow.setContentViewDescription, + setContent: _flow.setContent +})((0, _ContentLoader2.default)(ViewServer)); + +exports.Edit = Edit; +exports.ViewServer = ViewServer; +exports.ViewImage = ViewImage; + +},{"../../ducks/ui/flow":56,"../../flow/utils":64,"./CodeEditor":5,"./ContentLoader":6,"react":"react","react-redux":"react-redux"}],9:[function(require,module,exports){ +"use strict"; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.default = DownloadContentButton; + +var _utils = require("../../flow/utils"); + +var _react = require("react"); + +DownloadContentButton.propTypes = { + flow: _react.PropTypes.object.isRequired, + message: _react.PropTypes.object.isRequired +}; + +function DownloadContentButton(_ref) { + var flow = _ref.flow; + var message = _ref.message; + + + return React.createElement( + "a", + { className: "btn btn-default btn-xs", + href: _utils.MessageUtils.getContentURL(flow, message), + title: "Download the content of the flow." }, + React.createElement("i", { className: "fa fa-download" }) + ); +} + +},{"../../flow/utils":64,"react":"react"}],10:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.ContentEmpty = ContentEmpty; +exports.ContentMissing = ContentMissing; +exports.ContentTooLarge = ContentTooLarge; + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _utils = require('../../utils.js'); + +var _UploadContentButton = require('./UploadContentButton'); + +var _UploadContentButton2 = _interopRequireDefault(_UploadContentButton); + +var _DownloadContentButton = require('./DownloadContentButton'); + +var _DownloadContentButton2 = _interopRequireDefault(_DownloadContentButton); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function ContentEmpty(_ref) { + var flow = _ref.flow; + var message = _ref.message; + + return _react2.default.createElement( + 'div', + { className: 'alert alert-info' }, + 'No ', + flow.request === message ? 'request' : 'response', + ' content.' + ); +} + +function ContentMissing(_ref2) { + var flow = _ref2.flow; + var message = _ref2.message; + + return _react2.default.createElement( + 'div', + { className: 'alert alert-info' }, + flow.request === message ? 'Request' : 'Response', + ' content missing.' + ); +} + +function ContentTooLarge(_ref3) { + var message = _ref3.message; + var onClick = _ref3.onClick; + var uploadContent = _ref3.uploadContent; + var flow = _ref3.flow; + + return _react2.default.createElement( + 'div', + null, + _react2.default.createElement( + 'div', + { className: 'alert alert-warning' }, + _react2.default.createElement( + 'button', + { onClick: onClick, className: 'btn btn-xs btn-warning pull-right' }, + 'Display anyway' + ), + (0, _utils.formatSize)(message.contentLength), + ' content size.' + ), + _react2.default.createElement( + 'div', + { className: 'view-options text-center' }, + _react2.default.createElement(_UploadContentButton2.default, { uploadContent: uploadContent }), + ' ', + _react2.default.createElement(_DownloadContentButton2.default, { flow: flow, message: message }) + ) + ); +} + +},{"../../utils.js":65,"./DownloadContentButton":9,"./UploadContentButton":12,"react":"react"}],11:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactRedux = require('react-redux'); + +var _reactDom = require('react-dom'); + +var _Button = require('../common/Button'); + +var _Button2 = _interopRequireDefault(_Button); + +var _flow = require('../../ducks/ui/flow'); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +ShowFullContentButton.propTypes = { + setShowFullContent: _react.PropTypes.func.isRequired, + showFullContent: _react.PropTypes.bool.isRequired +}; + +function ShowFullContentButton(_ref) { + var setShowFullContent = _ref.setShowFullContent; + var showFullContent = _ref.showFullContent; + var visibleLines = _ref.visibleLines; + var contentLines = _ref.contentLines; + + + return !showFullContent && _react2.default.createElement( + 'div', + null, + _react2.default.createElement(_Button2.default, { className: 'view-all-content-btn btn-xs', onClick: function onClick() { + return setShowFullContent(true); + }, text: 'Show full content' }), + _react2.default.createElement( + 'span', + { className: 'pull-right' }, + ' ', + visibleLines, + '/', + contentLines, + ' are visible   ' + ) + ); +} + +exports.default = (0, _reactRedux.connect)(function (state) { + return { + showFullContent: state.ui.flow.showFullContent, + visibleLines: state.ui.flow.maxContentLines, + contentLines: state.ui.flow.content.length + + }; +}, { + setShowFullContent: _flow.setShowFullContent +})(ShowFullContentButton); + +},{"../../ducks/ui/flow":56,"../common/Button":40,"react":"react","react-dom":"react-dom","react-redux":"react-redux"}],12:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.default = UploadContentButton; + +var _react = require('react'); + +var _FileChooser = require('../common/FileChooser'); + +var _FileChooser2 = _interopRequireDefault(_FileChooser); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +UploadContentButton.propTypes = { + uploadContent: _react.PropTypes.func.isRequired +}; + +function UploadContentButton(_ref) { + var uploadContent = _ref.uploadContent; + + + var fileInput = void 0; + + return React.createElement(_FileChooser2.default, { + icon: 'fa-upload', + title: 'Upload a file to replace the content.', + onOpenFile: uploadContent, + className: 'btn btn-default btn-xs' }); +} + +},{"../common/FileChooser":42,"react":"react"}],13:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactRedux = require('react-redux'); + +var _ContentViews = require('./ContentViews'); + +var ContentViews = _interopRequireWildcard(_ContentViews); + +var _flow = require('../../ducks/ui/flow'); + +var _Dropdown = require('../common/Dropdown'); + +var _Dropdown2 = _interopRequireDefault(_Dropdown); + +function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +ViewSelector.propTypes = { + contentViews: _react.PropTypes.array.isRequired, + activeView: _react.PropTypes.string.isRequired, + isEdit: _react.PropTypes.bool.isRequired, + setContentView: _react.PropTypes.func.isRequired +}; + +function ViewSelector(_ref) { + var contentViews = _ref.contentViews; + var activeView = _ref.activeView; + var isEdit = _ref.isEdit; + var setContentView = _ref.setContentView; + + var edit = ContentViews.Edit.displayName; + var inner = _react2.default.createElement( + 'span', + null, + ' ', + _react2.default.createElement( + 'b', + null, + 'View:' + ), + ' ', + activeView, + _react2.default.createElement('span', { className: 'caret' }), + ' ' + ); + + return _react2.default.createElement( + _Dropdown2.default, + { dropup: true, className: 'pull-left', btnClass: 'btn btn-default btn-xs', text: inner }, + contentViews.map(function (name) { + return _react2.default.createElement( + 'a', + { href: '#', key: name, onClick: function onClick(e) { + e.preventDefault();setContentView(name); + } }, + name.toLowerCase().replace('_', ' ') + ); + }), + isEdit && _react2.default.createElement( + 'a', + { href: '#', onClick: function onClick(e) { + e.preventDefault();setContentView(edit); + } }, + edit.toLowerCase() + ) + ); +} + +exports.default = (0, _reactRedux.connect)(function (state) { + return { + contentViews: state.settings.contentViews, + activeView: state.ui.flow.contentView, + isEdit: !!state.ui.flow.modifiedFlow + }; +}, { + setContentView: _flow.setContentView +})(ViewSelector); + +},{"../../ducks/ui/flow":56,"../common/Dropdown":41,"./ContentViews":8,"react":"react","react-redux":"react-redux"}],14:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactRedux = require('react-redux'); + +var _eventLog = require('../ducks/eventLog'); + +var _ToggleButton = require('./common/ToggleButton'); + +var _ToggleButton2 = _interopRequireDefault(_ToggleButton); + +var _EventList = require('./EventLog/EventList'); + +var _EventList2 = _interopRequireDefault(_EventList); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; } + +function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; } + +var EventLog = function (_Component) { + _inherits(EventLog, _Component); + + function EventLog(props, context) { + _classCallCheck(this, EventLog); + + var _this = _possibleConstructorReturn(this, Object.getPrototypeOf(EventLog).call(this, props, context)); + + _this.state = { height: _this.props.defaultHeight }; + + _this.onDragStart = _this.onDragStart.bind(_this); + _this.onDragMove = _this.onDragMove.bind(_this); + _this.onDragStop = _this.onDragStop.bind(_this); + return _this; + } + + _createClass(EventLog, [{ + key: 'onDragStart', + value: function onDragStart(event) { + event.preventDefault(); + this.dragStart = this.state.height + event.pageY; + window.addEventListener('mousemove', this.onDragMove); + window.addEventListener('mouseup', this.onDragStop); + window.addEventListener('dragend', this.onDragStop); + } + }, { + key: 'onDragMove', + value: function onDragMove(event) { + event.preventDefault(); + this.setState({ height: this.dragStart - event.pageY }); + } + }, { + key: 'onDragStop', + value: function onDragStop(event) { + event.preventDefault(); + window.removeEventListener('mousemove', this.onDragMove); + } + }, { + key: 'render', + value: function render() { + var height = this.state.height; + var _props = this.props; + var filters = _props.filters; + var events = _props.events; + var toggleFilter = _props.toggleFilter; + var close = _props.close; + + + return _react2.default.createElement( + 'div', + { className: 'eventlog', style: { height: height } }, + _react2.default.createElement( + 'div', + { onMouseDown: this.onDragStart }, + 'Eventlog', + _react2.default.createElement( + 'div', + { className: 'pull-right' }, + ['debug', 'info', 'web'].map(function (type) { + return _react2.default.createElement(_ToggleButton2.default, { key: type, text: type, checked: filters[type], onToggle: function onToggle() { + return toggleFilter(type); + } }); + }), + _react2.default.createElement('i', { onClick: close, className: 'fa fa-close' }) + ) + ), + _react2.default.createElement(_EventList2.default, { events: events }) + ); + } + }]); + + return EventLog; +}(_react.Component); + +EventLog.propTypes = { + filters: _react.PropTypes.object.isRequired, + events: _react.PropTypes.array.isRequired, + toggleFilter: _react.PropTypes.func.isRequired, + close: _react.PropTypes.func.isRequired, + defaultHeight: _react.PropTypes.number +}; +EventLog.defaultProps = { + defaultHeight: 200 +}; +exports.default = (0, _reactRedux.connect)(function (state) { + return { + filters: state.eventLog.filters, + events: state.eventLog.view.data + }; +}, { + close: _eventLog.toggleVisibility, + toggleFilter: _eventLog.toggleFilter +})(EventLog); + +},{"../ducks/eventLog":50,"./EventLog/EventList":15,"./common/ToggleButton":44,"react":"react","react-redux":"react-redux"}],15:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactDom = require('react-dom'); + +var _reactDom2 = _interopRequireDefault(_reactDom); + +var _shallowequal = require('shallowequal'); + +var _shallowequal2 = _interopRequireDefault(_shallowequal); + +var _AutoScroll = require('../helpers/AutoScroll'); + +var _AutoScroll2 = _interopRequireDefault(_AutoScroll); + +var _VirtualScroll = require('../helpers/VirtualScroll'); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; } + +function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; } + +var EventLogList = function (_Component) { + _inherits(EventLogList, _Component); + + function EventLogList(props) { + _classCallCheck(this, EventLogList); + + var _this = _possibleConstructorReturn(this, Object.getPrototypeOf(EventLogList).call(this, props)); + + _this.heights = {}; + _this.state = { vScroll: (0, _VirtualScroll.calcVScroll)() }; + + _this.onViewportUpdate = _this.onViewportUpdate.bind(_this); + return _this; + } + + _createClass(EventLogList, [{ + key: 'componentDidMount', + value: function componentDidMount() { + window.addEventListener('resize', this.onViewportUpdate); + this.onViewportUpdate(); + } + }, { + key: 'componentWillUnmount', + value: function componentWillUnmount() { + window.removeEventListener('resize', this.onViewportUpdate); + } + }, { + key: 'componentDidUpdate', + value: function componentDidUpdate() { + this.onViewportUpdate(); + } + }, { + key: 'onViewportUpdate', + value: function onViewportUpdate() { + var _this2 = this; + + var viewport = _reactDom2.default.findDOMNode(this); + + var vScroll = (0, _VirtualScroll.calcVScroll)({ + itemCount: this.props.events.length, + rowHeight: this.props.rowHeight, + viewportTop: viewport.scrollTop, + viewportHeight: viewport.offsetHeight, + itemHeights: this.props.events.map(function (entry) { + return _this2.heights[entry.id]; + }) + }); + + if (!(0, _shallowequal2.default)(this.state.vScroll, vScroll)) { + this.setState({ vScroll: vScroll }); + } + } + }, { + key: 'setHeight', + value: function setHeight(id, node) { + if (node && !this.heights[id]) { + var height = node.offsetHeight; + if (this.heights[id] !== height) { + this.heights[id] = height; + this.onViewportUpdate(); + } + } + } + }, { + key: 'render', + value: function render() { + var _this3 = this; + + var vScroll = this.state.vScroll; + var events = this.props.events; + + + return _react2.default.createElement( + 'pre', + { onScroll: this.onViewportUpdate }, + _react2.default.createElement('div', { style: { height: vScroll.paddingTop } }), + events.slice(vScroll.start, vScroll.end).map(function (event) { + return _react2.default.createElement( + 'div', + { key: event.id, ref: function ref(node) { + return _this3.setHeight(event.id, node); + } }, + _react2.default.createElement(LogIcon, { event: event }), + event.message + ); + }), + _react2.default.createElement('div', { style: { height: vScroll.paddingBottom } }) + ); + } + }]); + + return EventLogList; +}(_react.Component); + +EventLogList.propTypes = { + events: _react.PropTypes.array.isRequired, + rowHeight: _react.PropTypes.number +}; +EventLogList.defaultProps = { + rowHeight: 18 +}; + + +function LogIcon(_ref) { + var event = _ref.event; + + var icon = { web: 'html5', debug: 'bug' }[event.level] || 'info'; + return _react2.default.createElement('i', { className: 'fa fa-fw fa-' + icon }); +} + +exports.default = (0, _AutoScroll2.default)(EventLogList); + +},{"../helpers/AutoScroll":46,"../helpers/VirtualScroll":47,"react":"react","react-dom":"react-dom","shallowequal":"shallowequal"}],16:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactDom = require('react-dom'); + +var _reactDom2 = _interopRequireDefault(_reactDom); + +var _shallowequal = require('shallowequal'); + +var _shallowequal2 = _interopRequireDefault(_shallowequal); + +var _AutoScroll = require('./helpers/AutoScroll'); + +var _AutoScroll2 = _interopRequireDefault(_AutoScroll); + +var _VirtualScroll = require('./helpers/VirtualScroll'); + +var _FlowTableHead = require('./FlowTable/FlowTableHead'); + +var _FlowTableHead2 = _interopRequireDefault(_FlowTableHead); + +var _FlowRow = require('./FlowTable/FlowRow'); + +var _FlowRow2 = _interopRequireDefault(_FlowRow); + +var _filt = require('../filt/filt'); + +var _filt2 = _interopRequireDefault(_filt); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; } + +function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; } + +var FlowTable = function (_React$Component) { + _inherits(FlowTable, _React$Component); + + function FlowTable(props, context) { + _classCallCheck(this, FlowTable); + + var _this = _possibleConstructorReturn(this, Object.getPrototypeOf(FlowTable).call(this, props, context)); + + _this.state = { vScroll: (0, _VirtualScroll.calcVScroll)() }; + _this.onViewportUpdate = _this.onViewportUpdate.bind(_this); + return _this; + } + + _createClass(FlowTable, [{ + key: 'componentWillMount', + value: function componentWillMount() { + window.addEventListener('resize', this.onViewportUpdate); + } + }, { + key: 'componentWillUnmount', + value: function componentWillUnmount() { + window.removeEventListener('resize', this.onViewportUpdate); + } + }, { + key: 'componentDidUpdate', + value: function componentDidUpdate() { + this.onViewportUpdate(); + + if (!this.shouldScrollIntoView) { + return; + } + + this.shouldScrollIntoView = false; + + var _props = this.props; + var rowHeight = _props.rowHeight; + var flows = _props.flows; + var selected = _props.selected; + + var viewport = _reactDom2.default.findDOMNode(this); + var head = _reactDom2.default.findDOMNode(this.refs.head); + + var headHeight = head ? head.offsetHeight : 0; + + var rowTop = flows.indexOf(selected) * rowHeight + headHeight; + var rowBottom = rowTop + rowHeight; + + var viewportTop = viewport.scrollTop; + var viewportHeight = viewport.offsetHeight; + + // Account for pinned thead + if (rowTop - headHeight < viewportTop) { + viewport.scrollTop = rowTop - headHeight; + } else if (rowBottom > viewportTop + viewportHeight) { + viewport.scrollTop = rowBottom - viewportHeight; + } + } + }, { + key: 'componentWillReceiveProps', + value: function componentWillReceiveProps(nextProps) { + if (nextProps.selected && nextProps.selected !== this.props.selected) { + this.shouldScrollIntoView = true; + } + } + }, { + key: 'onViewportUpdate', + value: function onViewportUpdate() { + var viewport = _reactDom2.default.findDOMNode(this); + var viewportTop = viewport.scrollTop; + + var vScroll = (0, _VirtualScroll.calcVScroll)({ + viewportTop: viewportTop, + viewportHeight: viewport.offsetHeight, + itemCount: this.props.flows.length, + rowHeight: this.props.rowHeight + }); + + if (this.state.viewportTop !== viewportTop || !(0, _shallowequal2.default)(this.state.vScroll, vScroll)) { + this.setState({ vScroll: vScroll, viewportTop: viewportTop }); + } + } + }, { + key: 'render', + value: function render() { + var _this2 = this; + + var _state = this.state; + var vScroll = _state.vScroll; + var viewportTop = _state.viewportTop; + var _props2 = this.props; + var flows = _props2.flows; + var selected = _props2.selected; + var highlight = _props2.highlight; + + var isHighlighted = highlight ? _filt2.default.parse(highlight) : function () { + return false; + }; + + return _react2.default.createElement( + 'div', + { className: 'flow-table', onScroll: this.onViewportUpdate }, + _react2.default.createElement( + 'table', + null, + _react2.default.createElement( + 'thead', + { ref: 'head', style: { transform: 'translateY(' + viewportTop + 'px)' } }, + _react2.default.createElement(_FlowTableHead2.default, null) + ), + _react2.default.createElement( + 'tbody', + null, + _react2.default.createElement('tr', { style: { height: vScroll.paddingTop } }), + flows.slice(vScroll.start, vScroll.end).map(function (flow) { + return _react2.default.createElement(_FlowRow2.default, { + key: flow.id, + flow: flow, + selected: flow === selected, + highlighted: isHighlighted(flow), + onSelect: _this2.props.onSelect + }); + }), + _react2.default.createElement('tr', { style: { height: vScroll.paddingBottom } }) + ) + ) + ); + } + }]); + + return FlowTable; +}(_react2.default.Component); + +FlowTable.propTypes = { + onSelect: _react.PropTypes.func.isRequired, + flows: _react.PropTypes.array.isRequired, + rowHeight: _react.PropTypes.number, + highlight: _react.PropTypes.string, + selected: _react.PropTypes.object +}; +FlowTable.defaultProps = { + rowHeight: 32 +}; +exports.default = (0, _AutoScroll2.default)(FlowTable); + +},{"../filt/filt":63,"./FlowTable/FlowRow":18,"./FlowTable/FlowTableHead":19,"./helpers/AutoScroll":46,"./helpers/VirtualScroll":47,"react":"react","react-dom":"react-dom","shallowequal":"shallowequal"}],17:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.TLSColumn = TLSColumn; +exports.IconColumn = IconColumn; +exports.PathColumn = PathColumn; +exports.MethodColumn = MethodColumn; +exports.StatusColumn = StatusColumn; +exports.SizeColumn = SizeColumn; +exports.TimeColumn = TimeColumn; + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _classnames = require('classnames'); + +var _classnames2 = _interopRequireDefault(_classnames); + +var _utils = require('../../flow/utils.js'); + +var _utils2 = require('../../utils.js'); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function TLSColumn(_ref) { + var flow = _ref.flow; + + return _react2.default.createElement('td', { className: (0, _classnames2.default)('col-tls', flow.request.scheme === 'https' ? 'col-tls-https' : 'col-tls-http') }); +} + +TLSColumn.headerClass = 'col-tls'; +TLSColumn.headerName = ''; + +function IconColumn(_ref2) { + var flow = _ref2.flow; + + return _react2.default.createElement( + 'td', + { className: 'col-icon' }, + _react2.default.createElement('div', { className: (0, _classnames2.default)('resource-icon', IconColumn.getIcon(flow)) }) + ); +} + +IconColumn.headerClass = 'col-icon'; +IconColumn.headerName = ''; + +IconColumn.getIcon = function (flow) { + if (!flow.response) { + return 'resource-icon-plain'; + } + + var contentType = _utils.ResponseUtils.getContentType(flow.response) || ''; + + // @todo We should assign a type to the flow somewhere else. + if (flow.response.status_code === 304) { + return 'resource-icon-not-modified'; + } + if (300 <= flow.response.status_code && flow.response.status_code < 400) { + return 'resource-icon-redirect'; + } + if (contentType.indexOf('image') >= 0) { + return 'resource-icon-image'; + } + if (contentType.indexOf('javascript') >= 0) { + return 'resource-icon-js'; + } + if (contentType.indexOf('css') >= 0) { + return 'resource-icon-css'; + } + if (contentType.indexOf('html') >= 0) { + return 'resource-icon-document'; + } + + return 'resource-icon-plain'; +}; + +function PathColumn(_ref3) { + var flow = _ref3.flow; + + return _react2.default.createElement( + 'td', + { className: 'col-path' }, + flow.request.is_replay && _react2.default.createElement('i', { className: 'fa fa-fw fa-repeat pull-right' }), + flow.intercepted && _react2.default.createElement('i', { className: 'fa fa-fw fa-pause pull-right' }), + _utils.RequestUtils.pretty_url(flow.request) + ); +} + +PathColumn.headerClass = 'col-path'; +PathColumn.headerName = 'Path'; + +function MethodColumn(_ref4) { + var flow = _ref4.flow; + + return _react2.default.createElement( + 'td', + { className: 'col-method' }, + flow.request.method + ); +} + +MethodColumn.headerClass = 'col-method'; +MethodColumn.headerName = 'Method'; + +function StatusColumn(_ref5) { + var flow = _ref5.flow; + + return _react2.default.createElement( + 'td', + { className: 'col-status' }, + flow.response && flow.response.status_code + ); +} + +StatusColumn.headerClass = 'col-status'; +StatusColumn.headerName = 'Status'; + +function SizeColumn(_ref6) { + var flow = _ref6.flow; + + return _react2.default.createElement( + 'td', + { className: 'col-size' }, + (0, _utils2.formatSize)(SizeColumn.getTotalSize(flow)) + ); +} + +SizeColumn.getTotalSize = function (flow) { + var total = flow.request.contentLength; + if (flow.response) { + total += flow.response.contentLength || 0; + } + return total; +}; + +SizeColumn.headerClass = 'col-size'; +SizeColumn.headerName = 'Size'; + +function TimeColumn(_ref7) { + var flow = _ref7.flow; + + return _react2.default.createElement( + 'td', + { className: 'col-time' }, + flow.response ? (0, _utils2.formatTimeDelta)(1000 * (flow.response.timestamp_end - flow.request.timestamp_start)) : '...' + ); +} + +TimeColumn.headerClass = 'col-time'; +TimeColumn.headerName = 'Time'; + +exports.default = [TLSColumn, IconColumn, PathColumn, MethodColumn, StatusColumn, SizeColumn, TimeColumn]; + +},{"../../flow/utils.js":64,"../../utils.js":65,"classnames":"classnames","react":"react"}],18:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _classnames = require('classnames'); + +var _classnames2 = _interopRequireDefault(_classnames); + +var _FlowColumns = require('./FlowColumns'); + +var _FlowColumns2 = _interopRequireDefault(_FlowColumns); + +var _utils = require('../../utils'); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +FlowRow.propTypes = { + onSelect: _react.PropTypes.func.isRequired, + flow: _react.PropTypes.object.isRequired, + highlighted: _react.PropTypes.bool, + selected: _react.PropTypes.bool +}; + +function FlowRow(_ref) { + var flow = _ref.flow; + var selected = _ref.selected; + var highlighted = _ref.highlighted; + var onSelect = _ref.onSelect; + + var className = (0, _classnames2.default)({ + 'selected': selected, + 'highlighted': highlighted, + 'intercepted': flow.intercepted, + 'has-request': flow.request, + 'has-response': flow.response + }); + + return _react2.default.createElement( + 'tr', + { className: className, onClick: function onClick() { + return onSelect(flow.id); + } }, + _FlowColumns2.default.map(function (Column) { + return _react2.default.createElement(Column, { key: Column.name, flow: flow }); + }) + ); +} + +exports.default = (0, _utils.pure)(FlowRow); + +},{"../../utils":65,"./FlowColumns":17,"classnames":"classnames","react":"react"}],19:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactRedux = require('react-redux'); + +var _classnames = require('classnames'); + +var _classnames2 = _interopRequireDefault(_classnames); + +var _FlowColumns = require('./FlowColumns'); + +var _FlowColumns2 = _interopRequireDefault(_FlowColumns); + +var _flowView = require('../../ducks/flowView'); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +FlowTableHead.propTypes = { + updateSort: _react.PropTypes.func.isRequired, + sortDesc: _react2.default.PropTypes.bool.isRequired, + sortColumn: _react2.default.PropTypes.string +}; + +function FlowTableHead(_ref) { + var sortColumn = _ref.sortColumn; + var sortDesc = _ref.sortDesc; + var updateSort = _ref.updateSort; + + var sortType = sortDesc ? 'sort-desc' : 'sort-asc'; + + return _react2.default.createElement( + 'tr', + null, + _FlowColumns2.default.map(function (Column) { + return _react2.default.createElement( + 'th', + { className: (0, _classnames2.default)(Column.headerClass, sortColumn === Column.name && sortType), + key: Column.name, + onClick: function onClick() { + return updateSort(Column.name, Column.name !== sortColumn ? false : !sortDesc); + } }, + Column.headerName + ); + }) + ); +} + +exports.default = (0, _reactRedux.connect)(function (state) { + return { + sortDesc: state.flowView.sort.desc, + sortColumn: state.flowView.sort.column + }; +}, { + updateSort: _flowView.updateSort +})(FlowTableHead); + +},{"../../ducks/flowView":51,"./FlowColumns":17,"classnames":"classnames","react":"react","react-redux":"react-redux"}],20:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactRedux = require('react-redux'); + +var _lodash = require('lodash'); + +var _lodash2 = _interopRequireDefault(_lodash); + +var _Nav = require('./FlowView/Nav'); + +var _Nav2 = _interopRequireDefault(_Nav); + +var _Messages = require('./FlowView/Messages'); + +var _Details = require('./FlowView/Details'); + +var _Details2 = _interopRequireDefault(_Details); + +var _Prompt = require('./Prompt'); + +var _Prompt2 = _interopRequireDefault(_Prompt); + +var _flow = require('../ducks/ui/flow'); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; } + +function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; } + +var FlowView = function (_Component) { + _inherits(FlowView, _Component); + + function FlowView(props, context) { + _classCallCheck(this, FlowView); + + var _this = _possibleConstructorReturn(this, Object.getPrototypeOf(FlowView).call(this, props, context)); + + _this.onPromptFinish = _this.onPromptFinish.bind(_this); + return _this; + } + + _createClass(FlowView, [{ + key: 'onPromptFinish', + value: function onPromptFinish(edit) { + this.props.setPrompt(false); + if (edit && this.tabComponent) { + this.tabComponent.edit(edit); + } + } + }, { + key: 'getPromptOptions', + value: function getPromptOptions() { + switch (this.props.tab) { + + case 'request': + return ['method', 'url', { text: 'http version', key: 'v' }, 'header']; + break; + + case 'response': + return [{ text: 'http version', key: 'v' }, 'code', 'message', 'header']; + break; + + case 'details': + return; + + default: + throw 'Unknown tab for edit: ' + this.props.tab; + } + } + }, { + key: 'render', + value: function render() { + var _this2 = this; + + var _props = this.props; + var flow = _props.flow; + var active = _props.tab; + var updateFlow = _props.updateFlow; + + var tabs = ['request', 'response', 'error'].filter(function (k) { + return flow[k]; + }).concat(['details']); + + if (tabs.indexOf(active) < 0) { + if (active === 'response' && flow.error) { + active = 'error'; + } else if (active === 'error' && flow.response) { + active = 'response'; + } else { + active = tabs[0]; + } + } + + var Tab = FlowView.allTabs[_lodash2.default.capitalize(active)]; + + return _react2.default.createElement( + 'div', + { className: 'flow-detail' }, + _react2.default.createElement(_Nav2.default, { + flow: flow, + tabs: tabs, + active: active, + onSelectTab: this.props.selectTab + }), + _react2.default.createElement(Tab, { ref: function ref(tab) { + return _this2.tabComponent = tab; + }, flow: flow, updateFlow: updateFlow }), + this.props.promptOpen && _react2.default.createElement(_Prompt2.default, { options: this.getPromptOptions(), done: this.onPromptFinish }) + ); + } + }]); + + return FlowView; +}(_react.Component); + +FlowView.allTabs = { Request: _Messages.Request, Response: _Messages.Response, Error: _Messages.ErrorView, Details: _Details2.default }; +exports.default = FlowView; +exports.default = (0, _reactRedux.connect)(function (state) { + return { + promptOpen: state.ui.promptOpen, + tab: state.ui.flow.tab + }; +}, { + selectTab: _flow.selectTab +})(FlowView); + +},{"../ducks/ui/flow":56,"./FlowView/Details":21,"./FlowView/Messages":23,"./FlowView/Nav":24,"./Prompt":36,"lodash":"lodash","react":"react","react-redux":"react-redux"}],21:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +exports.TimeStamp = TimeStamp; +exports.ConnectionInfo = ConnectionInfo; +exports.CertificateInfo = CertificateInfo; +exports.Timing = Timing; +exports.default = Details; + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _lodash = require('lodash'); + +var _lodash2 = _interopRequireDefault(_lodash); + +var _utils = require('../../utils.js'); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function TimeStamp(_ref) { + var t = _ref.t; + var deltaTo = _ref.deltaTo; + var title = _ref.title; + + return t ? _react2.default.createElement( + 'tr', + null, + _react2.default.createElement( + 'td', + null, + title, + ':' + ), + _react2.default.createElement( + 'td', + null, + (0, _utils.formatTimeStamp)(t), + deltaTo && _react2.default.createElement( + 'span', + { className: 'text-muted' }, + '(', + (0, _utils.formatTimeDelta)(1000 * (t - deltaTo)), + ')' + ) + ) + ) : _react2.default.createElement('tr', null); +} + +function ConnectionInfo(_ref2) { + var conn = _ref2.conn; + + return _react2.default.createElement( + 'table', + { className: 'connection-table' }, + _react2.default.createElement( + 'tbody', + null, + _react2.default.createElement( + 'tr', + { key: 'address' }, + _react2.default.createElement( + 'td', + null, + 'Address:' + ), + _react2.default.createElement( + 'td', + null, + conn.address.address.join(':') + ) + ), + conn.sni && _react2.default.createElement( + 'tr', + { key: 'sni' }, + _react2.default.createElement( + 'td', + null, + _react2.default.createElement( + 'abbr', + { title: 'TLS Server Name Indication' }, + 'TLS SNI:' + ) + ), + _react2.default.createElement( + 'td', + null, + conn.sni + ) + ) + ) + ); +} + +function CertificateInfo(_ref3) { + var flow = _ref3.flow; + + // @todo We should fetch human-readable certificate representation from the server + return _react2.default.createElement( + 'div', + null, + flow.client_conn.cert && [_react2.default.createElement( + 'h4', + { key: 'name' }, + 'Client Certificate' + ), _react2.default.createElement( + 'pre', + { key: 'value', style: { maxHeight: 100 } }, + flow.client_conn.cert + )], + flow.server_conn.cert && [_react2.default.createElement( + 'h4', + { key: 'name' }, + 'Server Certificate' + ), _react2.default.createElement( + 'pre', + { key: 'value', style: { maxHeight: 100 } }, + flow.server_conn.cert + )] + ); +} + +function Timing(_ref4) { + var flow = _ref4.flow; + var sc = flow.server_conn; + var cc = flow.client_conn; + var req = flow.request; + var res = flow.response; + + + var timestamps = [{ + title: "Server conn. initiated", + t: sc.timestamp_start, + deltaTo: req.timestamp_start + }, { + title: "Server conn. TCP handshake", + t: sc.timestamp_tcp_setup, + deltaTo: req.timestamp_start + }, { + title: "Server conn. SSL handshake", + t: sc.timestamp_ssl_setup, + deltaTo: req.timestamp_start + }, { + title: "Client conn. established", + t: cc.timestamp_start, + deltaTo: req.timestamp_start + }, { + title: "Client conn. SSL handshake", + t: cc.timestamp_ssl_setup, + deltaTo: req.timestamp_start + }, { + title: "First request byte", + t: req.timestamp_start + }, { + title: "Request complete", + t: req.timestamp_end, + deltaTo: req.timestamp_start + }, res && { + title: "First response byte", + t: res.timestamp_start, + deltaTo: req.timestamp_start + }, res && { + title: "Response complete", + t: res.timestamp_end, + deltaTo: req.timestamp_start + }]; + + return _react2.default.createElement( + 'div', + null, + _react2.default.createElement( + 'h4', + null, + 'Timing' + ), + _react2.default.createElement( + 'table', + { className: 'timing-table' }, + _react2.default.createElement( + 'tbody', + null, + timestamps.filter(function (v) { + return v; + }).sort(function (a, b) { + return a.t - b.t; + }).map(function (item) { + return _react2.default.createElement(TimeStamp, _extends({ key: item.title }, item)); + }) + ) + ) + ); +} + +function Details(_ref5) { + var flow = _ref5.flow; + + return _react2.default.createElement( + 'section', + { className: 'detail' }, + _react2.default.createElement( + 'h4', + null, + 'Client Connection' + ), + _react2.default.createElement(ConnectionInfo, { conn: flow.client_conn }), + _react2.default.createElement( + 'h4', + null, + 'Server Connection' + ), + _react2.default.createElement(ConnectionInfo, { conn: flow.server_conn }), + _react2.default.createElement(CertificateInfo, { flow: flow }), + _react2.default.createElement(Timing, { flow: flow }) + ); +} + +},{"../../utils.js":65,"lodash":"lodash","react":"react"}],22:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactDom = require('react-dom'); + +var _reactDom2 = _interopRequireDefault(_reactDom); + +var _ValueEditor = require('../ValueEditor/ValueEditor'); + +var _ValueEditor2 = _interopRequireDefault(_ValueEditor); + +var _utils = require('../../utils'); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _objectWithoutProperties(obj, keys) { var target = {}; for (var i in obj) { if (keys.indexOf(i) >= 0) continue; if (!Object.prototype.hasOwnProperty.call(obj, i)) continue; target[i] = obj[i]; } return target; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; } + +function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; } + +var HeaderEditor = function (_Component) { + _inherits(HeaderEditor, _Component); + + function HeaderEditor(props) { + _classCallCheck(this, HeaderEditor); + + var _this = _possibleConstructorReturn(this, Object.getPrototypeOf(HeaderEditor).call(this, props)); + + _this.onKeyDown = _this.onKeyDown.bind(_this); + return _this; + } + + _createClass(HeaderEditor, [{ + key: 'render', + value: function render() { + var _props = this.props; + var onTab = _props.onTab; + + var props = _objectWithoutProperties(_props, ['onTab']); + + return _react2.default.createElement(_ValueEditor2.default, _extends({}, props, { + onKeyDown: this.onKeyDown + })); + } + }, { + key: 'focus', + value: function focus() { + _reactDom2.default.findDOMNode(this).focus(); + } + }, { + key: 'onKeyDown', + value: function onKeyDown(e) { + switch (e.keyCode) { + case _utils.Key.BACKSPACE: + var s = window.getSelection().getRangeAt(0); + if (s.startOffset === 0 && s.endOffset === 0) { + this.props.onRemove(e); + } + break; + case _utils.Key.ENTER: + case _utils.Key.TAB: + if (!e.shiftKey) { + this.props.onTab(e); + } + break; + } + } + }]); + + return HeaderEditor; +}(_react.Component); + +var Headers = function (_Component2) { + _inherits(Headers, _Component2); + + function Headers() { + _classCallCheck(this, Headers); + + return _possibleConstructorReturn(this, Object.getPrototypeOf(Headers).apply(this, arguments)); + } + + _createClass(Headers, [{ + key: 'onChange', + value: function onChange(row, col, val) { + var nextHeaders = _.cloneDeep(this.props.message.headers); + + nextHeaders[row][col] = val; + + if (!nextHeaders[row][0] && !nextHeaders[row][1]) { + // do not delete last row + if (nextHeaders.length === 1) { + nextHeaders[0][0] = 'Name'; + nextHeaders[0][1] = 'Value'; + } else { + nextHeaders.splice(row, 1); + // manually move selection target if this has been the last row. + if (row === nextHeaders.length) { + this._nextSel = row - 1 + '-value'; + } + } + } + + this.props.onChange(nextHeaders); + } + }, { + key: 'edit', + value: function edit() { + this.refs['0-key'].focus(); + } + }, { + key: 'onTab', + value: function onTab(row, col, e) { + var headers = this.props.message.headers; + + if (col === 0) { + this._nextSel = row + '-value'; + return; + } + if (row !== headers.length - 1) { + this._nextSel = row + 1 + '-key'; + return; + } + + e.preventDefault(); + + var nextHeaders = _.cloneDeep(this.props.message.headers); + nextHeaders.push(['Name', 'Value']); + this.props.onChange(nextHeaders); + this._nextSel = row + 1 + '-key'; + } + }, { + key: 'componentDidUpdate', + value: function componentDidUpdate() { + if (this._nextSel && this.refs[this._nextSel]) { + this.refs[this._nextSel].focus(); + this._nextSel = undefined; + } + } + }, { + key: 'onRemove', + value: function onRemove(row, col, e) { + if (col === 1) { + e.preventDefault(); + this.refs[row + '-key'].focus(); + } else if (row > 0) { + e.preventDefault(); + this.refs[row - 1 + '-value'].focus(); + } + } + }, { + key: 'render', + value: function render() { + var _this3 = this; + + var _props2 = this.props; + var message = _props2.message; + var readonly = _props2.readonly; + + + return _react2.default.createElement( + 'table', + { className: 'header-table' }, + _react2.default.createElement( + 'tbody', + null, + message.headers.map(function (header, i) { + return _react2.default.createElement( + 'tr', + { key: i }, + _react2.default.createElement( + 'td', + { className: 'header-name' }, + _react2.default.createElement(HeaderEditor, { + ref: i + '-key', + content: header[0], + readonly: readonly, + onDone: function onDone(val) { + return _this3.onChange(i, 0, val); + }, + onRemove: function onRemove(event) { + return _this3.onRemove(i, 0, event); + }, + onTab: function onTab(event) { + return _this3.onTab(i, 0, event); + } + }), + _react2.default.createElement( + 'span', + { className: 'header-colon' }, + ':' + ) + ), + _react2.default.createElement( + 'td', + { className: 'header-value' }, + _react2.default.createElement(HeaderEditor, { + ref: i + '-value', + content: header[1], + readonly: readonly, + onDone: function onDone(val) { + return _this3.onChange(i, 1, val); + }, + onRemove: function onRemove(event) { + return _this3.onRemove(i, 1, event); + }, + onTab: function onTab(event) { + return _this3.onTab(i, 1, event); + } + }) + ) + ); + }) + ) + ); + } + }]); + + return Headers; +}(_react.Component); + +Headers.propTypes = { + onChange: _react.PropTypes.func.isRequired, + message: _react.PropTypes.object.isRequired +}; +exports.default = Headers; + +},{"../../utils":65,"../ValueEditor/ValueEditor":39,"react":"react","react-dom":"react-dom"}],23:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.Response = exports.Request = undefined; + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +exports.ErrorView = ErrorView; + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactRedux = require('react-redux'); + +var _utils = require('../../flow/utils.js'); + +var _utils2 = require('../../utils.js'); + +var _ContentView = require('../ContentView'); + +var _ContentView2 = _interopRequireDefault(_ContentView); + +var _ContentViewOptions = require('../ContentView/ContentViewOptions'); + +var _ContentViewOptions2 = _interopRequireDefault(_ContentViewOptions); + +var _ValidateEditor = require('../ValueEditor/ValidateEditor'); + +var _ValidateEditor2 = _interopRequireDefault(_ValidateEditor); + +var _ValueEditor = require('../ValueEditor/ValueEditor'); + +var _ValueEditor2 = _interopRequireDefault(_ValueEditor); + +var _Headers = require('./Headers'); + +var _Headers2 = _interopRequireDefault(_Headers); + +var _flow = require('../../ducks/ui/flow'); + +var _flows = require('../../ducks/flows'); + +var FlowActions = _interopRequireWildcard(_flows); + +var _ToggleEdit = require('./ToggleEdit'); + +var _ToggleEdit2 = _interopRequireDefault(_ToggleEdit); + +function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; } + +function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; } + +function RequestLine(_ref) { + var flow = _ref.flow; + var readonly = _ref.readonly; + var updateFlow = _ref.updateFlow; + + return _react2.default.createElement( + 'div', + { className: 'first-line request-line' }, + _react2.default.createElement( + 'div', + null, + _react2.default.createElement(_ValueEditor2.default, { + content: flow.request.method, + readonly: readonly, + onDone: function onDone(method) { + return updateFlow({ request: { method: method } }); + } + }), + ' ', + _react2.default.createElement(_ValidateEditor2.default, { + content: _utils.RequestUtils.pretty_url(flow.request), + readonly: readonly, + onDone: function onDone(url) { + return updateFlow({ request: _extends({ path: '' }, (0, _utils.parseUrl)(url)) }); + }, + isValid: function isValid(url) { + return !!(0, _utils.parseUrl)(url).host; + } + }), + ' ', + _react2.default.createElement(_ValidateEditor2.default, { + content: flow.request.http_version, + readonly: readonly, + onDone: function onDone(http_version) { + return updateFlow({ request: { http_version: http_version } }); + }, + isValid: _utils.isValidHttpVersion + }) + ) + ); +} + +function ResponseLine(_ref2) { + var flow = _ref2.flow; + var readonly = _ref2.readonly; + var updateFlow = _ref2.updateFlow; + + return _react2.default.createElement( + 'div', + { className: 'first-line response-line' }, + _react2.default.createElement(_ValidateEditor2.default, { + content: flow.response.http_version, + readonly: readonly, + onDone: function onDone(nextVer) { + return updateFlow({ response: { http_version: nextVer } }); + }, + isValid: _utils.isValidHttpVersion + }), + ' ', + _react2.default.createElement(_ValidateEditor2.default, { + content: flow.response.status_code + '', + readonly: readonly, + onDone: function onDone(code) { + return updateFlow({ response: { code: parseInt(code) } }); + }, + isValid: function isValid(code) { + return (/^\d+$/.test(code) + ); + } + }), + ' ', + _react2.default.createElement(_ValueEditor2.default, { + content: flow.response.reason, + readonly: readonly, + onDone: function onDone(msg) { + return updateFlow({ response: { msg: msg } }); + } + }) + ); +} + +var Message = (0, _reactRedux.connect)(function (state) { + return { + flow: state.ui.flow.modifiedFlow || state.flows.byId[state.flows.selected[0]], + isEdit: !!state.ui.flow.modifiedFlow + }; +}, { + updateFlow: _flow.updateEdit, + uploadContent: FlowActions.uploadContent +}); + +var Request = exports.Request = function (_Component) { + _inherits(Request, _Component); + + function Request() { + _classCallCheck(this, Request); + + return _possibleConstructorReturn(this, Object.getPrototypeOf(Request).apply(this, arguments)); + } + + _createClass(Request, [{ + key: 'render', + value: function render() { + var _props = this.props; + var flow = _props.flow; + var isEdit = _props.isEdit; + var updateFlow = _props.updateFlow; + var _uploadContent = _props.uploadContent; + + var noContent = !isEdit && (flow.request.contentLength == 0 || flow.request.contentLength == null); + return _react2.default.createElement( + 'section', + { className: 'request' }, + _react2.default.createElement( + 'article', + null, + _react2.default.createElement(_ToggleEdit2.default, null), + _react2.default.createElement(RequestLine, { + flow: flow, + readonly: !isEdit, + updateFlow: updateFlow }), + _react2.default.createElement(_Headers2.default, { + message: flow.request, + readonly: !isEdit, + onChange: function onChange(headers) { + return updateFlow({ request: { headers: headers } }); + } + }), + _react2.default.createElement('hr', null), + _react2.default.createElement(_ContentView2.default, { + readonly: !isEdit, + flow: flow, + onContentChange: function onContentChange(content) { + return updateFlow({ request: { content: content } }); + }, + message: flow.request }) + ), + !noContent && _react2.default.createElement( + 'footer', + null, + _react2.default.createElement(_ContentViewOptions2.default, { + flow: flow, + readonly: !isEdit, + message: flow.request, + uploadContent: function uploadContent(content) { + return _uploadContent(flow, content, "request"); + } }) + ) + ); + } + }, { + key: 'edit', + value: function edit(k) { + throw "unimplemented"; + /* + switch (k) { + case 'm': + this.refs.requestLine.refs.method.focus() + break + case 'u': + this.refs.requestLine.refs.url.focus() + break + case 'v': + this.refs.requestLine.refs.httpVersion.focus() + break + case 'h': + this.refs.headers.edit() + break + default: + throw new Error(`Unimplemented: ${k}`) + } + */ + } + }]); + + return Request; +}(_react.Component); + +exports.Request = Request = Message(Request); + +var Response = exports.Response = function (_Component2) { + _inherits(Response, _Component2); + + function Response() { + _classCallCheck(this, Response); + + return _possibleConstructorReturn(this, Object.getPrototypeOf(Response).apply(this, arguments)); + } + + _createClass(Response, [{ + key: 'render', + value: function render() { + var _props2 = this.props; + var flow = _props2.flow; + var isEdit = _props2.isEdit; + var updateFlow = _props2.updateFlow; + var _uploadContent2 = _props2.uploadContent; + + var noContent = !isEdit && (flow.response.contentLength == 0 || flow.response.contentLength == null); + + return _react2.default.createElement( + 'section', + { className: 'response' }, + _react2.default.createElement( + 'article', + null, + _react2.default.createElement(_ToggleEdit2.default, null), + _react2.default.createElement(ResponseLine, { + flow: flow, + readonly: !isEdit, + updateFlow: updateFlow }), + _react2.default.createElement(_Headers2.default, { + message: flow.response, + readonly: !isEdit, + onChange: function onChange(headers) { + return updateFlow({ response: { headers: headers } }); + } + }), + _react2.default.createElement('hr', null), + _react2.default.createElement(_ContentView2.default, { + readonly: !isEdit, + flow: flow, + onContentChange: function onContentChange(content) { + return updateFlow({ response: { content: content } }); + }, + message: flow.response + }) + ), + !noContent && _react2.default.createElement( + 'footer', + null, + _react2.default.createElement(_ContentViewOptions2.default, { + flow: flow, + message: flow.response, + uploadContent: function uploadContent(content) { + return _uploadContent2(flow, content, "response"); + }, + readonly: !isEdit }) + ) + ); + } + }, { + key: 'edit', + value: function edit(k) { + throw "unimplemented"; + /* + switch (k) { + case 'c': + this.refs.responseLine.refs.status_code.focus() + break + case 'm': + this.refs.responseLine.refs.msg.focus() + break + case 'v': + this.refs.responseLine.refs.httpVersion.focus() + break + case 'h': + this.refs.headers.edit() + break + default: + throw new Error(`'Unimplemented: ${k}`) + } + */ + } + }]); + + return Response; +}(_react.Component); + +exports.Response = Response = Message(Response); + +ErrorView.propTypes = { + flow: _react.PropTypes.object.isRequired +}; + +function ErrorView(_ref3) { + var flow = _ref3.flow; + + return _react2.default.createElement( + 'section', + { className: 'error' }, + _react2.default.createElement( + 'div', + { className: 'alert alert-warning' }, + flow.error.msg, + _react2.default.createElement( + 'div', + null, + _react2.default.createElement( + 'small', + null, + (0, _utils2.formatTimeStamp)(flow.error.timestamp) + ) + ) + ) + ); +} + +},{"../../ducks/flows":52,"../../ducks/ui/flow":56,"../../flow/utils.js":64,"../../utils.js":65,"../ContentView":4,"../ContentView/ContentViewOptions":7,"../ValueEditor/ValidateEditor":38,"../ValueEditor/ValueEditor":39,"./Headers":22,"./ToggleEdit":25,"react":"react","react-redux":"react-redux"}],24:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.default = Nav; + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactRedux = require('react-redux'); + +var _classnames = require('classnames'); + +var _classnames2 = _interopRequireDefault(_classnames); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +NavAction.propTypes = { + icon: _react.PropTypes.string.isRequired, + title: _react.PropTypes.string.isRequired, + onClick: _react.PropTypes.func.isRequired +}; + +function NavAction(_ref) { + var icon = _ref.icon; + var title = _ref.title; + var _onClick = _ref.onClick; + + return _react2.default.createElement( + 'a', + { title: title, + href: '#', + className: 'nav-action', + onClick: function onClick(event) { + event.preventDefault(); + _onClick(event); + } }, + _react2.default.createElement('i', { className: 'fa fa-fw ' + icon }) + ); +} + +Nav.propTypes = { + active: _react.PropTypes.string.isRequired, + tabs: _react.PropTypes.array.isRequired, + onSelectTab: _react.PropTypes.func.isRequired +}; + +function Nav(_ref2) { + var active = _ref2.active; + var tabs = _ref2.tabs; + var onSelectTab = _ref2.onSelectTab; + + return _react2.default.createElement( + 'nav', + { className: 'nav-tabs nav-tabs-sm' }, + tabs.map(function (tab) { + return _react2.default.createElement( + 'a', + { key: tab, + href: '#', + className: (0, _classnames2.default)({ active: active === tab }), + onClick: function onClick(event) { + event.preventDefault(); + onSelectTab(tab); + } }, + _.capitalize(tab) + ); + }) + ); +} + +},{"classnames":"classnames","react":"react","react-redux":"react-redux"}],25:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactRedux = require('react-redux'); + +var _flow = require('../../ducks/ui/flow'); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +ToggleEdit.propTypes = { + isEdit: _react.PropTypes.bool.isRequired, + flow: _react.PropTypes.object.isRequired, + startEdit: _react.PropTypes.func.isRequired, + stopEdit: _react.PropTypes.func.isRequired +}; + +function ToggleEdit(_ref) { + var isEdit = _ref.isEdit; + var startEdit = _ref.startEdit; + var stopEdit = _ref.stopEdit; + var flow = _ref.flow; + var modifiedFlow = _ref.modifiedFlow; + + return _react2.default.createElement( + 'div', + { className: 'edit-flow-container' }, + isEdit ? _react2.default.createElement( + 'a', + { className: 'edit-flow', onClick: function onClick() { + return stopEdit(flow, modifiedFlow); + } }, + _react2.default.createElement('i', { className: 'fa fa-check' }) + ) : _react2.default.createElement( + 'a', + { className: 'edit-flow', onClick: function onClick() { + return startEdit(flow); + } }, + _react2.default.createElement('i', { className: 'fa fa-pencil' }) + ) + ); +} + +exports.default = (0, _reactRedux.connect)(function (state) { + return { + isEdit: !!state.ui.flow.modifiedFlow, + modifiedFlow: state.ui.flow.modifiedFlow || state.flows.byId[state.flows.selected[0]], + flow: state.flows.byId[state.flows.selected[0]] + }; +}, { + startEdit: _flow.startEdit, + stopEdit: _flow.stopEdit +})(ToggleEdit); + +},{"../../ducks/ui/flow":56,"react":"react","react-redux":"react-redux"}],26:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactRedux = require('react-redux'); + +var _utils = require('../utils.js'); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +Footer.propTypes = { + settings: _react2.default.PropTypes.object.isRequired +}; + +function Footer(_ref) { + var settings = _ref.settings; + var mode = settings.mode; + var intercept = settings.intercept; + var showhost = settings.showhost; + var no_upstream_cert = settings.no_upstream_cert; + var rawtcp = settings.rawtcp; + var http2 = settings.http2; + var anticache = settings.anticache; + var anticomp = settings.anticomp; + var stickyauth = settings.stickyauth; + var stickycookie = settings.stickycookie; + var stream = settings.stream; + + return _react2.default.createElement( + 'footer', + null, + mode && mode != "regular" && _react2.default.createElement( + 'span', + { className: 'label label-success' }, + mode, + ' mode' + ), + intercept && _react2.default.createElement( + 'span', + { className: 'label label-success' }, + 'Intercept: ', + intercept + ), + showhost && _react2.default.createElement( + 'span', + { className: 'label label-success' }, + 'showhost' + ), + no_upstream_cert && _react2.default.createElement( + 'span', + { className: 'label label-success' }, + 'no-upstream-cert' + ), + rawtcp && _react2.default.createElement( + 'span', + { className: 'label label-success' }, + 'raw-tcp' + ), + !http2 && _react2.default.createElement( + 'span', + { className: 'label label-success' }, + 'no-http2' + ), + anticache && _react2.default.createElement( + 'span', + { className: 'label label-success' }, + 'anticache' + ), + anticomp && _react2.default.createElement( + 'span', + { className: 'label label-success' }, + 'anticomp' + ), + stickyauth && _react2.default.createElement( + 'span', + { className: 'label label-success' }, + 'stickyauth: ', + stickyauth + ), + stickycookie && _react2.default.createElement( + 'span', + { className: 'label label-success' }, + 'stickycookie: ', + stickycookie + ), + stream && _react2.default.createElement( + 'span', + { className: 'label label-success' }, + 'stream: ', + (0, _utils.formatSize)(stream) + ) + ); +} + +exports.default = (0, _reactRedux.connect)(function (state) { + return { + settings: state.settings + }; +})(Footer); + +},{"../utils.js":65,"react":"react","react-redux":"react-redux"}],27:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactRedux = require('react-redux'); + +var _classnames = require('classnames'); + +var _classnames2 = _interopRequireDefault(_classnames); + +var _MainMenu = require('./Header/MainMenu'); + +var _MainMenu2 = _interopRequireDefault(_MainMenu); + +var _ViewMenu = require('./Header/ViewMenu'); + +var _ViewMenu2 = _interopRequireDefault(_ViewMenu); + +var _OptionMenu = require('./Header/OptionMenu'); + +var _OptionMenu2 = _interopRequireDefault(_OptionMenu); + +var _FileMenu = require('./Header/FileMenu'); + +var _FileMenu2 = _interopRequireDefault(_FileMenu); + +var _FlowMenu = require('./Header/FlowMenu'); + +var _FlowMenu2 = _interopRequireDefault(_FlowMenu); + +var _header = require('../ducks/ui/header'); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _toConsumableArray(arr) { if (Array.isArray(arr)) { for (var i = 0, arr2 = Array(arr.length); i < arr.length; i++) { arr2[i] = arr[i]; } return arr2; } else { return Array.from(arr); } } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; } + +function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; } + +var Header = function (_Component) { + _inherits(Header, _Component); + + function Header() { + _classCallCheck(this, Header); + + return _possibleConstructorReturn(this, Object.getPrototypeOf(Header).apply(this, arguments)); + } + + _createClass(Header, [{ + key: 'handleClick', + value: function handleClick(active, e) { + e.preventDefault(); + this.props.setActiveMenu(active.title); + } + }, { + key: 'render', + value: function render() { + var _this2 = this; + + var _props = this.props; + var selectedFlowId = _props.selectedFlowId; + var activeMenu = _props.activeMenu; + + + var entries = [].concat(_toConsumableArray(Header.entries)); + if (selectedFlowId) entries.push(_FlowMenu2.default); + + var Active = _.find(entries, function (e) { + return e.title == activeMenu; + }); + + return _react2.default.createElement( + 'header', + null, + _react2.default.createElement( + 'nav', + { className: 'nav-tabs nav-tabs-lg' }, + _react2.default.createElement(_FileMenu2.default, null), + entries.map(function (Entry) { + return _react2.default.createElement( + 'a', + { key: Entry.title, + href: '#', + className: (0, _classnames2.default)({ active: Entry === Active }), + onClick: function onClick(e) { + return _this2.handleClick(Entry, e); + } }, + Entry.title + ); + }) + ), + _react2.default.createElement( + 'div', + { className: 'menu' }, + _react2.default.createElement(Active, null) + ) + ); + } + }]); + + return Header; +}(_react.Component); + +Header.entries = [_MainMenu2.default, _ViewMenu2.default, _OptionMenu2.default]; +exports.default = (0, _reactRedux.connect)(function (state) { + return { + selectedFlowId: state.flows.selected[0], + activeMenu: state.ui.header.activeMenu + }; +}, { + setActiveMenu: _header.setActiveMenu +})(Header); + +},{"../ducks/ui/header":57,"./Header/FileMenu":28,"./Header/FlowMenu":31,"./Header/MainMenu":32,"./Header/OptionMenu":33,"./Header/ViewMenu":34,"classnames":"classnames","react":"react","react-redux":"react-redux"}],28:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactRedux = require('react-redux'); + +var _FileChooser = require('../common/FileChooser'); + +var _FileChooser2 = _interopRequireDefault(_FileChooser); + +var _Dropdown = require('../common/Dropdown'); + +var _Dropdown2 = _interopRequireDefault(_Dropdown); + +var _flows = require('../../ducks/flows'); + +var flowsActions = _interopRequireWildcard(_flows); + +function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +FileMenu.propTypes = { + clearFlows: _react.PropTypes.func.isRequired, + loadFlows: _react.PropTypes.func.isRequired, + saveFlows: _react.PropTypes.func.isRequired +}; + +FileMenu.onNewClick = function (e, clearFlows) { + e.preventDefault(); + if (confirm('Delete all flows?')) clearFlows(); +}; + +function FileMenu(_ref) { + var clearFlows = _ref.clearFlows; + var loadFlows = _ref.loadFlows; + var saveFlows = _ref.saveFlows; + + return _react2.default.createElement( + _Dropdown2.default, + { className: 'pull-left', btnClass: 'special', text: 'mitmproxy' }, + _react2.default.createElement( + 'a', + { href: '#', onClick: function onClick(e) { + return FileMenu.onNewClick(e, clearFlows); + } }, + _react2.default.createElement('i', { className: 'fa fa-fw fa-file' }), + 'New' + ), + _react2.default.createElement(_FileChooser2.default, { + icon: 'fa-folder-open', + text: 'Open...', + onOpenFile: function onOpenFile(file) { + return loadFlows(file); + } + }), + _react2.default.createElement( + 'a', + { href: '#', onClick: function onClick(e) { + e.preventDefault();saveFlows(); + } }, + _react2.default.createElement('i', { className: 'fa fa-fw fa-floppy-o' }), + 'Save...' + ), + _react2.default.createElement(_Dropdown.Divider, null), + _react2.default.createElement( + 'a', + { href: 'http://mitm.it/', target: '_blank' }, + _react2.default.createElement('i', { className: 'fa fa-fw fa-external-link' }), + 'Install Certificates...' + ) + ); +} + +exports.default = (0, _reactRedux.connect)(null, { + clearFlows: flowsActions.clear, + loadFlows: flowsActions.upload, + saveFlows: flowsActions.download +})(FileMenu); + +},{"../../ducks/flows":52,"../common/Dropdown":41,"../common/FileChooser":42,"react":"react","react-redux":"react-redux"}],29:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _utils = require('../../utils'); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; } + +function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; } + +var FilterDocs = function (_Component) { + _inherits(FilterDocs, _Component); + + // @todo move to redux + + function FilterDocs(props, context) { + _classCallCheck(this, FilterDocs); + + var _this = _possibleConstructorReturn(this, Object.getPrototypeOf(FilterDocs).call(this, props, context)); + + _this.state = { doc: FilterDocs.doc }; + return _this; + } + + _createClass(FilterDocs, [{ + key: 'componentWillMount', + value: function componentWillMount() { + var _this2 = this; + + if (!FilterDocs.xhr) { + FilterDocs.xhr = (0, _utils.fetchApi)('/filter-help').then(function (response) { + return response.json(); + }); + FilterDocs.xhr.catch(function () { + FilterDocs.xhr = null; + }); + } + if (!this.state.doc) { + FilterDocs.xhr.then(function (doc) { + FilterDocs.doc = doc; + _this2.setState({ doc: doc }); + }); + } + } + }, { + key: 'render', + value: function render() { + var doc = this.state.doc; + + return !doc ? _react2.default.createElement('i', { className: 'fa fa-spinner fa-spin' }) : _react2.default.createElement( + 'table', + { className: 'table table-condensed' }, + _react2.default.createElement( + 'tbody', + null, + doc.commands.map(function (cmd) { + return _react2.default.createElement( + 'tr', + { key: cmd[1] }, + _react2.default.createElement( + 'td', + null, + cmd[0].replace(' ', ' ') + ), + _react2.default.createElement( + 'td', + null, + cmd[1] + ) + ); + }), + _react2.default.createElement( + 'tr', + { key: 'docs-link' }, + _react2.default.createElement( + 'td', + { colSpan: '2' }, + _react2.default.createElement( + 'a', + { href: 'http://docs.mitmproxy.org/en/stable/features/filters.html', + target: '_blank' }, + _react2.default.createElement('i', { className: 'fa fa-external-link' }), + '  mitmproxy docs' + ) + ) + ) + ) + ); + } + }]); + + return FilterDocs; +}(_react.Component); + +FilterDocs.xhr = null; +FilterDocs.doc = null; +exports.default = FilterDocs; + +},{"../../utils":65,"react":"react"}],30:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactDom = require('react-dom'); + +var _reactDom2 = _interopRequireDefault(_reactDom); + +var _classnames = require('classnames'); + +var _classnames2 = _interopRequireDefault(_classnames); + +var _utils = require('../../utils.js'); + +var _filt = require('../../filt/filt'); + +var _filt2 = _interopRequireDefault(_filt); + +var _FilterDocs = require('./FilterDocs'); + +var _FilterDocs2 = _interopRequireDefault(_FilterDocs); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; } + +function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; } + +var FilterInput = function (_Component) { + _inherits(FilterInput, _Component); + + function FilterInput(props, context) { + _classCallCheck(this, FilterInput); + + // Consider both focus and mouseover for showing/hiding the tooltip, + // because onBlur of the input is triggered before the click on the tooltip + // finalized, hiding the tooltip just as the user clicks on it. + var _this = _possibleConstructorReturn(this, Object.getPrototypeOf(FilterInput).call(this, props, context)); + + _this.state = { value: _this.props.value, focus: false, mousefocus: false }; + + _this.onChange = _this.onChange.bind(_this); + _this.onFocus = _this.onFocus.bind(_this); + _this.onBlur = _this.onBlur.bind(_this); + _this.onKeyDown = _this.onKeyDown.bind(_this); + _this.onMouseEnter = _this.onMouseEnter.bind(_this); + _this.onMouseLeave = _this.onMouseLeave.bind(_this); + return _this; + } + + _createClass(FilterInput, [{ + key: 'componentWillReceiveProps', + value: function componentWillReceiveProps(nextProps) { + this.setState({ value: nextProps.value }); + } + }, { + key: 'isValid', + value: function isValid(filt) { + try { + var str = filt == null ? this.state.value : filt; + if (str) { + _filt2.default.parse(str); + } + return true; + } catch (e) { + return false; + } + } + }, { + key: 'getDesc', + value: function getDesc() { + if (!this.state.value) { + return _react2.default.createElement(_FilterDocs2.default, null); + } + try { + return _filt2.default.parse(this.state.value).desc; + } catch (e) { + return '' + e; + } + } + }, { + key: 'onChange', + value: function onChange(e) { + var value = e.target.value; + this.setState({ value: value }); + + // Only propagate valid filters upwards. + if (this.isValid(value)) { + this.props.onChange(value); + } + } + }, { + key: 'onFocus', + value: function onFocus() { + this.setState({ focus: true }); + } + }, { + key: 'onBlur', + value: function onBlur() { + this.setState({ focus: false }); + } + }, { + key: 'onMouseEnter', + value: function onMouseEnter() { + this.setState({ mousefocus: true }); + } + }, { + key: 'onMouseLeave', + value: function onMouseLeave() { + this.setState({ mousefocus: false }); + } + }, { + key: 'onKeyDown', + value: function onKeyDown(e) { + if (e.keyCode === _utils.Key.ESC || e.keyCode === _utils.Key.ENTER) { + this.blur(); + // If closed using ESC/ENTER, hide the tooltip. + this.setState({ mousefocus: false }); + } + e.stopPropagation(); + } + }, { + key: 'blur', + value: function blur() { + _reactDom2.default.findDOMNode(this.refs.input).blur(); + } + }, { + key: 'select', + value: function select() { + _reactDom2.default.findDOMNode(this.refs.input).select(); + } + }, { + key: 'render', + value: function render() { + var _props = this.props; + var type = _props.type; + var color = _props.color; + var placeholder = _props.placeholder; + var _state = this.state; + var value = _state.value; + var focus = _state.focus; + var mousefocus = _state.mousefocus; + + return _react2.default.createElement( + 'div', + { className: (0, _classnames2.default)('filter-input input-group', { 'has-error': !this.isValid() }) }, + _react2.default.createElement( + 'span', + { className: 'input-group-addon' }, + _react2.default.createElement('i', { className: 'fa fa-fw fa-' + type, style: { color: color } }) + ), + _react2.default.createElement('input', { + type: 'text', + ref: 'input', + placeholder: placeholder, + className: 'form-control', + value: value, + onChange: this.onChange, + onFocus: this.onFocus, + onBlur: this.onBlur, + onKeyDown: this.onKeyDown + }), + (focus || mousefocus) && _react2.default.createElement( + 'div', + { className: 'popover bottom', + onMouseEnter: this.onMouseEnter, + onMouseLeave: this.onMouseLeave }, + _react2.default.createElement('div', { className: 'arrow' }), + _react2.default.createElement( + 'div', + { className: 'popover-content' }, + this.getDesc() + ) + ) + ); + } + }]); + + return FilterInput; +}(_react.Component); + +exports.default = FilterInput; + +},{"../../filt/filt":63,"../../utils.js":65,"./FilterDocs":29,"classnames":"classnames","react":"react","react-dom":"react-dom"}],31:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactRedux = require('react-redux'); + +var _Button = require('../common/Button'); + +var _Button2 = _interopRequireDefault(_Button); + +var _utils = require('../../flow/utils.js'); + +var _flows = require('../../ducks/flows'); + +var flowsActions = _interopRequireWildcard(_flows); + +function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +FlowMenu.title = 'Flow'; + +FlowMenu.propTypes = { + flow: _react.PropTypes.object.isRequired, + acceptFlow: _react.PropTypes.func.isRequired, + replayFlow: _react.PropTypes.func.isRequired, + duplicateFlow: _react.PropTypes.func.isRequired, + removeFlow: _react.PropTypes.func.isRequired, + revertFlow: _react.PropTypes.func.isRequired +}; + +function FlowMenu(_ref) { + var flow = _ref.flow; + var acceptFlow = _ref.acceptFlow; + var replayFlow = _ref.replayFlow; + var duplicateFlow = _ref.duplicateFlow; + var removeFlow = _ref.removeFlow; + var revertFlow = _ref.revertFlow; + + return _react2.default.createElement( + 'div', + null, + _react2.default.createElement( + 'div', + { className: 'menu-row' }, + _react2.default.createElement(_Button2.default, { disabled: !flow || !flow.intercepted, title: '[a]ccept intercepted flow', text: 'Accept', icon: 'fa-play', onClick: function onClick() { + return acceptFlow(flow); + } }), + _react2.default.createElement(_Button2.default, { title: '[r]eplay flow', text: 'Replay', icon: 'fa-repeat', onClick: function onClick() { + return replayFlow(flow); + } }), + _react2.default.createElement(_Button2.default, { title: '[D]uplicate flow', text: 'Duplicate', icon: 'fa-copy', onClick: function onClick() { + return duplicateFlow(flow); + } }), + _react2.default.createElement(_Button2.default, { title: '[d]elete flow', text: 'Delete', icon: 'fa-trash', onClick: function onClick() { + return removeFlow(flow); + } }), + _react2.default.createElement(_Button2.default, { disabled: !flow || !flow.modified, title: 'revert changes to flow [V]', text: 'Revert', icon: 'fa-history', onClick: function onClick() { + return revertFlow(flow); + } }), + _react2.default.createElement(_Button2.default, { title: 'download', text: 'Download', icon: 'fa-download', onClick: function onClick() { + return window.location = _utils.MessageUtils.getContentURL(flow, flow.response); + } }) + ), + _react2.default.createElement('div', { className: 'clearfix' }) + ); +} + +exports.default = (0, _reactRedux.connect)(function (state) { + return { + flow: state.flows.byId[state.flows.selected[0]] + }; +}, { + acceptFlow: flowsActions.accept, + replayFlow: flowsActions.replay, + duplicateFlow: flowsActions.duplicate, + removeFlow: flowsActions.remove, + revertFlow: flowsActions.revert +})(FlowMenu); + +},{"../../ducks/flows":52,"../../flow/utils.js":64,"../common/Button":40,"react":"react","react-redux":"react-redux"}],32:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.default = MainMenu; + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactRedux = require('react-redux'); + +var _FilterInput = require('./FilterInput'); + +var _FilterInput2 = _interopRequireDefault(_FilterInput); + +var _settings = require('../../ducks/settings'); + +var _flowView = require('../../ducks/flowView'); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +MainMenu.title = "Start"; + +function MainMenu() { + return _react2.default.createElement( + 'div', + null, + _react2.default.createElement( + 'div', + { className: 'menu-row' }, + _react2.default.createElement(FlowFilterInput, null), + _react2.default.createElement(HighlightInput, null), + _react2.default.createElement(InterceptInput, null) + ), + _react2.default.createElement('div', { className: 'clearfix' }) + ); +} + +var InterceptInput = (0, _reactRedux.connect)(function (state) { + return { + value: state.settings.intercept || '', + placeholder: 'Intercept', + type: 'pause', + color: 'hsl(208, 56%, 53%)' + }; +}, { onChange: function onChange(intercept) { + return (0, _settings.update)({ intercept: intercept }); + } })(_FilterInput2.default); + +var FlowFilterInput = (0, _reactRedux.connect)(function (state) { + return { + value: state.flowView.filter || '', + placeholder: 'Search', + type: 'search', + color: 'black' + }; +}, { onChange: _flowView.updateFilter })(_FilterInput2.default); + +var HighlightInput = (0, _reactRedux.connect)(function (state) { + return { + value: state.flowView.highlight || '', + placeholder: 'Highlight', + type: 'tag', + color: 'hsl(48, 100%, 50%)' + }; +}, { onChange: _flowView.updateHighlight })(_FilterInput2.default); + +},{"../../ducks/flowView":51,"../../ducks/settings":55,"./FilterInput":30,"react":"react","react-redux":"react-redux"}],33:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactRedux = require('react-redux'); + +var _ToggleButton = require('../common/ToggleButton'); + +var _ToggleButton2 = _interopRequireDefault(_ToggleButton); + +var _ToggleInputButton = require('../common/ToggleInputButton'); + +var _ToggleInputButton2 = _interopRequireDefault(_ToggleInputButton); + +var _settings = require('../../ducks/settings'); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +OptionMenu.title = 'Options'; + +OptionMenu.propTypes = { + settings: _react.PropTypes.object.isRequired, + updateSettings: _react.PropTypes.func.isRequired +}; + +function OptionMenu(_ref) { + var settings = _ref.settings; + var updateSettings = _ref.updateSettings; + + return _react2.default.createElement( + 'div', + null, + _react2.default.createElement( + 'div', + { className: 'menu-row' }, + _react2.default.createElement(_ToggleButton2.default, { text: 'showhost', + checked: settings.showhost, + onToggle: function onToggle() { + return updateSettings({ showhost: !settings.showhost }); + } + }), + _react2.default.createElement(_ToggleButton2.default, { text: 'no_upstream_cert', + checked: settings.no_upstream_cert, + onToggle: function onToggle() { + return updateSettings({ no_upstream_cert: !settings.no_upstream_cert }); + } + }), + _react2.default.createElement(_ToggleButton2.default, { text: 'rawtcp', + checked: settings.rawtcp, + onToggle: function onToggle() { + return updateSettings({ rawtcp: !settings.rawtcp }); + } + }), + _react2.default.createElement(_ToggleButton2.default, { text: 'http2', + checked: settings.http2, + onToggle: function onToggle() { + return updateSettings({ http2: !settings.http2 }); + } + }), + _react2.default.createElement(_ToggleButton2.default, { text: 'anticache', + checked: settings.anticache, + onToggle: function onToggle() { + return updateSettings({ anticache: !settings.anticache }); + } + }), + _react2.default.createElement(_ToggleButton2.default, { text: 'anticomp', + checked: settings.anticomp, + onToggle: function onToggle() { + return updateSettings({ anticomp: !settings.anticomp }); + } + }), + _react2.default.createElement(_ToggleInputButton2.default, { name: 'stickyauth', placeholder: 'Sticky auth filter', + checked: !!settings.stickyauth, + txt: settings.stickyauth, + onToggleChanged: function onToggleChanged(txt) { + return updateSettings({ stickyauth: !settings.stickyauth ? txt : null }); + } + }), + _react2.default.createElement(_ToggleInputButton2.default, { name: 'stickycookie', placeholder: 'Sticky cookie filter', + checked: !!settings.stickycookie, + txt: settings.stickycookie, + onToggleChanged: function onToggleChanged(txt) { + return updateSettings({ stickycookie: !settings.stickycookie ? txt : null }); + } + }), + _react2.default.createElement(_ToggleInputButton2.default, { name: 'stream', placeholder: 'stream...', + checked: !!settings.stream, + txt: settings.stream, + inputType: 'number', + onToggleChanged: function onToggleChanged(txt) { + return updateSettings({ stream: !settings.stream ? txt : null }); + } + }) + ), + _react2.default.createElement('div', { className: 'clearfix' }) + ); +} + +exports.default = (0, _reactRedux.connect)(function (state) { + return { + settings: state.settings + }; +}, { + updateSettings: _settings.update +})(OptionMenu); + +},{"../../ducks/settings":55,"../common/ToggleButton":44,"../common/ToggleInputButton":45,"react":"react","react-redux":"react-redux"}],34:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactRedux = require('react-redux'); + +var _ToggleButton = require('../common/ToggleButton'); + +var _ToggleButton2 = _interopRequireDefault(_ToggleButton); + +var _eventLog = require('../../ducks/eventLog'); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +ViewMenu.title = 'View'; +ViewMenu.route = 'flows'; + +ViewMenu.propTypes = { + eventLogVisible: _react.PropTypes.bool.isRequired, + toggleEventLog: _react.PropTypes.func.isRequired +}; + +function ViewMenu(_ref) { + var eventLogVisible = _ref.eventLogVisible; + var toggleEventLog = _ref.toggleEventLog; + + return _react2.default.createElement( + 'div', + null, + _react2.default.createElement( + 'div', + { className: 'menu-row' }, + _react2.default.createElement(_ToggleButton2.default, { text: 'Show Event Log', checked: eventLogVisible, onToggle: toggleEventLog }) + ), + _react2.default.createElement('div', { className: 'clearfix' }) + ); +} + +exports.default = (0, _reactRedux.connect)(function (state) { + return { + eventLogVisible: state.eventLog.visible + }; +}, { + toggleEventLog: _eventLog.toggleVisibility +})(ViewMenu); + +},{"../../ducks/eventLog":50,"../common/ToggleButton":44,"react":"react","react-redux":"react-redux"}],35:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactRedux = require('react-redux'); + +var _Splitter = require('./common/Splitter'); + +var _Splitter2 = _interopRequireDefault(_Splitter); + +var _FlowTable = require('./FlowTable'); + +var _FlowTable2 = _interopRequireDefault(_FlowTable); + +var _FlowView = require('./FlowView'); + +var _FlowView2 = _interopRequireDefault(_FlowView); + +var _flows = require('../ducks/flows'); + +var flowsActions = _interopRequireWildcard(_flows); + +var _flowView = require('../ducks/flowView'); + +function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; } + +function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; } + +var MainView = function (_Component) { + _inherits(MainView, _Component); + + function MainView() { + _classCallCheck(this, MainView); + + return _possibleConstructorReturn(this, Object.getPrototypeOf(MainView).apply(this, arguments)); + } + + _createClass(MainView, [{ + key: 'render', + value: function render() { + var _this2 = this; + + var _props = this.props; + var flows = _props.flows; + var selectedFlow = _props.selectedFlow; + var highlight = _props.highlight; + + return _react2.default.createElement( + 'div', + { className: 'main-view' }, + _react2.default.createElement(_FlowTable2.default, { + ref: 'flowTable', + flows: flows, + selected: selectedFlow, + highlight: highlight, + onSelect: this.props.selectFlow + }), + selectedFlow && [_react2.default.createElement(_Splitter2.default, { key: 'splitter' }), _react2.default.createElement(_FlowView2.default, { + key: 'flowDetails', + ref: 'flowDetails', + tab: this.props.tab, + updateFlow: function updateFlow(data) { + return _this2.props.updateFlow(selectedFlow, data); + }, + flow: selectedFlow + })] + ); + } + }]); + + return MainView; +}(_react.Component); + +MainView.propTypes = { + highlight: _react.PropTypes.string, + sort: _react.PropTypes.object +}; +exports.default = (0, _reactRedux.connect)(function (state) { + return { + flows: state.flowView.data, + filter: state.flowView.filter, + highlight: state.flowView.highlight, + selectedFlow: state.flows.byId[state.flows.selected[0]], + tab: state.ui.flow.tab + }; +}, { + selectFlow: flowsActions.select, + updateFilter: _flowView.updateFilter, + updateHighlight: _flowView.updateHighlight, + updateFlow: flowsActions.update +})(MainView); + +},{"../ducks/flowView":51,"../ducks/flows":52,"./FlowTable":16,"./FlowView":20,"./common/Splitter":43,"react":"react","react-redux":"react-redux"}],36:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.default = Prompt; + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactDom = require('react-dom'); + +var _reactDom2 = _interopRequireDefault(_reactDom); + +var _lodash = require('lodash'); + +var _lodash2 = _interopRequireDefault(_lodash); + +var _utils = require('../utils.js'); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +Prompt.propTypes = { + options: _react.PropTypes.array.isRequired, + done: _react.PropTypes.func.isRequired, + prompt: _react.PropTypes.string +}; + +function Prompt(_ref) { + var prompt = _ref.prompt; + var done = _ref.done; + var options = _ref.options; + + var opts = []; + + for (var i = 0; i < options.length; i++) { + var opt = options[i]; + if (_lodash2.default.isString(opt)) { + var str = opt; + while (str.length > 0 && keyTaken(str[0])) { + str = str.substr(1); + } + opt = { text: opt, key: str[0] }; + } + if (!opt.text || !opt.key || keyTaken(opt.key)) { + throw 'invalid options'; + } + opts.push(opt); + } + + function keyTaken(k) { + return _lodash2.default.map(opts, 'key').includes(k); + } + + function onKeyDown(event) { + event.stopPropagation(); + event.preventDefault(); + var key = opts.find(function (opt) { + return _utils.Key[opt.key.toUpperCase()] === event.keyCode; + }); + if (!key && event.keyCode !== _utils.Key.ESC && event.keyCode !== _utils.Key.ENTER) { + return; + } + done(key.key || false); + } + + return _react2.default.createElement( + 'div', + { tabIndex: '0', onKeyDown: onKeyDown, className: 'prompt-dialog' }, + _react2.default.createElement( + 'div', + { className: 'prompt-content' }, + prompt || _react2.default.createElement( + 'strong', + null, + 'Select: ' + ), + opts.map(function (opt) { + var idx = opt.text.indexOf(opt.key); + function onClick(event) { + done(opt.key); + event.stopPropagation(); + } + return _react2.default.createElement( + 'span', + { key: opt.key, className: 'option', onClick: onClick }, + idx !== -1 ? opt.text.substring(0, idx) : opt.text + '(', + _react2.default.createElement( + 'strong', + { className: 'text-primary' }, + opt.key + ), + idx !== -1 ? opt.text.substring(idx + 1) : ')' + ); + }) + ) + ); +} + +},{"../utils.js":65,"lodash":"lodash","react":"react","react-dom":"react-dom"}],37:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactRedux = require('react-redux'); + +var _history = require('history'); + +var _app = require('../ducks/app'); + +var _keyboard = require('../ducks/ui/keyboard'); + +var _flowView = require('../ducks/flowView'); + +var _flow = require('../ducks/ui/flow'); + +var _flows = require('../ducks/flows'); + +var _actions = require('../actions'); + +var _MainView = require('./MainView'); + +var _MainView2 = _interopRequireDefault(_MainView); + +var _Header = require('./Header'); + +var _Header2 = _interopRequireDefault(_Header); + +var _EventLog = require('./EventLog'); + +var _EventLog2 = _interopRequireDefault(_EventLog); + +var _Footer = require('./Footer'); + +var _Footer2 = _interopRequireDefault(_Footer); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; } + +function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; } + +var ProxyAppMain = function (_Component) { + _inherits(ProxyAppMain, _Component); + + function ProxyAppMain() { + _classCallCheck(this, ProxyAppMain); + + return _possibleConstructorReturn(this, Object.getPrototypeOf(ProxyAppMain).apply(this, arguments)); + } + + _createClass(ProxyAppMain, [{ + key: 'flushToStore', + value: function flushToStore(location) { + var components = location.pathname.split('/').filter(function (v) { + return v; + }); + var query = location.query || {}; + + if (components.length > 2) { + this.props.selectFlow(components[1]); + this.props.selectTab(components[2]); + } else { + this.props.selectFlow(null); + this.props.selectTab(null); + } + + this.props.updateFilter(query[_actions.Query.SEARCH]); + this.props.updateHighlight(query[_actions.Query.HIGHLIGHT]); + } + }, { + key: 'flushToHistory', + value: function flushToHistory(props) { + var query = _extends({}, query); + + if (props.filter) { + query[_actions.Query.SEARCH] = props.filter; + } + + if (props.highlight) { + query[_actions.Query.HIGHLIGHT] = props.highlight; + } + + if (props.selectedFlowId) { + this.history.push({ pathname: '/flows/' + props.selectedFlowId + '/' + props.tab, query: query }); + } else { + this.history.push({ pathname: '/flows', query: query }); + } + } + }, { + key: 'componentWillMount', + value: function componentWillMount() { + var _this2 = this; + + this.props.appInit(); + this.history = (0, _history.useQueries)(_history.createHashHistory)(); + this.unlisten = this.history.listen(function (location) { + return _this2.flushToStore(location); + }); + window.addEventListener('keydown', this.props.onKeyDown); + } + }, { + key: 'componentWillUnmount', + value: function componentWillUnmount() { + this.props.appDestruct(); + this.unlisten(); + window.removeEventListener('keydown', this.props.onKeyDown); + } + }, { + key: 'componentWillReceiveProps', + value: function componentWillReceiveProps(nextProps) { + this.flushToHistory(nextProps); + } + }, { + key: 'render', + value: function render() { + var _props = this.props; + var showEventLog = _props.showEventLog; + var location = _props.location; + var filter = _props.filter; + var highlight = _props.highlight; + + return _react2.default.createElement( + 'div', + { id: 'container', tabIndex: '0' }, + _react2.default.createElement(_Header2.default, null), + _react2.default.createElement(_MainView2.default, null), + showEventLog && _react2.default.createElement(_EventLog2.default, { key: 'eventlog' }), + _react2.default.createElement(_Footer2.default, null) + ); + } + }]); + + return ProxyAppMain; +}(_react.Component); + +exports.default = (0, _reactRedux.connect)(function (state) { + return { + showEventLog: state.eventLog.visible, + filter: state.flowView.filter, + highlight: state.flowView.highlight, + tab: state.ui.flow.tab, + selectedFlowId: state.flows.selected[0] + }; +}, { + appInit: _app.init, + appDestruct: _app.destruct, + onKeyDown: _keyboard.onKeyDown, + updateFilter: _flowView.updateFilter, + updateHighlight: _flowView.updateHighlight, + selectTab: _flow.selectTab, + selectFlow: _flows.select +})(ProxyAppMain); + +},{"../actions":2,"../ducks/app":49,"../ducks/flowView":51,"../ducks/flows":52,"../ducks/ui/flow":56,"../ducks/ui/keyboard":59,"./EventLog":14,"./Footer":26,"./Header":27,"./MainView":35,"history":"history","react":"react","react-redux":"react-redux"}],38:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _ValueEditor = require('./ValueEditor'); + +var _ValueEditor2 = _interopRequireDefault(_ValueEditor); + +var _classnames = require('classnames'); + +var _classnames2 = _interopRequireDefault(_classnames); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; } + +function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; } + +var ValidateEditor = function (_Component) { + _inherits(ValidateEditor, _Component); + + function ValidateEditor(props) { + _classCallCheck(this, ValidateEditor); + + var _this = _possibleConstructorReturn(this, Object.getPrototypeOf(ValidateEditor).call(this, props)); + + _this.state = { valid: props.isValid(props.content) }; + _this.onInput = _this.onInput.bind(_this); + _this.onDone = _this.onDone.bind(_this); + return _this; + } + + _createClass(ValidateEditor, [{ + key: 'componentWillReceiveProps', + value: function componentWillReceiveProps(nextProps) { + this.setState({ valid: nextProps.isValid(nextProps.content) }); + } + }, { + key: 'onInput', + value: function onInput(content) { + this.setState({ valid: this.props.isValid(content) }); + } + }, { + key: 'onDone', + value: function onDone(content) { + if (!this.props.isValid(content)) { + this.editor.reset(); + content = this.props.content; + } + this.props.onDone(content); + } + }, { + key: 'render', + value: function render() { + var _this2 = this; + + var className = (0, _classnames2.default)(this.props.className, { + 'has-success': this.state.valid, + 'has-warning': !this.state.valid + }); + return _react2.default.createElement(_ValueEditor2.default, { + content: this.props.content, + readonly: this.props.readonly, + onDone: this.onDone, + onInput: this.onInput, + className: className, + ref: function ref(e) { + return _this2.editor = e; + } + }); + } + }]); + + return ValidateEditor; +}(_react.Component); + +ValidateEditor.propTypes = { + content: _react.PropTypes.string.isRequired, + readonly: _react.PropTypes.bool, + onDone: _react.PropTypes.func.isRequired, + className: _react.PropTypes.string, + isValid: _react.PropTypes.func.isRequired +}; +exports.default = ValidateEditor; + +},{"./ValueEditor":39,"classnames":"classnames","react":"react"}],39:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _lodash = require('lodash'); + +var _lodash2 = _interopRequireDefault(_lodash); + +var _classnames = require('classnames'); + +var _classnames2 = _interopRequireDefault(_classnames); + +var _utils = require('../../utils'); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; } + +function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; } + +var ValueEditor = function (_Component) { + _inherits(ValueEditor, _Component); + + function ValueEditor(props) { + _classCallCheck(this, ValueEditor); + + var _this = _possibleConstructorReturn(this, Object.getPrototypeOf(ValueEditor).call(this, props)); + + _this.state = { editable: false }; + + _this.onPaste = _this.onPaste.bind(_this); + _this.onMouseDown = _this.onMouseDown.bind(_this); + _this.onMouseUp = _this.onMouseUp.bind(_this); + _this.onFocus = _this.onFocus.bind(_this); + _this.onClick = _this.onClick.bind(_this); + _this.blur = _this.blur.bind(_this); + _this.onBlur = _this.onBlur.bind(_this); + _this.reset = _this.reset.bind(_this); + _this.onKeyDown = _this.onKeyDown.bind(_this); + _this.onInput = _this.onInput.bind(_this); + return _this; + } + + _createClass(ValueEditor, [{ + key: 'blur', + value: function blur() { + // a stop would cause a blur as a side-effect. + // but a blur event must trigger a stop as well. + // to fix this, make stop = blur and do the actual stop in the onBlur handler. + this.input.blur(); + } + }, { + key: 'reset', + value: function reset() { + this.input.innerHTML = _lodash2.default.escape(this.props.content); + } + }, { + key: 'render', + value: function render() { + var _this2 = this; + + var className = (0, _classnames2.default)('inline-input', { + 'readonly': this.props.readonly, + 'editable': !this.props.readonly + }, this.props.className); + return _react2.default.createElement('div', { + ref: function ref(input) { + return _this2.input = input; + }, + tabIndex: this.props.readonly ? undefined : 0, + className: className, + contentEditable: this.state.editable || undefined, + onFocus: this.onFocus, + onMouseDown: this.onMouseDown, + onClick: this.onClick, + onBlur: this.onBlur, + onKeyDown: this.onKeyDown, + onInput: this.onInput, + onPaste: this.onPaste, + dangerouslySetInnerHTML: { __html: _lodash2.default.escape(this.props.content) } + }); + } + }, { + key: 'onPaste', + value: function onPaste(e) { + e.preventDefault(); + var content = e.clipboardData.getData('text/plain'); + document.execCommand('insertHTML', false, content); + } + }, { + key: 'onMouseDown', + value: function onMouseDown(e) { + this._mouseDown = true; + window.addEventListener('mouseup', this.onMouseUp); + } + }, { + key: 'onMouseUp', + value: function onMouseUp() { + if (this._mouseDown) { + this._mouseDown = false; + window.removeEventListener('mouseup', this.onMouseUp); + } + } + }, { + key: 'onClick', + value: function onClick(e) { + this.onMouseUp(); + this.onFocus(e); + } + }, { + key: 'onFocus', + value: function onFocus(e) { + var _this3 = this; + + if (this._mouseDown || this._ignore_events || this.state.editable || this.props.readonly) { + return; + } + + // contenteditable in FireFox is more or less broken. + // - we need to blur() and then focus(), otherwise the caret is not shown. + // - blur() + focus() == we need to save the caret position before + // Firefox sometimes just doesn't set a caret position => use caretPositionFromPoint + var sel = window.getSelection(); + var range = void 0; + if (sel.rangeCount > 0) { + range = sel.getRangeAt(0); + } else if (document.caretPositionFromPoint && e.clientX && e.clientY) { + var pos = document.caretPositionFromPoint(e.clientX, e.clientY); + range = document.createRange(); + range.setStart(pos.offsetNode, pos.offset); + } else if (document.caretRangeFromPoint && e.clientX && e.clientY) { + range = document.caretRangeFromPoint(e.clientX, e.clientY); + } else { + range = document.createRange(); + range.selectNodeContents(this.input); + } + + this._ignore_events = true; + this.setState({ editable: true }, function () { + _this3.input.blur(); + _this3.input.focus(); + _this3._ignore_events = false; + range.selectNodeContents(_this3.input); + sel.removeAllRanges(); + sel.addRange(range); + }); + } + }, { + key: 'onBlur', + value: function onBlur(e) { + if (this._ignore_events || this.props.readonly) { + return; + } + window.getSelection().removeAllRanges(); //make sure that selection is cleared on blur + this.setState({ editable: false }); + this.props.onDone(this.input.textContent); + } + }, { + key: 'onKeyDown', + value: function onKeyDown(e) { + e.stopPropagation(); + switch (e.keyCode) { + case _utils.Key.ESC: + e.preventDefault(); + this.reset(); + this.blur(); + break; + case _utils.Key.ENTER: + if (!e.shiftKey) { + e.preventDefault(); + this.blur(); + } + break; + default: + break; + } + this.props.onKeyDown(e); + } + }, { + key: 'onInput', + value: function onInput() { + this.props.onInput(this.input.textContent); + } + }]); + + return ValueEditor; +}(_react.Component); + +ValueEditor.propTypes = { + content: _react.PropTypes.string.isRequired, + readonly: _react.PropTypes.bool, + onDone: _react.PropTypes.func.isRequired, + className: _react.PropTypes.string, + onInput: _react.PropTypes.func, + onKeyDown: _react.PropTypes.func +}; +ValueEditor.defaultProps = { + onInput: function onInput() {}, + onKeyDown: function onKeyDown() {} +}; +exports.default = ValueEditor; + +},{"../../utils":65,"classnames":"classnames","lodash":"lodash","react":"react"}],40:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.default = Button; + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _classnames = require('classnames'); + +var _classnames2 = _interopRequireDefault(_classnames); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +Button.propTypes = { + onClick: _react.PropTypes.func.isRequired, + text: _react.PropTypes.string, + icon: _react.PropTypes.string +}; + +function Button(_ref) { + var onClick = _ref.onClick; + var text = _ref.text; + var icon = _ref.icon; + var disabled = _ref.disabled; + var className = _ref.className; + + return _react2.default.createElement( + 'div', + { className: (0, _classnames2.default)(className, 'btn btn-default'), + onClick: onClick, + disabled: disabled }, + icon && _react2.default.createElement('i', { className: "fa fa-fw " + icon }), + text && text + ); +} + +},{"classnames":"classnames","react":"react"}],41:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +exports.Divider = Divider; + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _classnames = require('classnames'); + +var _classnames2 = _interopRequireDefault(_classnames); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; } + +function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; } + +function Divider() { + return _react2.default.createElement('hr', { className: 'divider' }); +} + +var Dropdown = function (_Component) { + _inherits(Dropdown, _Component); + + function Dropdown(props, context) { + _classCallCheck(this, Dropdown); + + var _this = _possibleConstructorReturn(this, Object.getPrototypeOf(Dropdown).call(this, props, context)); + + _this.state = { open: false }; + _this.close = _this.close.bind(_this); + _this.open = _this.open.bind(_this); + return _this; + } + + _createClass(Dropdown, [{ + key: 'close', + value: function close() { + this.setState({ open: false }); + document.removeEventListener('click', this.close); + } + }, { + key: 'open', + value: function open(e) { + e.preventDefault(); + if (this.state.open) { + return; + } + this.setState({ open: !this.state.open }); + document.addEventListener('click', this.close); + } + }, { + key: 'render', + value: function render() { + var _props = this.props; + var dropup = _props.dropup; + var className = _props.className; + var btnClass = _props.btnClass; + var text = _props.text; + var children = _props.children; + + return _react2.default.createElement( + 'div', + { className: (0, _classnames2.default)(dropup ? 'dropup' : 'dropdown', className, { open: this.state.open }) }, + _react2.default.createElement( + 'a', + { href: '#', className: btnClass, + onClick: this.open }, + text + ), + _react2.default.createElement( + 'ul', + { className: 'dropdown-menu', role: 'menu' }, + children.map(function (item, i) { + return _react2.default.createElement( + 'li', + { key: i }, + ' ', + item, + ' ' + ); + }) + ) + ); + } + }]); + + return Dropdown; +}(_react.Component); + +Dropdown.propTypes = { + dropup: _react.PropTypes.bool, + className: _react.PropTypes.string, + btnClass: _react.PropTypes.string.isRequired +}; +Dropdown.defaultProps = { + dropup: false +}; +exports.default = Dropdown; + +},{"classnames":"classnames","react":"react"}],42:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.default = FileChooser; + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +FileChooser.propTypes = { + icon: _react.PropTypes.string, + text: _react.PropTypes.string, + className: _react.PropTypes.string, + title: _react.PropTypes.string, + onOpenFile: _react.PropTypes.func.isRequired +}; + +function FileChooser(_ref) { + var icon = _ref.icon; + var text = _ref.text; + var className = _ref.className; + var title = _ref.title; + var onOpenFile = _ref.onOpenFile; + + var fileInput = void 0; + return _react2.default.createElement( + 'a', + { href: '#', onClick: function onClick() { + return fileInput.click(); + }, + className: className, + title: title }, + _react2.default.createElement('i', { className: 'fa fa-fw ' + icon }), + text, + _react2.default.createElement('input', { + ref: function ref(_ref2) { + return fileInput = _ref2; + }, + className: 'hidden', + type: 'file', + onChange: function onChange(e) { + e.preventDefault();if (e.target.files.length > 0) onOpenFile(e.target.files[0]);fileInput = ""; + } + }) + ); +} + +},{"react":"react"}],43:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _reactDom = require('react-dom'); + +var _reactDom2 = _interopRequireDefault(_reactDom); + +var _classnames = require('classnames'); + +var _classnames2 = _interopRequireDefault(_classnames); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; } + +function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; } + +var Splitter = function (_Component) { + _inherits(Splitter, _Component); + + function Splitter(props, context) { + _classCallCheck(this, Splitter); + + var _this = _possibleConstructorReturn(this, Object.getPrototypeOf(Splitter).call(this, props, context)); + + _this.state = { applied: false, startX: false, startY: false }; + + _this.onMouseMove = _this.onMouseMove.bind(_this); + _this.onMouseDown = _this.onMouseDown.bind(_this); + _this.onMouseUp = _this.onMouseUp.bind(_this); + _this.onDragEnd = _this.onDragEnd.bind(_this); + return _this; + } + + _createClass(Splitter, [{ + key: 'onMouseDown', + value: function onMouseDown(e) { + this.setState({ startX: e.pageX, startY: e.pageY }); + + window.addEventListener('mousemove', this.onMouseMove); + window.addEventListener('mouseup', this.onMouseUp); + // Occasionally, only a dragEnd event is triggered, but no mouseUp. + window.addEventListener('dragend', this.onDragEnd); + } + }, { + key: 'onDragEnd', + value: function onDragEnd() { + _reactDom2.default.findDOMNode(this).style.transform = ''; + + window.removeEventListener('dragend', this.onDragEnd); + window.removeEventListener('mouseup', this.onMouseUp); + window.removeEventListener('mousemove', this.onMouseMove); + } + }, { + key: 'onMouseUp', + value: function onMouseUp(e) { + this.onDragEnd(); + + var node = _reactDom2.default.findDOMNode(this); + var prev = node.previousElementSibling; + + var flexBasis = prev.offsetHeight + e.pageY - this.state.startY; + + if (this.props.axis === 'x') { + flexBasis = prev.offsetWidth + e.pageX - this.state.startX; + } + + prev.style.flex = '0 0 ' + Math.max(0, flexBasis) + 'px'; + node.nextElementSibling.style.flex = '1 1 auto'; + + this.setState({ applied: true }); + this.onResize(); + } + }, { + key: 'onMouseMove', + value: function onMouseMove(e) { + var dX = 0; + var dY = 0; + if (this.props.axis === 'x') { + dX = e.pageX - this.state.startX; + } else { + dY = e.pageY - this.state.startY; + } + _reactDom2.default.findDOMNode(this).style.transform = 'translate(' + dX + 'px, ' + dY + 'px)'; + } + }, { + key: 'onResize', + value: function onResize() { + // Trigger a global resize event. This notifies components that employ virtual scrolling + // that their viewport may have changed. + window.setTimeout(function () { + return window.dispatchEvent(new CustomEvent('resize')); + }, 1); + } + }, { + key: 'reset', + value: function reset(willUnmount) { + if (!this.state.applied) { + return; + } + + var node = _reactDom2.default.findDOMNode(this); + + node.previousElementSibling.style.flex = ''; + node.nextElementSibling.style.flex = ''; + + if (!willUnmount) { + this.setState({ applied: false }); + } + this.onResize(); + } + }, { + key: 'componentWillUnmount', + value: function componentWillUnmount() { + this.reset(true); + } + }, { + key: 'render', + value: function render() { + return _react2.default.createElement( + 'div', + { className: (0, _classnames2.default)('splitter', this.props.axis === 'x' ? 'splitter-x' : 'splitter-y') }, + _react2.default.createElement('div', { onMouseDown: this.onMouseDown, draggable: 'true' }) + ); + } + }]); + + return Splitter; +}(_react.Component); + +Splitter.defaultProps = { axis: 'x' }; +exports.default = Splitter; + +},{"classnames":"classnames","react":"react","react-dom":"react-dom"}],44:[function(require,module,exports){ +"use strict"; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.default = ToggleButton; + +var _react = require("react"); + +var _react2 = _interopRequireDefault(_react); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +ToggleButton.propTypes = { + checked: _react.PropTypes.bool.isRequired, + onToggle: _react.PropTypes.func.isRequired, + text: _react.PropTypes.string.isRequired +}; + +function ToggleButton(_ref) { + var checked = _ref.checked; + var onToggle = _ref.onToggle; + var text = _ref.text; + + return _react2.default.createElement( + "div", + { className: "btn btn-toggle " + (checked ? "btn-primary" : "btn-default"), onClick: onToggle }, + _react2.default.createElement("i", { className: "fa fa-fw " + (checked ? "fa-check-square-o" : "fa-square-o") }), + " ", + text + ); +} + +},{"react":"react"}],45:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _classnames = require('classnames'); + +var _classnames2 = _interopRequireDefault(_classnames); + +var _utils = require('../../utils'); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; } + +function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; } + +var ToggleInputButton = function (_Component) { + _inherits(ToggleInputButton, _Component); + + function ToggleInputButton(props) { + _classCallCheck(this, ToggleInputButton); + + var _this = _possibleConstructorReturn(this, Object.getPrototypeOf(ToggleInputButton).call(this, props)); + + _this.state = { txt: props.txt || '' }; + return _this; + } + + _createClass(ToggleInputButton, [{ + key: 'onKeyDown', + value: function onKeyDown(e) { + e.stopPropagation(); + if (e.keyCode === _utils.Key.ENTER) { + this.props.onToggleChanged(this.state.txt); + } + } + }, { + key: 'render', + value: function render() { + var _this2 = this; + + var _props = this.props; + var checked = _props.checked; + var onToggleChanged = _props.onToggleChanged; + var name = _props.name; + var inputType = _props.inputType; + var placeholder = _props.placeholder; + + return _react2.default.createElement( + 'div', + { className: 'input-group toggle-input-btn' }, + _react2.default.createElement( + 'span', + { className: 'input-group-btn', + onClick: function onClick() { + return onToggleChanged(_this2.state.txt); + } }, + _react2.default.createElement( + 'div', + { className: (0, _classnames2.default)('btn', checked ? 'btn-primary' : 'btn-default') }, + _react2.default.createElement('span', { className: (0, _classnames2.default)('fa', checked ? 'fa-check-square-o' : 'fa-square-o') }), + ' ', + name + ) + ), + _react2.default.createElement('input', { + className: 'form-control', + placeholder: placeholder, + disabled: checked, + value: this.state.txt, + type: inputType || 'text', + onChange: function onChange(e) { + return _this2.setState({ txt: e.target.value }); + }, + onKeyDown: function onKeyDown(e) { + return _this2.onKeyDown(e); + } + }) + ); + } + }]); + + return ToggleInputButton; +}(_react.Component); + +ToggleInputButton.propTypes = { + name: _react.PropTypes.string.isRequired, + txt: _react.PropTypes.string, + onToggleChanged: _react.PropTypes.func.isRequired, + checked: _react.PropTypes.bool.isRequired, + placeholder: _react.PropTypes.string.isRequired, + inputType: _react.PropTypes.string +}; +exports.default = ToggleInputButton; + +},{"../../utils":65,"classnames":"classnames","react":"react"}],46:[function(require,module,exports){ +"use strict"; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _get = function get(object, property, receiver) { if (object === null) object = Function.prototype; var desc = Object.getOwnPropertyDescriptor(object, property); if (desc === undefined) { var parent = Object.getPrototypeOf(object); if (parent === null) { return undefined; } else { return get(parent, property, receiver); } } else if ("value" in desc) { return desc.value; } else { var getter = desc.get; if (getter === undefined) { return undefined; } return getter.call(receiver); } }; + +var _react = require("react"); + +var _react2 = _interopRequireDefault(_react); + +var _reactDom = require("react-dom"); + +var _reactDom2 = _interopRequireDefault(_reactDom); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; } + +function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; } + +var symShouldStick = Symbol("shouldStick"); +var isAtBottom = function isAtBottom(v) { + return v.scrollTop + v.clientHeight === v.scrollHeight; +}; + +exports.default = function (Component) { + var _class, _temp; + + return Object.assign((_temp = _class = function (_Component) { + _inherits(AutoScrollWrapper, _Component); + + function AutoScrollWrapper() { + _classCallCheck(this, AutoScrollWrapper); + + return _possibleConstructorReturn(this, Object.getPrototypeOf(AutoScrollWrapper).apply(this, arguments)); + } + + _createClass(AutoScrollWrapper, [{ + key: "componentWillUpdate", + value: function componentWillUpdate() { + var viewport = _reactDom2.default.findDOMNode(this); + this[symShouldStick] = viewport.scrollTop && isAtBottom(viewport); + _get(Object.getPrototypeOf(AutoScrollWrapper.prototype), "componentWillUpdate", this) && _get(Object.getPrototypeOf(AutoScrollWrapper.prototype), "componentWillUpdate", this).call(this); + } + }, { + key: "componentDidUpdate", + value: function componentDidUpdate() { + var viewport = _reactDom2.default.findDOMNode(this); + if (this[symShouldStick] && !isAtBottom(viewport)) { + viewport.scrollTop = viewport.scrollHeight; + } + _get(Object.getPrototypeOf(AutoScrollWrapper.prototype), "componentDidUpdate", this) && _get(Object.getPrototypeOf(AutoScrollWrapper.prototype), "componentDidUpdate", this).call(this); + } + }]); + + return AutoScrollWrapper; + }(Component), _class.displayName = Component.name, _temp), Component); +}; + +},{"react":"react","react-dom":"react-dom"}],47:[function(require,module,exports){ +"use strict"; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.calcVScroll = calcVScroll; +/** + * Calculate virtual scroll stuffs + * + * @param {?Object} opts Options for calculation + * + * @returns {Object} result + * + * __opts__ should have following properties: + * - {number} itemCount + * - {number} rowHeight + * - {number} viewportTop + * - {number} viewportHeight + * - {Array} [itemHeights] + * + * __result__ have following properties: + * - {number} start + * - {number} end + * - {number} paddingTop + * - {number} paddingBottom + */ +function calcVScroll(opts) { + if (!opts) { + return { start: 0, end: 0, paddingTop: 0, paddingBottom: 0 }; + } + + var itemCount = opts.itemCount; + var rowHeight = opts.rowHeight; + var viewportTop = opts.viewportTop; + var viewportHeight = opts.viewportHeight; + var itemHeights = opts.itemHeights; + + var viewportBottom = viewportTop + viewportHeight; + + var start = 0; + var end = 0; + + var paddingTop = 0; + var paddingBottom = 0; + + if (itemHeights) { + + for (var i = 0, pos = 0; i < itemCount; i++) { + var height = itemHeights[i] || rowHeight; + + if (pos <= viewportTop && i % 2 === 0) { + paddingTop = pos; + start = i; + } + + if (pos <= viewportBottom) { + end = i + 1; + } else { + paddingBottom += height; + } + + pos += height; + } + } else { + + // Make sure that we start at an even row so that CSS `:nth-child(even)` is preserved + start = Math.max(0, Math.floor(viewportTop / rowHeight) - 1) & ~1; + end = Math.min(itemCount, start + Math.ceil(viewportHeight / rowHeight) + 2); + + // When a large trunk of elements is removed from the button, start may be far off the viewport. + // To make this issue less severe, limit the top placeholder to the total number of rows. + paddingTop = Math.min(start, itemCount) * rowHeight; + paddingBottom = Math.max(0, itemCount - end) * rowHeight; + } + + return { start: start, end: end, paddingTop: paddingTop, paddingBottom: paddingBottom }; +} + +},{}],48:[function(require,module,exports){ +"use strict"; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.AppDispatcher = undefined; + +var _flux = require("flux"); + +var _flux2 = _interopRequireDefault(_flux); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +var PayloadSources = { + VIEW: "view", + SERVER: "server" +}; + +var AppDispatcher = exports.AppDispatcher = new _flux2.default.Dispatcher(); +AppDispatcher.dispatchViewAction = function (action) { + action.source = PayloadSources.VIEW; + this.dispatch(action); +}; +AppDispatcher.dispatchServerAction = function (action) { + action.source = PayloadSources.SERVER; + this.dispatch(action); +}; + +},{"flux":"flux"}],49:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.INIT = undefined; +exports.reduce = reduce; +exports.init = init; +exports.destruct = destruct; + +var _websocket = require('./websocket'); + +var INIT = exports.INIT = 'APP_INIT'; + +var defaultState = {}; + +function reduce() { + var state = arguments.length <= 0 || arguments[0] === undefined ? defaultState : arguments[0]; + var action = arguments[1]; + + switch (action.type) { + + default: + return state; + } +} + +function init() { + return function (dispatch) { + dispatch((0, _websocket.connect)()); + dispatch({ type: INIT }); + }; +} + +function destruct() { + return function (dispatch) { + dispatch((0, _websocket.disconnect)()); + dispatch({ type: DESTRUCT }); + }; +} + +},{"./websocket":62}],50:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.FETCH_ERROR = exports.UNKNOWN_CMD = exports.TOGGLE_FILTER = exports.TOGGLE_VISIBILITY = exports.RECEIVE = exports.ADD = exports.DATA_URL = exports.MSG_TYPE = undefined; + +var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol ? "symbol" : typeof obj; }; + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +exports.default = reduce; +exports.toggleFilter = toggleFilter; +exports.toggleVisibility = toggleVisibility; +exports.add = add; +exports.handleWsMsg = handleWsMsg; +exports.fetchData = fetchData; +exports.receiveData = receiveData; + +var _list = require('./utils/list'); + +var listActions = _interopRequireWildcard(_list); + +var _view = require('./utils/view'); + +var viewActions = _interopRequireWildcard(_view); + +var _websocket = require('./websocket'); + +var websocketActions = _interopRequireWildcard(_websocket); + +var _msgQueue = require('./msgQueue'); + +var msgQueueActions = _interopRequireWildcard(_msgQueue); + +function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } + +function _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; } + +var MSG_TYPE = exports.MSG_TYPE = 'UPDATE_EVENTLOG'; +var DATA_URL = exports.DATA_URL = '/events'; + +var ADD = exports.ADD = 'EVENTLOG_ADD'; +var RECEIVE = exports.RECEIVE = 'EVENTLOG_RECEIVE'; +var TOGGLE_VISIBILITY = exports.TOGGLE_VISIBILITY = 'EVENTLOG_TOGGLE_VISIBILITY'; +var TOGGLE_FILTER = exports.TOGGLE_FILTER = 'EVENTLOG_TOGGLE_FILTER'; +var UNKNOWN_CMD = exports.UNKNOWN_CMD = 'EVENTLOG_UNKNOWN_CMD'; +var FETCH_ERROR = exports.FETCH_ERROR = 'EVENTLOG_FETCH_ERROR'; + +var defaultState = { + logId: 0, + visible: false, + filters: { debug: false, info: true, web: true }, + list: (0, listActions.default)(undefined, {}), + view: (0, viewActions.default)(undefined, {}) +}; + +function reduce() { + var state = arguments.length <= 0 || arguments[0] === undefined ? defaultState : arguments[0]; + var action = arguments[1]; + + var _ret = function () { + switch (action.type) { + + case TOGGLE_VISIBILITY: + return { + v: _extends({}, state, { + visible: !state.visible + }) + }; + + case TOGGLE_FILTER: + var filters = _extends({}, state.filters, _defineProperty({}, action.filter, !state.filters[action.filter])); + return { + v: _extends({}, state, { + filters: filters, + view: (0, viewActions.default)(state.view, viewActions.updateFilter(state.list.data, function (log) { + return filters[log.level]; + })) + }) + }; + + case ADD: + var item = { + id: state.logId, + message: action.message, + level: action.level + }; + return { + v: _extends({}, state, { + logId: state.logId + 1, + list: (0, listActions.default)(state.list, listActions.add(item)), + view: (0, viewActions.default)(state.view, viewActions.add(item, function (log) { + return state.filters[log.level]; + })) + }) + }; + + case RECEIVE: + return { + v: _extends({}, state, { + list: (0, listActions.default)(state.list, listActions.receive(action.list)), + view: (0, viewActions.default)(state.view, viewActions.receive(action.list, function (log) { + return state.filters[log.level]; + })) + }) + }; + + default: + return { + v: state + }; + } + }(); + + if ((typeof _ret === 'undefined' ? 'undefined' : _typeof(_ret)) === "object") return _ret.v; +} + +/** + * @public + */ +function toggleFilter(filter) { + return { type: TOGGLE_FILTER, filter: filter }; +} + +/** + * @public + * + * @todo move to ui? + */ +function toggleVisibility() { + return { type: TOGGLE_VISIBILITY }; +} + +/** + * @public + */ +function add(message) { + var level = arguments.length <= 1 || arguments[1] === undefined ? 'web' : arguments[1]; + + return { type: ADD, message: message, level: level }; +} + +/** + * This action creater takes all WebSocket events + * + * @public websocket + */ +function handleWsMsg(msg) { + switch (msg.cmd) { + + case websocketActions.CMD_ADD: + return add(msg.data.message, msg.data.level); + + case websocketActions.CMD_RESET: + return fetchData(); + + default: + return { type: UNKNOWN_CMD, msg: msg }; + } +} + +/** + * @public websocket + */ +function fetchData() { + return msgQueueActions.fetchData(MSG_TYPE); +} + +/** + * @public msgQueue + */ +function receiveData(list) { + return { type: RECEIVE, list: list }; +} + +},{"./msgQueue":54,"./utils/list":60,"./utils/view":61,"./websocket":62}],51:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.UPDATE_HIGHLIGHT = exports.UPDATE_SORT = exports.UPDATE_FILTER = undefined; + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +exports.makeFilter = makeFilter; +exports.makeSort = makeSort; +exports.default = reduce; +exports.updateFilter = updateFilter; +exports.updateHighlight = updateHighlight; +exports.updateSort = updateSort; +exports.selectRelative = selectRelative; + +var _view = require('./utils/view'); + +var viewActions = _interopRequireWildcard(_view); + +var _flows = require('./flows'); + +var flowActions = _interopRequireWildcard(_flows); + +var _filt = require('../filt/filt'); + +var _filt2 = _interopRequireDefault(_filt); + +var _utils = require('../flow/utils'); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } + +var UPDATE_FILTER = exports.UPDATE_FILTER = 'FLOWVIEW_UPDATE_FILTER'; +var UPDATE_SORT = exports.UPDATE_SORT = 'FLOWVIEW_UPDATE_SORT'; +var UPDATE_HIGHLIGHT = exports.UPDATE_HIGHLIGHT = 'FLOWVIEW_UPDATE_HIGHLIGHT'; + +var sortKeyFuns = { + + TLSColumn: function TLSColumn(flow) { + return flow.request.scheme; + }, + + PathColumn: function PathColumn(flow) { + return _utils.RequestUtils.pretty_url(flow.request); + }, + + MethodColumn: function MethodColumn(flow) { + return flow.request.method; + }, + + StatusColumn: function StatusColumn(flow) { + return flow.response && flow.response.status_code; + }, + + TimeColumn: function TimeColumn(flow) { + return flow.response && flow.response.timestamp_end - flow.request.timestamp_start; + }, + + SizeColumn: function SizeColumn(flow) { + var total = flow.request.contentLength; + if (flow.response) { + total += flow.response.contentLength || 0; + } + return total; + } +}; + +function makeFilter(filter) { + if (!filter) { + return; + } + return _filt2.default.parse(filter); +} + +function makeSort(_ref) { + var column = _ref.column; + var desc = _ref.desc; + + var sortKeyFun = sortKeyFuns[column]; + if (!sortKeyFun) { + return; + } + return function (a, b) { + var ka = sortKeyFun(a); + var kb = sortKeyFun(b); + if (ka > kb) { + return desc ? -1 : 1; + } + if (ka < kb) { + return desc ? 1 : -1; + } + return 0; + }; +} + +var defaultState = _extends({ + highlight: null, + filter: null, + sort: { column: null, desc: false } +}, (0, viewActions.default)(undefined, {})); + +function reduce() { + var state = arguments.length <= 0 || arguments[0] === undefined ? defaultState : arguments[0]; + var action = arguments[1]; + + switch (action.type) { + + case UPDATE_HIGHLIGHT: + return _extends({}, state, { + highlight: action.highlight + }); + + case UPDATE_FILTER: + return _extends({}, (0, viewActions.default)(state, viewActions.updateFilter(action.flows, makeFilter(action.filter), makeSort(state.sort))), { + filter: action.filter + }); + + case UPDATE_SORT: + var sort = { column: action.column, desc: action.desc }; + return _extends({}, (0, viewActions.default)(state, viewActions.updateSort(makeSort(sort))), { + sort: sort + }); + + case flowActions.ADD: + return _extends({}, (0, viewActions.default)(state, viewActions.add(action.item, makeFilter(state.filter), makeSort(state.sort)))); + + case flowActions.UPDATE: + return _extends({}, (0, viewActions.default)(state, viewActions.update(action.item, makeFilter(state.filter), makeSort(state.sort)))); + + case flowActions.REMOVE: + return _extends({}, (0, viewActions.default)(state, viewActions.remove(action.id))); + + case flowActions.RECEIVE: + return _extends({}, (0, viewActions.default)(state, viewActions.receive(action.list, makeFilter(state.filter), makeSort(state.sort)))); + + default: + return _extends({}, (0, viewActions.default)(state, action)); + } +} + +/** + * @public + */ +function updateFilter(filter) { + return function (dispatch, getState) { + dispatch({ type: UPDATE_FILTER, filter: filter, flows: getState().flows.data }); + }; +} + +/** + * @public + */ +function updateHighlight(highlight) { + return { type: UPDATE_HIGHLIGHT, highlight: highlight }; +} + +/** + * @public + */ +function updateSort(column, desc) { + return { type: UPDATE_SORT, column: column, desc: desc }; +} + +/** + * @public + */ +function selectRelative(shift) { + return function (dispatch, getState) { + var currentSelectionIndex = getState().flowView.indexOf[getState().flows.selected[0]]; + var minIndex = 0; + var maxIndex = getState().flowView.data.length - 1; + var newIndex = void 0; + if (currentSelectionIndex === undefined) { + newIndex = shift < 0 ? minIndex : maxIndex; + } else { + newIndex = currentSelectionIndex + shift; + newIndex = Math.max(newIndex, minIndex); + newIndex = Math.min(newIndex, maxIndex); + } + var flow = getState().flowView.data[newIndex]; + dispatch(flowActions.select(flow ? flow.id : undefined)); + }; +} + +},{"../filt/filt":63,"../flow/utils":64,"./flows":52,"./utils/view":61}],52:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.SELECT = exports.FETCH_ERROR = exports.UNKNOWN_CMD = exports.REQUEST_ACTION = exports.RECEIVE = exports.REMOVE = exports.UPDATE = exports.ADD = exports.DATA_URL = exports.MSG_TYPE = undefined; + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +exports.default = reduce; +exports.accept = accept; +exports.acceptAll = acceptAll; +exports.remove = remove; +exports.duplicate = duplicate; +exports.replay = replay; +exports.revert = revert; +exports.update = update; +exports.uploadContent = uploadContent; +exports.clear = clear; +exports.download = download; +exports.upload = upload; +exports.select = select; +exports.handleWsMsg = handleWsMsg; +exports.fetchFlows = fetchFlows; +exports.receiveData = receiveData; +exports.addFlow = addFlow; +exports.updateFlow = updateFlow; +exports.removeFlow = removeFlow; + +var _utils = require('../utils'); + +var _list = require('./utils/list'); + +var listActions = _interopRequireWildcard(_list); + +var _msgQueue = require('./msgQueue'); + +var msgQueueActions = _interopRequireWildcard(_msgQueue); + +var _websocket = require('./websocket'); + +var websocketActions = _interopRequireWildcard(_websocket); + +function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } + +var MSG_TYPE = exports.MSG_TYPE = 'UPDATE_FLOWS'; +var DATA_URL = exports.DATA_URL = '/flows'; + +var ADD = exports.ADD = 'FLOWS_ADD'; +var UPDATE = exports.UPDATE = 'FLOWS_UPDATE'; +var REMOVE = exports.REMOVE = 'FLOWS_REMOVE'; +var RECEIVE = exports.RECEIVE = 'FLOWS_RECEIVE'; +var REQUEST_ACTION = exports.REQUEST_ACTION = 'FLOWS_REQUEST_ACTION'; +var UNKNOWN_CMD = exports.UNKNOWN_CMD = 'FLOWS_UNKNOWN_CMD'; +var FETCH_ERROR = exports.FETCH_ERROR = 'FLOWS_FETCH_ERROR'; +var SELECT = exports.SELECT = 'FLOWS_SELECT'; + +var defaultState = _extends({ + selected: [] +}, (0, listActions.default)(undefined, {})); + +function reduce() { + var state = arguments.length <= 0 || arguments[0] === undefined ? defaultState : arguments[0]; + var action = arguments[1]; + + switch (action.type) { + + case ADD: + return _extends({}, state, (0, listActions.default)(state, listActions.add(action.item))); + + case UPDATE: + return _extends({}, state, (0, listActions.default)(state, listActions.update(action.item))); + + case REMOVE: + return _extends({}, state, (0, listActions.default)(state, listActions.remove(action.id))); + + case RECEIVE: + return _extends({}, state, (0, listActions.default)(state, listActions.receive(action.list))); + + case SELECT: + return _extends({}, state, { + selected: action.flowIds + }); + + default: + return _extends({}, state, (0, listActions.default)(state, action)); + } +} + +/** + * @public + */ +function accept(flow) { + return function (dispatch) { + return (0, _utils.fetchApi)('/flows/' + flow.id + '/accept', { method: 'POST' }); + }; +} + +/** + * @public + */ +function acceptAll() { + return function (dispatch) { + return (0, _utils.fetchApi)('/flows/accept', { method: 'POST' }); + }; +} + +/** + * @public + */ +function remove(flow) { + return function (dispatch) { + return (0, _utils.fetchApi)('/flows/' + flow.id, { method: 'DELETE' }); + }; +} + +/** + * @public + */ +function duplicate(flow) { + return function (dispatch) { + return (0, _utils.fetchApi)('/flows/' + flow.id + '/duplicate', { method: 'POST' }); + }; +} + +/** + * @public + */ +function replay(flow) { + return function (dispatch) { + return (0, _utils.fetchApi)('/flows/' + flow.id + '/replay', { method: 'POST' }); + }; +} + +/** + * @public + */ +function revert(flow) { + return function (dispatch) { + return (0, _utils.fetchApi)('/flows/' + flow.id + '/revert', { method: 'POST' }); + }; +} + +/** + * @public + */ +function update(flow, data) { + return function (dispatch) { + return _utils.fetchApi.put('/flows/' + flow.id, data); + }; +} + +function uploadContent(flow, file, type) { + var body = new FormData(); + file = new Blob([file], { type: 'plain/text' }); + body.append('file', file); + return function (dispatch) { + return (0, _utils.fetchApi)('/flows/' + flow.id + '/' + type + '/content', { method: 'post', body: body }); + }; +} + +/** + * @public + */ +function clear() { + return function (dispatch) { + return (0, _utils.fetchApi)('/clear', { method: 'POST' }); + }; +} + +/** + * @public + */ +function download() { + window.location = '/flows/dump'; + return { type: REQUEST_ACTION }; +} + +/** + * @public + */ +function upload(file) { + var body = new FormData(); + body.append('file', file); + return function (dispatch) { + return (0, _utils.fetchApi)('/flows/dump', { method: 'post', body: body }); + }; +} + +function select(id) { + return { + type: SELECT, + flowIds: id ? [id] : [] + }; +} + +/** + * This action creater takes all WebSocket events + * + * @public websocket + */ +function handleWsMsg(msg) { + switch (msg.cmd) { + + case websocketActions.CMD_ADD: + return addFlow(msg.data); + + case websocketActions.CMD_UPDATE: + return updateFlow(msg.data); + + case websocketActions.CMD_REMOVE: + return removeFlow(msg.data.id); + + case websocketActions.CMD_RESET: + return fetchFlows(); + + default: + return { type: UNKNOWN_CMD, msg: msg }; + } +} + +/** + * @public websocket + */ +function fetchFlows() { + return msgQueueActions.fetchData(MSG_TYPE); +} + +/** + * @public msgQueue + */ +function receiveData(list) { + return { type: RECEIVE, list: list }; +} + +/** + * @private + */ +function addFlow(item) { + return { type: ADD, item: item }; +} + +/** + * @private + */ +function updateFlow(item) { + return { type: UPDATE, item: item }; +} + +/** + * @private + */ +function removeFlow(id) { + return function (dispatch) { + dispatch(select()); + dispatch({ type: REMOVE, id: id }); + }; +} + +},{"../utils":65,"./msgQueue":54,"./utils/list":60,"./websocket":62}],53:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _redux = require('redux'); + +var _eventLog = require('./eventLog'); + +var _eventLog2 = _interopRequireDefault(_eventLog); + +var _websocket = require('./websocket'); + +var _websocket2 = _interopRequireDefault(_websocket); + +var _flows = require('./flows'); + +var _flows2 = _interopRequireDefault(_flows); + +var _flowView = require('./flowView'); + +var _flowView2 = _interopRequireDefault(_flowView); + +var _settings = require('./settings'); + +var _settings2 = _interopRequireDefault(_settings); + +var _index = require('./ui/index'); + +var _index2 = _interopRequireDefault(_index); + +var _msgQueue = require('./msgQueue'); + +var _msgQueue2 = _interopRequireDefault(_msgQueue); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +exports.default = (0, _redux.combineReducers)({ + eventLog: _eventLog2.default, + websocket: _websocket2.default, + flows: _flows2.default, + flowView: _flowView2.default, + settings: _settings2.default, + ui: _index2.default, + msgQueue: _msgQueue2.default +}); + +},{"./eventLog":50,"./flowView":51,"./flows":52,"./msgQueue":54,"./settings":55,"./ui/index":58,"./websocket":62,"redux":"redux"}],54:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.FETCH_ERROR = exports.CLEAR = exports.ENQUEUE = exports.INIT = undefined; + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +var _handlers; + +exports.default = reduce; +exports.handleWsMsg = handleWsMsg; +exports.fetchData = fetchData; +exports.receive = receive; +exports.init = init; +exports.clear = clear; +exports.fetchError = fetchError; + +var _utils = require('../utils'); + +var _websocket = require('./websocket'); + +var websocketActions = _interopRequireWildcard(_websocket); + +var _eventLog = require('./eventLog'); + +var eventLogActions = _interopRequireWildcard(_eventLog); + +var _flows = require('./flows'); + +var flowsActions = _interopRequireWildcard(_flows); + +var _settings = require('./settings'); + +var settingsActions = _interopRequireWildcard(_settings); + +function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } + +function _toConsumableArray(arr) { if (Array.isArray(arr)) { for (var i = 0, arr2 = Array(arr.length); i < arr.length; i++) { arr2[i] = arr[i]; } return arr2; } else { return Array.from(arr); } } + +function _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; } + +var INIT = exports.INIT = 'MSG_QUEUE_INIT'; +var ENQUEUE = exports.ENQUEUE = 'MSG_QUEUE_ENQUEUE'; +var CLEAR = exports.CLEAR = 'MSG_QUEUE_CLEAR'; +var FETCH_ERROR = exports.FETCH_ERROR = 'MSG_QUEUE_FETCH_ERROR'; + +var handlers = (_handlers = {}, _defineProperty(_handlers, eventLogActions.MSG_TYPE, eventLogActions), _defineProperty(_handlers, flowsActions.MSG_TYPE, flowsActions), _defineProperty(_handlers, settingsActions.MSG_TYPE, settingsActions), _handlers); + +var defaultState = {}; + +function reduce() { + var state = arguments.length <= 0 || arguments[0] === undefined ? defaultState : arguments[0]; + var action = arguments[1]; + + switch (action.type) { + + case INIT: + return _extends({}, state, _defineProperty({}, action.queue, [])); + + case ENQUEUE: + return _extends({}, state, _defineProperty({}, action.queue, [].concat(_toConsumableArray(state[action.queue]), [action.msg]))); + + case CLEAR: + return _extends({}, state, _defineProperty({}, action.queue, null)); + + default: + return state; + } +} + +/** + * @public websocket + */ +function handleWsMsg(msg) { + return function (dispatch, getState) { + var handler = handlers[msg.type]; + if (msg.cmd === websocketActions.CMD_RESET) { + return dispatch(fetchData(handler.MSG_TYPE)); + } + if (getState().msgQueue[handler.MSG_TYPE]) { + return dispatch({ type: ENQUEUE, queue: handler.MSG_TYPE, msg: msg }); + } + return dispatch(handler.handleWsMsg(msg)); + }; +} + +/** + * @public + */ +function fetchData(type) { + return function (dispatch) { + var handler = handlers[type]; + + dispatch(init(handler.MSG_TYPE)); + + (0, _utils.fetchApi)(handler.DATA_URL).then(function (res) { + return res.json(); + }).then(function (json) { + return dispatch(receive(type, json)); + }).catch(function (error) { + return dispatch(fetchError(type, error)); + }); + }; +} + +/** + * @private + */ +function receive(type, res) { + return function (dispatch, getState) { + var handler = handlers[type]; + var queue = getState().msgQueue[handler.MSG_TYPE] || []; + + dispatch(clear(handler.MSG_TYPE)); + dispatch(handler.receiveData(res.data)); + var _iteratorNormalCompletion = true; + var _didIteratorError = false; + var _iteratorError = undefined; + + try { + for (var _iterator = queue[Symbol.iterator](), _step; !(_iteratorNormalCompletion = (_step = _iterator.next()).done); _iteratorNormalCompletion = true) { + var msg = _step.value; + + dispatch(handler.handleWsMsg(msg)); + } + } catch (err) { + _didIteratorError = true; + _iteratorError = err; + } finally { + try { + if (!_iteratorNormalCompletion && _iterator.return) { + _iterator.return(); + } + } finally { + if (_didIteratorError) { + throw _iteratorError; + } + } + } + }; +} + +/** + * @private + */ +function init(queue) { + return { type: INIT, queue: queue }; +} + +/** + * @private + */ +function clear(queue) { + return { type: CLEAR, queue: queue }; +} + +/** + * @private + */ +function fetchError(type, error) { + var _ref; + + return _ref = { type: FETCH_ERROR }, _defineProperty(_ref, 'type', type), _defineProperty(_ref, 'error', error), _ref; +} + +},{"../utils":65,"./eventLog":50,"./flows":52,"./settings":55,"./websocket":62}],55:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.UNKNOWN_CMD = exports.REQUEST_UPDATE = exports.UPDATE = exports.RECEIVE = exports.DATA_URL = exports.MSG_TYPE = undefined; + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +exports.default = reducer; +exports.handleWsMsg = handleWsMsg; +exports.update = update; +exports.fetchData = fetchData; +exports.receiveData = receiveData; +exports.updateSettings = updateSettings; + +var _utils = require('../utils'); + +var _websocket = require('./websocket'); + +var websocketActions = _interopRequireWildcard(_websocket); + +var _msgQueue = require('./msgQueue'); + +var msgQueueActions = _interopRequireWildcard(_msgQueue); + +function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } + +var MSG_TYPE = exports.MSG_TYPE = 'UPDATE_SETTINGS'; +var DATA_URL = exports.DATA_URL = '/settings'; + +var RECEIVE = exports.RECEIVE = 'RECEIVE'; +var UPDATE = exports.UPDATE = 'UPDATE'; +var REQUEST_UPDATE = exports.REQUEST_UPDATE = 'REQUEST_UPDATE'; +var UNKNOWN_CMD = exports.UNKNOWN_CMD = 'SETTINGS_UNKNOWN_CMD'; + +var defaultState = {}; + +function reducer() { + var state = arguments.length <= 0 || arguments[0] === undefined ? defaultState : arguments[0]; + var action = arguments[1]; + + switch (action.type) { + + case RECEIVE: + return action.settings; + + case UPDATE: + return _extends({}, state, action.settings); + + default: + return state; + } +} + +/** + * @public msgQueue + */ +function handleWsMsg(msg) { + switch (msg.cmd) { + + case websocketActions.CMD_UPDATE: + return updateSettings(msg.data); + + default: + console.error('unknown settings update', msg); + return { type: UNKNOWN_CMD, msg: msg }; + } +} + +/** + * @public + */ +function update(settings) { + _utils.fetchApi.put('/settings', settings); + return { type: REQUEST_UPDATE }; +} + +/** + * @public websocket + */ +function fetchData() { + return msgQueueActions.fetchData(MSG_TYPE); +} + +/** + * @public msgQueue + */ +function receiveData(settings) { + return { type: RECEIVE, settings: settings }; +} + +/** + * @private + */ +function updateSettings(settings) { + return { type: UPDATE, settings: settings }; +} + +},{"../utils":65,"./msgQueue":54,"./websocket":62}],56:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.SET_CONTENT = exports.SET_CONTENT_VIEW_DESCRIPTION = exports.SET_SHOW_FULL_CONTENT = exports.UPLOAD_CONTENT = exports.UPDATE_EDIT = exports.START_EDIT = exports.SET_TAB = exports.DISPLAY_LARGE = exports.SET_CONTENT_VIEW = undefined; + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +exports.default = reducer; +exports.setContentView = setContentView; +exports.displayLarge = displayLarge; +exports.selectTab = selectTab; +exports.startEdit = startEdit; +exports.updateEdit = updateEdit; +exports.setContentViewDescription = setContentViewDescription; +exports.setShowFullContent = setShowFullContent; +exports.updateEdit = updateEdit; +exports.setContent = setContent; +exports.stopEdit = stopEdit; + +var _flows = require('../flows'); + +var flowsActions = _interopRequireWildcard(_flows); + +var _utils = require('../../utils'); + +var _lodash = require('lodash'); + +var _lodash2 = _interopRequireDefault(_lodash); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } + +var SET_CONTENT_VIEW = exports.SET_CONTENT_VIEW = 'UI_FLOWVIEW_SET_CONTENT_VIEW', + DISPLAY_LARGE = exports.DISPLAY_LARGE = 'UI_FLOWVIEW_DISPLAY_LARGE', + SET_TAB = exports.SET_TAB = "UI_FLOWVIEW_SET_TAB", + START_EDIT = exports.START_EDIT = 'UI_FLOWVIEW_START_EDIT', + UPDATE_EDIT = exports.UPDATE_EDIT = 'UI_FLOWVIEW_UPDATE_EDIT', + UPLOAD_CONTENT = exports.UPLOAD_CONTENT = 'UI_FLOWVIEW_UPLOAD_CONTENT', + SET_SHOW_FULL_CONTENT = exports.SET_SHOW_FULL_CONTENT = 'UI_SET_SHOW_FULL_CONTENT', + SET_CONTENT_VIEW_DESCRIPTION = exports.SET_CONTENT_VIEW_DESCRIPTION = "UI_SET_CONTENT_VIEW_DESCRIPTION", + SET_CONTENT = exports.SET_CONTENT = "UI_SET_CONTENT"; + +var defaultState = { + displayLarge: false, + contentViewDescription: '', + showFullContent: false, + modifiedFlow: false, + contentView: 'Auto', + tab: 'request', + content: [], + maxContentLines: 80 +}; + +function reducer() { + var state = arguments.length <= 0 || arguments[0] === undefined ? defaultState : arguments[0]; + var action = arguments[1]; + + var wasInEditMode = !!state.modifiedFlow; + switch (action.type) { + + case START_EDIT: + return _extends({}, state, { + modifiedFlow: action.flow, + contentView: 'Edit', + showFullContent: true + }); + + case UPDATE_EDIT: + return _extends({}, state, { + modifiedFlow: _lodash2.default.merge({}, state.modifiedFlow, action.update) + }); + + case flowsActions.SELECT: + return _extends({}, state, { + modifiedFlow: false, + displayLarge: false, + contentView: wasInEditMode ? 'Auto' : state.contentView, + viewDescription: '', + showFullContent: false + }); + + case flowsActions.UPDATE: + // There is no explicit "stop edit" event. + // We stop editing when we receive an update for + // the currently edited flow from the server + if (action.item.id === state.modifiedFlow.id) { + return _extends({}, state, { + modifiedFlow: false, + displayLarge: false, + contentView: wasInEditMode ? 'Auto' : state.contentView, + viewDescription: '', + showFullContent: false + }); + } else { + return state; + } + + case SET_CONTENT_VIEW_DESCRIPTION: + return _extends({}, state, { + viewDescription: action.description + }); + + case SET_SHOW_FULL_CONTENT: + return _extends({}, state, { + showFullContent: action.show + }); + + case SET_TAB: + return _extends({}, state, { + tab: action.tab ? action.tab : 'request', + displayLarge: false, + showFullContent: false + }); + + case SET_CONTENT_VIEW: + return _extends({}, state, { + contentView: action.contentView, + showFullContent: action.contentView == 'Edit' + }); + + case SET_CONTENT: + var isFullContentShown = action.content.length < state.maxContentLines; + return _extends({}, state, { + content: action.content, + showFullContent: isFullContentShown + }); + + case DISPLAY_LARGE: + return _extends({}, state, { + displayLarge: true + }); + default: + return state; + } +} + +function setContentView(contentView) { + return { type: SET_CONTENT_VIEW, contentView: contentView }; +} + +function displayLarge() { + return { type: DISPLAY_LARGE }; +} + +function selectTab(tab) { + return { type: SET_TAB, tab: tab }; +} + +function startEdit(flow) { + return { type: START_EDIT, flow: flow }; +} + +function updateEdit(update) { + return { type: UPDATE_EDIT, update: update }; +} + +function setContentViewDescription(description) { + return { type: SET_CONTENT_VIEW_DESCRIPTION, description: description }; +} + +function setShowFullContent(show) { + return { type: SET_SHOW_FULL_CONTENT, show: show }; +} + +function updateEdit(update) { + return { type: UPDATE_EDIT, update: update }; +} + +function setContent(content) { + return { type: SET_CONTENT, content: content }; +} + +function stopEdit(flow, modifiedFlow) { + var diff = (0, _utils.getDiff)(flow, modifiedFlow); + return flowsActions.update(flow, diff); +} + +},{"../../utils":65,"../flows":52,"lodash":"lodash"}],57:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.SET_ACTIVE_MENU = undefined; + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +exports.default = reducer; +exports.setActiveMenu = setActiveMenu; + +var _flows = require('../flows'); + +var flowsActions = _interopRequireWildcard(_flows); + +function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } + +var SET_ACTIVE_MENU = exports.SET_ACTIVE_MENU = 'UI_SET_ACTIVE_MENU'; + +var defaultState = { + activeMenu: 'Start', + isFlowSelected: false +}; + +function reducer() { + var state = arguments.length <= 0 || arguments[0] === undefined ? defaultState : arguments[0]; + var action = arguments[1]; + + switch (action.type) { + + case SET_ACTIVE_MENU: + return _extends({}, state, { + activeMenu: action.activeMenu + }); + + case flowsActions.SELECT: + // First Select + if (action.flowIds.length && !state.isFlowSelected) { + return _extends({}, state, { + activeMenu: 'Flow', + isFlowSelected: true + }); + } + + // Deselect + if (!action.flowIds.length && state.isFlowSelected) { + var activeMenu = state.activeMenu; + if (activeMenu == 'Flow') { + activeMenu = 'Start'; + } + return _extends({}, state, { + activeMenu: activeMenu, + isFlowSelected: false + }); + } + return state; + default: + return state; + } +} + +function setActiveMenu(activeMenu) { + return { type: SET_ACTIVE_MENU, activeMenu: activeMenu }; +} + +},{"../flows":52}],58:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); + +var _redux = require('redux'); + +var _flow = require('./flow'); + +var _flow2 = _interopRequireDefault(_flow); + +var _header = require('./header'); + +var _header2 = _interopRequireDefault(_header); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +exports.default = (0, _redux.combineReducers)({ + flow: _flow2.default, + header: _header2.default +}); + +},{"./flow":56,"./header":57,"redux":"redux"}],59:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.onKeyDown = onKeyDown; + +var _utils = require('../../utils'); + +var _flowView = require('../flowView'); + +var _flow = require('./flow'); + +var _flows = require('../flows'); + +var flowsActions = _interopRequireWildcard(_flows); + +function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } + +function onKeyDown(e) { + console.debug("onKeyDown", e); + if (e.ctrlKey) { + return function () {}; + } + var key = e.keyCode; + var shiftKey = e.shiftKey; + e.preventDefault(); + return function (dispatch, getState) { + + var flow = getState().flows.byId[getState().flows.selected[0]]; + + switch (key) { + case _utils.Key.K: + case _utils.Key.UP: + dispatch((0, _flowView.selectRelative)(-1)); + break; + + case _utils.Key.J: + case _utils.Key.DOWN: + dispatch((0, _flowView.selectRelative)(+1)); + break; + + case _utils.Key.SPACE: + case _utils.Key.PAGE_DOWN: + dispatch((0, _flowView.selectRelative)(+10)); + break; + + case _utils.Key.PAGE_UP: + dispatch((0, _flowView.selectRelative)(-10)); + break; + + case _utils.Key.END: + dispatch((0, _flowView.selectRelative)(+1e10)); + break; + + case _utils.Key.HOME: + dispatch((0, _flowView.selectRelative)(-1e10)); + break; + + case _utils.Key.ESC: + dispatch(flowsActions.select(null)); + break; + + case _utils.Key.LEFT: + { + if (!flow) break; + var tabs = ['request', 'response', 'error'].filter(function (k) { + return flow[k]; + }).concat(['details']), + currentTab = getState().ui.flow.tab, + nextTab = tabs[(tabs.indexOf(currentTab) - 1 + tabs.length) % tabs.length]; + dispatch((0, _flow.selectTab)(nextTab)); + break; + } + + case _utils.Key.TAB: + case _utils.Key.RIGHT: + { + if (!flow) break; + var _tabs = ['request', 'response', 'error'].filter(function (k) { + return flow[k]; + }).concat(['details']), + _currentTab = getState().ui.flow.tab, + _nextTab = _tabs[(_tabs.indexOf(_currentTab) + 1) % _tabs.length]; + dispatch((0, _flow.selectTab)(_nextTab)); + break; + } + + case _utils.Key.C: + if (shiftKey) { + dispatch(flowsActions.clear()); + } + break; + + case _utils.Key.D: + { + if (!flow) { + return; + } + if (shiftKey) { + dispatch(flowsActions.duplicate(flow)); + } else { + dispatch(flowsActions.remove(flow)); + } + break; + } + + case _utils.Key.A: + { + if (shiftKey) { + dispatch(flowsActions.acceptAll()); + } else if (flow && flow.intercepted) { + dispatch(flowsActions.accept(flow)); + } + break; + } + + case _utils.Key.R: + { + if (!shiftKey && flow) { + dispatch(flowsActions.replay(flow)); + } + break; + } + + case _utils.Key.V: + { + if (!shiftKey && flow && flow.modified) { + dispatch(flowsActions.revert(flow)); + } + break; + } + + default: + return; + } + }; +} + +},{"../../utils":65,"../flowView":51,"../flows":52,"./flow":56}],60:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.RECEIVE = exports.REMOVE = exports.UPDATE = exports.ADD = undefined; + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +exports.default = reduce; +exports.add = add; +exports.update = update; +exports.remove = remove; +exports.receive = receive; + +var _lodash = require('lodash'); + +var _lodash2 = _interopRequireDefault(_lodash); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; } + +function _toConsumableArray(arr) { if (Array.isArray(arr)) { for (var i = 0, arr2 = Array(arr.length); i < arr.length; i++) { arr2[i] = arr[i]; } return arr2; } else { return Array.from(arr); } } + +var ADD = exports.ADD = 'LIST_ADD'; +var UPDATE = exports.UPDATE = 'LIST_UPDATE'; +var REMOVE = exports.REMOVE = 'LIST_REMOVE'; +var RECEIVE = exports.RECEIVE = 'LIST_RECEIVE'; + +var defaultState = { + data: [], + byId: {}, + indexOf: {} +}; + +function reduce() { + var state = arguments.length <= 0 || arguments[0] === undefined ? defaultState : arguments[0]; + var action = arguments[1]; + + switch (action.type) { + + case ADD: + return _extends({}, state, { + data: [].concat(_toConsumableArray(state.data), [action.item]), + byId: _extends({}, state.byId, _defineProperty({}, action.item.id, action.item)), + indexOf: _extends({}, state.indexOf, _defineProperty({}, action.item.id, state.data.length)) + }); + + case UPDATE: + { + var index = state.indexOf[action.item.id]; + + if (index == null) { + return state; + } + + var data = [].concat(_toConsumableArray(state.data)); + + data[index] = action.item; + + return _extends({}, state, { + data: data, + byId: _extends({}, state.byId, _defineProperty({}, action.item.id, action.item)) + }); + } + + case REMOVE: + { + var _index = state.indexOf[action.id]; + + if (_index == null) { + return state; + } + + var _data = [].concat(_toConsumableArray(state.data)); + var indexOf = _extends({}, state.indexOf, _defineProperty({}, action.id, null)); + + _data.splice(_index, 1); + for (var i = _data.length - 1; i >= _index; i--) { + indexOf[_data[i].id] = i; + } + + return _extends({}, state, { + data: _data, + indexOf: indexOf, + byId: _extends({}, state.byId, _defineProperty({}, action.id, null)) + }); + } + + case RECEIVE: + return _extends({}, state, { + data: action.list, + byId: _lodash2.default.fromPairs(action.list.map(function (item) { + return [item.id, item]; + })), + indexOf: _lodash2.default.fromPairs(action.list.map(function (item, index) { + return [item.id, index]; + })) + }); + + default: + return state; + } +} + +/** + * @public + */ +function add(item) { + return { type: ADD, item: item }; +} + +/** + * @public + */ +function update(item) { + return { type: UPDATE, item: item }; +} + +/** + * @public + */ +function remove(id) { + return { type: REMOVE, id: id }; +} + +/** + * @public + */ +function receive(list) { + return { type: RECEIVE, list: list }; +} + +},{"lodash":"lodash"}],61:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.RECEIVE = exports.REMOVE = exports.UPDATE = exports.ADD = exports.UPDATE_SORT = exports.UPDATE_FILTER = undefined; + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +exports.default = reduce; +exports.updateFilter = updateFilter; +exports.updateSort = updateSort; +exports.add = add; +exports.update = update; +exports.remove = remove; +exports.receive = receive; + +var _lodash = require('lodash'); + +var _lodash2 = _interopRequireDefault(_lodash); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; } + +function _toConsumableArray(arr) { if (Array.isArray(arr)) { for (var i = 0, arr2 = Array(arr.length); i < arr.length; i++) { arr2[i] = arr[i]; } return arr2; } else { return Array.from(arr); } } + +var UPDATE_FILTER = exports.UPDATE_FILTER = 'VIEW_UPDATE_FILTER'; +var UPDATE_SORT = exports.UPDATE_SORT = 'VIEW_UPDATE_SORT'; +var ADD = exports.ADD = 'VIEW_ADD'; +var UPDATE = exports.UPDATE = 'VIEW_UPDATE'; +var REMOVE = exports.REMOVE = 'VIEW_REMOVE'; +var RECEIVE = exports.RECEIVE = 'VIEW_RECEIVE'; + +var defaultState = { + data: [], + indexOf: {} +}; + +function reduce() { + var state = arguments.length <= 0 || arguments[0] === undefined ? defaultState : arguments[0]; + var action = arguments[1]; + + switch (action.type) { + + case UPDATE_FILTER: + { + var data = action.list.filter(action.filter).sort(action.sort); + return _extends({}, state, { + data: data, + indexOf: _lodash2.default.fromPairs(data.map(function (item, index) { + return [item.id, index]; + })) + }); + } + + case UPDATE_SORT: + { + var _data = [].concat(_toConsumableArray(state.data)).sort(action.sort); + return _extends({}, state, { + data: _data, + indexOf: _lodash2.default.fromPairs(_data.map(function (item, index) { + return [item.id, index]; + })) + }); + } + + case ADD: + if (state.indexOf[action.item.id] != null || !action.filter(action.item)) { + return state; + } + return _extends({}, state, sortedInsert(state, action.item, action.sort)); + + case REMOVE: + if (state.indexOf[action.id] == null) { + return state; + } + return _extends({}, state, sortedRemove(state, action.id)); + + case UPDATE: + var hasOldItem = state.indexOf[action.item.id] !== null && state.indexOf[action.item.id] !== undefined; + var hasNewItem = action.filter(action.item); + if (!hasNewItem && !hasOldItem) { + return state; + } + if (hasNewItem && !hasOldItem) { + return _extends({}, state, sortedInsert(state, action.item, action.sort)); + } + if (!hasNewItem && hasOldItem) { + return _extends({}, state, sortedRemove(state, action.item.id)); + } + if (hasNewItem && hasOldItem) { + return _extends({}, state, sortedUpdate(state, action.item, action.sort)); + } + case RECEIVE: + { + var _data2 = action.list.filter(action.filter).sort(action.sort); + return _extends({}, state, { + data: _data2, + indexOf: _lodash2.default.fromPairs(_data2.map(function (item, index) { + return [item.id, index]; + })) + }); + } + + default: + return state; + } +} + +function updateFilter(list) { + var filter = arguments.length <= 1 || arguments[1] === undefined ? defaultFilter : arguments[1]; + var sort = arguments.length <= 2 || arguments[2] === undefined ? defaultSort : arguments[2]; + + return { type: UPDATE_FILTER, list: list, filter: filter, sort: sort }; +} + +function updateSort() { + var sort = arguments.length <= 0 || arguments[0] === undefined ? defaultSort : arguments[0]; + + return { type: UPDATE_SORT, sort: sort }; +} + +function add(item) { + var filter = arguments.length <= 1 || arguments[1] === undefined ? defaultFilter : arguments[1]; + var sort = arguments.length <= 2 || arguments[2] === undefined ? defaultSort : arguments[2]; + + return { type: ADD, item: item, filter: filter, sort: sort }; +} + +function update(item) { + var filter = arguments.length <= 1 || arguments[1] === undefined ? defaultFilter : arguments[1]; + var sort = arguments.length <= 2 || arguments[2] === undefined ? defaultSort : arguments[2]; + + return { type: UPDATE, item: item, filter: filter, sort: sort }; +} + +function remove(id) { + return { type: REMOVE, id: id }; +} + +function receive(list) { + var filter = arguments.length <= 1 || arguments[1] === undefined ? defaultFilter : arguments[1]; + var sort = arguments.length <= 2 || arguments[2] === undefined ? defaultSort : arguments[2]; + + return { type: RECEIVE, list: list, filter: filter, sort: sort }; +} + +function sortedInsert(state, item, sort) { + var index = sortedIndex(state.data, item, sort); + var data = [].concat(_toConsumableArray(state.data)); + var indexOf = _extends({}, state.indexOf); + + data.splice(index, 0, item); + for (var i = data.length - 1; i >= index; i--) { + indexOf[data[i].id] = i; + } + + return { data: data, indexOf: indexOf }; +} + +function sortedRemove(state, id) { + var index = state.indexOf[id]; + var data = [].concat(_toConsumableArray(state.data)); + var indexOf = _extends({}, state.indexOf, _defineProperty({}, id, null)); + + data.splice(index, 1); + for (var i = data.length - 1; i >= index; i--) { + indexOf[data[i].id] = i; + } + + return { data: data, indexOf: indexOf }; +} + +function sortedUpdate(state, item, sort) { + var data = [].concat(_toConsumableArray(state.data)); + var indexOf = _extends({}, state.indexOf); + var index = indexOf[item.id]; + data[index] = item; + while (index + 1 < data.length && sort(data[index], data[index + 1]) > 0) { + data[index] = data[index + 1]; + data[index + 1] = item; + indexOf[item.id] = index + 1; + indexOf[data[index].id] = index; + ++index; + } + while (index > 0 && sort(data[index], data[index - 1]) < 0) { + data[index] = data[index - 1]; + data[index - 1] = item; + indexOf[item.id] = index - 1; + indexOf[data[index].id] = index; + --index; + } + return { data: data, indexOf: indexOf }; +} + +function sortedIndex(list, item, sort) { + var low = 0; + var high = list.length; + + while (low < high) { + var middle = low + high >>> 1; + if (sort(item, list[middle]) >= 0) { + low = middle + 1; + } else { + high = middle; + } + } + + return low; +} + +function defaultFilter() { + return true; +} + +function defaultSort(a, b) { + return 0; +} + +},{"lodash":"lodash"}],62:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.MESSAGE = exports.ERROR = exports.DISCONNECTED = exports.DISCONNECT = exports.CONNECTED = exports.CONNECT = exports.SYM_SOCKET = exports.CMD_RESET = exports.CMD_REMOVE = exports.CMD_UPDATE = exports.CMD_ADD = undefined; + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +exports.default = reduce; +exports.connect = connect; +exports.disconnect = disconnect; +exports.onConnect = onConnect; +exports.onMessage = onMessage; +exports.onDisconnect = onDisconnect; +exports.onError = onError; + +var _actions = require('../actions.js'); + +var _dispatcher = require('../dispatcher.js'); + +var _msgQueue = require('./msgQueue'); + +var msgQueueActions = _interopRequireWildcard(_msgQueue); + +var _eventLog = require('./eventLog'); + +var eventLogActions = _interopRequireWildcard(_eventLog); + +var _flows = require('./flows'); + +var flowsActions = _interopRequireWildcard(_flows); + +var _settings = require('./settings'); + +var settingsActions = _interopRequireWildcard(_settings); + +function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } + +function _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; } + +var CMD_ADD = exports.CMD_ADD = 'add'; +var CMD_UPDATE = exports.CMD_UPDATE = 'update'; +var CMD_REMOVE = exports.CMD_REMOVE = 'remove'; +var CMD_RESET = exports.CMD_RESET = 'reset'; + +var SYM_SOCKET = exports.SYM_SOCKET = Symbol('WEBSOCKET_SYM_SOCKET'); + +var CONNECT = exports.CONNECT = 'WEBSOCKET_CONNECT'; +var CONNECTED = exports.CONNECTED = 'WEBSOCKET_CONNECTED'; +var DISCONNECT = exports.DISCONNECT = 'WEBSOCKET_DISCONNECT'; +var DISCONNECTED = exports.DISCONNECTED = 'WEBSOCKET_DISCONNECTED'; +var ERROR = exports.ERROR = 'WEBSOCKET_ERROR'; +var MESSAGE = exports.MESSAGE = 'WEBSOCKET_MESSAGE'; + +/* we may want to have an error message attribute here at some point */ +var defaultState = { connected: false, socket: null }; + +function reduce() { + var _extends3; + + var state = arguments.length <= 0 || arguments[0] === undefined ? defaultState : arguments[0]; + var action = arguments[1]; + + switch (action.type) { + + case CONNECT: + return _extends({}, state, _defineProperty({}, SYM_SOCKET, action.socket)); + + case CONNECTED: + return _extends({}, state, { connected: true }); + + case DISCONNECT: + return _extends({}, state, { connected: false }); + + case DISCONNECTED: + return _extends({}, state, (_extends3 = {}, _defineProperty(_extends3, SYM_SOCKET, null), _defineProperty(_extends3, 'connected', false), _extends3)); + + default: + return state; + } +} + +function connect() { + return function (dispatch) { + var socket = new WebSocket(location.origin.replace('http', 'ws') + '/updates'); + + socket.addEventListener('open', function () { + return dispatch(onConnect()); + }); + socket.addEventListener('close', function () { + return dispatch(onDisconnect()); + }); + socket.addEventListener('message', function (msg) { + return dispatch(onMessage(JSON.parse(msg.data))); + }); + socket.addEventListener('error', function (error) { + return dispatch(onError(error)); + }); + + dispatch({ type: CONNECT, socket: socket }); + }; +} + +function disconnect() { + return function (dispatch, getState) { + getState().settings[SYM_SOCKET].close(); + dispatch({ type: DISCONNECT }); + }; +} + +function onConnect() { + // workaround to make sure that our state is already available. + return function (dispatch) { + dispatch({ type: CONNECTED }); + dispatch(settingsActions.fetchData()); + dispatch(flowsActions.fetchFlows()); + dispatch(eventLogActions.fetchData()); + }; +} + +function onMessage(msg) { + return msgQueueActions.handleWsMsg(msg); +} + +function onDisconnect() { + return function (dispatch) { + dispatch(eventLogActions.add('WebSocket connection closed.')); + dispatch({ type: DISCONNECTED }); + }; +} + +function onError(error) { + // @todo let event log subscribe WebSocketActions.ERROR + return function (dispatch) { + dispatch(eventLogActions.add('WebSocket connection error.')); + dispatch({ type: ERROR, error: error }); + }; +} + +},{"../actions.js":2,"../dispatcher.js":48,"./eventLog":50,"./flows":52,"./msgQueue":54,"./settings":55}],63:[function(require,module,exports){ +"use strict"; + +module.exports = function () { + "use strict"; + + /* + * Generated by PEG.js 0.9.0. + * + * http://pegjs.org/ + */ + + function peg$subclass(child, parent) { + function ctor() { + this.constructor = child; + } + ctor.prototype = parent.prototype; + child.prototype = new ctor(); + } + + function peg$SyntaxError(message, expected, found, location) { + this.message = message; + this.expected = expected; + this.found = found; + this.location = location; + this.name = "SyntaxError"; + + if (typeof Error.captureStackTrace === "function") { + Error.captureStackTrace(this, peg$SyntaxError); + } + } + + peg$subclass(peg$SyntaxError, Error); + + function peg$parse(input) { + var options = arguments.length > 1 ? arguments[1] : {}, + parser = this, + peg$FAILED = {}, + peg$startRuleFunctions = { start: peg$parsestart }, + peg$startRuleFunction = peg$parsestart, + peg$c0 = { type: "other", description: "filter expression" }, + peg$c1 = function peg$c1(orExpr) { + return orExpr; + }, + peg$c2 = { type: "other", description: "whitespace" }, + peg$c3 = /^[ \t\n\r]/, + peg$c4 = { type: "class", value: "[ \\t\\n\\r]", description: "[ \\t\\n\\r]" }, + peg$c5 = { type: "other", description: "control character" }, + peg$c6 = /^[|&!()~"]/, + peg$c7 = { type: "class", value: "[|&!()~\"]", description: "[|&!()~\"]" }, + peg$c8 = { type: "other", description: "optional whitespace" }, + peg$c9 = "|", + peg$c10 = { type: "literal", value: "|", description: "\"|\"" }, + peg$c11 = function peg$c11(first, second) { + return or(first, second); + }, + peg$c12 = "&", + peg$c13 = { type: "literal", value: "&", description: "\"&\"" }, + peg$c14 = function peg$c14(first, second) { + return and(first, second); + }, + peg$c15 = "!", + peg$c16 = { type: "literal", value: "!", description: "\"!\"" }, + peg$c17 = function peg$c17(expr) { + return not(expr); + }, + peg$c18 = "(", + peg$c19 = { type: "literal", value: "(", description: "\"(\"" }, + peg$c20 = ")", + peg$c21 = { type: "literal", value: ")", description: "\")\"" }, + peg$c22 = function peg$c22(expr) { + return binding(expr); + }, + peg$c23 = "~a", + peg$c24 = { type: "literal", value: "~a", description: "\"~a\"" }, + peg$c25 = function peg$c25() { + return assetFilter; + }, + peg$c26 = "~e", + peg$c27 = { type: "literal", value: "~e", description: "\"~e\"" }, + peg$c28 = function peg$c28() { + return errorFilter; + }, + peg$c29 = "~q", + peg$c30 = { type: "literal", value: "~q", description: "\"~q\"" }, + peg$c31 = function peg$c31() { + return noResponseFilter; + }, + peg$c32 = "~s", + peg$c33 = { type: "literal", value: "~s", description: "\"~s\"" }, + peg$c34 = function peg$c34() { + return responseFilter; + }, + peg$c35 = "true", + peg$c36 = { type: "literal", value: "true", description: "\"true\"" }, + peg$c37 = function peg$c37() { + return trueFilter; + }, + peg$c38 = "false", + peg$c39 = { type: "literal", value: "false", description: "\"false\"" }, + peg$c40 = function peg$c40() { + return falseFilter; + }, + peg$c41 = "~c", + peg$c42 = { type: "literal", value: "~c", description: "\"~c\"" }, + peg$c43 = function peg$c43(s) { + return responseCode(s); + }, + peg$c44 = "~d", + peg$c45 = { type: "literal", value: "~d", description: "\"~d\"" }, + peg$c46 = function peg$c46(s) { + return domain(s); + }, + peg$c47 = "~h", + peg$c48 = { type: "literal", value: "~h", description: "\"~h\"" }, + peg$c49 = function peg$c49(s) { + return header(s); + }, + peg$c50 = "~hq", + peg$c51 = { type: "literal", value: "~hq", description: "\"~hq\"" }, + peg$c52 = function peg$c52(s) { + return requestHeader(s); + }, + peg$c53 = "~hs", + peg$c54 = { type: "literal", value: "~hs", description: "\"~hs\"" }, + peg$c55 = function peg$c55(s) { + return responseHeader(s); + }, + peg$c56 = "~m", + peg$c57 = { type: "literal", value: "~m", description: "\"~m\"" }, + peg$c58 = function peg$c58(s) { + return method(s); + }, + peg$c59 = "~t", + peg$c60 = { type: "literal", value: "~t", description: "\"~t\"" }, + peg$c61 = function peg$c61(s) { + return contentType(s); + }, + peg$c62 = "~tq", + peg$c63 = { type: "literal", value: "~tq", description: "\"~tq\"" }, + peg$c64 = function peg$c64(s) { + return requestContentType(s); + }, + peg$c65 = "~ts", + peg$c66 = { type: "literal", value: "~ts", description: "\"~ts\"" }, + peg$c67 = function peg$c67(s) { + return responseContentType(s); + }, + peg$c68 = "~u", + peg$c69 = { type: "literal", value: "~u", description: "\"~u\"" }, + peg$c70 = function peg$c70(s) { + return url(s); + }, + peg$c71 = { type: "other", description: "integer" }, + peg$c72 = /^['"]/, + peg$c73 = { type: "class", value: "['\"]", description: "['\"]" }, + peg$c74 = /^[0-9]/, + peg$c75 = { type: "class", value: "[0-9]", description: "[0-9]" }, + peg$c76 = function peg$c76(digits) { + return parseInt(digits.join(""), 10); + }, + peg$c77 = { type: "other", description: "string" }, + peg$c78 = "\"", + peg$c79 = { type: "literal", value: "\"", description: "\"\\\"\"" }, + peg$c80 = function peg$c80(chars) { + return chars.join(""); + }, + peg$c81 = "'", + peg$c82 = { type: "literal", value: "'", description: "\"'\"" }, + peg$c83 = /^["\\]/, + peg$c84 = { type: "class", value: "[\"\\\\]", description: "[\"\\\\]" }, + peg$c85 = { type: "any", description: "any character" }, + peg$c86 = function peg$c86(char) { + return char; + }, + peg$c87 = "\\", + peg$c88 = { type: "literal", value: "\\", description: "\"\\\\\"" }, + peg$c89 = /^['\\]/, + peg$c90 = { type: "class", value: "['\\\\]", description: "['\\\\]" }, + peg$c91 = /^['"\\]/, + peg$c92 = { type: "class", value: "['\"\\\\]", description: "['\"\\\\]" }, + peg$c93 = "n", + peg$c94 = { type: "literal", value: "n", description: "\"n\"" }, + peg$c95 = function peg$c95() { + return "\n"; + }, + peg$c96 = "r", + peg$c97 = { type: "literal", value: "r", description: "\"r\"" }, + peg$c98 = function peg$c98() { + return "\r"; + }, + peg$c99 = "t", + peg$c100 = { type: "literal", value: "t", description: "\"t\"" }, + peg$c101 = function peg$c101() { + return "\t"; + }, + peg$currPos = 0, + peg$savedPos = 0, + peg$posDetailsCache = [{ line: 1, column: 1, seenCR: false }], + peg$maxFailPos = 0, + peg$maxFailExpected = [], + peg$silentFails = 0, + peg$result; + + if ("startRule" in options) { + if (!(options.startRule in peg$startRuleFunctions)) { + throw new Error("Can't start parsing from rule \"" + options.startRule + "\"."); + } + + peg$startRuleFunction = peg$startRuleFunctions[options.startRule]; + } + + function text() { + return input.substring(peg$savedPos, peg$currPos); + } + + function location() { + return peg$computeLocation(peg$savedPos, peg$currPos); + } + + function expected(description) { + throw peg$buildException(null, [{ type: "other", description: description }], input.substring(peg$savedPos, peg$currPos), peg$computeLocation(peg$savedPos, peg$currPos)); + } + + function error(message) { + throw peg$buildException(message, null, input.substring(peg$savedPos, peg$currPos), peg$computeLocation(peg$savedPos, peg$currPos)); + } + + function peg$computePosDetails(pos) { + var details = peg$posDetailsCache[pos], + p, + ch; + + if (details) { + return details; + } else { + p = pos - 1; + while (!peg$posDetailsCache[p]) { + p--; + } + + details = peg$posDetailsCache[p]; + details = { + line: details.line, + column: details.column, + seenCR: details.seenCR + }; + + while (p < pos) { + ch = input.charAt(p); + if (ch === "\n") { + if (!details.seenCR) { + details.line++; + } + details.column = 1; + details.seenCR = false; + } else if (ch === "\r" || ch === "\u2028" || ch === "\u2029") { + details.line++; + details.column = 1; + details.seenCR = true; + } else { + details.column++; + details.seenCR = false; + } + + p++; + } + + peg$posDetailsCache[pos] = details; + return details; + } + } + + function peg$computeLocation(startPos, endPos) { + var startPosDetails = peg$computePosDetails(startPos), + endPosDetails = peg$computePosDetails(endPos); + + return { + start: { + offset: startPos, + line: startPosDetails.line, + column: startPosDetails.column + }, + end: { + offset: endPos, + line: endPosDetails.line, + column: endPosDetails.column + } + }; + } + + function peg$fail(expected) { + if (peg$currPos < peg$maxFailPos) { + return; + } + + if (peg$currPos > peg$maxFailPos) { + peg$maxFailPos = peg$currPos; + peg$maxFailExpected = []; + } + + peg$maxFailExpected.push(expected); + } + + function peg$buildException(message, expected, found, location) { + function cleanupExpected(expected) { + var i = 1; + + expected.sort(function (a, b) { + if (a.description < b.description) { + return -1; + } else if (a.description > b.description) { + return 1; + } else { + return 0; + } + }); + + while (i < expected.length) { + if (expected[i - 1] === expected[i]) { + expected.splice(i, 1); + } else { + i++; + } + } + } + + function buildMessage(expected, found) { + function stringEscape(s) { + function hex(ch) { + return ch.charCodeAt(0).toString(16).toUpperCase(); + } + + return s.replace(/\\/g, '\\\\').replace(/"/g, '\\"').replace(/\x08/g, '\\b').replace(/\t/g, '\\t').replace(/\n/g, '\\n').replace(/\f/g, '\\f').replace(/\r/g, '\\r').replace(/[\x00-\x07\x0B\x0E\x0F]/g, function (ch) { + return '\\x0' + hex(ch); + }).replace(/[\x10-\x1F\x80-\xFF]/g, function (ch) { + return '\\x' + hex(ch); + }).replace(/[\u0100-\u0FFF]/g, function (ch) { + return "\\u0" + hex(ch); + }).replace(/[\u1000-\uFFFF]/g, function (ch) { + return "\\u" + hex(ch); + }); + } + + var expectedDescs = new Array(expected.length), + expectedDesc, + foundDesc, + i; + + for (i = 0; i < expected.length; i++) { + expectedDescs[i] = expected[i].description; + } + + expectedDesc = expected.length > 1 ? expectedDescs.slice(0, -1).join(", ") + " or " + expectedDescs[expected.length - 1] : expectedDescs[0]; + + foundDesc = found ? "\"" + stringEscape(found) + "\"" : "end of input"; + + return "Expected " + expectedDesc + " but " + foundDesc + " found."; + } + + if (expected !== null) { + cleanupExpected(expected); + } + + return new peg$SyntaxError(message !== null ? message : buildMessage(expected, found), expected, found, location); + } + + function peg$parsestart() { + var s0, s1, s2, s3; + + peg$silentFails++; + s0 = peg$currPos; + s1 = peg$parse__(); + if (s1 !== peg$FAILED) { + s2 = peg$parseOrExpr(); + if (s2 !== peg$FAILED) { + s3 = peg$parse__(); + if (s3 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c1(s2); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + peg$silentFails--; + if (s0 === peg$FAILED) { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c0); + } + } + + return s0; + } + + function peg$parsews() { + var s0, s1; + + peg$silentFails++; + if (peg$c3.test(input.charAt(peg$currPos))) { + s0 = input.charAt(peg$currPos); + peg$currPos++; + } else { + s0 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c4); + } + } + peg$silentFails--; + if (s0 === peg$FAILED) { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c2); + } + } + + return s0; + } + + function peg$parsecc() { + var s0, s1; + + peg$silentFails++; + if (peg$c6.test(input.charAt(peg$currPos))) { + s0 = input.charAt(peg$currPos); + peg$currPos++; + } else { + s0 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c7); + } + } + peg$silentFails--; + if (s0 === peg$FAILED) { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c5); + } + } + + return s0; + } + + function peg$parse__() { + var s0, s1; + + peg$silentFails++; + s0 = []; + s1 = peg$parsews(); + while (s1 !== peg$FAILED) { + s0.push(s1); + s1 = peg$parsews(); + } + peg$silentFails--; + if (s0 === peg$FAILED) { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c8); + } + } + + return s0; + } + + function peg$parseOrExpr() { + var s0, s1, s2, s3, s4, s5; + + s0 = peg$currPos; + s1 = peg$parseAndExpr(); + if (s1 !== peg$FAILED) { + s2 = peg$parse__(); + if (s2 !== peg$FAILED) { + if (input.charCodeAt(peg$currPos) === 124) { + s3 = peg$c9; + peg$currPos++; + } else { + s3 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c10); + } + } + if (s3 !== peg$FAILED) { + s4 = peg$parse__(); + if (s4 !== peg$FAILED) { + s5 = peg$parseOrExpr(); + if (s5 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c11(s1, s5); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + if (s0 === peg$FAILED) { + s0 = peg$parseAndExpr(); + } + + return s0; + } + + function peg$parseAndExpr() { + var s0, s1, s2, s3, s4, s5; + + s0 = peg$currPos; + s1 = peg$parseNotExpr(); + if (s1 !== peg$FAILED) { + s2 = peg$parse__(); + if (s2 !== peg$FAILED) { + if (input.charCodeAt(peg$currPos) === 38) { + s3 = peg$c12; + peg$currPos++; + } else { + s3 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c13); + } + } + if (s3 !== peg$FAILED) { + s4 = peg$parse__(); + if (s4 !== peg$FAILED) { + s5 = peg$parseAndExpr(); + if (s5 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c14(s1, s5); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + if (s0 === peg$FAILED) { + s0 = peg$currPos; + s1 = peg$parseNotExpr(); + if (s1 !== peg$FAILED) { + s2 = []; + s3 = peg$parsews(); + if (s3 !== peg$FAILED) { + while (s3 !== peg$FAILED) { + s2.push(s3); + s3 = peg$parsews(); + } + } else { + s2 = peg$FAILED; + } + if (s2 !== peg$FAILED) { + s3 = peg$parseAndExpr(); + if (s3 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c14(s1, s3); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + if (s0 === peg$FAILED) { + s0 = peg$parseNotExpr(); + } + } + + return s0; + } + + function peg$parseNotExpr() { + var s0, s1, s2, s3; + + s0 = peg$currPos; + if (input.charCodeAt(peg$currPos) === 33) { + s1 = peg$c15; + peg$currPos++; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c16); + } + } + if (s1 !== peg$FAILED) { + s2 = peg$parse__(); + if (s2 !== peg$FAILED) { + s3 = peg$parseNotExpr(); + if (s3 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c17(s3); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + if (s0 === peg$FAILED) { + s0 = peg$parseBindingExpr(); + } + + return s0; + } + + function peg$parseBindingExpr() { + var s0, s1, s2, s3, s4, s5; + + s0 = peg$currPos; + if (input.charCodeAt(peg$currPos) === 40) { + s1 = peg$c18; + peg$currPos++; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c19); + } + } + if (s1 !== peg$FAILED) { + s2 = peg$parse__(); + if (s2 !== peg$FAILED) { + s3 = peg$parseOrExpr(); + if (s3 !== peg$FAILED) { + s4 = peg$parse__(); + if (s4 !== peg$FAILED) { + if (input.charCodeAt(peg$currPos) === 41) { + s5 = peg$c20; + peg$currPos++; + } else { + s5 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c21); + } + } + if (s5 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c22(s3); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + if (s0 === peg$FAILED) { + s0 = peg$parseExpr(); + } + + return s0; + } + + function peg$parseExpr() { + var s0; + + s0 = peg$parseNullaryExpr(); + if (s0 === peg$FAILED) { + s0 = peg$parseUnaryExpr(); + } + + return s0; + } + + function peg$parseNullaryExpr() { + var s0, s1; + + s0 = peg$parseBooleanLiteral(); + if (s0 === peg$FAILED) { + s0 = peg$currPos; + if (input.substr(peg$currPos, 2) === peg$c23) { + s1 = peg$c23; + peg$currPos += 2; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c24); + } + } + if (s1 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c25(); + } + s0 = s1; + if (s0 === peg$FAILED) { + s0 = peg$currPos; + if (input.substr(peg$currPos, 2) === peg$c26) { + s1 = peg$c26; + peg$currPos += 2; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c27); + } + } + if (s1 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c28(); + } + s0 = s1; + if (s0 === peg$FAILED) { + s0 = peg$currPos; + if (input.substr(peg$currPos, 2) === peg$c29) { + s1 = peg$c29; + peg$currPos += 2; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c30); + } + } + if (s1 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c31(); + } + s0 = s1; + if (s0 === peg$FAILED) { + s0 = peg$currPos; + if (input.substr(peg$currPos, 2) === peg$c32) { + s1 = peg$c32; + peg$currPos += 2; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c33); + } + } + if (s1 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c34(); + } + s0 = s1; + } + } + } + } + + return s0; + } + + function peg$parseBooleanLiteral() { + var s0, s1; + + s0 = peg$currPos; + if (input.substr(peg$currPos, 4) === peg$c35) { + s1 = peg$c35; + peg$currPos += 4; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c36); + } + } + if (s1 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c37(); + } + s0 = s1; + if (s0 === peg$FAILED) { + s0 = peg$currPos; + if (input.substr(peg$currPos, 5) === peg$c38) { + s1 = peg$c38; + peg$currPos += 5; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c39); + } + } + if (s1 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c40(); + } + s0 = s1; + } + + return s0; + } + + function peg$parseUnaryExpr() { + var s0, s1, s2, s3; + + s0 = peg$currPos; + if (input.substr(peg$currPos, 2) === peg$c41) { + s1 = peg$c41; + peg$currPos += 2; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c42); + } + } + if (s1 !== peg$FAILED) { + s2 = []; + s3 = peg$parsews(); + if (s3 !== peg$FAILED) { + while (s3 !== peg$FAILED) { + s2.push(s3); + s3 = peg$parsews(); + } + } else { + s2 = peg$FAILED; + } + if (s2 !== peg$FAILED) { + s3 = peg$parseIntegerLiteral(); + if (s3 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c43(s3); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + if (s0 === peg$FAILED) { + s0 = peg$currPos; + if (input.substr(peg$currPos, 2) === peg$c44) { + s1 = peg$c44; + peg$currPos += 2; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c45); + } + } + if (s1 !== peg$FAILED) { + s2 = []; + s3 = peg$parsews(); + if (s3 !== peg$FAILED) { + while (s3 !== peg$FAILED) { + s2.push(s3); + s3 = peg$parsews(); + } + } else { + s2 = peg$FAILED; + } + if (s2 !== peg$FAILED) { + s3 = peg$parseStringLiteral(); + if (s3 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c46(s3); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + if (s0 === peg$FAILED) { + s0 = peg$currPos; + if (input.substr(peg$currPos, 2) === peg$c47) { + s1 = peg$c47; + peg$currPos += 2; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c48); + } + } + if (s1 !== peg$FAILED) { + s2 = []; + s3 = peg$parsews(); + if (s3 !== peg$FAILED) { + while (s3 !== peg$FAILED) { + s2.push(s3); + s3 = peg$parsews(); + } + } else { + s2 = peg$FAILED; + } + if (s2 !== peg$FAILED) { + s3 = peg$parseStringLiteral(); + if (s3 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c49(s3); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + if (s0 === peg$FAILED) { + s0 = peg$currPos; + if (input.substr(peg$currPos, 3) === peg$c50) { + s1 = peg$c50; + peg$currPos += 3; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c51); + } + } + if (s1 !== peg$FAILED) { + s2 = []; + s3 = peg$parsews(); + if (s3 !== peg$FAILED) { + while (s3 !== peg$FAILED) { + s2.push(s3); + s3 = peg$parsews(); + } + } else { + s2 = peg$FAILED; + } + if (s2 !== peg$FAILED) { + s3 = peg$parseStringLiteral(); + if (s3 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c52(s3); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + if (s0 === peg$FAILED) { + s0 = peg$currPos; + if (input.substr(peg$currPos, 3) === peg$c53) { + s1 = peg$c53; + peg$currPos += 3; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c54); + } + } + if (s1 !== peg$FAILED) { + s2 = []; + s3 = peg$parsews(); + if (s3 !== peg$FAILED) { + while (s3 !== peg$FAILED) { + s2.push(s3); + s3 = peg$parsews(); + } + } else { + s2 = peg$FAILED; + } + if (s2 !== peg$FAILED) { + s3 = peg$parseStringLiteral(); + if (s3 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c55(s3); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + if (s0 === peg$FAILED) { + s0 = peg$currPos; + if (input.substr(peg$currPos, 2) === peg$c56) { + s1 = peg$c56; + peg$currPos += 2; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c57); + } + } + if (s1 !== peg$FAILED) { + s2 = []; + s3 = peg$parsews(); + if (s3 !== peg$FAILED) { + while (s3 !== peg$FAILED) { + s2.push(s3); + s3 = peg$parsews(); + } + } else { + s2 = peg$FAILED; + } + if (s2 !== peg$FAILED) { + s3 = peg$parseStringLiteral(); + if (s3 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c58(s3); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + if (s0 === peg$FAILED) { + s0 = peg$currPos; + if (input.substr(peg$currPos, 2) === peg$c59) { + s1 = peg$c59; + peg$currPos += 2; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c60); + } + } + if (s1 !== peg$FAILED) { + s2 = []; + s3 = peg$parsews(); + if (s3 !== peg$FAILED) { + while (s3 !== peg$FAILED) { + s2.push(s3); + s3 = peg$parsews(); + } + } else { + s2 = peg$FAILED; + } + if (s2 !== peg$FAILED) { + s3 = peg$parseStringLiteral(); + if (s3 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c61(s3); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + if (s0 === peg$FAILED) { + s0 = peg$currPos; + if (input.substr(peg$currPos, 3) === peg$c62) { + s1 = peg$c62; + peg$currPos += 3; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c63); + } + } + if (s1 !== peg$FAILED) { + s2 = []; + s3 = peg$parsews(); + if (s3 !== peg$FAILED) { + while (s3 !== peg$FAILED) { + s2.push(s3); + s3 = peg$parsews(); + } + } else { + s2 = peg$FAILED; + } + if (s2 !== peg$FAILED) { + s3 = peg$parseStringLiteral(); + if (s3 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c64(s3); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + if (s0 === peg$FAILED) { + s0 = peg$currPos; + if (input.substr(peg$currPos, 3) === peg$c65) { + s1 = peg$c65; + peg$currPos += 3; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c66); + } + } + if (s1 !== peg$FAILED) { + s2 = []; + s3 = peg$parsews(); + if (s3 !== peg$FAILED) { + while (s3 !== peg$FAILED) { + s2.push(s3); + s3 = peg$parsews(); + } + } else { + s2 = peg$FAILED; + } + if (s2 !== peg$FAILED) { + s3 = peg$parseStringLiteral(); + if (s3 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c67(s3); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + if (s0 === peg$FAILED) { + s0 = peg$currPos; + if (input.substr(peg$currPos, 2) === peg$c68) { + s1 = peg$c68; + peg$currPos += 2; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c69); + } + } + if (s1 !== peg$FAILED) { + s2 = []; + s3 = peg$parsews(); + if (s3 !== peg$FAILED) { + while (s3 !== peg$FAILED) { + s2.push(s3); + s3 = peg$parsews(); + } + } else { + s2 = peg$FAILED; + } + if (s2 !== peg$FAILED) { + s3 = peg$parseStringLiteral(); + if (s3 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c70(s3); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + if (s0 === peg$FAILED) { + s0 = peg$currPos; + s1 = peg$parseStringLiteral(); + if (s1 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c70(s1); + } + s0 = s1; + } + } + } + } + } + } + } + } + } + } + + return s0; + } + + function peg$parseIntegerLiteral() { + var s0, s1, s2, s3; + + peg$silentFails++; + s0 = peg$currPos; + if (peg$c72.test(input.charAt(peg$currPos))) { + s1 = input.charAt(peg$currPos); + peg$currPos++; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c73); + } + } + if (s1 === peg$FAILED) { + s1 = null; + } + if (s1 !== peg$FAILED) { + s2 = []; + if (peg$c74.test(input.charAt(peg$currPos))) { + s3 = input.charAt(peg$currPos); + peg$currPos++; + } else { + s3 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c75); + } + } + if (s3 !== peg$FAILED) { + while (s3 !== peg$FAILED) { + s2.push(s3); + if (peg$c74.test(input.charAt(peg$currPos))) { + s3 = input.charAt(peg$currPos); + peg$currPos++; + } else { + s3 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c75); + } + } + } + } else { + s2 = peg$FAILED; + } + if (s2 !== peg$FAILED) { + if (peg$c72.test(input.charAt(peg$currPos))) { + s3 = input.charAt(peg$currPos); + peg$currPos++; + } else { + s3 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c73); + } + } + if (s3 === peg$FAILED) { + s3 = null; + } + if (s3 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c76(s2); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + peg$silentFails--; + if (s0 === peg$FAILED) { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c71); + } + } + + return s0; + } + + function peg$parseStringLiteral() { + var s0, s1, s2, s3; + + peg$silentFails++; + s0 = peg$currPos; + if (input.charCodeAt(peg$currPos) === 34) { + s1 = peg$c78; + peg$currPos++; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c79); + } + } + if (s1 !== peg$FAILED) { + s2 = []; + s3 = peg$parseDoubleStringChar(); + while (s3 !== peg$FAILED) { + s2.push(s3); + s3 = peg$parseDoubleStringChar(); + } + if (s2 !== peg$FAILED) { + if (input.charCodeAt(peg$currPos) === 34) { + s3 = peg$c78; + peg$currPos++; + } else { + s3 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c79); + } + } + if (s3 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c80(s2); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + if (s0 === peg$FAILED) { + s0 = peg$currPos; + if (input.charCodeAt(peg$currPos) === 39) { + s1 = peg$c81; + peg$currPos++; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c82); + } + } + if (s1 !== peg$FAILED) { + s2 = []; + s3 = peg$parseSingleStringChar(); + while (s3 !== peg$FAILED) { + s2.push(s3); + s3 = peg$parseSingleStringChar(); + } + if (s2 !== peg$FAILED) { + if (input.charCodeAt(peg$currPos) === 39) { + s3 = peg$c81; + peg$currPos++; + } else { + s3 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c82); + } + } + if (s3 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c80(s2); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + if (s0 === peg$FAILED) { + s0 = peg$currPos; + s1 = peg$currPos; + peg$silentFails++; + s2 = peg$parsecc(); + peg$silentFails--; + if (s2 === peg$FAILED) { + s1 = void 0; + } else { + peg$currPos = s1; + s1 = peg$FAILED; + } + if (s1 !== peg$FAILED) { + s2 = []; + s3 = peg$parseUnquotedStringChar(); + if (s3 !== peg$FAILED) { + while (s3 !== peg$FAILED) { + s2.push(s3); + s3 = peg$parseUnquotedStringChar(); + } + } else { + s2 = peg$FAILED; + } + if (s2 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c80(s2); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } + } + peg$silentFails--; + if (s0 === peg$FAILED) { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c77); + } + } + + return s0; + } + + function peg$parseDoubleStringChar() { + var s0, s1, s2; + + s0 = peg$currPos; + s1 = peg$currPos; + peg$silentFails++; + if (peg$c83.test(input.charAt(peg$currPos))) { + s2 = input.charAt(peg$currPos); + peg$currPos++; + } else { + s2 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c84); + } + } + peg$silentFails--; + if (s2 === peg$FAILED) { + s1 = void 0; + } else { + peg$currPos = s1; + s1 = peg$FAILED; + } + if (s1 !== peg$FAILED) { + if (input.length > peg$currPos) { + s2 = input.charAt(peg$currPos); + peg$currPos++; + } else { + s2 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c85); + } + } + if (s2 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c86(s2); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + if (s0 === peg$FAILED) { + s0 = peg$currPos; + if (input.charCodeAt(peg$currPos) === 92) { + s1 = peg$c87; + peg$currPos++; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c88); + } + } + if (s1 !== peg$FAILED) { + s2 = peg$parseEscapeSequence(); + if (s2 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c86(s2); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } + + return s0; + } + + function peg$parseSingleStringChar() { + var s0, s1, s2; + + s0 = peg$currPos; + s1 = peg$currPos; + peg$silentFails++; + if (peg$c89.test(input.charAt(peg$currPos))) { + s2 = input.charAt(peg$currPos); + peg$currPos++; + } else { + s2 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c90); + } + } + peg$silentFails--; + if (s2 === peg$FAILED) { + s1 = void 0; + } else { + peg$currPos = s1; + s1 = peg$FAILED; + } + if (s1 !== peg$FAILED) { + if (input.length > peg$currPos) { + s2 = input.charAt(peg$currPos); + peg$currPos++; + } else { + s2 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c85); + } + } + if (s2 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c86(s2); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + if (s0 === peg$FAILED) { + s0 = peg$currPos; + if (input.charCodeAt(peg$currPos) === 92) { + s1 = peg$c87; + peg$currPos++; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c88); + } + } + if (s1 !== peg$FAILED) { + s2 = peg$parseEscapeSequence(); + if (s2 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c86(s2); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } + + return s0; + } + + function peg$parseUnquotedStringChar() { + var s0, s1, s2; + + s0 = peg$currPos; + s1 = peg$currPos; + peg$silentFails++; + s2 = peg$parsews(); + peg$silentFails--; + if (s2 === peg$FAILED) { + s1 = void 0; + } else { + peg$currPos = s1; + s1 = peg$FAILED; + } + if (s1 !== peg$FAILED) { + if (input.length > peg$currPos) { + s2 = input.charAt(peg$currPos); + peg$currPos++; + } else { + s2 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c85); + } + } + if (s2 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c86(s2); + s0 = s1; + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + } else { + peg$currPos = s0; + s0 = peg$FAILED; + } + + return s0; + } + + function peg$parseEscapeSequence() { + var s0, s1; + + if (peg$c91.test(input.charAt(peg$currPos))) { + s0 = input.charAt(peg$currPos); + peg$currPos++; + } else { + s0 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c92); + } + } + if (s0 === peg$FAILED) { + s0 = peg$currPos; + if (input.charCodeAt(peg$currPos) === 110) { + s1 = peg$c93; + peg$currPos++; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c94); + } + } + if (s1 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c95(); + } + s0 = s1; + if (s0 === peg$FAILED) { + s0 = peg$currPos; + if (input.charCodeAt(peg$currPos) === 114) { + s1 = peg$c96; + peg$currPos++; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c97); + } + } + if (s1 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c98(); + } + s0 = s1; + if (s0 === peg$FAILED) { + s0 = peg$currPos; + if (input.charCodeAt(peg$currPos) === 116) { + s1 = peg$c99; + peg$currPos++; + } else { + s1 = peg$FAILED; + if (peg$silentFails === 0) { + peg$fail(peg$c100); + } + } + if (s1 !== peg$FAILED) { + peg$savedPos = s0; + s1 = peg$c101(); + } + s0 = s1; + } + } + } + + return s0; + } + + var flowutils = require("../flow/utils.js"); + + function or(first, second) { + // Add explicit function names to ease debugging. + function orFilter() { + return first.apply(this, arguments) || second.apply(this, arguments); + } + orFilter.desc = first.desc + " or " + second.desc; + return orFilter; + } + function and(first, second) { + function andFilter() { + return first.apply(this, arguments) && second.apply(this, arguments); + } + andFilter.desc = first.desc + " and " + second.desc; + return andFilter; + } + function not(expr) { + function notFilter() { + return !expr.apply(this, arguments); + } + notFilter.desc = "not " + expr.desc; + return notFilter; + } + function binding(expr) { + function bindingFilter() { + return expr.apply(this, arguments); + } + bindingFilter.desc = "(" + expr.desc + ")"; + return bindingFilter; + } + function trueFilter(flow) { + return true; + } + trueFilter.desc = "true"; + function falseFilter(flow) { + return false; + } + falseFilter.desc = "false"; + + var ASSET_TYPES = [new RegExp("text/javascript"), new RegExp("application/x-javascript"), new RegExp("application/javascript"), new RegExp("text/css"), new RegExp("image/.*"), new RegExp("application/x-shockwave-flash")]; + function assetFilter(flow) { + if (flow.response) { + var ct = flowutils.ResponseUtils.getContentType(flow.response); + var i = ASSET_TYPES.length; + while (i--) { + if (ASSET_TYPES[i].test(ct)) { + return true; + } + } + } + return false; + } + assetFilter.desc = "is asset"; + function responseCode(code) { + function responseCodeFilter(flow) { + return flow.response && flow.response.status_code === code; + } + responseCodeFilter.desc = "resp. code is " + code; + return responseCodeFilter; + } + function domain(regex) { + regex = new RegExp(regex, "i"); + function domainFilter(flow) { + return flow.request && regex.test(flow.request.host); + } + domainFilter.desc = "domain matches " + regex; + return domainFilter; + } + function errorFilter(flow) { + return !!flow.error; + } + errorFilter.desc = "has error"; + function header(regex) { + regex = new RegExp(regex, "i"); + function headerFilter(flow) { + return flow.request && flowutils.RequestUtils.match_header(flow.request, regex) || flow.response && flowutils.ResponseUtils.match_header(flow.response, regex); + } + headerFilter.desc = "header matches " + regex; + return headerFilter; + } + function requestHeader(regex) { + regex = new RegExp(regex, "i"); + function requestHeaderFilter(flow) { + return flow.request && flowutils.RequestUtils.match_header(flow.request, regex); + } + requestHeaderFilter.desc = "req. header matches " + regex; + return requestHeaderFilter; + } + function responseHeader(regex) { + regex = new RegExp(regex, "i"); + function responseHeaderFilter(flow) { + return flow.response && flowutils.ResponseUtils.match_header(flow.response, regex); + } + responseHeaderFilter.desc = "resp. header matches " + regex; + return responseHeaderFilter; + } + function method(regex) { + regex = new RegExp(regex, "i"); + function methodFilter(flow) { + return flow.request && regex.test(flow.request.method); + } + methodFilter.desc = "method matches " + regex; + return methodFilter; + } + function noResponseFilter(flow) { + return flow.request && !flow.response; + } + noResponseFilter.desc = "has no response"; + function responseFilter(flow) { + return !!flow.response; + } + responseFilter.desc = "has response"; + + function contentType(regex) { + regex = new RegExp(regex, "i"); + function contentTypeFilter(flow) { + return flow.request && regex.test(flowutils.RequestUtils.getContentType(flow.request)) || flow.response && regex.test(flowutils.ResponseUtils.getContentType(flow.response)); + } + contentTypeFilter.desc = "content type matches " + regex; + return contentTypeFilter; + } + function requestContentType(regex) { + regex = new RegExp(regex, "i"); + function requestContentTypeFilter(flow) { + return flow.request && regex.test(flowutils.RequestUtils.getContentType(flow.request)); + } + requestContentTypeFilter.desc = "req. content type matches " + regex; + return requestContentTypeFilter; + } + function responseContentType(regex) { + regex = new RegExp(regex, "i"); + function responseContentTypeFilter(flow) { + return flow.response && regex.test(flowutils.ResponseUtils.getContentType(flow.response)); + } + responseContentTypeFilter.desc = "resp. content type matches " + regex; + return responseContentTypeFilter; + } + function url(regex) { + regex = new RegExp(regex, "i"); + function urlFilter(flow) { + return flow.request && regex.test(flowutils.RequestUtils.pretty_url(flow.request)); + } + urlFilter.desc = "url matches " + regex; + return urlFilter; + } + + peg$result = peg$startRuleFunction(); + + if (peg$result !== peg$FAILED && peg$currPos === input.length) { + return peg$result; + } else { + if (peg$result !== peg$FAILED && peg$currPos < input.length) { + peg$fail({ type: "end", description: "end of input" }); + } + + throw peg$buildException(null, peg$maxFailExpected, peg$maxFailPos < input.length ? input.charAt(peg$maxFailPos) : null, peg$maxFailPos < input.length ? peg$computeLocation(peg$maxFailPos, peg$maxFailPos + 1) : peg$computeLocation(peg$maxFailPos, peg$maxFailPos)); + } + } + + return { + SyntaxError: peg$SyntaxError, + parse: peg$parse + }; +}(); + +},{"../flow/utils.js":64}],64:[function(require,module,exports){ +"use strict"; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.isValidHttpVersion = exports.parseUrl = exports.ResponseUtils = exports.RequestUtils = exports.MessageUtils = undefined; + +var _lodash = require("lodash"); + +var _lodash2 = _interopRequireDefault(_lodash); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +var defaultPorts = { + "http": 80, + "https": 443 +}; + +var MessageUtils = exports.MessageUtils = { + getContentType: function getContentType(message) { + var ct = this.get_first_header(message, /^Content-Type$/i); + if (ct) { + return ct.split(";")[0].trim(); + } + }, + get_first_header: function get_first_header(message, regex) { + //FIXME: Cache Invalidation. + if (!message._headerLookups) Object.defineProperty(message, "_headerLookups", { + value: {}, + configurable: false, + enumerable: false, + writable: false + }); + if (!(regex in message._headerLookups)) { + var header; + for (var i = 0; i < message.headers.length; i++) { + if (!!message.headers[i][0].match(regex)) { + header = message.headers[i]; + break; + } + } + message._headerLookups[regex] = header ? header[1] : undefined; + } + return message._headerLookups[regex]; + }, + match_header: function match_header(message, regex) { + var headers = message.headers; + var i = headers.length; + while (i--) { + if (regex.test(headers[i].join(" "))) { + return headers[i]; + } + } + return false; + }, + getContentURL: function getContentURL(flow, message, view) { + if (message === flow.request) { + message = "request"; + } else if (message === flow.response) { + message = "response"; + } + return "/flows/" + flow.id + "/" + message + "/content" + (view ? "/" + view : ''); + } +}; + +var RequestUtils = exports.RequestUtils = _lodash2.default.extend(MessageUtils, { + pretty_host: function pretty_host(request) { + //FIXME: Add hostheader + return request.host; + }, + pretty_url: function pretty_url(request) { + var port = ""; + if (defaultPorts[request.scheme] !== request.port) { + port = ":" + request.port; + } + return request.scheme + "://" + this.pretty_host(request) + port + request.path; + } +}); + +var ResponseUtils = exports.ResponseUtils = _lodash2.default.extend(MessageUtils, {}); + +var parseUrl_regex = /^(?:(https?):\/\/)?([^\/:]+)?(?::(\d+))?(\/.*)?$/i; +var parseUrl = exports.parseUrl = function parseUrl(url) { + //there are many correct ways to parse a URL, + //however, a mitmproxy user may also wish to generate a not-so-correct URL. ;-) + var parts = parseUrl_regex.exec(url); + if (!parts) { + return false; + } + + var scheme = parts[1], + host = parts[2], + port = parseInt(parts[3]), + path = parts[4]; + if (scheme) { + port = port || defaultPorts[scheme]; + } + var ret = {}; + if (scheme) { + ret.scheme = scheme; + } + if (host) { + ret.host = host; + } + if (port) { + ret.port = port; + } + if (path) { + ret.path = path; + } + return ret; +}; + +var isValidHttpVersion_regex = /^HTTP\/\d+(\.\d+)*$/i; +var isValidHttpVersion = exports.isValidHttpVersion = function isValidHttpVersion(httpVersion) { + return isValidHttpVersion_regex.test(httpVersion); +}; + +},{"lodash":"lodash"}],65:[function(require,module,exports){ +'use strict'; + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.pure = exports.formatTimeStamp = exports.formatTimeDelta = exports.formatSize = exports.Key = undefined; + +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol ? "symbol" : typeof obj; }; + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +exports.reverseString = reverseString; +exports.fetchApi = fetchApi; +exports.getDiff = getDiff; + +var _lodash = require('lodash'); + +var _lodash2 = _interopRequireDefault(_lodash); + +var _react = require('react'); + +var _react2 = _interopRequireDefault(_react); + +var _shallowequal = require('shallowequal'); + +var _shallowequal2 = _interopRequireDefault(_shallowequal); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; } + +function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; } + +window._ = _lodash2.default; +window.React = _react2.default; + +var Key = exports.Key = { + UP: 38, + DOWN: 40, + PAGE_UP: 33, + PAGE_DOWN: 34, + HOME: 36, + END: 35, + LEFT: 37, + RIGHT: 39, + ENTER: 13, + ESC: 27, + TAB: 9, + SPACE: 32, + BACKSPACE: 8, + SHIFT: 16 +}; +// Add A-Z +for (var i = 65; i <= 90; i++) { + Key[String.fromCharCode(i)] = i; +} + +var formatSize = exports.formatSize = function formatSize(bytes) { + if (bytes === 0) return "0"; + var prefix = ["b", "kb", "mb", "gb", "tb"]; + for (var i = 0; i < prefix.length; i++) { + if (Math.pow(1024, i + 1) > bytes) { + break; + } + } + var precision; + if (bytes % Math.pow(1024, i) === 0) precision = 0;else precision = 1; + return (bytes / Math.pow(1024, i)).toFixed(precision) + prefix[i]; +}; + +var formatTimeDelta = exports.formatTimeDelta = function formatTimeDelta(milliseconds) { + var time = milliseconds; + var prefix = ["ms", "s", "min", "h"]; + var div = [1000, 60, 60]; + var i = 0; + while (Math.abs(time) >= div[i] && i < div.length) { + time = time / div[i]; + i++; + } + return Math.round(time) + prefix[i]; +}; + +var formatTimeStamp = exports.formatTimeStamp = function formatTimeStamp(seconds) { + var ts = new Date(seconds * 1000).toISOString(); + return ts.replace("T", " ").replace("Z", ""); +}; + +// At some places, we need to sort strings alphabetically descending, +// but we can only provide a key function. +// This beauty "reverses" a JS string. +var end = String.fromCharCode(0xffff); +function reverseString(s) { + return String.fromCharCode.apply(String, _lodash2.default.map(s.split(""), function (c) { + return 0xffff - c.charCodeAt(0); + })) + end; +} + +function getCookie(name) { + var r = document.cookie.match(new RegExp("\\b" + name + "=([^;]*)\\b")); + return r ? r[1] : undefined; +} +var xsrf = '_xsrf=' + getCookie("_xsrf"); + +function fetchApi(url) { + var options = arguments.length <= 1 || arguments[1] === undefined ? {} : arguments[1]; + + if (options.method && options.method !== "GET") { + if (url.indexOf("?") === -1) { + url += "?" + xsrf; + } else { + url += "&" + xsrf; + } + } + + return fetch(url, _extends({ + credentials: 'same-origin' + }, options)); +} + +fetchApi.put = function (url, json, options) { + return fetchApi(url, _extends({ + method: "PUT", + headers: { + 'Content-Type': 'application/json' + }, + body: JSON.stringify(json) + }, options)); +}; + +function getDiff(obj1, obj2) { + var result = _extends({}, obj2); + for (var key in obj1) { + if (_lodash2.default.isEqual(obj2[key], obj1[key])) result[key] = undefined;else if (!(Array.isArray(obj2[key]) && Array.isArray(obj1[key])) && _typeof(obj2[key]) == 'object' && _typeof(obj1[key]) == 'object') result[key] = getDiff(obj1[key], obj2[key]); + } + return result; +} + +var pure = exports.pure = function pure(renderFn) { + var _class, _temp; + + return _temp = _class = function (_React$Component) { + _inherits(_class, _React$Component); + + function _class() { + _classCallCheck(this, _class); + + return _possibleConstructorReturn(this, Object.getPrototypeOf(_class).apply(this, arguments)); + } + + _createClass(_class, [{ + key: 'shouldComponentUpdate', + value: function shouldComponentUpdate(nextProps) { + return !(0, _shallowequal2.default)(this.props, nextProps); + } + }, { + key: 'render', + value: function render() { + return renderFn(this.props); + } + }]); + + return _class; + }(_react2.default.Component), _class.displayName = renderFn.name, _temp; +}; + +},{"lodash":"lodash","react":"react","shallowequal":"shallowequal"}]},{},[3]) + + +//# sourceMappingURL=app.js.map diff --git a/mitmproxy/tools/web/static/fonts/fontawesome-webfont.eot b/mitmproxy/tools/web/static/fonts/fontawesome-webfont.eot new file mode 100644 index 00000000..84677bc0 Binary files /dev/null and b/mitmproxy/tools/web/static/fonts/fontawesome-webfont.eot differ diff --git a/mitmproxy/tools/web/static/fonts/fontawesome-webfont.svg b/mitmproxy/tools/web/static/fonts/fontawesome-webfont.svg new file mode 100644 index 00000000..d907b25a --- /dev/null +++ b/mitmproxy/tools/web/static/fonts/fontawesome-webfont.svg @@ -0,0 +1,520 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/mitmproxy/tools/web/static/fonts/fontawesome-webfont.ttf b/mitmproxy/tools/web/static/fonts/fontawesome-webfont.ttf new file mode 100644 index 00000000..96a3639c Binary files /dev/null and b/mitmproxy/tools/web/static/fonts/fontawesome-webfont.ttf differ diff --git a/mitmproxy/tools/web/static/fonts/fontawesome-webfont.woff b/mitmproxy/tools/web/static/fonts/fontawesome-webfont.woff new file mode 100644 index 00000000..628b6a52 Binary files /dev/null and b/mitmproxy/tools/web/static/fonts/fontawesome-webfont.woff differ diff --git a/mitmproxy/tools/web/static/images/chrome-devtools/LICENSE b/mitmproxy/tools/web/static/images/chrome-devtools/LICENSE new file mode 100644 index 00000000..6e4f8b9f --- /dev/null +++ b/mitmproxy/tools/web/static/images/chrome-devtools/LICENSE @@ -0,0 +1,30 @@ +// Copyright 2014 The Chromium Authors. All rights reserved. +// +// The Chromium Authors can be found at +// http://src.chromium.org/svn/trunk/src/AUTHORS +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. \ No newline at end of file diff --git a/mitmproxy/tools/web/static/images/chrome-devtools/resourceCSSIcon.png b/mitmproxy/tools/web/static/images/chrome-devtools/resourceCSSIcon.png new file mode 100644 index 00000000..18828d06 Binary files /dev/null and b/mitmproxy/tools/web/static/images/chrome-devtools/resourceCSSIcon.png differ diff --git a/mitmproxy/tools/web/static/images/chrome-devtools/resourceDocumentIcon.png b/mitmproxy/tools/web/static/images/chrome-devtools/resourceDocumentIcon.png new file mode 100644 index 00000000..fdc10e47 Binary files /dev/null and b/mitmproxy/tools/web/static/images/chrome-devtools/resourceDocumentIcon.png differ diff --git a/mitmproxy/tools/web/static/images/chrome-devtools/resourceJSIcon.png b/mitmproxy/tools/web/static/images/chrome-devtools/resourceJSIcon.png new file mode 100644 index 00000000..c1b72189 Binary files /dev/null and b/mitmproxy/tools/web/static/images/chrome-devtools/resourceJSIcon.png differ diff --git a/mitmproxy/tools/web/static/images/chrome-devtools/resourcePlainIcon.png b/mitmproxy/tools/web/static/images/chrome-devtools/resourcePlainIcon.png new file mode 100644 index 00000000..8c82a4c7 Binary files /dev/null and b/mitmproxy/tools/web/static/images/chrome-devtools/resourcePlainIcon.png differ diff --git a/mitmproxy/tools/web/static/images/favicon.ico b/mitmproxy/tools/web/static/images/favicon.ico new file mode 100644 index 00000000..bfd2fde7 Binary files /dev/null and b/mitmproxy/tools/web/static/images/favicon.ico differ diff --git a/mitmproxy/tools/web/static/images/resourceExecutableIcon.png b/mitmproxy/tools/web/static/images/resourceExecutableIcon.png new file mode 100644 index 00000000..fa70c2fd Binary files /dev/null and b/mitmproxy/tools/web/static/images/resourceExecutableIcon.png differ diff --git a/mitmproxy/tools/web/static/images/resourceFlashIcon.png b/mitmproxy/tools/web/static/images/resourceFlashIcon.png new file mode 100644 index 00000000..ead5a4d0 Binary files /dev/null and b/mitmproxy/tools/web/static/images/resourceFlashIcon.png differ diff --git a/mitmproxy/tools/web/static/images/resourceImageIcon.png b/mitmproxy/tools/web/static/images/resourceImageIcon.png new file mode 100644 index 00000000..23163042 Binary files /dev/null and b/mitmproxy/tools/web/static/images/resourceImageIcon.png differ diff --git a/mitmproxy/tools/web/static/images/resourceJavaIcon.png b/mitmproxy/tools/web/static/images/resourceJavaIcon.png new file mode 100644 index 00000000..553b3391 Binary files /dev/null and b/mitmproxy/tools/web/static/images/resourceJavaIcon.png differ diff --git a/mitmproxy/tools/web/static/images/resourceNotModifiedIcon.png b/mitmproxy/tools/web/static/images/resourceNotModifiedIcon.png new file mode 100644 index 00000000..9c6a879d Binary files /dev/null and b/mitmproxy/tools/web/static/images/resourceNotModifiedIcon.png differ diff --git a/mitmproxy/tools/web/static/images/resourceRedirectIcon.png b/mitmproxy/tools/web/static/images/resourceRedirectIcon.png new file mode 100644 index 00000000..58fe3ac1 Binary files /dev/null and b/mitmproxy/tools/web/static/images/resourceRedirectIcon.png differ diff --git a/mitmproxy/tools/web/static/vendor.css b/mitmproxy/tools/web/static/vendor.css new file mode 100644 index 00000000..f8df478e --- /dev/null +++ b/mitmproxy/tools/web/static/vendor.css @@ -0,0 +1,8397 @@ +/*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */ +html { + font-family: sans-serif; + -ms-text-size-adjust: 100%; + -webkit-text-size-adjust: 100%; +} +body { + margin: 0; +} +article, +aside, +details, +figcaption, +figure, +footer, +header, +hgroup, +main, +menu, +nav, +section, +summary { + display: block; +} +audio, +canvas, +progress, +video { + display: inline-block; + vertical-align: baseline; +} +audio:not([controls]) { + display: none; + height: 0; +} +[hidden], +template { + display: none; +} +a { + background-color: transparent; +} +a:active, +a:hover { + outline: 0; +} +abbr[title] { + border-bottom: 1px dotted; +} +b, +strong { + font-weight: bold; +} +dfn { + font-style: italic; +} +h1 { + font-size: 2em; + margin: 0.67em 0; +} +mark { + background: #ff0; + color: #000; +} +small { + font-size: 80%; +} +sub, +sup { + font-size: 75%; + line-height: 0; + position: relative; + vertical-align: baseline; +} +sup { + top: -0.5em; +} +sub { + bottom: -0.25em; +} +img { + border: 0; +} +svg:not(:root) { + overflow: hidden; +} +figure { + margin: 1em 40px; +} +hr { + box-sizing: content-box; + height: 0; +} +pre { + overflow: auto; +} +code, +kbd, +pre, +samp { + font-family: monospace, monospace; + font-size: 1em; +} +button, +input, +optgroup, +select, +textarea { + color: inherit; + font: inherit; + margin: 0; +} +button { + overflow: visible; +} +button, +select { + text-transform: none; +} +button, +html input[type="button"], +input[type="reset"], +input[type="submit"] { + -webkit-appearance: button; + cursor: pointer; +} +button[disabled], +html input[disabled] { + cursor: default; +} +button::-moz-focus-inner, +input::-moz-focus-inner { + border: 0; + padding: 0; +} +input { + line-height: normal; +} +input[type="checkbox"], +input[type="radio"] { + box-sizing: border-box; + padding: 0; +} +input[type="number"]::-webkit-inner-spin-button, +input[type="number"]::-webkit-outer-spin-button { + height: auto; +} +input[type="search"] { + -webkit-appearance: textfield; + box-sizing: content-box; +} +input[type="search"]::-webkit-search-cancel-button, +input[type="search"]::-webkit-search-decoration { + -webkit-appearance: none; +} +fieldset { + border: 1px solid #c0c0c0; + margin: 0 2px; + padding: 0.35em 0.625em 0.75em; +} +legend { + border: 0; + padding: 0; +} +textarea { + overflow: auto; +} +optgroup { + font-weight: bold; +} +table { + border-collapse: collapse; + border-spacing: 0; +} +td, +th { + padding: 0; +} +/*! Source: https://github.com/h5bp/html5-boilerplate/blob/master/src/css/main.css */ +@media print { + *, + *:before, + *:after { + background: transparent !important; + color: #000 !important; + box-shadow: none !important; + text-shadow: none !important; + } + a, + a:visited { + text-decoration: underline; + } + a[href]:after { + content: " (" attr(href) ")"; + } + abbr[title]:after { + content: " (" attr(title) ")"; + } + a[href^="#"]:after, + a[href^="javascript:"]:after { + content: ""; + } + pre, + blockquote { + border: 1px solid #999; + page-break-inside: avoid; + } + thead { + display: table-header-group; + } + tr, + img { + page-break-inside: avoid; + } + img { + max-width: 100% !important; + } + p, + h2, + h3 { + orphans: 3; + widows: 3; + } + h2, + h3 { + page-break-after: avoid; + } + .navbar { + display: none; + } + .btn > .caret, + .dropup > .btn > .caret { + border-top-color: #000 !important; + } + .label { + border: 1px solid #000; + } + .table { + border-collapse: collapse !important; + } + .table td, + .table th { + background-color: #fff !important; + } + .table-bordered th, + .table-bordered td { + border: 1px solid #ddd !important; + } +} +@font-face { + font-family: 'Glyphicons Halflings'; + src: url('../fonts/glyphicons-halflings-regular.eot'); + src: url('../fonts/glyphicons-halflings-regular.eot?#iefix') format('embedded-opentype'), url('../fonts/glyphicons-halflings-regular.woff2') format('woff2'), url('../fonts/glyphicons-halflings-regular.woff') format('woff'), url('../fonts/glyphicons-halflings-regular.ttf') format('truetype'), url('../fonts/glyphicons-halflings-regular.svg#glyphicons_halflingsregular') format('svg'); +} +.glyphicon { + position: relative; + top: 1px; + display: inline-block; + font-family: 'Glyphicons Halflings'; + font-style: normal; + font-weight: normal; + line-height: 1; + -webkit-font-smoothing: antialiased; + -moz-osx-font-smoothing: grayscale; +} +.glyphicon-asterisk:before { + content: "\002a"; +} +.glyphicon-plus:before { + content: "\002b"; +} +.glyphicon-euro:before, +.glyphicon-eur:before { + content: "\20ac"; +} +.glyphicon-minus:before { + content: "\2212"; +} +.glyphicon-cloud:before { + content: "\2601"; +} +.glyphicon-envelope:before { + content: "\2709"; +} +.glyphicon-pencil:before { + content: "\270f"; +} +.glyphicon-glass:before { + content: "\e001"; +} +.glyphicon-music:before { + content: "\e002"; +} +.glyphicon-search:before { + content: "\e003"; +} +.glyphicon-heart:before { + content: "\e005"; +} +.glyphicon-star:before { + content: "\e006"; +} +.glyphicon-star-empty:before { + content: "\e007"; +} +.glyphicon-user:before { + content: "\e008"; +} +.glyphicon-film:before { + content: "\e009"; +} +.glyphicon-th-large:before { + content: "\e010"; +} +.glyphicon-th:before { + content: "\e011"; +} +.glyphicon-th-list:before { + content: "\e012"; +} +.glyphicon-ok:before { + content: "\e013"; +} +.glyphicon-remove:before { + content: "\e014"; +} +.glyphicon-zoom-in:before { + content: "\e015"; +} +.glyphicon-zoom-out:before { + content: "\e016"; +} +.glyphicon-off:before { + content: "\e017"; +} +.glyphicon-signal:before { + content: "\e018"; +} +.glyphicon-cog:before { + content: "\e019"; +} +.glyphicon-trash:before { + content: "\e020"; +} +.glyphicon-home:before { + content: "\e021"; +} +.glyphicon-file:before { + content: "\e022"; +} +.glyphicon-time:before { + content: "\e023"; +} +.glyphicon-road:before { + content: "\e024"; +} +.glyphicon-download-alt:before { + content: "\e025"; +} +.glyphicon-download:before { + content: "\e026"; +} +.glyphicon-upload:before { + content: "\e027"; +} +.glyphicon-inbox:before { + content: "\e028"; +} +.glyphicon-play-circle:before { + content: "\e029"; +} +.glyphicon-repeat:before { + content: "\e030"; +} +.glyphicon-refresh:before { + content: "\e031"; +} +.glyphicon-list-alt:before { + content: "\e032"; +} +.glyphicon-lock:before { + content: "\e033"; +} +.glyphicon-flag:before { + content: "\e034"; +} +.glyphicon-headphones:before { + content: "\e035"; +} +.glyphicon-volume-off:before { + content: "\e036"; +} +.glyphicon-volume-down:before { + content: "\e037"; +} +.glyphicon-volume-up:before { + content: "\e038"; +} +.glyphicon-qrcode:before { + content: "\e039"; +} +.glyphicon-barcode:before { + content: "\e040"; +} +.glyphicon-tag:before { + content: "\e041"; +} +.glyphicon-tags:before { + content: "\e042"; +} +.glyphicon-book:before { + content: "\e043"; +} +.glyphicon-bookmark:before { + content: "\e044"; +} +.glyphicon-print:before { + content: "\e045"; +} +.glyphicon-camera:before { + content: "\e046"; +} +.glyphicon-font:before { + content: "\e047"; +} +.glyphicon-bold:before { + content: "\e048"; +} +.glyphicon-italic:before { + content: "\e049"; +} +.glyphicon-text-height:before { + content: "\e050"; +} +.glyphicon-text-width:before { + content: "\e051"; +} +.glyphicon-align-left:before { + content: "\e052"; +} +.glyphicon-align-center:before { + content: "\e053"; +} +.glyphicon-align-right:before { + content: "\e054"; +} +.glyphicon-align-justify:before { + content: "\e055"; +} +.glyphicon-list:before { + content: "\e056"; +} +.glyphicon-indent-left:before { + content: "\e057"; +} +.glyphicon-indent-right:before { + content: "\e058"; +} +.glyphicon-facetime-video:before { + content: "\e059"; +} +.glyphicon-picture:before { + content: "\e060"; +} +.glyphicon-map-marker:before { + content: "\e062"; +} +.glyphicon-adjust:before { + content: "\e063"; +} +.glyphicon-tint:before { + content: "\e064"; +} +.glyphicon-edit:before { + content: "\e065"; +} +.glyphicon-share:before { + content: "\e066"; +} +.glyphicon-check:before { + content: "\e067"; +} +.glyphicon-move:before { + content: "\e068"; +} +.glyphicon-step-backward:before { + content: "\e069"; +} +.glyphicon-fast-backward:before { + content: "\e070"; +} +.glyphicon-backward:before { + content: "\e071"; +} +.glyphicon-play:before { + content: "\e072"; +} +.glyphicon-pause:before { + content: "\e073"; +} +.glyphicon-stop:before { + content: "\e074"; +} +.glyphicon-forward:before { + content: "\e075"; +} +.glyphicon-fast-forward:before { + content: "\e076"; +} +.glyphicon-step-forward:before { + content: "\e077"; +} +.glyphicon-eject:before { + content: "\e078"; +} +.glyphicon-chevron-left:before { + content: "\e079"; +} +.glyphicon-chevron-right:before { + content: "\e080"; +} +.glyphicon-plus-sign:before { + content: "\e081"; +} +.glyphicon-minus-sign:before { + content: "\e082"; +} +.glyphicon-remove-sign:before { + content: "\e083"; +} +.glyphicon-ok-sign:before { + content: "\e084"; +} +.glyphicon-question-sign:before { + content: "\e085"; +} +.glyphicon-info-sign:before { + content: "\e086"; +} +.glyphicon-screenshot:before { + content: "\e087"; +} +.glyphicon-remove-circle:before { + content: "\e088"; +} +.glyphicon-ok-circle:before { + content: "\e089"; +} +.glyphicon-ban-circle:before { + content: "\e090"; +} +.glyphicon-arrow-left:before { + content: "\e091"; +} +.glyphicon-arrow-right:before { + content: "\e092"; +} +.glyphicon-arrow-up:before { + content: "\e093"; +} +.glyphicon-arrow-down:before { + content: "\e094"; +} +.glyphicon-share-alt:before { + content: "\e095"; +} +.glyphicon-resize-full:before { + content: "\e096"; +} +.glyphicon-resize-small:before { + content: "\e097"; +} +.glyphicon-exclamation-sign:before { + content: "\e101"; +} +.glyphicon-gift:before { + content: "\e102"; +} +.glyphicon-leaf:before { + content: "\e103"; +} +.glyphicon-fire:before { + content: "\e104"; +} +.glyphicon-eye-open:before { + content: "\e105"; +} +.glyphicon-eye-close:before { + content: "\e106"; +} +.glyphicon-warning-sign:before { + content: "\e107"; +} +.glyphicon-plane:before { + content: "\e108"; +} +.glyphicon-calendar:before { + content: "\e109"; +} +.glyphicon-random:before { + content: "\e110"; +} +.glyphicon-comment:before { + content: "\e111"; +} +.glyphicon-magnet:before { + content: "\e112"; +} +.glyphicon-chevron-up:before { + content: "\e113"; +} +.glyphicon-chevron-down:before { + content: "\e114"; +} +.glyphicon-retweet:before { + content: "\e115"; +} +.glyphicon-shopping-cart:before { + content: "\e116"; +} +.glyphicon-folder-close:before { + content: "\e117"; +} +.glyphicon-folder-open:before { + content: "\e118"; +} +.glyphicon-resize-vertical:before { + content: "\e119"; +} +.glyphicon-resize-horizontal:before { + content: "\e120"; +} +.glyphicon-hdd:before { + content: "\e121"; +} +.glyphicon-bullhorn:before { + content: "\e122"; +} +.glyphicon-bell:before { + content: "\e123"; +} +.glyphicon-certificate:before { + content: "\e124"; +} +.glyphicon-thumbs-up:before { + content: "\e125"; +} +.glyphicon-thumbs-down:before { + content: "\e126"; +} +.glyphicon-hand-right:before { + content: "\e127"; +} +.glyphicon-hand-left:before { + content: "\e128"; +} +.glyphicon-hand-up:before { + content: "\e129"; +} +.glyphicon-hand-down:before { + content: "\e130"; +} +.glyphicon-circle-arrow-right:before { + content: "\e131"; +} +.glyphicon-circle-arrow-left:before { + content: "\e132"; +} +.glyphicon-circle-arrow-up:before { + content: "\e133"; +} +.glyphicon-circle-arrow-down:before { + content: "\e134"; +} +.glyphicon-globe:before { + content: "\e135"; +} +.glyphicon-wrench:before { + content: "\e136"; +} +.glyphicon-tasks:before { + content: "\e137"; +} +.glyphicon-filter:before { + content: "\e138"; +} +.glyphicon-briefcase:before { + content: "\e139"; +} +.glyphicon-fullscreen:before { + content: "\e140"; +} +.glyphicon-dashboard:before { + content: "\e141"; +} +.glyphicon-paperclip:before { + content: "\e142"; +} +.glyphicon-heart-empty:before { + content: "\e143"; +} +.glyphicon-link:before { + content: "\e144"; +} +.glyphicon-phone:before { + content: "\e145"; +} +.glyphicon-pushpin:before { + content: "\e146"; +} +.glyphicon-usd:before { + content: "\e148"; +} +.glyphicon-gbp:before { + content: "\e149"; +} +.glyphicon-sort:before { + content: "\e150"; +} +.glyphicon-sort-by-alphabet:before { + content: "\e151"; +} +.glyphicon-sort-by-alphabet-alt:before { + content: "\e152"; +} +.glyphicon-sort-by-order:before { + content: "\e153"; +} +.glyphicon-sort-by-order-alt:before { + content: "\e154"; +} +.glyphicon-sort-by-attributes:before { + content: "\e155"; +} +.glyphicon-sort-by-attributes-alt:before { + content: "\e156"; +} +.glyphicon-unchecked:before { + content: "\e157"; +} +.glyphicon-expand:before { + content: "\e158"; +} +.glyphicon-collapse-down:before { + content: "\e159"; +} +.glyphicon-collapse-up:before { + content: "\e160"; +} +.glyphicon-log-in:before { + content: "\e161"; +} +.glyphicon-flash:before { + content: "\e162"; +} +.glyphicon-log-out:before { + content: "\e163"; +} +.glyphicon-new-window:before { + content: "\e164"; +} +.glyphicon-record:before { + content: "\e165"; +} +.glyphicon-save:before { + content: "\e166"; +} +.glyphicon-open:before { + content: "\e167"; +} +.glyphicon-saved:before { + content: "\e168"; +} +.glyphicon-import:before { + content: "\e169"; +} +.glyphicon-export:before { + content: "\e170"; +} +.glyphicon-send:before { + content: "\e171"; +} +.glyphicon-floppy-disk:before { + content: "\e172"; +} +.glyphicon-floppy-saved:before { + content: "\e173"; +} +.glyphicon-floppy-remove:before { + content: "\e174"; +} +.glyphicon-floppy-save:before { + content: "\e175"; +} +.glyphicon-floppy-open:before { + content: "\e176"; +} +.glyphicon-credit-card:before { + content: "\e177"; +} +.glyphicon-transfer:before { + content: "\e178"; +} +.glyphicon-cutlery:before { + content: "\e179"; +} +.glyphicon-header:before { + content: "\e180"; +} +.glyphicon-compressed:before { + content: "\e181"; +} +.glyphicon-earphone:before { + content: "\e182"; +} +.glyphicon-phone-alt:before { + content: "\e183"; +} +.glyphicon-tower:before { + content: "\e184"; +} +.glyphicon-stats:before { + content: "\e185"; +} +.glyphicon-sd-video:before { + content: "\e186"; +} +.glyphicon-hd-video:before { + content: "\e187"; +} +.glyphicon-subtitles:before { + content: "\e188"; +} +.glyphicon-sound-stereo:before { + content: "\e189"; +} +.glyphicon-sound-dolby:before { + content: "\e190"; +} +.glyphicon-sound-5-1:before { + content: "\e191"; +} +.glyphicon-sound-6-1:before { + content: "\e192"; +} +.glyphicon-sound-7-1:before { + content: "\e193"; +} +.glyphicon-copyright-mark:before { + content: "\e194"; +} +.glyphicon-registration-mark:before { + content: "\e195"; +} +.glyphicon-cloud-download:before { + content: "\e197"; +} +.glyphicon-cloud-upload:before { + content: "\e198"; +} +.glyphicon-tree-conifer:before { + content: "\e199"; +} +.glyphicon-tree-deciduous:before { + content: "\e200"; +} +.glyphicon-cd:before { + content: "\e201"; +} +.glyphicon-save-file:before { + content: "\e202"; +} +.glyphicon-open-file:before { + content: "\e203"; +} +.glyphicon-level-up:before { + content: "\e204"; +} +.glyphicon-copy:before { + content: "\e205"; +} +.glyphicon-paste:before { + content: "\e206"; +} +.glyphicon-alert:before { + content: "\e209"; +} +.glyphicon-equalizer:before { + content: "\e210"; +} +.glyphicon-king:before { + content: "\e211"; +} +.glyphicon-queen:before { + content: "\e212"; +} +.glyphicon-pawn:before { + content: "\e213"; +} +.glyphicon-bishop:before { + content: "\e214"; +} +.glyphicon-knight:before { + content: "\e215"; +} +.glyphicon-baby-formula:before { + content: "\e216"; +} +.glyphicon-tent:before { + content: "\26fa"; +} +.glyphicon-blackboard:before { + content: "\e218"; +} +.glyphicon-bed:before { + content: "\e219"; +} +.glyphicon-apple:before { + content: "\f8ff"; +} +.glyphicon-erase:before { + content: "\e221"; +} +.glyphicon-hourglass:before { + content: "\231b"; +} +.glyphicon-lamp:before { + content: "\e223"; +} +.glyphicon-duplicate:before { + content: "\e224"; +} +.glyphicon-piggy-bank:before { + content: "\e225"; +} +.glyphicon-scissors:before { + content: "\e226"; +} +.glyphicon-bitcoin:before { + content: "\e227"; +} +.glyphicon-btc:before { + content: "\e227"; +} +.glyphicon-xbt:before { + content: "\e227"; +} +.glyphicon-yen:before { + content: "\00a5"; +} +.glyphicon-jpy:before { + content: "\00a5"; +} +.glyphicon-ruble:before { + content: "\20bd"; +} +.glyphicon-rub:before { + content: "\20bd"; +} +.glyphicon-scale:before { + content: "\e230"; +} +.glyphicon-ice-lolly:before { + content: "\e231"; +} +.glyphicon-ice-lolly-tasted:before { + content: "\e232"; +} +.glyphicon-education:before { + content: "\e233"; +} +.glyphicon-option-horizontal:before { + content: "\e234"; +} +.glyphicon-option-vertical:before { + content: "\e235"; +} +.glyphicon-menu-hamburger:before { + content: "\e236"; +} +.glyphicon-modal-window:before { + content: "\e237"; +} +.glyphicon-oil:before { + content: "\e238"; +} +.glyphicon-grain:before { + content: "\e239"; +} +.glyphicon-sunglasses:before { + content: "\e240"; +} +.glyphicon-text-size:before { + content: "\e241"; +} +.glyphicon-text-color:before { + content: "\e242"; +} +.glyphicon-text-background:before { + content: "\e243"; +} +.glyphicon-object-align-top:before { + content: "\e244"; +} +.glyphicon-object-align-bottom:before { + content: "\e245"; +} +.glyphicon-object-align-horizontal:before { + content: "\e246"; +} +.glyphicon-object-align-left:before { + content: "\e247"; +} +.glyphicon-object-align-vertical:before { + content: "\e248"; +} +.glyphicon-object-align-right:before { + content: "\e249"; +} +.glyphicon-triangle-right:before { + content: "\e250"; +} +.glyphicon-triangle-left:before { + content: "\e251"; +} +.glyphicon-triangle-bottom:before { + content: "\e252"; +} +.glyphicon-triangle-top:before { + content: "\e253"; +} +.glyphicon-console:before { + content: "\e254"; +} +.glyphicon-superscript:before { + content: "\e255"; +} +.glyphicon-subscript:before { + content: "\e256"; +} +.glyphicon-menu-left:before { + content: "\e257"; +} +.glyphicon-menu-right:before { + content: "\e258"; +} +.glyphicon-menu-down:before { + content: "\e259"; +} +.glyphicon-menu-up:before { + content: "\e260"; +} +* { + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; +} +*:before, +*:after { + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; +} +html { + font-size: 10px; + -webkit-tap-highlight-color: rgba(0, 0, 0, 0); +} +body { + font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; + font-size: 14px; + line-height: 1.42857143; + color: #333333; + background-color: #fff; +} +input, +button, +select, +textarea { + font-family: inherit; + font-size: inherit; + line-height: inherit; +} +a { + color: #337ab7; + text-decoration: none; +} +a:hover, +a:focus { + color: #23527c; + text-decoration: underline; +} +a:focus { + outline: thin dotted; + outline: 5px auto -webkit-focus-ring-color; + outline-offset: -2px; +} +figure { + margin: 0; +} +img { + vertical-align: middle; +} +.img-responsive, +.thumbnail > img, +.thumbnail a > img, +.carousel-inner > .item > img, +.carousel-inner > .item > a > img { + display: block; + max-width: 100%; + height: auto; +} +.img-rounded { + border-radius: 6px; +} +.img-thumbnail { + padding: 4px; + line-height: 1.42857143; + background-color: #fff; + border: 1px solid #ddd; + border-radius: 4px; + -webkit-transition: all 0.2s ease-in-out; + -o-transition: all 0.2s ease-in-out; + transition: all 0.2s ease-in-out; + display: inline-block; + max-width: 100%; + height: auto; +} +.img-circle { + border-radius: 50%; +} +hr { + margin-top: 20px; + margin-bottom: 20px; + border: 0; + border-top: 1px solid #eeeeee; +} +.sr-only { + position: absolute; + width: 1px; + height: 1px; + margin: -1px; + padding: 0; + overflow: hidden; + clip: rect(0, 0, 0, 0); + border: 0; +} +.sr-only-focusable:active, +.sr-only-focusable:focus { + position: static; + width: auto; + height: auto; + margin: 0; + overflow: visible; + clip: auto; +} +[role="button"] { + cursor: pointer; +} +h1, +h2, +h3, +h4, +h5, +h6, +.h1, +.h2, +.h3, +.h4, +.h5, +.h6 { + font-family: inherit; + font-weight: 500; + line-height: 1.1; + color: inherit; +} +h1 small, +h2 small, +h3 small, +h4 small, +h5 small, +h6 small, +.h1 small, +.h2 small, +.h3 small, +.h4 small, +.h5 small, +.h6 small, +h1 .small, +h2 .small, +h3 .small, +h4 .small, +h5 .small, +h6 .small, +.h1 .small, +.h2 .small, +.h3 .small, +.h4 .small, +.h5 .small, +.h6 .small { + font-weight: normal; + line-height: 1; + color: #777777; +} +h1, +.h1, +h2, +.h2, +h3, +.h3 { + margin-top: 20px; + margin-bottom: 10px; +} +h1 small, +.h1 small, +h2 small, +.h2 small, +h3 small, +.h3 small, +h1 .small, +.h1 .small, +h2 .small, +.h2 .small, +h3 .small, +.h3 .small { + font-size: 65%; +} +h4, +.h4, +h5, +.h5, +h6, +.h6 { + margin-top: 10px; + margin-bottom: 10px; +} +h4 small, +.h4 small, +h5 small, +.h5 small, +h6 small, +.h6 small, +h4 .small, +.h4 .small, +h5 .small, +.h5 .small, +h6 .small, +.h6 .small { + font-size: 75%; +} +h1, +.h1 { + font-size: 36px; +} +h2, +.h2 { + font-size: 30px; +} +h3, +.h3 { + font-size: 24px; +} +h4, +.h4 { + font-size: 18px; +} +h5, +.h5 { + font-size: 14px; +} +h6, +.h6 { + font-size: 12px; +} +p { + margin: 0 0 10px; +} +.lead { + margin-bottom: 20px; + font-size: 16px; + font-weight: 300; + line-height: 1.4; +} +@media (min-width: 768px) { + .lead { + font-size: 21px; + } +} +small, +.small { + font-size: 85%; +} +mark, +.mark { + background-color: #fcf8e3; + padding: .2em; +} +.text-left { + text-align: left; +} +.text-right { + text-align: right; +} +.text-center { + text-align: center; +} +.text-justify { + text-align: justify; +} +.text-nowrap { + white-space: nowrap; +} +.text-lowercase { + text-transform: lowercase; +} +.text-uppercase { + text-transform: uppercase; +} +.text-capitalize { + text-transform: capitalize; +} +.text-muted { + color: #777777; +} +.text-primary { + color: #337ab7; +} +a.text-primary:hover, +a.text-primary:focus { + color: #286090; +} +.text-success { + color: #3c763d; +} +a.text-success:hover, +a.text-success:focus { + color: #2b542c; +} +.text-info { + color: #31708f; +} +a.text-info:hover, +a.text-info:focus { + color: #245269; +} +.text-warning { + color: #8a6d3b; +} +a.text-warning:hover, +a.text-warning:focus { + color: #66512c; +} +.text-danger { + color: #a94442; +} +a.text-danger:hover, +a.text-danger:focus { + color: #843534; +} +.bg-primary { + color: #fff; + background-color: #337ab7; +} +a.bg-primary:hover, +a.bg-primary:focus { + background-color: #286090; +} +.bg-success { + background-color: #dff0d8; +} +a.bg-success:hover, +a.bg-success:focus { + background-color: #c1e2b3; +} +.bg-info { + background-color: #d9edf7; +} +a.bg-info:hover, +a.bg-info:focus { + background-color: #afd9ee; +} +.bg-warning { + background-color: #fcf8e3; +} +a.bg-warning:hover, +a.bg-warning:focus { + background-color: #f7ecb5; +} +.bg-danger { + background-color: #f2dede; +} +a.bg-danger:hover, +a.bg-danger:focus { + background-color: #e4b9b9; +} +.page-header { + padding-bottom: 9px; + margin: 40px 0 20px; + border-bottom: 1px solid #eeeeee; +} +ul, +ol { + margin-top: 0; + margin-bottom: 10px; +} +ul ul, +ol ul, +ul ol, +ol ol { + margin-bottom: 0; +} +.list-unstyled { + padding-left: 0; + list-style: none; +} +.list-inline { + padding-left: 0; + list-style: none; + margin-left: -5px; +} +.list-inline > li { + display: inline-block; + padding-left: 5px; + padding-right: 5px; +} +dl { + margin-top: 0; + margin-bottom: 20px; +} +dt, +dd { + line-height: 1.42857143; +} +dt { + font-weight: bold; +} +dd { + margin-left: 0; +} +@media (min-width: 768px) { + .dl-horizontal dt { + float: left; + width: 160px; + clear: left; + text-align: right; + overflow: hidden; + text-overflow: ellipsis; + white-space: nowrap; + } + .dl-horizontal dd { + margin-left: 180px; + } +} +abbr[title], +abbr[data-original-title] { + cursor: help; + border-bottom: 1px dotted #777777; +} +.initialism { + font-size: 90%; + text-transform: uppercase; +} +blockquote { + padding: 10px 20px; + margin: 0 0 20px; + font-size: 17.5px; + border-left: 5px solid #eeeeee; +} +blockquote p:last-child, +blockquote ul:last-child, +blockquote ol:last-child { + margin-bottom: 0; +} +blockquote footer, +blockquote small, +blockquote .small { + display: block; + font-size: 80%; + line-height: 1.42857143; + color: #777777; +} +blockquote footer:before, +blockquote small:before, +blockquote .small:before { + content: '\2014 \00A0'; +} +.blockquote-reverse, +blockquote.pull-right { + padding-right: 15px; + padding-left: 0; + border-right: 5px solid #eeeeee; + border-left: 0; + text-align: right; +} +.blockquote-reverse footer:before, +blockquote.pull-right footer:before, +.blockquote-reverse small:before, +blockquote.pull-right small:before, +.blockquote-reverse .small:before, +blockquote.pull-right .small:before { + content: ''; +} +.blockquote-reverse footer:after, +blockquote.pull-right footer:after, +.blockquote-reverse small:after, +blockquote.pull-right small:after, +.blockquote-reverse .small:after, +blockquote.pull-right .small:after { + content: '\00A0 \2014'; +} +address { + margin-bottom: 20px; + font-style: normal; + line-height: 1.42857143; +} +code, +kbd, +pre, +samp { + font-family: Menlo, Monaco, Consolas, "Courier New", monospace; +} +code { + padding: 2px 4px; + font-size: 90%; + color: #c7254e; + background-color: #f9f2f4; + border-radius: 4px; +} +kbd { + padding: 2px 4px; + font-size: 90%; + color: #fff; + background-color: #333; + border-radius: 3px; + box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.25); +} +kbd kbd { + padding: 0; + font-size: 100%; + font-weight: bold; + box-shadow: none; +} +pre { + display: block; + padding: 9.5px; + margin: 0 0 10px; + font-size: 13px; + line-height: 1.42857143; + word-break: break-all; + word-wrap: break-word; + color: #333333; + background-color: #f5f5f5; + border: 1px solid #ccc; + border-radius: 4px; +} +pre code { + padding: 0; + font-size: inherit; + color: inherit; + white-space: pre-wrap; + background-color: transparent; + border-radius: 0; +} +.pre-scrollable { + max-height: 340px; + overflow-y: scroll; +} +.container { + margin-right: auto; + margin-left: auto; + padding-left: 15px; + padding-right: 15px; +} +@media (min-width: 768px) { + .container { + width: 750px; + } +} +@media (min-width: 992px) { + .container { + width: 970px; + } +} +@media (min-width: 1200px) { + .container { + width: 1170px; + } +} +.container-fluid { + margin-right: auto; + margin-left: auto; + padding-left: 15px; + padding-right: 15px; +} +.row { + margin-left: -15px; + margin-right: -15px; +} +.col-xs-1, .col-sm-1, .col-md-1, .col-lg-1, .col-xs-2, .col-sm-2, .col-md-2, .col-lg-2, .col-xs-3, .col-sm-3, .col-md-3, .col-lg-3, .col-xs-4, .col-sm-4, .col-md-4, .col-lg-4, .col-xs-5, .col-sm-5, .col-md-5, .col-lg-5, .col-xs-6, .col-sm-6, .col-md-6, .col-lg-6, .col-xs-7, .col-sm-7, .col-md-7, .col-lg-7, .col-xs-8, .col-sm-8, .col-md-8, .col-lg-8, .col-xs-9, .col-sm-9, .col-md-9, .col-lg-9, .col-xs-10, .col-sm-10, .col-md-10, .col-lg-10, .col-xs-11, .col-sm-11, .col-md-11, .col-lg-11, .col-xs-12, .col-sm-12, .col-md-12, .col-lg-12 { + position: relative; + min-height: 1px; + padding-left: 15px; + padding-right: 15px; +} +.col-xs-1, .col-xs-2, .col-xs-3, .col-xs-4, .col-xs-5, .col-xs-6, .col-xs-7, .col-xs-8, .col-xs-9, .col-xs-10, .col-xs-11, .col-xs-12 { + float: left; +} +.col-xs-12 { + width: 100%; +} +.col-xs-11 { + width: 91.66666667%; +} +.col-xs-10 { + width: 83.33333333%; +} +.col-xs-9 { + width: 75%; +} +.col-xs-8 { + width: 66.66666667%; +} +.col-xs-7 { + width: 58.33333333%; +} +.col-xs-6 { + width: 50%; +} +.col-xs-5 { + width: 41.66666667%; +} +.col-xs-4 { + width: 33.33333333%; +} +.col-xs-3 { + width: 25%; +} +.col-xs-2 { + width: 16.66666667%; +} +.col-xs-1 { + width: 8.33333333%; +} +.col-xs-pull-12 { + right: 100%; +} +.col-xs-pull-11 { + right: 91.66666667%; +} +.col-xs-pull-10 { + right: 83.33333333%; +} +.col-xs-pull-9 { + right: 75%; +} +.col-xs-pull-8 { + right: 66.66666667%; +} +.col-xs-pull-7 { + right: 58.33333333%; +} +.col-xs-pull-6 { + right: 50%; +} +.col-xs-pull-5 { + right: 41.66666667%; +} +.col-xs-pull-4 { + right: 33.33333333%; +} +.col-xs-pull-3 { + right: 25%; +} +.col-xs-pull-2 { + right: 16.66666667%; +} +.col-xs-pull-1 { + right: 8.33333333%; +} +.col-xs-pull-0 { + right: auto; +} +.col-xs-push-12 { + left: 100%; +} +.col-xs-push-11 { + left: 91.66666667%; +} +.col-xs-push-10 { + left: 83.33333333%; +} +.col-xs-push-9 { + left: 75%; +} +.col-xs-push-8 { + left: 66.66666667%; +} +.col-xs-push-7 { + left: 58.33333333%; +} +.col-xs-push-6 { + left: 50%; +} +.col-xs-push-5 { + left: 41.66666667%; +} +.col-xs-push-4 { + left: 33.33333333%; +} +.col-xs-push-3 { + left: 25%; +} +.col-xs-push-2 { + left: 16.66666667%; +} +.col-xs-push-1 { + left: 8.33333333%; +} +.col-xs-push-0 { + left: auto; +} +.col-xs-offset-12 { + margin-left: 100%; +} +.col-xs-offset-11 { + margin-left: 91.66666667%; +} +.col-xs-offset-10 { + margin-left: 83.33333333%; +} +.col-xs-offset-9 { + margin-left: 75%; +} +.col-xs-offset-8 { + margin-left: 66.66666667%; +} +.col-xs-offset-7 { + margin-left: 58.33333333%; +} +.col-xs-offset-6 { + margin-left: 50%; +} +.col-xs-offset-5 { + margin-left: 41.66666667%; +} +.col-xs-offset-4 { + margin-left: 33.33333333%; +} +.col-xs-offset-3 { + margin-left: 25%; +} +.col-xs-offset-2 { + margin-left: 16.66666667%; +} +.col-xs-offset-1 { + margin-left: 8.33333333%; +} +.col-xs-offset-0 { + margin-left: 0%; +} +@media (min-width: 768px) { + .col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12 { + float: left; + } + .col-sm-12 { + width: 100%; + } + .col-sm-11 { + width: 91.66666667%; + } + .col-sm-10 { + width: 83.33333333%; + } + .col-sm-9 { + width: 75%; + } + .col-sm-8 { + width: 66.66666667%; + } + .col-sm-7 { + width: 58.33333333%; + } + .col-sm-6 { + width: 50%; + } + .col-sm-5 { + width: 41.66666667%; + } + .col-sm-4 { + width: 33.33333333%; + } + .col-sm-3 { + width: 25%; + } + .col-sm-2 { + width: 16.66666667%; + } + .col-sm-1 { + width: 8.33333333%; + } + .col-sm-pull-12 { + right: 100%; + } + .col-sm-pull-11 { + right: 91.66666667%; + } + .col-sm-pull-10 { + right: 83.33333333%; + } + .col-sm-pull-9 { + right: 75%; + } + .col-sm-pull-8 { + right: 66.66666667%; + } + .col-sm-pull-7 { + right: 58.33333333%; + } + .col-sm-pull-6 { + right: 50%; + } + .col-sm-pull-5 { + right: 41.66666667%; + } + .col-sm-pull-4 { + right: 33.33333333%; + } + .col-sm-pull-3 { + right: 25%; + } + .col-sm-pull-2 { + right: 16.66666667%; + } + .col-sm-pull-1 { + right: 8.33333333%; + } + .col-sm-pull-0 { + right: auto; + } + .col-sm-push-12 { + left: 100%; + } + .col-sm-push-11 { + left: 91.66666667%; + } + .col-sm-push-10 { + left: 83.33333333%; + } + .col-sm-push-9 { + left: 75%; + } + .col-sm-push-8 { + left: 66.66666667%; + } + .col-sm-push-7 { + left: 58.33333333%; + } + .col-sm-push-6 { + left: 50%; + } + .col-sm-push-5 { + left: 41.66666667%; + } + .col-sm-push-4 { + left: 33.33333333%; + } + .col-sm-push-3 { + left: 25%; + } + .col-sm-push-2 { + left: 16.66666667%; + } + .col-sm-push-1 { + left: 8.33333333%; + } + .col-sm-push-0 { + left: auto; + } + .col-sm-offset-12 { + margin-left: 100%; + } + .col-sm-offset-11 { + margin-left: 91.66666667%; + } + .col-sm-offset-10 { + margin-left: 83.33333333%; + } + .col-sm-offset-9 { + margin-left: 75%; + } + .col-sm-offset-8 { + margin-left: 66.66666667%; + } + .col-sm-offset-7 { + margin-left: 58.33333333%; + } + .col-sm-offset-6 { + margin-left: 50%; + } + .col-sm-offset-5 { + margin-left: 41.66666667%; + } + .col-sm-offset-4 { + margin-left: 33.33333333%; + } + .col-sm-offset-3 { + margin-left: 25%; + } + .col-sm-offset-2 { + margin-left: 16.66666667%; + } + .col-sm-offset-1 { + margin-left: 8.33333333%; + } + .col-sm-offset-0 { + margin-left: 0%; + } +} +@media (min-width: 992px) { + .col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12 { + float: left; + } + .col-md-12 { + width: 100%; + } + .col-md-11 { + width: 91.66666667%; + } + .col-md-10 { + width: 83.33333333%; + } + .col-md-9 { + width: 75%; + } + .col-md-8 { + width: 66.66666667%; + } + .col-md-7 { + width: 58.33333333%; + } + .col-md-6 { + width: 50%; + } + .col-md-5 { + width: 41.66666667%; + } + .col-md-4 { + width: 33.33333333%; + } + .col-md-3 { + width: 25%; + } + .col-md-2 { + width: 16.66666667%; + } + .col-md-1 { + width: 8.33333333%; + } + .col-md-pull-12 { + right: 100%; + } + .col-md-pull-11 { + right: 91.66666667%; + } + .col-md-pull-10 { + right: 83.33333333%; + } + .col-md-pull-9 { + right: 75%; + } + .col-md-pull-8 { + right: 66.66666667%; + } + .col-md-pull-7 { + right: 58.33333333%; + } + .col-md-pull-6 { + right: 50%; + } + .col-md-pull-5 { + right: 41.66666667%; + } + .col-md-pull-4 { + right: 33.33333333%; + } + .col-md-pull-3 { + right: 25%; + } + .col-md-pull-2 { + right: 16.66666667%; + } + .col-md-pull-1 { + right: 8.33333333%; + } + .col-md-pull-0 { + right: auto; + } + .col-md-push-12 { + left: 100%; + } + .col-md-push-11 { + left: 91.66666667%; + } + .col-md-push-10 { + left: 83.33333333%; + } + .col-md-push-9 { + left: 75%; + } + .col-md-push-8 { + left: 66.66666667%; + } + .col-md-push-7 { + left: 58.33333333%; + } + .col-md-push-6 { + left: 50%; + } + .col-md-push-5 { + left: 41.66666667%; + } + .col-md-push-4 { + left: 33.33333333%; + } + .col-md-push-3 { + left: 25%; + } + .col-md-push-2 { + left: 16.66666667%; + } + .col-md-push-1 { + left: 8.33333333%; + } + .col-md-push-0 { + left: auto; + } + .col-md-offset-12 { + margin-left: 100%; + } + .col-md-offset-11 { + margin-left: 91.66666667%; + } + .col-md-offset-10 { + margin-left: 83.33333333%; + } + .col-md-offset-9 { + margin-left: 75%; + } + .col-md-offset-8 { + margin-left: 66.66666667%; + } + .col-md-offset-7 { + margin-left: 58.33333333%; + } + .col-md-offset-6 { + margin-left: 50%; + } + .col-md-offset-5 { + margin-left: 41.66666667%; + } + .col-md-offset-4 { + margin-left: 33.33333333%; + } + .col-md-offset-3 { + margin-left: 25%; + } + .col-md-offset-2 { + margin-left: 16.66666667%; + } + .col-md-offset-1 { + margin-left: 8.33333333%; + } + .col-md-offset-0 { + margin-left: 0%; + } +} +@media (min-width: 1200px) { + .col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12 { + float: left; + } + .col-lg-12 { + width: 100%; + } + .col-lg-11 { + width: 91.66666667%; + } + .col-lg-10 { + width: 83.33333333%; + } + .col-lg-9 { + width: 75%; + } + .col-lg-8 { + width: 66.66666667%; + } + .col-lg-7 { + width: 58.33333333%; + } + .col-lg-6 { + width: 50%; + } + .col-lg-5 { + width: 41.66666667%; + } + .col-lg-4 { + width: 33.33333333%; + } + .col-lg-3 { + width: 25%; + } + .col-lg-2 { + width: 16.66666667%; + } + .col-lg-1 { + width: 8.33333333%; + } + .col-lg-pull-12 { + right: 100%; + } + .col-lg-pull-11 { + right: 91.66666667%; + } + .col-lg-pull-10 { + right: 83.33333333%; + } + .col-lg-pull-9 { + right: 75%; + } + .col-lg-pull-8 { + right: 66.66666667%; + } + .col-lg-pull-7 { + right: 58.33333333%; + } + .col-lg-pull-6 { + right: 50%; + } + .col-lg-pull-5 { + right: 41.66666667%; + } + .col-lg-pull-4 { + right: 33.33333333%; + } + .col-lg-pull-3 { + right: 25%; + } + .col-lg-pull-2 { + right: 16.66666667%; + } + .col-lg-pull-1 { + right: 8.33333333%; + } + .col-lg-pull-0 { + right: auto; + } + .col-lg-push-12 { + left: 100%; + } + .col-lg-push-11 { + left: 91.66666667%; + } + .col-lg-push-10 { + left: 83.33333333%; + } + .col-lg-push-9 { + left: 75%; + } + .col-lg-push-8 { + left: 66.66666667%; + } + .col-lg-push-7 { + left: 58.33333333%; + } + .col-lg-push-6 { + left: 50%; + } + .col-lg-push-5 { + left: 41.66666667%; + } + .col-lg-push-4 { + left: 33.33333333%; + } + .col-lg-push-3 { + left: 25%; + } + .col-lg-push-2 { + left: 16.66666667%; + } + .col-lg-push-1 { + left: 8.33333333%; + } + .col-lg-push-0 { + left: auto; + } + .col-lg-offset-12 { + margin-left: 100%; + } + .col-lg-offset-11 { + margin-left: 91.66666667%; + } + .col-lg-offset-10 { + margin-left: 83.33333333%; + } + .col-lg-offset-9 { + margin-left: 75%; + } + .col-lg-offset-8 { + margin-left: 66.66666667%; + } + .col-lg-offset-7 { + margin-left: 58.33333333%; + } + .col-lg-offset-6 { + margin-left: 50%; + } + .col-lg-offset-5 { + margin-left: 41.66666667%; + } + .col-lg-offset-4 { + margin-left: 33.33333333%; + } + .col-lg-offset-3 { + margin-left: 25%; + } + .col-lg-offset-2 { + margin-left: 16.66666667%; + } + .col-lg-offset-1 { + margin-left: 8.33333333%; + } + .col-lg-offset-0 { + margin-left: 0%; + } +} +table { + background-color: transparent; +} +caption { + padding-top: 8px; + padding-bottom: 8px; + color: #777777; + text-align: left; +} +th { + text-align: left; +} +.table { + width: 100%; + max-width: 100%; + margin-bottom: 20px; +} +.table > thead > tr > th, +.table > tbody > tr > th, +.table > tfoot > tr > th, +.table > thead > tr > td, +.table > tbody > tr > td, +.table > tfoot > tr > td { + padding: 8px; + line-height: 1.42857143; + vertical-align: top; + border-top: 1px solid #ddd; +} +.table > thead > tr > th { + vertical-align: bottom; + border-bottom: 2px solid #ddd; +} +.table > caption + thead > tr:first-child > th, +.table > colgroup + thead > tr:first-child > th, +.table > thead:first-child > tr:first-child > th, +.table > caption + thead > tr:first-child > td, +.table > colgroup + thead > tr:first-child > td, +.table > thead:first-child > tr:first-child > td { + border-top: 0; +} +.table > tbody + tbody { + border-top: 2px solid #ddd; +} +.table .table { + background-color: #fff; +} +.table-condensed > thead > tr > th, +.table-condensed > tbody > tr > th, +.table-condensed > tfoot > tr > th, +.table-condensed > thead > tr > td, +.table-condensed > tbody > tr > td, +.table-condensed > tfoot > tr > td { + padding: 5px; +} +.table-bordered { + border: 1px solid #ddd; +} +.table-bordered > thead > tr > th, +.table-bordered > tbody > tr > th, +.table-bordered > tfoot > tr > th, +.table-bordered > thead > tr > td, +.table-bordered > tbody > tr > td, +.table-bordered > tfoot > tr > td { + border: 1px solid #ddd; +} +.table-bordered > thead > tr > th, +.table-bordered > thead > tr > td { + border-bottom-width: 2px; +} +.table-striped > tbody > tr:nth-of-type(odd) { + background-color: #f9f9f9; +} +.table-hover > tbody > tr:hover { + background-color: #f5f5f5; +} +table col[class*="col-"] { + position: static; + float: none; + display: table-column; +} +table td[class*="col-"], +table th[class*="col-"] { + position: static; + float: none; + display: table-cell; +} +.table > thead > tr > td.active, +.table > tbody > tr > td.active, +.table > tfoot > tr > td.active, +.table > thead > tr > th.active, +.table > tbody > tr > th.active, +.table > tfoot > tr > th.active, +.table > thead > tr.active > td, +.table > tbody > tr.active > td, +.table > tfoot > tr.active > td, +.table > thead > tr.active > th, +.table > tbody > tr.active > th, +.table > tfoot > tr.active > th { + background-color: #f5f5f5; +} +.table-hover > tbody > tr > td.active:hover, +.table-hover > tbody > tr > th.active:hover, +.table-hover > tbody > tr.active:hover > td, +.table-hover > tbody > tr:hover > .active, +.table-hover > tbody > tr.active:hover > th { + background-color: #e8e8e8; +} +.table > thead > tr > td.success, +.table > tbody > tr > td.success, +.table > tfoot > tr > td.success, +.table > thead > tr > th.success, +.table > tbody > tr > th.success, +.table > tfoot > tr > th.success, +.table > thead > tr.success > td, +.table > tbody > tr.success > td, +.table > tfoot > tr.success > td, +.table > thead > tr.success > th, +.table > tbody > tr.success > th, +.table > tfoot > tr.success > th { + background-color: #dff0d8; +} +.table-hover > tbody > tr > td.success:hover, +.table-hover > tbody > tr > th.success:hover, +.table-hover > tbody > tr.success:hover > td, +.table-hover > tbody > tr:hover > .success, +.table-hover > tbody > tr.success:hover > th { + background-color: #d0e9c6; +} +.table > thead > tr > td.info, +.table > tbody > tr > td.info, +.table > tfoot > tr > td.info, +.table > thead > tr > th.info, +.table > tbody > tr > th.info, +.table > tfoot > tr > th.info, +.table > thead > tr.info > td, +.table > tbody > tr.info > td, +.table > tfoot > tr.info > td, +.table > thead > tr.info > th, +.table > tbody > tr.info > th, +.table > tfoot > tr.info > th { + background-color: #d9edf7; +} +.table-hover > tbody > tr > td.info:hover, +.table-hover > tbody > tr > th.info:hover, +.table-hover > tbody > tr.info:hover > td, +.table-hover > tbody > tr:hover > .info, +.table-hover > tbody > tr.info:hover > th { + background-color: #c4e3f3; +} +.table > thead > tr > td.warning, +.table > tbody > tr > td.warning, +.table > tfoot > tr > td.warning, +.table > thead > tr > th.warning, +.table > tbody > tr > th.warning, +.table > tfoot > tr > th.warning, +.table > thead > tr.warning > td, +.table > tbody > tr.warning > td, +.table > tfoot > tr.warning > td, +.table > thead > tr.warning > th, +.table > tbody > tr.warning > th, +.table > tfoot > tr.warning > th { + background-color: #fcf8e3; +} +.table-hover > tbody > tr > td.warning:hover, +.table-hover > tbody > tr > th.warning:hover, +.table-hover > tbody > tr.warning:hover > td, +.table-hover > tbody > tr:hover > .warning, +.table-hover > tbody > tr.warning:hover > th { + background-color: #faf2cc; +} +.table > thead > tr > td.danger, +.table > tbody > tr > td.danger, +.table > tfoot > tr > td.danger, +.table > thead > tr > th.danger, +.table > tbody > tr > th.danger, +.table > tfoot > tr > th.danger, +.table > thead > tr.danger > td, +.table > tbody > tr.danger > td, +.table > tfoot > tr.danger > td, +.table > thead > tr.danger > th, +.table > tbody > tr.danger > th, +.table > tfoot > tr.danger > th { + background-color: #f2dede; +} +.table-hover > tbody > tr > td.danger:hover, +.table-hover > tbody > tr > th.danger:hover, +.table-hover > tbody > tr.danger:hover > td, +.table-hover > tbody > tr:hover > .danger, +.table-hover > tbody > tr.danger:hover > th { + background-color: #ebcccc; +} +.table-responsive { + overflow-x: auto; + min-height: 0.01%; +} +@media screen and (max-width: 767px) { + .table-responsive { + width: 100%; + margin-bottom: 15px; + overflow-y: hidden; + -ms-overflow-style: -ms-autohiding-scrollbar; + border: 1px solid #ddd; + } + .table-responsive > .table { + margin-bottom: 0; + } + .table-responsive > .table > thead > tr > th, + .table-responsive > .table > tbody > tr > th, + .table-responsive > .table > tfoot > tr > th, + .table-responsive > .table > thead > tr > td, + .table-responsive > .table > tbody > tr > td, + .table-responsive > .table > tfoot > tr > td { + white-space: nowrap; + } + .table-responsive > .table-bordered { + border: 0; + } + .table-responsive > .table-bordered > thead > tr > th:first-child, + .table-responsive > .table-bordered > tbody > tr > th:first-child, + .table-responsive > .table-bordered > tfoot > tr > th:first-child, + .table-responsive > .table-bordered > thead > tr > td:first-child, + .table-responsive > .table-bordered > tbody > tr > td:first-child, + .table-responsive > .table-bordered > tfoot > tr > td:first-child { + border-left: 0; + } + .table-responsive > .table-bordered > thead > tr > th:last-child, + .table-responsive > .table-bordered > tbody > tr > th:last-child, + .table-responsive > .table-bordered > tfoot > tr > th:last-child, + .table-responsive > .table-bordered > thead > tr > td:last-child, + .table-responsive > .table-bordered > tbody > tr > td:last-child, + .table-responsive > .table-bordered > tfoot > tr > td:last-child { + border-right: 0; + } + .table-responsive > .table-bordered > tbody > tr:last-child > th, + .table-responsive > .table-bordered > tfoot > tr:last-child > th, + .table-responsive > .table-bordered > tbody > tr:last-child > td, + .table-responsive > .table-bordered > tfoot > tr:last-child > td { + border-bottom: 0; + } +} +fieldset { + padding: 0; + margin: 0; + border: 0; + min-width: 0; +} +legend { + display: block; + width: 100%; + padding: 0; + margin-bottom: 20px; + font-size: 21px; + line-height: inherit; + color: #333333; + border: 0; + border-bottom: 1px solid #e5e5e5; +} +label { + display: inline-block; + max-width: 100%; + margin-bottom: 5px; + font-weight: bold; +} +input[type="search"] { + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; +} +input[type="radio"], +input[type="checkbox"] { + margin: 4px 0 0; + margin-top: 1px \9; + line-height: normal; +} +input[type="file"] { + display: block; +} +input[type="range"] { + display: block; + width: 100%; +} +select[multiple], +select[size] { + height: auto; +} +input[type="file"]:focus, +input[type="radio"]:focus, +input[type="checkbox"]:focus { + outline: thin dotted; + outline: 5px auto -webkit-focus-ring-color; + outline-offset: -2px; +} +output { + display: block; + padding-top: 7px; + font-size: 14px; + line-height: 1.42857143; + color: #555555; +} +.form-control { + display: block; + width: 100%; + height: 34px; + padding: 6px 12px; + font-size: 14px; + line-height: 1.42857143; + color: #555555; + background-color: #fff; + background-image: none; + border: 1px solid #ccc; + border-radius: 4px; + -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); + box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); + -webkit-transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; + -o-transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; + transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; +} +.form-control:focus { + border-color: #66afe9; + outline: 0; + -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, 0.6); + box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, 0.6); +} +.form-control::-moz-placeholder { + color: #999; + opacity: 1; +} +.form-control:-ms-input-placeholder { + color: #999; +} +.form-control::-webkit-input-placeholder { + color: #999; +} +.form-control::-ms-expand { + border: 0; + background-color: transparent; +} +.form-control[disabled], +.form-control[readonly], +fieldset[disabled] .form-control { + background-color: #eeeeee; + opacity: 1; +} +.form-control[disabled], +fieldset[disabled] .form-control { + cursor: not-allowed; +} +textarea.form-control { + height: auto; +} +input[type="search"] { + -webkit-appearance: none; +} +@media screen and (-webkit-min-device-pixel-ratio: 0) { + input[type="date"].form-control, + input[type="time"].form-control, + input[type="datetime-local"].form-control, + input[type="month"].form-control { + line-height: 34px; + } + input[type="date"].input-sm, + input[type="time"].input-sm, + input[type="datetime-local"].input-sm, + input[type="month"].input-sm, + .input-group-sm input[type="date"], + .input-group-sm input[type="time"], + .input-group-sm input[type="datetime-local"], + .input-group-sm input[type="month"] { + line-height: 30px; + } + input[type="date"].input-lg, + input[type="time"].input-lg, + input[type="datetime-local"].input-lg, + input[type="month"].input-lg, + .input-group-lg input[type="date"], + .input-group-lg input[type="time"], + .input-group-lg input[type="datetime-local"], + .input-group-lg input[type="month"] { + line-height: 46px; + } +} +.form-group { + margin-bottom: 15px; +} +.radio, +.checkbox { + position: relative; + display: block; + margin-top: 10px; + margin-bottom: 10px; +} +.radio label, +.checkbox label { + min-height: 20px; + padding-left: 20px; + margin-bottom: 0; + font-weight: normal; + cursor: pointer; +} +.radio input[type="radio"], +.radio-inline input[type="radio"], +.checkbox input[type="checkbox"], +.checkbox-inline input[type="checkbox"] { + position: absolute; + margin-left: -20px; + margin-top: 4px \9; +} +.radio + .radio, +.checkbox + .checkbox { + margin-top: -5px; +} +.radio-inline, +.checkbox-inline { + position: relative; + display: inline-block; + padding-left: 20px; + margin-bottom: 0; + vertical-align: middle; + font-weight: normal; + cursor: pointer; +} +.radio-inline + .radio-inline, +.checkbox-inline + .checkbox-inline { + margin-top: 0; + margin-left: 10px; +} +input[type="radio"][disabled], +input[type="checkbox"][disabled], +input[type="radio"].disabled, +input[type="checkbox"].disabled, +fieldset[disabled] input[type="radio"], +fieldset[disabled] input[type="checkbox"] { + cursor: not-allowed; +} +.radio-inline.disabled, +.checkbox-inline.disabled, +fieldset[disabled] .radio-inline, +fieldset[disabled] .checkbox-inline { + cursor: not-allowed; +} +.radio.disabled label, +.checkbox.disabled label, +fieldset[disabled] .radio label, +fieldset[disabled] .checkbox label { + cursor: not-allowed; +} +.form-control-static { + padding-top: 7px; + padding-bottom: 7px; + margin-bottom: 0; + min-height: 34px; +} +.form-control-static.input-lg, +.form-control-static.input-sm { + padding-left: 0; + padding-right: 0; +} +.input-sm { + height: 30px; + padding: 5px 10px; + font-size: 12px; + line-height: 1.5; + border-radius: 3px; +} +select.input-sm { + height: 30px; + line-height: 30px; +} +textarea.input-sm, +select[multiple].input-sm { + height: auto; +} +.form-group-sm .form-control { + height: 30px; + padding: 5px 10px; + font-size: 12px; + line-height: 1.5; + border-radius: 3px; +} +.form-group-sm select.form-control { + height: 30px; + line-height: 30px; +} +.form-group-sm textarea.form-control, +.form-group-sm select[multiple].form-control { + height: auto; +} +.form-group-sm .form-control-static { + height: 30px; + min-height: 32px; + padding: 6px 10px; + font-size: 12px; + line-height: 1.5; +} +.input-lg { + height: 46px; + padding: 10px 16px; + font-size: 18px; + line-height: 1.3333333; + border-radius: 6px; +} +select.input-lg { + height: 46px; + line-height: 46px; +} +textarea.input-lg, +select[multiple].input-lg { + height: auto; +} +.form-group-lg .form-control { + height: 46px; + padding: 10px 16px; + font-size: 18px; + line-height: 1.3333333; + border-radius: 6px; +} +.form-group-lg select.form-control { + height: 46px; + line-height: 46px; +} +.form-group-lg textarea.form-control, +.form-group-lg select[multiple].form-control { + height: auto; +} +.form-group-lg .form-control-static { + height: 46px; + min-height: 38px; + padding: 11px 16px; + font-size: 18px; + line-height: 1.3333333; +} +.has-feedback { + position: relative; +} +.has-feedback .form-control { + padding-right: 42.5px; +} +.form-control-feedback { + position: absolute; + top: 0; + right: 0; + z-index: 2; + display: block; + width: 34px; + height: 34px; + line-height: 34px; + text-align: center; + pointer-events: none; +} +.input-lg + .form-control-feedback, +.input-group-lg + .form-control-feedback, +.form-group-lg .form-control + .form-control-feedback { + width: 46px; + height: 46px; + line-height: 46px; +} +.input-sm + .form-control-feedback, +.input-group-sm + .form-control-feedback, +.form-group-sm .form-control + .form-control-feedback { + width: 30px; + height: 30px; + line-height: 30px; +} +.has-success .help-block, +.has-success .control-label, +.has-success .radio, +.has-success .checkbox, +.has-success .radio-inline, +.has-success .checkbox-inline, +.has-success.radio label, +.has-success.checkbox label, +.has-success.radio-inline label, +.has-success.checkbox-inline label { + color: #3c763d; +} +.has-success .form-control { + border-color: #3c763d; + -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); + box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); +} +.has-success .form-control:focus { + border-color: #2b542c; + -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #67b168; + box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #67b168; +} +.has-success .input-group-addon { + color: #3c763d; + border-color: #3c763d; + background-color: #dff0d8; +} +.has-success .form-control-feedback { + color: #3c763d; +} +.has-warning .help-block, +.has-warning .control-label, +.has-warning .radio, +.has-warning .checkbox, +.has-warning .radio-inline, +.has-warning .checkbox-inline, +.has-warning.radio label, +.has-warning.checkbox label, +.has-warning.radio-inline label, +.has-warning.checkbox-inline label { + color: #8a6d3b; +} +.has-warning .form-control { + border-color: #8a6d3b; + -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); + box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); +} +.has-warning .form-control:focus { + border-color: #66512c; + -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #c0a16b; + box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #c0a16b; +} +.has-warning .input-group-addon { + color: #8a6d3b; + border-color: #8a6d3b; + background-color: #fcf8e3; +} +.has-warning .form-control-feedback { + color: #8a6d3b; +} +.has-error .help-block, +.has-error .control-label, +.has-error .radio, +.has-error .checkbox, +.has-error .radio-inline, +.has-error .checkbox-inline, +.has-error.radio label, +.has-error.checkbox label, +.has-error.radio-inline label, +.has-error.checkbox-inline label { + color: #a94442; +} +.has-error .form-control { + border-color: #a94442; + -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); + box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); +} +.has-error .form-control:focus { + border-color: #843534; + -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #ce8483; + box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #ce8483; +} +.has-error .input-group-addon { + color: #a94442; + border-color: #a94442; + background-color: #f2dede; +} +.has-error .form-control-feedback { + color: #a94442; +} +.has-feedback label ~ .form-control-feedback { + top: 25px; +} +.has-feedback label.sr-only ~ .form-control-feedback { + top: 0; +} +.help-block { + display: block; + margin-top: 5px; + margin-bottom: 10px; + color: #737373; +} +@media (min-width: 768px) { + .form-inline .form-group { + display: inline-block; + margin-bottom: 0; + vertical-align: middle; + } + .form-inline .form-control { + display: inline-block; + width: auto; + vertical-align: middle; + } + .form-inline .form-control-static { + display: inline-block; + } + .form-inline .input-group { + display: inline-table; + vertical-align: middle; + } + .form-inline .input-group .input-group-addon, + .form-inline .input-group .input-group-btn, + .form-inline .input-group .form-control { + width: auto; + } + .form-inline .input-group > .form-control { + width: 100%; + } + .form-inline .control-label { + margin-bottom: 0; + vertical-align: middle; + } + .form-inline .radio, + .form-inline .checkbox { + display: inline-block; + margin-top: 0; + margin-bottom: 0; + vertical-align: middle; + } + .form-inline .radio label, + .form-inline .checkbox label { + padding-left: 0; + } + .form-inline .radio input[type="radio"], + .form-inline .checkbox input[type="checkbox"] { + position: relative; + margin-left: 0; + } + .form-inline .has-feedback .form-control-feedback { + top: 0; + } +} +.form-horizontal .radio, +.form-horizontal .checkbox, +.form-horizontal .radio-inline, +.form-horizontal .checkbox-inline { + margin-top: 0; + margin-bottom: 0; + padding-top: 7px; +} +.form-horizontal .radio, +.form-horizontal .checkbox { + min-height: 27px; +} +.form-horizontal .form-group { + margin-left: -15px; + margin-right: -15px; +} +@media (min-width: 768px) { + .form-horizontal .control-label { + text-align: right; + margin-bottom: 0; + padding-top: 7px; + } +} +.form-horizontal .has-feedback .form-control-feedback { + right: 15px; +} +@media (min-width: 768px) { + .form-horizontal .form-group-lg .control-label { + padding-top: 11px; + font-size: 18px; + } +} +@media (min-width: 768px) { + .form-horizontal .form-group-sm .control-label { + padding-top: 6px; + font-size: 12px; + } +} +.btn { + display: inline-block; + margin-bottom: 0; + font-weight: normal; + text-align: center; + vertical-align: middle; + touch-action: manipulation; + cursor: pointer; + background-image: none; + border: 1px solid transparent; + white-space: nowrap; + padding: 6px 12px; + font-size: 14px; + line-height: 1.42857143; + border-radius: 4px; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} +.btn:focus, +.btn:active:focus, +.btn.active:focus, +.btn.focus, +.btn:active.focus, +.btn.active.focus { + outline: thin dotted; + outline: 5px auto -webkit-focus-ring-color; + outline-offset: -2px; +} +.btn:hover, +.btn:focus, +.btn.focus { + color: #333; + text-decoration: none; +} +.btn:active, +.btn.active { + outline: 0; + background-image: none; + -webkit-box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); +} +.btn.disabled, +.btn[disabled], +fieldset[disabled] .btn { + cursor: not-allowed; + opacity: 0.65; + filter: alpha(opacity=65); + -webkit-box-shadow: none; + box-shadow: none; +} +a.btn.disabled, +fieldset[disabled] a.btn { + pointer-events: none; +} +.btn-default { + color: #333; + background-color: #fff; + border-color: #ccc; +} +.btn-default:focus, +.btn-default.focus { + color: #333; + background-color: #e6e6e6; + border-color: #8c8c8c; +} +.btn-default:hover { + color: #333; + background-color: #e6e6e6; + border-color: #adadad; +} +.btn-default:active, +.btn-default.active, +.open > .dropdown-toggle.btn-default { + color: #333; + background-color: #e6e6e6; + border-color: #adadad; +} +.btn-default:active:hover, +.btn-default.active:hover, +.open > .dropdown-toggle.btn-default:hover, +.btn-default:active:focus, +.btn-default.active:focus, +.open > .dropdown-toggle.btn-default:focus, +.btn-default:active.focus, +.btn-default.active.focus, +.open > .dropdown-toggle.btn-default.focus { + color: #333; + background-color: #d4d4d4; + border-color: #8c8c8c; +} +.btn-default:active, +.btn-default.active, +.open > .dropdown-toggle.btn-default { + background-image: none; +} +.btn-default.disabled:hover, +.btn-default[disabled]:hover, +fieldset[disabled] .btn-default:hover, +.btn-default.disabled:focus, +.btn-default[disabled]:focus, +fieldset[disabled] .btn-default:focus, +.btn-default.disabled.focus, +.btn-default[disabled].focus, +fieldset[disabled] .btn-default.focus { + background-color: #fff; + border-color: #ccc; +} +.btn-default .badge { + color: #fff; + background-color: #333; +} +.btn-primary { + color: #fff; + background-color: #337ab7; + border-color: #2e6da4; +} +.btn-primary:focus, +.btn-primary.focus { + color: #fff; + background-color: #286090; + border-color: #122b40; +} +.btn-primary:hover { + color: #fff; + background-color: #286090; + border-color: #204d74; +} +.btn-primary:active, +.btn-primary.active, +.open > .dropdown-toggle.btn-primary { + color: #fff; + background-color: #286090; + border-color: #204d74; +} +.btn-primary:active:hover, +.btn-primary.active:hover, +.open > .dropdown-toggle.btn-primary:hover, +.btn-primary:active:focus, +.btn-primary.active:focus, +.open > .dropdown-toggle.btn-primary:focus, +.btn-primary:active.focus, +.btn-primary.active.focus, +.open > .dropdown-toggle.btn-primary.focus { + color: #fff; + background-color: #204d74; + border-color: #122b40; +} +.btn-primary:active, +.btn-primary.active, +.open > .dropdown-toggle.btn-primary { + background-image: none; +} +.btn-primary.disabled:hover, +.btn-primary[disabled]:hover, +fieldset[disabled] .btn-primary:hover, +.btn-primary.disabled:focus, +.btn-primary[disabled]:focus, +fieldset[disabled] .btn-primary:focus, +.btn-primary.disabled.focus, +.btn-primary[disabled].focus, +fieldset[disabled] .btn-primary.focus { + background-color: #337ab7; + border-color: #2e6da4; +} +.btn-primary .badge { + color: #337ab7; + background-color: #fff; +} +.btn-success { + color: #fff; + background-color: #5cb85c; + border-color: #4cae4c; +} +.btn-success:focus, +.btn-success.focus { + color: #fff; + background-color: #449d44; + border-color: #255625; +} +.btn-success:hover { + color: #fff; + background-color: #449d44; + border-color: #398439; +} +.btn-success:active, +.btn-success.active, +.open > .dropdown-toggle.btn-success { + color: #fff; + background-color: #449d44; + border-color: #398439; +} +.btn-success:active:hover, +.btn-success.active:hover, +.open > .dropdown-toggle.btn-success:hover, +.btn-success:active:focus, +.btn-success.active:focus, +.open > .dropdown-toggle.btn-success:focus, +.btn-success:active.focus, +.btn-success.active.focus, +.open > .dropdown-toggle.btn-success.focus { + color: #fff; + background-color: #398439; + border-color: #255625; +} +.btn-success:active, +.btn-success.active, +.open > .dropdown-toggle.btn-success { + background-image: none; +} +.btn-success.disabled:hover, +.btn-success[disabled]:hover, +fieldset[disabled] .btn-success:hover, +.btn-success.disabled:focus, +.btn-success[disabled]:focus, +fieldset[disabled] .btn-success:focus, +.btn-success.disabled.focus, +.btn-success[disabled].focus, +fieldset[disabled] .btn-success.focus { + background-color: #5cb85c; + border-color: #4cae4c; +} +.btn-success .badge { + color: #5cb85c; + background-color: #fff; +} +.btn-info { + color: #fff; + background-color: #5bc0de; + border-color: #46b8da; +} +.btn-info:focus, +.btn-info.focus { + color: #fff; + background-color: #31b0d5; + border-color: #1b6d85; +} +.btn-info:hover { + color: #fff; + background-color: #31b0d5; + border-color: #269abc; +} +.btn-info:active, +.btn-info.active, +.open > .dropdown-toggle.btn-info { + color: #fff; + background-color: #31b0d5; + border-color: #269abc; +} +.btn-info:active:hover, +.btn-info.active:hover, +.open > .dropdown-toggle.btn-info:hover, +.btn-info:active:focus, +.btn-info.active:focus, +.open > .dropdown-toggle.btn-info:focus, +.btn-info:active.focus, +.btn-info.active.focus, +.open > .dropdown-toggle.btn-info.focus { + color: #fff; + background-color: #269abc; + border-color: #1b6d85; +} +.btn-info:active, +.btn-info.active, +.open > .dropdown-toggle.btn-info { + background-image: none; +} +.btn-info.disabled:hover, +.btn-info[disabled]:hover, +fieldset[disabled] .btn-info:hover, +.btn-info.disabled:focus, +.btn-info[disabled]:focus, +fieldset[disabled] .btn-info:focus, +.btn-info.disabled.focus, +.btn-info[disabled].focus, +fieldset[disabled] .btn-info.focus { + background-color: #5bc0de; + border-color: #46b8da; +} +.btn-info .badge { + color: #5bc0de; + background-color: #fff; +} +.btn-warning { + color: #fff; + background-color: #f0ad4e; + border-color: #eea236; +} +.btn-warning:focus, +.btn-warning.focus { + color: #fff; + background-color: #ec971f; + border-color: #985f0d; +} +.btn-warning:hover { + color: #fff; + background-color: #ec971f; + border-color: #d58512; +} +.btn-warning:active, +.btn-warning.active, +.open > .dropdown-toggle.btn-warning { + color: #fff; + background-color: #ec971f; + border-color: #d58512; +} +.btn-warning:active:hover, +.btn-warning.active:hover, +.open > .dropdown-toggle.btn-warning:hover, +.btn-warning:active:focus, +.btn-warning.active:focus, +.open > .dropdown-toggle.btn-warning:focus, +.btn-warning:active.focus, +.btn-warning.active.focus, +.open > .dropdown-toggle.btn-warning.focus { + color: #fff; + background-color: #d58512; + border-color: #985f0d; +} +.btn-warning:active, +.btn-warning.active, +.open > .dropdown-toggle.btn-warning { + background-image: none; +} +.btn-warning.disabled:hover, +.btn-warning[disabled]:hover, +fieldset[disabled] .btn-warning:hover, +.btn-warning.disabled:focus, +.btn-warning[disabled]:focus, +fieldset[disabled] .btn-warning:focus, +.btn-warning.disabled.focus, +.btn-warning[disabled].focus, +fieldset[disabled] .btn-warning.focus { + background-color: #f0ad4e; + border-color: #eea236; +} +.btn-warning .badge { + color: #f0ad4e; + background-color: #fff; +} +.btn-danger { + color: #fff; + background-color: #d9534f; + border-color: #d43f3a; +} +.btn-danger:focus, +.btn-danger.focus { + color: #fff; + background-color: #c9302c; + border-color: #761c19; +} +.btn-danger:hover { + color: #fff; + background-color: #c9302c; + border-color: #ac2925; +} +.btn-danger:active, +.btn-danger.active, +.open > .dropdown-toggle.btn-danger { + color: #fff; + background-color: #c9302c; + border-color: #ac2925; +} +.btn-danger:active:hover, +.btn-danger.active:hover, +.open > .dropdown-toggle.btn-danger:hover, +.btn-danger:active:focus, +.btn-danger.active:focus, +.open > .dropdown-toggle.btn-danger:focus, +.btn-danger:active.focus, +.btn-danger.active.focus, +.open > .dropdown-toggle.btn-danger.focus { + color: #fff; + background-color: #ac2925; + border-color: #761c19; +} +.btn-danger:active, +.btn-danger.active, +.open > .dropdown-toggle.btn-danger { + background-image: none; +} +.btn-danger.disabled:hover, +.btn-danger[disabled]:hover, +fieldset[disabled] .btn-danger:hover, +.btn-danger.disabled:focus, +.btn-danger[disabled]:focus, +fieldset[disabled] .btn-danger:focus, +.btn-danger.disabled.focus, +.btn-danger[disabled].focus, +fieldset[disabled] .btn-danger.focus { + background-color: #d9534f; + border-color: #d43f3a; +} +.btn-danger .badge { + color: #d9534f; + background-color: #fff; +} +.btn-link { + color: #337ab7; + font-weight: normal; + border-radius: 0; +} +.btn-link, +.btn-link:active, +.btn-link.active, +.btn-link[disabled], +fieldset[disabled] .btn-link { + background-color: transparent; + -webkit-box-shadow: none; + box-shadow: none; +} +.btn-link, +.btn-link:hover, +.btn-link:focus, +.btn-link:active { + border-color: transparent; +} +.btn-link:hover, +.btn-link:focus { + color: #23527c; + text-decoration: underline; + background-color: transparent; +} +.btn-link[disabled]:hover, +fieldset[disabled] .btn-link:hover, +.btn-link[disabled]:focus, +fieldset[disabled] .btn-link:focus { + color: #777777; + text-decoration: none; +} +.btn-lg, +.btn-group-lg > .btn { + padding: 10px 16px; + font-size: 18px; + line-height: 1.3333333; + border-radius: 6px; +} +.btn-sm, +.btn-group-sm > .btn { + padding: 5px 10px; + font-size: 12px; + line-height: 1.5; + border-radius: 3px; +} +.btn-xs, +.btn-group-xs > .btn { + padding: 1px 5px; + font-size: 12px; + line-height: 1.5; + border-radius: 3px; +} +.btn-block { + display: block; + width: 100%; +} +.btn-block + .btn-block { + margin-top: 5px; +} +input[type="submit"].btn-block, +input[type="reset"].btn-block, +input[type="button"].btn-block { + width: 100%; +} +.fade { + opacity: 0; + -webkit-transition: opacity 0.15s linear; + -o-transition: opacity 0.15s linear; + transition: opacity 0.15s linear; +} +.fade.in { + opacity: 1; +} +.collapse { + display: none; +} +.collapse.in { + display: block; +} +tr.collapse.in { + display: table-row; +} +tbody.collapse.in { + display: table-row-group; +} +.collapsing { + position: relative; + height: 0; + overflow: hidden; + -webkit-transition-property: height, visibility; + transition-property: height, visibility; + -webkit-transition-duration: 0.35s; + transition-duration: 0.35s; + -webkit-transition-timing-function: ease; + transition-timing-function: ease; +} +.caret { + display: inline-block; + width: 0; + height: 0; + margin-left: 2px; + vertical-align: middle; + border-top: 4px dashed; + border-top: 4px solid \9; + border-right: 4px solid transparent; + border-left: 4px solid transparent; +} +.dropup, +.dropdown { + position: relative; +} +.dropdown-toggle:focus { + outline: 0; +} +.dropdown-menu { + position: absolute; + top: 100%; + left: 0; + z-index: 1000; + display: none; + float: left; + min-width: 160px; + padding: 5px 0; + margin: 2px 0 0; + list-style: none; + font-size: 14px; + text-align: left; + background-color: #fff; + border: 1px solid #ccc; + border: 1px solid rgba(0, 0, 0, 0.15); + border-radius: 4px; + -webkit-box-shadow: 0 6px 12px rgba(0, 0, 0, 0.175); + box-shadow: 0 6px 12px rgba(0, 0, 0, 0.175); + background-clip: padding-box; +} +.dropdown-menu.pull-right { + right: 0; + left: auto; +} +.dropdown-menu .divider { + height: 1px; + margin: 9px 0; + overflow: hidden; + background-color: #e5e5e5; +} +.dropdown-menu > li > a { + display: block; + padding: 3px 20px; + clear: both; + font-weight: normal; + line-height: 1.42857143; + color: #333333; + white-space: nowrap; +} +.dropdown-menu > li > a:hover, +.dropdown-menu > li > a:focus { + text-decoration: none; + color: #262626; + background-color: #f5f5f5; +} +.dropdown-menu > .active > a, +.dropdown-menu > .active > a:hover, +.dropdown-menu > .active > a:focus { + color: #fff; + text-decoration: none; + outline: 0; + background-color: #337ab7; +} +.dropdown-menu > .disabled > a, +.dropdown-menu > .disabled > a:hover, +.dropdown-menu > .disabled > a:focus { + color: #777777; +} +.dropdown-menu > .disabled > a:hover, +.dropdown-menu > .disabled > a:focus { + text-decoration: none; + background-color: transparent; + background-image: none; + filter: progid:DXImageTransform.Microsoft.gradient(enabled = false); + cursor: not-allowed; +} +.open > .dropdown-menu { + display: block; +} +.open > a { + outline: 0; +} +.dropdown-menu-right { + left: auto; + right: 0; +} +.dropdown-menu-left { + left: 0; + right: auto; +} +.dropdown-header { + display: block; + padding: 3px 20px; + font-size: 12px; + line-height: 1.42857143; + color: #777777; + white-space: nowrap; +} +.dropdown-backdrop { + position: fixed; + left: 0; + right: 0; + bottom: 0; + top: 0; + z-index: 990; +} +.pull-right > .dropdown-menu { + right: 0; + left: auto; +} +.dropup .caret, +.navbar-fixed-bottom .dropdown .caret { + border-top: 0; + border-bottom: 4px dashed; + border-bottom: 4px solid \9; + content: ""; +} +.dropup .dropdown-menu, +.navbar-fixed-bottom .dropdown .dropdown-menu { + top: auto; + bottom: 100%; + margin-bottom: 2px; +} +@media (min-width: 768px) { + .navbar-right .dropdown-menu { + left: auto; + right: 0; + } + .navbar-right .dropdown-menu-left { + left: 0; + right: auto; + } +} +.btn-group, +.btn-group-vertical { + position: relative; + display: inline-block; + vertical-align: middle; +} +.btn-group > .btn, +.btn-group-vertical > .btn { + position: relative; + float: left; +} +.btn-group > .btn:hover, +.btn-group-vertical > .btn:hover, +.btn-group > .btn:focus, +.btn-group-vertical > .btn:focus, +.btn-group > .btn:active, +.btn-group-vertical > .btn:active, +.btn-group > .btn.active, +.btn-group-vertical > .btn.active { + z-index: 2; +} +.btn-group .btn + .btn, +.btn-group .btn + .btn-group, +.btn-group .btn-group + .btn, +.btn-group .btn-group + .btn-group { + margin-left: -1px; +} +.btn-toolbar { + margin-left: -5px; +} +.btn-toolbar .btn, +.btn-toolbar .btn-group, +.btn-toolbar .input-group { + float: left; +} +.btn-toolbar > .btn, +.btn-toolbar > .btn-group, +.btn-toolbar > .input-group { + margin-left: 5px; +} +.btn-group > .btn:not(:first-child):not(:last-child):not(.dropdown-toggle) { + border-radius: 0; +} +.btn-group > .btn:first-child { + margin-left: 0; +} +.btn-group > .btn:first-child:not(:last-child):not(.dropdown-toggle) { + border-bottom-right-radius: 0; + border-top-right-radius: 0; +} +.btn-group > .btn:last-child:not(:first-child), +.btn-group > .dropdown-toggle:not(:first-child) { + border-bottom-left-radius: 0; + border-top-left-radius: 0; +} +.btn-group > .btn-group { + float: left; +} +.btn-group > .btn-group:not(:first-child):not(:last-child) > .btn { + border-radius: 0; +} +.btn-group > .btn-group:first-child:not(:last-child) > .btn:last-child, +.btn-group > .btn-group:first-child:not(:last-child) > .dropdown-toggle { + border-bottom-right-radius: 0; + border-top-right-radius: 0; +} +.btn-group > .btn-group:last-child:not(:first-child) > .btn:first-child { + border-bottom-left-radius: 0; + border-top-left-radius: 0; +} +.btn-group .dropdown-toggle:active, +.btn-group.open .dropdown-toggle { + outline: 0; +} +.btn-group > .btn + .dropdown-toggle { + padding-left: 8px; + padding-right: 8px; +} +.btn-group > .btn-lg + .dropdown-toggle { + padding-left: 12px; + padding-right: 12px; +} +.btn-group.open .dropdown-toggle { + -webkit-box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); +} +.btn-group.open .dropdown-toggle.btn-link { + -webkit-box-shadow: none; + box-shadow: none; +} +.btn .caret { + margin-left: 0; +} +.btn-lg .caret { + border-width: 5px 5px 0; + border-bottom-width: 0; +} +.dropup .btn-lg .caret { + border-width: 0 5px 5px; +} +.btn-group-vertical > .btn, +.btn-group-vertical > .btn-group, +.btn-group-vertical > .btn-group > .btn { + display: block; + float: none; + width: 100%; + max-width: 100%; +} +.btn-group-vertical > .btn-group > .btn { + float: none; +} +.btn-group-vertical > .btn + .btn, +.btn-group-vertical > .btn + .btn-group, +.btn-group-vertical > .btn-group + .btn, +.btn-group-vertical > .btn-group + .btn-group { + margin-top: -1px; + margin-left: 0; +} +.btn-group-vertical > .btn:not(:first-child):not(:last-child) { + border-radius: 0; +} +.btn-group-vertical > .btn:first-child:not(:last-child) { + border-top-right-radius: 4px; + border-top-left-radius: 4px; + border-bottom-right-radius: 0; + border-bottom-left-radius: 0; +} +.btn-group-vertical > .btn:last-child:not(:first-child) { + border-top-right-radius: 0; + border-top-left-radius: 0; + border-bottom-right-radius: 4px; + border-bottom-left-radius: 4px; +} +.btn-group-vertical > .btn-group:not(:first-child):not(:last-child) > .btn { + border-radius: 0; +} +.btn-group-vertical > .btn-group:first-child:not(:last-child) > .btn:last-child, +.btn-group-vertical > .btn-group:first-child:not(:last-child) > .dropdown-toggle { + border-bottom-right-radius: 0; + border-bottom-left-radius: 0; +} +.btn-group-vertical > .btn-group:last-child:not(:first-child) > .btn:first-child { + border-top-right-radius: 0; + border-top-left-radius: 0; +} +.btn-group-justified { + display: table; + width: 100%; + table-layout: fixed; + border-collapse: separate; +} +.btn-group-justified > .btn, +.btn-group-justified > .btn-group { + float: none; + display: table-cell; + width: 1%; +} +.btn-group-justified > .btn-group .btn { + width: 100%; +} +.btn-group-justified > .btn-group .dropdown-menu { + left: auto; +} +[data-toggle="buttons"] > .btn input[type="radio"], +[data-toggle="buttons"] > .btn-group > .btn input[type="radio"], +[data-toggle="buttons"] > .btn input[type="checkbox"], +[data-toggle="buttons"] > .btn-group > .btn input[type="checkbox"] { + position: absolute; + clip: rect(0, 0, 0, 0); + pointer-events: none; +} +.input-group { + position: relative; + display: table; + border-collapse: separate; +} +.input-group[class*="col-"] { + float: none; + padding-left: 0; + padding-right: 0; +} +.input-group .form-control { + position: relative; + z-index: 2; + float: left; + width: 100%; + margin-bottom: 0; +} +.input-group .form-control:focus { + z-index: 3; +} +.input-group-lg > .form-control, +.input-group-lg > .input-group-addon, +.input-group-lg > .input-group-btn > .btn { + height: 46px; + padding: 10px 16px; + font-size: 18px; + line-height: 1.3333333; + border-radius: 6px; +} +select.input-group-lg > .form-control, +select.input-group-lg > .input-group-addon, +select.input-group-lg > .input-group-btn > .btn { + height: 46px; + line-height: 46px; +} +textarea.input-group-lg > .form-control, +textarea.input-group-lg > .input-group-addon, +textarea.input-group-lg > .input-group-btn > .btn, +select[multiple].input-group-lg > .form-control, +select[multiple].input-group-lg > .input-group-addon, +select[multiple].input-group-lg > .input-group-btn > .btn { + height: auto; +} +.input-group-sm > .form-control, +.input-group-sm > .input-group-addon, +.input-group-sm > .input-group-btn > .btn { + height: 30px; + padding: 5px 10px; + font-size: 12px; + line-height: 1.5; + border-radius: 3px; +} +select.input-group-sm > .form-control, +select.input-group-sm > .input-group-addon, +select.input-group-sm > .input-group-btn > .btn { + height: 30px; + line-height: 30px; +} +textarea.input-group-sm > .form-control, +textarea.input-group-sm > .input-group-addon, +textarea.input-group-sm > .input-group-btn > .btn, +select[multiple].input-group-sm > .form-control, +select[multiple].input-group-sm > .input-group-addon, +select[multiple].input-group-sm > .input-group-btn > .btn { + height: auto; +} +.input-group-addon, +.input-group-btn, +.input-group .form-control { + display: table-cell; +} +.input-group-addon:not(:first-child):not(:last-child), +.input-group-btn:not(:first-child):not(:last-child), +.input-group .form-control:not(:first-child):not(:last-child) { + border-radius: 0; +} +.input-group-addon, +.input-group-btn { + width: 1%; + white-space: nowrap; + vertical-align: middle; +} +.input-group-addon { + padding: 6px 12px; + font-size: 14px; + font-weight: normal; + line-height: 1; + color: #555555; + text-align: center; + background-color: #eeeeee; + border: 1px solid #ccc; + border-radius: 4px; +} +.input-group-addon.input-sm { + padding: 5px 10px; + font-size: 12px; + border-radius: 3px; +} +.input-group-addon.input-lg { + padding: 10px 16px; + font-size: 18px; + border-radius: 6px; +} +.input-group-addon input[type="radio"], +.input-group-addon input[type="checkbox"] { + margin-top: 0; +} +.input-group .form-control:first-child, +.input-group-addon:first-child, +.input-group-btn:first-child > .btn, +.input-group-btn:first-child > .btn-group > .btn, +.input-group-btn:first-child > .dropdown-toggle, +.input-group-btn:last-child > .btn:not(:last-child):not(.dropdown-toggle), +.input-group-btn:last-child > .btn-group:not(:last-child) > .btn { + border-bottom-right-radius: 0; + border-top-right-radius: 0; +} +.input-group-addon:first-child { + border-right: 0; +} +.input-group .form-control:last-child, +.input-group-addon:last-child, +.input-group-btn:last-child > .btn, +.input-group-btn:last-child > .btn-group > .btn, +.input-group-btn:last-child > .dropdown-toggle, +.input-group-btn:first-child > .btn:not(:first-child), +.input-group-btn:first-child > .btn-group:not(:first-child) > .btn { + border-bottom-left-radius: 0; + border-top-left-radius: 0; +} +.input-group-addon:last-child { + border-left: 0; +} +.input-group-btn { + position: relative; + font-size: 0; + white-space: nowrap; +} +.input-group-btn > .btn { + position: relative; +} +.input-group-btn > .btn + .btn { + margin-left: -1px; +} +.input-group-btn > .btn:hover, +.input-group-btn > .btn:focus, +.input-group-btn > .btn:active { + z-index: 2; +} +.input-group-btn:first-child > .btn, +.input-group-btn:first-child > .btn-group { + margin-right: -1px; +} +.input-group-btn:last-child > .btn, +.input-group-btn:last-child > .btn-group { + z-index: 2; + margin-left: -1px; +} +.nav { + margin-bottom: 0; + padding-left: 0; + list-style: none; +} +.nav > li { + position: relative; + display: block; +} +.nav > li > a { + position: relative; + display: block; + padding: 10px 15px; +} +.nav > li > a:hover, +.nav > li > a:focus { + text-decoration: none; + background-color: #eeeeee; +} +.nav > li.disabled > a { + color: #777777; +} +.nav > li.disabled > a:hover, +.nav > li.disabled > a:focus { + color: #777777; + text-decoration: none; + background-color: transparent; + cursor: not-allowed; +} +.nav .open > a, +.nav .open > a:hover, +.nav .open > a:focus { + background-color: #eeeeee; + border-color: #337ab7; +} +.nav .nav-divider { + height: 1px; + margin: 9px 0; + overflow: hidden; + background-color: #e5e5e5; +} +.nav > li > a > img { + max-width: none; +} +.nav-tabs { + border-bottom: 1px solid #ddd; +} +.nav-tabs > li { + float: left; + margin-bottom: -1px; +} +.nav-tabs > li > a { + margin-right: 2px; + line-height: 1.42857143; + border: 1px solid transparent; + border-radius: 4px 4px 0 0; +} +.nav-tabs > li > a:hover { + border-color: #eeeeee #eeeeee #ddd; +} +.nav-tabs > li.active > a, +.nav-tabs > li.active > a:hover, +.nav-tabs > li.active > a:focus { + color: #555555; + background-color: #fff; + border: 1px solid #ddd; + border-bottom-color: transparent; + cursor: default; +} +.nav-tabs.nav-justified { + width: 100%; + border-bottom: 0; +} +.nav-tabs.nav-justified > li { + float: none; +} +.nav-tabs.nav-justified > li > a { + text-align: center; + margin-bottom: 5px; +} +.nav-tabs.nav-justified > .dropdown .dropdown-menu { + top: auto; + left: auto; +} +@media (min-width: 768px) { + .nav-tabs.nav-justified > li { + display: table-cell; + width: 1%; + } + .nav-tabs.nav-justified > li > a { + margin-bottom: 0; + } +} +.nav-tabs.nav-justified > li > a { + margin-right: 0; + border-radius: 4px; +} +.nav-tabs.nav-justified > .active > a, +.nav-tabs.nav-justified > .active > a:hover, +.nav-tabs.nav-justified > .active > a:focus { + border: 1px solid #ddd; +} +@media (min-width: 768px) { + .nav-tabs.nav-justified > li > a { + border-bottom: 1px solid #ddd; + border-radius: 4px 4px 0 0; + } + .nav-tabs.nav-justified > .active > a, + .nav-tabs.nav-justified > .active > a:hover, + .nav-tabs.nav-justified > .active > a:focus { + border-bottom-color: #fff; + } +} +.nav-pills > li { + float: left; +} +.nav-pills > li > a { + border-radius: 4px; +} +.nav-pills > li + li { + margin-left: 2px; +} +.nav-pills > li.active > a, +.nav-pills > li.active > a:hover, +.nav-pills > li.active > a:focus { + color: #fff; + background-color: #337ab7; +} +.nav-stacked > li { + float: none; +} +.nav-stacked > li + li { + margin-top: 2px; + margin-left: 0; +} +.nav-justified { + width: 100%; +} +.nav-justified > li { + float: none; +} +.nav-justified > li > a { + text-align: center; + margin-bottom: 5px; +} +.nav-justified > .dropdown .dropdown-menu { + top: auto; + left: auto; +} +@media (min-width: 768px) { + .nav-justified > li { + display: table-cell; + width: 1%; + } + .nav-justified > li > a { + margin-bottom: 0; + } +} +.nav-tabs-justified { + border-bottom: 0; +} +.nav-tabs-justified > li > a { + margin-right: 0; + border-radius: 4px; +} +.nav-tabs-justified > .active > a, +.nav-tabs-justified > .active > a:hover, +.nav-tabs-justified > .active > a:focus { + border: 1px solid #ddd; +} +@media (min-width: 768px) { + .nav-tabs-justified > li > a { + border-bottom: 1px solid #ddd; + border-radius: 4px 4px 0 0; + } + .nav-tabs-justified > .active > a, + .nav-tabs-justified > .active > a:hover, + .nav-tabs-justified > .active > a:focus { + border-bottom-color: #fff; + } +} +.tab-content > .tab-pane { + display: none; +} +.tab-content > .active { + display: block; +} +.nav-tabs .dropdown-menu { + margin-top: -1px; + border-top-right-radius: 0; + border-top-left-radius: 0; +} +.navbar { + position: relative; + min-height: 32px; + margin-bottom: 20px; + border: 1px solid transparent; +} +@media (min-width: 768px) { + .navbar { + border-radius: 4px; + } +} +@media (min-width: 768px) { + .navbar-header { + float: left; + } +} +.navbar-collapse { + overflow-x: visible; + padding-right: 15px; + padding-left: 15px; + border-top: 1px solid transparent; + box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1); + -webkit-overflow-scrolling: touch; +} +.navbar-collapse.in { + overflow-y: auto; +} +@media (min-width: 768px) { + .navbar-collapse { + width: auto; + border-top: 0; + box-shadow: none; + } + .navbar-collapse.collapse { + display: block !important; + height: auto !important; + padding-bottom: 0; + overflow: visible !important; + } + .navbar-collapse.in { + overflow-y: visible; + } + .navbar-fixed-top .navbar-collapse, + .navbar-static-top .navbar-collapse, + .navbar-fixed-bottom .navbar-collapse { + padding-left: 0; + padding-right: 0; + } +} +.navbar-fixed-top .navbar-collapse, +.navbar-fixed-bottom .navbar-collapse { + max-height: 340px; +} +@media (max-device-width: 480px) and (orientation: landscape) { + .navbar-fixed-top .navbar-collapse, + .navbar-fixed-bottom .navbar-collapse { + max-height: 200px; + } +} +.container > .navbar-header, +.container-fluid > .navbar-header, +.container > .navbar-collapse, +.container-fluid > .navbar-collapse { + margin-right: -15px; + margin-left: -15px; +} +@media (min-width: 768px) { + .container > .navbar-header, + .container-fluid > .navbar-header, + .container > .navbar-collapse, + .container-fluid > .navbar-collapse { + margin-right: 0; + margin-left: 0; + } +} +.navbar-static-top { + z-index: 1000; + border-width: 0 0 1px; +} +@media (min-width: 768px) { + .navbar-static-top { + border-radius: 0; + } +} +.navbar-fixed-top, +.navbar-fixed-bottom { + position: fixed; + right: 0; + left: 0; + z-index: 1030; +} +@media (min-width: 768px) { + .navbar-fixed-top, + .navbar-fixed-bottom { + border-radius: 0; + } +} +.navbar-fixed-top { + top: 0; + border-width: 0 0 1px; +} +.navbar-fixed-bottom { + bottom: 0; + margin-bottom: 0; + border-width: 1px 0 0; +} +.navbar-brand { + float: left; + padding: 6px 15px; + font-size: 18px; + line-height: 20px; + height: 32px; +} +.navbar-brand:hover, +.navbar-brand:focus { + text-decoration: none; +} +.navbar-brand > img { + display: block; +} +@media (min-width: 768px) { + .navbar > .container .navbar-brand, + .navbar > .container-fluid .navbar-brand { + margin-left: -15px; + } +} +.navbar-toggle { + position: relative; + float: right; + margin-right: 15px; + padding: 9px 10px; + margin-top: -1px; + margin-bottom: -1px; + background-color: transparent; + background-image: none; + border: 1px solid transparent; + border-radius: 4px; +} +.navbar-toggle:focus { + outline: 0; +} +.navbar-toggle .icon-bar { + display: block; + width: 22px; + height: 2px; + border-radius: 1px; +} +.navbar-toggle .icon-bar + .icon-bar { + margin-top: 4px; +} +@media (min-width: 768px) { + .navbar-toggle { + display: none; + } +} +.navbar-nav { + margin: 3px -15px; +} +.navbar-nav > li > a { + padding-top: 10px; + padding-bottom: 10px; + line-height: 20px; +} +@media (max-width: 767px) { + .navbar-nav .open .dropdown-menu { + position: static; + float: none; + width: auto; + margin-top: 0; + background-color: transparent; + border: 0; + box-shadow: none; + } + .navbar-nav .open .dropdown-menu > li > a, + .navbar-nav .open .dropdown-menu .dropdown-header { + padding: 5px 15px 5px 25px; + } + .navbar-nav .open .dropdown-menu > li > a { + line-height: 20px; + } + .navbar-nav .open .dropdown-menu > li > a:hover, + .navbar-nav .open .dropdown-menu > li > a:focus { + background-image: none; + } +} +@media (min-width: 768px) { + .navbar-nav { + float: left; + margin: 0; + } + .navbar-nav > li { + float: left; + } + .navbar-nav > li > a { + padding-top: 6px; + padding-bottom: 6px; + } +} +.navbar-form { + margin-left: -15px; + margin-right: -15px; + padding: 10px 15px; + border-top: 1px solid transparent; + border-bottom: 1px solid transparent; + -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1), 0 1px 0 rgba(255, 255, 255, 0.1); + box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1), 0 1px 0 rgba(255, 255, 255, 0.1); + margin-top: -1px; + margin-bottom: -1px; +} +@media (min-width: 768px) { + .navbar-form .form-group { + display: inline-block; + margin-bottom: 0; + vertical-align: middle; + } + .navbar-form .form-control { + display: inline-block; + width: auto; + vertical-align: middle; + } + .navbar-form .form-control-static { + display: inline-block; + } + .navbar-form .input-group { + display: inline-table; + vertical-align: middle; + } + .navbar-form .input-group .input-group-addon, + .navbar-form .input-group .input-group-btn, + .navbar-form .input-group .form-control { + width: auto; + } + .navbar-form .input-group > .form-control { + width: 100%; + } + .navbar-form .control-label { + margin-bottom: 0; + vertical-align: middle; + } + .navbar-form .radio, + .navbar-form .checkbox { + display: inline-block; + margin-top: 0; + margin-bottom: 0; + vertical-align: middle; + } + .navbar-form .radio label, + .navbar-form .checkbox label { + padding-left: 0; + } + .navbar-form .radio input[type="radio"], + .navbar-form .checkbox input[type="checkbox"] { + position: relative; + margin-left: 0; + } + .navbar-form .has-feedback .form-control-feedback { + top: 0; + } +} +@media (max-width: 767px) { + .navbar-form .form-group { + margin-bottom: 5px; + } + .navbar-form .form-group:last-child { + margin-bottom: 0; + } +} +@media (min-width: 768px) { + .navbar-form { + width: auto; + border: 0; + margin-left: 0; + margin-right: 0; + padding-top: 0; + padding-bottom: 0; + -webkit-box-shadow: none; + box-shadow: none; + } +} +.navbar-nav > li > .dropdown-menu { + margin-top: 0; + border-top-right-radius: 0; + border-top-left-radius: 0; +} +.navbar-fixed-bottom .navbar-nav > li > .dropdown-menu { + margin-bottom: 0; + border-top-right-radius: 4px; + border-top-left-radius: 4px; + border-bottom-right-radius: 0; + border-bottom-left-radius: 0; +} +.navbar-btn { + margin-top: -1px; + margin-bottom: -1px; +} +.navbar-btn.btn-sm { + margin-top: 1px; + margin-bottom: 1px; +} +.navbar-btn.btn-xs { + margin-top: 5px; + margin-bottom: 5px; +} +.navbar-text { + margin-top: 6px; + margin-bottom: 6px; +} +@media (min-width: 768px) { + .navbar-text { + float: left; + margin-left: 15px; + margin-right: 15px; + } +} +@media (min-width: 768px) { + .navbar-left { + float: left !important; + float: left; + } + .navbar-right { + float: right !important; + float: right; + margin-right: -15px; + } + .navbar-right ~ .navbar-right { + margin-right: 0; + } +} +.navbar-default { + background-color: #ffffff; + border-color: #e0e0e0; +} +.navbar-default .navbar-brand { + color: #303030; +} +.navbar-default .navbar-brand:hover, +.navbar-default .navbar-brand:focus { + color: #161616; + background-color: transparent; +} +.navbar-default .navbar-text { + color: #303030; +} +.navbar-default .navbar-nav > li > a { + color: #303030; +} +.navbar-default .navbar-nav > li > a:hover, +.navbar-default .navbar-nav > li > a:focus { + color: #333; + background-color: transparent; +} +.navbar-default .navbar-nav > .active > a, +.navbar-default .navbar-nav > .active > a:hover, +.navbar-default .navbar-nav > .active > a:focus { + color: #555; + background-color: #eeeeee; +} +.navbar-default .navbar-nav > .disabled > a, +.navbar-default .navbar-nav > .disabled > a:hover, +.navbar-default .navbar-nav > .disabled > a:focus { + color: #ccc; + background-color: transparent; +} +.navbar-default .navbar-toggle { + border-color: #ddd; +} +.navbar-default .navbar-toggle:hover, +.navbar-default .navbar-toggle:focus { + background-color: #ddd; +} +.navbar-default .navbar-toggle .icon-bar { + background-color: #888; +} +.navbar-default .navbar-collapse, +.navbar-default .navbar-form { + border-color: #e0e0e0; +} +.navbar-default .navbar-nav > .open > a, +.navbar-default .navbar-nav > .open > a:hover, +.navbar-default .navbar-nav > .open > a:focus { + background-color: #eeeeee; + color: #555; +} +@media (max-width: 767px) { + .navbar-default .navbar-nav .open .dropdown-menu > li > a { + color: #303030; + } + .navbar-default .navbar-nav .open .dropdown-menu > li > a:hover, + .navbar-default .navbar-nav .open .dropdown-menu > li > a:focus { + color: #333; + background-color: transparent; + } + .navbar-default .navbar-nav .open .dropdown-menu > .active > a, + .navbar-default .navbar-nav .open .dropdown-menu > .active > a:hover, + .navbar-default .navbar-nav .open .dropdown-menu > .active > a:focus { + color: #555; + background-color: #eeeeee; + } + .navbar-default .navbar-nav .open .dropdown-menu > .disabled > a, + .navbar-default .navbar-nav .open .dropdown-menu > .disabled > a:hover, + .navbar-default .navbar-nav .open .dropdown-menu > .disabled > a:focus { + color: #ccc; + background-color: transparent; + } +} +.navbar-default .navbar-link { + color: #303030; +} +.navbar-default .navbar-link:hover { + color: #333; +} +.navbar-default .btn-link { + color: #303030; +} +.navbar-default .btn-link:hover, +.navbar-default .btn-link:focus { + color: #333; +} +.navbar-default .btn-link[disabled]:hover, +fieldset[disabled] .navbar-default .btn-link:hover, +.navbar-default .btn-link[disabled]:focus, +fieldset[disabled] .navbar-default .btn-link:focus { + color: #ccc; +} +.navbar-inverse { + background-color: #222; + border-color: #080808; +} +.navbar-inverse .navbar-brand { + color: #9d9d9d; +} +.navbar-inverse .navbar-brand:hover, +.navbar-inverse .navbar-brand:focus { + color: #fff; + background-color: transparent; +} +.navbar-inverse .navbar-text { + color: #9d9d9d; +} +.navbar-inverse .navbar-nav > li > a { + color: #9d9d9d; +} +.navbar-inverse .navbar-nav > li > a:hover, +.navbar-inverse .navbar-nav > li > a:focus { + color: #fff; + background-color: transparent; +} +.navbar-inverse .navbar-nav > .active > a, +.navbar-inverse .navbar-nav > .active > a:hover, +.navbar-inverse .navbar-nav > .active > a:focus { + color: #fff; + background-color: #080808; +} +.navbar-inverse .navbar-nav > .disabled > a, +.navbar-inverse .navbar-nav > .disabled > a:hover, +.navbar-inverse .navbar-nav > .disabled > a:focus { + color: #444; + background-color: transparent; +} +.navbar-inverse .navbar-toggle { + border-color: #333; +} +.navbar-inverse .navbar-toggle:hover, +.navbar-inverse .navbar-toggle:focus { + background-color: #333; +} +.navbar-inverse .navbar-toggle .icon-bar { + background-color: #fff; +} +.navbar-inverse .navbar-collapse, +.navbar-inverse .navbar-form { + border-color: #101010; +} +.navbar-inverse .navbar-nav > .open > a, +.navbar-inverse .navbar-nav > .open > a:hover, +.navbar-inverse .navbar-nav > .open > a:focus { + background-color: #080808; + color: #fff; +} +@media (max-width: 767px) { + .navbar-inverse .navbar-nav .open .dropdown-menu > .dropdown-header { + border-color: #080808; + } + .navbar-inverse .navbar-nav .open .dropdown-menu .divider { + background-color: #080808; + } + .navbar-inverse .navbar-nav .open .dropdown-menu > li > a { + color: #9d9d9d; + } + .navbar-inverse .navbar-nav .open .dropdown-menu > li > a:hover, + .navbar-inverse .navbar-nav .open .dropdown-menu > li > a:focus { + color: #fff; + background-color: transparent; + } + .navbar-inverse .navbar-nav .open .dropdown-menu > .active > a, + .navbar-inverse .navbar-nav .open .dropdown-menu > .active > a:hover, + .navbar-inverse .navbar-nav .open .dropdown-menu > .active > a:focus { + color: #fff; + background-color: #080808; + } + .navbar-inverse .navbar-nav .open .dropdown-menu > .disabled > a, + .navbar-inverse .navbar-nav .open .dropdown-menu > .disabled > a:hover, + .navbar-inverse .navbar-nav .open .dropdown-menu > .disabled > a:focus { + color: #444; + background-color: transparent; + } +} +.navbar-inverse .navbar-link { + color: #9d9d9d; +} +.navbar-inverse .navbar-link:hover { + color: #fff; +} +.navbar-inverse .btn-link { + color: #9d9d9d; +} +.navbar-inverse .btn-link:hover, +.navbar-inverse .btn-link:focus { + color: #fff; +} +.navbar-inverse .btn-link[disabled]:hover, +fieldset[disabled] .navbar-inverse .btn-link:hover, +.navbar-inverse .btn-link[disabled]:focus, +fieldset[disabled] .navbar-inverse .btn-link:focus { + color: #444; +} +.breadcrumb { + padding: 8px 15px; + margin-bottom: 20px; + list-style: none; + background-color: #f5f5f5; + border-radius: 4px; +} +.breadcrumb > li { + display: inline-block; +} +.breadcrumb > li + li:before { + content: "/\00a0"; + padding: 0 5px; + color: #ccc; +} +.breadcrumb > .active { + color: #777777; +} +.pagination { + display: inline-block; + padding-left: 0; + margin: 20px 0; + border-radius: 4px; +} +.pagination > li { + display: inline; +} +.pagination > li > a, +.pagination > li > span { + position: relative; + float: left; + padding: 6px 12px; + line-height: 1.42857143; + text-decoration: none; + color: #337ab7; + background-color: #fff; + border: 1px solid #ddd; + margin-left: -1px; +} +.pagination > li:first-child > a, +.pagination > li:first-child > span { + margin-left: 0; + border-bottom-left-radius: 4px; + border-top-left-radius: 4px; +} +.pagination > li:last-child > a, +.pagination > li:last-child > span { + border-bottom-right-radius: 4px; + border-top-right-radius: 4px; +} +.pagination > li > a:hover, +.pagination > li > span:hover, +.pagination > li > a:focus, +.pagination > li > span:focus { + z-index: 2; + color: #23527c; + background-color: #eeeeee; + border-color: #ddd; +} +.pagination > .active > a, +.pagination > .active > span, +.pagination > .active > a:hover, +.pagination > .active > span:hover, +.pagination > .active > a:focus, +.pagination > .active > span:focus { + z-index: 3; + color: #fff; + background-color: #337ab7; + border-color: #337ab7; + cursor: default; +} +.pagination > .disabled > span, +.pagination > .disabled > span:hover, +.pagination > .disabled > span:focus, +.pagination > .disabled > a, +.pagination > .disabled > a:hover, +.pagination > .disabled > a:focus { + color: #777777; + background-color: #fff; + border-color: #ddd; + cursor: not-allowed; +} +.pagination-lg > li > a, +.pagination-lg > li > span { + padding: 10px 16px; + font-size: 18px; + line-height: 1.3333333; +} +.pagination-lg > li:first-child > a, +.pagination-lg > li:first-child > span { + border-bottom-left-radius: 6px; + border-top-left-radius: 6px; +} +.pagination-lg > li:last-child > a, +.pagination-lg > li:last-child > span { + border-bottom-right-radius: 6px; + border-top-right-radius: 6px; +} +.pagination-sm > li > a, +.pagination-sm > li > span { + padding: 5px 10px; + font-size: 12px; + line-height: 1.5; +} +.pagination-sm > li:first-child > a, +.pagination-sm > li:first-child > span { + border-bottom-left-radius: 3px; + border-top-left-radius: 3px; +} +.pagination-sm > li:last-child > a, +.pagination-sm > li:last-child > span { + border-bottom-right-radius: 3px; + border-top-right-radius: 3px; +} +.pager { + padding-left: 0; + margin: 20px 0; + list-style: none; + text-align: center; +} +.pager li { + display: inline; +} +.pager li > a, +.pager li > span { + display: inline-block; + padding: 5px 14px; + background-color: #fff; + border: 1px solid #ddd; + border-radius: 15px; +} +.pager li > a:hover, +.pager li > a:focus { + text-decoration: none; + background-color: #eeeeee; +} +.pager .next > a, +.pager .next > span { + float: right; +} +.pager .previous > a, +.pager .previous > span { + float: left; +} +.pager .disabled > a, +.pager .disabled > a:hover, +.pager .disabled > a:focus, +.pager .disabled > span { + color: #777777; + background-color: #fff; + cursor: not-allowed; +} +.label { + display: inline; + padding: .2em .6em .3em; + font-size: 75%; + font-weight: bold; + line-height: 1; + color: #fff; + text-align: center; + white-space: nowrap; + vertical-align: baseline; + border-radius: .25em; +} +a.label:hover, +a.label:focus { + color: #fff; + text-decoration: none; + cursor: pointer; +} +.label:empty { + display: none; +} +.btn .label { + position: relative; + top: -1px; +} +.label-default { + background-color: #777777; +} +.label-default[href]:hover, +.label-default[href]:focus { + background-color: #5e5e5e; +} +.label-primary { + background-color: #337ab7; +} +.label-primary[href]:hover, +.label-primary[href]:focus { + background-color: #286090; +} +.label-success { + background-color: #5cb85c; +} +.label-success[href]:hover, +.label-success[href]:focus { + background-color: #449d44; +} +.label-info { + background-color: #5bc0de; +} +.label-info[href]:hover, +.label-info[href]:focus { + background-color: #31b0d5; +} +.label-warning { + background-color: #f0ad4e; +} +.label-warning[href]:hover, +.label-warning[href]:focus { + background-color: #ec971f; +} +.label-danger { + background-color: #d9534f; +} +.label-danger[href]:hover, +.label-danger[href]:focus { + background-color: #c9302c; +} +.badge { + display: inline-block; + min-width: 10px; + padding: 3px 7px; + font-size: 12px; + font-weight: bold; + color: #fff; + line-height: 1; + vertical-align: middle; + white-space: nowrap; + text-align: center; + background-color: #777777; + border-radius: 10px; +} +.badge:empty { + display: none; +} +.btn .badge { + position: relative; + top: -1px; +} +.btn-xs .badge, +.btn-group-xs > .btn .badge { + top: 0; + padding: 1px 5px; +} +a.badge:hover, +a.badge:focus { + color: #fff; + text-decoration: none; + cursor: pointer; +} +.list-group-item.active > .badge, +.nav-pills > .active > a > .badge { + color: #337ab7; + background-color: #fff; +} +.list-group-item > .badge { + float: right; +} +.list-group-item > .badge + .badge { + margin-right: 5px; +} +.nav-pills > li > a > .badge { + margin-left: 3px; +} +.jumbotron { + padding-top: 30px; + padding-bottom: 30px; + margin-bottom: 30px; + color: inherit; + background-color: #eeeeee; +} +.jumbotron h1, +.jumbotron .h1 { + color: inherit; +} +.jumbotron p { + margin-bottom: 15px; + font-size: 21px; + font-weight: 200; +} +.jumbotron > hr { + border-top-color: #d5d5d5; +} +.container .jumbotron, +.container-fluid .jumbotron { + border-radius: 6px; + padding-left: 15px; + padding-right: 15px; +} +.jumbotron .container { + max-width: 100%; +} +@media screen and (min-width: 768px) { + .jumbotron { + padding-top: 48px; + padding-bottom: 48px; + } + .container .jumbotron, + .container-fluid .jumbotron { + padding-left: 60px; + padding-right: 60px; + } + .jumbotron h1, + .jumbotron .h1 { + font-size: 63px; + } +} +.thumbnail { + display: block; + padding: 4px; + margin-bottom: 20px; + line-height: 1.42857143; + background-color: #fff; + border: 1px solid #ddd; + border-radius: 4px; + -webkit-transition: border 0.2s ease-in-out; + -o-transition: border 0.2s ease-in-out; + transition: border 0.2s ease-in-out; +} +.thumbnail > img, +.thumbnail a > img { + margin-left: auto; + margin-right: auto; +} +a.thumbnail:hover, +a.thumbnail:focus, +a.thumbnail.active { + border-color: #337ab7; +} +.thumbnail .caption { + padding: 9px; + color: #333333; +} +.alert { + padding: 15px; + margin-bottom: 20px; + border: 1px solid transparent; + border-radius: 4px; +} +.alert h4 { + margin-top: 0; + color: inherit; +} +.alert .alert-link { + font-weight: bold; +} +.alert > p, +.alert > ul { + margin-bottom: 0; +} +.alert > p + p { + margin-top: 5px; +} +.alert-dismissable, +.alert-dismissible { + padding-right: 35px; +} +.alert-dismissable .close, +.alert-dismissible .close { + position: relative; + top: -2px; + right: -21px; + color: inherit; +} +.alert-success { + background-color: #dff0d8; + border-color: #d6e9c6; + color: #3c763d; +} +.alert-success hr { + border-top-color: #c9e2b3; +} +.alert-success .alert-link { + color: #2b542c; +} +.alert-info { + background-color: #d9edf7; + border-color: #bce8f1; + color: #31708f; +} +.alert-info hr { + border-top-color: #a6e1ec; +} +.alert-info .alert-link { + color: #245269; +} +.alert-warning { + background-color: #fcf8e3; + border-color: #faebcc; + color: #8a6d3b; +} +.alert-warning hr { + border-top-color: #f7e1b5; +} +.alert-warning .alert-link { + color: #66512c; +} +.alert-danger { + background-color: #f2dede; + border-color: #ebccd1; + color: #a94442; +} +.alert-danger hr { + border-top-color: #e4b9c0; +} +.alert-danger .alert-link { + color: #843534; +} +@-webkit-keyframes progress-bar-stripes { + from { + background-position: 40px 0; + } + to { + background-position: 0 0; + } +} +@keyframes progress-bar-stripes { + from { + background-position: 40px 0; + } + to { + background-position: 0 0; + } +} +.progress { + overflow: hidden; + height: 20px; + margin-bottom: 20px; + background-color: #f5f5f5; + border-radius: 4px; + -webkit-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1); + box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1); +} +.progress-bar { + float: left; + width: 0%; + height: 100%; + font-size: 12px; + line-height: 20px; + color: #fff; + text-align: center; + background-color: #337ab7; + -webkit-box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.15); + box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.15); + -webkit-transition: width 0.6s ease; + -o-transition: width 0.6s ease; + transition: width 0.6s ease; +} +.progress-striped .progress-bar, +.progress-bar-striped { + background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-size: 40px 40px; +} +.progress.active .progress-bar, +.progress-bar.active { + -webkit-animation: progress-bar-stripes 2s linear infinite; + -o-animation: progress-bar-stripes 2s linear infinite; + animation: progress-bar-stripes 2s linear infinite; +} +.progress-bar-success { + background-color: #5cb85c; +} +.progress-striped .progress-bar-success { + background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); +} +.progress-bar-info { + background-color: #5bc0de; +} +.progress-striped .progress-bar-info { + background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); +} +.progress-bar-warning { + background-color: #f0ad4e; +} +.progress-striped .progress-bar-warning { + background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); +} +.progress-bar-danger { + background-color: #d9534f; +} +.progress-striped .progress-bar-danger { + background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); +} +.media { + margin-top: 15px; +} +.media:first-child { + margin-top: 0; +} +.media, +.media-body { + zoom: 1; + overflow: hidden; +} +.media-body { + width: 10000px; +} +.media-object { + display: block; +} +.media-object.img-thumbnail { + max-width: none; +} +.media-right, +.media > .pull-right { + padding-left: 10px; +} +.media-left, +.media > .pull-left { + padding-right: 10px; +} +.media-left, +.media-right, +.media-body { + display: table-cell; + vertical-align: top; +} +.media-middle { + vertical-align: middle; +} +.media-bottom { + vertical-align: bottom; +} +.media-heading { + margin-top: 0; + margin-bottom: 5px; +} +.media-list { + padding-left: 0; + list-style: none; +} +.list-group { + margin-bottom: 20px; + padding-left: 0; +} +.list-group-item { + position: relative; + display: block; + padding: 10px 15px; + margin-bottom: -1px; + background-color: #fff; + border: 1px solid #ddd; +} +.list-group-item:first-child { + border-top-right-radius: 4px; + border-top-left-radius: 4px; +} +.list-group-item:last-child { + margin-bottom: 0; + border-bottom-right-radius: 4px; + border-bottom-left-radius: 4px; +} +a.list-group-item, +button.list-group-item { + color: #555; +} +a.list-group-item .list-group-item-heading, +button.list-group-item .list-group-item-heading { + color: #333; +} +a.list-group-item:hover, +button.list-group-item:hover, +a.list-group-item:focus, +button.list-group-item:focus { + text-decoration: none; + color: #555; + background-color: #f5f5f5; +} +button.list-group-item { + width: 100%; + text-align: left; +} +.list-group-item.disabled, +.list-group-item.disabled:hover, +.list-group-item.disabled:focus { + background-color: #eeeeee; + color: #777777; + cursor: not-allowed; +} +.list-group-item.disabled .list-group-item-heading, +.list-group-item.disabled:hover .list-group-item-heading, +.list-group-item.disabled:focus .list-group-item-heading { + color: inherit; +} +.list-group-item.disabled .list-group-item-text, +.list-group-item.disabled:hover .list-group-item-text, +.list-group-item.disabled:focus .list-group-item-text { + color: #777777; +} +.list-group-item.active, +.list-group-item.active:hover, +.list-group-item.active:focus { + z-index: 2; + color: #fff; + background-color: #337ab7; + border-color: #337ab7; +} +.list-group-item.active .list-group-item-heading, +.list-group-item.active:hover .list-group-item-heading, +.list-group-item.active:focus .list-group-item-heading, +.list-group-item.active .list-group-item-heading > small, +.list-group-item.active:hover .list-group-item-heading > small, +.list-group-item.active:focus .list-group-item-heading > small, +.list-group-item.active .list-group-item-heading > .small, +.list-group-item.active:hover .list-group-item-heading > .small, +.list-group-item.active:focus .list-group-item-heading > .small { + color: inherit; +} +.list-group-item.active .list-group-item-text, +.list-group-item.active:hover .list-group-item-text, +.list-group-item.active:focus .list-group-item-text { + color: #c7ddef; +} +.list-group-item-success { + color: #3c763d; + background-color: #dff0d8; +} +a.list-group-item-success, +button.list-group-item-success { + color: #3c763d; +} +a.list-group-item-success .list-group-item-heading, +button.list-group-item-success .list-group-item-heading { + color: inherit; +} +a.list-group-item-success:hover, +button.list-group-item-success:hover, +a.list-group-item-success:focus, +button.list-group-item-success:focus { + color: #3c763d; + background-color: #d0e9c6; +} +a.list-group-item-success.active, +button.list-group-item-success.active, +a.list-group-item-success.active:hover, +button.list-group-item-success.active:hover, +a.list-group-item-success.active:focus, +button.list-group-item-success.active:focus { + color: #fff; + background-color: #3c763d; + border-color: #3c763d; +} +.list-group-item-info { + color: #31708f; + background-color: #d9edf7; +} +a.list-group-item-info, +button.list-group-item-info { + color: #31708f; +} +a.list-group-item-info .list-group-item-heading, +button.list-group-item-info .list-group-item-heading { + color: inherit; +} +a.list-group-item-info:hover, +button.list-group-item-info:hover, +a.list-group-item-info:focus, +button.list-group-item-info:focus { + color: #31708f; + background-color: #c4e3f3; +} +a.list-group-item-info.active, +button.list-group-item-info.active, +a.list-group-item-info.active:hover, +button.list-group-item-info.active:hover, +a.list-group-item-info.active:focus, +button.list-group-item-info.active:focus { + color: #fff; + background-color: #31708f; + border-color: #31708f; +} +.list-group-item-warning { + color: #8a6d3b; + background-color: #fcf8e3; +} +a.list-group-item-warning, +button.list-group-item-warning { + color: #8a6d3b; +} +a.list-group-item-warning .list-group-item-heading, +button.list-group-item-warning .list-group-item-heading { + color: inherit; +} +a.list-group-item-warning:hover, +button.list-group-item-warning:hover, +a.list-group-item-warning:focus, +button.list-group-item-warning:focus { + color: #8a6d3b; + background-color: #faf2cc; +} +a.list-group-item-warning.active, +button.list-group-item-warning.active, +a.list-group-item-warning.active:hover, +button.list-group-item-warning.active:hover, +a.list-group-item-warning.active:focus, +button.list-group-item-warning.active:focus { + color: #fff; + background-color: #8a6d3b; + border-color: #8a6d3b; +} +.list-group-item-danger { + color: #a94442; + background-color: #f2dede; +} +a.list-group-item-danger, +button.list-group-item-danger { + color: #a94442; +} +a.list-group-item-danger .list-group-item-heading, +button.list-group-item-danger .list-group-item-heading { + color: inherit; +} +a.list-group-item-danger:hover, +button.list-group-item-danger:hover, +a.list-group-item-danger:focus, +button.list-group-item-danger:focus { + color: #a94442; + background-color: #ebcccc; +} +a.list-group-item-danger.active, +button.list-group-item-danger.active, +a.list-group-item-danger.active:hover, +button.list-group-item-danger.active:hover, +a.list-group-item-danger.active:focus, +button.list-group-item-danger.active:focus { + color: #fff; + background-color: #a94442; + border-color: #a94442; +} +.list-group-item-heading { + margin-top: 0; + margin-bottom: 5px; +} +.list-group-item-text { + margin-bottom: 0; + line-height: 1.3; +} +.panel { + margin-bottom: 20px; + background-color: #fff; + border: 1px solid transparent; + border-radius: 4px; + -webkit-box-shadow: 0 1px 1px rgba(0, 0, 0, 0.05); + box-shadow: 0 1px 1px rgba(0, 0, 0, 0.05); +} +.panel-body { + padding: 15px; +} +.panel-heading { + padding: 10px 15px; + border-bottom: 1px solid transparent; + border-top-right-radius: 3px; + border-top-left-radius: 3px; +} +.panel-heading > .dropdown .dropdown-toggle { + color: inherit; +} +.panel-title { + margin-top: 0; + margin-bottom: 0; + font-size: 16px; + color: inherit; +} +.panel-title > a, +.panel-title > small, +.panel-title > .small, +.panel-title > small > a, +.panel-title > .small > a { + color: inherit; +} +.panel-footer { + padding: 10px 15px; + background-color: #f5f5f5; + border-top: 1px solid #ddd; + border-bottom-right-radius: 3px; + border-bottom-left-radius: 3px; +} +.panel > .list-group, +.panel > .panel-collapse > .list-group { + margin-bottom: 0; +} +.panel > .list-group .list-group-item, +.panel > .panel-collapse > .list-group .list-group-item { + border-width: 1px 0; + border-radius: 0; +} +.panel > .list-group:first-child .list-group-item:first-child, +.panel > .panel-collapse > .list-group:first-child .list-group-item:first-child { + border-top: 0; + border-top-right-radius: 3px; + border-top-left-radius: 3px; +} +.panel > .list-group:last-child .list-group-item:last-child, +.panel > .panel-collapse > .list-group:last-child .list-group-item:last-child { + border-bottom: 0; + border-bottom-right-radius: 3px; + border-bottom-left-radius: 3px; +} +.panel > .panel-heading + .panel-collapse > .list-group .list-group-item:first-child { + border-top-right-radius: 0; + border-top-left-radius: 0; +} +.panel-heading + .list-group .list-group-item:first-child { + border-top-width: 0; +} +.list-group + .panel-footer { + border-top-width: 0; +} +.panel > .table, +.panel > .table-responsive > .table, +.panel > .panel-collapse > .table { + margin-bottom: 0; +} +.panel > .table caption, +.panel > .table-responsive > .table caption, +.panel > .panel-collapse > .table caption { + padding-left: 15px; + padding-right: 15px; +} +.panel > .table:first-child, +.panel > .table-responsive:first-child > .table:first-child { + border-top-right-radius: 3px; + border-top-left-radius: 3px; +} +.panel > .table:first-child > thead:first-child > tr:first-child, +.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child, +.panel > .table:first-child > tbody:first-child > tr:first-child, +.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child { + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} +.panel > .table:first-child > thead:first-child > tr:first-child td:first-child, +.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child td:first-child, +.panel > .table:first-child > tbody:first-child > tr:first-child td:first-child, +.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child td:first-child, +.panel > .table:first-child > thead:first-child > tr:first-child th:first-child, +.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child th:first-child, +.panel > .table:first-child > tbody:first-child > tr:first-child th:first-child, +.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child th:first-child { + border-top-left-radius: 3px; +} +.panel > .table:first-child > thead:first-child > tr:first-child td:last-child, +.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child td:last-child, +.panel > .table:first-child > tbody:first-child > tr:first-child td:last-child, +.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child td:last-child, +.panel > .table:first-child > thead:first-child > tr:first-child th:last-child, +.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child th:last-child, +.panel > .table:first-child > tbody:first-child > tr:first-child th:last-child, +.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child th:last-child { + border-top-right-radius: 3px; +} +.panel > .table:last-child, +.panel > .table-responsive:last-child > .table:last-child { + border-bottom-right-radius: 3px; + border-bottom-left-radius: 3px; +} +.panel > .table:last-child > tbody:last-child > tr:last-child, +.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child, +.panel > .table:last-child > tfoot:last-child > tr:last-child, +.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child { + border-bottom-left-radius: 3px; + border-bottom-right-radius: 3px; +} +.panel > .table:last-child > tbody:last-child > tr:last-child td:first-child, +.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child td:first-child, +.panel > .table:last-child > tfoot:last-child > tr:last-child td:first-child, +.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child td:first-child, +.panel > .table:last-child > tbody:last-child > tr:last-child th:first-child, +.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child th:first-child, +.panel > .table:last-child > tfoot:last-child > tr:last-child th:first-child, +.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child th:first-child { + border-bottom-left-radius: 3px; +} +.panel > .table:last-child > tbody:last-child > tr:last-child td:last-child, +.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child td:last-child, +.panel > .table:last-child > tfoot:last-child > tr:last-child td:last-child, +.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child td:last-child, +.panel > .table:last-child > tbody:last-child > tr:last-child th:last-child, +.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child th:last-child, +.panel > .table:last-child > tfoot:last-child > tr:last-child th:last-child, +.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child th:last-child { + border-bottom-right-radius: 3px; +} +.panel > .panel-body + .table, +.panel > .panel-body + .table-responsive, +.panel > .table + .panel-body, +.panel > .table-responsive + .panel-body { + border-top: 1px solid #ddd; +} +.panel > .table > tbody:first-child > tr:first-child th, +.panel > .table > tbody:first-child > tr:first-child td { + border-top: 0; +} +.panel > .table-bordered, +.panel > .table-responsive > .table-bordered { + border: 0; +} +.panel > .table-bordered > thead > tr > th:first-child, +.panel > .table-responsive > .table-bordered > thead > tr > th:first-child, +.panel > .table-bordered > tbody > tr > th:first-child, +.panel > .table-responsive > .table-bordered > tbody > tr > th:first-child, +.panel > .table-bordered > tfoot > tr > th:first-child, +.panel > .table-responsive > .table-bordered > tfoot > tr > th:first-child, +.panel > .table-bordered > thead > tr > td:first-child, +.panel > .table-responsive > .table-bordered > thead > tr > td:first-child, +.panel > .table-bordered > tbody > tr > td:first-child, +.panel > .table-responsive > .table-bordered > tbody > tr > td:first-child, +.panel > .table-bordered > tfoot > tr > td:first-child, +.panel > .table-responsive > .table-bordered > tfoot > tr > td:first-child { + border-left: 0; +} +.panel > .table-bordered > thead > tr > th:last-child, +.panel > .table-responsive > .table-bordered > thead > tr > th:last-child, +.panel > .table-bordered > tbody > tr > th:last-child, +.panel > .table-responsive > .table-bordered > tbody > tr > th:last-child, +.panel > .table-bordered > tfoot > tr > th:last-child, +.panel > .table-responsive > .table-bordered > tfoot > tr > th:last-child, +.panel > .table-bordered > thead > tr > td:last-child, +.panel > .table-responsive > .table-bordered > thead > tr > td:last-child, +.panel > .table-bordered > tbody > tr > td:last-child, +.panel > .table-responsive > .table-bordered > tbody > tr > td:last-child, +.panel > .table-bordered > tfoot > tr > td:last-child, +.panel > .table-responsive > .table-bordered > tfoot > tr > td:last-child { + border-right: 0; +} +.panel > .table-bordered > thead > tr:first-child > td, +.panel > .table-responsive > .table-bordered > thead > tr:first-child > td, +.panel > .table-bordered > tbody > tr:first-child > td, +.panel > .table-responsive > .table-bordered > tbody > tr:first-child > td, +.panel > .table-bordered > thead > tr:first-child > th, +.panel > .table-responsive > .table-bordered > thead > tr:first-child > th, +.panel > .table-bordered > tbody > tr:first-child > th, +.panel > .table-responsive > .table-bordered > tbody > tr:first-child > th { + border-bottom: 0; +} +.panel > .table-bordered > tbody > tr:last-child > td, +.panel > .table-responsive > .table-bordered > tbody > tr:last-child > td, +.panel > .table-bordered > tfoot > tr:last-child > td, +.panel > .table-responsive > .table-bordered > tfoot > tr:last-child > td, +.panel > .table-bordered > tbody > tr:last-child > th, +.panel > .table-responsive > .table-bordered > tbody > tr:last-child > th, +.panel > .table-bordered > tfoot > tr:last-child > th, +.panel > .table-responsive > .table-bordered > tfoot > tr:last-child > th { + border-bottom: 0; +} +.panel > .table-responsive { + border: 0; + margin-bottom: 0; +} +.panel-group { + margin-bottom: 20px; +} +.panel-group .panel { + margin-bottom: 0; + border-radius: 4px; +} +.panel-group .panel + .panel { + margin-top: 5px; +} +.panel-group .panel-heading { + border-bottom: 0; +} +.panel-group .panel-heading + .panel-collapse > .panel-body, +.panel-group .panel-heading + .panel-collapse > .list-group { + border-top: 1px solid #ddd; +} +.panel-group .panel-footer { + border-top: 0; +} +.panel-group .panel-footer + .panel-collapse .panel-body { + border-bottom: 1px solid #ddd; +} +.panel-default { + border-color: #ddd; +} +.panel-default > .panel-heading { + color: #333333; + background-color: #f5f5f5; + border-color: #ddd; +} +.panel-default > .panel-heading + .panel-collapse > .panel-body { + border-top-color: #ddd; +} +.panel-default > .panel-heading .badge { + color: #f5f5f5; + background-color: #333333; +} +.panel-default > .panel-footer + .panel-collapse > .panel-body { + border-bottom-color: #ddd; +} +.panel-primary { + border-color: #337ab7; +} +.panel-primary > .panel-heading { + color: #fff; + background-color: #337ab7; + border-color: #337ab7; +} +.panel-primary > .panel-heading + .panel-collapse > .panel-body { + border-top-color: #337ab7; +} +.panel-primary > .panel-heading .badge { + color: #337ab7; + background-color: #fff; +} +.panel-primary > .panel-footer + .panel-collapse > .panel-body { + border-bottom-color: #337ab7; +} +.panel-success { + border-color: #d6e9c6; +} +.panel-success > .panel-heading { + color: #3c763d; + background-color: #dff0d8; + border-color: #d6e9c6; +} +.panel-success > .panel-heading + .panel-collapse > .panel-body { + border-top-color: #d6e9c6; +} +.panel-success > .panel-heading .badge { + color: #dff0d8; + background-color: #3c763d; +} +.panel-success > .panel-footer + .panel-collapse > .panel-body { + border-bottom-color: #d6e9c6; +} +.panel-info { + border-color: #bce8f1; +} +.panel-info > .panel-heading { + color: #31708f; + background-color: #d9edf7; + border-color: #bce8f1; +} +.panel-info > .panel-heading + .panel-collapse > .panel-body { + border-top-color: #bce8f1; +} +.panel-info > .panel-heading .badge { + color: #d9edf7; + background-color: #31708f; +} +.panel-info > .panel-footer + .panel-collapse > .panel-body { + border-bottom-color: #bce8f1; +} +.panel-warning { + border-color: #faebcc; +} +.panel-warning > .panel-heading { + color: #8a6d3b; + background-color: #fcf8e3; + border-color: #faebcc; +} +.panel-warning > .panel-heading + .panel-collapse > .panel-body { + border-top-color: #faebcc; +} +.panel-warning > .panel-heading .badge { + color: #fcf8e3; + background-color: #8a6d3b; +} +.panel-warning > .panel-footer + .panel-collapse > .panel-body { + border-bottom-color: #faebcc; +} +.panel-danger { + border-color: #ebccd1; +} +.panel-danger > .panel-heading { + color: #a94442; + background-color: #f2dede; + border-color: #ebccd1; +} +.panel-danger > .panel-heading + .panel-collapse > .panel-body { + border-top-color: #ebccd1; +} +.panel-danger > .panel-heading .badge { + color: #f2dede; + background-color: #a94442; +} +.panel-danger > .panel-footer + .panel-collapse > .panel-body { + border-bottom-color: #ebccd1; +} +.embed-responsive { + position: relative; + display: block; + height: 0; + padding: 0; + overflow: hidden; +} +.embed-responsive .embed-responsive-item, +.embed-responsive iframe, +.embed-responsive embed, +.embed-responsive object, +.embed-responsive video { + position: absolute; + top: 0; + left: 0; + bottom: 0; + height: 100%; + width: 100%; + border: 0; +} +.embed-responsive-16by9 { + padding-bottom: 56.25%; +} +.embed-responsive-4by3 { + padding-bottom: 75%; +} +.well { + min-height: 20px; + padding: 19px; + margin-bottom: 20px; + background-color: #f5f5f5; + border: 1px solid #e3e3e3; + border-radius: 4px; + -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.05); + box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.05); +} +.well blockquote { + border-color: #ddd; + border-color: rgba(0, 0, 0, 0.15); +} +.well-lg { + padding: 24px; + border-radius: 6px; +} +.well-sm { + padding: 9px; + border-radius: 3px; +} +.close { + float: right; + font-size: 21px; + font-weight: bold; + line-height: 1; + color: #000; + text-shadow: 0 1px 0 #fff; + opacity: 0.2; + filter: alpha(opacity=20); +} +.close:hover, +.close:focus { + color: #000; + text-decoration: none; + cursor: pointer; + opacity: 0.5; + filter: alpha(opacity=50); +} +button.close { + padding: 0; + cursor: pointer; + background: transparent; + border: 0; + -webkit-appearance: none; +} +.modal-open { + overflow: hidden; +} +.modal { + display: none; + overflow: hidden; + position: fixed; + top: 0; + right: 0; + bottom: 0; + left: 0; + z-index: 1050; + -webkit-overflow-scrolling: touch; + outline: 0; +} +.modal.fade .modal-dialog { + -webkit-transform: translate(0, -25%); + -ms-transform: translate(0, -25%); + -o-transform: translate(0, -25%); + transform: translate(0, -25%); + -webkit-transition: -webkit-transform 0.3s ease-out; + -moz-transition: -moz-transform 0.3s ease-out; + -o-transition: -o-transform 0.3s ease-out; + transition: transform 0.3s ease-out; +} +.modal.in .modal-dialog { + -webkit-transform: translate(0, 0); + -ms-transform: translate(0, 0); + -o-transform: translate(0, 0); + transform: translate(0, 0); +} +.modal-open .modal { + overflow-x: hidden; + overflow-y: auto; +} +.modal-dialog { + position: relative; + width: auto; + margin: 10px; +} +.modal-content { + position: relative; + background-color: #fff; + border: 1px solid #999; + border: 1px solid rgba(0, 0, 0, 0.2); + border-radius: 6px; + -webkit-box-shadow: 0 3px 9px rgba(0, 0, 0, 0.5); + box-shadow: 0 3px 9px rgba(0, 0, 0, 0.5); + background-clip: padding-box; + outline: 0; +} +.modal-backdrop { + position: fixed; + top: 0; + right: 0; + bottom: 0; + left: 0; + z-index: 1040; + background-color: #000; +} +.modal-backdrop.fade { + opacity: 0; + filter: alpha(opacity=0); +} +.modal-backdrop.in { + opacity: 0.5; + filter: alpha(opacity=50); +} +.modal-header { + padding: 15px; + border-bottom: 1px solid #e5e5e5; +} +.modal-header .close { + margin-top: -2px; +} +.modal-title { + margin: 0; + line-height: 1.42857143; +} +.modal-body { + position: relative; + padding: 15px; +} +.modal-footer { + padding: 15px; + text-align: right; + border-top: 1px solid #e5e5e5; +} +.modal-footer .btn + .btn { + margin-left: 5px; + margin-bottom: 0; +} +.modal-footer .btn-group .btn + .btn { + margin-left: -1px; +} +.modal-footer .btn-block + .btn-block { + margin-left: 0; +} +.modal-scrollbar-measure { + position: absolute; + top: -9999px; + width: 50px; + height: 50px; + overflow: scroll; +} +@media (min-width: 768px) { + .modal-dialog { + width: 600px; + margin: 30px auto; + } + .modal-content { + -webkit-box-shadow: 0 5px 15px rgba(0, 0, 0, 0.5); + box-shadow: 0 5px 15px rgba(0, 0, 0, 0.5); + } + .modal-sm { + width: 300px; + } +} +@media (min-width: 992px) { + .modal-lg { + width: 900px; + } +} +.tooltip { + position: absolute; + z-index: 1070; + display: block; + font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; + font-style: normal; + font-weight: normal; + letter-spacing: normal; + line-break: auto; + line-height: 1.42857143; + text-align: left; + text-align: start; + text-decoration: none; + text-shadow: none; + text-transform: none; + white-space: normal; + word-break: normal; + word-spacing: normal; + word-wrap: normal; + font-size: 12px; + opacity: 0; + filter: alpha(opacity=0); +} +.tooltip.in { + opacity: 0.9; + filter: alpha(opacity=90); +} +.tooltip.top { + margin-top: -3px; + padding: 5px 0; +} +.tooltip.right { + margin-left: 3px; + padding: 0 5px; +} +.tooltip.bottom { + margin-top: 3px; + padding: 5px 0; +} +.tooltip.left { + margin-left: -3px; + padding: 0 5px; +} +.tooltip-inner { + max-width: 200px; + padding: 3px 8px; + color: #fff; + text-align: center; + background-color: #000; + border-radius: 4px; +} +.tooltip-arrow { + position: absolute; + width: 0; + height: 0; + border-color: transparent; + border-style: solid; +} +.tooltip.top .tooltip-arrow { + bottom: 0; + left: 50%; + margin-left: -5px; + border-width: 5px 5px 0; + border-top-color: #000; +} +.tooltip.top-left .tooltip-arrow { + bottom: 0; + right: 5px; + margin-bottom: -5px; + border-width: 5px 5px 0; + border-top-color: #000; +} +.tooltip.top-right .tooltip-arrow { + bottom: 0; + left: 5px; + margin-bottom: -5px; + border-width: 5px 5px 0; + border-top-color: #000; +} +.tooltip.right .tooltip-arrow { + top: 50%; + left: 0; + margin-top: -5px; + border-width: 5px 5px 5px 0; + border-right-color: #000; +} +.tooltip.left .tooltip-arrow { + top: 50%; + right: 0; + margin-top: -5px; + border-width: 5px 0 5px 5px; + border-left-color: #000; +} +.tooltip.bottom .tooltip-arrow { + top: 0; + left: 50%; + margin-left: -5px; + border-width: 0 5px 5px; + border-bottom-color: #000; +} +.tooltip.bottom-left .tooltip-arrow { + top: 0; + right: 5px; + margin-top: -5px; + border-width: 0 5px 5px; + border-bottom-color: #000; +} +.tooltip.bottom-right .tooltip-arrow { + top: 0; + left: 5px; + margin-top: -5px; + border-width: 0 5px 5px; + border-bottom-color: #000; +} +.popover { + position: absolute; + top: 0; + left: 0; + z-index: 1060; + display: none; + max-width: 276px; + padding: 1px; + font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; + font-style: normal; + font-weight: normal; + letter-spacing: normal; + line-break: auto; + line-height: 1.42857143; + text-align: left; + text-align: start; + text-decoration: none; + text-shadow: none; + text-transform: none; + white-space: normal; + word-break: normal; + word-spacing: normal; + word-wrap: normal; + font-size: 14px; + background-color: #fff; + background-clip: padding-box; + border: 1px solid #ccc; + border: 1px solid rgba(0, 0, 0, 0.2); + border-radius: 6px; + -webkit-box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2); + box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2); +} +.popover.top { + margin-top: -10px; +} +.popover.right { + margin-left: 10px; +} +.popover.bottom { + margin-top: 10px; +} +.popover.left { + margin-left: -10px; +} +.popover-title { + margin: 0; + padding: 8px 14px; + font-size: 14px; + background-color: #f7f7f7; + border-bottom: 1px solid #ebebeb; + border-radius: 5px 5px 0 0; +} +.popover-content { + padding: 9px 14px; +} +.popover > .arrow, +.popover > .arrow:after { + position: absolute; + display: block; + width: 0; + height: 0; + border-color: transparent; + border-style: solid; +} +.popover > .arrow { + border-width: 11px; +} +.popover > .arrow:after { + border-width: 10px; + content: ""; +} +.popover.top > .arrow { + left: 50%; + margin-left: -11px; + border-bottom-width: 0; + border-top-color: #999999; + border-top-color: rgba(0, 0, 0, 0.25); + bottom: -11px; +} +.popover.top > .arrow:after { + content: " "; + bottom: 1px; + margin-left: -10px; + border-bottom-width: 0; + border-top-color: #fff; +} +.popover.right > .arrow { + top: 50%; + left: -11px; + margin-top: -11px; + border-left-width: 0; + border-right-color: #999999; + border-right-color: rgba(0, 0, 0, 0.25); +} +.popover.right > .arrow:after { + content: " "; + left: 1px; + bottom: -10px; + border-left-width: 0; + border-right-color: #fff; +} +.popover.bottom > .arrow { + left: 50%; + margin-left: -11px; + border-top-width: 0; + border-bottom-color: #999999; + border-bottom-color: rgba(0, 0, 0, 0.25); + top: -11px; +} +.popover.bottom > .arrow:after { + content: " "; + top: 1px; + margin-left: -10px; + border-top-width: 0; + border-bottom-color: #fff; +} +.popover.left > .arrow { + top: 50%; + right: -11px; + margin-top: -11px; + border-right-width: 0; + border-left-color: #999999; + border-left-color: rgba(0, 0, 0, 0.25); +} +.popover.left > .arrow:after { + content: " "; + right: 1px; + border-right-width: 0; + border-left-color: #fff; + bottom: -10px; +} +.carousel { + position: relative; +} +.carousel-inner { + position: relative; + overflow: hidden; + width: 100%; +} +.carousel-inner > .item { + display: none; + position: relative; + -webkit-transition: 0.6s ease-in-out left; + -o-transition: 0.6s ease-in-out left; + transition: 0.6s ease-in-out left; +} +.carousel-inner > .item > img, +.carousel-inner > .item > a > img { + line-height: 1; +} +@media all and (transform-3d), (-webkit-transform-3d) { + .carousel-inner > .item { + -webkit-transition: -webkit-transform 0.6s ease-in-out; + -moz-transition: -moz-transform 0.6s ease-in-out; + -o-transition: -o-transform 0.6s ease-in-out; + transition: transform 0.6s ease-in-out; + -webkit-backface-visibility: hidden; + -moz-backface-visibility: hidden; + backface-visibility: hidden; + -webkit-perspective: 1000px; + -moz-perspective: 1000px; + perspective: 1000px; + } + .carousel-inner > .item.next, + .carousel-inner > .item.active.right { + -webkit-transform: translate3d(100%, 0, 0); + transform: translate3d(100%, 0, 0); + left: 0; + } + .carousel-inner > .item.prev, + .carousel-inner > .item.active.left { + -webkit-transform: translate3d(-100%, 0, 0); + transform: translate3d(-100%, 0, 0); + left: 0; + } + .carousel-inner > .item.next.left, + .carousel-inner > .item.prev.right, + .carousel-inner > .item.active { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + left: 0; + } +} +.carousel-inner > .active, +.carousel-inner > .next, +.carousel-inner > .prev { + display: block; +} +.carousel-inner > .active { + left: 0; +} +.carousel-inner > .next, +.carousel-inner > .prev { + position: absolute; + top: 0; + width: 100%; +} +.carousel-inner > .next { + left: 100%; +} +.carousel-inner > .prev { + left: -100%; +} +.carousel-inner > .next.left, +.carousel-inner > .prev.right { + left: 0; +} +.carousel-inner > .active.left { + left: -100%; +} +.carousel-inner > .active.right { + left: 100%; +} +.carousel-control { + position: absolute; + top: 0; + left: 0; + bottom: 0; + width: 15%; + opacity: 0.5; + filter: alpha(opacity=50); + font-size: 20px; + color: #fff; + text-align: center; + text-shadow: 0 1px 2px rgba(0, 0, 0, 0.6); + background-color: rgba(0, 0, 0, 0); +} +.carousel-control.left { + background-image: -webkit-linear-gradient(left, rgba(0, 0, 0, 0.5) 0%, rgba(0, 0, 0, 0.0001) 100%); + background-image: -o-linear-gradient(left, rgba(0, 0, 0, 0.5) 0%, rgba(0, 0, 0, 0.0001) 100%); + background-image: linear-gradient(to right, rgba(0, 0, 0, 0.5) 0%, rgba(0, 0, 0, 0.0001) 100%); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#80000000', endColorstr='#00000000', GradientType=1); +} +.carousel-control.right { + left: auto; + right: 0; + background-image: -webkit-linear-gradient(left, rgba(0, 0, 0, 0.0001) 0%, rgba(0, 0, 0, 0.5) 100%); + background-image: -o-linear-gradient(left, rgba(0, 0, 0, 0.0001) 0%, rgba(0, 0, 0, 0.5) 100%); + background-image: linear-gradient(to right, rgba(0, 0, 0, 0.0001) 0%, rgba(0, 0, 0, 0.5) 100%); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#00000000', endColorstr='#80000000', GradientType=1); +} +.carousel-control:hover, +.carousel-control:focus { + outline: 0; + color: #fff; + text-decoration: none; + opacity: 0.9; + filter: alpha(opacity=90); +} +.carousel-control .icon-prev, +.carousel-control .icon-next, +.carousel-control .glyphicon-chevron-left, +.carousel-control .glyphicon-chevron-right { + position: absolute; + top: 50%; + margin-top: -10px; + z-index: 5; + display: inline-block; +} +.carousel-control .icon-prev, +.carousel-control .glyphicon-chevron-left { + left: 50%; + margin-left: -10px; +} +.carousel-control .icon-next, +.carousel-control .glyphicon-chevron-right { + right: 50%; + margin-right: -10px; +} +.carousel-control .icon-prev, +.carousel-control .icon-next { + width: 20px; + height: 20px; + line-height: 1; + font-family: serif; +} +.carousel-control .icon-prev:before { + content: '\2039'; +} +.carousel-control .icon-next:before { + content: '\203a'; +} +.carousel-indicators { + position: absolute; + bottom: 10px; + left: 50%; + z-index: 15; + width: 60%; + margin-left: -30%; + padding-left: 0; + list-style: none; + text-align: center; +} +.carousel-indicators li { + display: inline-block; + width: 10px; + height: 10px; + margin: 1px; + text-indent: -999px; + border: 1px solid #fff; + border-radius: 10px; + cursor: pointer; + background-color: #000 \9; + background-color: rgba(0, 0, 0, 0); +} +.carousel-indicators .active { + margin: 0; + width: 12px; + height: 12px; + background-color: #fff; +} +.carousel-caption { + position: absolute; + left: 15%; + right: 15%; + bottom: 20px; + z-index: 10; + padding-top: 20px; + padding-bottom: 20px; + color: #fff; + text-align: center; + text-shadow: 0 1px 2px rgba(0, 0, 0, 0.6); +} +.carousel-caption .btn { + text-shadow: none; +} +@media screen and (min-width: 768px) { + .carousel-control .glyphicon-chevron-left, + .carousel-control .glyphicon-chevron-right, + .carousel-control .icon-prev, + .carousel-control .icon-next { + width: 30px; + height: 30px; + margin-top: -10px; + font-size: 30px; + } + .carousel-control .glyphicon-chevron-left, + .carousel-control .icon-prev { + margin-left: -10px; + } + .carousel-control .glyphicon-chevron-right, + .carousel-control .icon-next { + margin-right: -10px; + } + .carousel-caption { + left: 20%; + right: 20%; + padding-bottom: 30px; + } + .carousel-indicators { + bottom: 20px; + } +} +.clearfix:before, +.clearfix:after, +.dl-horizontal dd:before, +.dl-horizontal dd:after, +.container:before, +.container:after, +.container-fluid:before, +.container-fluid:after, +.row:before, +.row:after, +.form-horizontal .form-group:before, +.form-horizontal .form-group:after, +.btn-toolbar:before, +.btn-toolbar:after, +.btn-group-vertical > .btn-group:before, +.btn-group-vertical > .btn-group:after, +.nav:before, +.nav:after, +.navbar:before, +.navbar:after, +.navbar-header:before, +.navbar-header:after, +.navbar-collapse:before, +.navbar-collapse:after, +.pager:before, +.pager:after, +.panel-body:before, +.panel-body:after, +.modal-header:before, +.modal-header:after, +.modal-footer:before, +.modal-footer:after { + content: " "; + display: table; +} +.clearfix:after, +.dl-horizontal dd:after, +.container:after, +.container-fluid:after, +.row:after, +.form-horizontal .form-group:after, +.btn-toolbar:after, +.btn-group-vertical > .btn-group:after, +.nav:after, +.navbar:after, +.navbar-header:after, +.navbar-collapse:after, +.pager:after, +.panel-body:after, +.modal-header:after, +.modal-footer:after { + clear: both; +} +.center-block { + display: block; + margin-left: auto; + margin-right: auto; +} +.pull-right { + float: right !important; +} +.pull-left { + float: left !important; +} +.hide { + display: none !important; +} +.show { + display: block !important; +} +.invisible { + visibility: hidden; +} +.text-hide { + font: 0/0 a; + color: transparent; + text-shadow: none; + background-color: transparent; + border: 0; +} +.hidden { + display: none !important; +} +.affix { + position: fixed; +} +@-ms-viewport { + width: device-width; +} +.visible-xs, +.visible-sm, +.visible-md, +.visible-lg { + display: none !important; +} +.visible-xs-block, +.visible-xs-inline, +.visible-xs-inline-block, +.visible-sm-block, +.visible-sm-inline, +.visible-sm-inline-block, +.visible-md-block, +.visible-md-inline, +.visible-md-inline-block, +.visible-lg-block, +.visible-lg-inline, +.visible-lg-inline-block { + display: none !important; +} +@media (max-width: 767px) { + .visible-xs { + display: block !important; + } + table.visible-xs { + display: table !important; + } + tr.visible-xs { + display: table-row !important; + } + th.visible-xs, + td.visible-xs { + display: table-cell !important; + } +} +@media (max-width: 767px) { + .visible-xs-block { + display: block !important; + } +} +@media (max-width: 767px) { + .visible-xs-inline { + display: inline !important; + } +} +@media (max-width: 767px) { + .visible-xs-inline-block { + display: inline-block !important; + } +} +@media (min-width: 768px) and (max-width: 991px) { + .visible-sm { + display: block !important; + } + table.visible-sm { + display: table !important; + } + tr.visible-sm { + display: table-row !important; + } + th.visible-sm, + td.visible-sm { + display: table-cell !important; + } +} +@media (min-width: 768px) and (max-width: 991px) { + .visible-sm-block { + display: block !important; + } +} +@media (min-width: 768px) and (max-width: 991px) { + .visible-sm-inline { + display: inline !important; + } +} +@media (min-width: 768px) and (max-width: 991px) { + .visible-sm-inline-block { + display: inline-block !important; + } +} +@media (min-width: 992px) and (max-width: 1199px) { + .visible-md { + display: block !important; + } + table.visible-md { + display: table !important; + } + tr.visible-md { + display: table-row !important; + } + th.visible-md, + td.visible-md { + display: table-cell !important; + } +} +@media (min-width: 992px) and (max-width: 1199px) { + .visible-md-block { + display: block !important; + } +} +@media (min-width: 992px) and (max-width: 1199px) { + .visible-md-inline { + display: inline !important; + } +} +@media (min-width: 992px) and (max-width: 1199px) { + .visible-md-inline-block { + display: inline-block !important; + } +} +@media (min-width: 1200px) { + .visible-lg { + display: block !important; + } + table.visible-lg { + display: table !important; + } + tr.visible-lg { + display: table-row !important; + } + th.visible-lg, + td.visible-lg { + display: table-cell !important; + } +} +@media (min-width: 1200px) { + .visible-lg-block { + display: block !important; + } +} +@media (min-width: 1200px) { + .visible-lg-inline { + display: inline !important; + } +} +@media (min-width: 1200px) { + .visible-lg-inline-block { + display: inline-block !important; + } +} +@media (max-width: 767px) { + .hidden-xs { + display: none !important; + } +} +@media (min-width: 768px) and (max-width: 991px) { + .hidden-sm { + display: none !important; + } +} +@media (min-width: 992px) and (max-width: 1199px) { + .hidden-md { + display: none !important; + } +} +@media (min-width: 1200px) { + .hidden-lg { + display: none !important; + } +} +.visible-print { + display: none !important; +} +@media print { + .visible-print { + display: block !important; + } + table.visible-print { + display: table !important; + } + tr.visible-print { + display: table-row !important; + } + th.visible-print, + td.visible-print { + display: table-cell !important; + } +} +.visible-print-block { + display: none !important; +} +@media print { + .visible-print-block { + display: block !important; + } +} +.visible-print-inline { + display: none !important; +} +@media print { + .visible-print-inline { + display: inline !important; + } +} +.visible-print-inline-block { + display: none !important; +} +@media print { + .visible-print-inline-block { + display: inline-block !important; + } +} +@media print { + .hidden-print { + display: none !important; + } +} +/*! + * Font Awesome 4.2.0 by @davegandy - http://fontawesome.io - @fontawesome + * License - http://fontawesome.io/license (Font: SIL OFL 1.1, CSS: MIT License) + */ +/* FONT PATH + * -------------------------- */ +@font-face { + font-family: 'FontAwesome'; + src: url('fonts/fontawesome-webfont.eot?v=4.2.0'); + src: url('fonts/fontawesome-webfont.eot?#iefix&v=4.2.0') format('embedded-opentype'), url('fonts/fontawesome-webfont.woff?v=4.2.0') format('woff'), url('fonts/fontawesome-webfont.ttf?v=4.2.0') format('truetype'), url('fonts/fontawesome-webfont.svg?v=4.2.0#fontawesomeregular') format('svg'); + font-weight: normal; + font-style: normal; +} +.fa { + display: inline-block; + font: normal normal normal 14px/1 FontAwesome; + font-size: inherit; + text-rendering: auto; + -webkit-font-smoothing: antialiased; + -moz-osx-font-smoothing: grayscale; +} +/* makes the font 33% larger relative to the icon container */ +.fa-lg { + font-size: 1.3333333333333333em; + line-height: 0.75em; + vertical-align: -15%; +} +.fa-2x { + font-size: 2em; +} +.fa-3x { + font-size: 3em; +} +.fa-4x { + font-size: 4em; +} +.fa-5x { + font-size: 5em; +} +.fa-fw { + width: 1.2857142857142858em; + text-align: center; +} +.fa-ul { + padding-left: 0; + margin-left: 2.142857142857143em; + list-style-type: none; +} +.fa-ul > li { + position: relative; +} +.fa-li { + position: absolute; + left: -2.14285714em; + width: 2.142857142857143em; + top: 0.14285714285714285em; + text-align: center; +} +.fa-li.fa-lg { + left: -1.85714286em; +} +.fa-border { + padding: .2em .25em .15em; + border: solid 0.08em #eeeeee; + border-radius: .1em; +} +.pull-right { + float: right; +} +.pull-left { + float: left; +} +.fa.pull-left { + margin-right: .3em; +} +.fa.pull-right { + margin-left: .3em; +} +.fa-spin { + -webkit-animation: fa-spin 2s infinite linear; + animation: fa-spin 2s infinite linear; +} +@-webkit-keyframes fa-spin { + 0% { + -webkit-transform: rotate(0deg); + transform: rotate(0deg); + } + 100% { + -webkit-transform: rotate(359deg); + transform: rotate(359deg); + } +} +@keyframes fa-spin { + 0% { + -webkit-transform: rotate(0deg); + transform: rotate(0deg); + } + 100% { + -webkit-transform: rotate(359deg); + transform: rotate(359deg); + } +} +.fa-rotate-90 { + filter: progid:DXImageTransform.Microsoft.BasicImage(rotation=1); + -webkit-transform: rotate(90deg); + -ms-transform: rotate(90deg); + transform: rotate(90deg); +} +.fa-rotate-180 { + filter: progid:DXImageTransform.Microsoft.BasicImage(rotation=2); + -webkit-transform: rotate(180deg); + -ms-transform: rotate(180deg); + transform: rotate(180deg); +} +.fa-rotate-270 { + filter: progid:DXImageTransform.Microsoft.BasicImage(rotation=3); + -webkit-transform: rotate(270deg); + -ms-transform: rotate(270deg); + transform: rotate(270deg); +} +.fa-flip-horizontal { + filter: progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1); + -webkit-transform: scale(-1, 1); + -ms-transform: scale(-1, 1); + transform: scale(-1, 1); +} +.fa-flip-vertical { + filter: progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1); + -webkit-transform: scale(1, -1); + -ms-transform: scale(1, -1); + transform: scale(1, -1); +} +:root .fa-rotate-90, +:root .fa-rotate-180, +:root .fa-rotate-270, +:root .fa-flip-horizontal, +:root .fa-flip-vertical { + filter: none; +} +.fa-stack { + position: relative; + display: inline-block; + width: 2em; + height: 2em; + line-height: 2em; + vertical-align: middle; +} +.fa-stack-1x, +.fa-stack-2x { + position: absolute; + left: 0; + width: 100%; + text-align: center; +} +.fa-stack-1x { + line-height: inherit; +} +.fa-stack-2x { + font-size: 2em; +} +.fa-inverse { + color: #ffffff; +} +/* Font Awesome uses the Unicode Private Use Area (PUA) to ensure screen + readers do not read off random characters that represent icons */ +.fa-glass:before { + content: "\f000"; +} +.fa-music:before { + content: "\f001"; +} +.fa-search:before { + content: "\f002"; +} +.fa-envelope-o:before { + content: "\f003"; +} +.fa-heart:before { + content: "\f004"; +} +.fa-star:before { + content: "\f005"; +} +.fa-star-o:before { + content: "\f006"; +} +.fa-user:before { + content: "\f007"; +} +.fa-film:before { + content: "\f008"; +} +.fa-th-large:before { + content: "\f009"; +} +.fa-th:before { + content: "\f00a"; +} +.fa-th-list:before { + content: "\f00b"; +} +.fa-check:before { + content: "\f00c"; +} +.fa-remove:before, +.fa-close:before, +.fa-times:before { + content: "\f00d"; +} +.fa-search-plus:before { + content: "\f00e"; +} +.fa-search-minus:before { + content: "\f010"; +} +.fa-power-off:before { + content: "\f011"; +} +.fa-signal:before { + content: "\f012"; +} +.fa-gear:before, +.fa-cog:before { + content: "\f013"; +} +.fa-trash-o:before { + content: "\f014"; +} +.fa-home:before { + content: "\f015"; +} +.fa-file-o:before { + content: "\f016"; +} +.fa-clock-o:before { + content: "\f017"; +} +.fa-road:before { + content: "\f018"; +} +.fa-download:before { + content: "\f019"; +} +.fa-arrow-circle-o-down:before { + content: "\f01a"; +} +.fa-arrow-circle-o-up:before { + content: "\f01b"; +} +.fa-inbox:before { + content: "\f01c"; +} +.fa-play-circle-o:before { + content: "\f01d"; +} +.fa-rotate-right:before, +.fa-repeat:before { + content: "\f01e"; +} +.fa-refresh:before { + content: "\f021"; +} +.fa-list-alt:before { + content: "\f022"; +} +.fa-lock:before { + content: "\f023"; +} +.fa-flag:before { + content: "\f024"; +} +.fa-headphones:before { + content: "\f025"; +} +.fa-volume-off:before { + content: "\f026"; +} +.fa-volume-down:before { + content: "\f027"; +} +.fa-volume-up:before { + content: "\f028"; +} +.fa-qrcode:before { + content: "\f029"; +} +.fa-barcode:before { + content: "\f02a"; +} +.fa-tag:before { + content: "\f02b"; +} +.fa-tags:before { + content: "\f02c"; +} +.fa-book:before { + content: "\f02d"; +} +.fa-bookmark:before { + content: "\f02e"; +} +.fa-print:before { + content: "\f02f"; +} +.fa-camera:before { + content: "\f030"; +} +.fa-font:before { + content: "\f031"; +} +.fa-bold:before { + content: "\f032"; +} +.fa-italic:before { + content: "\f033"; +} +.fa-text-height:before { + content: "\f034"; +} +.fa-text-width:before { + content: "\f035"; +} +.fa-align-left:before { + content: "\f036"; +} +.fa-align-center:before { + content: "\f037"; +} +.fa-align-right:before { + content: "\f038"; +} +.fa-align-justify:before { + content: "\f039"; +} +.fa-list:before { + content: "\f03a"; +} +.fa-dedent:before, +.fa-outdent:before { + content: "\f03b"; +} +.fa-indent:before { + content: "\f03c"; +} +.fa-video-camera:before { + content: "\f03d"; +} +.fa-photo:before, +.fa-image:before, +.fa-picture-o:before { + content: "\f03e"; +} +.fa-pencil:before { + content: "\f040"; +} +.fa-map-marker:before { + content: "\f041"; +} +.fa-adjust:before { + content: "\f042"; +} +.fa-tint:before { + content: "\f043"; +} +.fa-edit:before, +.fa-pencil-square-o:before { + content: "\f044"; +} +.fa-share-square-o:before { + content: "\f045"; +} +.fa-check-square-o:before { + content: "\f046"; +} +.fa-arrows:before { + content: "\f047"; +} +.fa-step-backward:before { + content: "\f048"; +} +.fa-fast-backward:before { + content: "\f049"; +} +.fa-backward:before { + content: "\f04a"; +} +.fa-play:before { + content: "\f04b"; +} +.fa-pause:before { + content: "\f04c"; +} +.fa-stop:before { + content: "\f04d"; +} +.fa-forward:before { + content: "\f04e"; +} +.fa-fast-forward:before { + content: "\f050"; +} +.fa-step-forward:before { + content: "\f051"; +} +.fa-eject:before { + content: "\f052"; +} +.fa-chevron-left:before { + content: "\f053"; +} +.fa-chevron-right:before { + content: "\f054"; +} +.fa-plus-circle:before { + content: "\f055"; +} +.fa-minus-circle:before { + content: "\f056"; +} +.fa-times-circle:before { + content: "\f057"; +} +.fa-check-circle:before { + content: "\f058"; +} +.fa-question-circle:before { + content: "\f059"; +} +.fa-info-circle:before { + content: "\f05a"; +} +.fa-crosshairs:before { + content: "\f05b"; +} +.fa-times-circle-o:before { + content: "\f05c"; +} +.fa-check-circle-o:before { + content: "\f05d"; +} +.fa-ban:before { + content: "\f05e"; +} +.fa-arrow-left:before { + content: "\f060"; +} +.fa-arrow-right:before { + content: "\f061"; +} +.fa-arrow-up:before { + content: "\f062"; +} +.fa-arrow-down:before { + content: "\f063"; +} +.fa-mail-forward:before, +.fa-share:before { + content: "\f064"; +} +.fa-expand:before { + content: "\f065"; +} +.fa-compress:before { + content: "\f066"; +} +.fa-plus:before { + content: "\f067"; +} +.fa-minus:before { + content: "\f068"; +} +.fa-asterisk:before { + content: "\f069"; +} +.fa-exclamation-circle:before { + content: "\f06a"; +} +.fa-gift:before { + content: "\f06b"; +} +.fa-leaf:before { + content: "\f06c"; +} +.fa-fire:before { + content: "\f06d"; +} +.fa-eye:before { + content: "\f06e"; +} +.fa-eye-slash:before { + content: "\f070"; +} +.fa-warning:before, +.fa-exclamation-triangle:before { + content: "\f071"; +} +.fa-plane:before { + content: "\f072"; +} +.fa-calendar:before { + content: "\f073"; +} +.fa-random:before { + content: "\f074"; +} +.fa-comment:before { + content: "\f075"; +} +.fa-magnet:before { + content: "\f076"; +} +.fa-chevron-up:before { + content: "\f077"; +} +.fa-chevron-down:before { + content: "\f078"; +} +.fa-retweet:before { + content: "\f079"; +} +.fa-shopping-cart:before { + content: "\f07a"; +} +.fa-folder:before { + content: "\f07b"; +} +.fa-folder-open:before { + content: "\f07c"; +} +.fa-arrows-v:before { + content: "\f07d"; +} +.fa-arrows-h:before { + content: "\f07e"; +} +.fa-bar-chart-o:before, +.fa-bar-chart:before { + content: "\f080"; +} +.fa-twitter-square:before { + content: "\f081"; +} +.fa-facebook-square:before { + content: "\f082"; +} +.fa-camera-retro:before { + content: "\f083"; +} +.fa-key:before { + content: "\f084"; +} +.fa-gears:before, +.fa-cogs:before { + content: "\f085"; +} +.fa-comments:before { + content: "\f086"; +} +.fa-thumbs-o-up:before { + content: "\f087"; +} +.fa-thumbs-o-down:before { + content: "\f088"; +} +.fa-star-half:before { + content: "\f089"; +} +.fa-heart-o:before { + content: "\f08a"; +} +.fa-sign-out:before { + content: "\f08b"; +} +.fa-linkedin-square:before { + content: "\f08c"; +} +.fa-thumb-tack:before { + content: "\f08d"; +} +.fa-external-link:before { + content: "\f08e"; +} +.fa-sign-in:before { + content: "\f090"; +} +.fa-trophy:before { + content: "\f091"; +} +.fa-github-square:before { + content: "\f092"; +} +.fa-upload:before { + content: "\f093"; +} +.fa-lemon-o:before { + content: "\f094"; +} +.fa-phone:before { + content: "\f095"; +} +.fa-square-o:before { + content: "\f096"; +} +.fa-bookmark-o:before { + content: "\f097"; +} +.fa-phone-square:before { + content: "\f098"; +} +.fa-twitter:before { + content: "\f099"; +} +.fa-facebook:before { + content: "\f09a"; +} +.fa-github:before { + content: "\f09b"; +} +.fa-unlock:before { + content: "\f09c"; +} +.fa-credit-card:before { + content: "\f09d"; +} +.fa-rss:before { + content: "\f09e"; +} +.fa-hdd-o:before { + content: "\f0a0"; +} +.fa-bullhorn:before { + content: "\f0a1"; +} +.fa-bell:before { + content: "\f0f3"; +} +.fa-certificate:before { + content: "\f0a3"; +} +.fa-hand-o-right:before { + content: "\f0a4"; +} +.fa-hand-o-left:before { + content: "\f0a5"; +} +.fa-hand-o-up:before { + content: "\f0a6"; +} +.fa-hand-o-down:before { + content: "\f0a7"; +} +.fa-arrow-circle-left:before { + content: "\f0a8"; +} +.fa-arrow-circle-right:before { + content: "\f0a9"; +} +.fa-arrow-circle-up:before { + content: "\f0aa"; +} +.fa-arrow-circle-down:before { + content: "\f0ab"; +} +.fa-globe:before { + content: "\f0ac"; +} +.fa-wrench:before { + content: "\f0ad"; +} +.fa-tasks:before { + content: "\f0ae"; +} +.fa-filter:before { + content: "\f0b0"; +} +.fa-briefcase:before { + content: "\f0b1"; +} +.fa-arrows-alt:before { + content: "\f0b2"; +} +.fa-group:before, +.fa-users:before { + content: "\f0c0"; +} +.fa-chain:before, +.fa-link:before { + content: "\f0c1"; +} +.fa-cloud:before { + content: "\f0c2"; +} +.fa-flask:before { + content: "\f0c3"; +} +.fa-cut:before, +.fa-scissors:before { + content: "\f0c4"; +} +.fa-copy:before, +.fa-files-o:before { + content: "\f0c5"; +} +.fa-paperclip:before { + content: "\f0c6"; +} +.fa-save:before, +.fa-floppy-o:before { + content: "\f0c7"; +} +.fa-square:before { + content: "\f0c8"; +} +.fa-navicon:before, +.fa-reorder:before, +.fa-bars:before { + content: "\f0c9"; +} +.fa-list-ul:before { + content: "\f0ca"; +} +.fa-list-ol:before { + content: "\f0cb"; +} +.fa-strikethrough:before { + content: "\f0cc"; +} +.fa-underline:before { + content: "\f0cd"; +} +.fa-table:before { + content: "\f0ce"; +} +.fa-magic:before { + content: "\f0d0"; +} +.fa-truck:before { + content: "\f0d1"; +} +.fa-pinterest:before { + content: "\f0d2"; +} +.fa-pinterest-square:before { + content: "\f0d3"; +} +.fa-google-plus-square:before { + content: "\f0d4"; +} +.fa-google-plus:before { + content: "\f0d5"; +} +.fa-money:before { + content: "\f0d6"; +} +.fa-caret-down:before { + content: "\f0d7"; +} +.fa-caret-up:before { + content: "\f0d8"; +} +.fa-caret-left:before { + content: "\f0d9"; +} +.fa-caret-right:before { + content: "\f0da"; +} +.fa-columns:before { + content: "\f0db"; +} +.fa-unsorted:before, +.fa-sort:before { + content: "\f0dc"; +} +.fa-sort-down:before, +.fa-sort-desc:before { + content: "\f0dd"; +} +.fa-sort-up:before, +.fa-sort-asc:before { + content: "\f0de"; +} +.fa-envelope:before { + content: "\f0e0"; +} +.fa-linkedin:before { + content: "\f0e1"; +} +.fa-rotate-left:before, +.fa-undo:before { + content: "\f0e2"; +} +.fa-legal:before, +.fa-gavel:before { + content: "\f0e3"; +} +.fa-dashboard:before, +.fa-tachometer:before { + content: "\f0e4"; +} +.fa-comment-o:before { + content: "\f0e5"; +} +.fa-comments-o:before { + content: "\f0e6"; +} +.fa-flash:before, +.fa-bolt:before { + content: "\f0e7"; +} +.fa-sitemap:before { + content: "\f0e8"; +} +.fa-umbrella:before { + content: "\f0e9"; +} +.fa-paste:before, +.fa-clipboard:before { + content: "\f0ea"; +} +.fa-lightbulb-o:before { + content: "\f0eb"; +} +.fa-exchange:before { + content: "\f0ec"; +} +.fa-cloud-download:before { + content: "\f0ed"; +} +.fa-cloud-upload:before { + content: "\f0ee"; +} +.fa-user-md:before { + content: "\f0f0"; +} +.fa-stethoscope:before { + content: "\f0f1"; +} +.fa-suitcase:before { + content: "\f0f2"; +} +.fa-bell-o:before { + content: "\f0a2"; +} +.fa-coffee:before { + content: "\f0f4"; +} +.fa-cutlery:before { + content: "\f0f5"; +} +.fa-file-text-o:before { + content: "\f0f6"; +} +.fa-building-o:before { + content: "\f0f7"; +} +.fa-hospital-o:before { + content: "\f0f8"; +} +.fa-ambulance:before { + content: "\f0f9"; +} +.fa-medkit:before { + content: "\f0fa"; +} +.fa-fighter-jet:before { + content: "\f0fb"; +} +.fa-beer:before { + content: "\f0fc"; +} +.fa-h-square:before { + content: "\f0fd"; +} +.fa-plus-square:before { + content: "\f0fe"; +} +.fa-angle-double-left:before { + content: "\f100"; +} +.fa-angle-double-right:before { + content: "\f101"; +} +.fa-angle-double-up:before { + content: "\f102"; +} +.fa-angle-double-down:before { + content: "\f103"; +} +.fa-angle-left:before { + content: "\f104"; +} +.fa-angle-right:before { + content: "\f105"; +} +.fa-angle-up:before { + content: "\f106"; +} +.fa-angle-down:before { + content: "\f107"; +} +.fa-desktop:before { + content: "\f108"; +} +.fa-laptop:before { + content: "\f109"; +} +.fa-tablet:before { + content: "\f10a"; +} +.fa-mobile-phone:before, +.fa-mobile:before { + content: "\f10b"; +} +.fa-circle-o:before { + content: "\f10c"; +} +.fa-quote-left:before { + content: "\f10d"; +} +.fa-quote-right:before { + content: "\f10e"; +} +.fa-spinner:before { + content: "\f110"; +} +.fa-circle:before { + content: "\f111"; +} +.fa-mail-reply:before, +.fa-reply:before { + content: "\f112"; +} +.fa-github-alt:before { + content: "\f113"; +} +.fa-folder-o:before { + content: "\f114"; +} +.fa-folder-open-o:before { + content: "\f115"; +} +.fa-smile-o:before { + content: "\f118"; +} +.fa-frown-o:before { + content: "\f119"; +} +.fa-meh-o:before { + content: "\f11a"; +} +.fa-gamepad:before { + content: "\f11b"; +} +.fa-keyboard-o:before { + content: "\f11c"; +} +.fa-flag-o:before { + content: "\f11d"; +} +.fa-flag-checkered:before { + content: "\f11e"; +} +.fa-terminal:before { + content: "\f120"; +} +.fa-code:before { + content: "\f121"; +} +.fa-mail-reply-all:before, +.fa-reply-all:before { + content: "\f122"; +} +.fa-star-half-empty:before, +.fa-star-half-full:before, +.fa-star-half-o:before { + content: "\f123"; +} +.fa-location-arrow:before { + content: "\f124"; +} +.fa-crop:before { + content: "\f125"; +} +.fa-code-fork:before { + content: "\f126"; +} +.fa-unlink:before, +.fa-chain-broken:before { + content: "\f127"; +} +.fa-question:before { + content: "\f128"; +} +.fa-info:before { + content: "\f129"; +} +.fa-exclamation:before { + content: "\f12a"; +} +.fa-superscript:before { + content: "\f12b"; +} +.fa-subscript:before { + content: "\f12c"; +} +.fa-eraser:before { + content: "\f12d"; +} +.fa-puzzle-piece:before { + content: "\f12e"; +} +.fa-microphone:before { + content: "\f130"; +} +.fa-microphone-slash:before { + content: "\f131"; +} +.fa-shield:before { + content: "\f132"; +} +.fa-calendar-o:before { + content: "\f133"; +} +.fa-fire-extinguisher:before { + content: "\f134"; +} +.fa-rocket:before { + content: "\f135"; +} +.fa-maxcdn:before { + content: "\f136"; +} +.fa-chevron-circle-left:before { + content: "\f137"; +} +.fa-chevron-circle-right:before { + content: "\f138"; +} +.fa-chevron-circle-up:before { + content: "\f139"; +} +.fa-chevron-circle-down:before { + content: "\f13a"; +} +.fa-html5:before { + content: "\f13b"; +} +.fa-css3:before { + content: "\f13c"; +} +.fa-anchor:before { + content: "\f13d"; +} +.fa-unlock-alt:before { + content: "\f13e"; +} +.fa-bullseye:before { + content: "\f140"; +} +.fa-ellipsis-h:before { + content: "\f141"; +} +.fa-ellipsis-v:before { + content: "\f142"; +} +.fa-rss-square:before { + content: "\f143"; +} +.fa-play-circle:before { + content: "\f144"; +} +.fa-ticket:before { + content: "\f145"; +} +.fa-minus-square:before { + content: "\f146"; +} +.fa-minus-square-o:before { + content: "\f147"; +} +.fa-level-up:before { + content: "\f148"; +} +.fa-level-down:before { + content: "\f149"; +} +.fa-check-square:before { + content: "\f14a"; +} +.fa-pencil-square:before { + content: "\f14b"; +} +.fa-external-link-square:before { + content: "\f14c"; +} +.fa-share-square:before { + content: "\f14d"; +} +.fa-compass:before { + content: "\f14e"; +} +.fa-toggle-down:before, +.fa-caret-square-o-down:before { + content: "\f150"; +} +.fa-toggle-up:before, +.fa-caret-square-o-up:before { + content: "\f151"; +} +.fa-toggle-right:before, +.fa-caret-square-o-right:before { + content: "\f152"; +} +.fa-euro:before, +.fa-eur:before { + content: "\f153"; +} +.fa-gbp:before { + content: "\f154"; +} +.fa-dollar:before, +.fa-usd:before { + content: "\f155"; +} +.fa-rupee:before, +.fa-inr:before { + content: "\f156"; +} +.fa-cny:before, +.fa-rmb:before, +.fa-yen:before, +.fa-jpy:before { + content: "\f157"; +} +.fa-ruble:before, +.fa-rouble:before, +.fa-rub:before { + content: "\f158"; +} +.fa-won:before, +.fa-krw:before { + content: "\f159"; +} +.fa-bitcoin:before, +.fa-btc:before { + content: "\f15a"; +} +.fa-file:before { + content: "\f15b"; +} +.fa-file-text:before { + content: "\f15c"; +} +.fa-sort-alpha-asc:before { + content: "\f15d"; +} +.fa-sort-alpha-desc:before { + content: "\f15e"; +} +.fa-sort-amount-asc:before { + content: "\f160"; +} +.fa-sort-amount-desc:before { + content: "\f161"; +} +.fa-sort-numeric-asc:before { + content: "\f162"; +} +.fa-sort-numeric-desc:before { + content: "\f163"; +} +.fa-thumbs-up:before { + content: "\f164"; +} +.fa-thumbs-down:before { + content: "\f165"; +} +.fa-youtube-square:before { + content: "\f166"; +} +.fa-youtube:before { + content: "\f167"; +} +.fa-xing:before { + content: "\f168"; +} +.fa-xing-square:before { + content: "\f169"; +} +.fa-youtube-play:before { + content: "\f16a"; +} +.fa-dropbox:before { + content: "\f16b"; +} +.fa-stack-overflow:before { + content: "\f16c"; +} +.fa-instagram:before { + content: "\f16d"; +} +.fa-flickr:before { + content: "\f16e"; +} +.fa-adn:before { + content: "\f170"; +} +.fa-bitbucket:before { + content: "\f171"; +} +.fa-bitbucket-square:before { + content: "\f172"; +} +.fa-tumblr:before { + content: "\f173"; +} +.fa-tumblr-square:before { + content: "\f174"; +} +.fa-long-arrow-down:before { + content: "\f175"; +} +.fa-long-arrow-up:before { + content: "\f176"; +} +.fa-long-arrow-left:before { + content: "\f177"; +} +.fa-long-arrow-right:before { + content: "\f178"; +} +.fa-apple:before { + content: "\f179"; +} +.fa-windows:before { + content: "\f17a"; +} +.fa-android:before { + content: "\f17b"; +} +.fa-linux:before { + content: "\f17c"; +} +.fa-dribbble:before { + content: "\f17d"; +} +.fa-skype:before { + content: "\f17e"; +} +.fa-foursquare:before { + content: "\f180"; +} +.fa-trello:before { + content: "\f181"; +} +.fa-female:before { + content: "\f182"; +} +.fa-male:before { + content: "\f183"; +} +.fa-gittip:before { + content: "\f184"; +} +.fa-sun-o:before { + content: "\f185"; +} +.fa-moon-o:before { + content: "\f186"; +} +.fa-archive:before { + content: "\f187"; +} +.fa-bug:before { + content: "\f188"; +} +.fa-vk:before { + content: "\f189"; +} +.fa-weibo:before { + content: "\f18a"; +} +.fa-renren:before { + content: "\f18b"; +} +.fa-pagelines:before { + content: "\f18c"; +} +.fa-stack-exchange:before { + content: "\f18d"; +} +.fa-arrow-circle-o-right:before { + content: "\f18e"; +} +.fa-arrow-circle-o-left:before { + content: "\f190"; +} +.fa-toggle-left:before, +.fa-caret-square-o-left:before { + content: "\f191"; +} +.fa-dot-circle-o:before { + content: "\f192"; +} +.fa-wheelchair:before { + content: "\f193"; +} +.fa-vimeo-square:before { + content: "\f194"; +} +.fa-turkish-lira:before, +.fa-try:before { + content: "\f195"; +} +.fa-plus-square-o:before { + content: "\f196"; +} +.fa-space-shuttle:before { + content: "\f197"; +} +.fa-slack:before { + content: "\f198"; +} +.fa-envelope-square:before { + content: "\f199"; +} +.fa-wordpress:before { + content: "\f19a"; +} +.fa-openid:before { + content: "\f19b"; +} +.fa-institution:before, +.fa-bank:before, +.fa-university:before { + content: "\f19c"; +} +.fa-mortar-board:before, +.fa-graduation-cap:before { + content: "\f19d"; +} +.fa-yahoo:before { + content: "\f19e"; +} +.fa-google:before { + content: "\f1a0"; +} +.fa-reddit:before { + content: "\f1a1"; +} +.fa-reddit-square:before { + content: "\f1a2"; +} +.fa-stumbleupon-circle:before { + content: "\f1a3"; +} +.fa-stumbleupon:before { + content: "\f1a4"; +} +.fa-delicious:before { + content: "\f1a5"; +} +.fa-digg:before { + content: "\f1a6"; +} +.fa-pied-piper:before { + content: "\f1a7"; +} +.fa-pied-piper-alt:before { + content: "\f1a8"; +} +.fa-drupal:before { + content: "\f1a9"; +} +.fa-joomla:before { + content: "\f1aa"; +} +.fa-language:before { + content: "\f1ab"; +} +.fa-fax:before { + content: "\f1ac"; +} +.fa-building:before { + content: "\f1ad"; +} +.fa-child:before { + content: "\f1ae"; +} +.fa-paw:before { + content: "\f1b0"; +} +.fa-spoon:before { + content: "\f1b1"; +} +.fa-cube:before { + content: "\f1b2"; +} +.fa-cubes:before { + content: "\f1b3"; +} +.fa-behance:before { + content: "\f1b4"; +} +.fa-behance-square:before { + content: "\f1b5"; +} +.fa-steam:before { + content: "\f1b6"; +} +.fa-steam-square:before { + content: "\f1b7"; +} +.fa-recycle:before { + content: "\f1b8"; +} +.fa-automobile:before, +.fa-car:before { + content: "\f1b9"; +} +.fa-cab:before, +.fa-taxi:before { + content: "\f1ba"; +} +.fa-tree:before { + content: "\f1bb"; +} +.fa-spotify:before { + content: "\f1bc"; +} +.fa-deviantart:before { + content: "\f1bd"; +} +.fa-soundcloud:before { + content: "\f1be"; +} +.fa-database:before { + content: "\f1c0"; +} +.fa-file-pdf-o:before { + content: "\f1c1"; +} +.fa-file-word-o:before { + content: "\f1c2"; +} +.fa-file-excel-o:before { + content: "\f1c3"; +} +.fa-file-powerpoint-o:before { + content: "\f1c4"; +} +.fa-file-photo-o:before, +.fa-file-picture-o:before, +.fa-file-image-o:before { + content: "\f1c5"; +} +.fa-file-zip-o:before, +.fa-file-archive-o:before { + content: "\f1c6"; +} +.fa-file-sound-o:before, +.fa-file-audio-o:before { + content: "\f1c7"; +} +.fa-file-movie-o:before, +.fa-file-video-o:before { + content: "\f1c8"; +} +.fa-file-code-o:before { + content: "\f1c9"; +} +.fa-vine:before { + content: "\f1ca"; +} +.fa-codepen:before { + content: "\f1cb"; +} +.fa-jsfiddle:before { + content: "\f1cc"; +} +.fa-life-bouy:before, +.fa-life-buoy:before, +.fa-life-saver:before, +.fa-support:before, +.fa-life-ring:before { + content: "\f1cd"; +} +.fa-circle-o-notch:before { + content: "\f1ce"; +} +.fa-ra:before, +.fa-rebel:before { + content: "\f1d0"; +} +.fa-ge:before, +.fa-empire:before { + content: "\f1d1"; +} +.fa-git-square:before { + content: "\f1d2"; +} +.fa-git:before { + content: "\f1d3"; +} +.fa-hacker-news:before { + content: "\f1d4"; +} +.fa-tencent-weibo:before { + content: "\f1d5"; +} +.fa-qq:before { + content: "\f1d6"; +} +.fa-wechat:before, +.fa-weixin:before { + content: "\f1d7"; +} +.fa-send:before, +.fa-paper-plane:before { + content: "\f1d8"; +} +.fa-send-o:before, +.fa-paper-plane-o:before { + content: "\f1d9"; +} +.fa-history:before { + content: "\f1da"; +} +.fa-circle-thin:before { + content: "\f1db"; +} +.fa-header:before { + content: "\f1dc"; +} +.fa-paragraph:before { + content: "\f1dd"; +} +.fa-sliders:before { + content: "\f1de"; +} +.fa-share-alt:before { + content: "\f1e0"; +} +.fa-share-alt-square:before { + content: "\f1e1"; +} +.fa-bomb:before { + content: "\f1e2"; +} +.fa-soccer-ball-o:before, +.fa-futbol-o:before { + content: "\f1e3"; +} +.fa-tty:before { + content: "\f1e4"; +} +.fa-binoculars:before { + content: "\f1e5"; +} +.fa-plug:before { + content: "\f1e6"; +} +.fa-slideshare:before { + content: "\f1e7"; +} +.fa-twitch:before { + content: "\f1e8"; +} +.fa-yelp:before { + content: "\f1e9"; +} +.fa-newspaper-o:before { + content: "\f1ea"; +} +.fa-wifi:before { + content: "\f1eb"; +} +.fa-calculator:before { + content: "\f1ec"; +} +.fa-paypal:before { + content: "\f1ed"; +} +.fa-google-wallet:before { + content: "\f1ee"; +} +.fa-cc-visa:before { + content: "\f1f0"; +} +.fa-cc-mastercard:before { + content: "\f1f1"; +} +.fa-cc-discover:before { + content: "\f1f2"; +} +.fa-cc-amex:before { + content: "\f1f3"; +} +.fa-cc-paypal:before { + content: "\f1f4"; +} +.fa-cc-stripe:before { + content: "\f1f5"; +} +.fa-bell-slash:before { + content: "\f1f6"; +} +.fa-bell-slash-o:before { + content: "\f1f7"; +} +.fa-trash:before { + content: "\f1f8"; +} +.fa-copyright:before { + content: "\f1f9"; +} +.fa-at:before { + content: "\f1fa"; +} +.fa-eyedropper:before { + content: "\f1fb"; +} +.fa-paint-brush:before { + content: "\f1fc"; +} +.fa-birthday-cake:before { + content: "\f1fd"; +} +.fa-area-chart:before { + content: "\f1fe"; +} +.fa-pie-chart:before { + content: "\f200"; +} +.fa-line-chart:before { + content: "\f201"; +} +.fa-lastfm:before { + content: "\f202"; +} +.fa-lastfm-square:before { + content: "\f203"; +} +.fa-toggle-off:before { + content: "\f204"; +} +.fa-toggle-on:before { + content: "\f205"; +} +.fa-bicycle:before { + content: "\f206"; +} +.fa-bus:before { + content: "\f207"; +} +.fa-ioxhost:before { + content: "\f208"; +} +.fa-angellist:before { + content: "\f209"; +} +.fa-cc:before { + content: "\f20a"; +} +.fa-shekel:before, +.fa-sheqel:before, +.fa-ils:before { + content: "\f20b"; +} +.fa-meanpath:before { + content: "\f20c"; +} + +/*# sourceMappingURL=vendor.css.map */ diff --git a/mitmproxy/tools/web/static/vendor.js b/mitmproxy/tools/web/static/vendor.js new file mode 100644 index 00000000..0d85e24c --- /dev/null +++ b/mitmproxy/tools/web/static/vendor.js @@ -0,0 +1,51995 @@ +require=(function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o= 15) { presto = false; webkit = true; } + // Some browsers use the wrong event properties to signal cmd/ctrl on OS X + var flipCtrlCmd = mac && (qtwebkit || presto && (presto_version == null || presto_version < 12.11)); + var captureRightClick = gecko || (ie && ie_version >= 9); + + // Optimize some code when these features are not used. + var sawReadOnlySpans = false, sawCollapsedSpans = false; + + // EDITOR CONSTRUCTOR + + // A CodeMirror instance represents an editor. This is the object + // that user code is usually dealing with. + + function CodeMirror(place, options) { + if (!(this instanceof CodeMirror)) return new CodeMirror(place, options); + + this.options = options = options ? copyObj(options) : {}; + // Determine effective options based on given values and defaults. + copyObj(defaults, options, false); + setGuttersForLineNumbers(options); + + var doc = options.value; + if (typeof doc == "string") doc = new Doc(doc, options.mode, null, options.lineSeparator); + this.doc = doc; + + var input = new CodeMirror.inputStyles[options.inputStyle](this); + var display = this.display = new Display(place, doc, input); + display.wrapper.CodeMirror = this; + updateGutters(this); + themeChanged(this); + if (options.lineWrapping) + this.display.wrapper.className += " CodeMirror-wrap"; + if (options.autofocus && !mobile) display.input.focus(); + initScrollbars(this); + + this.state = { + keyMaps: [], // stores maps added by addKeyMap + overlays: [], // highlighting overlays, as added by addOverlay + modeGen: 0, // bumped when mode/overlay changes, used to invalidate highlighting info + overwrite: false, + delayingBlurEvent: false, + focused: false, + suppressEdits: false, // used to disable editing during key handlers when in readOnly mode + pasteIncoming: false, cutIncoming: false, // help recognize paste/cut edits in input.poll + selectingText: false, + draggingText: false, + highlight: new Delayed(), // stores highlight worker timeout + keySeq: null, // Unfinished key sequence + specialChars: null + }; + + var cm = this; + + // Override magic textarea content restore that IE sometimes does + // on our hidden textarea on reload + if (ie && ie_version < 11) setTimeout(function() { cm.display.input.reset(true); }, 20); + + registerEventHandlers(this); + ensureGlobalHandlers(); + + startOperation(this); + this.curOp.forceUpdate = true; + attachDoc(this, doc); + + if ((options.autofocus && !mobile) || cm.hasFocus()) + setTimeout(bind(onFocus, this), 20); + else + onBlur(this); + + for (var opt in optionHandlers) if (optionHandlers.hasOwnProperty(opt)) + optionHandlers[opt](this, options[opt], Init); + maybeUpdateLineNumberWidth(this); + if (options.finishInit) options.finishInit(this); + for (var i = 0; i < initHooks.length; ++i) initHooks[i](this); + endOperation(this); + // Suppress optimizelegibility in Webkit, since it breaks text + // measuring on line wrapping boundaries. + if (webkit && options.lineWrapping && + getComputedStyle(display.lineDiv).textRendering == "optimizelegibility") + display.lineDiv.style.textRendering = "auto"; + } + + // DISPLAY CONSTRUCTOR + + // The display handles the DOM integration, both for input reading + // and content drawing. It holds references to DOM nodes and + // display-related state. + + function Display(place, doc, input) { + var d = this; + this.input = input; + + // Covers bottom-right square when both scrollbars are present. + d.scrollbarFiller = elt("div", null, "CodeMirror-scrollbar-filler"); + d.scrollbarFiller.setAttribute("cm-not-content", "true"); + // Covers bottom of gutter when coverGutterNextToScrollbar is on + // and h scrollbar is present. + d.gutterFiller = elt("div", null, "CodeMirror-gutter-filler"); + d.gutterFiller.setAttribute("cm-not-content", "true"); + // Will contain the actual code, positioned to cover the viewport. + d.lineDiv = elt("div", null, "CodeMirror-code"); + // Elements are added to these to represent selection and cursors. + d.selectionDiv = elt("div", null, null, "position: relative; z-index: 1"); + d.cursorDiv = elt("div", null, "CodeMirror-cursors"); + // A visibility: hidden element used to find the size of things. + d.measure = elt("div", null, "CodeMirror-measure"); + // When lines outside of the viewport are measured, they are drawn in this. + d.lineMeasure = elt("div", null, "CodeMirror-measure"); + // Wraps everything that needs to exist inside the vertically-padded coordinate system + d.lineSpace = elt("div", [d.measure, d.lineMeasure, d.selectionDiv, d.cursorDiv, d.lineDiv], + null, "position: relative; outline: none"); + // Moved around its parent to cover visible view. + d.mover = elt("div", [elt("div", [d.lineSpace], "CodeMirror-lines")], null, "position: relative"); + // Set to the height of the document, allowing scrolling. + d.sizer = elt("div", [d.mover], "CodeMirror-sizer"); + d.sizerWidth = null; + // Behavior of elts with overflow: auto and padding is + // inconsistent across browsers. This is used to ensure the + // scrollable area is big enough. + d.heightForcer = elt("div", null, null, "position: absolute; height: " + scrollerGap + "px; width: 1px;"); + // Will contain the gutters, if any. + d.gutters = elt("div", null, "CodeMirror-gutters"); + d.lineGutter = null; + // Actual scrollable element. + d.scroller = elt("div", [d.sizer, d.heightForcer, d.gutters], "CodeMirror-scroll"); + d.scroller.setAttribute("tabIndex", "-1"); + // The element in which the editor lives. + d.wrapper = elt("div", [d.scrollbarFiller, d.gutterFiller, d.scroller], "CodeMirror"); + + // Work around IE7 z-index bug (not perfect, hence IE7 not really being supported) + if (ie && ie_version < 8) { d.gutters.style.zIndex = -1; d.scroller.style.paddingRight = 0; } + if (!webkit && !(gecko && mobile)) d.scroller.draggable = true; + + if (place) { + if (place.appendChild) place.appendChild(d.wrapper); + else place(d.wrapper); + } + + // Current rendered range (may be bigger than the view window). + d.viewFrom = d.viewTo = doc.first; + d.reportedViewFrom = d.reportedViewTo = doc.first; + // Information about the rendered lines. + d.view = []; + d.renderedView = null; + // Holds info about a single rendered line when it was rendered + // for measurement, while not in view. + d.externalMeasured = null; + // Empty space (in pixels) above the view + d.viewOffset = 0; + d.lastWrapHeight = d.lastWrapWidth = 0; + d.updateLineNumbers = null; + + d.nativeBarWidth = d.barHeight = d.barWidth = 0; + d.scrollbarsClipped = false; + + // Used to only resize the line number gutter when necessary (when + // the amount of lines crosses a boundary that makes its width change) + d.lineNumWidth = d.lineNumInnerWidth = d.lineNumChars = null; + // Set to true when a non-horizontal-scrolling line widget is + // added. As an optimization, line widget aligning is skipped when + // this is false. + d.alignWidgets = false; + + d.cachedCharWidth = d.cachedTextHeight = d.cachedPaddingH = null; + + // Tracks the maximum line length so that the horizontal scrollbar + // can be kept static when scrolling. + d.maxLine = null; + d.maxLineLength = 0; + d.maxLineChanged = false; + + // Used for measuring wheel scrolling granularity + d.wheelDX = d.wheelDY = d.wheelStartX = d.wheelStartY = null; + + // True when shift is held down. + d.shift = false; + + // Used to track whether anything happened since the context menu + // was opened. + d.selForContextMenu = null; + + d.activeTouch = null; + + input.init(d); + } + + // STATE UPDATES + + // Used to get the editor into a consistent state again when options change. + + function loadMode(cm) { + cm.doc.mode = CodeMirror.getMode(cm.options, cm.doc.modeOption); + resetModeState(cm); + } + + function resetModeState(cm) { + cm.doc.iter(function(line) { + if (line.stateAfter) line.stateAfter = null; + if (line.styles) line.styles = null; + }); + cm.doc.frontier = cm.doc.first; + startWorker(cm, 100); + cm.state.modeGen++; + if (cm.curOp) regChange(cm); + } + + function wrappingChanged(cm) { + if (cm.options.lineWrapping) { + addClass(cm.display.wrapper, "CodeMirror-wrap"); + cm.display.sizer.style.minWidth = ""; + cm.display.sizerWidth = null; + } else { + rmClass(cm.display.wrapper, "CodeMirror-wrap"); + findMaxLine(cm); + } + estimateLineHeights(cm); + regChange(cm); + clearCaches(cm); + setTimeout(function(){updateScrollbars(cm);}, 100); + } + + // Returns a function that estimates the height of a line, to use as + // first approximation until the line becomes visible (and is thus + // properly measurable). + function estimateHeight(cm) { + var th = textHeight(cm.display), wrapping = cm.options.lineWrapping; + var perLine = wrapping && Math.max(5, cm.display.scroller.clientWidth / charWidth(cm.display) - 3); + return function(line) { + if (lineIsHidden(cm.doc, line)) return 0; + + var widgetsHeight = 0; + if (line.widgets) for (var i = 0; i < line.widgets.length; i++) { + if (line.widgets[i].height) widgetsHeight += line.widgets[i].height; + } + + if (wrapping) + return widgetsHeight + (Math.ceil(line.text.length / perLine) || 1) * th; + else + return widgetsHeight + th; + }; + } + + function estimateLineHeights(cm) { + var doc = cm.doc, est = estimateHeight(cm); + doc.iter(function(line) { + var estHeight = est(line); + if (estHeight != line.height) updateLineHeight(line, estHeight); + }); + } + + function themeChanged(cm) { + cm.display.wrapper.className = cm.display.wrapper.className.replace(/\s*cm-s-\S+/g, "") + + cm.options.theme.replace(/(^|\s)\s*/g, " cm-s-"); + clearCaches(cm); + } + + function guttersChanged(cm) { + updateGutters(cm); + regChange(cm); + setTimeout(function(){alignHorizontally(cm);}, 20); + } + + // Rebuild the gutter elements, ensure the margin to the left of the + // code matches their width. + function updateGutters(cm) { + var gutters = cm.display.gutters, specs = cm.options.gutters; + removeChildren(gutters); + for (var i = 0; i < specs.length; ++i) { + var gutterClass = specs[i]; + var gElt = gutters.appendChild(elt("div", null, "CodeMirror-gutter " + gutterClass)); + if (gutterClass == "CodeMirror-linenumbers") { + cm.display.lineGutter = gElt; + gElt.style.width = (cm.display.lineNumWidth || 1) + "px"; + } + } + gutters.style.display = i ? "" : "none"; + updateGutterSpace(cm); + } + + function updateGutterSpace(cm) { + var width = cm.display.gutters.offsetWidth; + cm.display.sizer.style.marginLeft = width + "px"; + } + + // Compute the character length of a line, taking into account + // collapsed ranges (see markText) that might hide parts, and join + // other lines onto it. + function lineLength(line) { + if (line.height == 0) return 0; + var len = line.text.length, merged, cur = line; + while (merged = collapsedSpanAtStart(cur)) { + var found = merged.find(0, true); + cur = found.from.line; + len += found.from.ch - found.to.ch; + } + cur = line; + while (merged = collapsedSpanAtEnd(cur)) { + var found = merged.find(0, true); + len -= cur.text.length - found.from.ch; + cur = found.to.line; + len += cur.text.length - found.to.ch; + } + return len; + } + + // Find the longest line in the document. + function findMaxLine(cm) { + var d = cm.display, doc = cm.doc; + d.maxLine = getLine(doc, doc.first); + d.maxLineLength = lineLength(d.maxLine); + d.maxLineChanged = true; + doc.iter(function(line) { + var len = lineLength(line); + if (len > d.maxLineLength) { + d.maxLineLength = len; + d.maxLine = line; + } + }); + } + + // Make sure the gutters options contains the element + // "CodeMirror-linenumbers" when the lineNumbers option is true. + function setGuttersForLineNumbers(options) { + var found = indexOf(options.gutters, "CodeMirror-linenumbers"); + if (found == -1 && options.lineNumbers) { + options.gutters = options.gutters.concat(["CodeMirror-linenumbers"]); + } else if (found > -1 && !options.lineNumbers) { + options.gutters = options.gutters.slice(0); + options.gutters.splice(found, 1); + } + } + + // SCROLLBARS + + // Prepare DOM reads needed to update the scrollbars. Done in one + // shot to minimize update/measure roundtrips. + function measureForScrollbars(cm) { + var d = cm.display, gutterW = d.gutters.offsetWidth; + var docH = Math.round(cm.doc.height + paddingVert(cm.display)); + return { + clientHeight: d.scroller.clientHeight, + viewHeight: d.wrapper.clientHeight, + scrollWidth: d.scroller.scrollWidth, clientWidth: d.scroller.clientWidth, + viewWidth: d.wrapper.clientWidth, + barLeft: cm.options.fixedGutter ? gutterW : 0, + docHeight: docH, + scrollHeight: docH + scrollGap(cm) + d.barHeight, + nativeBarWidth: d.nativeBarWidth, + gutterWidth: gutterW + }; + } + + function NativeScrollbars(place, scroll, cm) { + this.cm = cm; + var vert = this.vert = elt("div", [elt("div", null, null, "min-width: 1px")], "CodeMirror-vscrollbar"); + var horiz = this.horiz = elt("div", [elt("div", null, null, "height: 100%; min-height: 1px")], "CodeMirror-hscrollbar"); + place(vert); place(horiz); + + on(vert, "scroll", function() { + if (vert.clientHeight) scroll(vert.scrollTop, "vertical"); + }); + on(horiz, "scroll", function() { + if (horiz.clientWidth) scroll(horiz.scrollLeft, "horizontal"); + }); + + this.checkedZeroWidth = false; + // Need to set a minimum width to see the scrollbar on IE7 (but must not set it on IE8). + if (ie && ie_version < 8) this.horiz.style.minHeight = this.vert.style.minWidth = "18px"; + } + + NativeScrollbars.prototype = copyObj({ + update: function(measure) { + var needsH = measure.scrollWidth > measure.clientWidth + 1; + var needsV = measure.scrollHeight > measure.clientHeight + 1; + var sWidth = measure.nativeBarWidth; + + if (needsV) { + this.vert.style.display = "block"; + this.vert.style.bottom = needsH ? sWidth + "px" : "0"; + var totalHeight = measure.viewHeight - (needsH ? sWidth : 0); + // A bug in IE8 can cause this value to be negative, so guard it. + this.vert.firstChild.style.height = + Math.max(0, measure.scrollHeight - measure.clientHeight + totalHeight) + "px"; + } else { + this.vert.style.display = ""; + this.vert.firstChild.style.height = "0"; + } + + if (needsH) { + this.horiz.style.display = "block"; + this.horiz.style.right = needsV ? sWidth + "px" : "0"; + this.horiz.style.left = measure.barLeft + "px"; + var totalWidth = measure.viewWidth - measure.barLeft - (needsV ? sWidth : 0); + this.horiz.firstChild.style.width = + (measure.scrollWidth - measure.clientWidth + totalWidth) + "px"; + } else { + this.horiz.style.display = ""; + this.horiz.firstChild.style.width = "0"; + } + + if (!this.checkedZeroWidth && measure.clientHeight > 0) { + if (sWidth == 0) this.zeroWidthHack(); + this.checkedZeroWidth = true; + } + + return {right: needsV ? sWidth : 0, bottom: needsH ? sWidth : 0}; + }, + setScrollLeft: function(pos) { + if (this.horiz.scrollLeft != pos) this.horiz.scrollLeft = pos; + if (this.disableHoriz) this.enableZeroWidthBar(this.horiz, this.disableHoriz); + }, + setScrollTop: function(pos) { + if (this.vert.scrollTop != pos) this.vert.scrollTop = pos; + if (this.disableVert) this.enableZeroWidthBar(this.vert, this.disableVert); + }, + zeroWidthHack: function() { + var w = mac && !mac_geMountainLion ? "12px" : "18px"; + this.horiz.style.height = this.vert.style.width = w; + this.horiz.style.pointerEvents = this.vert.style.pointerEvents = "none"; + this.disableHoriz = new Delayed; + this.disableVert = new Delayed; + }, + enableZeroWidthBar: function(bar, delay) { + bar.style.pointerEvents = "auto"; + function maybeDisable() { + // To find out whether the scrollbar is still visible, we + // check whether the element under the pixel in the bottom + // left corner of the scrollbar box is the scrollbar box + // itself (when the bar is still visible) or its filler child + // (when the bar is hidden). If it is still visible, we keep + // it enabled, if it's hidden, we disable pointer events. + var box = bar.getBoundingClientRect(); + var elt = document.elementFromPoint(box.left + 1, box.bottom - 1); + if (elt != bar) bar.style.pointerEvents = "none"; + else delay.set(1000, maybeDisable); + } + delay.set(1000, maybeDisable); + }, + clear: function() { + var parent = this.horiz.parentNode; + parent.removeChild(this.horiz); + parent.removeChild(this.vert); + } + }, NativeScrollbars.prototype); + + function NullScrollbars() {} + + NullScrollbars.prototype = copyObj({ + update: function() { return {bottom: 0, right: 0}; }, + setScrollLeft: function() {}, + setScrollTop: function() {}, + clear: function() {} + }, NullScrollbars.prototype); + + CodeMirror.scrollbarModel = {"native": NativeScrollbars, "null": NullScrollbars}; + + function initScrollbars(cm) { + if (cm.display.scrollbars) { + cm.display.scrollbars.clear(); + if (cm.display.scrollbars.addClass) + rmClass(cm.display.wrapper, cm.display.scrollbars.addClass); + } + + cm.display.scrollbars = new CodeMirror.scrollbarModel[cm.options.scrollbarStyle](function(node) { + cm.display.wrapper.insertBefore(node, cm.display.scrollbarFiller); + // Prevent clicks in the scrollbars from killing focus + on(node, "mousedown", function() { + if (cm.state.focused) setTimeout(function() { cm.display.input.focus(); }, 0); + }); + node.setAttribute("cm-not-content", "true"); + }, function(pos, axis) { + if (axis == "horizontal") setScrollLeft(cm, pos); + else setScrollTop(cm, pos); + }, cm); + if (cm.display.scrollbars.addClass) + addClass(cm.display.wrapper, cm.display.scrollbars.addClass); + } + + function updateScrollbars(cm, measure) { + if (!measure) measure = measureForScrollbars(cm); + var startWidth = cm.display.barWidth, startHeight = cm.display.barHeight; + updateScrollbarsInner(cm, measure); + for (var i = 0; i < 4 && startWidth != cm.display.barWidth || startHeight != cm.display.barHeight; i++) { + if (startWidth != cm.display.barWidth && cm.options.lineWrapping) + updateHeightsInViewport(cm); + updateScrollbarsInner(cm, measureForScrollbars(cm)); + startWidth = cm.display.barWidth; startHeight = cm.display.barHeight; + } + } + + // Re-synchronize the fake scrollbars with the actual size of the + // content. + function updateScrollbarsInner(cm, measure) { + var d = cm.display; + var sizes = d.scrollbars.update(measure); + + d.sizer.style.paddingRight = (d.barWidth = sizes.right) + "px"; + d.sizer.style.paddingBottom = (d.barHeight = sizes.bottom) + "px"; + d.heightForcer.style.borderBottom = sizes.bottom + "px solid transparent" + + if (sizes.right && sizes.bottom) { + d.scrollbarFiller.style.display = "block"; + d.scrollbarFiller.style.height = sizes.bottom + "px"; + d.scrollbarFiller.style.width = sizes.right + "px"; + } else d.scrollbarFiller.style.display = ""; + if (sizes.bottom && cm.options.coverGutterNextToScrollbar && cm.options.fixedGutter) { + d.gutterFiller.style.display = "block"; + d.gutterFiller.style.height = sizes.bottom + "px"; + d.gutterFiller.style.width = measure.gutterWidth + "px"; + } else d.gutterFiller.style.display = ""; + } + + // Compute the lines that are visible in a given viewport (defaults + // the the current scroll position). viewport may contain top, + // height, and ensure (see op.scrollToPos) properties. + function visibleLines(display, doc, viewport) { + var top = viewport && viewport.top != null ? Math.max(0, viewport.top) : display.scroller.scrollTop; + top = Math.floor(top - paddingTop(display)); + var bottom = viewport && viewport.bottom != null ? viewport.bottom : top + display.wrapper.clientHeight; + + var from = lineAtHeight(doc, top), to = lineAtHeight(doc, bottom); + // Ensure is a {from: {line, ch}, to: {line, ch}} object, and + // forces those lines into the viewport (if possible). + if (viewport && viewport.ensure) { + var ensureFrom = viewport.ensure.from.line, ensureTo = viewport.ensure.to.line; + if (ensureFrom < from) { + from = ensureFrom; + to = lineAtHeight(doc, heightAtLine(getLine(doc, ensureFrom)) + display.wrapper.clientHeight); + } else if (Math.min(ensureTo, doc.lastLine()) >= to) { + from = lineAtHeight(doc, heightAtLine(getLine(doc, ensureTo)) - display.wrapper.clientHeight); + to = ensureTo; + } + } + return {from: from, to: Math.max(to, from + 1)}; + } + + // LINE NUMBERS + + // Re-align line numbers and gutter marks to compensate for + // horizontal scrolling. + function alignHorizontally(cm) { + var display = cm.display, view = display.view; + if (!display.alignWidgets && (!display.gutters.firstChild || !cm.options.fixedGutter)) return; + var comp = compensateForHScroll(display) - display.scroller.scrollLeft + cm.doc.scrollLeft; + var gutterW = display.gutters.offsetWidth, left = comp + "px"; + for (var i = 0; i < view.length; i++) if (!view[i].hidden) { + if (cm.options.fixedGutter && view[i].gutter) + view[i].gutter.style.left = left; + var align = view[i].alignable; + if (align) for (var j = 0; j < align.length; j++) + align[j].style.left = left; + } + if (cm.options.fixedGutter) + display.gutters.style.left = (comp + gutterW) + "px"; + } + + // Used to ensure that the line number gutter is still the right + // size for the current document size. Returns true when an update + // is needed. + function maybeUpdateLineNumberWidth(cm) { + if (!cm.options.lineNumbers) return false; + var doc = cm.doc, last = lineNumberFor(cm.options, doc.first + doc.size - 1), display = cm.display; + if (last.length != display.lineNumChars) { + var test = display.measure.appendChild(elt("div", [elt("div", last)], + "CodeMirror-linenumber CodeMirror-gutter-elt")); + var innerW = test.firstChild.offsetWidth, padding = test.offsetWidth - innerW; + display.lineGutter.style.width = ""; + display.lineNumInnerWidth = Math.max(innerW, display.lineGutter.offsetWidth - padding) + 1; + display.lineNumWidth = display.lineNumInnerWidth + padding; + display.lineNumChars = display.lineNumInnerWidth ? last.length : -1; + display.lineGutter.style.width = display.lineNumWidth + "px"; + updateGutterSpace(cm); + return true; + } + return false; + } + + function lineNumberFor(options, i) { + return String(options.lineNumberFormatter(i + options.firstLineNumber)); + } + + // Computes display.scroller.scrollLeft + display.gutters.offsetWidth, + // but using getBoundingClientRect to get a sub-pixel-accurate + // result. + function compensateForHScroll(display) { + return display.scroller.getBoundingClientRect().left - display.sizer.getBoundingClientRect().left; + } + + // DISPLAY DRAWING + + function DisplayUpdate(cm, viewport, force) { + var display = cm.display; + + this.viewport = viewport; + // Store some values that we'll need later (but don't want to force a relayout for) + this.visible = visibleLines(display, cm.doc, viewport); + this.editorIsHidden = !display.wrapper.offsetWidth; + this.wrapperHeight = display.wrapper.clientHeight; + this.wrapperWidth = display.wrapper.clientWidth; + this.oldDisplayWidth = displayWidth(cm); + this.force = force; + this.dims = getDimensions(cm); + this.events = []; + } + + DisplayUpdate.prototype.signal = function(emitter, type) { + if (hasHandler(emitter, type)) + this.events.push(arguments); + }; + DisplayUpdate.prototype.finish = function() { + for (var i = 0; i < this.events.length; i++) + signal.apply(null, this.events[i]); + }; + + function maybeClipScrollbars(cm) { + var display = cm.display; + if (!display.scrollbarsClipped && display.scroller.offsetWidth) { + display.nativeBarWidth = display.scroller.offsetWidth - display.scroller.clientWidth; + display.heightForcer.style.height = scrollGap(cm) + "px"; + display.sizer.style.marginBottom = -display.nativeBarWidth + "px"; + display.sizer.style.borderRightWidth = scrollGap(cm) + "px"; + display.scrollbarsClipped = true; + } + } + + // Does the actual updating of the line display. Bails out + // (returning false) when there is nothing to be done and forced is + // false. + function updateDisplayIfNeeded(cm, update) { + var display = cm.display, doc = cm.doc; + + if (update.editorIsHidden) { + resetView(cm); + return false; + } + + // Bail out if the visible area is already rendered and nothing changed. + if (!update.force && + update.visible.from >= display.viewFrom && update.visible.to <= display.viewTo && + (display.updateLineNumbers == null || display.updateLineNumbers >= display.viewTo) && + display.renderedView == display.view && countDirtyView(cm) == 0) + return false; + + if (maybeUpdateLineNumberWidth(cm)) { + resetView(cm); + update.dims = getDimensions(cm); + } + + // Compute a suitable new viewport (from & to) + var end = doc.first + doc.size; + var from = Math.max(update.visible.from - cm.options.viewportMargin, doc.first); + var to = Math.min(end, update.visible.to + cm.options.viewportMargin); + if (display.viewFrom < from && from - display.viewFrom < 20) from = Math.max(doc.first, display.viewFrom); + if (display.viewTo > to && display.viewTo - to < 20) to = Math.min(end, display.viewTo); + if (sawCollapsedSpans) { + from = visualLineNo(cm.doc, from); + to = visualLineEndNo(cm.doc, to); + } + + var different = from != display.viewFrom || to != display.viewTo || + display.lastWrapHeight != update.wrapperHeight || display.lastWrapWidth != update.wrapperWidth; + adjustView(cm, from, to); + + display.viewOffset = heightAtLine(getLine(cm.doc, display.viewFrom)); + // Position the mover div to align with the current scroll position + cm.display.mover.style.top = display.viewOffset + "px"; + + var toUpdate = countDirtyView(cm); + if (!different && toUpdate == 0 && !update.force && display.renderedView == display.view && + (display.updateLineNumbers == null || display.updateLineNumbers >= display.viewTo)) + return false; + + // For big changes, we hide the enclosing element during the + // update, since that speeds up the operations on most browsers. + var focused = activeElt(); + if (toUpdate > 4) display.lineDiv.style.display = "none"; + patchDisplay(cm, display.updateLineNumbers, update.dims); + if (toUpdate > 4) display.lineDiv.style.display = ""; + display.renderedView = display.view; + // There might have been a widget with a focused element that got + // hidden or updated, if so re-focus it. + if (focused && activeElt() != focused && focused.offsetHeight) focused.focus(); + + // Prevent selection and cursors from interfering with the scroll + // width and height. + removeChildren(display.cursorDiv); + removeChildren(display.selectionDiv); + display.gutters.style.height = display.sizer.style.minHeight = 0; + + if (different) { + display.lastWrapHeight = update.wrapperHeight; + display.lastWrapWidth = update.wrapperWidth; + startWorker(cm, 400); + } + + display.updateLineNumbers = null; + + return true; + } + + function postUpdateDisplay(cm, update) { + var viewport = update.viewport; + + for (var first = true;; first = false) { + if (!first || !cm.options.lineWrapping || update.oldDisplayWidth == displayWidth(cm)) { + // Clip forced viewport to actual scrollable area. + if (viewport && viewport.top != null) + viewport = {top: Math.min(cm.doc.height + paddingVert(cm.display) - displayHeight(cm), viewport.top)}; + // Updated line heights might result in the drawn area not + // actually covering the viewport. Keep looping until it does. + update.visible = visibleLines(cm.display, cm.doc, viewport); + if (update.visible.from >= cm.display.viewFrom && update.visible.to <= cm.display.viewTo) + break; + } + if (!updateDisplayIfNeeded(cm, update)) break; + updateHeightsInViewport(cm); + var barMeasure = measureForScrollbars(cm); + updateSelection(cm); + updateScrollbars(cm, barMeasure); + setDocumentHeight(cm, barMeasure); + } + + update.signal(cm, "update", cm); + if (cm.display.viewFrom != cm.display.reportedViewFrom || cm.display.viewTo != cm.display.reportedViewTo) { + update.signal(cm, "viewportChange", cm, cm.display.viewFrom, cm.display.viewTo); + cm.display.reportedViewFrom = cm.display.viewFrom; cm.display.reportedViewTo = cm.display.viewTo; + } + } + + function updateDisplaySimple(cm, viewport) { + var update = new DisplayUpdate(cm, viewport); + if (updateDisplayIfNeeded(cm, update)) { + updateHeightsInViewport(cm); + postUpdateDisplay(cm, update); + var barMeasure = measureForScrollbars(cm); + updateSelection(cm); + updateScrollbars(cm, barMeasure); + setDocumentHeight(cm, barMeasure); + update.finish(); + } + } + + function setDocumentHeight(cm, measure) { + cm.display.sizer.style.minHeight = measure.docHeight + "px"; + cm.display.heightForcer.style.top = measure.docHeight + "px"; + cm.display.gutters.style.height = (measure.docHeight + cm.display.barHeight + scrollGap(cm)) + "px"; + } + + // Read the actual heights of the rendered lines, and update their + // stored heights to match. + function updateHeightsInViewport(cm) { + var display = cm.display; + var prevBottom = display.lineDiv.offsetTop; + for (var i = 0; i < display.view.length; i++) { + var cur = display.view[i], height; + if (cur.hidden) continue; + if (ie && ie_version < 8) { + var bot = cur.node.offsetTop + cur.node.offsetHeight; + height = bot - prevBottom; + prevBottom = bot; + } else { + var box = cur.node.getBoundingClientRect(); + height = box.bottom - box.top; + } + var diff = cur.line.height - height; + if (height < 2) height = textHeight(display); + if (diff > .001 || diff < -.001) { + updateLineHeight(cur.line, height); + updateWidgetHeight(cur.line); + if (cur.rest) for (var j = 0; j < cur.rest.length; j++) + updateWidgetHeight(cur.rest[j]); + } + } + } + + // Read and store the height of line widgets associated with the + // given line. + function updateWidgetHeight(line) { + if (line.widgets) for (var i = 0; i < line.widgets.length; ++i) + line.widgets[i].height = line.widgets[i].node.parentNode.offsetHeight; + } + + // Do a bulk-read of the DOM positions and sizes needed to draw the + // view, so that we don't interleave reading and writing to the DOM. + function getDimensions(cm) { + var d = cm.display, left = {}, width = {}; + var gutterLeft = d.gutters.clientLeft; + for (var n = d.gutters.firstChild, i = 0; n; n = n.nextSibling, ++i) { + left[cm.options.gutters[i]] = n.offsetLeft + n.clientLeft + gutterLeft; + width[cm.options.gutters[i]] = n.clientWidth; + } + return {fixedPos: compensateForHScroll(d), + gutterTotalWidth: d.gutters.offsetWidth, + gutterLeft: left, + gutterWidth: width, + wrapperWidth: d.wrapper.clientWidth}; + } + + // Sync the actual display DOM structure with display.view, removing + // nodes for lines that are no longer in view, and creating the ones + // that are not there yet, and updating the ones that are out of + // date. + function patchDisplay(cm, updateNumbersFrom, dims) { + var display = cm.display, lineNumbers = cm.options.lineNumbers; + var container = display.lineDiv, cur = container.firstChild; + + function rm(node) { + var next = node.nextSibling; + // Works around a throw-scroll bug in OS X Webkit + if (webkit && mac && cm.display.currentWheelTarget == node) + node.style.display = "none"; + else + node.parentNode.removeChild(node); + return next; + } + + var view = display.view, lineN = display.viewFrom; + // Loop over the elements in the view, syncing cur (the DOM nodes + // in display.lineDiv) with the view as we go. + for (var i = 0; i < view.length; i++) { + var lineView = view[i]; + if (lineView.hidden) { + } else if (!lineView.node || lineView.node.parentNode != container) { // Not drawn yet + var node = buildLineElement(cm, lineView, lineN, dims); + container.insertBefore(node, cur); + } else { // Already drawn + while (cur != lineView.node) cur = rm(cur); + var updateNumber = lineNumbers && updateNumbersFrom != null && + updateNumbersFrom <= lineN && lineView.lineNumber; + if (lineView.changes) { + if (indexOf(lineView.changes, "gutter") > -1) updateNumber = false; + updateLineForChanges(cm, lineView, lineN, dims); + } + if (updateNumber) { + removeChildren(lineView.lineNumber); + lineView.lineNumber.appendChild(document.createTextNode(lineNumberFor(cm.options, lineN))); + } + cur = lineView.node.nextSibling; + } + lineN += lineView.size; + } + while (cur) cur = rm(cur); + } + + // When an aspect of a line changes, a string is added to + // lineView.changes. This updates the relevant part of the line's + // DOM structure. + function updateLineForChanges(cm, lineView, lineN, dims) { + for (var j = 0; j < lineView.changes.length; j++) { + var type = lineView.changes[j]; + if (type == "text") updateLineText(cm, lineView); + else if (type == "gutter") updateLineGutter(cm, lineView, lineN, dims); + else if (type == "class") updateLineClasses(lineView); + else if (type == "widget") updateLineWidgets(cm, lineView, dims); + } + lineView.changes = null; + } + + // Lines with gutter elements, widgets or a background class need to + // be wrapped, and have the extra elements added to the wrapper div + function ensureLineWrapped(lineView) { + if (lineView.node == lineView.text) { + lineView.node = elt("div", null, null, "position: relative"); + if (lineView.text.parentNode) + lineView.text.parentNode.replaceChild(lineView.node, lineView.text); + lineView.node.appendChild(lineView.text); + if (ie && ie_version < 8) lineView.node.style.zIndex = 2; + } + return lineView.node; + } + + function updateLineBackground(lineView) { + var cls = lineView.bgClass ? lineView.bgClass + " " + (lineView.line.bgClass || "") : lineView.line.bgClass; + if (cls) cls += " CodeMirror-linebackground"; + if (lineView.background) { + if (cls) lineView.background.className = cls; + else { lineView.background.parentNode.removeChild(lineView.background); lineView.background = null; } + } else if (cls) { + var wrap = ensureLineWrapped(lineView); + lineView.background = wrap.insertBefore(elt("div", null, cls), wrap.firstChild); + } + } + + // Wrapper around buildLineContent which will reuse the structure + // in display.externalMeasured when possible. + function getLineContent(cm, lineView) { + var ext = cm.display.externalMeasured; + if (ext && ext.line == lineView.line) { + cm.display.externalMeasured = null; + lineView.measure = ext.measure; + return ext.built; + } + return buildLineContent(cm, lineView); + } + + // Redraw the line's text. Interacts with the background and text + // classes because the mode may output tokens that influence these + // classes. + function updateLineText(cm, lineView) { + var cls = lineView.text.className; + var built = getLineContent(cm, lineView); + if (lineView.text == lineView.node) lineView.node = built.pre; + lineView.text.parentNode.replaceChild(built.pre, lineView.text); + lineView.text = built.pre; + if (built.bgClass != lineView.bgClass || built.textClass != lineView.textClass) { + lineView.bgClass = built.bgClass; + lineView.textClass = built.textClass; + updateLineClasses(lineView); + } else if (cls) { + lineView.text.className = cls; + } + } + + function updateLineClasses(lineView) { + updateLineBackground(lineView); + if (lineView.line.wrapClass) + ensureLineWrapped(lineView).className = lineView.line.wrapClass; + else if (lineView.node != lineView.text) + lineView.node.className = ""; + var textClass = lineView.textClass ? lineView.textClass + " " + (lineView.line.textClass || "") : lineView.line.textClass; + lineView.text.className = textClass || ""; + } + + function updateLineGutter(cm, lineView, lineN, dims) { + if (lineView.gutter) { + lineView.node.removeChild(lineView.gutter); + lineView.gutter = null; + } + if (lineView.gutterBackground) { + lineView.node.removeChild(lineView.gutterBackground); + lineView.gutterBackground = null; + } + if (lineView.line.gutterClass) { + var wrap = ensureLineWrapped(lineView); + lineView.gutterBackground = elt("div", null, "CodeMirror-gutter-background " + lineView.line.gutterClass, + "left: " + (cm.options.fixedGutter ? dims.fixedPos : -dims.gutterTotalWidth) + + "px; width: " + dims.gutterTotalWidth + "px"); + wrap.insertBefore(lineView.gutterBackground, lineView.text); + } + var markers = lineView.line.gutterMarkers; + if (cm.options.lineNumbers || markers) { + var wrap = ensureLineWrapped(lineView); + var gutterWrap = lineView.gutter = elt("div", null, "CodeMirror-gutter-wrapper", "left: " + + (cm.options.fixedGutter ? dims.fixedPos : -dims.gutterTotalWidth) + "px"); + cm.display.input.setUneditable(gutterWrap); + wrap.insertBefore(gutterWrap, lineView.text); + if (lineView.line.gutterClass) + gutterWrap.className += " " + lineView.line.gutterClass; + if (cm.options.lineNumbers && (!markers || !markers["CodeMirror-linenumbers"])) + lineView.lineNumber = gutterWrap.appendChild( + elt("div", lineNumberFor(cm.options, lineN), + "CodeMirror-linenumber CodeMirror-gutter-elt", + "left: " + dims.gutterLeft["CodeMirror-linenumbers"] + "px; width: " + + cm.display.lineNumInnerWidth + "px")); + if (markers) for (var k = 0; k < cm.options.gutters.length; ++k) { + var id = cm.options.gutters[k], found = markers.hasOwnProperty(id) && markers[id]; + if (found) + gutterWrap.appendChild(elt("div", [found], "CodeMirror-gutter-elt", "left: " + + dims.gutterLeft[id] + "px; width: " + dims.gutterWidth[id] + "px")); + } + } + } + + function updateLineWidgets(cm, lineView, dims) { + if (lineView.alignable) lineView.alignable = null; + for (var node = lineView.node.firstChild, next; node; node = next) { + var next = node.nextSibling; + if (node.className == "CodeMirror-linewidget") + lineView.node.removeChild(node); + } + insertLineWidgets(cm, lineView, dims); + } + + // Build a line's DOM representation from scratch + function buildLineElement(cm, lineView, lineN, dims) { + var built = getLineContent(cm, lineView); + lineView.text = lineView.node = built.pre; + if (built.bgClass) lineView.bgClass = built.bgClass; + if (built.textClass) lineView.textClass = built.textClass; + + updateLineClasses(lineView); + updateLineGutter(cm, lineView, lineN, dims); + insertLineWidgets(cm, lineView, dims); + return lineView.node; + } + + // A lineView may contain multiple logical lines (when merged by + // collapsed spans). The widgets for all of them need to be drawn. + function insertLineWidgets(cm, lineView, dims) { + insertLineWidgetsFor(cm, lineView.line, lineView, dims, true); + if (lineView.rest) for (var i = 0; i < lineView.rest.length; i++) + insertLineWidgetsFor(cm, lineView.rest[i], lineView, dims, false); + } + + function insertLineWidgetsFor(cm, line, lineView, dims, allowAbove) { + if (!line.widgets) return; + var wrap = ensureLineWrapped(lineView); + for (var i = 0, ws = line.widgets; i < ws.length; ++i) { + var widget = ws[i], node = elt("div", [widget.node], "CodeMirror-linewidget"); + if (!widget.handleMouseEvents) node.setAttribute("cm-ignore-events", "true"); + positionLineWidget(widget, node, lineView, dims); + cm.display.input.setUneditable(node); + if (allowAbove && widget.above) + wrap.insertBefore(node, lineView.gutter || lineView.text); + else + wrap.appendChild(node); + signalLater(widget, "redraw"); + } + } + + function positionLineWidget(widget, node, lineView, dims) { + if (widget.noHScroll) { + (lineView.alignable || (lineView.alignable = [])).push(node); + var width = dims.wrapperWidth; + node.style.left = dims.fixedPos + "px"; + if (!widget.coverGutter) { + width -= dims.gutterTotalWidth; + node.style.paddingLeft = dims.gutterTotalWidth + "px"; + } + node.style.width = width + "px"; + } + if (widget.coverGutter) { + node.style.zIndex = 5; + node.style.position = "relative"; + if (!widget.noHScroll) node.style.marginLeft = -dims.gutterTotalWidth + "px"; + } + } + + // POSITION OBJECT + + // A Pos instance represents a position within the text. + var Pos = CodeMirror.Pos = function(line, ch) { + if (!(this instanceof Pos)) return new Pos(line, ch); + this.line = line; this.ch = ch; + }; + + // Compare two positions, return 0 if they are the same, a negative + // number when a is less, and a positive number otherwise. + var cmp = CodeMirror.cmpPos = function(a, b) { return a.line - b.line || a.ch - b.ch; }; + + function copyPos(x) {return Pos(x.line, x.ch);} + function maxPos(a, b) { return cmp(a, b) < 0 ? b : a; } + function minPos(a, b) { return cmp(a, b) < 0 ? a : b; } + + // INPUT HANDLING + + function ensureFocus(cm) { + if (!cm.state.focused) { cm.display.input.focus(); onFocus(cm); } + } + + // This will be set to a {lineWise: bool, text: [string]} object, so + // that, when pasting, we know what kind of selections the copied + // text was made out of. + var lastCopied = null; + + function applyTextInput(cm, inserted, deleted, sel, origin) { + var doc = cm.doc; + cm.display.shift = false; + if (!sel) sel = doc.sel; + + var paste = cm.state.pasteIncoming || origin == "paste"; + var textLines = doc.splitLines(inserted), multiPaste = null + // When pasing N lines into N selections, insert one line per selection + if (paste && sel.ranges.length > 1) { + if (lastCopied && lastCopied.text.join("\n") == inserted) { + if (sel.ranges.length % lastCopied.text.length == 0) { + multiPaste = []; + for (var i = 0; i < lastCopied.text.length; i++) + multiPaste.push(doc.splitLines(lastCopied.text[i])); + } + } else if (textLines.length == sel.ranges.length) { + multiPaste = map(textLines, function(l) { return [l]; }); + } + } + + // Normal behavior is to insert the new text into every selection + for (var i = sel.ranges.length - 1; i >= 0; i--) { + var range = sel.ranges[i]; + var from = range.from(), to = range.to(); + if (range.empty()) { + if (deleted && deleted > 0) // Handle deletion + from = Pos(from.line, from.ch - deleted); + else if (cm.state.overwrite && !paste) // Handle overwrite + to = Pos(to.line, Math.min(getLine(doc, to.line).text.length, to.ch + lst(textLines).length)); + else if (lastCopied && lastCopied.lineWise && lastCopied.text.join("\n") == inserted) + from = to = Pos(from.line, 0) + } + var updateInput = cm.curOp.updateInput; + var changeEvent = {from: from, to: to, text: multiPaste ? multiPaste[i % multiPaste.length] : textLines, + origin: origin || (paste ? "paste" : cm.state.cutIncoming ? "cut" : "+input")}; + makeChange(cm.doc, changeEvent); + signalLater(cm, "inputRead", cm, changeEvent); + } + if (inserted && !paste) + triggerElectric(cm, inserted); + + ensureCursorVisible(cm); + cm.curOp.updateInput = updateInput; + cm.curOp.typing = true; + cm.state.pasteIncoming = cm.state.cutIncoming = false; + } + + function handlePaste(e, cm) { + var pasted = e.clipboardData && e.clipboardData.getData("text/plain"); + if (pasted) { + e.preventDefault(); + if (!cm.isReadOnly() && !cm.options.disableInput) + runInOp(cm, function() { applyTextInput(cm, pasted, 0, null, "paste"); }); + return true; + } + } + + function triggerElectric(cm, inserted) { + // When an 'electric' character is inserted, immediately trigger a reindent + if (!cm.options.electricChars || !cm.options.smartIndent) return; + var sel = cm.doc.sel; + + for (var i = sel.ranges.length - 1; i >= 0; i--) { + var range = sel.ranges[i]; + if (range.head.ch > 100 || (i && sel.ranges[i - 1].head.line == range.head.line)) continue; + var mode = cm.getModeAt(range.head); + var indented = false; + if (mode.electricChars) { + for (var j = 0; j < mode.electricChars.length; j++) + if (inserted.indexOf(mode.electricChars.charAt(j)) > -1) { + indented = indentLine(cm, range.head.line, "smart"); + break; + } + } else if (mode.electricInput) { + if (mode.electricInput.test(getLine(cm.doc, range.head.line).text.slice(0, range.head.ch))) + indented = indentLine(cm, range.head.line, "smart"); + } + if (indented) signalLater(cm, "electricInput", cm, range.head.line); + } + } + + function copyableRanges(cm) { + var text = [], ranges = []; + for (var i = 0; i < cm.doc.sel.ranges.length; i++) { + var line = cm.doc.sel.ranges[i].head.line; + var lineRange = {anchor: Pos(line, 0), head: Pos(line + 1, 0)}; + ranges.push(lineRange); + text.push(cm.getRange(lineRange.anchor, lineRange.head)); + } + return {text: text, ranges: ranges}; + } + + function disableBrowserMagic(field) { + field.setAttribute("autocorrect", "off"); + field.setAttribute("autocapitalize", "off"); + field.setAttribute("spellcheck", "false"); + } + + // TEXTAREA INPUT STYLE + + function TextareaInput(cm) { + this.cm = cm; + // See input.poll and input.reset + this.prevInput = ""; + + // Flag that indicates whether we expect input to appear real soon + // now (after some event like 'keypress' or 'input') and are + // polling intensively. + this.pollingFast = false; + // Self-resetting timeout for the poller + this.polling = new Delayed(); + // Tracks when input.reset has punted to just putting a short + // string into the textarea instead of the full selection. + this.inaccurateSelection = false; + // Used to work around IE issue with selection being forgotten when focus moves away from textarea + this.hasSelection = false; + this.composing = null; + }; + + function hiddenTextarea() { + var te = elt("textarea", null, null, "position: absolute; bottom: -1em; padding: 0; width: 1px; height: 1em; outline: none"); + var div = elt("div", [te], null, "overflow: hidden; position: relative; width: 3px; height: 0px;"); + // The textarea is kept positioned near the cursor to prevent the + // fact that it'll be scrolled into view on input from scrolling + // our fake cursor out of view. On webkit, when wrap=off, paste is + // very slow. So make the area wide instead. + if (webkit) te.style.width = "1000px"; + else te.setAttribute("wrap", "off"); + // If border: 0; -- iOS fails to open keyboard (issue #1287) + if (ios) te.style.border = "1px solid black"; + disableBrowserMagic(te); + return div; + } + + TextareaInput.prototype = copyObj({ + init: function(display) { + var input = this, cm = this.cm; + + // Wraps and hides input textarea + var div = this.wrapper = hiddenTextarea(); + // The semihidden textarea that is focused when the editor is + // focused, and receives input. + var te = this.textarea = div.firstChild; + display.wrapper.insertBefore(div, display.wrapper.firstChild); + + // Needed to hide big blue blinking cursor on Mobile Safari (doesn't seem to work in iOS 8 anymore) + if (ios) te.style.width = "0px"; + + on(te, "input", function() { + if (ie && ie_version >= 9 && input.hasSelection) input.hasSelection = null; + input.poll(); + }); + + on(te, "paste", function(e) { + if (signalDOMEvent(cm, e) || handlePaste(e, cm)) return + + cm.state.pasteIncoming = true; + input.fastPoll(); + }); + + function prepareCopyCut(e) { + if (signalDOMEvent(cm, e)) return + if (cm.somethingSelected()) { + lastCopied = {lineWise: false, text: cm.getSelections()}; + if (input.inaccurateSelection) { + input.prevInput = ""; + input.inaccurateSelection = false; + te.value = lastCopied.text.join("\n"); + selectInput(te); + } + } else if (!cm.options.lineWiseCopyCut) { + return; + } else { + var ranges = copyableRanges(cm); + lastCopied = {lineWise: true, text: ranges.text}; + if (e.type == "cut") { + cm.setSelections(ranges.ranges, null, sel_dontScroll); + } else { + input.prevInput = ""; + te.value = ranges.text.join("\n"); + selectInput(te); + } + } + if (e.type == "cut") cm.state.cutIncoming = true; + } + on(te, "cut", prepareCopyCut); + on(te, "copy", prepareCopyCut); + + on(display.scroller, "paste", function(e) { + if (eventInWidget(display, e) || signalDOMEvent(cm, e)) return; + cm.state.pasteIncoming = true; + input.focus(); + }); + + // Prevent normal selection in the editor (we handle our own) + on(display.lineSpace, "selectstart", function(e) { + if (!eventInWidget(display, e)) e_preventDefault(e); + }); + + on(te, "compositionstart", function() { + var start = cm.getCursor("from"); + if (input.composing) input.composing.range.clear() + input.composing = { + start: start, + range: cm.markText(start, cm.getCursor("to"), {className: "CodeMirror-composing"}) + }; + }); + on(te, "compositionend", function() { + if (input.composing) { + input.poll(); + input.composing.range.clear(); + input.composing = null; + } + }); + }, + + prepareSelection: function() { + // Redraw the selection and/or cursor + var cm = this.cm, display = cm.display, doc = cm.doc; + var result = prepareSelection(cm); + + // Move the hidden textarea near the cursor to prevent scrolling artifacts + if (cm.options.moveInputWithCursor) { + var headPos = cursorCoords(cm, doc.sel.primary().head, "div"); + var wrapOff = display.wrapper.getBoundingClientRect(), lineOff = display.lineDiv.getBoundingClientRect(); + result.teTop = Math.max(0, Math.min(display.wrapper.clientHeight - 10, + headPos.top + lineOff.top - wrapOff.top)); + result.teLeft = Math.max(0, Math.min(display.wrapper.clientWidth - 10, + headPos.left + lineOff.left - wrapOff.left)); + } + + return result; + }, + + showSelection: function(drawn) { + var cm = this.cm, display = cm.display; + removeChildrenAndAdd(display.cursorDiv, drawn.cursors); + removeChildrenAndAdd(display.selectionDiv, drawn.selection); + if (drawn.teTop != null) { + this.wrapper.style.top = drawn.teTop + "px"; + this.wrapper.style.left = drawn.teLeft + "px"; + } + }, + + // Reset the input to correspond to the selection (or to be empty, + // when not typing and nothing is selected) + reset: function(typing) { + if (this.contextMenuPending) return; + var minimal, selected, cm = this.cm, doc = cm.doc; + if (cm.somethingSelected()) { + this.prevInput = ""; + var range = doc.sel.primary(); + minimal = hasCopyEvent && + (range.to().line - range.from().line > 100 || (selected = cm.getSelection()).length > 1000); + var content = minimal ? "-" : selected || cm.getSelection(); + this.textarea.value = content; + if (cm.state.focused) selectInput(this.textarea); + if (ie && ie_version >= 9) this.hasSelection = content; + } else if (!typing) { + this.prevInput = this.textarea.value = ""; + if (ie && ie_version >= 9) this.hasSelection = null; + } + this.inaccurateSelection = minimal; + }, + + getField: function() { return this.textarea; }, + + supportsTouch: function() { return false; }, + + focus: function() { + if (this.cm.options.readOnly != "nocursor" && (!mobile || activeElt() != this.textarea)) { + try { this.textarea.focus(); } + catch (e) {} // IE8 will throw if the textarea is display: none or not in DOM + } + }, + + blur: function() { this.textarea.blur(); }, + + resetPosition: function() { + this.wrapper.style.top = this.wrapper.style.left = 0; + }, + + receivedFocus: function() { this.slowPoll(); }, + + // Poll for input changes, using the normal rate of polling. This + // runs as long as the editor is focused. + slowPoll: function() { + var input = this; + if (input.pollingFast) return; + input.polling.set(this.cm.options.pollInterval, function() { + input.poll(); + if (input.cm.state.focused) input.slowPoll(); + }); + }, + + // When an event has just come in that is likely to add or change + // something in the input textarea, we poll faster, to ensure that + // the change appears on the screen quickly. + fastPoll: function() { + var missed = false, input = this; + input.pollingFast = true; + function p() { + var changed = input.poll(); + if (!changed && !missed) {missed = true; input.polling.set(60, p);} + else {input.pollingFast = false; input.slowPoll();} + } + input.polling.set(20, p); + }, + + // Read input from the textarea, and update the document to match. + // When something is selected, it is present in the textarea, and + // selected (unless it is huge, in which case a placeholder is + // used). When nothing is selected, the cursor sits after previously + // seen text (can be empty), which is stored in prevInput (we must + // not reset the textarea when typing, because that breaks IME). + poll: function() { + var cm = this.cm, input = this.textarea, prevInput = this.prevInput; + // Since this is called a *lot*, try to bail out as cheaply as + // possible when it is clear that nothing happened. hasSelection + // will be the case when there is a lot of text in the textarea, + // in which case reading its value would be expensive. + if (this.contextMenuPending || !cm.state.focused || + (hasSelection(input) && !prevInput && !this.composing) || + cm.isReadOnly() || cm.options.disableInput || cm.state.keySeq) + return false; + + var text = input.value; + // If nothing changed, bail. + if (text == prevInput && !cm.somethingSelected()) return false; + // Work around nonsensical selection resetting in IE9/10, and + // inexplicable appearance of private area unicode characters on + // some key combos in Mac (#2689). + if (ie && ie_version >= 9 && this.hasSelection === text || + mac && /[\uf700-\uf7ff]/.test(text)) { + cm.display.input.reset(); + return false; + } + + if (cm.doc.sel == cm.display.selForContextMenu) { + var first = text.charCodeAt(0); + if (first == 0x200b && !prevInput) prevInput = "\u200b"; + if (first == 0x21da) { this.reset(); return this.cm.execCommand("undo"); } + } + // Find the part of the input that is actually new + var same = 0, l = Math.min(prevInput.length, text.length); + while (same < l && prevInput.charCodeAt(same) == text.charCodeAt(same)) ++same; + + var self = this; + runInOp(cm, function() { + applyTextInput(cm, text.slice(same), prevInput.length - same, + null, self.composing ? "*compose" : null); + + // Don't leave long text in the textarea, since it makes further polling slow + if (text.length > 1000 || text.indexOf("\n") > -1) input.value = self.prevInput = ""; + else self.prevInput = text; + + if (self.composing) { + self.composing.range.clear(); + self.composing.range = cm.markText(self.composing.start, cm.getCursor("to"), + {className: "CodeMirror-composing"}); + } + }); + return true; + }, + + ensurePolled: function() { + if (this.pollingFast && this.poll()) this.pollingFast = false; + }, + + onKeyPress: function() { + if (ie && ie_version >= 9) this.hasSelection = null; + this.fastPoll(); + }, + + onContextMenu: function(e) { + var input = this, cm = input.cm, display = cm.display, te = input.textarea; + var pos = posFromMouse(cm, e), scrollPos = display.scroller.scrollTop; + if (!pos || presto) return; // Opera is difficult. + + // Reset the current text selection only if the click is done outside of the selection + // and 'resetSelectionOnContextMenu' option is true. + var reset = cm.options.resetSelectionOnContextMenu; + if (reset && cm.doc.sel.contains(pos) == -1) + operation(cm, setSelection)(cm.doc, simpleSelection(pos), sel_dontScroll); + + var oldCSS = te.style.cssText, oldWrapperCSS = input.wrapper.style.cssText; + input.wrapper.style.cssText = "position: absolute" + var wrapperBox = input.wrapper.getBoundingClientRect() + te.style.cssText = "position: absolute; width: 30px; height: 30px; top: " + (e.clientY - wrapperBox.top - 5) + + "px; left: " + (e.clientX - wrapperBox.left - 5) + "px; z-index: 1000; background: " + + (ie ? "rgba(255, 255, 255, .05)" : "transparent") + + "; outline: none; border-width: 0; outline: none; overflow: hidden; opacity: .05; filter: alpha(opacity=5);"; + if (webkit) var oldScrollY = window.scrollY; // Work around Chrome issue (#2712) + display.input.focus(); + if (webkit) window.scrollTo(null, oldScrollY); + display.input.reset(); + // Adds "Select all" to context menu in FF + if (!cm.somethingSelected()) te.value = input.prevInput = " "; + input.contextMenuPending = true; + display.selForContextMenu = cm.doc.sel; + clearTimeout(display.detectingSelectAll); + + // Select-all will be greyed out if there's nothing to select, so + // this adds a zero-width space so that we can later check whether + // it got selected. + function prepareSelectAllHack() { + if (te.selectionStart != null) { + var selected = cm.somethingSelected(); + var extval = "\u200b" + (selected ? te.value : ""); + te.value = "\u21da"; // Used to catch context-menu undo + te.value = extval; + input.prevInput = selected ? "" : "\u200b"; + te.selectionStart = 1; te.selectionEnd = extval.length; + // Re-set this, in case some other handler touched the + // selection in the meantime. + display.selForContextMenu = cm.doc.sel; + } + } + function rehide() { + input.contextMenuPending = false; + input.wrapper.style.cssText = oldWrapperCSS + te.style.cssText = oldCSS; + if (ie && ie_version < 9) display.scrollbars.setScrollTop(display.scroller.scrollTop = scrollPos); + + // Try to detect the user choosing select-all + if (te.selectionStart != null) { + if (!ie || (ie && ie_version < 9)) prepareSelectAllHack(); + var i = 0, poll = function() { + if (display.selForContextMenu == cm.doc.sel && te.selectionStart == 0 && + te.selectionEnd > 0 && input.prevInput == "\u200b") + operation(cm, commands.selectAll)(cm); + else if (i++ < 10) display.detectingSelectAll = setTimeout(poll, 500); + else display.input.reset(); + }; + display.detectingSelectAll = setTimeout(poll, 200); + } + } + + if (ie && ie_version >= 9) prepareSelectAllHack(); + if (captureRightClick) { + e_stop(e); + var mouseup = function() { + off(window, "mouseup", mouseup); + setTimeout(rehide, 20); + }; + on(window, "mouseup", mouseup); + } else { + setTimeout(rehide, 50); + } + }, + + readOnlyChanged: function(val) { + if (!val) this.reset(); + }, + + setUneditable: nothing, + + needsContentAttribute: false + }, TextareaInput.prototype); + + // CONTENTEDITABLE INPUT STYLE + + function ContentEditableInput(cm) { + this.cm = cm; + this.lastAnchorNode = this.lastAnchorOffset = this.lastFocusNode = this.lastFocusOffset = null; + this.polling = new Delayed(); + this.gracePeriod = false; + } + + ContentEditableInput.prototype = copyObj({ + init: function(display) { + var input = this, cm = input.cm; + var div = input.div = display.lineDiv; + disableBrowserMagic(div); + + on(div, "paste", function(e) { + if (!signalDOMEvent(cm, e)) handlePaste(e, cm); + }) + + on(div, "compositionstart", function(e) { + var data = e.data; + input.composing = {sel: cm.doc.sel, data: data, startData: data}; + if (!data) return; + var prim = cm.doc.sel.primary(); + var line = cm.getLine(prim.head.line); + var found = line.indexOf(data, Math.max(0, prim.head.ch - data.length)); + if (found > -1 && found <= prim.head.ch) + input.composing.sel = simpleSelection(Pos(prim.head.line, found), + Pos(prim.head.line, found + data.length)); + }); + on(div, "compositionupdate", function(e) { + input.composing.data = e.data; + }); + on(div, "compositionend", function(e) { + var ours = input.composing; + if (!ours) return; + if (e.data != ours.startData && !/\u200b/.test(e.data)) + ours.data = e.data; + // Need a small delay to prevent other code (input event, + // selection polling) from doing damage when fired right after + // compositionend. + setTimeout(function() { + if (!ours.handled) + input.applyComposition(ours); + if (input.composing == ours) + input.composing = null; + }, 50); + }); + + on(div, "touchstart", function() { + input.forceCompositionEnd(); + }); + + on(div, "input", function() { + if (input.composing) return; + if (cm.isReadOnly() || !input.pollContent()) + runInOp(input.cm, function() {regChange(cm);}); + }); + + function onCopyCut(e) { + if (signalDOMEvent(cm, e)) return + if (cm.somethingSelected()) { + lastCopied = {lineWise: false, text: cm.getSelections()}; + if (e.type == "cut") cm.replaceSelection("", null, "cut"); + } else if (!cm.options.lineWiseCopyCut) { + return; + } else { + var ranges = copyableRanges(cm); + lastCopied = {lineWise: true, text: ranges.text}; + if (e.type == "cut") { + cm.operation(function() { + cm.setSelections(ranges.ranges, 0, sel_dontScroll); + cm.replaceSelection("", null, "cut"); + }); + } + } + // iOS exposes the clipboard API, but seems to discard content inserted into it + if (e.clipboardData && !ios) { + e.preventDefault(); + e.clipboardData.clearData(); + e.clipboardData.setData("text/plain", lastCopied.text.join("\n")); + } else { + // Old-fashioned briefly-focus-a-textarea hack + var kludge = hiddenTextarea(), te = kludge.firstChild; + cm.display.lineSpace.insertBefore(kludge, cm.display.lineSpace.firstChild); + te.value = lastCopied.text.join("\n"); + var hadFocus = document.activeElement; + selectInput(te); + setTimeout(function() { + cm.display.lineSpace.removeChild(kludge); + hadFocus.focus(); + }, 50); + } + } + on(div, "copy", onCopyCut); + on(div, "cut", onCopyCut); + }, + + prepareSelection: function() { + var result = prepareSelection(this.cm, false); + result.focus = this.cm.state.focused; + return result; + }, + + showSelection: function(info, takeFocus) { + if (!info || !this.cm.display.view.length) return; + if (info.focus || takeFocus) this.showPrimarySelection(); + this.showMultipleSelections(info); + }, + + showPrimarySelection: function() { + var sel = window.getSelection(), prim = this.cm.doc.sel.primary(); + var curAnchor = domToPos(this.cm, sel.anchorNode, sel.anchorOffset); + var curFocus = domToPos(this.cm, sel.focusNode, sel.focusOffset); + if (curAnchor && !curAnchor.bad && curFocus && !curFocus.bad && + cmp(minPos(curAnchor, curFocus), prim.from()) == 0 && + cmp(maxPos(curAnchor, curFocus), prim.to()) == 0) + return; + + var start = posToDOM(this.cm, prim.from()); + var end = posToDOM(this.cm, prim.to()); + if (!start && !end) return; + + var view = this.cm.display.view; + var old = sel.rangeCount && sel.getRangeAt(0); + if (!start) { + start = {node: view[0].measure.map[2], offset: 0}; + } else if (!end) { // FIXME dangerously hacky + var measure = view[view.length - 1].measure; + var map = measure.maps ? measure.maps[measure.maps.length - 1] : measure.map; + end = {node: map[map.length - 1], offset: map[map.length - 2] - map[map.length - 3]}; + } + + try { var rng = range(start.node, start.offset, end.offset, end.node); } + catch(e) {} // Our model of the DOM might be outdated, in which case the range we try to set can be impossible + if (rng) { + if (!gecko && this.cm.state.focused) { + sel.collapse(start.node, start.offset); + if (!rng.collapsed) sel.addRange(rng); + } else { + sel.removeAllRanges(); + sel.addRange(rng); + } + if (old && sel.anchorNode == null) sel.addRange(old); + else if (gecko) this.startGracePeriod(); + } + this.rememberSelection(); + }, + + startGracePeriod: function() { + var input = this; + clearTimeout(this.gracePeriod); + this.gracePeriod = setTimeout(function() { + input.gracePeriod = false; + if (input.selectionChanged()) + input.cm.operation(function() { input.cm.curOp.selectionChanged = true; }); + }, 20); + }, + + showMultipleSelections: function(info) { + removeChildrenAndAdd(this.cm.display.cursorDiv, info.cursors); + removeChildrenAndAdd(this.cm.display.selectionDiv, info.selection); + }, + + rememberSelection: function() { + var sel = window.getSelection(); + this.lastAnchorNode = sel.anchorNode; this.lastAnchorOffset = sel.anchorOffset; + this.lastFocusNode = sel.focusNode; this.lastFocusOffset = sel.focusOffset; + }, + + selectionInEditor: function() { + var sel = window.getSelection(); + if (!sel.rangeCount) return false; + var node = sel.getRangeAt(0).commonAncestorContainer; + return contains(this.div, node); + }, + + focus: function() { + if (this.cm.options.readOnly != "nocursor") this.div.focus(); + }, + blur: function() { this.div.blur(); }, + getField: function() { return this.div; }, + + supportsTouch: function() { return true; }, + + receivedFocus: function() { + var input = this; + if (this.selectionInEditor()) + this.pollSelection(); + else + runInOp(this.cm, function() { input.cm.curOp.selectionChanged = true; }); + + function poll() { + if (input.cm.state.focused) { + input.pollSelection(); + input.polling.set(input.cm.options.pollInterval, poll); + } + } + this.polling.set(this.cm.options.pollInterval, poll); + }, + + selectionChanged: function() { + var sel = window.getSelection(); + return sel.anchorNode != this.lastAnchorNode || sel.anchorOffset != this.lastAnchorOffset || + sel.focusNode != this.lastFocusNode || sel.focusOffset != this.lastFocusOffset; + }, + + pollSelection: function() { + if (!this.composing && !this.gracePeriod && this.selectionChanged()) { + var sel = window.getSelection(), cm = this.cm; + this.rememberSelection(); + var anchor = domToPos(cm, sel.anchorNode, sel.anchorOffset); + var head = domToPos(cm, sel.focusNode, sel.focusOffset); + if (anchor && head) runInOp(cm, function() { + setSelection(cm.doc, simpleSelection(anchor, head), sel_dontScroll); + if (anchor.bad || head.bad) cm.curOp.selectionChanged = true; + }); + } + }, + + pollContent: function() { + var cm = this.cm, display = cm.display, sel = cm.doc.sel.primary(); + var from = sel.from(), to = sel.to(); + if (from.line < display.viewFrom || to.line > display.viewTo - 1) return false; + + var fromIndex; + if (from.line == display.viewFrom || (fromIndex = findViewIndex(cm, from.line)) == 0) { + var fromLine = lineNo(display.view[0].line); + var fromNode = display.view[0].node; + } else { + var fromLine = lineNo(display.view[fromIndex].line); + var fromNode = display.view[fromIndex - 1].node.nextSibling; + } + var toIndex = findViewIndex(cm, to.line); + if (toIndex == display.view.length - 1) { + var toLine = display.viewTo - 1; + var toNode = display.lineDiv.lastChild; + } else { + var toLine = lineNo(display.view[toIndex + 1].line) - 1; + var toNode = display.view[toIndex + 1].node.previousSibling; + } + + var newText = cm.doc.splitLines(domTextBetween(cm, fromNode, toNode, fromLine, toLine)); + var oldText = getBetween(cm.doc, Pos(fromLine, 0), Pos(toLine, getLine(cm.doc, toLine).text.length)); + while (newText.length > 1 && oldText.length > 1) { + if (lst(newText) == lst(oldText)) { newText.pop(); oldText.pop(); toLine--; } + else if (newText[0] == oldText[0]) { newText.shift(); oldText.shift(); fromLine++; } + else break; + } + + var cutFront = 0, cutEnd = 0; + var newTop = newText[0], oldTop = oldText[0], maxCutFront = Math.min(newTop.length, oldTop.length); + while (cutFront < maxCutFront && newTop.charCodeAt(cutFront) == oldTop.charCodeAt(cutFront)) + ++cutFront; + var newBot = lst(newText), oldBot = lst(oldText); + var maxCutEnd = Math.min(newBot.length - (newText.length == 1 ? cutFront : 0), + oldBot.length - (oldText.length == 1 ? cutFront : 0)); + while (cutEnd < maxCutEnd && + newBot.charCodeAt(newBot.length - cutEnd - 1) == oldBot.charCodeAt(oldBot.length - cutEnd - 1)) + ++cutEnd; + + newText[newText.length - 1] = newBot.slice(0, newBot.length - cutEnd); + newText[0] = newText[0].slice(cutFront); + + var chFrom = Pos(fromLine, cutFront); + var chTo = Pos(toLine, oldText.length ? lst(oldText).length - cutEnd : 0); + if (newText.length > 1 || newText[0] || cmp(chFrom, chTo)) { + replaceRange(cm.doc, newText, chFrom, chTo, "+input"); + return true; + } + }, + + ensurePolled: function() { + this.forceCompositionEnd(); + }, + reset: function() { + this.forceCompositionEnd(); + }, + forceCompositionEnd: function() { + if (!this.composing || this.composing.handled) return; + this.applyComposition(this.composing); + this.composing.handled = true; + this.div.blur(); + this.div.focus(); + }, + applyComposition: function(composing) { + if (this.cm.isReadOnly()) + operation(this.cm, regChange)(this.cm) + else if (composing.data && composing.data != composing.startData) + operation(this.cm, applyTextInput)(this.cm, composing.data, 0, composing.sel); + }, + + setUneditable: function(node) { + node.contentEditable = "false" + }, + + onKeyPress: function(e) { + e.preventDefault(); + if (!this.cm.isReadOnly()) + operation(this.cm, applyTextInput)(this.cm, String.fromCharCode(e.charCode == null ? e.keyCode : e.charCode), 0); + }, + + readOnlyChanged: function(val) { + this.div.contentEditable = String(val != "nocursor") + }, + + onContextMenu: nothing, + resetPosition: nothing, + + needsContentAttribute: true + }, ContentEditableInput.prototype); + + function posToDOM(cm, pos) { + var view = findViewForLine(cm, pos.line); + if (!view || view.hidden) return null; + var line = getLine(cm.doc, pos.line); + var info = mapFromLineView(view, line, pos.line); + + var order = getOrder(line), side = "left"; + if (order) { + var partPos = getBidiPartAt(order, pos.ch); + side = partPos % 2 ? "right" : "left"; + } + var result = nodeAndOffsetInLineMap(info.map, pos.ch, side); + result.offset = result.collapse == "right" ? result.end : result.start; + return result; + } + + function badPos(pos, bad) { if (bad) pos.bad = true; return pos; } + + function domToPos(cm, node, offset) { + var lineNode; + if (node == cm.display.lineDiv) { + lineNode = cm.display.lineDiv.childNodes[offset]; + if (!lineNode) return badPos(cm.clipPos(Pos(cm.display.viewTo - 1)), true); + node = null; offset = 0; + } else { + for (lineNode = node;; lineNode = lineNode.parentNode) { + if (!lineNode || lineNode == cm.display.lineDiv) return null; + if (lineNode.parentNode && lineNode.parentNode == cm.display.lineDiv) break; + } + } + for (var i = 0; i < cm.display.view.length; i++) { + var lineView = cm.display.view[i]; + if (lineView.node == lineNode) + return locateNodeInLineView(lineView, node, offset); + } + } + + function locateNodeInLineView(lineView, node, offset) { + var wrapper = lineView.text.firstChild, bad = false; + if (!node || !contains(wrapper, node)) return badPos(Pos(lineNo(lineView.line), 0), true); + if (node == wrapper) { + bad = true; + node = wrapper.childNodes[offset]; + offset = 0; + if (!node) { + var line = lineView.rest ? lst(lineView.rest) : lineView.line; + return badPos(Pos(lineNo(line), line.text.length), bad); + } + } + + var textNode = node.nodeType == 3 ? node : null, topNode = node; + if (!textNode && node.childNodes.length == 1 && node.firstChild.nodeType == 3) { + textNode = node.firstChild; + if (offset) offset = textNode.nodeValue.length; + } + while (topNode.parentNode != wrapper) topNode = topNode.parentNode; + var measure = lineView.measure, maps = measure.maps; + + function find(textNode, topNode, offset) { + for (var i = -1; i < (maps ? maps.length : 0); i++) { + var map = i < 0 ? measure.map : maps[i]; + for (var j = 0; j < map.length; j += 3) { + var curNode = map[j + 2]; + if (curNode == textNode || curNode == topNode) { + var line = lineNo(i < 0 ? lineView.line : lineView.rest[i]); + var ch = map[j] + offset; + if (offset < 0 || curNode != textNode) ch = map[j + (offset ? 1 : 0)]; + return Pos(line, ch); + } + } + } + } + var found = find(textNode, topNode, offset); + if (found) return badPos(found, bad); + + // FIXME this is all really shaky. might handle the few cases it needs to handle, but likely to cause problems + for (var after = topNode.nextSibling, dist = textNode ? textNode.nodeValue.length - offset : 0; after; after = after.nextSibling) { + found = find(after, after.firstChild, 0); + if (found) + return badPos(Pos(found.line, found.ch - dist), bad); + else + dist += after.textContent.length; + } + for (var before = topNode.previousSibling, dist = offset; before; before = before.previousSibling) { + found = find(before, before.firstChild, -1); + if (found) + return badPos(Pos(found.line, found.ch + dist), bad); + else + dist += after.textContent.length; + } + } + + function domTextBetween(cm, from, to, fromLine, toLine) { + var text = "", closing = false, lineSep = cm.doc.lineSeparator(); + function recognizeMarker(id) { return function(marker) { return marker.id == id; }; } + function walk(node) { + if (node.nodeType == 1) { + var cmText = node.getAttribute("cm-text"); + if (cmText != null) { + if (cmText == "") cmText = node.textContent.replace(/\u200b/g, ""); + text += cmText; + return; + } + var markerID = node.getAttribute("cm-marker"), range; + if (markerID) { + var found = cm.findMarks(Pos(fromLine, 0), Pos(toLine + 1, 0), recognizeMarker(+markerID)); + if (found.length && (range = found[0].find())) + text += getBetween(cm.doc, range.from, range.to).join(lineSep); + return; + } + if (node.getAttribute("contenteditable") == "false") return; + for (var i = 0; i < node.childNodes.length; i++) + walk(node.childNodes[i]); + if (/^(pre|div|p)$/i.test(node.nodeName)) + closing = true; + } else if (node.nodeType == 3) { + var val = node.nodeValue; + if (!val) return; + if (closing) { + text += lineSep; + closing = false; + } + text += val; + } + } + for (;;) { + walk(from); + if (from == to) break; + from = from.nextSibling; + } + return text; + } + + CodeMirror.inputStyles = {"textarea": TextareaInput, "contenteditable": ContentEditableInput}; + + // SELECTION / CURSOR + + // Selection objects are immutable. A new one is created every time + // the selection changes. A selection is one or more non-overlapping + // (and non-touching) ranges, sorted, and an integer that indicates + // which one is the primary selection (the one that's scrolled into + // view, that getCursor returns, etc). + function Selection(ranges, primIndex) { + this.ranges = ranges; + this.primIndex = primIndex; + } + + Selection.prototype = { + primary: function() { return this.ranges[this.primIndex]; }, + equals: function(other) { + if (other == this) return true; + if (other.primIndex != this.primIndex || other.ranges.length != this.ranges.length) return false; + for (var i = 0; i < this.ranges.length; i++) { + var here = this.ranges[i], there = other.ranges[i]; + if (cmp(here.anchor, there.anchor) != 0 || cmp(here.head, there.head) != 0) return false; + } + return true; + }, + deepCopy: function() { + for (var out = [], i = 0; i < this.ranges.length; i++) + out[i] = new Range(copyPos(this.ranges[i].anchor), copyPos(this.ranges[i].head)); + return new Selection(out, this.primIndex); + }, + somethingSelected: function() { + for (var i = 0; i < this.ranges.length; i++) + if (!this.ranges[i].empty()) return true; + return false; + }, + contains: function(pos, end) { + if (!end) end = pos; + for (var i = 0; i < this.ranges.length; i++) { + var range = this.ranges[i]; + if (cmp(end, range.from()) >= 0 && cmp(pos, range.to()) <= 0) + return i; + } + return -1; + } + }; + + function Range(anchor, head) { + this.anchor = anchor; this.head = head; + } + + Range.prototype = { + from: function() { return minPos(this.anchor, this.head); }, + to: function() { return maxPos(this.anchor, this.head); }, + empty: function() { + return this.head.line == this.anchor.line && this.head.ch == this.anchor.ch; + } + }; + + // Take an unsorted, potentially overlapping set of ranges, and + // build a selection out of it. 'Consumes' ranges array (modifying + // it). + function normalizeSelection(ranges, primIndex) { + var prim = ranges[primIndex]; + ranges.sort(function(a, b) { return cmp(a.from(), b.from()); }); + primIndex = indexOf(ranges, prim); + for (var i = 1; i < ranges.length; i++) { + var cur = ranges[i], prev = ranges[i - 1]; + if (cmp(prev.to(), cur.from()) >= 0) { + var from = minPos(prev.from(), cur.from()), to = maxPos(prev.to(), cur.to()); + var inv = prev.empty() ? cur.from() == cur.head : prev.from() == prev.head; + if (i <= primIndex) --primIndex; + ranges.splice(--i, 2, new Range(inv ? to : from, inv ? from : to)); + } + } + return new Selection(ranges, primIndex); + } + + function simpleSelection(anchor, head) { + return new Selection([new Range(anchor, head || anchor)], 0); + } + + // Most of the external API clips given positions to make sure they + // actually exist within the document. + function clipLine(doc, n) {return Math.max(doc.first, Math.min(n, doc.first + doc.size - 1));} + function clipPos(doc, pos) { + if (pos.line < doc.first) return Pos(doc.first, 0); + var last = doc.first + doc.size - 1; + if (pos.line > last) return Pos(last, getLine(doc, last).text.length); + return clipToLen(pos, getLine(doc, pos.line).text.length); + } + function clipToLen(pos, linelen) { + var ch = pos.ch; + if (ch == null || ch > linelen) return Pos(pos.line, linelen); + else if (ch < 0) return Pos(pos.line, 0); + else return pos; + } + function isLine(doc, l) {return l >= doc.first && l < doc.first + doc.size;} + function clipPosArray(doc, array) { + for (var out = [], i = 0; i < array.length; i++) out[i] = clipPos(doc, array[i]); + return out; + } + + // SELECTION UPDATES + + // The 'scroll' parameter given to many of these indicated whether + // the new cursor position should be scrolled into view after + // modifying the selection. + + // If shift is held or the extend flag is set, extends a range to + // include a given position (and optionally a second position). + // Otherwise, simply returns the range between the given positions. + // Used for cursor motion and such. + function extendRange(doc, range, head, other) { + if (doc.cm && doc.cm.display.shift || doc.extend) { + var anchor = range.anchor; + if (other) { + var posBefore = cmp(head, anchor) < 0; + if (posBefore != (cmp(other, anchor) < 0)) { + anchor = head; + head = other; + } else if (posBefore != (cmp(head, other) < 0)) { + head = other; + } + } + return new Range(anchor, head); + } else { + return new Range(other || head, head); + } + } + + // Extend the primary selection range, discard the rest. + function extendSelection(doc, head, other, options) { + setSelection(doc, new Selection([extendRange(doc, doc.sel.primary(), head, other)], 0), options); + } + + // Extend all selections (pos is an array of selections with length + // equal the number of selections) + function extendSelections(doc, heads, options) { + for (var out = [], i = 0; i < doc.sel.ranges.length; i++) + out[i] = extendRange(doc, doc.sel.ranges[i], heads[i], null); + var newSel = normalizeSelection(out, doc.sel.primIndex); + setSelection(doc, newSel, options); + } + + // Updates a single range in the selection. + function replaceOneSelection(doc, i, range, options) { + var ranges = doc.sel.ranges.slice(0); + ranges[i] = range; + setSelection(doc, normalizeSelection(ranges, doc.sel.primIndex), options); + } + + // Reset the selection to a single range. + function setSimpleSelection(doc, anchor, head, options) { + setSelection(doc, simpleSelection(anchor, head), options); + } + + // Give beforeSelectionChange handlers a change to influence a + // selection update. + function filterSelectionChange(doc, sel, options) { + var obj = { + ranges: sel.ranges, + update: function(ranges) { + this.ranges = []; + for (var i = 0; i < ranges.length; i++) + this.ranges[i] = new Range(clipPos(doc, ranges[i].anchor), + clipPos(doc, ranges[i].head)); + }, + origin: options && options.origin + }; + signal(doc, "beforeSelectionChange", doc, obj); + if (doc.cm) signal(doc.cm, "beforeSelectionChange", doc.cm, obj); + if (obj.ranges != sel.ranges) return normalizeSelection(obj.ranges, obj.ranges.length - 1); + else return sel; + } + + function setSelectionReplaceHistory(doc, sel, options) { + var done = doc.history.done, last = lst(done); + if (last && last.ranges) { + done[done.length - 1] = sel; + setSelectionNoUndo(doc, sel, options); + } else { + setSelection(doc, sel, options); + } + } + + // Set a new selection. + function setSelection(doc, sel, options) { + setSelectionNoUndo(doc, sel, options); + addSelectionToHistory(doc, doc.sel, doc.cm ? doc.cm.curOp.id : NaN, options); + } + + function setSelectionNoUndo(doc, sel, options) { + if (hasHandler(doc, "beforeSelectionChange") || doc.cm && hasHandler(doc.cm, "beforeSelectionChange")) + sel = filterSelectionChange(doc, sel, options); + + var bias = options && options.bias || + (cmp(sel.primary().head, doc.sel.primary().head) < 0 ? -1 : 1); + setSelectionInner(doc, skipAtomicInSelection(doc, sel, bias, true)); + + if (!(options && options.scroll === false) && doc.cm) + ensureCursorVisible(doc.cm); + } + + function setSelectionInner(doc, sel) { + if (sel.equals(doc.sel)) return; + + doc.sel = sel; + + if (doc.cm) { + doc.cm.curOp.updateInput = doc.cm.curOp.selectionChanged = true; + signalCursorActivity(doc.cm); + } + signalLater(doc, "cursorActivity", doc); + } + + // Verify that the selection does not partially select any atomic + // marked ranges. + function reCheckSelection(doc) { + setSelectionInner(doc, skipAtomicInSelection(doc, doc.sel, null, false), sel_dontScroll); + } + + // Return a selection that does not partially select any atomic + // ranges. + function skipAtomicInSelection(doc, sel, bias, mayClear) { + var out; + for (var i = 0; i < sel.ranges.length; i++) { + var range = sel.ranges[i]; + var old = sel.ranges.length == doc.sel.ranges.length && doc.sel.ranges[i]; + var newAnchor = skipAtomic(doc, range.anchor, old && old.anchor, bias, mayClear); + var newHead = skipAtomic(doc, range.head, old && old.head, bias, mayClear); + if (out || newAnchor != range.anchor || newHead != range.head) { + if (!out) out = sel.ranges.slice(0, i); + out[i] = new Range(newAnchor, newHead); + } + } + return out ? normalizeSelection(out, sel.primIndex) : sel; + } + + function skipAtomicInner(doc, pos, oldPos, dir, mayClear) { + var line = getLine(doc, pos.line); + if (line.markedSpans) for (var i = 0; i < line.markedSpans.length; ++i) { + var sp = line.markedSpans[i], m = sp.marker; + if ((sp.from == null || (m.inclusiveLeft ? sp.from <= pos.ch : sp.from < pos.ch)) && + (sp.to == null || (m.inclusiveRight ? sp.to >= pos.ch : sp.to > pos.ch))) { + if (mayClear) { + signal(m, "beforeCursorEnter"); + if (m.explicitlyCleared) { + if (!line.markedSpans) break; + else {--i; continue;} + } + } + if (!m.atomic) continue; + + if (oldPos) { + var near = m.find(dir < 0 ? 1 : -1), diff; + if (dir < 0 ? m.inclusiveRight : m.inclusiveLeft) + near = movePos(doc, near, -dir, near && near.line == pos.line ? line : null); + if (near && near.line == pos.line && (diff = cmp(near, oldPos)) && (dir < 0 ? diff < 0 : diff > 0)) + return skipAtomicInner(doc, near, pos, dir, mayClear); + } + + var far = m.find(dir < 0 ? -1 : 1); + if (dir < 0 ? m.inclusiveLeft : m.inclusiveRight) + far = movePos(doc, far, dir, far.line == pos.line ? line : null); + return far ? skipAtomicInner(doc, far, pos, dir, mayClear) : null; + } + } + return pos; + } + + // Ensure a given position is not inside an atomic range. + function skipAtomic(doc, pos, oldPos, bias, mayClear) { + var dir = bias || 1; + var found = skipAtomicInner(doc, pos, oldPos, dir, mayClear) || + (!mayClear && skipAtomicInner(doc, pos, oldPos, dir, true)) || + skipAtomicInner(doc, pos, oldPos, -dir, mayClear) || + (!mayClear && skipAtomicInner(doc, pos, oldPos, -dir, true)); + if (!found) { + doc.cantEdit = true; + return Pos(doc.first, 0); + } + return found; + } + + function movePos(doc, pos, dir, line) { + if (dir < 0 && pos.ch == 0) { + if (pos.line > doc.first) return clipPos(doc, Pos(pos.line - 1)); + else return null; + } else if (dir > 0 && pos.ch == (line || getLine(doc, pos.line)).text.length) { + if (pos.line < doc.first + doc.size - 1) return Pos(pos.line + 1, 0); + else return null; + } else { + return new Pos(pos.line, pos.ch + dir); + } + } + + // SELECTION DRAWING + + function updateSelection(cm) { + cm.display.input.showSelection(cm.display.input.prepareSelection()); + } + + function prepareSelection(cm, primary) { + var doc = cm.doc, result = {}; + var curFragment = result.cursors = document.createDocumentFragment(); + var selFragment = result.selection = document.createDocumentFragment(); + + for (var i = 0; i < doc.sel.ranges.length; i++) { + if (primary === false && i == doc.sel.primIndex) continue; + var range = doc.sel.ranges[i]; + if (range.from().line >= cm.display.viewTo || range.to().line < cm.display.viewFrom) continue; + var collapsed = range.empty(); + if (collapsed || cm.options.showCursorWhenSelecting) + drawSelectionCursor(cm, range.head, curFragment); + if (!collapsed) + drawSelectionRange(cm, range, selFragment); + } + return result; + } + + // Draws a cursor for the given range + function drawSelectionCursor(cm, head, output) { + var pos = cursorCoords(cm, head, "div", null, null, !cm.options.singleCursorHeightPerLine); + + var cursor = output.appendChild(elt("div", "\u00a0", "CodeMirror-cursor")); + cursor.style.left = pos.left + "px"; + cursor.style.top = pos.top + "px"; + cursor.style.height = Math.max(0, pos.bottom - pos.top) * cm.options.cursorHeight + "px"; + + if (pos.other) { + // Secondary cursor, shown when on a 'jump' in bi-directional text + var otherCursor = output.appendChild(elt("div", "\u00a0", "CodeMirror-cursor CodeMirror-secondarycursor")); + otherCursor.style.display = ""; + otherCursor.style.left = pos.other.left + "px"; + otherCursor.style.top = pos.other.top + "px"; + otherCursor.style.height = (pos.other.bottom - pos.other.top) * .85 + "px"; + } + } + + // Draws the given range as a highlighted selection + function drawSelectionRange(cm, range, output) { + var display = cm.display, doc = cm.doc; + var fragment = document.createDocumentFragment(); + var padding = paddingH(cm.display), leftSide = padding.left; + var rightSide = Math.max(display.sizerWidth, displayWidth(cm) - display.sizer.offsetLeft) - padding.right; + + function add(left, top, width, bottom) { + if (top < 0) top = 0; + top = Math.round(top); + bottom = Math.round(bottom); + fragment.appendChild(elt("div", null, "CodeMirror-selected", "position: absolute; left: " + left + + "px; top: " + top + "px; width: " + (width == null ? rightSide - left : width) + + "px; height: " + (bottom - top) + "px")); + } + + function drawForLine(line, fromArg, toArg) { + var lineObj = getLine(doc, line); + var lineLen = lineObj.text.length; + var start, end; + function coords(ch, bias) { + return charCoords(cm, Pos(line, ch), "div", lineObj, bias); + } + + iterateBidiSections(getOrder(lineObj), fromArg || 0, toArg == null ? lineLen : toArg, function(from, to, dir) { + var leftPos = coords(from, "left"), rightPos, left, right; + if (from == to) { + rightPos = leftPos; + left = right = leftPos.left; + } else { + rightPos = coords(to - 1, "right"); + if (dir == "rtl") { var tmp = leftPos; leftPos = rightPos; rightPos = tmp; } + left = leftPos.left; + right = rightPos.right; + } + if (fromArg == null && from == 0) left = leftSide; + if (rightPos.top - leftPos.top > 3) { // Different lines, draw top part + add(left, leftPos.top, null, leftPos.bottom); + left = leftSide; + if (leftPos.bottom < rightPos.top) add(left, leftPos.bottom, null, rightPos.top); + } + if (toArg == null && to == lineLen) right = rightSide; + if (!start || leftPos.top < start.top || leftPos.top == start.top && leftPos.left < start.left) + start = leftPos; + if (!end || rightPos.bottom > end.bottom || rightPos.bottom == end.bottom && rightPos.right > end.right) + end = rightPos; + if (left < leftSide + 1) left = leftSide; + add(left, rightPos.top, right - left, rightPos.bottom); + }); + return {start: start, end: end}; + } + + var sFrom = range.from(), sTo = range.to(); + if (sFrom.line == sTo.line) { + drawForLine(sFrom.line, sFrom.ch, sTo.ch); + } else { + var fromLine = getLine(doc, sFrom.line), toLine = getLine(doc, sTo.line); + var singleVLine = visualLine(fromLine) == visualLine(toLine); + var leftEnd = drawForLine(sFrom.line, sFrom.ch, singleVLine ? fromLine.text.length + 1 : null).end; + var rightStart = drawForLine(sTo.line, singleVLine ? 0 : null, sTo.ch).start; + if (singleVLine) { + if (leftEnd.top < rightStart.top - 2) { + add(leftEnd.right, leftEnd.top, null, leftEnd.bottom); + add(leftSide, rightStart.top, rightStart.left, rightStart.bottom); + } else { + add(leftEnd.right, leftEnd.top, rightStart.left - leftEnd.right, leftEnd.bottom); + } + } + if (leftEnd.bottom < rightStart.top) + add(leftSide, leftEnd.bottom, null, rightStart.top); + } + + output.appendChild(fragment); + } + + // Cursor-blinking + function restartBlink(cm) { + if (!cm.state.focused) return; + var display = cm.display; + clearInterval(display.blinker); + var on = true; + display.cursorDiv.style.visibility = ""; + if (cm.options.cursorBlinkRate > 0) + display.blinker = setInterval(function() { + display.cursorDiv.style.visibility = (on = !on) ? "" : "hidden"; + }, cm.options.cursorBlinkRate); + else if (cm.options.cursorBlinkRate < 0) + display.cursorDiv.style.visibility = "hidden"; + } + + // HIGHLIGHT WORKER + + function startWorker(cm, time) { + if (cm.doc.mode.startState && cm.doc.frontier < cm.display.viewTo) + cm.state.highlight.set(time, bind(highlightWorker, cm)); + } + + function highlightWorker(cm) { + var doc = cm.doc; + if (doc.frontier < doc.first) doc.frontier = doc.first; + if (doc.frontier >= cm.display.viewTo) return; + var end = +new Date + cm.options.workTime; + var state = copyState(doc.mode, getStateBefore(cm, doc.frontier)); + var changedLines = []; + + doc.iter(doc.frontier, Math.min(doc.first + doc.size, cm.display.viewTo + 500), function(line) { + if (doc.frontier >= cm.display.viewFrom) { // Visible + var oldStyles = line.styles, tooLong = line.text.length > cm.options.maxHighlightLength; + var highlighted = highlightLine(cm, line, tooLong ? copyState(doc.mode, state) : state, true); + line.styles = highlighted.styles; + var oldCls = line.styleClasses, newCls = highlighted.classes; + if (newCls) line.styleClasses = newCls; + else if (oldCls) line.styleClasses = null; + var ischange = !oldStyles || oldStyles.length != line.styles.length || + oldCls != newCls && (!oldCls || !newCls || oldCls.bgClass != newCls.bgClass || oldCls.textClass != newCls.textClass); + for (var i = 0; !ischange && i < oldStyles.length; ++i) ischange = oldStyles[i] != line.styles[i]; + if (ischange) changedLines.push(doc.frontier); + line.stateAfter = tooLong ? state : copyState(doc.mode, state); + } else { + if (line.text.length <= cm.options.maxHighlightLength) + processLine(cm, line.text, state); + line.stateAfter = doc.frontier % 5 == 0 ? copyState(doc.mode, state) : null; + } + ++doc.frontier; + if (+new Date > end) { + startWorker(cm, cm.options.workDelay); + return true; + } + }); + if (changedLines.length) runInOp(cm, function() { + for (var i = 0; i < changedLines.length; i++) + regLineChange(cm, changedLines[i], "text"); + }); + } + + // Finds the line to start with when starting a parse. Tries to + // find a line with a stateAfter, so that it can start with a + // valid state. If that fails, it returns the line with the + // smallest indentation, which tends to need the least context to + // parse correctly. + function findStartLine(cm, n, precise) { + var minindent, minline, doc = cm.doc; + var lim = precise ? -1 : n - (cm.doc.mode.innerMode ? 1000 : 100); + for (var search = n; search > lim; --search) { + if (search <= doc.first) return doc.first; + var line = getLine(doc, search - 1); + if (line.stateAfter && (!precise || search <= doc.frontier)) return search; + var indented = countColumn(line.text, null, cm.options.tabSize); + if (minline == null || minindent > indented) { + minline = search - 1; + minindent = indented; + } + } + return minline; + } + + function getStateBefore(cm, n, precise) { + var doc = cm.doc, display = cm.display; + if (!doc.mode.startState) return true; + var pos = findStartLine(cm, n, precise), state = pos > doc.first && getLine(doc, pos-1).stateAfter; + if (!state) state = startState(doc.mode); + else state = copyState(doc.mode, state); + doc.iter(pos, n, function(line) { + processLine(cm, line.text, state); + var save = pos == n - 1 || pos % 5 == 0 || pos >= display.viewFrom && pos < display.viewTo; + line.stateAfter = save ? copyState(doc.mode, state) : null; + ++pos; + }); + if (precise) doc.frontier = pos; + return state; + } + + // POSITION MEASUREMENT + + function paddingTop(display) {return display.lineSpace.offsetTop;} + function paddingVert(display) {return display.mover.offsetHeight - display.lineSpace.offsetHeight;} + function paddingH(display) { + if (display.cachedPaddingH) return display.cachedPaddingH; + var e = removeChildrenAndAdd(display.measure, elt("pre", "x")); + var style = window.getComputedStyle ? window.getComputedStyle(e) : e.currentStyle; + var data = {left: parseInt(style.paddingLeft), right: parseInt(style.paddingRight)}; + if (!isNaN(data.left) && !isNaN(data.right)) display.cachedPaddingH = data; + return data; + } + + function scrollGap(cm) { return scrollerGap - cm.display.nativeBarWidth; } + function displayWidth(cm) { + return cm.display.scroller.clientWidth - scrollGap(cm) - cm.display.barWidth; + } + function displayHeight(cm) { + return cm.display.scroller.clientHeight - scrollGap(cm) - cm.display.barHeight; + } + + // Ensure the lineView.wrapping.heights array is populated. This is + // an array of bottom offsets for the lines that make up a drawn + // line. When lineWrapping is on, there might be more than one + // height. + function ensureLineHeights(cm, lineView, rect) { + var wrapping = cm.options.lineWrapping; + var curWidth = wrapping && displayWidth(cm); + if (!lineView.measure.heights || wrapping && lineView.measure.width != curWidth) { + var heights = lineView.measure.heights = []; + if (wrapping) { + lineView.measure.width = curWidth; + var rects = lineView.text.firstChild.getClientRects(); + for (var i = 0; i < rects.length - 1; i++) { + var cur = rects[i], next = rects[i + 1]; + if (Math.abs(cur.bottom - next.bottom) > 2) + heights.push((cur.bottom + next.top) / 2 - rect.top); + } + } + heights.push(rect.bottom - rect.top); + } + } + + // Find a line map (mapping character offsets to text nodes) and a + // measurement cache for the given line number. (A line view might + // contain multiple lines when collapsed ranges are present.) + function mapFromLineView(lineView, line, lineN) { + if (lineView.line == line) + return {map: lineView.measure.map, cache: lineView.measure.cache}; + for (var i = 0; i < lineView.rest.length; i++) + if (lineView.rest[i] == line) + return {map: lineView.measure.maps[i], cache: lineView.measure.caches[i]}; + for (var i = 0; i < lineView.rest.length; i++) + if (lineNo(lineView.rest[i]) > lineN) + return {map: lineView.measure.maps[i], cache: lineView.measure.caches[i], before: true}; + } + + // Render a line into the hidden node display.externalMeasured. Used + // when measurement is needed for a line that's not in the viewport. + function updateExternalMeasurement(cm, line) { + line = visualLine(line); + var lineN = lineNo(line); + var view = cm.display.externalMeasured = new LineView(cm.doc, line, lineN); + view.lineN = lineN; + var built = view.built = buildLineContent(cm, view); + view.text = built.pre; + removeChildrenAndAdd(cm.display.lineMeasure, built.pre); + return view; + } + + // Get a {top, bottom, left, right} box (in line-local coordinates) + // for a given character. + function measureChar(cm, line, ch, bias) { + return measureCharPrepared(cm, prepareMeasureForLine(cm, line), ch, bias); + } + + // Find a line view that corresponds to the given line number. + function findViewForLine(cm, lineN) { + if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo) + return cm.display.view[findViewIndex(cm, lineN)]; + var ext = cm.display.externalMeasured; + if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size) + return ext; + } + + // Measurement can be split in two steps, the set-up work that + // applies to the whole line, and the measurement of the actual + // character. Functions like coordsChar, that need to do a lot of + // measurements in a row, can thus ensure that the set-up work is + // only done once. + function prepareMeasureForLine(cm, line) { + var lineN = lineNo(line); + var view = findViewForLine(cm, lineN); + if (view && !view.text) { + view = null; + } else if (view && view.changes) { + updateLineForChanges(cm, view, lineN, getDimensions(cm)); + cm.curOp.forceUpdate = true; + } + if (!view) + view = updateExternalMeasurement(cm, line); + + var info = mapFromLineView(view, line, lineN); + return { + line: line, view: view, rect: null, + map: info.map, cache: info.cache, before: info.before, + hasHeights: false + }; + } + + // Given a prepared measurement object, measures the position of an + // actual character (or fetches it from the cache). + function measureCharPrepared(cm, prepared, ch, bias, varHeight) { + if (prepared.before) ch = -1; + var key = ch + (bias || ""), found; + if (prepared.cache.hasOwnProperty(key)) { + found = prepared.cache[key]; + } else { + if (!prepared.rect) + prepared.rect = prepared.view.text.getBoundingClientRect(); + if (!prepared.hasHeights) { + ensureLineHeights(cm, prepared.view, prepared.rect); + prepared.hasHeights = true; + } + found = measureCharInner(cm, prepared, ch, bias); + if (!found.bogus) prepared.cache[key] = found; + } + return {left: found.left, right: found.right, + top: varHeight ? found.rtop : found.top, + bottom: varHeight ? found.rbottom : found.bottom}; + } + + var nullRect = {left: 0, right: 0, top: 0, bottom: 0}; + + function nodeAndOffsetInLineMap(map, ch, bias) { + var node, start, end, collapse; + // First, search the line map for the text node corresponding to, + // or closest to, the target character. + for (var i = 0; i < map.length; i += 3) { + var mStart = map[i], mEnd = map[i + 1]; + if (ch < mStart) { + start = 0; end = 1; + collapse = "left"; + } else if (ch < mEnd) { + start = ch - mStart; + end = start + 1; + } else if (i == map.length - 3 || ch == mEnd && map[i + 3] > ch) { + end = mEnd - mStart; + start = end - 1; + if (ch >= mEnd) collapse = "right"; + } + if (start != null) { + node = map[i + 2]; + if (mStart == mEnd && bias == (node.insertLeft ? "left" : "right")) + collapse = bias; + if (bias == "left" && start == 0) + while (i && map[i - 2] == map[i - 3] && map[i - 1].insertLeft) { + node = map[(i -= 3) + 2]; + collapse = "left"; + } + if (bias == "right" && start == mEnd - mStart) + while (i < map.length - 3 && map[i + 3] == map[i + 4] && !map[i + 5].insertLeft) { + node = map[(i += 3) + 2]; + collapse = "right"; + } + break; + } + } + return {node: node, start: start, end: end, collapse: collapse, coverStart: mStart, coverEnd: mEnd}; + } + + function getUsefulRect(rects, bias) { + var rect = nullRect + if (bias == "left") for (var i = 0; i < rects.length; i++) { + if ((rect = rects[i]).left != rect.right) break + } else for (var i = rects.length - 1; i >= 0; i--) { + if ((rect = rects[i]).left != rect.right) break + } + return rect + } + + function measureCharInner(cm, prepared, ch, bias) { + var place = nodeAndOffsetInLineMap(prepared.map, ch, bias); + var node = place.node, start = place.start, end = place.end, collapse = place.collapse; + + var rect; + if (node.nodeType == 3) { // If it is a text node, use a range to retrieve the coordinates. + for (var i = 0; i < 4; i++) { // Retry a maximum of 4 times when nonsense rectangles are returned + while (start && isExtendingChar(prepared.line.text.charAt(place.coverStart + start))) --start; + while (place.coverStart + end < place.coverEnd && isExtendingChar(prepared.line.text.charAt(place.coverStart + end))) ++end; + if (ie && ie_version < 9 && start == 0 && end == place.coverEnd - place.coverStart) + rect = node.parentNode.getBoundingClientRect(); + else + rect = getUsefulRect(range(node, start, end).getClientRects(), bias) + if (rect.left || rect.right || start == 0) break; + end = start; + start = start - 1; + collapse = "right"; + } + if (ie && ie_version < 11) rect = maybeUpdateRectForZooming(cm.display.measure, rect); + } else { // If it is a widget, simply get the box for the whole widget. + if (start > 0) collapse = bias = "right"; + var rects; + if (cm.options.lineWrapping && (rects = node.getClientRects()).length > 1) + rect = rects[bias == "right" ? rects.length - 1 : 0]; + else + rect = node.getBoundingClientRect(); + } + if (ie && ie_version < 9 && !start && (!rect || !rect.left && !rect.right)) { + var rSpan = node.parentNode.getClientRects()[0]; + if (rSpan) + rect = {left: rSpan.left, right: rSpan.left + charWidth(cm.display), top: rSpan.top, bottom: rSpan.bottom}; + else + rect = nullRect; + } + + var rtop = rect.top - prepared.rect.top, rbot = rect.bottom - prepared.rect.top; + var mid = (rtop + rbot) / 2; + var heights = prepared.view.measure.heights; + for (var i = 0; i < heights.length - 1; i++) + if (mid < heights[i]) break; + var top = i ? heights[i - 1] : 0, bot = heights[i]; + var result = {left: (collapse == "right" ? rect.right : rect.left) - prepared.rect.left, + right: (collapse == "left" ? rect.left : rect.right) - prepared.rect.left, + top: top, bottom: bot}; + if (!rect.left && !rect.right) result.bogus = true; + if (!cm.options.singleCursorHeightPerLine) { result.rtop = rtop; result.rbottom = rbot; } + + return result; + } + + // Work around problem with bounding client rects on ranges being + // returned incorrectly when zoomed on IE10 and below. + function maybeUpdateRectForZooming(measure, rect) { + if (!window.screen || screen.logicalXDPI == null || + screen.logicalXDPI == screen.deviceXDPI || !hasBadZoomedRects(measure)) + return rect; + var scaleX = screen.logicalXDPI / screen.deviceXDPI; + var scaleY = screen.logicalYDPI / screen.deviceYDPI; + return {left: rect.left * scaleX, right: rect.right * scaleX, + top: rect.top * scaleY, bottom: rect.bottom * scaleY}; + } + + function clearLineMeasurementCacheFor(lineView) { + if (lineView.measure) { + lineView.measure.cache = {}; + lineView.measure.heights = null; + if (lineView.rest) for (var i = 0; i < lineView.rest.length; i++) + lineView.measure.caches[i] = {}; + } + } + + function clearLineMeasurementCache(cm) { + cm.display.externalMeasure = null; + removeChildren(cm.display.lineMeasure); + for (var i = 0; i < cm.display.view.length; i++) + clearLineMeasurementCacheFor(cm.display.view[i]); + } + + function clearCaches(cm) { + clearLineMeasurementCache(cm); + cm.display.cachedCharWidth = cm.display.cachedTextHeight = cm.display.cachedPaddingH = null; + if (!cm.options.lineWrapping) cm.display.maxLineChanged = true; + cm.display.lineNumChars = null; + } + + function pageScrollX() { return window.pageXOffset || (document.documentElement || document.body).scrollLeft; } + function pageScrollY() { return window.pageYOffset || (document.documentElement || document.body).scrollTop; } + + // Converts a {top, bottom, left, right} box from line-local + // coordinates into another coordinate system. Context may be one of + // "line", "div" (display.lineDiv), "local"/null (editor), "window", + // or "page". + function intoCoordSystem(cm, lineObj, rect, context) { + if (lineObj.widgets) for (var i = 0; i < lineObj.widgets.length; ++i) if (lineObj.widgets[i].above) { + var size = widgetHeight(lineObj.widgets[i]); + rect.top += size; rect.bottom += size; + } + if (context == "line") return rect; + if (!context) context = "local"; + var yOff = heightAtLine(lineObj); + if (context == "local") yOff += paddingTop(cm.display); + else yOff -= cm.display.viewOffset; + if (context == "page" || context == "window") { + var lOff = cm.display.lineSpace.getBoundingClientRect(); + yOff += lOff.top + (context == "window" ? 0 : pageScrollY()); + var xOff = lOff.left + (context == "window" ? 0 : pageScrollX()); + rect.left += xOff; rect.right += xOff; + } + rect.top += yOff; rect.bottom += yOff; + return rect; + } + + // Coverts a box from "div" coords to another coordinate system. + // Context may be "window", "page", "div", or "local"/null. + function fromCoordSystem(cm, coords, context) { + if (context == "div") return coords; + var left = coords.left, top = coords.top; + // First move into "page" coordinate system + if (context == "page") { + left -= pageScrollX(); + top -= pageScrollY(); + } else if (context == "local" || !context) { + var localBox = cm.display.sizer.getBoundingClientRect(); + left += localBox.left; + top += localBox.top; + } + + var lineSpaceBox = cm.display.lineSpace.getBoundingClientRect(); + return {left: left - lineSpaceBox.left, top: top - lineSpaceBox.top}; + } + + function charCoords(cm, pos, context, lineObj, bias) { + if (!lineObj) lineObj = getLine(cm.doc, pos.line); + return intoCoordSystem(cm, lineObj, measureChar(cm, lineObj, pos.ch, bias), context); + } + + // Returns a box for a given cursor position, which may have an + // 'other' property containing the position of the secondary cursor + // on a bidi boundary. + function cursorCoords(cm, pos, context, lineObj, preparedMeasure, varHeight) { + lineObj = lineObj || getLine(cm.doc, pos.line); + if (!preparedMeasure) preparedMeasure = prepareMeasureForLine(cm, lineObj); + function get(ch, right) { + var m = measureCharPrepared(cm, preparedMeasure, ch, right ? "right" : "left", varHeight); + if (right) m.left = m.right; else m.right = m.left; + return intoCoordSystem(cm, lineObj, m, context); + } + function getBidi(ch, partPos) { + var part = order[partPos], right = part.level % 2; + if (ch == bidiLeft(part) && partPos && part.level < order[partPos - 1].level) { + part = order[--partPos]; + ch = bidiRight(part) - (part.level % 2 ? 0 : 1); + right = true; + } else if (ch == bidiRight(part) && partPos < order.length - 1 && part.level < order[partPos + 1].level) { + part = order[++partPos]; + ch = bidiLeft(part) - part.level % 2; + right = false; + } + if (right && ch == part.to && ch > part.from) return get(ch - 1); + return get(ch, right); + } + var order = getOrder(lineObj), ch = pos.ch; + if (!order) return get(ch); + var partPos = getBidiPartAt(order, ch); + var val = getBidi(ch, partPos); + if (bidiOther != null) val.other = getBidi(ch, bidiOther); + return val; + } + + // Used to cheaply estimate the coordinates for a position. Used for + // intermediate scroll updates. + function estimateCoords(cm, pos) { + var left = 0, pos = clipPos(cm.doc, pos); + if (!cm.options.lineWrapping) left = charWidth(cm.display) * pos.ch; + var lineObj = getLine(cm.doc, pos.line); + var top = heightAtLine(lineObj) + paddingTop(cm.display); + return {left: left, right: left, top: top, bottom: top + lineObj.height}; + } + + // Positions returned by coordsChar contain some extra information. + // xRel is the relative x position of the input coordinates compared + // to the found position (so xRel > 0 means the coordinates are to + // the right of the character position, for example). When outside + // is true, that means the coordinates lie outside the line's + // vertical range. + function PosWithInfo(line, ch, outside, xRel) { + var pos = Pos(line, ch); + pos.xRel = xRel; + if (outside) pos.outside = true; + return pos; + } + + // Compute the character position closest to the given coordinates. + // Input must be lineSpace-local ("div" coordinate system). + function coordsChar(cm, x, y) { + var doc = cm.doc; + y += cm.display.viewOffset; + if (y < 0) return PosWithInfo(doc.first, 0, true, -1); + var lineN = lineAtHeight(doc, y), last = doc.first + doc.size - 1; + if (lineN > last) + return PosWithInfo(doc.first + doc.size - 1, getLine(doc, last).text.length, true, 1); + if (x < 0) x = 0; + + var lineObj = getLine(doc, lineN); + for (;;) { + var found = coordsCharInner(cm, lineObj, lineN, x, y); + var merged = collapsedSpanAtEnd(lineObj); + var mergedPos = merged && merged.find(0, true); + if (merged && (found.ch > mergedPos.from.ch || found.ch == mergedPos.from.ch && found.xRel > 0)) + lineN = lineNo(lineObj = mergedPos.to.line); + else + return found; + } + } + + function coordsCharInner(cm, lineObj, lineNo, x, y) { + var innerOff = y - heightAtLine(lineObj); + var wrongLine = false, adjust = 2 * cm.display.wrapper.clientWidth; + var preparedMeasure = prepareMeasureForLine(cm, lineObj); + + function getX(ch) { + var sp = cursorCoords(cm, Pos(lineNo, ch), "line", lineObj, preparedMeasure); + wrongLine = true; + if (innerOff > sp.bottom) return sp.left - adjust; + else if (innerOff < sp.top) return sp.left + adjust; + else wrongLine = false; + return sp.left; + } + + var bidi = getOrder(lineObj), dist = lineObj.text.length; + var from = lineLeft(lineObj), to = lineRight(lineObj); + var fromX = getX(from), fromOutside = wrongLine, toX = getX(to), toOutside = wrongLine; + + if (x > toX) return PosWithInfo(lineNo, to, toOutside, 1); + // Do a binary search between these bounds. + for (;;) { + if (bidi ? to == from || to == moveVisually(lineObj, from, 1) : to - from <= 1) { + var ch = x < fromX || x - fromX <= toX - x ? from : to; + var outside = ch == from ? fromOutside : toOutside + var xDiff = x - (ch == from ? fromX : toX); + // This is a kludge to handle the case where the coordinates + // are after a line-wrapped line. We should replace it with a + // more general handling of cursor positions around line + // breaks. (Issue #4078) + if (toOutside && !bidi && !/\s/.test(lineObj.text.charAt(ch)) && xDiff > 0 && + ch < lineObj.text.length && preparedMeasure.view.measure.heights.length > 1) { + var charSize = measureCharPrepared(cm, preparedMeasure, ch, "right"); + if (innerOff <= charSize.bottom && innerOff >= charSize.top && Math.abs(x - charSize.right) < xDiff) { + outside = false + ch++ + xDiff = x - charSize.right + } + } + while (isExtendingChar(lineObj.text.charAt(ch))) ++ch; + var pos = PosWithInfo(lineNo, ch, outside, xDiff < -1 ? -1 : xDiff > 1 ? 1 : 0); + return pos; + } + var step = Math.ceil(dist / 2), middle = from + step; + if (bidi) { + middle = from; + for (var i = 0; i < step; ++i) middle = moveVisually(lineObj, middle, 1); + } + var middleX = getX(middle); + if (middleX > x) {to = middle; toX = middleX; if (toOutside = wrongLine) toX += 1000; dist = step;} + else {from = middle; fromX = middleX; fromOutside = wrongLine; dist -= step;} + } + } + + var measureText; + // Compute the default text height. + function textHeight(display) { + if (display.cachedTextHeight != null) return display.cachedTextHeight; + if (measureText == null) { + measureText = elt("pre"); + // Measure a bunch of lines, for browsers that compute + // fractional heights. + for (var i = 0; i < 49; ++i) { + measureText.appendChild(document.createTextNode("x")); + measureText.appendChild(elt("br")); + } + measureText.appendChild(document.createTextNode("x")); + } + removeChildrenAndAdd(display.measure, measureText); + var height = measureText.offsetHeight / 50; + if (height > 3) display.cachedTextHeight = height; + removeChildren(display.measure); + return height || 1; + } + + // Compute the default character width. + function charWidth(display) { + if (display.cachedCharWidth != null) return display.cachedCharWidth; + var anchor = elt("span", "xxxxxxxxxx"); + var pre = elt("pre", [anchor]); + removeChildrenAndAdd(display.measure, pre); + var rect = anchor.getBoundingClientRect(), width = (rect.right - rect.left) / 10; + if (width > 2) display.cachedCharWidth = width; + return width || 10; + } + + // OPERATIONS + + // Operations are used to wrap a series of changes to the editor + // state in such a way that each change won't have to update the + // cursor and display (which would be awkward, slow, and + // error-prone). Instead, display updates are batched and then all + // combined and executed at once. + + var operationGroup = null; + + var nextOpId = 0; + // Start a new operation. + function startOperation(cm) { + cm.curOp = { + cm: cm, + viewChanged: false, // Flag that indicates that lines might need to be redrawn + startHeight: cm.doc.height, // Used to detect need to update scrollbar + forceUpdate: false, // Used to force a redraw + updateInput: null, // Whether to reset the input textarea + typing: false, // Whether this reset should be careful to leave existing text (for compositing) + changeObjs: null, // Accumulated changes, for firing change events + cursorActivityHandlers: null, // Set of handlers to fire cursorActivity on + cursorActivityCalled: 0, // Tracks which cursorActivity handlers have been called already + selectionChanged: false, // Whether the selection needs to be redrawn + updateMaxLine: false, // Set when the widest line needs to be determined anew + scrollLeft: null, scrollTop: null, // Intermediate scroll position, not pushed to DOM yet + scrollToPos: null, // Used to scroll to a specific position + focus: false, + id: ++nextOpId // Unique ID + }; + if (operationGroup) { + operationGroup.ops.push(cm.curOp); + } else { + cm.curOp.ownsGroup = operationGroup = { + ops: [cm.curOp], + delayedCallbacks: [] + }; + } + } + + function fireCallbacksForOps(group) { + // Calls delayed callbacks and cursorActivity handlers until no + // new ones appear + var callbacks = group.delayedCallbacks, i = 0; + do { + for (; i < callbacks.length; i++) + callbacks[i].call(null); + for (var j = 0; j < group.ops.length; j++) { + var op = group.ops[j]; + if (op.cursorActivityHandlers) + while (op.cursorActivityCalled < op.cursorActivityHandlers.length) + op.cursorActivityHandlers[op.cursorActivityCalled++].call(null, op.cm); + } + } while (i < callbacks.length); + } + + // Finish an operation, updating the display and signalling delayed events + function endOperation(cm) { + var op = cm.curOp, group = op.ownsGroup; + if (!group) return; + + try { fireCallbacksForOps(group); } + finally { + operationGroup = null; + for (var i = 0; i < group.ops.length; i++) + group.ops[i].cm.curOp = null; + endOperations(group); + } + } + + // The DOM updates done when an operation finishes are batched so + // that the minimum number of relayouts are required. + function endOperations(group) { + var ops = group.ops; + for (var i = 0; i < ops.length; i++) // Read DOM + endOperation_R1(ops[i]); + for (var i = 0; i < ops.length; i++) // Write DOM (maybe) + endOperation_W1(ops[i]); + for (var i = 0; i < ops.length; i++) // Read DOM + endOperation_R2(ops[i]); + for (var i = 0; i < ops.length; i++) // Write DOM (maybe) + endOperation_W2(ops[i]); + for (var i = 0; i < ops.length; i++) // Read DOM + endOperation_finish(ops[i]); + } + + function endOperation_R1(op) { + var cm = op.cm, display = cm.display; + maybeClipScrollbars(cm); + if (op.updateMaxLine) findMaxLine(cm); + + op.mustUpdate = op.viewChanged || op.forceUpdate || op.scrollTop != null || + op.scrollToPos && (op.scrollToPos.from.line < display.viewFrom || + op.scrollToPos.to.line >= display.viewTo) || + display.maxLineChanged && cm.options.lineWrapping; + op.update = op.mustUpdate && + new DisplayUpdate(cm, op.mustUpdate && {top: op.scrollTop, ensure: op.scrollToPos}, op.forceUpdate); + } + + function endOperation_W1(op) { + op.updatedDisplay = op.mustUpdate && updateDisplayIfNeeded(op.cm, op.update); + } + + function endOperation_R2(op) { + var cm = op.cm, display = cm.display; + if (op.updatedDisplay) updateHeightsInViewport(cm); + + op.barMeasure = measureForScrollbars(cm); + + // If the max line changed since it was last measured, measure it, + // and ensure the document's width matches it. + // updateDisplay_W2 will use these properties to do the actual resizing + if (display.maxLineChanged && !cm.options.lineWrapping) { + op.adjustWidthTo = measureChar(cm, display.maxLine, display.maxLine.text.length).left + 3; + cm.display.sizerWidth = op.adjustWidthTo; + op.barMeasure.scrollWidth = + Math.max(display.scroller.clientWidth, display.sizer.offsetLeft + op.adjustWidthTo + scrollGap(cm) + cm.display.barWidth); + op.maxScrollLeft = Math.max(0, display.sizer.offsetLeft + op.adjustWidthTo - displayWidth(cm)); + } + + if (op.updatedDisplay || op.selectionChanged) + op.preparedSelection = display.input.prepareSelection(op.focus); + } + + function endOperation_W2(op) { + var cm = op.cm; + + if (op.adjustWidthTo != null) { + cm.display.sizer.style.minWidth = op.adjustWidthTo + "px"; + if (op.maxScrollLeft < cm.doc.scrollLeft) + setScrollLeft(cm, Math.min(cm.display.scroller.scrollLeft, op.maxScrollLeft), true); + cm.display.maxLineChanged = false; + } + + var takeFocus = op.focus && op.focus == activeElt() && (!document.hasFocus || document.hasFocus()) + if (op.preparedSelection) + cm.display.input.showSelection(op.preparedSelection, takeFocus); + if (op.updatedDisplay || op.startHeight != cm.doc.height) + updateScrollbars(cm, op.barMeasure); + if (op.updatedDisplay) + setDocumentHeight(cm, op.barMeasure); + + if (op.selectionChanged) restartBlink(cm); + + if (cm.state.focused && op.updateInput) + cm.display.input.reset(op.typing); + if (takeFocus) ensureFocus(op.cm); + } + + function endOperation_finish(op) { + var cm = op.cm, display = cm.display, doc = cm.doc; + + if (op.updatedDisplay) postUpdateDisplay(cm, op.update); + + // Abort mouse wheel delta measurement, when scrolling explicitly + if (display.wheelStartX != null && (op.scrollTop != null || op.scrollLeft != null || op.scrollToPos)) + display.wheelStartX = display.wheelStartY = null; + + // Propagate the scroll position to the actual DOM scroller + if (op.scrollTop != null && (display.scroller.scrollTop != op.scrollTop || op.forceScroll)) { + doc.scrollTop = Math.max(0, Math.min(display.scroller.scrollHeight - display.scroller.clientHeight, op.scrollTop)); + display.scrollbars.setScrollTop(doc.scrollTop); + display.scroller.scrollTop = doc.scrollTop; + } + if (op.scrollLeft != null && (display.scroller.scrollLeft != op.scrollLeft || op.forceScroll)) { + doc.scrollLeft = Math.max(0, Math.min(display.scroller.scrollWidth - display.scroller.clientWidth, op.scrollLeft)); + display.scrollbars.setScrollLeft(doc.scrollLeft); + display.scroller.scrollLeft = doc.scrollLeft; + alignHorizontally(cm); + } + // If we need to scroll a specific position into view, do so. + if (op.scrollToPos) { + var coords = scrollPosIntoView(cm, clipPos(doc, op.scrollToPos.from), + clipPos(doc, op.scrollToPos.to), op.scrollToPos.margin); + if (op.scrollToPos.isCursor && cm.state.focused) maybeScrollWindow(cm, coords); + } + + // Fire events for markers that are hidden/unidden by editing or + // undoing + var hidden = op.maybeHiddenMarkers, unhidden = op.maybeUnhiddenMarkers; + if (hidden) for (var i = 0; i < hidden.length; ++i) + if (!hidden[i].lines.length) signal(hidden[i], "hide"); + if (unhidden) for (var i = 0; i < unhidden.length; ++i) + if (unhidden[i].lines.length) signal(unhidden[i], "unhide"); + + if (display.wrapper.offsetHeight) + doc.scrollTop = cm.display.scroller.scrollTop; + + // Fire change events, and delayed event handlers + if (op.changeObjs) + signal(cm, "changes", cm, op.changeObjs); + if (op.update) + op.update.finish(); + } + + // Run the given function in an operation + function runInOp(cm, f) { + if (cm.curOp) return f(); + startOperation(cm); + try { return f(); } + finally { endOperation(cm); } + } + // Wraps a function in an operation. Returns the wrapped function. + function operation(cm, f) { + return function() { + if (cm.curOp) return f.apply(cm, arguments); + startOperation(cm); + try { return f.apply(cm, arguments); } + finally { endOperation(cm); } + }; + } + // Used to add methods to editor and doc instances, wrapping them in + // operations. + function methodOp(f) { + return function() { + if (this.curOp) return f.apply(this, arguments); + startOperation(this); + try { return f.apply(this, arguments); } + finally { endOperation(this); } + }; + } + function docMethodOp(f) { + return function() { + var cm = this.cm; + if (!cm || cm.curOp) return f.apply(this, arguments); + startOperation(cm); + try { return f.apply(this, arguments); } + finally { endOperation(cm); } + }; + } + + // VIEW TRACKING + + // These objects are used to represent the visible (currently drawn) + // part of the document. A LineView may correspond to multiple + // logical lines, if those are connected by collapsed ranges. + function LineView(doc, line, lineN) { + // The starting line + this.line = line; + // Continuing lines, if any + this.rest = visualLineContinued(line); + // Number of logical lines in this visual line + this.size = this.rest ? lineNo(lst(this.rest)) - lineN + 1 : 1; + this.node = this.text = null; + this.hidden = lineIsHidden(doc, line); + } + + // Create a range of LineView objects for the given lines. + function buildViewArray(cm, from, to) { + var array = [], nextPos; + for (var pos = from; pos < to; pos = nextPos) { + var view = new LineView(cm.doc, getLine(cm.doc, pos), pos); + nextPos = pos + view.size; + array.push(view); + } + return array; + } + + // Updates the display.view data structure for a given change to the + // document. From and to are in pre-change coordinates. Lendiff is + // the amount of lines added or subtracted by the change. This is + // used for changes that span multiple lines, or change the way + // lines are divided into visual lines. regLineChange (below) + // registers single-line changes. + function regChange(cm, from, to, lendiff) { + if (from == null) from = cm.doc.first; + if (to == null) to = cm.doc.first + cm.doc.size; + if (!lendiff) lendiff = 0; + + var display = cm.display; + if (lendiff && to < display.viewTo && + (display.updateLineNumbers == null || display.updateLineNumbers > from)) + display.updateLineNumbers = from; + + cm.curOp.viewChanged = true; + + if (from >= display.viewTo) { // Change after + if (sawCollapsedSpans && visualLineNo(cm.doc, from) < display.viewTo) + resetView(cm); + } else if (to <= display.viewFrom) { // Change before + if (sawCollapsedSpans && visualLineEndNo(cm.doc, to + lendiff) > display.viewFrom) { + resetView(cm); + } else { + display.viewFrom += lendiff; + display.viewTo += lendiff; + } + } else if (from <= display.viewFrom && to >= display.viewTo) { // Full overlap + resetView(cm); + } else if (from <= display.viewFrom) { // Top overlap + var cut = viewCuttingPoint(cm, to, to + lendiff, 1); + if (cut) { + display.view = display.view.slice(cut.index); + display.viewFrom = cut.lineN; + display.viewTo += lendiff; + } else { + resetView(cm); + } + } else if (to >= display.viewTo) { // Bottom overlap + var cut = viewCuttingPoint(cm, from, from, -1); + if (cut) { + display.view = display.view.slice(0, cut.index); + display.viewTo = cut.lineN; + } else { + resetView(cm); + } + } else { // Gap in the middle + var cutTop = viewCuttingPoint(cm, from, from, -1); + var cutBot = viewCuttingPoint(cm, to, to + lendiff, 1); + if (cutTop && cutBot) { + display.view = display.view.slice(0, cutTop.index) + .concat(buildViewArray(cm, cutTop.lineN, cutBot.lineN)) + .concat(display.view.slice(cutBot.index)); + display.viewTo += lendiff; + } else { + resetView(cm); + } + } + + var ext = display.externalMeasured; + if (ext) { + if (to < ext.lineN) + ext.lineN += lendiff; + else if (from < ext.lineN + ext.size) + display.externalMeasured = null; + } + } + + // Register a change to a single line. Type must be one of "text", + // "gutter", "class", "widget" + function regLineChange(cm, line, type) { + cm.curOp.viewChanged = true; + var display = cm.display, ext = cm.display.externalMeasured; + if (ext && line >= ext.lineN && line < ext.lineN + ext.size) + display.externalMeasured = null; + + if (line < display.viewFrom || line >= display.viewTo) return; + var lineView = display.view[findViewIndex(cm, line)]; + if (lineView.node == null) return; + var arr = lineView.changes || (lineView.changes = []); + if (indexOf(arr, type) == -1) arr.push(type); + } + + // Clear the view. + function resetView(cm) { + cm.display.viewFrom = cm.display.viewTo = cm.doc.first; + cm.display.view = []; + cm.display.viewOffset = 0; + } + + // Find the view element corresponding to a given line. Return null + // when the line isn't visible. + function findViewIndex(cm, n) { + if (n >= cm.display.viewTo) return null; + n -= cm.display.viewFrom; + if (n < 0) return null; + var view = cm.display.view; + for (var i = 0; i < view.length; i++) { + n -= view[i].size; + if (n < 0) return i; + } + } + + function viewCuttingPoint(cm, oldN, newN, dir) { + var index = findViewIndex(cm, oldN), diff, view = cm.display.view; + if (!sawCollapsedSpans || newN == cm.doc.first + cm.doc.size) + return {index: index, lineN: newN}; + for (var i = 0, n = cm.display.viewFrom; i < index; i++) + n += view[i].size; + if (n != oldN) { + if (dir > 0) { + if (index == view.length - 1) return null; + diff = (n + view[index].size) - oldN; + index++; + } else { + diff = n - oldN; + } + oldN += diff; newN += diff; + } + while (visualLineNo(cm.doc, newN) != newN) { + if (index == (dir < 0 ? 0 : view.length - 1)) return null; + newN += dir * view[index - (dir < 0 ? 1 : 0)].size; + index += dir; + } + return {index: index, lineN: newN}; + } + + // Force the view to cover a given range, adding empty view element + // or clipping off existing ones as needed. + function adjustView(cm, from, to) { + var display = cm.display, view = display.view; + if (view.length == 0 || from >= display.viewTo || to <= display.viewFrom) { + display.view = buildViewArray(cm, from, to); + display.viewFrom = from; + } else { + if (display.viewFrom > from) + display.view = buildViewArray(cm, from, display.viewFrom).concat(display.view); + else if (display.viewFrom < from) + display.view = display.view.slice(findViewIndex(cm, from)); + display.viewFrom = from; + if (display.viewTo < to) + display.view = display.view.concat(buildViewArray(cm, display.viewTo, to)); + else if (display.viewTo > to) + display.view = display.view.slice(0, findViewIndex(cm, to)); + } + display.viewTo = to; + } + + // Count the number of lines in the view whose DOM representation is + // out of date (or nonexistent). + function countDirtyView(cm) { + var view = cm.display.view, dirty = 0; + for (var i = 0; i < view.length; i++) { + var lineView = view[i]; + if (!lineView.hidden && (!lineView.node || lineView.changes)) ++dirty; + } + return dirty; + } + + // EVENT HANDLERS + + // Attach the necessary event handlers when initializing the editor + function registerEventHandlers(cm) { + var d = cm.display; + on(d.scroller, "mousedown", operation(cm, onMouseDown)); + // Older IE's will not fire a second mousedown for a double click + if (ie && ie_version < 11) + on(d.scroller, "dblclick", operation(cm, function(e) { + if (signalDOMEvent(cm, e)) return; + var pos = posFromMouse(cm, e); + if (!pos || clickInGutter(cm, e) || eventInWidget(cm.display, e)) return; + e_preventDefault(e); + var word = cm.findWordAt(pos); + extendSelection(cm.doc, word.anchor, word.head); + })); + else + on(d.scroller, "dblclick", function(e) { signalDOMEvent(cm, e) || e_preventDefault(e); }); + // Some browsers fire contextmenu *after* opening the menu, at + // which point we can't mess with it anymore. Context menu is + // handled in onMouseDown for these browsers. + if (!captureRightClick) on(d.scroller, "contextmenu", function(e) {onContextMenu(cm, e);}); + + // Used to suppress mouse event handling when a touch happens + var touchFinished, prevTouch = {end: 0}; + function finishTouch() { + if (d.activeTouch) { + touchFinished = setTimeout(function() {d.activeTouch = null;}, 1000); + prevTouch = d.activeTouch; + prevTouch.end = +new Date; + } + }; + function isMouseLikeTouchEvent(e) { + if (e.touches.length != 1) return false; + var touch = e.touches[0]; + return touch.radiusX <= 1 && touch.radiusY <= 1; + } + function farAway(touch, other) { + if (other.left == null) return true; + var dx = other.left - touch.left, dy = other.top - touch.top; + return dx * dx + dy * dy > 20 * 20; + } + on(d.scroller, "touchstart", function(e) { + if (!signalDOMEvent(cm, e) && !isMouseLikeTouchEvent(e)) { + clearTimeout(touchFinished); + var now = +new Date; + d.activeTouch = {start: now, moved: false, + prev: now - prevTouch.end <= 300 ? prevTouch : null}; + if (e.touches.length == 1) { + d.activeTouch.left = e.touches[0].pageX; + d.activeTouch.top = e.touches[0].pageY; + } + } + }); + on(d.scroller, "touchmove", function() { + if (d.activeTouch) d.activeTouch.moved = true; + }); + on(d.scroller, "touchend", function(e) { + var touch = d.activeTouch; + if (touch && !eventInWidget(d, e) && touch.left != null && + !touch.moved && new Date - touch.start < 300) { + var pos = cm.coordsChar(d.activeTouch, "page"), range; + if (!touch.prev || farAway(touch, touch.prev)) // Single tap + range = new Range(pos, pos); + else if (!touch.prev.prev || farAway(touch, touch.prev.prev)) // Double tap + range = cm.findWordAt(pos); + else // Triple tap + range = new Range(Pos(pos.line, 0), clipPos(cm.doc, Pos(pos.line + 1, 0))); + cm.setSelection(range.anchor, range.head); + cm.focus(); + e_preventDefault(e); + } + finishTouch(); + }); + on(d.scroller, "touchcancel", finishTouch); + + // Sync scrolling between fake scrollbars and real scrollable + // area, ensure viewport is updated when scrolling. + on(d.scroller, "scroll", function() { + if (d.scroller.clientHeight) { + setScrollTop(cm, d.scroller.scrollTop); + setScrollLeft(cm, d.scroller.scrollLeft, true); + signal(cm, "scroll", cm); + } + }); + + // Listen to wheel events in order to try and update the viewport on time. + on(d.scroller, "mousewheel", function(e){onScrollWheel(cm, e);}); + on(d.scroller, "DOMMouseScroll", function(e){onScrollWheel(cm, e);}); + + // Prevent wrapper from ever scrolling + on(d.wrapper, "scroll", function() { d.wrapper.scrollTop = d.wrapper.scrollLeft = 0; }); + + d.dragFunctions = { + enter: function(e) {if (!signalDOMEvent(cm, e)) e_stop(e);}, + over: function(e) {if (!signalDOMEvent(cm, e)) { onDragOver(cm, e); e_stop(e); }}, + start: function(e){onDragStart(cm, e);}, + drop: operation(cm, onDrop), + leave: function(e) {if (!signalDOMEvent(cm, e)) { clearDragCursor(cm); }} + }; + + var inp = d.input.getField(); + on(inp, "keyup", function(e) { onKeyUp.call(cm, e); }); + on(inp, "keydown", operation(cm, onKeyDown)); + on(inp, "keypress", operation(cm, onKeyPress)); + on(inp, "focus", bind(onFocus, cm)); + on(inp, "blur", bind(onBlur, cm)); + } + + function dragDropChanged(cm, value, old) { + var wasOn = old && old != CodeMirror.Init; + if (!value != !wasOn) { + var funcs = cm.display.dragFunctions; + var toggle = value ? on : off; + toggle(cm.display.scroller, "dragstart", funcs.start); + toggle(cm.display.scroller, "dragenter", funcs.enter); + toggle(cm.display.scroller, "dragover", funcs.over); + toggle(cm.display.scroller, "dragleave", funcs.leave); + toggle(cm.display.scroller, "drop", funcs.drop); + } + } + + // Called when the window resizes + function onResize(cm) { + var d = cm.display; + if (d.lastWrapHeight == d.wrapper.clientHeight && d.lastWrapWidth == d.wrapper.clientWidth) + return; + // Might be a text scaling operation, clear size caches. + d.cachedCharWidth = d.cachedTextHeight = d.cachedPaddingH = null; + d.scrollbarsClipped = false; + cm.setSize(); + } + + // MOUSE EVENTS + + // Return true when the given mouse event happened in a widget + function eventInWidget(display, e) { + for (var n = e_target(e); n != display.wrapper; n = n.parentNode) { + if (!n || (n.nodeType == 1 && n.getAttribute("cm-ignore-events") == "true") || + (n.parentNode == display.sizer && n != display.mover)) + return true; + } + } + + // Given a mouse event, find the corresponding position. If liberal + // is false, it checks whether a gutter or scrollbar was clicked, + // and returns null if it was. forRect is used by rectangular + // selections, and tries to estimate a character position even for + // coordinates beyond the right of the text. + function posFromMouse(cm, e, liberal, forRect) { + var display = cm.display; + if (!liberal && e_target(e).getAttribute("cm-not-content") == "true") return null; + + var x, y, space = display.lineSpace.getBoundingClientRect(); + // Fails unpredictably on IE[67] when mouse is dragged around quickly. + try { x = e.clientX - space.left; y = e.clientY - space.top; } + catch (e) { return null; } + var coords = coordsChar(cm, x, y), line; + if (forRect && coords.xRel == 1 && (line = getLine(cm.doc, coords.line).text).length == coords.ch) { + var colDiff = countColumn(line, line.length, cm.options.tabSize) - line.length; + coords = Pos(coords.line, Math.max(0, Math.round((x - paddingH(cm.display).left) / charWidth(cm.display)) - colDiff)); + } + return coords; + } + + // A mouse down can be a single click, double click, triple click, + // start of selection drag, start of text drag, new cursor + // (ctrl-click), rectangle drag (alt-drag), or xwin + // middle-click-paste. Or it might be a click on something we should + // not interfere with, such as a scrollbar or widget. + function onMouseDown(e) { + var cm = this, display = cm.display; + if (signalDOMEvent(cm, e) || display.activeTouch && display.input.supportsTouch()) return; + display.shift = e.shiftKey; + + if (eventInWidget(display, e)) { + if (!webkit) { + // Briefly turn off draggability, to allow widgets to do + // normal dragging things. + display.scroller.draggable = false; + setTimeout(function(){display.scroller.draggable = true;}, 100); + } + return; + } + if (clickInGutter(cm, e)) return; + var start = posFromMouse(cm, e); + window.focus(); + + switch (e_button(e)) { + case 1: + // #3261: make sure, that we're not starting a second selection + if (cm.state.selectingText) + cm.state.selectingText(e); + else if (start) + leftButtonDown(cm, e, start); + else if (e_target(e) == display.scroller) + e_preventDefault(e); + break; + case 2: + if (webkit) cm.state.lastMiddleDown = +new Date; + if (start) extendSelection(cm.doc, start); + setTimeout(function() {display.input.focus();}, 20); + e_preventDefault(e); + break; + case 3: + if (captureRightClick) onContextMenu(cm, e); + else delayBlurEvent(cm); + break; + } + } + + var lastClick, lastDoubleClick; + function leftButtonDown(cm, e, start) { + if (ie) setTimeout(bind(ensureFocus, cm), 0); + else cm.curOp.focus = activeElt(); + + var now = +new Date, type; + if (lastDoubleClick && lastDoubleClick.time > now - 400 && cmp(lastDoubleClick.pos, start) == 0) { + type = "triple"; + } else if (lastClick && lastClick.time > now - 400 && cmp(lastClick.pos, start) == 0) { + type = "double"; + lastDoubleClick = {time: now, pos: start}; + } else { + type = "single"; + lastClick = {time: now, pos: start}; + } + + var sel = cm.doc.sel, modifier = mac ? e.metaKey : e.ctrlKey, contained; + if (cm.options.dragDrop && dragAndDrop && !cm.isReadOnly() && + type == "single" && (contained = sel.contains(start)) > -1 && + (cmp((contained = sel.ranges[contained]).from(), start) < 0 || start.xRel > 0) && + (cmp(contained.to(), start) > 0 || start.xRel < 0)) + leftButtonStartDrag(cm, e, start, modifier); + else + leftButtonSelect(cm, e, start, type, modifier); + } + + // Start a text drag. When it ends, see if any dragging actually + // happen, and treat as a click if it didn't. + function leftButtonStartDrag(cm, e, start, modifier) { + var display = cm.display, startTime = +new Date; + var dragEnd = operation(cm, function(e2) { + if (webkit) display.scroller.draggable = false; + cm.state.draggingText = false; + off(document, "mouseup", dragEnd); + off(display.scroller, "drop", dragEnd); + if (Math.abs(e.clientX - e2.clientX) + Math.abs(e.clientY - e2.clientY) < 10) { + e_preventDefault(e2); + if (!modifier && +new Date - 200 < startTime) + extendSelection(cm.doc, start); + // Work around unexplainable focus problem in IE9 (#2127) and Chrome (#3081) + if (webkit || ie && ie_version == 9) + setTimeout(function() {document.body.focus(); display.input.focus();}, 20); + else + display.input.focus(); + } + }); + // Let the drag handler handle this. + if (webkit) display.scroller.draggable = true; + cm.state.draggingText = dragEnd; + dragEnd.copy = mac ? e.altKey : e.ctrlKey + // IE's approach to draggable + if (display.scroller.dragDrop) display.scroller.dragDrop(); + on(document, "mouseup", dragEnd); + on(display.scroller, "drop", dragEnd); + } + + // Normal selection, as opposed to text dragging. + function leftButtonSelect(cm, e, start, type, addNew) { + var display = cm.display, doc = cm.doc; + e_preventDefault(e); + + var ourRange, ourIndex, startSel = doc.sel, ranges = startSel.ranges; + if (addNew && !e.shiftKey) { + ourIndex = doc.sel.contains(start); + if (ourIndex > -1) + ourRange = ranges[ourIndex]; + else + ourRange = new Range(start, start); + } else { + ourRange = doc.sel.primary(); + ourIndex = doc.sel.primIndex; + } + + if (chromeOS ? e.shiftKey && e.metaKey : e.altKey) { + type = "rect"; + if (!addNew) ourRange = new Range(start, start); + start = posFromMouse(cm, e, true, true); + ourIndex = -1; + } else if (type == "double") { + var word = cm.findWordAt(start); + if (cm.display.shift || doc.extend) + ourRange = extendRange(doc, ourRange, word.anchor, word.head); + else + ourRange = word; + } else if (type == "triple") { + var line = new Range(Pos(start.line, 0), clipPos(doc, Pos(start.line + 1, 0))); + if (cm.display.shift || doc.extend) + ourRange = extendRange(doc, ourRange, line.anchor, line.head); + else + ourRange = line; + } else { + ourRange = extendRange(doc, ourRange, start); + } + + if (!addNew) { + ourIndex = 0; + setSelection(doc, new Selection([ourRange], 0), sel_mouse); + startSel = doc.sel; + } else if (ourIndex == -1) { + ourIndex = ranges.length; + setSelection(doc, normalizeSelection(ranges.concat([ourRange]), ourIndex), + {scroll: false, origin: "*mouse"}); + } else if (ranges.length > 1 && ranges[ourIndex].empty() && type == "single" && !e.shiftKey) { + setSelection(doc, normalizeSelection(ranges.slice(0, ourIndex).concat(ranges.slice(ourIndex + 1)), 0), + {scroll: false, origin: "*mouse"}); + startSel = doc.sel; + } else { + replaceOneSelection(doc, ourIndex, ourRange, sel_mouse); + } + + var lastPos = start; + function extendTo(pos) { + if (cmp(lastPos, pos) == 0) return; + lastPos = pos; + + if (type == "rect") { + var ranges = [], tabSize = cm.options.tabSize; + var startCol = countColumn(getLine(doc, start.line).text, start.ch, tabSize); + var posCol = countColumn(getLine(doc, pos.line).text, pos.ch, tabSize); + var left = Math.min(startCol, posCol), right = Math.max(startCol, posCol); + for (var line = Math.min(start.line, pos.line), end = Math.min(cm.lastLine(), Math.max(start.line, pos.line)); + line <= end; line++) { + var text = getLine(doc, line).text, leftPos = findColumn(text, left, tabSize); + if (left == right) + ranges.push(new Range(Pos(line, leftPos), Pos(line, leftPos))); + else if (text.length > leftPos) + ranges.push(new Range(Pos(line, leftPos), Pos(line, findColumn(text, right, tabSize)))); + } + if (!ranges.length) ranges.push(new Range(start, start)); + setSelection(doc, normalizeSelection(startSel.ranges.slice(0, ourIndex).concat(ranges), ourIndex), + {origin: "*mouse", scroll: false}); + cm.scrollIntoView(pos); + } else { + var oldRange = ourRange; + var anchor = oldRange.anchor, head = pos; + if (type != "single") { + if (type == "double") + var range = cm.findWordAt(pos); + else + var range = new Range(Pos(pos.line, 0), clipPos(doc, Pos(pos.line + 1, 0))); + if (cmp(range.anchor, anchor) > 0) { + head = range.head; + anchor = minPos(oldRange.from(), range.anchor); + } else { + head = range.anchor; + anchor = maxPos(oldRange.to(), range.head); + } + } + var ranges = startSel.ranges.slice(0); + ranges[ourIndex] = new Range(clipPos(doc, anchor), head); + setSelection(doc, normalizeSelection(ranges, ourIndex), sel_mouse); + } + } + + var editorSize = display.wrapper.getBoundingClientRect(); + // Used to ensure timeout re-tries don't fire when another extend + // happened in the meantime (clearTimeout isn't reliable -- at + // least on Chrome, the timeouts still happen even when cleared, + // if the clear happens after their scheduled firing time). + var counter = 0; + + function extend(e) { + var curCount = ++counter; + var cur = posFromMouse(cm, e, true, type == "rect"); + if (!cur) return; + if (cmp(cur, lastPos) != 0) { + cm.curOp.focus = activeElt(); + extendTo(cur); + var visible = visibleLines(display, doc); + if (cur.line >= visible.to || cur.line < visible.from) + setTimeout(operation(cm, function(){if (counter == curCount) extend(e);}), 150); + } else { + var outside = e.clientY < editorSize.top ? -20 : e.clientY > editorSize.bottom ? 20 : 0; + if (outside) setTimeout(operation(cm, function() { + if (counter != curCount) return; + display.scroller.scrollTop += outside; + extend(e); + }), 50); + } + } + + function done(e) { + cm.state.selectingText = false; + counter = Infinity; + e_preventDefault(e); + display.input.focus(); + off(document, "mousemove", move); + off(document, "mouseup", up); + doc.history.lastSelOrigin = null; + } + + var move = operation(cm, function(e) { + if (!e_button(e)) done(e); + else extend(e); + }); + var up = operation(cm, done); + cm.state.selectingText = up; + on(document, "mousemove", move); + on(document, "mouseup", up); + } + + // Determines whether an event happened in the gutter, and fires the + // handlers for the corresponding event. + function gutterEvent(cm, e, type, prevent) { + try { var mX = e.clientX, mY = e.clientY; } + catch(e) { return false; } + if (mX >= Math.floor(cm.display.gutters.getBoundingClientRect().right)) return false; + if (prevent) e_preventDefault(e); + + var display = cm.display; + var lineBox = display.lineDiv.getBoundingClientRect(); + + if (mY > lineBox.bottom || !hasHandler(cm, type)) return e_defaultPrevented(e); + mY -= lineBox.top - display.viewOffset; + + for (var i = 0; i < cm.options.gutters.length; ++i) { + var g = display.gutters.childNodes[i]; + if (g && g.getBoundingClientRect().right >= mX) { + var line = lineAtHeight(cm.doc, mY); + var gutter = cm.options.gutters[i]; + signal(cm, type, cm, line, gutter, e); + return e_defaultPrevented(e); + } + } + } + + function clickInGutter(cm, e) { + return gutterEvent(cm, e, "gutterClick", true); + } + + // Kludge to work around strange IE behavior where it'll sometimes + // re-fire a series of drag-related events right after the drop (#1551) + var lastDrop = 0; + + function onDrop(e) { + var cm = this; + clearDragCursor(cm); + if (signalDOMEvent(cm, e) || eventInWidget(cm.display, e)) + return; + e_preventDefault(e); + if (ie) lastDrop = +new Date; + var pos = posFromMouse(cm, e, true), files = e.dataTransfer.files; + if (!pos || cm.isReadOnly()) return; + // Might be a file drop, in which case we simply extract the text + // and insert it. + if (files && files.length && window.FileReader && window.File) { + var n = files.length, text = Array(n), read = 0; + var loadFile = function(file, i) { + if (cm.options.allowDropFileTypes && + indexOf(cm.options.allowDropFileTypes, file.type) == -1) + return; + + var reader = new FileReader; + reader.onload = operation(cm, function() { + var content = reader.result; + if (/[\x00-\x08\x0e-\x1f]{2}/.test(content)) content = ""; + text[i] = content; + if (++read == n) { + pos = clipPos(cm.doc, pos); + var change = {from: pos, to: pos, + text: cm.doc.splitLines(text.join(cm.doc.lineSeparator())), + origin: "paste"}; + makeChange(cm.doc, change); + setSelectionReplaceHistory(cm.doc, simpleSelection(pos, changeEnd(change))); + } + }); + reader.readAsText(file); + }; + for (var i = 0; i < n; ++i) loadFile(files[i], i); + } else { // Normal drop + // Don't do a replace if the drop happened inside of the selected text. + if (cm.state.draggingText && cm.doc.sel.contains(pos) > -1) { + cm.state.draggingText(e); + // Ensure the editor is re-focused + setTimeout(function() {cm.display.input.focus();}, 20); + return; + } + try { + var text = e.dataTransfer.getData("Text"); + if (text) { + if (cm.state.draggingText && !cm.state.draggingText.copy) + var selected = cm.listSelections(); + setSelectionNoUndo(cm.doc, simpleSelection(pos, pos)); + if (selected) for (var i = 0; i < selected.length; ++i) + replaceRange(cm.doc, "", selected[i].anchor, selected[i].head, "drag"); + cm.replaceSelection(text, "around", "paste"); + cm.display.input.focus(); + } + } + catch(e){} + } + } + + function onDragStart(cm, e) { + if (ie && (!cm.state.draggingText || +new Date - lastDrop < 100)) { e_stop(e); return; } + if (signalDOMEvent(cm, e) || eventInWidget(cm.display, e)) return; + + e.dataTransfer.setData("Text", cm.getSelection()); + e.dataTransfer.effectAllowed = "copyMove" + + // Use dummy image instead of default browsers image. + // Recent Safari (~6.0.2) have a tendency to segfault when this happens, so we don't do it there. + if (e.dataTransfer.setDragImage && !safari) { + var img = elt("img", null, null, "position: fixed; left: 0; top: 0;"); + img.src = "data:image/gif;base64,R0lGODlhAQABAAAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw=="; + if (presto) { + img.width = img.height = 1; + cm.display.wrapper.appendChild(img); + // Force a relayout, or Opera won't use our image for some obscure reason + img._top = img.offsetTop; + } + e.dataTransfer.setDragImage(img, 0, 0); + if (presto) img.parentNode.removeChild(img); + } + } + + function onDragOver(cm, e) { + var pos = posFromMouse(cm, e); + if (!pos) return; + var frag = document.createDocumentFragment(); + drawSelectionCursor(cm, pos, frag); + if (!cm.display.dragCursor) { + cm.display.dragCursor = elt("div", null, "CodeMirror-cursors CodeMirror-dragcursors"); + cm.display.lineSpace.insertBefore(cm.display.dragCursor, cm.display.cursorDiv); + } + removeChildrenAndAdd(cm.display.dragCursor, frag); + } + + function clearDragCursor(cm) { + if (cm.display.dragCursor) { + cm.display.lineSpace.removeChild(cm.display.dragCursor); + cm.display.dragCursor = null; + } + } + + // SCROLL EVENTS + + // Sync the scrollable area and scrollbars, ensure the viewport + // covers the visible area. + function setScrollTop(cm, val) { + if (Math.abs(cm.doc.scrollTop - val) < 2) return; + cm.doc.scrollTop = val; + if (!gecko) updateDisplaySimple(cm, {top: val}); + if (cm.display.scroller.scrollTop != val) cm.display.scroller.scrollTop = val; + cm.display.scrollbars.setScrollTop(val); + if (gecko) updateDisplaySimple(cm); + startWorker(cm, 100); + } + // Sync scroller and scrollbar, ensure the gutter elements are + // aligned. + function setScrollLeft(cm, val, isScroller) { + if (isScroller ? val == cm.doc.scrollLeft : Math.abs(cm.doc.scrollLeft - val) < 2) return; + val = Math.min(val, cm.display.scroller.scrollWidth - cm.display.scroller.clientWidth); + cm.doc.scrollLeft = val; + alignHorizontally(cm); + if (cm.display.scroller.scrollLeft != val) cm.display.scroller.scrollLeft = val; + cm.display.scrollbars.setScrollLeft(val); + } + + // Since the delta values reported on mouse wheel events are + // unstandardized between browsers and even browser versions, and + // generally horribly unpredictable, this code starts by measuring + // the scroll effect that the first few mouse wheel events have, + // and, from that, detects the way it can convert deltas to pixel + // offsets afterwards. + // + // The reason we want to know the amount a wheel event will scroll + // is that it gives us a chance to update the display before the + // actual scrolling happens, reducing flickering. + + var wheelSamples = 0, wheelPixelsPerUnit = null; + // Fill in a browser-detected starting value on browsers where we + // know one. These don't have to be accurate -- the result of them + // being wrong would just be a slight flicker on the first wheel + // scroll (if it is large enough). + if (ie) wheelPixelsPerUnit = -.53; + else if (gecko) wheelPixelsPerUnit = 15; + else if (chrome) wheelPixelsPerUnit = -.7; + else if (safari) wheelPixelsPerUnit = -1/3; + + var wheelEventDelta = function(e) { + var dx = e.wheelDeltaX, dy = e.wheelDeltaY; + if (dx == null && e.detail && e.axis == e.HORIZONTAL_AXIS) dx = e.detail; + if (dy == null && e.detail && e.axis == e.VERTICAL_AXIS) dy = e.detail; + else if (dy == null) dy = e.wheelDelta; + return {x: dx, y: dy}; + }; + CodeMirror.wheelEventPixels = function(e) { + var delta = wheelEventDelta(e); + delta.x *= wheelPixelsPerUnit; + delta.y *= wheelPixelsPerUnit; + return delta; + }; + + function onScrollWheel(cm, e) { + var delta = wheelEventDelta(e), dx = delta.x, dy = delta.y; + + var display = cm.display, scroll = display.scroller; + // Quit if there's nothing to scroll here + var canScrollX = scroll.scrollWidth > scroll.clientWidth; + var canScrollY = scroll.scrollHeight > scroll.clientHeight; + if (!(dx && canScrollX || dy && canScrollY)) return; + + // Webkit browsers on OS X abort momentum scrolls when the target + // of the scroll event is removed from the scrollable element. + // This hack (see related code in patchDisplay) makes sure the + // element is kept around. + if (dy && mac && webkit) { + outer: for (var cur = e.target, view = display.view; cur != scroll; cur = cur.parentNode) { + for (var i = 0; i < view.length; i++) { + if (view[i].node == cur) { + cm.display.currentWheelTarget = cur; + break outer; + } + } + } + } + + // On some browsers, horizontal scrolling will cause redraws to + // happen before the gutter has been realigned, causing it to + // wriggle around in a most unseemly way. When we have an + // estimated pixels/delta value, we just handle horizontal + // scrolling entirely here. It'll be slightly off from native, but + // better than glitching out. + if (dx && !gecko && !presto && wheelPixelsPerUnit != null) { + if (dy && canScrollY) + setScrollTop(cm, Math.max(0, Math.min(scroll.scrollTop + dy * wheelPixelsPerUnit, scroll.scrollHeight - scroll.clientHeight))); + setScrollLeft(cm, Math.max(0, Math.min(scroll.scrollLeft + dx * wheelPixelsPerUnit, scroll.scrollWidth - scroll.clientWidth))); + // Only prevent default scrolling if vertical scrolling is + // actually possible. Otherwise, it causes vertical scroll + // jitter on OSX trackpads when deltaX is small and deltaY + // is large (issue #3579) + if (!dy || (dy && canScrollY)) + e_preventDefault(e); + display.wheelStartX = null; // Abort measurement, if in progress + return; + } + + // 'Project' the visible viewport to cover the area that is being + // scrolled into view (if we know enough to estimate it). + if (dy && wheelPixelsPerUnit != null) { + var pixels = dy * wheelPixelsPerUnit; + var top = cm.doc.scrollTop, bot = top + display.wrapper.clientHeight; + if (pixels < 0) top = Math.max(0, top + pixels - 50); + else bot = Math.min(cm.doc.height, bot + pixels + 50); + updateDisplaySimple(cm, {top: top, bottom: bot}); + } + + if (wheelSamples < 20) { + if (display.wheelStartX == null) { + display.wheelStartX = scroll.scrollLeft; display.wheelStartY = scroll.scrollTop; + display.wheelDX = dx; display.wheelDY = dy; + setTimeout(function() { + if (display.wheelStartX == null) return; + var movedX = scroll.scrollLeft - display.wheelStartX; + var movedY = scroll.scrollTop - display.wheelStartY; + var sample = (movedY && display.wheelDY && movedY / display.wheelDY) || + (movedX && display.wheelDX && movedX / display.wheelDX); + display.wheelStartX = display.wheelStartY = null; + if (!sample) return; + wheelPixelsPerUnit = (wheelPixelsPerUnit * wheelSamples + sample) / (wheelSamples + 1); + ++wheelSamples; + }, 200); + } else { + display.wheelDX += dx; display.wheelDY += dy; + } + } + } + + // KEY EVENTS + + // Run a handler that was bound to a key. + function doHandleBinding(cm, bound, dropShift) { + if (typeof bound == "string") { + bound = commands[bound]; + if (!bound) return false; + } + // Ensure previous input has been read, so that the handler sees a + // consistent view of the document + cm.display.input.ensurePolled(); + var prevShift = cm.display.shift, done = false; + try { + if (cm.isReadOnly()) cm.state.suppressEdits = true; + if (dropShift) cm.display.shift = false; + done = bound(cm) != Pass; + } finally { + cm.display.shift = prevShift; + cm.state.suppressEdits = false; + } + return done; + } + + function lookupKeyForEditor(cm, name, handle) { + for (var i = 0; i < cm.state.keyMaps.length; i++) { + var result = lookupKey(name, cm.state.keyMaps[i], handle, cm); + if (result) return result; + } + return (cm.options.extraKeys && lookupKey(name, cm.options.extraKeys, handle, cm)) + || lookupKey(name, cm.options.keyMap, handle, cm); + } + + var stopSeq = new Delayed; + function dispatchKey(cm, name, e, handle) { + var seq = cm.state.keySeq; + if (seq) { + if (isModifierKey(name)) return "handled"; + stopSeq.set(50, function() { + if (cm.state.keySeq == seq) { + cm.state.keySeq = null; + cm.display.input.reset(); + } + }); + name = seq + " " + name; + } + var result = lookupKeyForEditor(cm, name, handle); + + if (result == "multi") + cm.state.keySeq = name; + if (result == "handled") + signalLater(cm, "keyHandled", cm, name, e); + + if (result == "handled" || result == "multi") { + e_preventDefault(e); + restartBlink(cm); + } + + if (seq && !result && /\'$/.test(name)) { + e_preventDefault(e); + return true; + } + return !!result; + } + + // Handle a key from the keydown event. + function handleKeyBinding(cm, e) { + var name = keyName(e, true); + if (!name) return false; + + if (e.shiftKey && !cm.state.keySeq) { + // First try to resolve full name (including 'Shift-'). Failing + // that, see if there is a cursor-motion command (starting with + // 'go') bound to the keyname without 'Shift-'. + return dispatchKey(cm, "Shift-" + name, e, function(b) {return doHandleBinding(cm, b, true);}) + || dispatchKey(cm, name, e, function(b) { + if (typeof b == "string" ? /^go[A-Z]/.test(b) : b.motion) + return doHandleBinding(cm, b); + }); + } else { + return dispatchKey(cm, name, e, function(b) { return doHandleBinding(cm, b); }); + } + } + + // Handle a key from the keypress event + function handleCharBinding(cm, e, ch) { + return dispatchKey(cm, "'" + ch + "'", e, + function(b) { return doHandleBinding(cm, b, true); }); + } + + var lastStoppedKey = null; + function onKeyDown(e) { + var cm = this; + cm.curOp.focus = activeElt(); + if (signalDOMEvent(cm, e)) return; + // IE does strange things with escape. + if (ie && ie_version < 11 && e.keyCode == 27) e.returnValue = false; + var code = e.keyCode; + cm.display.shift = code == 16 || e.shiftKey; + var handled = handleKeyBinding(cm, e); + if (presto) { + lastStoppedKey = handled ? code : null; + // Opera has no cut event... we try to at least catch the key combo + if (!handled && code == 88 && !hasCopyEvent && (mac ? e.metaKey : e.ctrlKey)) + cm.replaceSelection("", null, "cut"); + } + + // Turn mouse into crosshair when Alt is held on Mac. + if (code == 18 && !/\bCodeMirror-crosshair\b/.test(cm.display.lineDiv.className)) + showCrossHair(cm); + } + + function showCrossHair(cm) { + var lineDiv = cm.display.lineDiv; + addClass(lineDiv, "CodeMirror-crosshair"); + + function up(e) { + if (e.keyCode == 18 || !e.altKey) { + rmClass(lineDiv, "CodeMirror-crosshair"); + off(document, "keyup", up); + off(document, "mouseover", up); + } + } + on(document, "keyup", up); + on(document, "mouseover", up); + } + + function onKeyUp(e) { + if (e.keyCode == 16) this.doc.sel.shift = false; + signalDOMEvent(this, e); + } + + function onKeyPress(e) { + var cm = this; + if (eventInWidget(cm.display, e) || signalDOMEvent(cm, e) || e.ctrlKey && !e.altKey || mac && e.metaKey) return; + var keyCode = e.keyCode, charCode = e.charCode; + if (presto && keyCode == lastStoppedKey) {lastStoppedKey = null; e_preventDefault(e); return;} + if ((presto && (!e.which || e.which < 10)) && handleKeyBinding(cm, e)) return; + var ch = String.fromCharCode(charCode == null ? keyCode : charCode); + if (handleCharBinding(cm, e, ch)) return; + cm.display.input.onKeyPress(e); + } + + // FOCUS/BLUR EVENTS + + function delayBlurEvent(cm) { + cm.state.delayingBlurEvent = true; + setTimeout(function() { + if (cm.state.delayingBlurEvent) { + cm.state.delayingBlurEvent = false; + onBlur(cm); + } + }, 100); + } + + function onFocus(cm) { + if (cm.state.delayingBlurEvent) cm.state.delayingBlurEvent = false; + + if (cm.options.readOnly == "nocursor") return; + if (!cm.state.focused) { + signal(cm, "focus", cm); + cm.state.focused = true; + addClass(cm.display.wrapper, "CodeMirror-focused"); + // This test prevents this from firing when a context + // menu is closed (since the input reset would kill the + // select-all detection hack) + if (!cm.curOp && cm.display.selForContextMenu != cm.doc.sel) { + cm.display.input.reset(); + if (webkit) setTimeout(function() { cm.display.input.reset(true); }, 20); // Issue #1730 + } + cm.display.input.receivedFocus(); + } + restartBlink(cm); + } + function onBlur(cm) { + if (cm.state.delayingBlurEvent) return; + + if (cm.state.focused) { + signal(cm, "blur", cm); + cm.state.focused = false; + rmClass(cm.display.wrapper, "CodeMirror-focused"); + } + clearInterval(cm.display.blinker); + setTimeout(function() {if (!cm.state.focused) cm.display.shift = false;}, 150); + } + + // CONTEXT MENU HANDLING + + // To make the context menu work, we need to briefly unhide the + // textarea (making it as unobtrusive as possible) to let the + // right-click take effect on it. + function onContextMenu(cm, e) { + if (eventInWidget(cm.display, e) || contextMenuInGutter(cm, e)) return; + if (signalDOMEvent(cm, e, "contextmenu")) return; + cm.display.input.onContextMenu(e); + } + + function contextMenuInGutter(cm, e) { + if (!hasHandler(cm, "gutterContextMenu")) return false; + return gutterEvent(cm, e, "gutterContextMenu", false); + } + + // UPDATING + + // Compute the position of the end of a change (its 'to' property + // refers to the pre-change end). + var changeEnd = CodeMirror.changeEnd = function(change) { + if (!change.text) return change.to; + return Pos(change.from.line + change.text.length - 1, + lst(change.text).length + (change.text.length == 1 ? change.from.ch : 0)); + }; + + // Adjust a position to refer to the post-change position of the + // same text, or the end of the change if the change covers it. + function adjustForChange(pos, change) { + if (cmp(pos, change.from) < 0) return pos; + if (cmp(pos, change.to) <= 0) return changeEnd(change); + + var line = pos.line + change.text.length - (change.to.line - change.from.line) - 1, ch = pos.ch; + if (pos.line == change.to.line) ch += changeEnd(change).ch - change.to.ch; + return Pos(line, ch); + } + + function computeSelAfterChange(doc, change) { + var out = []; + for (var i = 0; i < doc.sel.ranges.length; i++) { + var range = doc.sel.ranges[i]; + out.push(new Range(adjustForChange(range.anchor, change), + adjustForChange(range.head, change))); + } + return normalizeSelection(out, doc.sel.primIndex); + } + + function offsetPos(pos, old, nw) { + if (pos.line == old.line) + return Pos(nw.line, pos.ch - old.ch + nw.ch); + else + return Pos(nw.line + (pos.line - old.line), pos.ch); + } + + // Used by replaceSelections to allow moving the selection to the + // start or around the replaced test. Hint may be "start" or "around". + function computeReplacedSel(doc, changes, hint) { + var out = []; + var oldPrev = Pos(doc.first, 0), newPrev = oldPrev; + for (var i = 0; i < changes.length; i++) { + var change = changes[i]; + var from = offsetPos(change.from, oldPrev, newPrev); + var to = offsetPos(changeEnd(change), oldPrev, newPrev); + oldPrev = change.to; + newPrev = to; + if (hint == "around") { + var range = doc.sel.ranges[i], inv = cmp(range.head, range.anchor) < 0; + out[i] = new Range(inv ? to : from, inv ? from : to); + } else { + out[i] = new Range(from, from); + } + } + return new Selection(out, doc.sel.primIndex); + } + + // Allow "beforeChange" event handlers to influence a change + function filterChange(doc, change, update) { + var obj = { + canceled: false, + from: change.from, + to: change.to, + text: change.text, + origin: change.origin, + cancel: function() { this.canceled = true; } + }; + if (update) obj.update = function(from, to, text, origin) { + if (from) this.from = clipPos(doc, from); + if (to) this.to = clipPos(doc, to); + if (text) this.text = text; + if (origin !== undefined) this.origin = origin; + }; + signal(doc, "beforeChange", doc, obj); + if (doc.cm) signal(doc.cm, "beforeChange", doc.cm, obj); + + if (obj.canceled) return null; + return {from: obj.from, to: obj.to, text: obj.text, origin: obj.origin}; + } + + // Apply a change to a document, and add it to the document's + // history, and propagating it to all linked documents. + function makeChange(doc, change, ignoreReadOnly) { + if (doc.cm) { + if (!doc.cm.curOp) return operation(doc.cm, makeChange)(doc, change, ignoreReadOnly); + if (doc.cm.state.suppressEdits) return; + } + + if (hasHandler(doc, "beforeChange") || doc.cm && hasHandler(doc.cm, "beforeChange")) { + change = filterChange(doc, change, true); + if (!change) return; + } + + // Possibly split or suppress the update based on the presence + // of read-only spans in its range. + var split = sawReadOnlySpans && !ignoreReadOnly && removeReadOnlyRanges(doc, change.from, change.to); + if (split) { + for (var i = split.length - 1; i >= 0; --i) + makeChangeInner(doc, {from: split[i].from, to: split[i].to, text: i ? [""] : change.text}); + } else { + makeChangeInner(doc, change); + } + } + + function makeChangeInner(doc, change) { + if (change.text.length == 1 && change.text[0] == "" && cmp(change.from, change.to) == 0) return; + var selAfter = computeSelAfterChange(doc, change); + addChangeToHistory(doc, change, selAfter, doc.cm ? doc.cm.curOp.id : NaN); + + makeChangeSingleDoc(doc, change, selAfter, stretchSpansOverChange(doc, change)); + var rebased = []; + + linkedDocs(doc, function(doc, sharedHist) { + if (!sharedHist && indexOf(rebased, doc.history) == -1) { + rebaseHist(doc.history, change); + rebased.push(doc.history); + } + makeChangeSingleDoc(doc, change, null, stretchSpansOverChange(doc, change)); + }); + } + + // Revert a change stored in a document's history. + function makeChangeFromHistory(doc, type, allowSelectionOnly) { + if (doc.cm && doc.cm.state.suppressEdits && !allowSelectionOnly) return; + + var hist = doc.history, event, selAfter = doc.sel; + var source = type == "undo" ? hist.done : hist.undone, dest = type == "undo" ? hist.undone : hist.done; + + // Verify that there is a useable event (so that ctrl-z won't + // needlessly clear selection events) + for (var i = 0; i < source.length; i++) { + event = source[i]; + if (allowSelectionOnly ? event.ranges && !event.equals(doc.sel) : !event.ranges) + break; + } + if (i == source.length) return; + hist.lastOrigin = hist.lastSelOrigin = null; + + for (;;) { + event = source.pop(); + if (event.ranges) { + pushSelectionToHistory(event, dest); + if (allowSelectionOnly && !event.equals(doc.sel)) { + setSelection(doc, event, {clearRedo: false}); + return; + } + selAfter = event; + } + else break; + } + + // Build up a reverse change object to add to the opposite history + // stack (redo when undoing, and vice versa). + var antiChanges = []; + pushSelectionToHistory(selAfter, dest); + dest.push({changes: antiChanges, generation: hist.generation}); + hist.generation = event.generation || ++hist.maxGeneration; + + var filter = hasHandler(doc, "beforeChange") || doc.cm && hasHandler(doc.cm, "beforeChange"); + + for (var i = event.changes.length - 1; i >= 0; --i) { + var change = event.changes[i]; + change.origin = type; + if (filter && !filterChange(doc, change, false)) { + source.length = 0; + return; + } + + antiChanges.push(historyChangeFromChange(doc, change)); + + var after = i ? computeSelAfterChange(doc, change) : lst(source); + makeChangeSingleDoc(doc, change, after, mergeOldSpans(doc, change)); + if (!i && doc.cm) doc.cm.scrollIntoView({from: change.from, to: changeEnd(change)}); + var rebased = []; + + // Propagate to the linked documents + linkedDocs(doc, function(doc, sharedHist) { + if (!sharedHist && indexOf(rebased, doc.history) == -1) { + rebaseHist(doc.history, change); + rebased.push(doc.history); + } + makeChangeSingleDoc(doc, change, null, mergeOldSpans(doc, change)); + }); + } + } + + // Sub-views need their line numbers shifted when text is added + // above or below them in the parent document. + function shiftDoc(doc, distance) { + if (distance == 0) return; + doc.first += distance; + doc.sel = new Selection(map(doc.sel.ranges, function(range) { + return new Range(Pos(range.anchor.line + distance, range.anchor.ch), + Pos(range.head.line + distance, range.head.ch)); + }), doc.sel.primIndex); + if (doc.cm) { + regChange(doc.cm, doc.first, doc.first - distance, distance); + for (var d = doc.cm.display, l = d.viewFrom; l < d.viewTo; l++) + regLineChange(doc.cm, l, "gutter"); + } + } + + // More lower-level change function, handling only a single document + // (not linked ones). + function makeChangeSingleDoc(doc, change, selAfter, spans) { + if (doc.cm && !doc.cm.curOp) + return operation(doc.cm, makeChangeSingleDoc)(doc, change, selAfter, spans); + + if (change.to.line < doc.first) { + shiftDoc(doc, change.text.length - 1 - (change.to.line - change.from.line)); + return; + } + if (change.from.line > doc.lastLine()) return; + + // Clip the change to the size of this doc + if (change.from.line < doc.first) { + var shift = change.text.length - 1 - (doc.first - change.from.line); + shiftDoc(doc, shift); + change = {from: Pos(doc.first, 0), to: Pos(change.to.line + shift, change.to.ch), + text: [lst(change.text)], origin: change.origin}; + } + var last = doc.lastLine(); + if (change.to.line > last) { + change = {from: change.from, to: Pos(last, getLine(doc, last).text.length), + text: [change.text[0]], origin: change.origin}; + } + + change.removed = getBetween(doc, change.from, change.to); + + if (!selAfter) selAfter = computeSelAfterChange(doc, change); + if (doc.cm) makeChangeSingleDocInEditor(doc.cm, change, spans); + else updateDoc(doc, change, spans); + setSelectionNoUndo(doc, selAfter, sel_dontScroll); + } + + // Handle the interaction of a change to a document with the editor + // that this document is part of. + function makeChangeSingleDocInEditor(cm, change, spans) { + var doc = cm.doc, display = cm.display, from = change.from, to = change.to; + + var recomputeMaxLength = false, checkWidthStart = from.line; + if (!cm.options.lineWrapping) { + checkWidthStart = lineNo(visualLine(getLine(doc, from.line))); + doc.iter(checkWidthStart, to.line + 1, function(line) { + if (line == display.maxLine) { + recomputeMaxLength = true; + return true; + } + }); + } + + if (doc.sel.contains(change.from, change.to) > -1) + signalCursorActivity(cm); + + updateDoc(doc, change, spans, estimateHeight(cm)); + + if (!cm.options.lineWrapping) { + doc.iter(checkWidthStart, from.line + change.text.length, function(line) { + var len = lineLength(line); + if (len > display.maxLineLength) { + display.maxLine = line; + display.maxLineLength = len; + display.maxLineChanged = true; + recomputeMaxLength = false; + } + }); + if (recomputeMaxLength) cm.curOp.updateMaxLine = true; + } + + // Adjust frontier, schedule worker + doc.frontier = Math.min(doc.frontier, from.line); + startWorker(cm, 400); + + var lendiff = change.text.length - (to.line - from.line) - 1; + // Remember that these lines changed, for updating the display + if (change.full) + regChange(cm); + else if (from.line == to.line && change.text.length == 1 && !isWholeLineUpdate(cm.doc, change)) + regLineChange(cm, from.line, "text"); + else + regChange(cm, from.line, to.line + 1, lendiff); + + var changesHandler = hasHandler(cm, "changes"), changeHandler = hasHandler(cm, "change"); + if (changeHandler || changesHandler) { + var obj = { + from: from, to: to, + text: change.text, + removed: change.removed, + origin: change.origin + }; + if (changeHandler) signalLater(cm, "change", cm, obj); + if (changesHandler) (cm.curOp.changeObjs || (cm.curOp.changeObjs = [])).push(obj); + } + cm.display.selForContextMenu = null; + } + + function replaceRange(doc, code, from, to, origin) { + if (!to) to = from; + if (cmp(to, from) < 0) { var tmp = to; to = from; from = tmp; } + if (typeof code == "string") code = doc.splitLines(code); + makeChange(doc, {from: from, to: to, text: code, origin: origin}); + } + + // SCROLLING THINGS INTO VIEW + + // If an editor sits on the top or bottom of the window, partially + // scrolled out of view, this ensures that the cursor is visible. + function maybeScrollWindow(cm, coords) { + if (signalDOMEvent(cm, "scrollCursorIntoView")) return; + + var display = cm.display, box = display.sizer.getBoundingClientRect(), doScroll = null; + if (coords.top + box.top < 0) doScroll = true; + else if (coords.bottom + box.top > (window.innerHeight || document.documentElement.clientHeight)) doScroll = false; + if (doScroll != null && !phantom) { + var scrollNode = elt("div", "\u200b", null, "position: absolute; top: " + + (coords.top - display.viewOffset - paddingTop(cm.display)) + "px; height: " + + (coords.bottom - coords.top + scrollGap(cm) + display.barHeight) + "px; left: " + + coords.left + "px; width: 2px;"); + cm.display.lineSpace.appendChild(scrollNode); + scrollNode.scrollIntoView(doScroll); + cm.display.lineSpace.removeChild(scrollNode); + } + } + + // Scroll a given position into view (immediately), verifying that + // it actually became visible (as line heights are accurately + // measured, the position of something may 'drift' during drawing). + function scrollPosIntoView(cm, pos, end, margin) { + if (margin == null) margin = 0; + for (var limit = 0; limit < 5; limit++) { + var changed = false, coords = cursorCoords(cm, pos); + var endCoords = !end || end == pos ? coords : cursorCoords(cm, end); + var scrollPos = calculateScrollPos(cm, Math.min(coords.left, endCoords.left), + Math.min(coords.top, endCoords.top) - margin, + Math.max(coords.left, endCoords.left), + Math.max(coords.bottom, endCoords.bottom) + margin); + var startTop = cm.doc.scrollTop, startLeft = cm.doc.scrollLeft; + if (scrollPos.scrollTop != null) { + setScrollTop(cm, scrollPos.scrollTop); + if (Math.abs(cm.doc.scrollTop - startTop) > 1) changed = true; + } + if (scrollPos.scrollLeft != null) { + setScrollLeft(cm, scrollPos.scrollLeft); + if (Math.abs(cm.doc.scrollLeft - startLeft) > 1) changed = true; + } + if (!changed) break; + } + return coords; + } + + // Scroll a given set of coordinates into view (immediately). + function scrollIntoView(cm, x1, y1, x2, y2) { + var scrollPos = calculateScrollPos(cm, x1, y1, x2, y2); + if (scrollPos.scrollTop != null) setScrollTop(cm, scrollPos.scrollTop); + if (scrollPos.scrollLeft != null) setScrollLeft(cm, scrollPos.scrollLeft); + } + + // Calculate a new scroll position needed to scroll the given + // rectangle into view. Returns an object with scrollTop and + // scrollLeft properties. When these are undefined, the + // vertical/horizontal position does not need to be adjusted. + function calculateScrollPos(cm, x1, y1, x2, y2) { + var display = cm.display, snapMargin = textHeight(cm.display); + if (y1 < 0) y1 = 0; + var screentop = cm.curOp && cm.curOp.scrollTop != null ? cm.curOp.scrollTop : display.scroller.scrollTop; + var screen = displayHeight(cm), result = {}; + if (y2 - y1 > screen) y2 = y1 + screen; + var docBottom = cm.doc.height + paddingVert(display); + var atTop = y1 < snapMargin, atBottom = y2 > docBottom - snapMargin; + if (y1 < screentop) { + result.scrollTop = atTop ? 0 : y1; + } else if (y2 > screentop + screen) { + var newTop = Math.min(y1, (atBottom ? docBottom : y2) - screen); + if (newTop != screentop) result.scrollTop = newTop; + } + + var screenleft = cm.curOp && cm.curOp.scrollLeft != null ? cm.curOp.scrollLeft : display.scroller.scrollLeft; + var screenw = displayWidth(cm) - (cm.options.fixedGutter ? display.gutters.offsetWidth : 0); + var tooWide = x2 - x1 > screenw; + if (tooWide) x2 = x1 + screenw; + if (x1 < 10) + result.scrollLeft = 0; + else if (x1 < screenleft) + result.scrollLeft = Math.max(0, x1 - (tooWide ? 0 : 10)); + else if (x2 > screenw + screenleft - 3) + result.scrollLeft = x2 + (tooWide ? 0 : 10) - screenw; + return result; + } + + // Store a relative adjustment to the scroll position in the current + // operation (to be applied when the operation finishes). + function addToScrollPos(cm, left, top) { + if (left != null || top != null) resolveScrollToPos(cm); + if (left != null) + cm.curOp.scrollLeft = (cm.curOp.scrollLeft == null ? cm.doc.scrollLeft : cm.curOp.scrollLeft) + left; + if (top != null) + cm.curOp.scrollTop = (cm.curOp.scrollTop == null ? cm.doc.scrollTop : cm.curOp.scrollTop) + top; + } + + // Make sure that at the end of the operation the current cursor is + // shown. + function ensureCursorVisible(cm) { + resolveScrollToPos(cm); + var cur = cm.getCursor(), from = cur, to = cur; + if (!cm.options.lineWrapping) { + from = cur.ch ? Pos(cur.line, cur.ch - 1) : cur; + to = Pos(cur.line, cur.ch + 1); + } + cm.curOp.scrollToPos = {from: from, to: to, margin: cm.options.cursorScrollMargin, isCursor: true}; + } + + // When an operation has its scrollToPos property set, and another + // scroll action is applied before the end of the operation, this + // 'simulates' scrolling that position into view in a cheap way, so + // that the effect of intermediate scroll commands is not ignored. + function resolveScrollToPos(cm) { + var range = cm.curOp.scrollToPos; + if (range) { + cm.curOp.scrollToPos = null; + var from = estimateCoords(cm, range.from), to = estimateCoords(cm, range.to); + var sPos = calculateScrollPos(cm, Math.min(from.left, to.left), + Math.min(from.top, to.top) - range.margin, + Math.max(from.right, to.right), + Math.max(from.bottom, to.bottom) + range.margin); + cm.scrollTo(sPos.scrollLeft, sPos.scrollTop); + } + } + + // API UTILITIES + + // Indent the given line. The how parameter can be "smart", + // "add"/null, "subtract", or "prev". When aggressive is false + // (typically set to true for forced single-line indents), empty + // lines are not indented, and places where the mode returns Pass + // are left alone. + function indentLine(cm, n, how, aggressive) { + var doc = cm.doc, state; + if (how == null) how = "add"; + if (how == "smart") { + // Fall back to "prev" when the mode doesn't have an indentation + // method. + if (!doc.mode.indent) how = "prev"; + else state = getStateBefore(cm, n); + } + + var tabSize = cm.options.tabSize; + var line = getLine(doc, n), curSpace = countColumn(line.text, null, tabSize); + if (line.stateAfter) line.stateAfter = null; + var curSpaceString = line.text.match(/^\s*/)[0], indentation; + if (!aggressive && !/\S/.test(line.text)) { + indentation = 0; + how = "not"; + } else if (how == "smart") { + indentation = doc.mode.indent(state, line.text.slice(curSpaceString.length), line.text); + if (indentation == Pass || indentation > 150) { + if (!aggressive) return; + how = "prev"; + } + } + if (how == "prev") { + if (n > doc.first) indentation = countColumn(getLine(doc, n-1).text, null, tabSize); + else indentation = 0; + } else if (how == "add") { + indentation = curSpace + cm.options.indentUnit; + } else if (how == "subtract") { + indentation = curSpace - cm.options.indentUnit; + } else if (typeof how == "number") { + indentation = curSpace + how; + } + indentation = Math.max(0, indentation); + + var indentString = "", pos = 0; + if (cm.options.indentWithTabs) + for (var i = Math.floor(indentation / tabSize); i; --i) {pos += tabSize; indentString += "\t";} + if (pos < indentation) indentString += spaceStr(indentation - pos); + + if (indentString != curSpaceString) { + replaceRange(doc, indentString, Pos(n, 0), Pos(n, curSpaceString.length), "+input"); + line.stateAfter = null; + return true; + } else { + // Ensure that, if the cursor was in the whitespace at the start + // of the line, it is moved to the end of that space. + for (var i = 0; i < doc.sel.ranges.length; i++) { + var range = doc.sel.ranges[i]; + if (range.head.line == n && range.head.ch < curSpaceString.length) { + var pos = Pos(n, curSpaceString.length); + replaceOneSelection(doc, i, new Range(pos, pos)); + break; + } + } + } + } + + // Utility for applying a change to a line by handle or number, + // returning the number and optionally registering the line as + // changed. + function changeLine(doc, handle, changeType, op) { + var no = handle, line = handle; + if (typeof handle == "number") line = getLine(doc, clipLine(doc, handle)); + else no = lineNo(handle); + if (no == null) return null; + if (op(line, no) && doc.cm) regLineChange(doc.cm, no, changeType); + return line; + } + + // Helper for deleting text near the selection(s), used to implement + // backspace, delete, and similar functionality. + function deleteNearSelection(cm, compute) { + var ranges = cm.doc.sel.ranges, kill = []; + // Build up a set of ranges to kill first, merging overlapping + // ranges. + for (var i = 0; i < ranges.length; i++) { + var toKill = compute(ranges[i]); + while (kill.length && cmp(toKill.from, lst(kill).to) <= 0) { + var replaced = kill.pop(); + if (cmp(replaced.from, toKill.from) < 0) { + toKill.from = replaced.from; + break; + } + } + kill.push(toKill); + } + // Next, remove those actual ranges. + runInOp(cm, function() { + for (var i = kill.length - 1; i >= 0; i--) + replaceRange(cm.doc, "", kill[i].from, kill[i].to, "+delete"); + ensureCursorVisible(cm); + }); + } + + // Used for horizontal relative motion. Dir is -1 or 1 (left or + // right), unit can be "char", "column" (like char, but doesn't + // cross line boundaries), "word" (across next word), or "group" (to + // the start of next group of word or non-word-non-whitespace + // chars). The visually param controls whether, in right-to-left + // text, direction 1 means to move towards the next index in the + // string, or towards the character to the right of the current + // position. The resulting position will have a hitSide=true + // property if it reached the end of the document. + function findPosH(doc, pos, dir, unit, visually) { + var line = pos.line, ch = pos.ch, origDir = dir; + var lineObj = getLine(doc, line); + function findNextLine() { + var l = line + dir; + if (l < doc.first || l >= doc.first + doc.size) return false + line = l; + return lineObj = getLine(doc, l); + } + function moveOnce(boundToLine) { + var next = (visually ? moveVisually : moveLogically)(lineObj, ch, dir, true); + if (next == null) { + if (!boundToLine && findNextLine()) { + if (visually) ch = (dir < 0 ? lineRight : lineLeft)(lineObj); + else ch = dir < 0 ? lineObj.text.length : 0; + } else return false + } else ch = next; + return true; + } + + if (unit == "char") { + moveOnce() + } else if (unit == "column") { + moveOnce(true) + } else if (unit == "word" || unit == "group") { + var sawType = null, group = unit == "group"; + var helper = doc.cm && doc.cm.getHelper(pos, "wordChars"); + for (var first = true;; first = false) { + if (dir < 0 && !moveOnce(!first)) break; + var cur = lineObj.text.charAt(ch) || "\n"; + var type = isWordChar(cur, helper) ? "w" + : group && cur == "\n" ? "n" + : !group || /\s/.test(cur) ? null + : "p"; + if (group && !first && !type) type = "s"; + if (sawType && sawType != type) { + if (dir < 0) {dir = 1; moveOnce();} + break; + } + + if (type) sawType = type; + if (dir > 0 && !moveOnce(!first)) break; + } + } + var result = skipAtomic(doc, Pos(line, ch), pos, origDir, true); + if (!cmp(pos, result)) result.hitSide = true; + return result; + } + + // For relative vertical movement. Dir may be -1 or 1. Unit can be + // "page" or "line". The resulting position will have a hitSide=true + // property if it reached the end of the document. + function findPosV(cm, pos, dir, unit) { + var doc = cm.doc, x = pos.left, y; + if (unit == "page") { + var pageSize = Math.min(cm.display.wrapper.clientHeight, window.innerHeight || document.documentElement.clientHeight); + y = pos.top + dir * (pageSize - (dir < 0 ? 1.5 : .5) * textHeight(cm.display)); + } else if (unit == "line") { + y = dir > 0 ? pos.bottom + 3 : pos.top - 3; + } + for (;;) { + var target = coordsChar(cm, x, y); + if (!target.outside) break; + if (dir < 0 ? y <= 0 : y >= doc.height) { target.hitSide = true; break; } + y += dir * 5; + } + return target; + } + + // EDITOR METHODS + + // The publicly visible API. Note that methodOp(f) means + // 'wrap f in an operation, performed on its `this` parameter'. + + // This is not the complete set of editor methods. Most of the + // methods defined on the Doc type are also injected into + // CodeMirror.prototype, for backwards compatibility and + // convenience. + + CodeMirror.prototype = { + constructor: CodeMirror, + focus: function(){window.focus(); this.display.input.focus();}, + + setOption: function(option, value) { + var options = this.options, old = options[option]; + if (options[option] == value && option != "mode") return; + options[option] = value; + if (optionHandlers.hasOwnProperty(option)) + operation(this, optionHandlers[option])(this, value, old); + }, + + getOption: function(option) {return this.options[option];}, + getDoc: function() {return this.doc;}, + + addKeyMap: function(map, bottom) { + this.state.keyMaps[bottom ? "push" : "unshift"](getKeyMap(map)); + }, + removeKeyMap: function(map) { + var maps = this.state.keyMaps; + for (var i = 0; i < maps.length; ++i) + if (maps[i] == map || maps[i].name == map) { + maps.splice(i, 1); + return true; + } + }, + + addOverlay: methodOp(function(spec, options) { + var mode = spec.token ? spec : CodeMirror.getMode(this.options, spec); + if (mode.startState) throw new Error("Overlays may not be stateful."); + this.state.overlays.push({mode: mode, modeSpec: spec, opaque: options && options.opaque}); + this.state.modeGen++; + regChange(this); + }), + removeOverlay: methodOp(function(spec) { + var overlays = this.state.overlays; + for (var i = 0; i < overlays.length; ++i) { + var cur = overlays[i].modeSpec; + if (cur == spec || typeof spec == "string" && cur.name == spec) { + overlays.splice(i, 1); + this.state.modeGen++; + regChange(this); + return; + } + } + }), + + indentLine: methodOp(function(n, dir, aggressive) { + if (typeof dir != "string" && typeof dir != "number") { + if (dir == null) dir = this.options.smartIndent ? "smart" : "prev"; + else dir = dir ? "add" : "subtract"; + } + if (isLine(this.doc, n)) indentLine(this, n, dir, aggressive); + }), + indentSelection: methodOp(function(how) { + var ranges = this.doc.sel.ranges, end = -1; + for (var i = 0; i < ranges.length; i++) { + var range = ranges[i]; + if (!range.empty()) { + var from = range.from(), to = range.to(); + var start = Math.max(end, from.line); + end = Math.min(this.lastLine(), to.line - (to.ch ? 0 : 1)) + 1; + for (var j = start; j < end; ++j) + indentLine(this, j, how); + var newRanges = this.doc.sel.ranges; + if (from.ch == 0 && ranges.length == newRanges.length && newRanges[i].from().ch > 0) + replaceOneSelection(this.doc, i, new Range(from, newRanges[i].to()), sel_dontScroll); + } else if (range.head.line > end) { + indentLine(this, range.head.line, how, true); + end = range.head.line; + if (i == this.doc.sel.primIndex) ensureCursorVisible(this); + } + } + }), + + // Fetch the parser token for a given character. Useful for hacks + // that want to inspect the mode state (say, for completion). + getTokenAt: function(pos, precise) { + return takeToken(this, pos, precise); + }, + + getLineTokens: function(line, precise) { + return takeToken(this, Pos(line), precise, true); + }, + + getTokenTypeAt: function(pos) { + pos = clipPos(this.doc, pos); + var styles = getLineStyles(this, getLine(this.doc, pos.line)); + var before = 0, after = (styles.length - 1) / 2, ch = pos.ch; + var type; + if (ch == 0) type = styles[2]; + else for (;;) { + var mid = (before + after) >> 1; + if ((mid ? styles[mid * 2 - 1] : 0) >= ch) after = mid; + else if (styles[mid * 2 + 1] < ch) before = mid + 1; + else { type = styles[mid * 2 + 2]; break; } + } + var cut = type ? type.indexOf("cm-overlay ") : -1; + return cut < 0 ? type : cut == 0 ? null : type.slice(0, cut - 1); + }, + + getModeAt: function(pos) { + var mode = this.doc.mode; + if (!mode.innerMode) return mode; + return CodeMirror.innerMode(mode, this.getTokenAt(pos).state).mode; + }, + + getHelper: function(pos, type) { + return this.getHelpers(pos, type)[0]; + }, + + getHelpers: function(pos, type) { + var found = []; + if (!helpers.hasOwnProperty(type)) return found; + var help = helpers[type], mode = this.getModeAt(pos); + if (typeof mode[type] == "string") { + if (help[mode[type]]) found.push(help[mode[type]]); + } else if (mode[type]) { + for (var i = 0; i < mode[type].length; i++) { + var val = help[mode[type][i]]; + if (val) found.push(val); + } + } else if (mode.helperType && help[mode.helperType]) { + found.push(help[mode.helperType]); + } else if (help[mode.name]) { + found.push(help[mode.name]); + } + for (var i = 0; i < help._global.length; i++) { + var cur = help._global[i]; + if (cur.pred(mode, this) && indexOf(found, cur.val) == -1) + found.push(cur.val); + } + return found; + }, + + getStateAfter: function(line, precise) { + var doc = this.doc; + line = clipLine(doc, line == null ? doc.first + doc.size - 1: line); + return getStateBefore(this, line + 1, precise); + }, + + cursorCoords: function(start, mode) { + var pos, range = this.doc.sel.primary(); + if (start == null) pos = range.head; + else if (typeof start == "object") pos = clipPos(this.doc, start); + else pos = start ? range.from() : range.to(); + return cursorCoords(this, pos, mode || "page"); + }, + + charCoords: function(pos, mode) { + return charCoords(this, clipPos(this.doc, pos), mode || "page"); + }, + + coordsChar: function(coords, mode) { + coords = fromCoordSystem(this, coords, mode || "page"); + return coordsChar(this, coords.left, coords.top); + }, + + lineAtHeight: function(height, mode) { + height = fromCoordSystem(this, {top: height, left: 0}, mode || "page").top; + return lineAtHeight(this.doc, height + this.display.viewOffset); + }, + heightAtLine: function(line, mode) { + var end = false, lineObj; + if (typeof line == "number") { + var last = this.doc.first + this.doc.size - 1; + if (line < this.doc.first) line = this.doc.first; + else if (line > last) { line = last; end = true; } + lineObj = getLine(this.doc, line); + } else { + lineObj = line; + } + return intoCoordSystem(this, lineObj, {top: 0, left: 0}, mode || "page").top + + (end ? this.doc.height - heightAtLine(lineObj) : 0); + }, + + defaultTextHeight: function() { return textHeight(this.display); }, + defaultCharWidth: function() { return charWidth(this.display); }, + + setGutterMarker: methodOp(function(line, gutterID, value) { + return changeLine(this.doc, line, "gutter", function(line) { + var markers = line.gutterMarkers || (line.gutterMarkers = {}); + markers[gutterID] = value; + if (!value && isEmpty(markers)) line.gutterMarkers = null; + return true; + }); + }), + + clearGutter: methodOp(function(gutterID) { + var cm = this, doc = cm.doc, i = doc.first; + doc.iter(function(line) { + if (line.gutterMarkers && line.gutterMarkers[gutterID]) { + line.gutterMarkers[gutterID] = null; + regLineChange(cm, i, "gutter"); + if (isEmpty(line.gutterMarkers)) line.gutterMarkers = null; + } + ++i; + }); + }), + + lineInfo: function(line) { + if (typeof line == "number") { + if (!isLine(this.doc, line)) return null; + var n = line; + line = getLine(this.doc, line); + if (!line) return null; + } else { + var n = lineNo(line); + if (n == null) return null; + } + return {line: n, handle: line, text: line.text, gutterMarkers: line.gutterMarkers, + textClass: line.textClass, bgClass: line.bgClass, wrapClass: line.wrapClass, + widgets: line.widgets}; + }, + + getViewport: function() { return {from: this.display.viewFrom, to: this.display.viewTo};}, + + addWidget: function(pos, node, scroll, vert, horiz) { + var display = this.display; + pos = cursorCoords(this, clipPos(this.doc, pos)); + var top = pos.bottom, left = pos.left; + node.style.position = "absolute"; + node.setAttribute("cm-ignore-events", "true"); + this.display.input.setUneditable(node); + display.sizer.appendChild(node); + if (vert == "over") { + top = pos.top; + } else if (vert == "above" || vert == "near") { + var vspace = Math.max(display.wrapper.clientHeight, this.doc.height), + hspace = Math.max(display.sizer.clientWidth, display.lineSpace.clientWidth); + // Default to positioning above (if specified and possible); otherwise default to positioning below + if ((vert == 'above' || pos.bottom + node.offsetHeight > vspace) && pos.top > node.offsetHeight) + top = pos.top - node.offsetHeight; + else if (pos.bottom + node.offsetHeight <= vspace) + top = pos.bottom; + if (left + node.offsetWidth > hspace) + left = hspace - node.offsetWidth; + } + node.style.top = top + "px"; + node.style.left = node.style.right = ""; + if (horiz == "right") { + left = display.sizer.clientWidth - node.offsetWidth; + node.style.right = "0px"; + } else { + if (horiz == "left") left = 0; + else if (horiz == "middle") left = (display.sizer.clientWidth - node.offsetWidth) / 2; + node.style.left = left + "px"; + } + if (scroll) + scrollIntoView(this, left, top, left + node.offsetWidth, top + node.offsetHeight); + }, + + triggerOnKeyDown: methodOp(onKeyDown), + triggerOnKeyPress: methodOp(onKeyPress), + triggerOnKeyUp: onKeyUp, + + execCommand: function(cmd) { + if (commands.hasOwnProperty(cmd)) + return commands[cmd].call(null, this); + }, + + triggerElectric: methodOp(function(text) { triggerElectric(this, text); }), + + findPosH: function(from, amount, unit, visually) { + var dir = 1; + if (amount < 0) { dir = -1; amount = -amount; } + for (var i = 0, cur = clipPos(this.doc, from); i < amount; ++i) { + cur = findPosH(this.doc, cur, dir, unit, visually); + if (cur.hitSide) break; + } + return cur; + }, + + moveH: methodOp(function(dir, unit) { + var cm = this; + cm.extendSelectionsBy(function(range) { + if (cm.display.shift || cm.doc.extend || range.empty()) + return findPosH(cm.doc, range.head, dir, unit, cm.options.rtlMoveVisually); + else + return dir < 0 ? range.from() : range.to(); + }, sel_move); + }), + + deleteH: methodOp(function(dir, unit) { + var sel = this.doc.sel, doc = this.doc; + if (sel.somethingSelected()) + doc.replaceSelection("", null, "+delete"); + else + deleteNearSelection(this, function(range) { + var other = findPosH(doc, range.head, dir, unit, false); + return dir < 0 ? {from: other, to: range.head} : {from: range.head, to: other}; + }); + }), + + findPosV: function(from, amount, unit, goalColumn) { + var dir = 1, x = goalColumn; + if (amount < 0) { dir = -1; amount = -amount; } + for (var i = 0, cur = clipPos(this.doc, from); i < amount; ++i) { + var coords = cursorCoords(this, cur, "div"); + if (x == null) x = coords.left; + else coords.left = x; + cur = findPosV(this, coords, dir, unit); + if (cur.hitSide) break; + } + return cur; + }, + + moveV: methodOp(function(dir, unit) { + var cm = this, doc = this.doc, goals = []; + var collapse = !cm.display.shift && !doc.extend && doc.sel.somethingSelected(); + doc.extendSelectionsBy(function(range) { + if (collapse) + return dir < 0 ? range.from() : range.to(); + var headPos = cursorCoords(cm, range.head, "div"); + if (range.goalColumn != null) headPos.left = range.goalColumn; + goals.push(headPos.left); + var pos = findPosV(cm, headPos, dir, unit); + if (unit == "page" && range == doc.sel.primary()) + addToScrollPos(cm, null, charCoords(cm, pos, "div").top - headPos.top); + return pos; + }, sel_move); + if (goals.length) for (var i = 0; i < doc.sel.ranges.length; i++) + doc.sel.ranges[i].goalColumn = goals[i]; + }), + + // Find the word at the given position (as returned by coordsChar). + findWordAt: function(pos) { + var doc = this.doc, line = getLine(doc, pos.line).text; + var start = pos.ch, end = pos.ch; + if (line) { + var helper = this.getHelper(pos, "wordChars"); + if ((pos.xRel < 0 || end == line.length) && start) --start; else ++end; + var startChar = line.charAt(start); + var check = isWordChar(startChar, helper) + ? function(ch) { return isWordChar(ch, helper); } + : /\s/.test(startChar) ? function(ch) {return /\s/.test(ch);} + : function(ch) {return !/\s/.test(ch) && !isWordChar(ch);}; + while (start > 0 && check(line.charAt(start - 1))) --start; + while (end < line.length && check(line.charAt(end))) ++end; + } + return new Range(Pos(pos.line, start), Pos(pos.line, end)); + }, + + toggleOverwrite: function(value) { + if (value != null && value == this.state.overwrite) return; + if (this.state.overwrite = !this.state.overwrite) + addClass(this.display.cursorDiv, "CodeMirror-overwrite"); + else + rmClass(this.display.cursorDiv, "CodeMirror-overwrite"); + + signal(this, "overwriteToggle", this, this.state.overwrite); + }, + hasFocus: function() { return this.display.input.getField() == activeElt(); }, + isReadOnly: function() { return !!(this.options.readOnly || this.doc.cantEdit); }, + + scrollTo: methodOp(function(x, y) { + if (x != null || y != null) resolveScrollToPos(this); + if (x != null) this.curOp.scrollLeft = x; + if (y != null) this.curOp.scrollTop = y; + }), + getScrollInfo: function() { + var scroller = this.display.scroller; + return {left: scroller.scrollLeft, top: scroller.scrollTop, + height: scroller.scrollHeight - scrollGap(this) - this.display.barHeight, + width: scroller.scrollWidth - scrollGap(this) - this.display.barWidth, + clientHeight: displayHeight(this), clientWidth: displayWidth(this)}; + }, + + scrollIntoView: methodOp(function(range, margin) { + if (range == null) { + range = {from: this.doc.sel.primary().head, to: null}; + if (margin == null) margin = this.options.cursorScrollMargin; + } else if (typeof range == "number") { + range = {from: Pos(range, 0), to: null}; + } else if (range.from == null) { + range = {from: range, to: null}; + } + if (!range.to) range.to = range.from; + range.margin = margin || 0; + + if (range.from.line != null) { + resolveScrollToPos(this); + this.curOp.scrollToPos = range; + } else { + var sPos = calculateScrollPos(this, Math.min(range.from.left, range.to.left), + Math.min(range.from.top, range.to.top) - range.margin, + Math.max(range.from.right, range.to.right), + Math.max(range.from.bottom, range.to.bottom) + range.margin); + this.scrollTo(sPos.scrollLeft, sPos.scrollTop); + } + }), + + setSize: methodOp(function(width, height) { + var cm = this; + function interpret(val) { + return typeof val == "number" || /^\d+$/.test(String(val)) ? val + "px" : val; + } + if (width != null) cm.display.wrapper.style.width = interpret(width); + if (height != null) cm.display.wrapper.style.height = interpret(height); + if (cm.options.lineWrapping) clearLineMeasurementCache(this); + var lineNo = cm.display.viewFrom; + cm.doc.iter(lineNo, cm.display.viewTo, function(line) { + if (line.widgets) for (var i = 0; i < line.widgets.length; i++) + if (line.widgets[i].noHScroll) { regLineChange(cm, lineNo, "widget"); break; } + ++lineNo; + }); + cm.curOp.forceUpdate = true; + signal(cm, "refresh", this); + }), + + operation: function(f){return runInOp(this, f);}, + + refresh: methodOp(function() { + var oldHeight = this.display.cachedTextHeight; + regChange(this); + this.curOp.forceUpdate = true; + clearCaches(this); + this.scrollTo(this.doc.scrollLeft, this.doc.scrollTop); + updateGutterSpace(this); + if (oldHeight == null || Math.abs(oldHeight - textHeight(this.display)) > .5) + estimateLineHeights(this); + signal(this, "refresh", this); + }), + + swapDoc: methodOp(function(doc) { + var old = this.doc; + old.cm = null; + attachDoc(this, doc); + clearCaches(this); + this.display.input.reset(); + this.scrollTo(doc.scrollLeft, doc.scrollTop); + this.curOp.forceScroll = true; + signalLater(this, "swapDoc", this, old); + return old; + }), + + getInputField: function(){return this.display.input.getField();}, + getWrapperElement: function(){return this.display.wrapper;}, + getScrollerElement: function(){return this.display.scroller;}, + getGutterElement: function(){return this.display.gutters;} + }; + eventMixin(CodeMirror); + + // OPTION DEFAULTS + + // The default configuration options. + var defaults = CodeMirror.defaults = {}; + // Functions to run when options are changed. + var optionHandlers = CodeMirror.optionHandlers = {}; + + function option(name, deflt, handle, notOnInit) { + CodeMirror.defaults[name] = deflt; + if (handle) optionHandlers[name] = + notOnInit ? function(cm, val, old) {if (old != Init) handle(cm, val, old);} : handle; + } + + // Passed to option handlers when there is no old value. + var Init = CodeMirror.Init = {toString: function(){return "CodeMirror.Init";}}; + + // These two are, on init, called from the constructor because they + // have to be initialized before the editor can start at all. + option("value", "", function(cm, val) { + cm.setValue(val); + }, true); + option("mode", null, function(cm, val) { + cm.doc.modeOption = val; + loadMode(cm); + }, true); + + option("indentUnit", 2, loadMode, true); + option("indentWithTabs", false); + option("smartIndent", true); + option("tabSize", 4, function(cm) { + resetModeState(cm); + clearCaches(cm); + regChange(cm); + }, true); + option("lineSeparator", null, function(cm, val) { + cm.doc.lineSep = val; + if (!val) return; + var newBreaks = [], lineNo = cm.doc.first; + cm.doc.iter(function(line) { + for (var pos = 0;;) { + var found = line.text.indexOf(val, pos); + if (found == -1) break; + pos = found + val.length; + newBreaks.push(Pos(lineNo, found)); + } + lineNo++; + }); + for (var i = newBreaks.length - 1; i >= 0; i--) + replaceRange(cm.doc, val, newBreaks[i], Pos(newBreaks[i].line, newBreaks[i].ch + val.length)) + }); + option("specialChars", /[\u0000-\u001f\u007f\u00ad\u200b-\u200f\u2028\u2029\ufeff]/g, function(cm, val, old) { + cm.state.specialChars = new RegExp(val.source + (val.test("\t") ? "" : "|\t"), "g"); + if (old != CodeMirror.Init) cm.refresh(); + }); + option("specialCharPlaceholder", defaultSpecialCharPlaceholder, function(cm) {cm.refresh();}, true); + option("electricChars", true); + option("inputStyle", mobile ? "contenteditable" : "textarea", function() { + throw new Error("inputStyle can not (yet) be changed in a running editor"); // FIXME + }, true); + option("rtlMoveVisually", !windows); + option("wholeLineUpdateBefore", true); + + option("theme", "default", function(cm) { + themeChanged(cm); + guttersChanged(cm); + }, true); + option("keyMap", "default", function(cm, val, old) { + var next = getKeyMap(val); + var prev = old != CodeMirror.Init && getKeyMap(old); + if (prev && prev.detach) prev.detach(cm, next); + if (next.attach) next.attach(cm, prev || null); + }); + option("extraKeys", null); + + option("lineWrapping", false, wrappingChanged, true); + option("gutters", [], function(cm) { + setGuttersForLineNumbers(cm.options); + guttersChanged(cm); + }, true); + option("fixedGutter", true, function(cm, val) { + cm.display.gutters.style.left = val ? compensateForHScroll(cm.display) + "px" : "0"; + cm.refresh(); + }, true); + option("coverGutterNextToScrollbar", false, function(cm) {updateScrollbars(cm);}, true); + option("scrollbarStyle", "native", function(cm) { + initScrollbars(cm); + updateScrollbars(cm); + cm.display.scrollbars.setScrollTop(cm.doc.scrollTop); + cm.display.scrollbars.setScrollLeft(cm.doc.scrollLeft); + }, true); + option("lineNumbers", false, function(cm) { + setGuttersForLineNumbers(cm.options); + guttersChanged(cm); + }, true); + option("firstLineNumber", 1, guttersChanged, true); + option("lineNumberFormatter", function(integer) {return integer;}, guttersChanged, true); + option("showCursorWhenSelecting", false, updateSelection, true); + + option("resetSelectionOnContextMenu", true); + option("lineWiseCopyCut", true); + + option("readOnly", false, function(cm, val) { + if (val == "nocursor") { + onBlur(cm); + cm.display.input.blur(); + cm.display.disabled = true; + } else { + cm.display.disabled = false; + } + cm.display.input.readOnlyChanged(val) + }); + option("disableInput", false, function(cm, val) {if (!val) cm.display.input.reset();}, true); + option("dragDrop", true, dragDropChanged); + option("allowDropFileTypes", null); + + option("cursorBlinkRate", 530); + option("cursorScrollMargin", 0); + option("cursorHeight", 1, updateSelection, true); + option("singleCursorHeightPerLine", true, updateSelection, true); + option("workTime", 100); + option("workDelay", 100); + option("flattenSpans", true, resetModeState, true); + option("addModeClass", false, resetModeState, true); + option("pollInterval", 100); + option("undoDepth", 200, function(cm, val){cm.doc.history.undoDepth = val;}); + option("historyEventDelay", 1250); + option("viewportMargin", 10, function(cm){cm.refresh();}, true); + option("maxHighlightLength", 10000, resetModeState, true); + option("moveInputWithCursor", true, function(cm, val) { + if (!val) cm.display.input.resetPosition(); + }); + + option("tabindex", null, function(cm, val) { + cm.display.input.getField().tabIndex = val || ""; + }); + option("autofocus", null); + + // MODE DEFINITION AND QUERYING + + // Known modes, by name and by MIME + var modes = CodeMirror.modes = {}, mimeModes = CodeMirror.mimeModes = {}; + + // Extra arguments are stored as the mode's dependencies, which is + // used by (legacy) mechanisms like loadmode.js to automatically + // load a mode. (Preferred mechanism is the require/define calls.) + CodeMirror.defineMode = function(name, mode) { + if (!CodeMirror.defaults.mode && name != "null") CodeMirror.defaults.mode = name; + if (arguments.length > 2) + mode.dependencies = Array.prototype.slice.call(arguments, 2); + modes[name] = mode; + }; + + CodeMirror.defineMIME = function(mime, spec) { + mimeModes[mime] = spec; + }; + + // Given a MIME type, a {name, ...options} config object, or a name + // string, return a mode config object. + CodeMirror.resolveMode = function(spec) { + if (typeof spec == "string" && mimeModes.hasOwnProperty(spec)) { + spec = mimeModes[spec]; + } else if (spec && typeof spec.name == "string" && mimeModes.hasOwnProperty(spec.name)) { + var found = mimeModes[spec.name]; + if (typeof found == "string") found = {name: found}; + spec = createObj(found, spec); + spec.name = found.name; + } else if (typeof spec == "string" && /^[\w\-]+\/[\w\-]+\+xml$/.test(spec)) { + return CodeMirror.resolveMode("application/xml"); + } + if (typeof spec == "string") return {name: spec}; + else return spec || {name: "null"}; + }; + + // Given a mode spec (anything that resolveMode accepts), find and + // initialize an actual mode object. + CodeMirror.getMode = function(options, spec) { + var spec = CodeMirror.resolveMode(spec); + var mfactory = modes[spec.name]; + if (!mfactory) return CodeMirror.getMode(options, "text/plain"); + var modeObj = mfactory(options, spec); + if (modeExtensions.hasOwnProperty(spec.name)) { + var exts = modeExtensions[spec.name]; + for (var prop in exts) { + if (!exts.hasOwnProperty(prop)) continue; + if (modeObj.hasOwnProperty(prop)) modeObj["_" + prop] = modeObj[prop]; + modeObj[prop] = exts[prop]; + } + } + modeObj.name = spec.name; + if (spec.helperType) modeObj.helperType = spec.helperType; + if (spec.modeProps) for (var prop in spec.modeProps) + modeObj[prop] = spec.modeProps[prop]; + + return modeObj; + }; + + // Minimal default mode. + CodeMirror.defineMode("null", function() { + return {token: function(stream) {stream.skipToEnd();}}; + }); + CodeMirror.defineMIME("text/plain", "null"); + + // This can be used to attach properties to mode objects from + // outside the actual mode definition. + var modeExtensions = CodeMirror.modeExtensions = {}; + CodeMirror.extendMode = function(mode, properties) { + var exts = modeExtensions.hasOwnProperty(mode) ? modeExtensions[mode] : (modeExtensions[mode] = {}); + copyObj(properties, exts); + }; + + // EXTENSIONS + + CodeMirror.defineExtension = function(name, func) { + CodeMirror.prototype[name] = func; + }; + CodeMirror.defineDocExtension = function(name, func) { + Doc.prototype[name] = func; + }; + CodeMirror.defineOption = option; + + var initHooks = []; + CodeMirror.defineInitHook = function(f) {initHooks.push(f);}; + + var helpers = CodeMirror.helpers = {}; + CodeMirror.registerHelper = function(type, name, value) { + if (!helpers.hasOwnProperty(type)) helpers[type] = CodeMirror[type] = {_global: []}; + helpers[type][name] = value; + }; + CodeMirror.registerGlobalHelper = function(type, name, predicate, value) { + CodeMirror.registerHelper(type, name, value); + helpers[type]._global.push({pred: predicate, val: value}); + }; + + // MODE STATE HANDLING + + // Utility functions for working with state. Exported because nested + // modes need to do this for their inner modes. + + var copyState = CodeMirror.copyState = function(mode, state) { + if (state === true) return state; + if (mode.copyState) return mode.copyState(state); + var nstate = {}; + for (var n in state) { + var val = state[n]; + if (val instanceof Array) val = val.concat([]); + nstate[n] = val; + } + return nstate; + }; + + var startState = CodeMirror.startState = function(mode, a1, a2) { + return mode.startState ? mode.startState(a1, a2) : true; + }; + + // Given a mode and a state (for that mode), find the inner mode and + // state at the position that the state refers to. + CodeMirror.innerMode = function(mode, state) { + while (mode.innerMode) { + var info = mode.innerMode(state); + if (!info || info.mode == mode) break; + state = info.state; + mode = info.mode; + } + return info || {mode: mode, state: state}; + }; + + // STANDARD COMMANDS + + // Commands are parameter-less actions that can be performed on an + // editor, mostly used for keybindings. + var commands = CodeMirror.commands = { + selectAll: function(cm) {cm.setSelection(Pos(cm.firstLine(), 0), Pos(cm.lastLine()), sel_dontScroll);}, + singleSelection: function(cm) { + cm.setSelection(cm.getCursor("anchor"), cm.getCursor("head"), sel_dontScroll); + }, + killLine: function(cm) { + deleteNearSelection(cm, function(range) { + if (range.empty()) { + var len = getLine(cm.doc, range.head.line).text.length; + if (range.head.ch == len && range.head.line < cm.lastLine()) + return {from: range.head, to: Pos(range.head.line + 1, 0)}; + else + return {from: range.head, to: Pos(range.head.line, len)}; + } else { + return {from: range.from(), to: range.to()}; + } + }); + }, + deleteLine: function(cm) { + deleteNearSelection(cm, function(range) { + return {from: Pos(range.from().line, 0), + to: clipPos(cm.doc, Pos(range.to().line + 1, 0))}; + }); + }, + delLineLeft: function(cm) { + deleteNearSelection(cm, function(range) { + return {from: Pos(range.from().line, 0), to: range.from()}; + }); + }, + delWrappedLineLeft: function(cm) { + deleteNearSelection(cm, function(range) { + var top = cm.charCoords(range.head, "div").top + 5; + var leftPos = cm.coordsChar({left: 0, top: top}, "div"); + return {from: leftPos, to: range.from()}; + }); + }, + delWrappedLineRight: function(cm) { + deleteNearSelection(cm, function(range) { + var top = cm.charCoords(range.head, "div").top + 5; + var rightPos = cm.coordsChar({left: cm.display.lineDiv.offsetWidth + 100, top: top}, "div"); + return {from: range.from(), to: rightPos }; + }); + }, + undo: function(cm) {cm.undo();}, + redo: function(cm) {cm.redo();}, + undoSelection: function(cm) {cm.undoSelection();}, + redoSelection: function(cm) {cm.redoSelection();}, + goDocStart: function(cm) {cm.extendSelection(Pos(cm.firstLine(), 0));}, + goDocEnd: function(cm) {cm.extendSelection(Pos(cm.lastLine()));}, + goLineStart: function(cm) { + cm.extendSelectionsBy(function(range) { return lineStart(cm, range.head.line); }, + {origin: "+move", bias: 1}); + }, + goLineStartSmart: function(cm) { + cm.extendSelectionsBy(function(range) { + return lineStartSmart(cm, range.head); + }, {origin: "+move", bias: 1}); + }, + goLineEnd: function(cm) { + cm.extendSelectionsBy(function(range) { return lineEnd(cm, range.head.line); }, + {origin: "+move", bias: -1}); + }, + goLineRight: function(cm) { + cm.extendSelectionsBy(function(range) { + var top = cm.charCoords(range.head, "div").top + 5; + return cm.coordsChar({left: cm.display.lineDiv.offsetWidth + 100, top: top}, "div"); + }, sel_move); + }, + goLineLeft: function(cm) { + cm.extendSelectionsBy(function(range) { + var top = cm.charCoords(range.head, "div").top + 5; + return cm.coordsChar({left: 0, top: top}, "div"); + }, sel_move); + }, + goLineLeftSmart: function(cm) { + cm.extendSelectionsBy(function(range) { + var top = cm.charCoords(range.head, "div").top + 5; + var pos = cm.coordsChar({left: 0, top: top}, "div"); + if (pos.ch < cm.getLine(pos.line).search(/\S/)) return lineStartSmart(cm, range.head); + return pos; + }, sel_move); + }, + goLineUp: function(cm) {cm.moveV(-1, "line");}, + goLineDown: function(cm) {cm.moveV(1, "line");}, + goPageUp: function(cm) {cm.moveV(-1, "page");}, + goPageDown: function(cm) {cm.moveV(1, "page");}, + goCharLeft: function(cm) {cm.moveH(-1, "char");}, + goCharRight: function(cm) {cm.moveH(1, "char");}, + goColumnLeft: function(cm) {cm.moveH(-1, "column");}, + goColumnRight: function(cm) {cm.moveH(1, "column");}, + goWordLeft: function(cm) {cm.moveH(-1, "word");}, + goGroupRight: function(cm) {cm.moveH(1, "group");}, + goGroupLeft: function(cm) {cm.moveH(-1, "group");}, + goWordRight: function(cm) {cm.moveH(1, "word");}, + delCharBefore: function(cm) {cm.deleteH(-1, "char");}, + delCharAfter: function(cm) {cm.deleteH(1, "char");}, + delWordBefore: function(cm) {cm.deleteH(-1, "word");}, + delWordAfter: function(cm) {cm.deleteH(1, "word");}, + delGroupBefore: function(cm) {cm.deleteH(-1, "group");}, + delGroupAfter: function(cm) {cm.deleteH(1, "group");}, + indentAuto: function(cm) {cm.indentSelection("smart");}, + indentMore: function(cm) {cm.indentSelection("add");}, + indentLess: function(cm) {cm.indentSelection("subtract");}, + insertTab: function(cm) {cm.replaceSelection("\t");}, + insertSoftTab: function(cm) { + var spaces = [], ranges = cm.listSelections(), tabSize = cm.options.tabSize; + for (var i = 0; i < ranges.length; i++) { + var pos = ranges[i].from(); + var col = countColumn(cm.getLine(pos.line), pos.ch, tabSize); + spaces.push(spaceStr(tabSize - col % tabSize)); + } + cm.replaceSelections(spaces); + }, + defaultTab: function(cm) { + if (cm.somethingSelected()) cm.indentSelection("add"); + else cm.execCommand("insertTab"); + }, + transposeChars: function(cm) { + runInOp(cm, function() { + var ranges = cm.listSelections(), newSel = []; + for (var i = 0; i < ranges.length; i++) { + var cur = ranges[i].head, line = getLine(cm.doc, cur.line).text; + if (line) { + if (cur.ch == line.length) cur = new Pos(cur.line, cur.ch - 1); + if (cur.ch > 0) { + cur = new Pos(cur.line, cur.ch + 1); + cm.replaceRange(line.charAt(cur.ch - 1) + line.charAt(cur.ch - 2), + Pos(cur.line, cur.ch - 2), cur, "+transpose"); + } else if (cur.line > cm.doc.first) { + var prev = getLine(cm.doc, cur.line - 1).text; + if (prev) + cm.replaceRange(line.charAt(0) + cm.doc.lineSeparator() + + prev.charAt(prev.length - 1), + Pos(cur.line - 1, prev.length - 1), Pos(cur.line, 1), "+transpose"); + } + } + newSel.push(new Range(cur, cur)); + } + cm.setSelections(newSel); + }); + }, + newlineAndIndent: function(cm) { + runInOp(cm, function() { + var len = cm.listSelections().length; + for (var i = 0; i < len; i++) { + var range = cm.listSelections()[i]; + cm.replaceRange(cm.doc.lineSeparator(), range.anchor, range.head, "+input"); + cm.indentLine(range.from().line + 1, null, true); + } + ensureCursorVisible(cm); + }); + }, + openLine: function(cm) {cm.replaceSelection("\n", "start")}, + toggleOverwrite: function(cm) {cm.toggleOverwrite();} + }; + + + // STANDARD KEYMAPS + + var keyMap = CodeMirror.keyMap = {}; + + keyMap.basic = { + "Left": "goCharLeft", "Right": "goCharRight", "Up": "goLineUp", "Down": "goLineDown", + "End": "goLineEnd", "Home": "goLineStartSmart", "PageUp": "goPageUp", "PageDown": "goPageDown", + "Delete": "delCharAfter", "Backspace": "delCharBefore", "Shift-Backspace": "delCharBefore", + "Tab": "defaultTab", "Shift-Tab": "indentAuto", + "Enter": "newlineAndIndent", "Insert": "toggleOverwrite", + "Esc": "singleSelection" + }; + // Note that the save and find-related commands aren't defined by + // default. User code or addons can define them. Unknown commands + // are simply ignored. + keyMap.pcDefault = { + "Ctrl-A": "selectAll", "Ctrl-D": "deleteLine", "Ctrl-Z": "undo", "Shift-Ctrl-Z": "redo", "Ctrl-Y": "redo", + "Ctrl-Home": "goDocStart", "Ctrl-End": "goDocEnd", "Ctrl-Up": "goLineUp", "Ctrl-Down": "goLineDown", + "Ctrl-Left": "goGroupLeft", "Ctrl-Right": "goGroupRight", "Alt-Left": "goLineStart", "Alt-Right": "goLineEnd", + "Ctrl-Backspace": "delGroupBefore", "Ctrl-Delete": "delGroupAfter", "Ctrl-S": "save", "Ctrl-F": "find", + "Ctrl-G": "findNext", "Shift-Ctrl-G": "findPrev", "Shift-Ctrl-F": "replace", "Shift-Ctrl-R": "replaceAll", + "Ctrl-[": "indentLess", "Ctrl-]": "indentMore", + "Ctrl-U": "undoSelection", "Shift-Ctrl-U": "redoSelection", "Alt-U": "redoSelection", + fallthrough: "basic" + }; + // Very basic readline/emacs-style bindings, which are standard on Mac. + keyMap.emacsy = { + "Ctrl-F": "goCharRight", "Ctrl-B": "goCharLeft", "Ctrl-P": "goLineUp", "Ctrl-N": "goLineDown", + "Alt-F": "goWordRight", "Alt-B": "goWordLeft", "Ctrl-A": "goLineStart", "Ctrl-E": "goLineEnd", + "Ctrl-V": "goPageDown", "Shift-Ctrl-V": "goPageUp", "Ctrl-D": "delCharAfter", "Ctrl-H": "delCharBefore", + "Alt-D": "delWordAfter", "Alt-Backspace": "delWordBefore", "Ctrl-K": "killLine", "Ctrl-T": "transposeChars", + "Ctrl-O": "openLine" + }; + keyMap.macDefault = { + "Cmd-A": "selectAll", "Cmd-D": "deleteLine", "Cmd-Z": "undo", "Shift-Cmd-Z": "redo", "Cmd-Y": "redo", + "Cmd-Home": "goDocStart", "Cmd-Up": "goDocStart", "Cmd-End": "goDocEnd", "Cmd-Down": "goDocEnd", "Alt-Left": "goGroupLeft", + "Alt-Right": "goGroupRight", "Cmd-Left": "goLineLeft", "Cmd-Right": "goLineRight", "Alt-Backspace": "delGroupBefore", + "Ctrl-Alt-Backspace": "delGroupAfter", "Alt-Delete": "delGroupAfter", "Cmd-S": "save", "Cmd-F": "find", + "Cmd-G": "findNext", "Shift-Cmd-G": "findPrev", "Cmd-Alt-F": "replace", "Shift-Cmd-Alt-F": "replaceAll", + "Cmd-[": "indentLess", "Cmd-]": "indentMore", "Cmd-Backspace": "delWrappedLineLeft", "Cmd-Delete": "delWrappedLineRight", + "Cmd-U": "undoSelection", "Shift-Cmd-U": "redoSelection", "Ctrl-Up": "goDocStart", "Ctrl-Down": "goDocEnd", + fallthrough: ["basic", "emacsy"] + }; + keyMap["default"] = mac ? keyMap.macDefault : keyMap.pcDefault; + + // KEYMAP DISPATCH + + function normalizeKeyName(name) { + var parts = name.split(/-(?!$)/), name = parts[parts.length - 1]; + var alt, ctrl, shift, cmd; + for (var i = 0; i < parts.length - 1; i++) { + var mod = parts[i]; + if (/^(cmd|meta|m)$/i.test(mod)) cmd = true; + else if (/^a(lt)?$/i.test(mod)) alt = true; + else if (/^(c|ctrl|control)$/i.test(mod)) ctrl = true; + else if (/^s(hift)$/i.test(mod)) shift = true; + else throw new Error("Unrecognized modifier name: " + mod); + } + if (alt) name = "Alt-" + name; + if (ctrl) name = "Ctrl-" + name; + if (cmd) name = "Cmd-" + name; + if (shift) name = "Shift-" + name; + return name; + } + + // This is a kludge to keep keymaps mostly working as raw objects + // (backwards compatibility) while at the same time support features + // like normalization and multi-stroke key bindings. It compiles a + // new normalized keymap, and then updates the old object to reflect + // this. + CodeMirror.normalizeKeyMap = function(keymap) { + var copy = {}; + for (var keyname in keymap) if (keymap.hasOwnProperty(keyname)) { + var value = keymap[keyname]; + if (/^(name|fallthrough|(de|at)tach)$/.test(keyname)) continue; + if (value == "...") { delete keymap[keyname]; continue; } + + var keys = map(keyname.split(" "), normalizeKeyName); + for (var i = 0; i < keys.length; i++) { + var val, name; + if (i == keys.length - 1) { + name = keys.join(" "); + val = value; + } else { + name = keys.slice(0, i + 1).join(" "); + val = "..."; + } + var prev = copy[name]; + if (!prev) copy[name] = val; + else if (prev != val) throw new Error("Inconsistent bindings for " + name); + } + delete keymap[keyname]; + } + for (var prop in copy) keymap[prop] = copy[prop]; + return keymap; + }; + + var lookupKey = CodeMirror.lookupKey = function(key, map, handle, context) { + map = getKeyMap(map); + var found = map.call ? map.call(key, context) : map[key]; + if (found === false) return "nothing"; + if (found === "...") return "multi"; + if (found != null && handle(found)) return "handled"; + + if (map.fallthrough) { + if (Object.prototype.toString.call(map.fallthrough) != "[object Array]") + return lookupKey(key, map.fallthrough, handle, context); + for (var i = 0; i < map.fallthrough.length; i++) { + var result = lookupKey(key, map.fallthrough[i], handle, context); + if (result) return result; + } + } + }; + + // Modifier key presses don't count as 'real' key presses for the + // purpose of keymap fallthrough. + var isModifierKey = CodeMirror.isModifierKey = function(value) { + var name = typeof value == "string" ? value : keyNames[value.keyCode]; + return name == "Ctrl" || name == "Alt" || name == "Shift" || name == "Mod"; + }; + + // Look up the name of a key as indicated by an event object. + var keyName = CodeMirror.keyName = function(event, noShift) { + if (presto && event.keyCode == 34 && event["char"]) return false; + var base = keyNames[event.keyCode], name = base; + if (name == null || event.altGraphKey) return false; + if (event.altKey && base != "Alt") name = "Alt-" + name; + if ((flipCtrlCmd ? event.metaKey : event.ctrlKey) && base != "Ctrl") name = "Ctrl-" + name; + if ((flipCtrlCmd ? event.ctrlKey : event.metaKey) && base != "Cmd") name = "Cmd-" + name; + if (!noShift && event.shiftKey && base != "Shift") name = "Shift-" + name; + return name; + }; + + function getKeyMap(val) { + return typeof val == "string" ? keyMap[val] : val; + } + + // FROMTEXTAREA + + CodeMirror.fromTextArea = function(textarea, options) { + options = options ? copyObj(options) : {}; + options.value = textarea.value; + if (!options.tabindex && textarea.tabIndex) + options.tabindex = textarea.tabIndex; + if (!options.placeholder && textarea.placeholder) + options.placeholder = textarea.placeholder; + // Set autofocus to true if this textarea is focused, or if it has + // autofocus and no other element is focused. + if (options.autofocus == null) { + var hasFocus = activeElt(); + options.autofocus = hasFocus == textarea || + textarea.getAttribute("autofocus") != null && hasFocus == document.body; + } + + function save() {textarea.value = cm.getValue();} + if (textarea.form) { + on(textarea.form, "submit", save); + // Deplorable hack to make the submit method do the right thing. + if (!options.leaveSubmitMethodAlone) { + var form = textarea.form, realSubmit = form.submit; + try { + var wrappedSubmit = form.submit = function() { + save(); + form.submit = realSubmit; + form.submit(); + form.submit = wrappedSubmit; + }; + } catch(e) {} + } + } + + options.finishInit = function(cm) { + cm.save = save; + cm.getTextArea = function() { return textarea; }; + cm.toTextArea = function() { + cm.toTextArea = isNaN; // Prevent this from being ran twice + save(); + textarea.parentNode.removeChild(cm.getWrapperElement()); + textarea.style.display = ""; + if (textarea.form) { + off(textarea.form, "submit", save); + if (typeof textarea.form.submit == "function") + textarea.form.submit = realSubmit; + } + }; + }; + + textarea.style.display = "none"; + var cm = CodeMirror(function(node) { + textarea.parentNode.insertBefore(node, textarea.nextSibling); + }, options); + return cm; + }; + + // STRING STREAM + + // Fed to the mode parsers, provides helper functions to make + // parsers more succinct. + + var StringStream = CodeMirror.StringStream = function(string, tabSize) { + this.pos = this.start = 0; + this.string = string; + this.tabSize = tabSize || 8; + this.lastColumnPos = this.lastColumnValue = 0; + this.lineStart = 0; + }; + + StringStream.prototype = { + eol: function() {return this.pos >= this.string.length;}, + sol: function() {return this.pos == this.lineStart;}, + peek: function() {return this.string.charAt(this.pos) || undefined;}, + next: function() { + if (this.pos < this.string.length) + return this.string.charAt(this.pos++); + }, + eat: function(match) { + var ch = this.string.charAt(this.pos); + if (typeof match == "string") var ok = ch == match; + else var ok = ch && (match.test ? match.test(ch) : match(ch)); + if (ok) {++this.pos; return ch;} + }, + eatWhile: function(match) { + var start = this.pos; + while (this.eat(match)){} + return this.pos > start; + }, + eatSpace: function() { + var start = this.pos; + while (/[\s\u00a0]/.test(this.string.charAt(this.pos))) ++this.pos; + return this.pos > start; + }, + skipToEnd: function() {this.pos = this.string.length;}, + skipTo: function(ch) { + var found = this.string.indexOf(ch, this.pos); + if (found > -1) {this.pos = found; return true;} + }, + backUp: function(n) {this.pos -= n;}, + column: function() { + if (this.lastColumnPos < this.start) { + this.lastColumnValue = countColumn(this.string, this.start, this.tabSize, this.lastColumnPos, this.lastColumnValue); + this.lastColumnPos = this.start; + } + return this.lastColumnValue - (this.lineStart ? countColumn(this.string, this.lineStart, this.tabSize) : 0); + }, + indentation: function() { + return countColumn(this.string, null, this.tabSize) - + (this.lineStart ? countColumn(this.string, this.lineStart, this.tabSize) : 0); + }, + match: function(pattern, consume, caseInsensitive) { + if (typeof pattern == "string") { + var cased = function(str) {return caseInsensitive ? str.toLowerCase() : str;}; + var substr = this.string.substr(this.pos, pattern.length); + if (cased(substr) == cased(pattern)) { + if (consume !== false) this.pos += pattern.length; + return true; + } + } else { + var match = this.string.slice(this.pos).match(pattern); + if (match && match.index > 0) return null; + if (match && consume !== false) this.pos += match[0].length; + return match; + } + }, + current: function(){return this.string.slice(this.start, this.pos);}, + hideFirstChars: function(n, inner) { + this.lineStart += n; + try { return inner(); } + finally { this.lineStart -= n; } + } + }; + + // TEXTMARKERS + + // Created with markText and setBookmark methods. A TextMarker is a + // handle that can be used to clear or find a marked position in the + // document. Line objects hold arrays (markedSpans) containing + // {from, to, marker} object pointing to such marker objects, and + // indicating that such a marker is present on that line. Multiple + // lines may point to the same marker when it spans across lines. + // The spans will have null for their from/to properties when the + // marker continues beyond the start/end of the line. Markers have + // links back to the lines they currently touch. + + var nextMarkerId = 0; + + var TextMarker = CodeMirror.TextMarker = function(doc, type) { + this.lines = []; + this.type = type; + this.doc = doc; + this.id = ++nextMarkerId; + }; + eventMixin(TextMarker); + + // Clear the marker. + TextMarker.prototype.clear = function() { + if (this.explicitlyCleared) return; + var cm = this.doc.cm, withOp = cm && !cm.curOp; + if (withOp) startOperation(cm); + if (hasHandler(this, "clear")) { + var found = this.find(); + if (found) signalLater(this, "clear", found.from, found.to); + } + var min = null, max = null; + for (var i = 0; i < this.lines.length; ++i) { + var line = this.lines[i]; + var span = getMarkedSpanFor(line.markedSpans, this); + if (cm && !this.collapsed) regLineChange(cm, lineNo(line), "text"); + else if (cm) { + if (span.to != null) max = lineNo(line); + if (span.from != null) min = lineNo(line); + } + line.markedSpans = removeMarkedSpan(line.markedSpans, span); + if (span.from == null && this.collapsed && !lineIsHidden(this.doc, line) && cm) + updateLineHeight(line, textHeight(cm.display)); + } + if (cm && this.collapsed && !cm.options.lineWrapping) for (var i = 0; i < this.lines.length; ++i) { + var visual = visualLine(this.lines[i]), len = lineLength(visual); + if (len > cm.display.maxLineLength) { + cm.display.maxLine = visual; + cm.display.maxLineLength = len; + cm.display.maxLineChanged = true; + } + } + + if (min != null && cm && this.collapsed) regChange(cm, min, max + 1); + this.lines.length = 0; + this.explicitlyCleared = true; + if (this.atomic && this.doc.cantEdit) { + this.doc.cantEdit = false; + if (cm) reCheckSelection(cm.doc); + } + if (cm) signalLater(cm, "markerCleared", cm, this); + if (withOp) endOperation(cm); + if (this.parent) this.parent.clear(); + }; + + // Find the position of the marker in the document. Returns a {from, + // to} object by default. Side can be passed to get a specific side + // -- 0 (both), -1 (left), or 1 (right). When lineObj is true, the + // Pos objects returned contain a line object, rather than a line + // number (used to prevent looking up the same line twice). + TextMarker.prototype.find = function(side, lineObj) { + if (side == null && this.type == "bookmark") side = 1; + var from, to; + for (var i = 0; i < this.lines.length; ++i) { + var line = this.lines[i]; + var span = getMarkedSpanFor(line.markedSpans, this); + if (span.from != null) { + from = Pos(lineObj ? line : lineNo(line), span.from); + if (side == -1) return from; + } + if (span.to != null) { + to = Pos(lineObj ? line : lineNo(line), span.to); + if (side == 1) return to; + } + } + return from && {from: from, to: to}; + }; + + // Signals that the marker's widget changed, and surrounding layout + // should be recomputed. + TextMarker.prototype.changed = function() { + var pos = this.find(-1, true), widget = this, cm = this.doc.cm; + if (!pos || !cm) return; + runInOp(cm, function() { + var line = pos.line, lineN = lineNo(pos.line); + var view = findViewForLine(cm, lineN); + if (view) { + clearLineMeasurementCacheFor(view); + cm.curOp.selectionChanged = cm.curOp.forceUpdate = true; + } + cm.curOp.updateMaxLine = true; + if (!lineIsHidden(widget.doc, line) && widget.height != null) { + var oldHeight = widget.height; + widget.height = null; + var dHeight = widgetHeight(widget) - oldHeight; + if (dHeight) + updateLineHeight(line, line.height + dHeight); + } + }); + }; + + TextMarker.prototype.attachLine = function(line) { + if (!this.lines.length && this.doc.cm) { + var op = this.doc.cm.curOp; + if (!op.maybeHiddenMarkers || indexOf(op.maybeHiddenMarkers, this) == -1) + (op.maybeUnhiddenMarkers || (op.maybeUnhiddenMarkers = [])).push(this); + } + this.lines.push(line); + }; + TextMarker.prototype.detachLine = function(line) { + this.lines.splice(indexOf(this.lines, line), 1); + if (!this.lines.length && this.doc.cm) { + var op = this.doc.cm.curOp; + (op.maybeHiddenMarkers || (op.maybeHiddenMarkers = [])).push(this); + } + }; + + // Collapsed markers have unique ids, in order to be able to order + // them, which is needed for uniquely determining an outer marker + // when they overlap (they may nest, but not partially overlap). + var nextMarkerId = 0; + + // Create a marker, wire it up to the right lines, and + function markText(doc, from, to, options, type) { + // Shared markers (across linked documents) are handled separately + // (markTextShared will call out to this again, once per + // document). + if (options && options.shared) return markTextShared(doc, from, to, options, type); + // Ensure we are in an operation. + if (doc.cm && !doc.cm.curOp) return operation(doc.cm, markText)(doc, from, to, options, type); + + var marker = new TextMarker(doc, type), diff = cmp(from, to); + if (options) copyObj(options, marker, false); + // Don't connect empty markers unless clearWhenEmpty is false + if (diff > 0 || diff == 0 && marker.clearWhenEmpty !== false) + return marker; + if (marker.replacedWith) { + // Showing up as a widget implies collapsed (widget replaces text) + marker.collapsed = true; + marker.widgetNode = elt("span", [marker.replacedWith], "CodeMirror-widget"); + if (!options.handleMouseEvents) marker.widgetNode.setAttribute("cm-ignore-events", "true"); + if (options.insertLeft) marker.widgetNode.insertLeft = true; + } + if (marker.collapsed) { + if (conflictingCollapsedRange(doc, from.line, from, to, marker) || + from.line != to.line && conflictingCollapsedRange(doc, to.line, from, to, marker)) + throw new Error("Inserting collapsed marker partially overlapping an existing one"); + sawCollapsedSpans = true; + } + + if (marker.addToHistory) + addChangeToHistory(doc, {from: from, to: to, origin: "markText"}, doc.sel, NaN); + + var curLine = from.line, cm = doc.cm, updateMaxLine; + doc.iter(curLine, to.line + 1, function(line) { + if (cm && marker.collapsed && !cm.options.lineWrapping && visualLine(line) == cm.display.maxLine) + updateMaxLine = true; + if (marker.collapsed && curLine != from.line) updateLineHeight(line, 0); + addMarkedSpan(line, new MarkedSpan(marker, + curLine == from.line ? from.ch : null, + curLine == to.line ? to.ch : null)); + ++curLine; + }); + // lineIsHidden depends on the presence of the spans, so needs a second pass + if (marker.collapsed) doc.iter(from.line, to.line + 1, function(line) { + if (lineIsHidden(doc, line)) updateLineHeight(line, 0); + }); + + if (marker.clearOnEnter) on(marker, "beforeCursorEnter", function() { marker.clear(); }); + + if (marker.readOnly) { + sawReadOnlySpans = true; + if (doc.history.done.length || doc.history.undone.length) + doc.clearHistory(); + } + if (marker.collapsed) { + marker.id = ++nextMarkerId; + marker.atomic = true; + } + if (cm) { + // Sync editor state + if (updateMaxLine) cm.curOp.updateMaxLine = true; + if (marker.collapsed) + regChange(cm, from.line, to.line + 1); + else if (marker.className || marker.title || marker.startStyle || marker.endStyle || marker.css) + for (var i = from.line; i <= to.line; i++) regLineChange(cm, i, "text"); + if (marker.atomic) reCheckSelection(cm.doc); + signalLater(cm, "markerAdded", cm, marker); + } + return marker; + } + + // SHARED TEXTMARKERS + + // A shared marker spans multiple linked documents. It is + // implemented as a meta-marker-object controlling multiple normal + // markers. + var SharedTextMarker = CodeMirror.SharedTextMarker = function(markers, primary) { + this.markers = markers; + this.primary = primary; + for (var i = 0; i < markers.length; ++i) + markers[i].parent = this; + }; + eventMixin(SharedTextMarker); + + SharedTextMarker.prototype.clear = function() { + if (this.explicitlyCleared) return; + this.explicitlyCleared = true; + for (var i = 0; i < this.markers.length; ++i) + this.markers[i].clear(); + signalLater(this, "clear"); + }; + SharedTextMarker.prototype.find = function(side, lineObj) { + return this.primary.find(side, lineObj); + }; + + function markTextShared(doc, from, to, options, type) { + options = copyObj(options); + options.shared = false; + var markers = [markText(doc, from, to, options, type)], primary = markers[0]; + var widget = options.widgetNode; + linkedDocs(doc, function(doc) { + if (widget) options.widgetNode = widget.cloneNode(true); + markers.push(markText(doc, clipPos(doc, from), clipPos(doc, to), options, type)); + for (var i = 0; i < doc.linked.length; ++i) + if (doc.linked[i].isParent) return; + primary = lst(markers); + }); + return new SharedTextMarker(markers, primary); + } + + function findSharedMarkers(doc) { + return doc.findMarks(Pos(doc.first, 0), doc.clipPos(Pos(doc.lastLine())), + function(m) { return m.parent; }); + } + + function copySharedMarkers(doc, markers) { + for (var i = 0; i < markers.length; i++) { + var marker = markers[i], pos = marker.find(); + var mFrom = doc.clipPos(pos.from), mTo = doc.clipPos(pos.to); + if (cmp(mFrom, mTo)) { + var subMark = markText(doc, mFrom, mTo, marker.primary, marker.primary.type); + marker.markers.push(subMark); + subMark.parent = marker; + } + } + } + + function detachSharedMarkers(markers) { + for (var i = 0; i < markers.length; i++) { + var marker = markers[i], linked = [marker.primary.doc];; + linkedDocs(marker.primary.doc, function(d) { linked.push(d); }); + for (var j = 0; j < marker.markers.length; j++) { + var subMarker = marker.markers[j]; + if (indexOf(linked, subMarker.doc) == -1) { + subMarker.parent = null; + marker.markers.splice(j--, 1); + } + } + } + } + + // TEXTMARKER SPANS + + function MarkedSpan(marker, from, to) { + this.marker = marker; + this.from = from; this.to = to; + } + + // Search an array of spans for a span matching the given marker. + function getMarkedSpanFor(spans, marker) { + if (spans) for (var i = 0; i < spans.length; ++i) { + var span = spans[i]; + if (span.marker == marker) return span; + } + } + // Remove a span from an array, returning undefined if no spans are + // left (we don't store arrays for lines without spans). + function removeMarkedSpan(spans, span) { + for (var r, i = 0; i < spans.length; ++i) + if (spans[i] != span) (r || (r = [])).push(spans[i]); + return r; + } + // Add a span to a line. + function addMarkedSpan(line, span) { + line.markedSpans = line.markedSpans ? line.markedSpans.concat([span]) : [span]; + span.marker.attachLine(line); + } + + // Used for the algorithm that adjusts markers for a change in the + // document. These functions cut an array of spans at a given + // character position, returning an array of remaining chunks (or + // undefined if nothing remains). + function markedSpansBefore(old, startCh, isInsert) { + if (old) for (var i = 0, nw; i < old.length; ++i) { + var span = old[i], marker = span.marker; + var startsBefore = span.from == null || (marker.inclusiveLeft ? span.from <= startCh : span.from < startCh); + if (startsBefore || span.from == startCh && marker.type == "bookmark" && (!isInsert || !span.marker.insertLeft)) { + var endsAfter = span.to == null || (marker.inclusiveRight ? span.to >= startCh : span.to > startCh); + (nw || (nw = [])).push(new MarkedSpan(marker, span.from, endsAfter ? null : span.to)); + } + } + return nw; + } + function markedSpansAfter(old, endCh, isInsert) { + if (old) for (var i = 0, nw; i < old.length; ++i) { + var span = old[i], marker = span.marker; + var endsAfter = span.to == null || (marker.inclusiveRight ? span.to >= endCh : span.to > endCh); + if (endsAfter || span.from == endCh && marker.type == "bookmark" && (!isInsert || span.marker.insertLeft)) { + var startsBefore = span.from == null || (marker.inclusiveLeft ? span.from <= endCh : span.from < endCh); + (nw || (nw = [])).push(new MarkedSpan(marker, startsBefore ? null : span.from - endCh, + span.to == null ? null : span.to - endCh)); + } + } + return nw; + } + + // Given a change object, compute the new set of marker spans that + // cover the line in which the change took place. Removes spans + // entirely within the change, reconnects spans belonging to the + // same marker that appear on both sides of the change, and cuts off + // spans partially within the change. Returns an array of span + // arrays with one element for each line in (after) the change. + function stretchSpansOverChange(doc, change) { + if (change.full) return null; + var oldFirst = isLine(doc, change.from.line) && getLine(doc, change.from.line).markedSpans; + var oldLast = isLine(doc, change.to.line) && getLine(doc, change.to.line).markedSpans; + if (!oldFirst && !oldLast) return null; + + var startCh = change.from.ch, endCh = change.to.ch, isInsert = cmp(change.from, change.to) == 0; + // Get the spans that 'stick out' on both sides + var first = markedSpansBefore(oldFirst, startCh, isInsert); + var last = markedSpansAfter(oldLast, endCh, isInsert); + + // Next, merge those two ends + var sameLine = change.text.length == 1, offset = lst(change.text).length + (sameLine ? startCh : 0); + if (first) { + // Fix up .to properties of first + for (var i = 0; i < first.length; ++i) { + var span = first[i]; + if (span.to == null) { + var found = getMarkedSpanFor(last, span.marker); + if (!found) span.to = startCh; + else if (sameLine) span.to = found.to == null ? null : found.to + offset; + } + } + } + if (last) { + // Fix up .from in last (or move them into first in case of sameLine) + for (var i = 0; i < last.length; ++i) { + var span = last[i]; + if (span.to != null) span.to += offset; + if (span.from == null) { + var found = getMarkedSpanFor(first, span.marker); + if (!found) { + span.from = offset; + if (sameLine) (first || (first = [])).push(span); + } + } else { + span.from += offset; + if (sameLine) (first || (first = [])).push(span); + } + } + } + // Make sure we didn't create any zero-length spans + if (first) first = clearEmptySpans(first); + if (last && last != first) last = clearEmptySpans(last); + + var newMarkers = [first]; + if (!sameLine) { + // Fill gap with whole-line-spans + var gap = change.text.length - 2, gapMarkers; + if (gap > 0 && first) + for (var i = 0; i < first.length; ++i) + if (first[i].to == null) + (gapMarkers || (gapMarkers = [])).push(new MarkedSpan(first[i].marker, null, null)); + for (var i = 0; i < gap; ++i) + newMarkers.push(gapMarkers); + newMarkers.push(last); + } + return newMarkers; + } + + // Remove spans that are empty and don't have a clearWhenEmpty + // option of false. + function clearEmptySpans(spans) { + for (var i = 0; i < spans.length; ++i) { + var span = spans[i]; + if (span.from != null && span.from == span.to && span.marker.clearWhenEmpty !== false) + spans.splice(i--, 1); + } + if (!spans.length) return null; + return spans; + } + + // Used for un/re-doing changes from the history. Combines the + // result of computing the existing spans with the set of spans that + // existed in the history (so that deleting around a span and then + // undoing brings back the span). + function mergeOldSpans(doc, change) { + var old = getOldSpans(doc, change); + var stretched = stretchSpansOverChange(doc, change); + if (!old) return stretched; + if (!stretched) return old; + + for (var i = 0; i < old.length; ++i) { + var oldCur = old[i], stretchCur = stretched[i]; + if (oldCur && stretchCur) { + spans: for (var j = 0; j < stretchCur.length; ++j) { + var span = stretchCur[j]; + for (var k = 0; k < oldCur.length; ++k) + if (oldCur[k].marker == span.marker) continue spans; + oldCur.push(span); + } + } else if (stretchCur) { + old[i] = stretchCur; + } + } + return old; + } + + // Used to 'clip' out readOnly ranges when making a change. + function removeReadOnlyRanges(doc, from, to) { + var markers = null; + doc.iter(from.line, to.line + 1, function(line) { + if (line.markedSpans) for (var i = 0; i < line.markedSpans.length; ++i) { + var mark = line.markedSpans[i].marker; + if (mark.readOnly && (!markers || indexOf(markers, mark) == -1)) + (markers || (markers = [])).push(mark); + } + }); + if (!markers) return null; + var parts = [{from: from, to: to}]; + for (var i = 0; i < markers.length; ++i) { + var mk = markers[i], m = mk.find(0); + for (var j = 0; j < parts.length; ++j) { + var p = parts[j]; + if (cmp(p.to, m.from) < 0 || cmp(p.from, m.to) > 0) continue; + var newParts = [j, 1], dfrom = cmp(p.from, m.from), dto = cmp(p.to, m.to); + if (dfrom < 0 || !mk.inclusiveLeft && !dfrom) + newParts.push({from: p.from, to: m.from}); + if (dto > 0 || !mk.inclusiveRight && !dto) + newParts.push({from: m.to, to: p.to}); + parts.splice.apply(parts, newParts); + j += newParts.length - 1; + } + } + return parts; + } + + // Connect or disconnect spans from a line. + function detachMarkedSpans(line) { + var spans = line.markedSpans; + if (!spans) return; + for (var i = 0; i < spans.length; ++i) + spans[i].marker.detachLine(line); + line.markedSpans = null; + } + function attachMarkedSpans(line, spans) { + if (!spans) return; + for (var i = 0; i < spans.length; ++i) + spans[i].marker.attachLine(line); + line.markedSpans = spans; + } + + // Helpers used when computing which overlapping collapsed span + // counts as the larger one. + function extraLeft(marker) { return marker.inclusiveLeft ? -1 : 0; } + function extraRight(marker) { return marker.inclusiveRight ? 1 : 0; } + + // Returns a number indicating which of two overlapping collapsed + // spans is larger (and thus includes the other). Falls back to + // comparing ids when the spans cover exactly the same range. + function compareCollapsedMarkers(a, b) { + var lenDiff = a.lines.length - b.lines.length; + if (lenDiff != 0) return lenDiff; + var aPos = a.find(), bPos = b.find(); + var fromCmp = cmp(aPos.from, bPos.from) || extraLeft(a) - extraLeft(b); + if (fromCmp) return -fromCmp; + var toCmp = cmp(aPos.to, bPos.to) || extraRight(a) - extraRight(b); + if (toCmp) return toCmp; + return b.id - a.id; + } + + // Find out whether a line ends or starts in a collapsed span. If + // so, return the marker for that span. + function collapsedSpanAtSide(line, start) { + var sps = sawCollapsedSpans && line.markedSpans, found; + if (sps) for (var sp, i = 0; i < sps.length; ++i) { + sp = sps[i]; + if (sp.marker.collapsed && (start ? sp.from : sp.to) == null && + (!found || compareCollapsedMarkers(found, sp.marker) < 0)) + found = sp.marker; + } + return found; + } + function collapsedSpanAtStart(line) { return collapsedSpanAtSide(line, true); } + function collapsedSpanAtEnd(line) { return collapsedSpanAtSide(line, false); } + + // Test whether there exists a collapsed span that partially + // overlaps (covers the start or end, but not both) of a new span. + // Such overlap is not allowed. + function conflictingCollapsedRange(doc, lineNo, from, to, marker) { + var line = getLine(doc, lineNo); + var sps = sawCollapsedSpans && line.markedSpans; + if (sps) for (var i = 0; i < sps.length; ++i) { + var sp = sps[i]; + if (!sp.marker.collapsed) continue; + var found = sp.marker.find(0); + var fromCmp = cmp(found.from, from) || extraLeft(sp.marker) - extraLeft(marker); + var toCmp = cmp(found.to, to) || extraRight(sp.marker) - extraRight(marker); + if (fromCmp >= 0 && toCmp <= 0 || fromCmp <= 0 && toCmp >= 0) continue; + if (fromCmp <= 0 && (sp.marker.inclusiveRight && marker.inclusiveLeft ? cmp(found.to, from) >= 0 : cmp(found.to, from) > 0) || + fromCmp >= 0 && (sp.marker.inclusiveRight && marker.inclusiveLeft ? cmp(found.from, to) <= 0 : cmp(found.from, to) < 0)) + return true; + } + } + + // A visual line is a line as drawn on the screen. Folding, for + // example, can cause multiple logical lines to appear on the same + // visual line. This finds the start of the visual line that the + // given line is part of (usually that is the line itself). + function visualLine(line) { + var merged; + while (merged = collapsedSpanAtStart(line)) + line = merged.find(-1, true).line; + return line; + } + + // Returns an array of logical lines that continue the visual line + // started by the argument, or undefined if there are no such lines. + function visualLineContinued(line) { + var merged, lines; + while (merged = collapsedSpanAtEnd(line)) { + line = merged.find(1, true).line; + (lines || (lines = [])).push(line); + } + return lines; + } + + // Get the line number of the start of the visual line that the + // given line number is part of. + function visualLineNo(doc, lineN) { + var line = getLine(doc, lineN), vis = visualLine(line); + if (line == vis) return lineN; + return lineNo(vis); + } + // Get the line number of the start of the next visual line after + // the given line. + function visualLineEndNo(doc, lineN) { + if (lineN > doc.lastLine()) return lineN; + var line = getLine(doc, lineN), merged; + if (!lineIsHidden(doc, line)) return lineN; + while (merged = collapsedSpanAtEnd(line)) + line = merged.find(1, true).line; + return lineNo(line) + 1; + } + + // Compute whether a line is hidden. Lines count as hidden when they + // are part of a visual line that starts with another line, or when + // they are entirely covered by collapsed, non-widget span. + function lineIsHidden(doc, line) { + var sps = sawCollapsedSpans && line.markedSpans; + if (sps) for (var sp, i = 0; i < sps.length; ++i) { + sp = sps[i]; + if (!sp.marker.collapsed) continue; + if (sp.from == null) return true; + if (sp.marker.widgetNode) continue; + if (sp.from == 0 && sp.marker.inclusiveLeft && lineIsHiddenInner(doc, line, sp)) + return true; + } + } + function lineIsHiddenInner(doc, line, span) { + if (span.to == null) { + var end = span.marker.find(1, true); + return lineIsHiddenInner(doc, end.line, getMarkedSpanFor(end.line.markedSpans, span.marker)); + } + if (span.marker.inclusiveRight && span.to == line.text.length) + return true; + for (var sp, i = 0; i < line.markedSpans.length; ++i) { + sp = line.markedSpans[i]; + if (sp.marker.collapsed && !sp.marker.widgetNode && sp.from == span.to && + (sp.to == null || sp.to != span.from) && + (sp.marker.inclusiveLeft || span.marker.inclusiveRight) && + lineIsHiddenInner(doc, line, sp)) return true; + } + } + + // LINE WIDGETS + + // Line widgets are block elements displayed above or below a line. + + var LineWidget = CodeMirror.LineWidget = function(doc, node, options) { + if (options) for (var opt in options) if (options.hasOwnProperty(opt)) + this[opt] = options[opt]; + this.doc = doc; + this.node = node; + }; + eventMixin(LineWidget); + + function adjustScrollWhenAboveVisible(cm, line, diff) { + if (heightAtLine(line) < ((cm.curOp && cm.curOp.scrollTop) || cm.doc.scrollTop)) + addToScrollPos(cm, null, diff); + } + + LineWidget.prototype.clear = function() { + var cm = this.doc.cm, ws = this.line.widgets, line = this.line, no = lineNo(line); + if (no == null || !ws) return; + for (var i = 0; i < ws.length; ++i) if (ws[i] == this) ws.splice(i--, 1); + if (!ws.length) line.widgets = null; + var height = widgetHeight(this); + updateLineHeight(line, Math.max(0, line.height - height)); + if (cm) runInOp(cm, function() { + adjustScrollWhenAboveVisible(cm, line, -height); + regLineChange(cm, no, "widget"); + }); + }; + LineWidget.prototype.changed = function() { + var oldH = this.height, cm = this.doc.cm, line = this.line; + this.height = null; + var diff = widgetHeight(this) - oldH; + if (!diff) return; + updateLineHeight(line, line.height + diff); + if (cm) runInOp(cm, function() { + cm.curOp.forceUpdate = true; + adjustScrollWhenAboveVisible(cm, line, diff); + }); + }; + + function widgetHeight(widget) { + if (widget.height != null) return widget.height; + var cm = widget.doc.cm; + if (!cm) return 0; + if (!contains(document.body, widget.node)) { + var parentStyle = "position: relative;"; + if (widget.coverGutter) + parentStyle += "margin-left: -" + cm.display.gutters.offsetWidth + "px;"; + if (widget.noHScroll) + parentStyle += "width: " + cm.display.wrapper.clientWidth + "px;"; + removeChildrenAndAdd(cm.display.measure, elt("div", [widget.node], null, parentStyle)); + } + return widget.height = widget.node.parentNode.offsetHeight; + } + + function addLineWidget(doc, handle, node, options) { + var widget = new LineWidget(doc, node, options); + var cm = doc.cm; + if (cm && widget.noHScroll) cm.display.alignWidgets = true; + changeLine(doc, handle, "widget", function(line) { + var widgets = line.widgets || (line.widgets = []); + if (widget.insertAt == null) widgets.push(widget); + else widgets.splice(Math.min(widgets.length - 1, Math.max(0, widget.insertAt)), 0, widget); + widget.line = line; + if (cm && !lineIsHidden(doc, line)) { + var aboveVisible = heightAtLine(line) < doc.scrollTop; + updateLineHeight(line, line.height + widgetHeight(widget)); + if (aboveVisible) addToScrollPos(cm, null, widget.height); + cm.curOp.forceUpdate = true; + } + return true; + }); + return widget; + } + + // LINE DATA STRUCTURE + + // Line objects. These hold state related to a line, including + // highlighting info (the styles array). + var Line = CodeMirror.Line = function(text, markedSpans, estimateHeight) { + this.text = text; + attachMarkedSpans(this, markedSpans); + this.height = estimateHeight ? estimateHeight(this) : 1; + }; + eventMixin(Line); + Line.prototype.lineNo = function() { return lineNo(this); }; + + // Change the content (text, markers) of a line. Automatically + // invalidates cached information and tries to re-estimate the + // line's height. + function updateLine(line, text, markedSpans, estimateHeight) { + line.text = text; + if (line.stateAfter) line.stateAfter = null; + if (line.styles) line.styles = null; + if (line.order != null) line.order = null; + detachMarkedSpans(line); + attachMarkedSpans(line, markedSpans); + var estHeight = estimateHeight ? estimateHeight(line) : 1; + if (estHeight != line.height) updateLineHeight(line, estHeight); + } + + // Detach a line from the document tree and its markers. + function cleanUpLine(line) { + line.parent = null; + detachMarkedSpans(line); + } + + function extractLineClasses(type, output) { + if (type) for (;;) { + var lineClass = type.match(/(?:^|\s+)line-(background-)?(\S+)/); + if (!lineClass) break; + type = type.slice(0, lineClass.index) + type.slice(lineClass.index + lineClass[0].length); + var prop = lineClass[1] ? "bgClass" : "textClass"; + if (output[prop] == null) + output[prop] = lineClass[2]; + else if (!(new RegExp("(?:^|\s)" + lineClass[2] + "(?:$|\s)")).test(output[prop])) + output[prop] += " " + lineClass[2]; + } + return type; + } + + function callBlankLine(mode, state) { + if (mode.blankLine) return mode.blankLine(state); + if (!mode.innerMode) return; + var inner = CodeMirror.innerMode(mode, state); + if (inner.mode.blankLine) return inner.mode.blankLine(inner.state); + } + + function readToken(mode, stream, state, inner) { + for (var i = 0; i < 10; i++) { + if (inner) inner[0] = CodeMirror.innerMode(mode, state).mode; + var style = mode.token(stream, state); + if (stream.pos > stream.start) return style; + } + throw new Error("Mode " + mode.name + " failed to advance stream."); + } + + // Utility for getTokenAt and getLineTokens + function takeToken(cm, pos, precise, asArray) { + function getObj(copy) { + return {start: stream.start, end: stream.pos, + string: stream.current(), + type: style || null, + state: copy ? copyState(doc.mode, state) : state}; + } + + var doc = cm.doc, mode = doc.mode, style; + pos = clipPos(doc, pos); + var line = getLine(doc, pos.line), state = getStateBefore(cm, pos.line, precise); + var stream = new StringStream(line.text, cm.options.tabSize), tokens; + if (asArray) tokens = []; + while ((asArray || stream.pos < pos.ch) && !stream.eol()) { + stream.start = stream.pos; + style = readToken(mode, stream, state); + if (asArray) tokens.push(getObj(true)); + } + return asArray ? tokens : getObj(); + } + + // Run the given mode's parser over a line, calling f for each token. + function runMode(cm, text, mode, state, f, lineClasses, forceToEnd) { + var flattenSpans = mode.flattenSpans; + if (flattenSpans == null) flattenSpans = cm.options.flattenSpans; + var curStart = 0, curStyle = null; + var stream = new StringStream(text, cm.options.tabSize), style; + var inner = cm.options.addModeClass && [null]; + if (text == "") extractLineClasses(callBlankLine(mode, state), lineClasses); + while (!stream.eol()) { + if (stream.pos > cm.options.maxHighlightLength) { + flattenSpans = false; + if (forceToEnd) processLine(cm, text, state, stream.pos); + stream.pos = text.length; + style = null; + } else { + style = extractLineClasses(readToken(mode, stream, state, inner), lineClasses); + } + if (inner) { + var mName = inner[0].name; + if (mName) style = "m-" + (style ? mName + " " + style : mName); + } + if (!flattenSpans || curStyle != style) { + while (curStart < stream.start) { + curStart = Math.min(stream.start, curStart + 50000); + f(curStart, curStyle); + } + curStyle = style; + } + stream.start = stream.pos; + } + while (curStart < stream.pos) { + // Webkit seems to refuse to render text nodes longer than 57444 characters + var pos = Math.min(stream.pos, curStart + 50000); + f(pos, curStyle); + curStart = pos; + } + } + + // Compute a style array (an array starting with a mode generation + // -- for invalidation -- followed by pairs of end positions and + // style strings), which is used to highlight the tokens on the + // line. + function highlightLine(cm, line, state, forceToEnd) { + // A styles array always starts with a number identifying the + // mode/overlays that it is based on (for easy invalidation). + var st = [cm.state.modeGen], lineClasses = {}; + // Compute the base array of styles + runMode(cm, line.text, cm.doc.mode, state, function(end, style) { + st.push(end, style); + }, lineClasses, forceToEnd); + + // Run overlays, adjust style array. + for (var o = 0; o < cm.state.overlays.length; ++o) { + var overlay = cm.state.overlays[o], i = 1, at = 0; + runMode(cm, line.text, overlay.mode, true, function(end, style) { + var start = i; + // Ensure there's a token end at the current position, and that i points at it + while (at < end) { + var i_end = st[i]; + if (i_end > end) + st.splice(i, 1, end, st[i+1], i_end); + i += 2; + at = Math.min(end, i_end); + } + if (!style) return; + if (overlay.opaque) { + st.splice(start, i - start, end, "cm-overlay " + style); + i = start + 2; + } else { + for (; start < i; start += 2) { + var cur = st[start+1]; + st[start+1] = (cur ? cur + " " : "") + "cm-overlay " + style; + } + } + }, lineClasses); + } + + return {styles: st, classes: lineClasses.bgClass || lineClasses.textClass ? lineClasses : null}; + } + + function getLineStyles(cm, line, updateFrontier) { + if (!line.styles || line.styles[0] != cm.state.modeGen) { + var state = getStateBefore(cm, lineNo(line)); + var result = highlightLine(cm, line, line.text.length > cm.options.maxHighlightLength ? copyState(cm.doc.mode, state) : state); + line.stateAfter = state; + line.styles = result.styles; + if (result.classes) line.styleClasses = result.classes; + else if (line.styleClasses) line.styleClasses = null; + if (updateFrontier === cm.doc.frontier) cm.doc.frontier++; + } + return line.styles; + } + + // Lightweight form of highlight -- proceed over this line and + // update state, but don't save a style array. Used for lines that + // aren't currently visible. + function processLine(cm, text, state, startAt) { + var mode = cm.doc.mode; + var stream = new StringStream(text, cm.options.tabSize); + stream.start = stream.pos = startAt || 0; + if (text == "") callBlankLine(mode, state); + while (!stream.eol()) { + readToken(mode, stream, state); + stream.start = stream.pos; + } + } + + // Convert a style as returned by a mode (either null, or a string + // containing one or more styles) to a CSS style. This is cached, + // and also looks for line-wide styles. + var styleToClassCache = {}, styleToClassCacheWithMode = {}; + function interpretTokenStyle(style, options) { + if (!style || /^\s*$/.test(style)) return null; + var cache = options.addModeClass ? styleToClassCacheWithMode : styleToClassCache; + return cache[style] || + (cache[style] = style.replace(/\S+/g, "cm-$&")); + } + + // Render the DOM representation of the text of a line. Also builds + // up a 'line map', which points at the DOM nodes that represent + // specific stretches of text, and is used by the measuring code. + // The returned object contains the DOM node, this map, and + // information about line-wide styles that were set by the mode. + function buildLineContent(cm, lineView) { + // The padding-right forces the element to have a 'border', which + // is needed on Webkit to be able to get line-level bounding + // rectangles for it (in measureChar). + var content = elt("span", null, null, webkit ? "padding-right: .1px" : null); + var builder = {pre: elt("pre", [content], "CodeMirror-line"), content: content, + col: 0, pos: 0, cm: cm, + trailingSpace: false, + splitSpaces: (ie || webkit) && cm.getOption("lineWrapping")}; + lineView.measure = {}; + + // Iterate over the logical lines that make up this visual line. + for (var i = 0; i <= (lineView.rest ? lineView.rest.length : 0); i++) { + var line = i ? lineView.rest[i - 1] : lineView.line, order; + builder.pos = 0; + builder.addToken = buildToken; + // Optionally wire in some hacks into the token-rendering + // algorithm, to deal with browser quirks. + if (hasBadBidiRects(cm.display.measure) && (order = getOrder(line))) + builder.addToken = buildTokenBadBidi(builder.addToken, order); + builder.map = []; + var allowFrontierUpdate = lineView != cm.display.externalMeasured && lineNo(line); + insertLineContent(line, builder, getLineStyles(cm, line, allowFrontierUpdate)); + if (line.styleClasses) { + if (line.styleClasses.bgClass) + builder.bgClass = joinClasses(line.styleClasses.bgClass, builder.bgClass || ""); + if (line.styleClasses.textClass) + builder.textClass = joinClasses(line.styleClasses.textClass, builder.textClass || ""); + } + + // Ensure at least a single node is present, for measuring. + if (builder.map.length == 0) + builder.map.push(0, 0, builder.content.appendChild(zeroWidthElement(cm.display.measure))); + + // Store the map and a cache object for the current logical line + if (i == 0) { + lineView.measure.map = builder.map; + lineView.measure.cache = {}; + } else { + (lineView.measure.maps || (lineView.measure.maps = [])).push(builder.map); + (lineView.measure.caches || (lineView.measure.caches = [])).push({}); + } + } + + // See issue #2901 + if (webkit) { + var last = builder.content.lastChild + if (/\bcm-tab\b/.test(last.className) || (last.querySelector && last.querySelector(".cm-tab"))) + builder.content.className = "cm-tab-wrap-hack"; + } + + signal(cm, "renderLine", cm, lineView.line, builder.pre); + if (builder.pre.className) + builder.textClass = joinClasses(builder.pre.className, builder.textClass || ""); + + return builder; + } + + function defaultSpecialCharPlaceholder(ch) { + var token = elt("span", "\u2022", "cm-invalidchar"); + token.title = "\\u" + ch.charCodeAt(0).toString(16); + token.setAttribute("aria-label", token.title); + return token; + } + + // Build up the DOM representation for a single token, and add it to + // the line map. Takes care to render special characters separately. + function buildToken(builder, text, style, startStyle, endStyle, title, css) { + if (!text) return; + var displayText = builder.splitSpaces ? splitSpaces(text, builder.trailingSpace) : text + var special = builder.cm.state.specialChars, mustWrap = false; + if (!special.test(text)) { + builder.col += text.length; + var content = document.createTextNode(displayText); + builder.map.push(builder.pos, builder.pos + text.length, content); + if (ie && ie_version < 9) mustWrap = true; + builder.pos += text.length; + } else { + var content = document.createDocumentFragment(), pos = 0; + while (true) { + special.lastIndex = pos; + var m = special.exec(text); + var skipped = m ? m.index - pos : text.length - pos; + if (skipped) { + var txt = document.createTextNode(displayText.slice(pos, pos + skipped)); + if (ie && ie_version < 9) content.appendChild(elt("span", [txt])); + else content.appendChild(txt); + builder.map.push(builder.pos, builder.pos + skipped, txt); + builder.col += skipped; + builder.pos += skipped; + } + if (!m) break; + pos += skipped + 1; + if (m[0] == "\t") { + var tabSize = builder.cm.options.tabSize, tabWidth = tabSize - builder.col % tabSize; + var txt = content.appendChild(elt("span", spaceStr(tabWidth), "cm-tab")); + txt.setAttribute("role", "presentation"); + txt.setAttribute("cm-text", "\t"); + builder.col += tabWidth; + } else if (m[0] == "\r" || m[0] == "\n") { + var txt = content.appendChild(elt("span", m[0] == "\r" ? "\u240d" : "\u2424", "cm-invalidchar")); + txt.setAttribute("cm-text", m[0]); + builder.col += 1; + } else { + var txt = builder.cm.options.specialCharPlaceholder(m[0]); + txt.setAttribute("cm-text", m[0]); + if (ie && ie_version < 9) content.appendChild(elt("span", [txt])); + else content.appendChild(txt); + builder.col += 1; + } + builder.map.push(builder.pos, builder.pos + 1, txt); + builder.pos++; + } + } + builder.trailingSpace = displayText.charCodeAt(text.length - 1) == 32 + if (style || startStyle || endStyle || mustWrap || css) { + var fullStyle = style || ""; + if (startStyle) fullStyle += startStyle; + if (endStyle) fullStyle += endStyle; + var token = elt("span", [content], fullStyle, css); + if (title) token.title = title; + return builder.content.appendChild(token); + } + builder.content.appendChild(content); + } + + function splitSpaces(text, trailingBefore) { + if (text.length > 1 && !/ /.test(text)) return text + var spaceBefore = trailingBefore, result = "" + for (var i = 0; i < text.length; i++) { + var ch = text.charAt(i) + if (ch == " " && spaceBefore && (i == text.length - 1 || text.charCodeAt(i + 1) == 32)) + ch = "\u00a0" + result += ch + spaceBefore = ch == " " + } + return result + } + + // Work around nonsense dimensions being reported for stretches of + // right-to-left text. + function buildTokenBadBidi(inner, order) { + return function(builder, text, style, startStyle, endStyle, title, css) { + style = style ? style + " cm-force-border" : "cm-force-border"; + var start = builder.pos, end = start + text.length; + for (;;) { + // Find the part that overlaps with the start of this text + for (var i = 0; i < order.length; i++) { + var part = order[i]; + if (part.to > start && part.from <= start) break; + } + if (part.to >= end) return inner(builder, text, style, startStyle, endStyle, title, css); + inner(builder, text.slice(0, part.to - start), style, startStyle, null, title, css); + startStyle = null; + text = text.slice(part.to - start); + start = part.to; + } + }; + } + + function buildCollapsedSpan(builder, size, marker, ignoreWidget) { + var widget = !ignoreWidget && marker.widgetNode; + if (widget) builder.map.push(builder.pos, builder.pos + size, widget); + if (!ignoreWidget && builder.cm.display.input.needsContentAttribute) { + if (!widget) + widget = builder.content.appendChild(document.createElement("span")); + widget.setAttribute("cm-marker", marker.id); + } + if (widget) { + builder.cm.display.input.setUneditable(widget); + builder.content.appendChild(widget); + } + builder.pos += size; + builder.trailingSpace = false + } + + // Outputs a number of spans to make up a line, taking highlighting + // and marked text into account. + function insertLineContent(line, builder, styles) { + var spans = line.markedSpans, allText = line.text, at = 0; + if (!spans) { + for (var i = 1; i < styles.length; i+=2) + builder.addToken(builder, allText.slice(at, at = styles[i]), interpretTokenStyle(styles[i+1], builder.cm.options)); + return; + } + + var len = allText.length, pos = 0, i = 1, text = "", style, css; + var nextChange = 0, spanStyle, spanEndStyle, spanStartStyle, title, collapsed; + for (;;) { + if (nextChange == pos) { // Update current marker set + spanStyle = spanEndStyle = spanStartStyle = title = css = ""; + collapsed = null; nextChange = Infinity; + var foundBookmarks = [], endStyles + for (var j = 0; j < spans.length; ++j) { + var sp = spans[j], m = sp.marker; + if (m.type == "bookmark" && sp.from == pos && m.widgetNode) { + foundBookmarks.push(m); + } else if (sp.from <= pos && (sp.to == null || sp.to > pos || m.collapsed && sp.to == pos && sp.from == pos)) { + if (sp.to != null && sp.to != pos && nextChange > sp.to) { + nextChange = sp.to; + spanEndStyle = ""; + } + if (m.className) spanStyle += " " + m.className; + if (m.css) css = (css ? css + ";" : "") + m.css; + if (m.startStyle && sp.from == pos) spanStartStyle += " " + m.startStyle; + if (m.endStyle && sp.to == nextChange) (endStyles || (endStyles = [])).push(m.endStyle, sp.to) + if (m.title && !title) title = m.title; + if (m.collapsed && (!collapsed || compareCollapsedMarkers(collapsed.marker, m) < 0)) + collapsed = sp; + } else if (sp.from > pos && nextChange > sp.from) { + nextChange = sp.from; + } + } + if (endStyles) for (var j = 0; j < endStyles.length; j += 2) + if (endStyles[j + 1] == nextChange) spanEndStyle += " " + endStyles[j] + + if (!collapsed || collapsed.from == pos) for (var j = 0; j < foundBookmarks.length; ++j) + buildCollapsedSpan(builder, 0, foundBookmarks[j]); + if (collapsed && (collapsed.from || 0) == pos) { + buildCollapsedSpan(builder, (collapsed.to == null ? len + 1 : collapsed.to) - pos, + collapsed.marker, collapsed.from == null); + if (collapsed.to == null) return; + if (collapsed.to == pos) collapsed = false; + } + } + if (pos >= len) break; + + var upto = Math.min(len, nextChange); + while (true) { + if (text) { + var end = pos + text.length; + if (!collapsed) { + var tokenText = end > upto ? text.slice(0, upto - pos) : text; + builder.addToken(builder, tokenText, style ? style + spanStyle : spanStyle, + spanStartStyle, pos + tokenText.length == nextChange ? spanEndStyle : "", title, css); + } + if (end >= upto) {text = text.slice(upto - pos); pos = upto; break;} + pos = end; + spanStartStyle = ""; + } + text = allText.slice(at, at = styles[i++]); + style = interpretTokenStyle(styles[i++], builder.cm.options); + } + } + } + + // DOCUMENT DATA STRUCTURE + + // By default, updates that start and end at the beginning of a line + // are treated specially, in order to make the association of line + // widgets and marker elements with the text behave more intuitive. + function isWholeLineUpdate(doc, change) { + return change.from.ch == 0 && change.to.ch == 0 && lst(change.text) == "" && + (!doc.cm || doc.cm.options.wholeLineUpdateBefore); + } + + // Perform a change on the document data structure. + function updateDoc(doc, change, markedSpans, estimateHeight) { + function spansFor(n) {return markedSpans ? markedSpans[n] : null;} + function update(line, text, spans) { + updateLine(line, text, spans, estimateHeight); + signalLater(line, "change", line, change); + } + function linesFor(start, end) { + for (var i = start, result = []; i < end; ++i) + result.push(new Line(text[i], spansFor(i), estimateHeight)); + return result; + } + + var from = change.from, to = change.to, text = change.text; + var firstLine = getLine(doc, from.line), lastLine = getLine(doc, to.line); + var lastText = lst(text), lastSpans = spansFor(text.length - 1), nlines = to.line - from.line; + + // Adjust the line structure + if (change.full) { + doc.insert(0, linesFor(0, text.length)); + doc.remove(text.length, doc.size - text.length); + } else if (isWholeLineUpdate(doc, change)) { + // This is a whole-line replace. Treated specially to make + // sure line objects move the way they are supposed to. + var added = linesFor(0, text.length - 1); + update(lastLine, lastLine.text, lastSpans); + if (nlines) doc.remove(from.line, nlines); + if (added.length) doc.insert(from.line, added); + } else if (firstLine == lastLine) { + if (text.length == 1) { + update(firstLine, firstLine.text.slice(0, from.ch) + lastText + firstLine.text.slice(to.ch), lastSpans); + } else { + var added = linesFor(1, text.length - 1); + added.push(new Line(lastText + firstLine.text.slice(to.ch), lastSpans, estimateHeight)); + update(firstLine, firstLine.text.slice(0, from.ch) + text[0], spansFor(0)); + doc.insert(from.line + 1, added); + } + } else if (text.length == 1) { + update(firstLine, firstLine.text.slice(0, from.ch) + text[0] + lastLine.text.slice(to.ch), spansFor(0)); + doc.remove(from.line + 1, nlines); + } else { + update(firstLine, firstLine.text.slice(0, from.ch) + text[0], spansFor(0)); + update(lastLine, lastText + lastLine.text.slice(to.ch), lastSpans); + var added = linesFor(1, text.length - 1); + if (nlines > 1) doc.remove(from.line + 1, nlines - 1); + doc.insert(from.line + 1, added); + } + + signalLater(doc, "change", doc, change); + } + + // The document is represented as a BTree consisting of leaves, with + // chunk of lines in them, and branches, with up to ten leaves or + // other branch nodes below them. The top node is always a branch + // node, and is the document object itself (meaning it has + // additional methods and properties). + // + // All nodes have parent links. The tree is used both to go from + // line numbers to line objects, and to go from objects to numbers. + // It also indexes by height, and is used to convert between height + // and line object, and to find the total height of the document. + // + // See also http://marijnhaverbeke.nl/blog/codemirror-line-tree.html + + function LeafChunk(lines) { + this.lines = lines; + this.parent = null; + for (var i = 0, height = 0; i < lines.length; ++i) { + lines[i].parent = this; + height += lines[i].height; + } + this.height = height; + } + + LeafChunk.prototype = { + chunkSize: function() { return this.lines.length; }, + // Remove the n lines at offset 'at'. + removeInner: function(at, n) { + for (var i = at, e = at + n; i < e; ++i) { + var line = this.lines[i]; + this.height -= line.height; + cleanUpLine(line); + signalLater(line, "delete"); + } + this.lines.splice(at, n); + }, + // Helper used to collapse a small branch into a single leaf. + collapse: function(lines) { + lines.push.apply(lines, this.lines); + }, + // Insert the given array of lines at offset 'at', count them as + // having the given height. + insertInner: function(at, lines, height) { + this.height += height; + this.lines = this.lines.slice(0, at).concat(lines).concat(this.lines.slice(at)); + for (var i = 0; i < lines.length; ++i) lines[i].parent = this; + }, + // Used to iterate over a part of the tree. + iterN: function(at, n, op) { + for (var e = at + n; at < e; ++at) + if (op(this.lines[at])) return true; + } + }; + + function BranchChunk(children) { + this.children = children; + var size = 0, height = 0; + for (var i = 0; i < children.length; ++i) { + var ch = children[i]; + size += ch.chunkSize(); height += ch.height; + ch.parent = this; + } + this.size = size; + this.height = height; + this.parent = null; + } + + BranchChunk.prototype = { + chunkSize: function() { return this.size; }, + removeInner: function(at, n) { + this.size -= n; + for (var i = 0; i < this.children.length; ++i) { + var child = this.children[i], sz = child.chunkSize(); + if (at < sz) { + var rm = Math.min(n, sz - at), oldHeight = child.height; + child.removeInner(at, rm); + this.height -= oldHeight - child.height; + if (sz == rm) { this.children.splice(i--, 1); child.parent = null; } + if ((n -= rm) == 0) break; + at = 0; + } else at -= sz; + } + // If the result is smaller than 25 lines, ensure that it is a + // single leaf node. + if (this.size - n < 25 && + (this.children.length > 1 || !(this.children[0] instanceof LeafChunk))) { + var lines = []; + this.collapse(lines); + this.children = [new LeafChunk(lines)]; + this.children[0].parent = this; + } + }, + collapse: function(lines) { + for (var i = 0; i < this.children.length; ++i) this.children[i].collapse(lines); + }, + insertInner: function(at, lines, height) { + this.size += lines.length; + this.height += height; + for (var i = 0; i < this.children.length; ++i) { + var child = this.children[i], sz = child.chunkSize(); + if (at <= sz) { + child.insertInner(at, lines, height); + if (child.lines && child.lines.length > 50) { + // To avoid memory thrashing when child.lines is huge (e.g. first view of a large file), it's never spliced. + // Instead, small slices are taken. They're taken in order because sequential memory accesses are fastest. + var remaining = child.lines.length % 25 + 25 + for (var pos = remaining; pos < child.lines.length;) { + var leaf = new LeafChunk(child.lines.slice(pos, pos += 25)); + child.height -= leaf.height; + this.children.splice(++i, 0, leaf); + leaf.parent = this; + } + child.lines = child.lines.slice(0, remaining); + this.maybeSpill(); + } + break; + } + at -= sz; + } + }, + // When a node has grown, check whether it should be split. + maybeSpill: function() { + if (this.children.length <= 10) return; + var me = this; + do { + var spilled = me.children.splice(me.children.length - 5, 5); + var sibling = new BranchChunk(spilled); + if (!me.parent) { // Become the parent node + var copy = new BranchChunk(me.children); + copy.parent = me; + me.children = [copy, sibling]; + me = copy; + } else { + me.size -= sibling.size; + me.height -= sibling.height; + var myIndex = indexOf(me.parent.children, me); + me.parent.children.splice(myIndex + 1, 0, sibling); + } + sibling.parent = me.parent; + } while (me.children.length > 10); + me.parent.maybeSpill(); + }, + iterN: function(at, n, op) { + for (var i = 0; i < this.children.length; ++i) { + var child = this.children[i], sz = child.chunkSize(); + if (at < sz) { + var used = Math.min(n, sz - at); + if (child.iterN(at, used, op)) return true; + if ((n -= used) == 0) break; + at = 0; + } else at -= sz; + } + } + }; + + var nextDocId = 0; + var Doc = CodeMirror.Doc = function(text, mode, firstLine, lineSep) { + if (!(this instanceof Doc)) return new Doc(text, mode, firstLine, lineSep); + if (firstLine == null) firstLine = 0; + + BranchChunk.call(this, [new LeafChunk([new Line("", null)])]); + this.first = firstLine; + this.scrollTop = this.scrollLeft = 0; + this.cantEdit = false; + this.cleanGeneration = 1; + this.frontier = firstLine; + var start = Pos(firstLine, 0); + this.sel = simpleSelection(start); + this.history = new History(null); + this.id = ++nextDocId; + this.modeOption = mode; + this.lineSep = lineSep; + this.extend = false; + + if (typeof text == "string") text = this.splitLines(text); + updateDoc(this, {from: start, to: start, text: text}); + setSelection(this, simpleSelection(start), sel_dontScroll); + }; + + Doc.prototype = createObj(BranchChunk.prototype, { + constructor: Doc, + // Iterate over the document. Supports two forms -- with only one + // argument, it calls that for each line in the document. With + // three, it iterates over the range given by the first two (with + // the second being non-inclusive). + iter: function(from, to, op) { + if (op) this.iterN(from - this.first, to - from, op); + else this.iterN(this.first, this.first + this.size, from); + }, + + // Non-public interface for adding and removing lines. + insert: function(at, lines) { + var height = 0; + for (var i = 0; i < lines.length; ++i) height += lines[i].height; + this.insertInner(at - this.first, lines, height); + }, + remove: function(at, n) { this.removeInner(at - this.first, n); }, + + // From here, the methods are part of the public interface. Most + // are also available from CodeMirror (editor) instances. + + getValue: function(lineSep) { + var lines = getLines(this, this.first, this.first + this.size); + if (lineSep === false) return lines; + return lines.join(lineSep || this.lineSeparator()); + }, + setValue: docMethodOp(function(code) { + var top = Pos(this.first, 0), last = this.first + this.size - 1; + makeChange(this, {from: top, to: Pos(last, getLine(this, last).text.length), + text: this.splitLines(code), origin: "setValue", full: true}, true); + setSelection(this, simpleSelection(top)); + }), + replaceRange: function(code, from, to, origin) { + from = clipPos(this, from); + to = to ? clipPos(this, to) : from; + replaceRange(this, code, from, to, origin); + }, + getRange: function(from, to, lineSep) { + var lines = getBetween(this, clipPos(this, from), clipPos(this, to)); + if (lineSep === false) return lines; + return lines.join(lineSep || this.lineSeparator()); + }, + + getLine: function(line) {var l = this.getLineHandle(line); return l && l.text;}, + + getLineHandle: function(line) {if (isLine(this, line)) return getLine(this, line);}, + getLineNumber: function(line) {return lineNo(line);}, + + getLineHandleVisualStart: function(line) { + if (typeof line == "number") line = getLine(this, line); + return visualLine(line); + }, + + lineCount: function() {return this.size;}, + firstLine: function() {return this.first;}, + lastLine: function() {return this.first + this.size - 1;}, + + clipPos: function(pos) {return clipPos(this, pos);}, + + getCursor: function(start) { + var range = this.sel.primary(), pos; + if (start == null || start == "head") pos = range.head; + else if (start == "anchor") pos = range.anchor; + else if (start == "end" || start == "to" || start === false) pos = range.to(); + else pos = range.from(); + return pos; + }, + listSelections: function() { return this.sel.ranges; }, + somethingSelected: function() {return this.sel.somethingSelected();}, + + setCursor: docMethodOp(function(line, ch, options) { + setSimpleSelection(this, clipPos(this, typeof line == "number" ? Pos(line, ch || 0) : line), null, options); + }), + setSelection: docMethodOp(function(anchor, head, options) { + setSimpleSelection(this, clipPos(this, anchor), clipPos(this, head || anchor), options); + }), + extendSelection: docMethodOp(function(head, other, options) { + extendSelection(this, clipPos(this, head), other && clipPos(this, other), options); + }), + extendSelections: docMethodOp(function(heads, options) { + extendSelections(this, clipPosArray(this, heads), options); + }), + extendSelectionsBy: docMethodOp(function(f, options) { + var heads = map(this.sel.ranges, f); + extendSelections(this, clipPosArray(this, heads), options); + }), + setSelections: docMethodOp(function(ranges, primary, options) { + if (!ranges.length) return; + for (var i = 0, out = []; i < ranges.length; i++) + out[i] = new Range(clipPos(this, ranges[i].anchor), + clipPos(this, ranges[i].head)); + if (primary == null) primary = Math.min(ranges.length - 1, this.sel.primIndex); + setSelection(this, normalizeSelection(out, primary), options); + }), + addSelection: docMethodOp(function(anchor, head, options) { + var ranges = this.sel.ranges.slice(0); + ranges.push(new Range(clipPos(this, anchor), clipPos(this, head || anchor))); + setSelection(this, normalizeSelection(ranges, ranges.length - 1), options); + }), + + getSelection: function(lineSep) { + var ranges = this.sel.ranges, lines; + for (var i = 0; i < ranges.length; i++) { + var sel = getBetween(this, ranges[i].from(), ranges[i].to()); + lines = lines ? lines.concat(sel) : sel; + } + if (lineSep === false) return lines; + else return lines.join(lineSep || this.lineSeparator()); + }, + getSelections: function(lineSep) { + var parts = [], ranges = this.sel.ranges; + for (var i = 0; i < ranges.length; i++) { + var sel = getBetween(this, ranges[i].from(), ranges[i].to()); + if (lineSep !== false) sel = sel.join(lineSep || this.lineSeparator()); + parts[i] = sel; + } + return parts; + }, + replaceSelection: function(code, collapse, origin) { + var dup = []; + for (var i = 0; i < this.sel.ranges.length; i++) + dup[i] = code; + this.replaceSelections(dup, collapse, origin || "+input"); + }, + replaceSelections: docMethodOp(function(code, collapse, origin) { + var changes = [], sel = this.sel; + for (var i = 0; i < sel.ranges.length; i++) { + var range = sel.ranges[i]; + changes[i] = {from: range.from(), to: range.to(), text: this.splitLines(code[i]), origin: origin}; + } + var newSel = collapse && collapse != "end" && computeReplacedSel(this, changes, collapse); + for (var i = changes.length - 1; i >= 0; i--) + makeChange(this, changes[i]); + if (newSel) setSelectionReplaceHistory(this, newSel); + else if (this.cm) ensureCursorVisible(this.cm); + }), + undo: docMethodOp(function() {makeChangeFromHistory(this, "undo");}), + redo: docMethodOp(function() {makeChangeFromHistory(this, "redo");}), + undoSelection: docMethodOp(function() {makeChangeFromHistory(this, "undo", true);}), + redoSelection: docMethodOp(function() {makeChangeFromHistory(this, "redo", true);}), + + setExtending: function(val) {this.extend = val;}, + getExtending: function() {return this.extend;}, + + historySize: function() { + var hist = this.history, done = 0, undone = 0; + for (var i = 0; i < hist.done.length; i++) if (!hist.done[i].ranges) ++done; + for (var i = 0; i < hist.undone.length; i++) if (!hist.undone[i].ranges) ++undone; + return {undo: done, redo: undone}; + }, + clearHistory: function() {this.history = new History(this.history.maxGeneration);}, + + markClean: function() { + this.cleanGeneration = this.changeGeneration(true); + }, + changeGeneration: function(forceSplit) { + if (forceSplit) + this.history.lastOp = this.history.lastSelOp = this.history.lastOrigin = null; + return this.history.generation; + }, + isClean: function (gen) { + return this.history.generation == (gen || this.cleanGeneration); + }, + + getHistory: function() { + return {done: copyHistoryArray(this.history.done), + undone: copyHistoryArray(this.history.undone)}; + }, + setHistory: function(histData) { + var hist = this.history = new History(this.history.maxGeneration); + hist.done = copyHistoryArray(histData.done.slice(0), null, true); + hist.undone = copyHistoryArray(histData.undone.slice(0), null, true); + }, + + addLineClass: docMethodOp(function(handle, where, cls) { + return changeLine(this, handle, where == "gutter" ? "gutter" : "class", function(line) { + var prop = where == "text" ? "textClass" + : where == "background" ? "bgClass" + : where == "gutter" ? "gutterClass" : "wrapClass"; + if (!line[prop]) line[prop] = cls; + else if (classTest(cls).test(line[prop])) return false; + else line[prop] += " " + cls; + return true; + }); + }), + removeLineClass: docMethodOp(function(handle, where, cls) { + return changeLine(this, handle, where == "gutter" ? "gutter" : "class", function(line) { + var prop = where == "text" ? "textClass" + : where == "background" ? "bgClass" + : where == "gutter" ? "gutterClass" : "wrapClass"; + var cur = line[prop]; + if (!cur) return false; + else if (cls == null) line[prop] = null; + else { + var found = cur.match(classTest(cls)); + if (!found) return false; + var end = found.index + found[0].length; + line[prop] = cur.slice(0, found.index) + (!found.index || end == cur.length ? "" : " ") + cur.slice(end) || null; + } + return true; + }); + }), + + addLineWidget: docMethodOp(function(handle, node, options) { + return addLineWidget(this, handle, node, options); + }), + removeLineWidget: function(widget) { widget.clear(); }, + + markText: function(from, to, options) { + return markText(this, clipPos(this, from), clipPos(this, to), options, options && options.type || "range"); + }, + setBookmark: function(pos, options) { + var realOpts = {replacedWith: options && (options.nodeType == null ? options.widget : options), + insertLeft: options && options.insertLeft, + clearWhenEmpty: false, shared: options && options.shared, + handleMouseEvents: options && options.handleMouseEvents}; + pos = clipPos(this, pos); + return markText(this, pos, pos, realOpts, "bookmark"); + }, + findMarksAt: function(pos) { + pos = clipPos(this, pos); + var markers = [], spans = getLine(this, pos.line).markedSpans; + if (spans) for (var i = 0; i < spans.length; ++i) { + var span = spans[i]; + if ((span.from == null || span.from <= pos.ch) && + (span.to == null || span.to >= pos.ch)) + markers.push(span.marker.parent || span.marker); + } + return markers; + }, + findMarks: function(from, to, filter) { + from = clipPos(this, from); to = clipPos(this, to); + var found = [], lineNo = from.line; + this.iter(from.line, to.line + 1, function(line) { + var spans = line.markedSpans; + if (spans) for (var i = 0; i < spans.length; i++) { + var span = spans[i]; + if (!(span.to != null && lineNo == from.line && from.ch >= span.to || + span.from == null && lineNo != from.line || + span.from != null && lineNo == to.line && span.from >= to.ch) && + (!filter || filter(span.marker))) + found.push(span.marker.parent || span.marker); + } + ++lineNo; + }); + return found; + }, + getAllMarks: function() { + var markers = []; + this.iter(function(line) { + var sps = line.markedSpans; + if (sps) for (var i = 0; i < sps.length; ++i) + if (sps[i].from != null) markers.push(sps[i].marker); + }); + return markers; + }, + + posFromIndex: function(off) { + var ch, lineNo = this.first, sepSize = this.lineSeparator().length; + this.iter(function(line) { + var sz = line.text.length + sepSize; + if (sz > off) { ch = off; return true; } + off -= sz; + ++lineNo; + }); + return clipPos(this, Pos(lineNo, ch)); + }, + indexFromPos: function (coords) { + coords = clipPos(this, coords); + var index = coords.ch; + if (coords.line < this.first || coords.ch < 0) return 0; + var sepSize = this.lineSeparator().length; + this.iter(this.first, coords.line, function (line) { + index += line.text.length + sepSize; + }); + return index; + }, + + copy: function(copyHistory) { + var doc = new Doc(getLines(this, this.first, this.first + this.size), + this.modeOption, this.first, this.lineSep); + doc.scrollTop = this.scrollTop; doc.scrollLeft = this.scrollLeft; + doc.sel = this.sel; + doc.extend = false; + if (copyHistory) { + doc.history.undoDepth = this.history.undoDepth; + doc.setHistory(this.getHistory()); + } + return doc; + }, + + linkedDoc: function(options) { + if (!options) options = {}; + var from = this.first, to = this.first + this.size; + if (options.from != null && options.from > from) from = options.from; + if (options.to != null && options.to < to) to = options.to; + var copy = new Doc(getLines(this, from, to), options.mode || this.modeOption, from, this.lineSep); + if (options.sharedHist) copy.history = this.history; + (this.linked || (this.linked = [])).push({doc: copy, sharedHist: options.sharedHist}); + copy.linked = [{doc: this, isParent: true, sharedHist: options.sharedHist}]; + copySharedMarkers(copy, findSharedMarkers(this)); + return copy; + }, + unlinkDoc: function(other) { + if (other instanceof CodeMirror) other = other.doc; + if (this.linked) for (var i = 0; i < this.linked.length; ++i) { + var link = this.linked[i]; + if (link.doc != other) continue; + this.linked.splice(i, 1); + other.unlinkDoc(this); + detachSharedMarkers(findSharedMarkers(this)); + break; + } + // If the histories were shared, split them again + if (other.history == this.history) { + var splitIds = [other.id]; + linkedDocs(other, function(doc) {splitIds.push(doc.id);}, true); + other.history = new History(null); + other.history.done = copyHistoryArray(this.history.done, splitIds); + other.history.undone = copyHistoryArray(this.history.undone, splitIds); + } + }, + iterLinkedDocs: function(f) {linkedDocs(this, f);}, + + getMode: function() {return this.mode;}, + getEditor: function() {return this.cm;}, + + splitLines: function(str) { + if (this.lineSep) return str.split(this.lineSep); + return splitLinesAuto(str); + }, + lineSeparator: function() { return this.lineSep || "\n"; } + }); + + // Public alias. + Doc.prototype.eachLine = Doc.prototype.iter; + + // Set up methods on CodeMirror's prototype to redirect to the editor's document. + var dontDelegate = "iter insert remove copy getEditor constructor".split(" "); + for (var prop in Doc.prototype) if (Doc.prototype.hasOwnProperty(prop) && indexOf(dontDelegate, prop) < 0) + CodeMirror.prototype[prop] = (function(method) { + return function() {return method.apply(this.doc, arguments);}; + })(Doc.prototype[prop]); + + eventMixin(Doc); + + // Call f for all linked documents. + function linkedDocs(doc, f, sharedHistOnly) { + function propagate(doc, skip, sharedHist) { + if (doc.linked) for (var i = 0; i < doc.linked.length; ++i) { + var rel = doc.linked[i]; + if (rel.doc == skip) continue; + var shared = sharedHist && rel.sharedHist; + if (sharedHistOnly && !shared) continue; + f(rel.doc, shared); + propagate(rel.doc, doc, shared); + } + } + propagate(doc, null, true); + } + + // Attach a document to an editor. + function attachDoc(cm, doc) { + if (doc.cm) throw new Error("This document is already in use."); + cm.doc = doc; + doc.cm = cm; + estimateLineHeights(cm); + loadMode(cm); + if (!cm.options.lineWrapping) findMaxLine(cm); + cm.options.mode = doc.modeOption; + regChange(cm); + } + + // LINE UTILITIES + + // Find the line object corresponding to the given line number. + function getLine(doc, n) { + n -= doc.first; + if (n < 0 || n >= doc.size) throw new Error("There is no line " + (n + doc.first) + " in the document."); + for (var chunk = doc; !chunk.lines;) { + for (var i = 0;; ++i) { + var child = chunk.children[i], sz = child.chunkSize(); + if (n < sz) { chunk = child; break; } + n -= sz; + } + } + return chunk.lines[n]; + } + + // Get the part of a document between two positions, as an array of + // strings. + function getBetween(doc, start, end) { + var out = [], n = start.line; + doc.iter(start.line, end.line + 1, function(line) { + var text = line.text; + if (n == end.line) text = text.slice(0, end.ch); + if (n == start.line) text = text.slice(start.ch); + out.push(text); + ++n; + }); + return out; + } + // Get the lines between from and to, as array of strings. + function getLines(doc, from, to) { + var out = []; + doc.iter(from, to, function(line) { out.push(line.text); }); + return out; + } + + // Update the height of a line, propagating the height change + // upwards to parent nodes. + function updateLineHeight(line, height) { + var diff = height - line.height; + if (diff) for (var n = line; n; n = n.parent) n.height += diff; + } + + // Given a line object, find its line number by walking up through + // its parent links. + function lineNo(line) { + if (line.parent == null) return null; + var cur = line.parent, no = indexOf(cur.lines, line); + for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) { + for (var i = 0;; ++i) { + if (chunk.children[i] == cur) break; + no += chunk.children[i].chunkSize(); + } + } + return no + cur.first; + } + + // Find the line at the given vertical position, using the height + // information in the document tree. + function lineAtHeight(chunk, h) { + var n = chunk.first; + outer: do { + for (var i = 0; i < chunk.children.length; ++i) { + var child = chunk.children[i], ch = child.height; + if (h < ch) { chunk = child; continue outer; } + h -= ch; + n += child.chunkSize(); + } + return n; + } while (!chunk.lines); + for (var i = 0; i < chunk.lines.length; ++i) { + var line = chunk.lines[i], lh = line.height; + if (h < lh) break; + h -= lh; + } + return n + i; + } + + + // Find the height above the given line. + function heightAtLine(lineObj) { + lineObj = visualLine(lineObj); + + var h = 0, chunk = lineObj.parent; + for (var i = 0; i < chunk.lines.length; ++i) { + var line = chunk.lines[i]; + if (line == lineObj) break; + else h += line.height; + } + for (var p = chunk.parent; p; chunk = p, p = chunk.parent) { + for (var i = 0; i < p.children.length; ++i) { + var cur = p.children[i]; + if (cur == chunk) break; + else h += cur.height; + } + } + return h; + } + + // Get the bidi ordering for the given line (and cache it). Returns + // false for lines that are fully left-to-right, and an array of + // BidiSpan objects otherwise. + function getOrder(line) { + var order = line.order; + if (order == null) order = line.order = bidiOrdering(line.text); + return order; + } + + // HISTORY + + function History(startGen) { + // Arrays of change events and selections. Doing something adds an + // event to done and clears undo. Undoing moves events from done + // to undone, redoing moves them in the other direction. + this.done = []; this.undone = []; + this.undoDepth = Infinity; + // Used to track when changes can be merged into a single undo + // event + this.lastModTime = this.lastSelTime = 0; + this.lastOp = this.lastSelOp = null; + this.lastOrigin = this.lastSelOrigin = null; + // Used by the isClean() method + this.generation = this.maxGeneration = startGen || 1; + } + + // Create a history change event from an updateDoc-style change + // object. + function historyChangeFromChange(doc, change) { + var histChange = {from: copyPos(change.from), to: changeEnd(change), text: getBetween(doc, change.from, change.to)}; + attachLocalSpans(doc, histChange, change.from.line, change.to.line + 1); + linkedDocs(doc, function(doc) {attachLocalSpans(doc, histChange, change.from.line, change.to.line + 1);}, true); + return histChange; + } + + // Pop all selection events off the end of a history array. Stop at + // a change event. + function clearSelectionEvents(array) { + while (array.length) { + var last = lst(array); + if (last.ranges) array.pop(); + else break; + } + } + + // Find the top change event in the history. Pop off selection + // events that are in the way. + function lastChangeEvent(hist, force) { + if (force) { + clearSelectionEvents(hist.done); + return lst(hist.done); + } else if (hist.done.length && !lst(hist.done).ranges) { + return lst(hist.done); + } else if (hist.done.length > 1 && !hist.done[hist.done.length - 2].ranges) { + hist.done.pop(); + return lst(hist.done); + } + } + + // Register a change in the history. Merges changes that are within + // a single operation, ore are close together with an origin that + // allows merging (starting with "+") into a single event. + function addChangeToHistory(doc, change, selAfter, opId) { + var hist = doc.history; + hist.undone.length = 0; + var time = +new Date, cur; + + if ((hist.lastOp == opId || + hist.lastOrigin == change.origin && change.origin && + ((change.origin.charAt(0) == "+" && doc.cm && hist.lastModTime > time - doc.cm.options.historyEventDelay) || + change.origin.charAt(0) == "*")) && + (cur = lastChangeEvent(hist, hist.lastOp == opId))) { + // Merge this change into the last event + var last = lst(cur.changes); + if (cmp(change.from, change.to) == 0 && cmp(change.from, last.to) == 0) { + // Optimized case for simple insertion -- don't want to add + // new changesets for every character typed + last.to = changeEnd(change); + } else { + // Add new sub-event + cur.changes.push(historyChangeFromChange(doc, change)); + } + } else { + // Can not be merged, start a new event. + var before = lst(hist.done); + if (!before || !before.ranges) + pushSelectionToHistory(doc.sel, hist.done); + cur = {changes: [historyChangeFromChange(doc, change)], + generation: hist.generation}; + hist.done.push(cur); + while (hist.done.length > hist.undoDepth) { + hist.done.shift(); + if (!hist.done[0].ranges) hist.done.shift(); + } + } + hist.done.push(selAfter); + hist.generation = ++hist.maxGeneration; + hist.lastModTime = hist.lastSelTime = time; + hist.lastOp = hist.lastSelOp = opId; + hist.lastOrigin = hist.lastSelOrigin = change.origin; + + if (!last) signal(doc, "historyAdded"); + } + + function selectionEventCanBeMerged(doc, origin, prev, sel) { + var ch = origin.charAt(0); + return ch == "*" || + ch == "+" && + prev.ranges.length == sel.ranges.length && + prev.somethingSelected() == sel.somethingSelected() && + new Date - doc.history.lastSelTime <= (doc.cm ? doc.cm.options.historyEventDelay : 500); + } + + // Called whenever the selection changes, sets the new selection as + // the pending selection in the history, and pushes the old pending + // selection into the 'done' array when it was significantly + // different (in number of selected ranges, emptiness, or time). + function addSelectionToHistory(doc, sel, opId, options) { + var hist = doc.history, origin = options && options.origin; + + // A new event is started when the previous origin does not match + // the current, or the origins don't allow matching. Origins + // starting with * are always merged, those starting with + are + // merged when similar and close together in time. + if (opId == hist.lastSelOp || + (origin && hist.lastSelOrigin == origin && + (hist.lastModTime == hist.lastSelTime && hist.lastOrigin == origin || + selectionEventCanBeMerged(doc, origin, lst(hist.done), sel)))) + hist.done[hist.done.length - 1] = sel; + else + pushSelectionToHistory(sel, hist.done); + + hist.lastSelTime = +new Date; + hist.lastSelOrigin = origin; + hist.lastSelOp = opId; + if (options && options.clearRedo !== false) + clearSelectionEvents(hist.undone); + } + + function pushSelectionToHistory(sel, dest) { + var top = lst(dest); + if (!(top && top.ranges && top.equals(sel))) + dest.push(sel); + } + + // Used to store marked span information in the history. + function attachLocalSpans(doc, change, from, to) { + var existing = change["spans_" + doc.id], n = 0; + doc.iter(Math.max(doc.first, from), Math.min(doc.first + doc.size, to), function(line) { + if (line.markedSpans) + (existing || (existing = change["spans_" + doc.id] = {}))[n] = line.markedSpans; + ++n; + }); + } + + // When un/re-doing restores text containing marked spans, those + // that have been explicitly cleared should not be restored. + function removeClearedSpans(spans) { + if (!spans) return null; + for (var i = 0, out; i < spans.length; ++i) { + if (spans[i].marker.explicitlyCleared) { if (!out) out = spans.slice(0, i); } + else if (out) out.push(spans[i]); + } + return !out ? spans : out.length ? out : null; + } + + // Retrieve and filter the old marked spans stored in a change event. + function getOldSpans(doc, change) { + var found = change["spans_" + doc.id]; + if (!found) return null; + for (var i = 0, nw = []; i < change.text.length; ++i) + nw.push(removeClearedSpans(found[i])); + return nw; + } + + // Used both to provide a JSON-safe object in .getHistory, and, when + // detaching a document, to split the history in two + function copyHistoryArray(events, newGroup, instantiateSel) { + for (var i = 0, copy = []; i < events.length; ++i) { + var event = events[i]; + if (event.ranges) { + copy.push(instantiateSel ? Selection.prototype.deepCopy.call(event) : event); + continue; + } + var changes = event.changes, newChanges = []; + copy.push({changes: newChanges}); + for (var j = 0; j < changes.length; ++j) { + var change = changes[j], m; + newChanges.push({from: change.from, to: change.to, text: change.text}); + if (newGroup) for (var prop in change) if (m = prop.match(/^spans_(\d+)$/)) { + if (indexOf(newGroup, Number(m[1])) > -1) { + lst(newChanges)[prop] = change[prop]; + delete change[prop]; + } + } + } + } + return copy; + } + + // Rebasing/resetting history to deal with externally-sourced changes + + function rebaseHistSelSingle(pos, from, to, diff) { + if (to < pos.line) { + pos.line += diff; + } else if (from < pos.line) { + pos.line = from; + pos.ch = 0; + } + } + + // Tries to rebase an array of history events given a change in the + // document. If the change touches the same lines as the event, the + // event, and everything 'behind' it, is discarded. If the change is + // before the event, the event's positions are updated. Uses a + // copy-on-write scheme for the positions, to avoid having to + // reallocate them all on every rebase, but also avoid problems with + // shared position objects being unsafely updated. + function rebaseHistArray(array, from, to, diff) { + for (var i = 0; i < array.length; ++i) { + var sub = array[i], ok = true; + if (sub.ranges) { + if (!sub.copied) { sub = array[i] = sub.deepCopy(); sub.copied = true; } + for (var j = 0; j < sub.ranges.length; j++) { + rebaseHistSelSingle(sub.ranges[j].anchor, from, to, diff); + rebaseHistSelSingle(sub.ranges[j].head, from, to, diff); + } + continue; + } + for (var j = 0; j < sub.changes.length; ++j) { + var cur = sub.changes[j]; + if (to < cur.from.line) { + cur.from = Pos(cur.from.line + diff, cur.from.ch); + cur.to = Pos(cur.to.line + diff, cur.to.ch); + } else if (from <= cur.to.line) { + ok = false; + break; + } + } + if (!ok) { + array.splice(0, i + 1); + i = 0; + } + } + } + + function rebaseHist(hist, change) { + var from = change.from.line, to = change.to.line, diff = change.text.length - (to - from) - 1; + rebaseHistArray(hist.done, from, to, diff); + rebaseHistArray(hist.undone, from, to, diff); + } + + // EVENT UTILITIES + + // Due to the fact that we still support jurassic IE versions, some + // compatibility wrappers are needed. + + var e_preventDefault = CodeMirror.e_preventDefault = function(e) { + if (e.preventDefault) e.preventDefault(); + else e.returnValue = false; + }; + var e_stopPropagation = CodeMirror.e_stopPropagation = function(e) { + if (e.stopPropagation) e.stopPropagation(); + else e.cancelBubble = true; + }; + function e_defaultPrevented(e) { + return e.defaultPrevented != null ? e.defaultPrevented : e.returnValue == false; + } + var e_stop = CodeMirror.e_stop = function(e) {e_preventDefault(e); e_stopPropagation(e);}; + + function e_target(e) {return e.target || e.srcElement;} + function e_button(e) { + var b = e.which; + if (b == null) { + if (e.button & 1) b = 1; + else if (e.button & 2) b = 3; + else if (e.button & 4) b = 2; + } + if (mac && e.ctrlKey && b == 1) b = 3; + return b; + } + + // EVENT HANDLING + + // Lightweight event framework. on/off also work on DOM nodes, + // registering native DOM handlers. + + var on = CodeMirror.on = function(emitter, type, f) { + if (emitter.addEventListener) + emitter.addEventListener(type, f, false); + else if (emitter.attachEvent) + emitter.attachEvent("on" + type, f); + else { + var map = emitter._handlers || (emitter._handlers = {}); + var arr = map[type] || (map[type] = []); + arr.push(f); + } + }; + + var noHandlers = [] + function getHandlers(emitter, type, copy) { + var arr = emitter._handlers && emitter._handlers[type] + if (copy) return arr && arr.length > 0 ? arr.slice() : noHandlers + else return arr || noHandlers + } + + var off = CodeMirror.off = function(emitter, type, f) { + if (emitter.removeEventListener) + emitter.removeEventListener(type, f, false); + else if (emitter.detachEvent) + emitter.detachEvent("on" + type, f); + else { + var handlers = getHandlers(emitter, type, false) + for (var i = 0; i < handlers.length; ++i) + if (handlers[i] == f) { handlers.splice(i, 1); break; } + } + }; + + var signal = CodeMirror.signal = function(emitter, type /*, values...*/) { + var handlers = getHandlers(emitter, type, true) + if (!handlers.length) return; + var args = Array.prototype.slice.call(arguments, 2); + for (var i = 0; i < handlers.length; ++i) handlers[i].apply(null, args); + }; + + var orphanDelayedCallbacks = null; + + // Often, we want to signal events at a point where we are in the + // middle of some work, but don't want the handler to start calling + // other methods on the editor, which might be in an inconsistent + // state or simply not expect any other events to happen. + // signalLater looks whether there are any handlers, and schedules + // them to be executed when the last operation ends, or, if no + // operation is active, when a timeout fires. + function signalLater(emitter, type /*, values...*/) { + var arr = getHandlers(emitter, type, false) + if (!arr.length) return; + var args = Array.prototype.slice.call(arguments, 2), list; + if (operationGroup) { + list = operationGroup.delayedCallbacks; + } else if (orphanDelayedCallbacks) { + list = orphanDelayedCallbacks; + } else { + list = orphanDelayedCallbacks = []; + setTimeout(fireOrphanDelayed, 0); + } + function bnd(f) {return function(){f.apply(null, args);};}; + for (var i = 0; i < arr.length; ++i) + list.push(bnd(arr[i])); + } + + function fireOrphanDelayed() { + var delayed = orphanDelayedCallbacks; + orphanDelayedCallbacks = null; + for (var i = 0; i < delayed.length; ++i) delayed[i](); + } + + // The DOM events that CodeMirror handles can be overridden by + // registering a (non-DOM) handler on the editor for the event name, + // and preventDefault-ing the event in that handler. + function signalDOMEvent(cm, e, override) { + if (typeof e == "string") + e = {type: e, preventDefault: function() { this.defaultPrevented = true; }}; + signal(cm, override || e.type, cm, e); + return e_defaultPrevented(e) || e.codemirrorIgnore; + } + + function signalCursorActivity(cm) { + var arr = cm._handlers && cm._handlers.cursorActivity; + if (!arr) return; + var set = cm.curOp.cursorActivityHandlers || (cm.curOp.cursorActivityHandlers = []); + for (var i = 0; i < arr.length; ++i) if (indexOf(set, arr[i]) == -1) + set.push(arr[i]); + } + + function hasHandler(emitter, type) { + return getHandlers(emitter, type).length > 0 + } + + // Add on and off methods to a constructor's prototype, to make + // registering events on such objects more convenient. + function eventMixin(ctor) { + ctor.prototype.on = function(type, f) {on(this, type, f);}; + ctor.prototype.off = function(type, f) {off(this, type, f);}; + } + + // MISC UTILITIES + + // Number of pixels added to scroller and sizer to hide scrollbar + var scrollerGap = 30; + + // Returned or thrown by various protocols to signal 'I'm not + // handling this'. + var Pass = CodeMirror.Pass = {toString: function(){return "CodeMirror.Pass";}}; + + // Reused option objects for setSelection & friends + var sel_dontScroll = {scroll: false}, sel_mouse = {origin: "*mouse"}, sel_move = {origin: "+move"}; + + function Delayed() {this.id = null;} + Delayed.prototype.set = function(ms, f) { + clearTimeout(this.id); + this.id = setTimeout(f, ms); + }; + + // Counts the column offset in a string, taking tabs into account. + // Used mostly to find indentation. + var countColumn = CodeMirror.countColumn = function(string, end, tabSize, startIndex, startValue) { + if (end == null) { + end = string.search(/[^\s\u00a0]/); + if (end == -1) end = string.length; + } + for (var i = startIndex || 0, n = startValue || 0;;) { + var nextTab = string.indexOf("\t", i); + if (nextTab < 0 || nextTab >= end) + return n + (end - i); + n += nextTab - i; + n += tabSize - (n % tabSize); + i = nextTab + 1; + } + }; + + // The inverse of countColumn -- find the offset that corresponds to + // a particular column. + var findColumn = CodeMirror.findColumn = function(string, goal, tabSize) { + for (var pos = 0, col = 0;;) { + var nextTab = string.indexOf("\t", pos); + if (nextTab == -1) nextTab = string.length; + var skipped = nextTab - pos; + if (nextTab == string.length || col + skipped >= goal) + return pos + Math.min(skipped, goal - col); + col += nextTab - pos; + col += tabSize - (col % tabSize); + pos = nextTab + 1; + if (col >= goal) return pos; + } + } + + var spaceStrs = [""]; + function spaceStr(n) { + while (spaceStrs.length <= n) + spaceStrs.push(lst(spaceStrs) + " "); + return spaceStrs[n]; + } + + function lst(arr) { return arr[arr.length-1]; } + + var selectInput = function(node) { node.select(); }; + if (ios) // Mobile Safari apparently has a bug where select() is broken. + selectInput = function(node) { node.selectionStart = 0; node.selectionEnd = node.value.length; }; + else if (ie) // Suppress mysterious IE10 errors + selectInput = function(node) { try { node.select(); } catch(_e) {} }; + + function indexOf(array, elt) { + for (var i = 0; i < array.length; ++i) + if (array[i] == elt) return i; + return -1; + } + function map(array, f) { + var out = []; + for (var i = 0; i < array.length; i++) out[i] = f(array[i], i); + return out; + } + + function nothing() {} + + function createObj(base, props) { + var inst; + if (Object.create) { + inst = Object.create(base); + } else { + nothing.prototype = base; + inst = new nothing(); + } + if (props) copyObj(props, inst); + return inst; + }; + + function copyObj(obj, target, overwrite) { + if (!target) target = {}; + for (var prop in obj) + if (obj.hasOwnProperty(prop) && (overwrite !== false || !target.hasOwnProperty(prop))) + target[prop] = obj[prop]; + return target; + } + + function bind(f) { + var args = Array.prototype.slice.call(arguments, 1); + return function(){return f.apply(null, args);}; + } + + var nonASCIISingleCaseWordChar = /[\u00df\u0587\u0590-\u05f4\u0600-\u06ff\u3040-\u309f\u30a0-\u30ff\u3400-\u4db5\u4e00-\u9fcc\uac00-\ud7af]/; + var isWordCharBasic = CodeMirror.isWordChar = function(ch) { + return /\w/.test(ch) || ch > "\x80" && + (ch.toUpperCase() != ch.toLowerCase() || nonASCIISingleCaseWordChar.test(ch)); + }; + function isWordChar(ch, helper) { + if (!helper) return isWordCharBasic(ch); + if (helper.source.indexOf("\\w") > -1 && isWordCharBasic(ch)) return true; + return helper.test(ch); + } + + function isEmpty(obj) { + for (var n in obj) if (obj.hasOwnProperty(n) && obj[n]) return false; + return true; + } + + // Extending unicode characters. A series of a non-extending char + + // any number of extending chars is treated as a single unit as far + // as editing and measuring is concerned. This is not fully correct, + // since some scripts/fonts/browsers also treat other configurations + // of code points as a group. + var extendingChars = /[\u0300-\u036f\u0483-\u0489\u0591-\u05bd\u05bf\u05c1\u05c2\u05c4\u05c5\u05c7\u0610-\u061a\u064b-\u065e\u0670\u06d6-\u06dc\u06de-\u06e4\u06e7\u06e8\u06ea-\u06ed\u0711\u0730-\u074a\u07a6-\u07b0\u07eb-\u07f3\u0816-\u0819\u081b-\u0823\u0825-\u0827\u0829-\u082d\u0900-\u0902\u093c\u0941-\u0948\u094d\u0951-\u0955\u0962\u0963\u0981\u09bc\u09be\u09c1-\u09c4\u09cd\u09d7\u09e2\u09e3\u0a01\u0a02\u0a3c\u0a41\u0a42\u0a47\u0a48\u0a4b-\u0a4d\u0a51\u0a70\u0a71\u0a75\u0a81\u0a82\u0abc\u0ac1-\u0ac5\u0ac7\u0ac8\u0acd\u0ae2\u0ae3\u0b01\u0b3c\u0b3e\u0b3f\u0b41-\u0b44\u0b4d\u0b56\u0b57\u0b62\u0b63\u0b82\u0bbe\u0bc0\u0bcd\u0bd7\u0c3e-\u0c40\u0c46-\u0c48\u0c4a-\u0c4d\u0c55\u0c56\u0c62\u0c63\u0cbc\u0cbf\u0cc2\u0cc6\u0ccc\u0ccd\u0cd5\u0cd6\u0ce2\u0ce3\u0d3e\u0d41-\u0d44\u0d4d\u0d57\u0d62\u0d63\u0dca\u0dcf\u0dd2-\u0dd4\u0dd6\u0ddf\u0e31\u0e34-\u0e3a\u0e47-\u0e4e\u0eb1\u0eb4-\u0eb9\u0ebb\u0ebc\u0ec8-\u0ecd\u0f18\u0f19\u0f35\u0f37\u0f39\u0f71-\u0f7e\u0f80-\u0f84\u0f86\u0f87\u0f90-\u0f97\u0f99-\u0fbc\u0fc6\u102d-\u1030\u1032-\u1037\u1039\u103a\u103d\u103e\u1058\u1059\u105e-\u1060\u1071-\u1074\u1082\u1085\u1086\u108d\u109d\u135f\u1712-\u1714\u1732-\u1734\u1752\u1753\u1772\u1773\u17b7-\u17bd\u17c6\u17c9-\u17d3\u17dd\u180b-\u180d\u18a9\u1920-\u1922\u1927\u1928\u1932\u1939-\u193b\u1a17\u1a18\u1a56\u1a58-\u1a5e\u1a60\u1a62\u1a65-\u1a6c\u1a73-\u1a7c\u1a7f\u1b00-\u1b03\u1b34\u1b36-\u1b3a\u1b3c\u1b42\u1b6b-\u1b73\u1b80\u1b81\u1ba2-\u1ba5\u1ba8\u1ba9\u1c2c-\u1c33\u1c36\u1c37\u1cd0-\u1cd2\u1cd4-\u1ce0\u1ce2-\u1ce8\u1ced\u1dc0-\u1de6\u1dfd-\u1dff\u200c\u200d\u20d0-\u20f0\u2cef-\u2cf1\u2de0-\u2dff\u302a-\u302f\u3099\u309a\ua66f-\ua672\ua67c\ua67d\ua6f0\ua6f1\ua802\ua806\ua80b\ua825\ua826\ua8c4\ua8e0-\ua8f1\ua926-\ua92d\ua947-\ua951\ua980-\ua982\ua9b3\ua9b6-\ua9b9\ua9bc\uaa29-\uaa2e\uaa31\uaa32\uaa35\uaa36\uaa43\uaa4c\uaab0\uaab2-\uaab4\uaab7\uaab8\uaabe\uaabf\uaac1\uabe5\uabe8\uabed\udc00-\udfff\ufb1e\ufe00-\ufe0f\ufe20-\ufe26\uff9e\uff9f]/; + function isExtendingChar(ch) { return ch.charCodeAt(0) >= 768 && extendingChars.test(ch); } + + // DOM UTILITIES + + function elt(tag, content, className, style) { + var e = document.createElement(tag); + if (className) e.className = className; + if (style) e.style.cssText = style; + if (typeof content == "string") e.appendChild(document.createTextNode(content)); + else if (content) for (var i = 0; i < content.length; ++i) e.appendChild(content[i]); + return e; + } + + var range; + if (document.createRange) range = function(node, start, end, endNode) { + var r = document.createRange(); + r.setEnd(endNode || node, end); + r.setStart(node, start); + return r; + }; + else range = function(node, start, end) { + var r = document.body.createTextRange(); + try { r.moveToElementText(node.parentNode); } + catch(e) { return r; } + r.collapse(true); + r.moveEnd("character", end); + r.moveStart("character", start); + return r; + }; + + function removeChildren(e) { + for (var count = e.childNodes.length; count > 0; --count) + e.removeChild(e.firstChild); + return e; + } + + function removeChildrenAndAdd(parent, e) { + return removeChildren(parent).appendChild(e); + } + + var contains = CodeMirror.contains = function(parent, child) { + if (child.nodeType == 3) // Android browser always returns false when child is a textnode + child = child.parentNode; + if (parent.contains) + return parent.contains(child); + do { + if (child.nodeType == 11) child = child.host; + if (child == parent) return true; + } while (child = child.parentNode); + }; + + function activeElt() { + var activeElement = document.activeElement; + while (activeElement && activeElement.root && activeElement.root.activeElement) + activeElement = activeElement.root.activeElement; + return activeElement; + } + // Older versions of IE throws unspecified error when touching + // document.activeElement in some cases (during loading, in iframe) + if (ie && ie_version < 11) activeElt = function() { + try { return document.activeElement; } + catch(e) { return document.body; } + }; + + function classTest(cls) { return new RegExp("(^|\\s)" + cls + "(?:$|\\s)\\s*"); } + var rmClass = CodeMirror.rmClass = function(node, cls) { + var current = node.className; + var match = classTest(cls).exec(current); + if (match) { + var after = current.slice(match.index + match[0].length); + node.className = current.slice(0, match.index) + (after ? match[1] + after : ""); + } + }; + var addClass = CodeMirror.addClass = function(node, cls) { + var current = node.className; + if (!classTest(cls).test(current)) node.className += (current ? " " : "") + cls; + }; + function joinClasses(a, b) { + var as = a.split(" "); + for (var i = 0; i < as.length; i++) + if (as[i] && !classTest(as[i]).test(b)) b += " " + as[i]; + return b; + } + + // WINDOW-WIDE EVENTS + + // These must be handled carefully, because naively registering a + // handler for each editor will cause the editors to never be + // garbage collected. + + function forEachCodeMirror(f) { + if (!document.body.getElementsByClassName) return; + var byClass = document.body.getElementsByClassName("CodeMirror"); + for (var i = 0; i < byClass.length; i++) { + var cm = byClass[i].CodeMirror; + if (cm) f(cm); + } + } + + var globalsRegistered = false; + function ensureGlobalHandlers() { + if (globalsRegistered) return; + registerGlobalHandlers(); + globalsRegistered = true; + } + function registerGlobalHandlers() { + // When the window resizes, we need to refresh active editors. + var resizeTimer; + on(window, "resize", function() { + if (resizeTimer == null) resizeTimer = setTimeout(function() { + resizeTimer = null; + forEachCodeMirror(onResize); + }, 100); + }); + // When the window loses focus, we want to show the editor as blurred + on(window, "blur", function() { + forEachCodeMirror(onBlur); + }); + } + + // FEATURE DETECTION + + // Detect drag-and-drop + var dragAndDrop = function() { + // There is *some* kind of drag-and-drop support in IE6-8, but I + // couldn't get it to work yet. + if (ie && ie_version < 9) return false; + var div = elt('div'); + return "draggable" in div || "dragDrop" in div; + }(); + + var zwspSupported; + function zeroWidthElement(measure) { + if (zwspSupported == null) { + var test = elt("span", "\u200b"); + removeChildrenAndAdd(measure, elt("span", [test, document.createTextNode("x")])); + if (measure.firstChild.offsetHeight != 0) + zwspSupported = test.offsetWidth <= 1 && test.offsetHeight > 2 && !(ie && ie_version < 8); + } + var node = zwspSupported ? elt("span", "\u200b") : + elt("span", "\u00a0", null, "display: inline-block; width: 1px; margin-right: -1px"); + node.setAttribute("cm-text", ""); + return node; + } + + // Feature-detect IE's crummy client rect reporting for bidi text + var badBidiRects; + function hasBadBidiRects(measure) { + if (badBidiRects != null) return badBidiRects; + var txt = removeChildrenAndAdd(measure, document.createTextNode("A\u062eA")); + var r0 = range(txt, 0, 1).getBoundingClientRect(); + var r1 = range(txt, 1, 2).getBoundingClientRect(); + removeChildren(measure); + if (!r0 || r0.left == r0.right) return false; // Safari returns null in some cases (#2780) + return badBidiRects = (r1.right - r0.right < 3); + } + + // See if "".split is the broken IE version, if so, provide an + // alternative way to split lines. + var splitLinesAuto = CodeMirror.splitLines = "\n\nb".split(/\n/).length != 3 ? function(string) { + var pos = 0, result = [], l = string.length; + while (pos <= l) { + var nl = string.indexOf("\n", pos); + if (nl == -1) nl = string.length; + var line = string.slice(pos, string.charAt(nl - 1) == "\r" ? nl - 1 : nl); + var rt = line.indexOf("\r"); + if (rt != -1) { + result.push(line.slice(0, rt)); + pos += rt + 1; + } else { + result.push(line); + pos = nl + 1; + } + } + return result; + } : function(string){return string.split(/\r\n?|\n/);}; + + var hasSelection = window.getSelection ? function(te) { + try { return te.selectionStart != te.selectionEnd; } + catch(e) { return false; } + } : function(te) { + try {var range = te.ownerDocument.selection.createRange();} + catch(e) {} + if (!range || range.parentElement() != te) return false; + return range.compareEndPoints("StartToEnd", range) != 0; + }; + + var hasCopyEvent = (function() { + var e = elt("div"); + if ("oncopy" in e) return true; + e.setAttribute("oncopy", "return;"); + return typeof e.oncopy == "function"; + })(); + + var badZoomedRects = null; + function hasBadZoomedRects(measure) { + if (badZoomedRects != null) return badZoomedRects; + var node = removeChildrenAndAdd(measure, elt("span", "x")); + var normal = node.getBoundingClientRect(); + var fromRange = range(node, 0, 1).getBoundingClientRect(); + return badZoomedRects = Math.abs(normal.left - fromRange.left) > 1; + } + + // KEY NAMES + + var keyNames = CodeMirror.keyNames = { + 3: "Enter", 8: "Backspace", 9: "Tab", 13: "Enter", 16: "Shift", 17: "Ctrl", 18: "Alt", + 19: "Pause", 20: "CapsLock", 27: "Esc", 32: "Space", 33: "PageUp", 34: "PageDown", 35: "End", + 36: "Home", 37: "Left", 38: "Up", 39: "Right", 40: "Down", 44: "PrintScrn", 45: "Insert", + 46: "Delete", 59: ";", 61: "=", 91: "Mod", 92: "Mod", 93: "Mod", + 106: "*", 107: "=", 109: "-", 110: ".", 111: "/", 127: "Delete", + 173: "-", 186: ";", 187: "=", 188: ",", 189: "-", 190: ".", 191: "/", 192: "`", 219: "[", 220: "\\", + 221: "]", 222: "'", 63232: "Up", 63233: "Down", 63234: "Left", 63235: "Right", 63272: "Delete", + 63273: "Home", 63275: "End", 63276: "PageUp", 63277: "PageDown", 63302: "Insert" + }; + (function() { + // Number keys + for (var i = 0; i < 10; i++) keyNames[i + 48] = keyNames[i + 96] = String(i); + // Alphabetic keys + for (var i = 65; i <= 90; i++) keyNames[i] = String.fromCharCode(i); + // Function keys + for (var i = 1; i <= 12; i++) keyNames[i + 111] = keyNames[i + 63235] = "F" + i; + })(); + + // BIDI HELPERS + + function iterateBidiSections(order, from, to, f) { + if (!order) return f(from, to, "ltr"); + var found = false; + for (var i = 0; i < order.length; ++i) { + var part = order[i]; + if (part.from < to && part.to > from || from == to && part.to == from) { + f(Math.max(part.from, from), Math.min(part.to, to), part.level == 1 ? "rtl" : "ltr"); + found = true; + } + } + if (!found) f(from, to, "ltr"); + } + + function bidiLeft(part) { return part.level % 2 ? part.to : part.from; } + function bidiRight(part) { return part.level % 2 ? part.from : part.to; } + + function lineLeft(line) { var order = getOrder(line); return order ? bidiLeft(order[0]) : 0; } + function lineRight(line) { + var order = getOrder(line); + if (!order) return line.text.length; + return bidiRight(lst(order)); + } + + function lineStart(cm, lineN) { + var line = getLine(cm.doc, lineN); + var visual = visualLine(line); + if (visual != line) lineN = lineNo(visual); + var order = getOrder(visual); + var ch = !order ? 0 : order[0].level % 2 ? lineRight(visual) : lineLeft(visual); + return Pos(lineN, ch); + } + function lineEnd(cm, lineN) { + var merged, line = getLine(cm.doc, lineN); + while (merged = collapsedSpanAtEnd(line)) { + line = merged.find(1, true).line; + lineN = null; + } + var order = getOrder(line); + var ch = !order ? line.text.length : order[0].level % 2 ? lineLeft(line) : lineRight(line); + return Pos(lineN == null ? lineNo(line) : lineN, ch); + } + function lineStartSmart(cm, pos) { + var start = lineStart(cm, pos.line); + var line = getLine(cm.doc, start.line); + var order = getOrder(line); + if (!order || order[0].level == 0) { + var firstNonWS = Math.max(0, line.text.search(/\S/)); + var inWS = pos.line == start.line && pos.ch <= firstNonWS && pos.ch; + return Pos(start.line, inWS ? 0 : firstNonWS); + } + return start; + } + + function compareBidiLevel(order, a, b) { + var linedir = order[0].level; + if (a == linedir) return true; + if (b == linedir) return false; + return a < b; + } + var bidiOther; + function getBidiPartAt(order, pos) { + bidiOther = null; + for (var i = 0, found; i < order.length; ++i) { + var cur = order[i]; + if (cur.from < pos && cur.to > pos) return i; + if ((cur.from == pos || cur.to == pos)) { + if (found == null) { + found = i; + } else if (compareBidiLevel(order, cur.level, order[found].level)) { + if (cur.from != cur.to) bidiOther = found; + return i; + } else { + if (cur.from != cur.to) bidiOther = i; + return found; + } + } + } + return found; + } + + function moveInLine(line, pos, dir, byUnit) { + if (!byUnit) return pos + dir; + do pos += dir; + while (pos > 0 && isExtendingChar(line.text.charAt(pos))); + return pos; + } + + // This is needed in order to move 'visually' through bi-directional + // text -- i.e., pressing left should make the cursor go left, even + // when in RTL text. The tricky part is the 'jumps', where RTL and + // LTR text touch each other. This often requires the cursor offset + // to move more than one unit, in order to visually move one unit. + function moveVisually(line, start, dir, byUnit) { + var bidi = getOrder(line); + if (!bidi) return moveLogically(line, start, dir, byUnit); + var pos = getBidiPartAt(bidi, start), part = bidi[pos]; + var target = moveInLine(line, start, part.level % 2 ? -dir : dir, byUnit); + + for (;;) { + if (target > part.from && target < part.to) return target; + if (target == part.from || target == part.to) { + if (getBidiPartAt(bidi, target) == pos) return target; + part = bidi[pos += dir]; + return (dir > 0) == part.level % 2 ? part.to : part.from; + } else { + part = bidi[pos += dir]; + if (!part) return null; + if ((dir > 0) == part.level % 2) + target = moveInLine(line, part.to, -1, byUnit); + else + target = moveInLine(line, part.from, 1, byUnit); + } + } + } + + function moveLogically(line, start, dir, byUnit) { + var target = start + dir; + if (byUnit) while (target > 0 && isExtendingChar(line.text.charAt(target))) target += dir; + return target < 0 || target > line.text.length ? null : target; + } + + // Bidirectional ordering algorithm + // See http://unicode.org/reports/tr9/tr9-13.html for the algorithm + // that this (partially) implements. + + // One-char codes used for character types: + // L (L): Left-to-Right + // R (R): Right-to-Left + // r (AL): Right-to-Left Arabic + // 1 (EN): European Number + // + (ES): European Number Separator + // % (ET): European Number Terminator + // n (AN): Arabic Number + // , (CS): Common Number Separator + // m (NSM): Non-Spacing Mark + // b (BN): Boundary Neutral + // s (B): Paragraph Separator + // t (S): Segment Separator + // w (WS): Whitespace + // N (ON): Other Neutrals + + // Returns null if characters are ordered as they appear + // (left-to-right), or an array of sections ({from, to, level} + // objects) in the order in which they occur visually. + var bidiOrdering = (function() { + // Character types for codepoints 0 to 0xff + var lowTypes = "bbbbbbbbbtstwsbbbbbbbbbbbbbbssstwNN%%%NNNNNN,N,N1111111111NNNNNNNLLLLLLLLLLLLLLLLLLLLLLLLLLNNNNNNLLLLLLLLLLLLLLLLLLLLLLLLLLNNNNbbbbbbsbbbbbbbbbbbbbbbbbbbbbbbbbb,N%%%%NNNNLNNNNN%%11NLNNN1LNNNNNLLLLLLLLLLLLLLLLLLLLLLLNLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLN"; + // Character types for codepoints 0x600 to 0x6ff + var arabicTypes = "rrrrrrrrrrrr,rNNmmmmmmrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrmmmmmmmmmmmmmmrrrrrrrnnnnnnnnnn%nnrrrmrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrmmmmmmmmmmmmmmmmmmmNmmmm"; + function charType(code) { + if (code <= 0xf7) return lowTypes.charAt(code); + else if (0x590 <= code && code <= 0x5f4) return "R"; + else if (0x600 <= code && code <= 0x6ed) return arabicTypes.charAt(code - 0x600); + else if (0x6ee <= code && code <= 0x8ac) return "r"; + else if (0x2000 <= code && code <= 0x200b) return "w"; + else if (code == 0x200c) return "b"; + else return "L"; + } + + var bidiRE = /[\u0590-\u05f4\u0600-\u06ff\u0700-\u08ac]/; + var isNeutral = /[stwN]/, isStrong = /[LRr]/, countsAsLeft = /[Lb1n]/, countsAsNum = /[1n]/; + // Browsers seem to always treat the boundaries of block elements as being L. + var outerType = "L"; + + function BidiSpan(level, from, to) { + this.level = level; + this.from = from; this.to = to; + } + + return function(str) { + if (!bidiRE.test(str)) return false; + var len = str.length, types = []; + for (var i = 0, type; i < len; ++i) + types.push(type = charType(str.charCodeAt(i))); + + // W1. Examine each non-spacing mark (NSM) in the level run, and + // change the type of the NSM to the type of the previous + // character. If the NSM is at the start of the level run, it will + // get the type of sor. + for (var i = 0, prev = outerType; i < len; ++i) { + var type = types[i]; + if (type == "m") types[i] = prev; + else prev = type; + } + + // W2. Search backwards from each instance of a European number + // until the first strong type (R, L, AL, or sor) is found. If an + // AL is found, change the type of the European number to Arabic + // number. + // W3. Change all ALs to R. + for (var i = 0, cur = outerType; i < len; ++i) { + var type = types[i]; + if (type == "1" && cur == "r") types[i] = "n"; + else if (isStrong.test(type)) { cur = type; if (type == "r") types[i] = "R"; } + } + + // W4. A single European separator between two European numbers + // changes to a European number. A single common separator between + // two numbers of the same type changes to that type. + for (var i = 1, prev = types[0]; i < len - 1; ++i) { + var type = types[i]; + if (type == "+" && prev == "1" && types[i+1] == "1") types[i] = "1"; + else if (type == "," && prev == types[i+1] && + (prev == "1" || prev == "n")) types[i] = prev; + prev = type; + } + + // W5. A sequence of European terminators adjacent to European + // numbers changes to all European numbers. + // W6. Otherwise, separators and terminators change to Other + // Neutral. + for (var i = 0; i < len; ++i) { + var type = types[i]; + if (type == ",") types[i] = "N"; + else if (type == "%") { + for (var end = i + 1; end < len && types[end] == "%"; ++end) {} + var replace = (i && types[i-1] == "!") || (end < len && types[end] == "1") ? "1" : "N"; + for (var j = i; j < end; ++j) types[j] = replace; + i = end - 1; + } + } + + // W7. Search backwards from each instance of a European number + // until the first strong type (R, L, or sor) is found. If an L is + // found, then change the type of the European number to L. + for (var i = 0, cur = outerType; i < len; ++i) { + var type = types[i]; + if (cur == "L" && type == "1") types[i] = "L"; + else if (isStrong.test(type)) cur = type; + } + + // N1. A sequence of neutrals takes the direction of the + // surrounding strong text if the text on both sides has the same + // direction. European and Arabic numbers act as if they were R in + // terms of their influence on neutrals. Start-of-level-run (sor) + // and end-of-level-run (eor) are used at level run boundaries. + // N2. Any remaining neutrals take the embedding direction. + for (var i = 0; i < len; ++i) { + if (isNeutral.test(types[i])) { + for (var end = i + 1; end < len && isNeutral.test(types[end]); ++end) {} + var before = (i ? types[i-1] : outerType) == "L"; + var after = (end < len ? types[end] : outerType) == "L"; + var replace = before || after ? "L" : "R"; + for (var j = i; j < end; ++j) types[j] = replace; + i = end - 1; + } + } + + // Here we depart from the documented algorithm, in order to avoid + // building up an actual levels array. Since there are only three + // levels (0, 1, 2) in an implementation that doesn't take + // explicit embedding into account, we can build up the order on + // the fly, without following the level-based algorithm. + var order = [], m; + for (var i = 0; i < len;) { + if (countsAsLeft.test(types[i])) { + var start = i; + for (++i; i < len && countsAsLeft.test(types[i]); ++i) {} + order.push(new BidiSpan(0, start, i)); + } else { + var pos = i, at = order.length; + for (++i; i < len && types[i] != "L"; ++i) {} + for (var j = pos; j < i;) { + if (countsAsNum.test(types[j])) { + if (pos < j) order.splice(at, 0, new BidiSpan(1, pos, j)); + var nstart = j; + for (++j; j < i && countsAsNum.test(types[j]); ++j) {} + order.splice(at, 0, new BidiSpan(2, nstart, j)); + pos = j; + } else ++j; + } + if (pos < i) order.splice(at, 0, new BidiSpan(1, pos, i)); + } + } + if (order[0].level == 1 && (m = str.match(/^\s+/))) { + order[0].from = m[0].length; + order.unshift(new BidiSpan(0, 0, m[0].length)); + } + if (lst(order).level == 1 && (m = str.match(/\s+$/))) { + lst(order).to -= m[0].length; + order.push(new BidiSpan(0, len - m[0].length, len)); + } + if (order[0].level == 2) + order.unshift(new BidiSpan(1, order[0].to, order[0].to)); + if (order[0].level != lst(order).level) + order.push(new BidiSpan(order[0].level, len, len)); + + return order; + }; + })(); + + // THE END + + CodeMirror.version = "5.17.0"; + + return CodeMirror; +}); + +},{}],2:[function(require,module,exports){ +var pSlice = Array.prototype.slice; +var objectKeys = require('./lib/keys.js'); +var isArguments = require('./lib/is_arguments.js'); + +var deepEqual = module.exports = function (actual, expected, opts) { + if (!opts) opts = {}; + // 7.1. All identical values are equivalent, as determined by ===. + if (actual === expected) { + return true; + + } else if (actual instanceof Date && expected instanceof Date) { + return actual.getTime() === expected.getTime(); + + // 7.3. Other pairs that do not both pass typeof value == 'object', + // equivalence is determined by ==. + } else if (!actual || !expected || typeof actual != 'object' && typeof expected != 'object') { + return opts.strict ? actual === expected : actual == expected; + + // 7.4. For all other Object pairs, including Array objects, equivalence is + // determined by having the same number of owned properties (as verified + // with Object.prototype.hasOwnProperty.call), the same set of keys + // (although not necessarily the same order), equivalent values for every + // corresponding key, and an identical 'prototype' property. Note: this + // accounts for both named and indexed properties on Arrays. + } else { + return objEquiv(actual, expected, opts); + } +} + +function isUndefinedOrNull(value) { + return value === null || value === undefined; +} + +function isBuffer (x) { + if (!x || typeof x !== 'object' || typeof x.length !== 'number') return false; + if (typeof x.copy !== 'function' || typeof x.slice !== 'function') { + return false; + } + if (x.length > 0 && typeof x[0] !== 'number') return false; + return true; +} + +function objEquiv(a, b, opts) { + var i, key; + if (isUndefinedOrNull(a) || isUndefinedOrNull(b)) + return false; + // an identical 'prototype' property. + if (a.prototype !== b.prototype) return false; + //~~~I've managed to break Object.keys through screwy arguments passing. + // Converting to array solves the problem. + if (isArguments(a)) { + if (!isArguments(b)) { + return false; + } + a = pSlice.call(a); + b = pSlice.call(b); + return deepEqual(a, b, opts); + } + if (isBuffer(a)) { + if (!isBuffer(b)) { + return false; + } + if (a.length !== b.length) return false; + for (i = 0; i < a.length; i++) { + if (a[i] !== b[i]) return false; + } + return true; + } + try { + var ka = objectKeys(a), + kb = objectKeys(b); + } catch (e) {//happens when one is a string literal and the other isn't + return false; + } + // having the same number of owned properties (keys incorporates + // hasOwnProperty) + if (ka.length != kb.length) + return false; + //the same set of keys (although not necessarily the same order), + ka.sort(); + kb.sort(); + //~~~cheap key test + for (i = ka.length - 1; i >= 0; i--) { + if (ka[i] != kb[i]) + return false; + } + //equivalent values for every corresponding key, and + //~~~possibly expensive deep test + for (i = ka.length - 1; i >= 0; i--) { + key = ka[i]; + if (!deepEqual(a[key], b[key], opts)) return false; + } + return typeof a === typeof b; +} + +},{"./lib/is_arguments.js":3,"./lib/keys.js":4}],3:[function(require,module,exports){ +var supportsArgumentsClass = (function(){ + return Object.prototype.toString.call(arguments) +})() == '[object Arguments]'; + +exports = module.exports = supportsArgumentsClass ? supported : unsupported; + +exports.supported = supported; +function supported(object) { + return Object.prototype.toString.call(object) == '[object Arguments]'; +}; + +exports.unsupported = unsupported; +function unsupported(object){ + return object && + typeof object == 'object' && + typeof object.length == 'number' && + Object.prototype.hasOwnProperty.call(object, 'callee') && + !Object.prototype.propertyIsEnumerable.call(object, 'callee') || + false; +}; + +},{}],4:[function(require,module,exports){ +exports = module.exports = typeof Object.keys === 'function' + ? Object.keys : shim; + +exports.shim = shim; +function shim (obj) { + var keys = []; + for (var key in obj) keys.push(key); + return keys; +} + +},{}],5:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2013-2015, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule invariant + */ + +"use strict"; + +/** + * Use invariant() to assert state which your program assumes to be true. + * + * Provide sprintf-style format (only %s is supported) and arguments + * to provide information about what broke and what you were + * expecting. + * + * The invariant message will be stripped in production, but the invariant + * will remain to ensure logic does not differ in production. + */ + +var invariant = function (condition, format, a, b, c, d, e, f) { + if (process.env.NODE_ENV !== 'production') { + if (format === undefined) { + throw new Error('invariant requires an error message argument'); + } + } + + if (!condition) { + var error; + if (format === undefined) { + error = new Error('Minified exception occurred; use the non-minified dev environment ' + 'for the full error message and additional helpful warnings.'); + } else { + var args = [a, b, c, d, e, f]; + var argIndex = 0; + error = new Error('Invariant Violation: ' + format.replace(/%s/g, function () { + return args[argIndex++]; + })); + } + + error.framesToPop = 1; // we don't care about invariant's own frame + throw error; + } +}; + +module.exports = invariant; +}).call(this,require('_process')) + +},{"_process":40}],6:[function(require,module,exports){ +(function (process){ +/** + * Copyright (c) 2014-2015, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule Dispatcher + * + * @preventMunge + */ + +'use strict'; + +exports.__esModule = true; + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError('Cannot call a class as a function'); } } + +var invariant = require('fbjs/lib/invariant'); + +var _prefix = 'ID_'; + +/** + * Dispatcher is used to broadcast payloads to registered callbacks. This is + * different from generic pub-sub systems in two ways: + * + * 1) Callbacks are not subscribed to particular events. Every payload is + * dispatched to every registered callback. + * 2) Callbacks can be deferred in whole or part until other callbacks have + * been executed. + * + * For example, consider this hypothetical flight destination form, which + * selects a default city when a country is selected: + * + * var flightDispatcher = new Dispatcher(); + * + * // Keeps track of which country is selected + * var CountryStore = {country: null}; + * + * // Keeps track of which city is selected + * var CityStore = {city: null}; + * + * // Keeps track of the base flight price of the selected city + * var FlightPriceStore = {price: null} + * + * When a user changes the selected city, we dispatch the payload: + * + * flightDispatcher.dispatch({ + * actionType: 'city-update', + * selectedCity: 'paris' + * }); + * + * This payload is digested by `CityStore`: + * + * flightDispatcher.register(function(payload) { + * if (payload.actionType === 'city-update') { + * CityStore.city = payload.selectedCity; + * } + * }); + * + * When the user selects a country, we dispatch the payload: + * + * flightDispatcher.dispatch({ + * actionType: 'country-update', + * selectedCountry: 'australia' + * }); + * + * This payload is digested by both stores: + * + * CountryStore.dispatchToken = flightDispatcher.register(function(payload) { + * if (payload.actionType === 'country-update') { + * CountryStore.country = payload.selectedCountry; + * } + * }); + * + * When the callback to update `CountryStore` is registered, we save a reference + * to the returned token. Using this token with `waitFor()`, we can guarantee + * that `CountryStore` is updated before the callback that updates `CityStore` + * needs to query its data. + * + * CityStore.dispatchToken = flightDispatcher.register(function(payload) { + * if (payload.actionType === 'country-update') { + * // `CountryStore.country` may not be updated. + * flightDispatcher.waitFor([CountryStore.dispatchToken]); + * // `CountryStore.country` is now guaranteed to be updated. + * + * // Select the default city for the new country + * CityStore.city = getDefaultCityForCountry(CountryStore.country); + * } + * }); + * + * The usage of `waitFor()` can be chained, for example: + * + * FlightPriceStore.dispatchToken = + * flightDispatcher.register(function(payload) { + * switch (payload.actionType) { + * case 'country-update': + * case 'city-update': + * flightDispatcher.waitFor([CityStore.dispatchToken]); + * FlightPriceStore.price = + * getFlightPriceStore(CountryStore.country, CityStore.city); + * break; + * } + * }); + * + * The `country-update` payload will be guaranteed to invoke the stores' + * registered callbacks in order: `CountryStore`, `CityStore`, then + * `FlightPriceStore`. + */ + +var Dispatcher = (function () { + function Dispatcher() { + _classCallCheck(this, Dispatcher); + + this._callbacks = {}; + this._isDispatching = false; + this._isHandled = {}; + this._isPending = {}; + this._lastID = 1; + } + + /** + * Registers a callback to be invoked with every dispatched payload. Returns + * a token that can be used with `waitFor()`. + */ + + Dispatcher.prototype.register = function register(callback) { + var id = _prefix + this._lastID++; + this._callbacks[id] = callback; + return id; + }; + + /** + * Removes a callback based on its token. + */ + + Dispatcher.prototype.unregister = function unregister(id) { + !this._callbacks[id] ? process.env.NODE_ENV !== 'production' ? invariant(false, 'Dispatcher.unregister(...): `%s` does not map to a registered callback.', id) : invariant(false) : undefined; + delete this._callbacks[id]; + }; + + /** + * Waits for the callbacks specified to be invoked before continuing execution + * of the current callback. This method should only be used by a callback in + * response to a dispatched payload. + */ + + Dispatcher.prototype.waitFor = function waitFor(ids) { + !this._isDispatching ? process.env.NODE_ENV !== 'production' ? invariant(false, 'Dispatcher.waitFor(...): Must be invoked while dispatching.') : invariant(false) : undefined; + for (var ii = 0; ii < ids.length; ii++) { + var id = ids[ii]; + if (this._isPending[id]) { + !this._isHandled[id] ? process.env.NODE_ENV !== 'production' ? invariant(false, 'Dispatcher.waitFor(...): Circular dependency detected while ' + 'waiting for `%s`.', id) : invariant(false) : undefined; + continue; + } + !this._callbacks[id] ? process.env.NODE_ENV !== 'production' ? invariant(false, 'Dispatcher.waitFor(...): `%s` does not map to a registered callback.', id) : invariant(false) : undefined; + this._invokeCallback(id); + } + }; + + /** + * Dispatches a payload to all registered callbacks. + */ + + Dispatcher.prototype.dispatch = function dispatch(payload) { + !!this._isDispatching ? process.env.NODE_ENV !== 'production' ? invariant(false, 'Dispatch.dispatch(...): Cannot dispatch in the middle of a dispatch.') : invariant(false) : undefined; + this._startDispatching(payload); + try { + for (var id in this._callbacks) { + if (this._isPending[id]) { + continue; + } + this._invokeCallback(id); + } + } finally { + this._stopDispatching(); + } + }; + + /** + * Is this Dispatcher currently dispatching. + */ + + Dispatcher.prototype.isDispatching = function isDispatching() { + return this._isDispatching; + }; + + /** + * Call the callback stored with the given id. Also do some internal + * bookkeeping. + * + * @internal + */ + + Dispatcher.prototype._invokeCallback = function _invokeCallback(id) { + this._isPending[id] = true; + this._callbacks[id](this._pendingPayload); + this._isHandled[id] = true; + }; + + /** + * Set up bookkeeping needed when dispatching. + * + * @internal + */ + + Dispatcher.prototype._startDispatching = function _startDispatching(payload) { + for (var id in this._callbacks) { + this._isPending[id] = false; + this._isHandled[id] = false; + } + this._pendingPayload = payload; + this._isDispatching = true; + }; + + /** + * Clear bookkeeping used for dispatching. + * + * @internal + */ + + Dispatcher.prototype._stopDispatching = function _stopDispatching() { + delete this._pendingPayload; + this._isDispatching = false; + }; + + return Dispatcher; +})(); + +module.exports = Dispatcher; +}).call(this,require('_process')) + +},{"_process":40,"fbjs/lib/invariant":5}],7:[function(require,module,exports){ +/** + * Indicates that navigation was caused by a call to history.push. + */ +'use strict'; + +exports.__esModule = true; +var PUSH = 'PUSH'; + +exports.PUSH = PUSH; +/** + * Indicates that navigation was caused by a call to history.replace. + */ +var REPLACE = 'REPLACE'; + +exports.REPLACE = REPLACE; +/** + * Indicates that navigation was caused by some other action such + * as using a browser's back/forward buttons and/or manually manipulating + * the URL in a browser's location bar. This is the default. + * + * See https://developer.mozilla.org/en-US/docs/Web/API/WindowEventHandlers/onpopstate + * for more information. + */ +var POP = 'POP'; + +exports.POP = POP; +exports['default'] = { + PUSH: PUSH, + REPLACE: REPLACE, + POP: POP +}; +},{}],8:[function(require,module,exports){ +"use strict"; + +exports.__esModule = true; +var _slice = Array.prototype.slice; +exports.loopAsync = loopAsync; + +function loopAsync(turns, work, callback) { + var currentTurn = 0, + isDone = false; + var sync = false, + hasNext = false, + doneArgs = undefined; + + function done() { + isDone = true; + if (sync) { + // Iterate instead of recursing if possible. + doneArgs = [].concat(_slice.call(arguments)); + return; + } + + callback.apply(this, arguments); + } + + function next() { + if (isDone) { + return; + } + + hasNext = true; + if (sync) { + // Iterate instead of recursing if possible. + return; + } + + sync = true; + + while (!isDone && currentTurn < turns && hasNext) { + hasNext = false; + work.call(this, currentTurn++, next, done); + } + + sync = false; + + if (isDone) { + // This means the loop finished synchronously. + callback.apply(this, doneArgs); + return; + } + + if (currentTurn >= turns && hasNext) { + isDone = true; + callback(); + } + } + + next(); +} +},{}],9:[function(require,module,exports){ +(function (process){ +/*eslint-disable no-empty */ +'use strict'; + +exports.__esModule = true; +exports.saveState = saveState; +exports.readState = readState; + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } + +var _warning = require('warning'); + +var _warning2 = _interopRequireDefault(_warning); + +var KeyPrefix = '@@History/'; +var QuotaExceededErrors = ['QuotaExceededError', 'QUOTA_EXCEEDED_ERR']; + +var SecurityError = 'SecurityError'; + +function createKey(key) { + return KeyPrefix + key; +} + +function saveState(key, state) { + try { + if (state == null) { + window.sessionStorage.removeItem(createKey(key)); + } else { + window.sessionStorage.setItem(createKey(key), JSON.stringify(state)); + } + } catch (error) { + if (error.name === SecurityError) { + // Blocking cookies in Chrome/Firefox/Safari throws SecurityError on any + // attempt to access window.sessionStorage. + process.env.NODE_ENV !== 'production' ? _warning2['default'](false, '[history] Unable to save state; sessionStorage is not available due to security settings') : undefined; + + return; + } + + if (QuotaExceededErrors.indexOf(error.name) >= 0 && window.sessionStorage.length === 0) { + // Safari "private mode" throws QuotaExceededError. + process.env.NODE_ENV !== 'production' ? _warning2['default'](false, '[history] Unable to save state; sessionStorage is not available in Safari private mode') : undefined; + + return; + } + + throw error; + } +} + +function readState(key) { + var json = undefined; + try { + json = window.sessionStorage.getItem(createKey(key)); + } catch (error) { + if (error.name === SecurityError) { + // Blocking cookies in Chrome/Firefox/Safari throws SecurityError on any + // attempt to access window.sessionStorage. + process.env.NODE_ENV !== 'production' ? _warning2['default'](false, '[history] Unable to read state; sessionStorage is not available due to security settings') : undefined; + + return null; + } + } + + if (json) { + try { + return JSON.parse(json); + } catch (error) { + // Ignore invalid JSON. + } + } + + return null; +} +}).call(this,require('_process')) + +},{"_process":40,"warning":26}],10:[function(require,module,exports){ +'use strict'; + +exports.__esModule = true; +exports.addEventListener = addEventListener; +exports.removeEventListener = removeEventListener; +exports.getHashPath = getHashPath; +exports.replaceHashPath = replaceHashPath; +exports.getWindowPath = getWindowPath; +exports.go = go; +exports.getUserConfirmation = getUserConfirmation; +exports.supportsHistory = supportsHistory; +exports.supportsGoWithoutReloadUsingHash = supportsGoWithoutReloadUsingHash; + +function addEventListener(node, event, listener) { + if (node.addEventListener) { + node.addEventListener(event, listener, false); + } else { + node.attachEvent('on' + event, listener); + } +} + +function removeEventListener(node, event, listener) { + if (node.removeEventListener) { + node.removeEventListener(event, listener, false); + } else { + node.detachEvent('on' + event, listener); + } +} + +function getHashPath() { + // We can't use window.location.hash here because it's not + // consistent across browsers - Firefox will pre-decode it! + return window.location.href.split('#')[1] || ''; +} + +function replaceHashPath(path) { + window.location.replace(window.location.pathname + window.location.search + '#' + path); +} + +function getWindowPath() { + return window.location.pathname + window.location.search + window.location.hash; +} + +function go(n) { + if (n) window.history.go(n); +} + +function getUserConfirmation(message, callback) { + callback(window.confirm(message)); +} + +/** + * Returns true if the HTML5 history API is supported. Taken from Modernizr. + * + * https://github.com/Modernizr/Modernizr/blob/master/LICENSE + * https://github.com/Modernizr/Modernizr/blob/master/feature-detects/history.js + * changed to avoid false negatives for Windows Phones: https://github.com/rackt/react-router/issues/586 + */ + +function supportsHistory() { + var ua = navigator.userAgent; + if ((ua.indexOf('Android 2.') !== -1 || ua.indexOf('Android 4.0') !== -1) && ua.indexOf('Mobile Safari') !== -1 && ua.indexOf('Chrome') === -1 && ua.indexOf('Windows Phone') === -1) { + return false; + } + return window.history && 'pushState' in window.history; +} + +/** + * Returns false if using go(n) with hash history causes a full page reload. + */ + +function supportsGoWithoutReloadUsingHash() { + var ua = navigator.userAgent; + return ua.indexOf('Firefox') === -1; +} +},{}],11:[function(require,module,exports){ +'use strict'; + +exports.__esModule = true; +var canUseDOM = !!(typeof window !== 'undefined' && window.document && window.document.createElement); +exports.canUseDOM = canUseDOM; +},{}],12:[function(require,module,exports){ +(function (process){ +'use strict'; + +exports.__esModule = true; +exports.extractPath = extractPath; +exports.parsePath = parsePath; + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } + +var _warning = require('warning'); + +var _warning2 = _interopRequireDefault(_warning); + +function extractPath(string) { + var match = string.match(/^https?:\/\/[^\/]*/); + + if (match == null) return string; + + return string.substring(match[0].length); +} + +function parsePath(path) { + var pathname = extractPath(path); + var search = ''; + var hash = ''; + + process.env.NODE_ENV !== 'production' ? _warning2['default'](path === pathname, 'A path must be pathname + search + hash only, not a fully qualified URL like "%s"', path) : undefined; + + var hashIndex = pathname.indexOf('#'); + if (hashIndex !== -1) { + hash = pathname.substring(hashIndex); + pathname = pathname.substring(0, hashIndex); + } + + var searchIndex = pathname.indexOf('?'); + if (searchIndex !== -1) { + search = pathname.substring(searchIndex); + pathname = pathname.substring(0, searchIndex); + } + + if (pathname === '') pathname = '/'; + + return { + pathname: pathname, + search: search, + hash: hash + }; +} +}).call(this,require('_process')) + +},{"_process":40,"warning":26}],13:[function(require,module,exports){ +(function (process){ +'use strict'; + +exports.__esModule = true; + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } + +var _invariant = require('invariant'); + +var _invariant2 = _interopRequireDefault(_invariant); + +var _Actions = require('./Actions'); + +var _PathUtils = require('./PathUtils'); + +var _ExecutionEnvironment = require('./ExecutionEnvironment'); + +var _DOMUtils = require('./DOMUtils'); + +var _DOMStateStorage = require('./DOMStateStorage'); + +var _createDOMHistory = require('./createDOMHistory'); + +var _createDOMHistory2 = _interopRequireDefault(_createDOMHistory); + +/** + * Creates and returns a history object that uses HTML5's history API + * (pushState, replaceState, and the popstate event) to manage history. + * This is the recommended method of managing history in browsers because + * it provides the cleanest URLs. + * + * Note: In browsers that do not support the HTML5 history API full + * page reloads will be used to preserve URLs. + */ +function createBrowserHistory() { + var options = arguments.length <= 0 || arguments[0] === undefined ? {} : arguments[0]; + + !_ExecutionEnvironment.canUseDOM ? process.env.NODE_ENV !== 'production' ? _invariant2['default'](false, 'Browser history needs a DOM') : _invariant2['default'](false) : undefined; + + var forceRefresh = options.forceRefresh; + + var isSupported = _DOMUtils.supportsHistory(); + var useRefresh = !isSupported || forceRefresh; + + function getCurrentLocation(historyState) { + try { + historyState = historyState || window.history.state || {}; + } catch (e) { + historyState = {}; + } + + var path = _DOMUtils.getWindowPath(); + var _historyState = historyState; + var key = _historyState.key; + + var state = undefined; + if (key) { + state = _DOMStateStorage.readState(key); + } else { + state = null; + key = history.createKey(); + + if (isSupported) window.history.replaceState(_extends({}, historyState, { key: key }), null); + } + + var location = _PathUtils.parsePath(path); + + return history.createLocation(_extends({}, location, { state: state }), undefined, key); + } + + function startPopStateListener(_ref) { + var transitionTo = _ref.transitionTo; + + function popStateListener(event) { + if (event.state === undefined) return; // Ignore extraneous popstate events in WebKit. + + transitionTo(getCurrentLocation(event.state)); + } + + _DOMUtils.addEventListener(window, 'popstate', popStateListener); + + return function () { + _DOMUtils.removeEventListener(window, 'popstate', popStateListener); + }; + } + + function finishTransition(location) { + var basename = location.basename; + var pathname = location.pathname; + var search = location.search; + var hash = location.hash; + var state = location.state; + var action = location.action; + var key = location.key; + + if (action === _Actions.POP) return; // Nothing to do. + + _DOMStateStorage.saveState(key, state); + + var path = (basename || '') + pathname + search + hash; + var historyState = { + key: key + }; + + if (action === _Actions.PUSH) { + if (useRefresh) { + window.location.href = path; + return false; // Prevent location update. + } else { + window.history.pushState(historyState, null, path); + } + } else { + // REPLACE + if (useRefresh) { + window.location.replace(path); + return false; // Prevent location update. + } else { + window.history.replaceState(historyState, null, path); + } + } + } + + var history = _createDOMHistory2['default'](_extends({}, options, { + getCurrentLocation: getCurrentLocation, + finishTransition: finishTransition, + saveState: _DOMStateStorage.saveState + })); + + var listenerCount = 0, + stopPopStateListener = undefined; + + function listenBefore(listener) { + if (++listenerCount === 1) stopPopStateListener = startPopStateListener(history); + + var unlisten = history.listenBefore(listener); + + return function () { + unlisten(); + + if (--listenerCount === 0) stopPopStateListener(); + }; + } + + function listen(listener) { + if (++listenerCount === 1) stopPopStateListener = startPopStateListener(history); + + var unlisten = history.listen(listener); + + return function () { + unlisten(); + + if (--listenerCount === 0) stopPopStateListener(); + }; + } + + // deprecated + function registerTransitionHook(hook) { + if (++listenerCount === 1) stopPopStateListener = startPopStateListener(history); + + history.registerTransitionHook(hook); + } + + // deprecated + function unregisterTransitionHook(hook) { + history.unregisterTransitionHook(hook); + + if (--listenerCount === 0) stopPopStateListener(); + } + + return _extends({}, history, { + listenBefore: listenBefore, + listen: listen, + registerTransitionHook: registerTransitionHook, + unregisterTransitionHook: unregisterTransitionHook + }); +} + +exports['default'] = createBrowserHistory; +module.exports = exports['default']; +}).call(this,require('_process')) + +},{"./Actions":7,"./DOMStateStorage":9,"./DOMUtils":10,"./ExecutionEnvironment":11,"./PathUtils":12,"./createDOMHistory":14,"_process":40,"invariant":28}],14:[function(require,module,exports){ +(function (process){ +'use strict'; + +exports.__esModule = true; + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } + +var _invariant = require('invariant'); + +var _invariant2 = _interopRequireDefault(_invariant); + +var _ExecutionEnvironment = require('./ExecutionEnvironment'); + +var _DOMUtils = require('./DOMUtils'); + +var _createHistory = require('./createHistory'); + +var _createHistory2 = _interopRequireDefault(_createHistory); + +function createDOMHistory(options) { + var history = _createHistory2['default'](_extends({ + getUserConfirmation: _DOMUtils.getUserConfirmation + }, options, { + go: _DOMUtils.go + })); + + function listen(listener) { + !_ExecutionEnvironment.canUseDOM ? process.env.NODE_ENV !== 'production' ? _invariant2['default'](false, 'DOM history needs a DOM') : _invariant2['default'](false) : undefined; + + return history.listen(listener); + } + + return _extends({}, history, { + listen: listen + }); +} + +exports['default'] = createDOMHistory; +module.exports = exports['default']; +}).call(this,require('_process')) + +},{"./DOMUtils":10,"./ExecutionEnvironment":11,"./createHistory":16,"_process":40,"invariant":28}],15:[function(require,module,exports){ +(function (process){ +'use strict'; + +exports.__esModule = true; + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } + +var _warning = require('warning'); + +var _warning2 = _interopRequireDefault(_warning); + +var _invariant = require('invariant'); + +var _invariant2 = _interopRequireDefault(_invariant); + +var _Actions = require('./Actions'); + +var _PathUtils = require('./PathUtils'); + +var _ExecutionEnvironment = require('./ExecutionEnvironment'); + +var _DOMUtils = require('./DOMUtils'); + +var _DOMStateStorage = require('./DOMStateStorage'); + +var _createDOMHistory = require('./createDOMHistory'); + +var _createDOMHistory2 = _interopRequireDefault(_createDOMHistory); + +function isAbsolutePath(path) { + return typeof path === 'string' && path.charAt(0) === '/'; +} + +function ensureSlash() { + var path = _DOMUtils.getHashPath(); + + if (isAbsolutePath(path)) return true; + + _DOMUtils.replaceHashPath('/' + path); + + return false; +} + +function addQueryStringValueToPath(path, key, value) { + return path + (path.indexOf('?') === -1 ? '?' : '&') + (key + '=' + value); +} + +function stripQueryStringValueFromPath(path, key) { + return path.replace(new RegExp('[?&]?' + key + '=[a-zA-Z0-9]+'), ''); +} + +function getQueryStringValueFromPath(path, key) { + var match = path.match(new RegExp('\\?.*?\\b' + key + '=(.+?)\\b')); + return match && match[1]; +} + +var DefaultQueryKey = '_k'; + +function createHashHistory() { + var options = arguments.length <= 0 || arguments[0] === undefined ? {} : arguments[0]; + + !_ExecutionEnvironment.canUseDOM ? process.env.NODE_ENV !== 'production' ? _invariant2['default'](false, 'Hash history needs a DOM') : _invariant2['default'](false) : undefined; + + var queryKey = options.queryKey; + + if (queryKey === undefined || !!queryKey) queryKey = typeof queryKey === 'string' ? queryKey : DefaultQueryKey; + + function getCurrentLocation() { + var path = _DOMUtils.getHashPath(); + + var key = undefined, + state = undefined; + if (queryKey) { + key = getQueryStringValueFromPath(path, queryKey); + path = stripQueryStringValueFromPath(path, queryKey); + + if (key) { + state = _DOMStateStorage.readState(key); + } else { + state = null; + key = history.createKey(); + _DOMUtils.replaceHashPath(addQueryStringValueToPath(path, queryKey, key)); + } + } else { + key = state = null; + } + + var location = _PathUtils.parsePath(path); + + return history.createLocation(_extends({}, location, { state: state }), undefined, key); + } + + function startHashChangeListener(_ref) { + var transitionTo = _ref.transitionTo; + + function hashChangeListener() { + if (!ensureSlash()) return; // Always make sure hashes are preceeded with a /. + + transitionTo(getCurrentLocation()); + } + + ensureSlash(); + _DOMUtils.addEventListener(window, 'hashchange', hashChangeListener); + + return function () { + _DOMUtils.removeEventListener(window, 'hashchange', hashChangeListener); + }; + } + + function finishTransition(location) { + var basename = location.basename; + var pathname = location.pathname; + var search = location.search; + var state = location.state; + var action = location.action; + var key = location.key; + + if (action === _Actions.POP) return; // Nothing to do. + + var path = (basename || '') + pathname + search; + + if (queryKey) { + path = addQueryStringValueToPath(path, queryKey, key); + _DOMStateStorage.saveState(key, state); + } else { + // Drop key and state. + location.key = location.state = null; + } + + var currentHash = _DOMUtils.getHashPath(); + + if (action === _Actions.PUSH) { + if (currentHash !== path) { + window.location.hash = path; + } else { + process.env.NODE_ENV !== 'production' ? _warning2['default'](false, 'You cannot PUSH the same path using hash history') : undefined; + } + } else if (currentHash !== path) { + // REPLACE + _DOMUtils.replaceHashPath(path); + } + } + + var history = _createDOMHistory2['default'](_extends({}, options, { + getCurrentLocation: getCurrentLocation, + finishTransition: finishTransition, + saveState: _DOMStateStorage.saveState + })); + + var listenerCount = 0, + stopHashChangeListener = undefined; + + function listenBefore(listener) { + if (++listenerCount === 1) stopHashChangeListener = startHashChangeListener(history); + + var unlisten = history.listenBefore(listener); + + return function () { + unlisten(); + + if (--listenerCount === 0) stopHashChangeListener(); + }; + } + + function listen(listener) { + if (++listenerCount === 1) stopHashChangeListener = startHashChangeListener(history); + + var unlisten = history.listen(listener); + + return function () { + unlisten(); + + if (--listenerCount === 0) stopHashChangeListener(); + }; + } + + function push(location) { + process.env.NODE_ENV !== 'production' ? _warning2['default'](queryKey || location.state == null, 'You cannot use state without a queryKey it will be dropped') : undefined; + + history.push(location); + } + + function replace(location) { + process.env.NODE_ENV !== 'production' ? _warning2['default'](queryKey || location.state == null, 'You cannot use state without a queryKey it will be dropped') : undefined; + + history.replace(location); + } + + var goIsSupportedWithoutReload = _DOMUtils.supportsGoWithoutReloadUsingHash(); + + function go(n) { + process.env.NODE_ENV !== 'production' ? _warning2['default'](goIsSupportedWithoutReload, 'Hash history go(n) causes a full page reload in this browser') : undefined; + + history.go(n); + } + + function createHref(path) { + return '#' + history.createHref(path); + } + + // deprecated + function registerTransitionHook(hook) { + if (++listenerCount === 1) stopHashChangeListener = startHashChangeListener(history); + + history.registerTransitionHook(hook); + } + + // deprecated + function unregisterTransitionHook(hook) { + history.unregisterTransitionHook(hook); + + if (--listenerCount === 0) stopHashChangeListener(); + } + + // deprecated + function pushState(state, path) { + process.env.NODE_ENV !== 'production' ? _warning2['default'](queryKey || state == null, 'You cannot use state without a queryKey it will be dropped') : undefined; + + history.pushState(state, path); + } + + // deprecated + function replaceState(state, path) { + process.env.NODE_ENV !== 'production' ? _warning2['default'](queryKey || state == null, 'You cannot use state without a queryKey it will be dropped') : undefined; + + history.replaceState(state, path); + } + + return _extends({}, history, { + listenBefore: listenBefore, + listen: listen, + push: push, + replace: replace, + go: go, + createHref: createHref, + + registerTransitionHook: registerTransitionHook, // deprecated - warning is in createHistory + unregisterTransitionHook: unregisterTransitionHook, // deprecated - warning is in createHistory + pushState: pushState, // deprecated - warning is in createHistory + replaceState: replaceState // deprecated - warning is in createHistory + }); +} + +exports['default'] = createHashHistory; +module.exports = exports['default']; +}).call(this,require('_process')) + +},{"./Actions":7,"./DOMStateStorage":9,"./DOMUtils":10,"./ExecutionEnvironment":11,"./PathUtils":12,"./createDOMHistory":14,"_process":40,"invariant":28,"warning":26}],16:[function(require,module,exports){ +(function (process){ +'use strict'; + +exports.__esModule = true; + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } + +var _warning = require('warning'); + +var _warning2 = _interopRequireDefault(_warning); + +var _deepEqual = require('deep-equal'); + +var _deepEqual2 = _interopRequireDefault(_deepEqual); + +var _PathUtils = require('./PathUtils'); + +var _AsyncUtils = require('./AsyncUtils'); + +var _Actions = require('./Actions'); + +var _createLocation2 = require('./createLocation'); + +var _createLocation3 = _interopRequireDefault(_createLocation2); + +var _runTransitionHook = require('./runTransitionHook'); + +var _runTransitionHook2 = _interopRequireDefault(_runTransitionHook); + +var _deprecate = require('./deprecate'); + +var _deprecate2 = _interopRequireDefault(_deprecate); + +function createRandomKey(length) { + return Math.random().toString(36).substr(2, length); +} + +function locationsAreEqual(a, b) { + return a.pathname === b.pathname && a.search === b.search && + //a.action === b.action && // Different action !== location change. + a.key === b.key && _deepEqual2['default'](a.state, b.state); +} + +var DefaultKeyLength = 6; + +function createHistory() { + var options = arguments.length <= 0 || arguments[0] === undefined ? {} : arguments[0]; + var getCurrentLocation = options.getCurrentLocation; + var finishTransition = options.finishTransition; + var saveState = options.saveState; + var go = options.go; + var getUserConfirmation = options.getUserConfirmation; + var keyLength = options.keyLength; + + if (typeof keyLength !== 'number') keyLength = DefaultKeyLength; + + var transitionHooks = []; + + function listenBefore(hook) { + transitionHooks.push(hook); + + return function () { + transitionHooks = transitionHooks.filter(function (item) { + return item !== hook; + }); + }; + } + + var allKeys = []; + var changeListeners = []; + var location = undefined; + + function getCurrent() { + if (pendingLocation && pendingLocation.action === _Actions.POP) { + return allKeys.indexOf(pendingLocation.key); + } else if (location) { + return allKeys.indexOf(location.key); + } else { + return -1; + } + } + + function updateLocation(newLocation) { + var current = getCurrent(); + + location = newLocation; + + if (location.action === _Actions.PUSH) { + allKeys = [].concat(allKeys.slice(0, current + 1), [location.key]); + } else if (location.action === _Actions.REPLACE) { + allKeys[current] = location.key; + } + + changeListeners.forEach(function (listener) { + listener(location); + }); + } + + function listen(listener) { + changeListeners.push(listener); + + if (location) { + listener(location); + } else { + var _location = getCurrentLocation(); + allKeys = [_location.key]; + updateLocation(_location); + } + + return function () { + changeListeners = changeListeners.filter(function (item) { + return item !== listener; + }); + }; + } + + function confirmTransitionTo(location, callback) { + _AsyncUtils.loopAsync(transitionHooks.length, function (index, next, done) { + _runTransitionHook2['default'](transitionHooks[index], location, function (result) { + if (result != null) { + done(result); + } else { + next(); + } + }); + }, function (message) { + if (getUserConfirmation && typeof message === 'string') { + getUserConfirmation(message, function (ok) { + callback(ok !== false); + }); + } else { + callback(message !== false); + } + }); + } + + var pendingLocation = undefined; + + function transitionTo(nextLocation) { + if (location && locationsAreEqual(location, nextLocation)) return; // Nothing to do. + + pendingLocation = nextLocation; + + confirmTransitionTo(nextLocation, function (ok) { + if (pendingLocation !== nextLocation) return; // Transition was interrupted. + + if (ok) { + // treat PUSH to current path like REPLACE to be consistent with browsers + if (nextLocation.action === _Actions.PUSH) { + var prevPath = createPath(location); + var nextPath = createPath(nextLocation); + + if (nextPath === prevPath && _deepEqual2['default'](location.state, nextLocation.state)) nextLocation.action = _Actions.REPLACE; + } + + if (finishTransition(nextLocation) !== false) updateLocation(nextLocation); + } else if (location && nextLocation.action === _Actions.POP) { + var prevIndex = allKeys.indexOf(location.key); + var nextIndex = allKeys.indexOf(nextLocation.key); + + if (prevIndex !== -1 && nextIndex !== -1) go(prevIndex - nextIndex); // Restore the URL. + } + }); + } + + function push(location) { + transitionTo(createLocation(location, _Actions.PUSH, createKey())); + } + + function replace(location) { + transitionTo(createLocation(location, _Actions.REPLACE, createKey())); + } + + function goBack() { + go(-1); + } + + function goForward() { + go(1); + } + + function createKey() { + return createRandomKey(keyLength); + } + + function createPath(location) { + if (location == null || typeof location === 'string') return location; + + var pathname = location.pathname; + var search = location.search; + var hash = location.hash; + + var result = pathname; + + if (search) result += search; + + if (hash) result += hash; + + return result; + } + + function createHref(location) { + return createPath(location); + } + + function createLocation(location, action) { + var key = arguments.length <= 2 || arguments[2] === undefined ? createKey() : arguments[2]; + + if (typeof action === 'object') { + process.env.NODE_ENV !== 'production' ? _warning2['default'](false, 'The state (2nd) argument to history.createLocation is deprecated; use a ' + 'location descriptor instead') : undefined; + + if (typeof location === 'string') location = _PathUtils.parsePath(location); + + location = _extends({}, location, { state: action }); + + action = key; + key = arguments[3] || createKey(); + } + + return _createLocation3['default'](location, action, key); + } + + // deprecated + function setState(state) { + if (location) { + updateLocationState(location, state); + updateLocation(location); + } else { + updateLocationState(getCurrentLocation(), state); + } + } + + function updateLocationState(location, state) { + location.state = _extends({}, location.state, state); + saveState(location.key, location.state); + } + + // deprecated + function registerTransitionHook(hook) { + if (transitionHooks.indexOf(hook) === -1) transitionHooks.push(hook); + } + + // deprecated + function unregisterTransitionHook(hook) { + transitionHooks = transitionHooks.filter(function (item) { + return item !== hook; + }); + } + + // deprecated + function pushState(state, path) { + if (typeof path === 'string') path = _PathUtils.parsePath(path); + + push(_extends({ state: state }, path)); + } + + // deprecated + function replaceState(state, path) { + if (typeof path === 'string') path = _PathUtils.parsePath(path); + + replace(_extends({ state: state }, path)); + } + + return { + listenBefore: listenBefore, + listen: listen, + transitionTo: transitionTo, + push: push, + replace: replace, + go: go, + goBack: goBack, + goForward: goForward, + createKey: createKey, + createPath: createPath, + createHref: createHref, + createLocation: createLocation, + + setState: _deprecate2['default'](setState, 'setState is deprecated; use location.key to save state instead'), + registerTransitionHook: _deprecate2['default'](registerTransitionHook, 'registerTransitionHook is deprecated; use listenBefore instead'), + unregisterTransitionHook: _deprecate2['default'](unregisterTransitionHook, 'unregisterTransitionHook is deprecated; use the callback returned from listenBefore instead'), + pushState: _deprecate2['default'](pushState, 'pushState is deprecated; use push instead'), + replaceState: _deprecate2['default'](replaceState, 'replaceState is deprecated; use replace instead') + }; +} + +exports['default'] = createHistory; +module.exports = exports['default']; +}).call(this,require('_process')) + +},{"./Actions":7,"./AsyncUtils":8,"./PathUtils":12,"./createLocation":17,"./deprecate":19,"./runTransitionHook":22,"_process":40,"deep-equal":2,"warning":26}],17:[function(require,module,exports){ +(function (process){ +'use strict'; + +exports.__esModule = true; + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } + +var _warning = require('warning'); + +var _warning2 = _interopRequireDefault(_warning); + +var _Actions = require('./Actions'); + +var _PathUtils = require('./PathUtils'); + +function createLocation() { + var location = arguments.length <= 0 || arguments[0] === undefined ? '/' : arguments[0]; + var action = arguments.length <= 1 || arguments[1] === undefined ? _Actions.POP : arguments[1]; + var key = arguments.length <= 2 || arguments[2] === undefined ? null : arguments[2]; + + var _fourthArg = arguments.length <= 3 || arguments[3] === undefined ? null : arguments[3]; + + if (typeof location === 'string') location = _PathUtils.parsePath(location); + + if (typeof action === 'object') { + process.env.NODE_ENV !== 'production' ? _warning2['default'](false, 'The state (2nd) argument to createLocation is deprecated; use a ' + 'location descriptor instead') : undefined; + + location = _extends({}, location, { state: action }); + + action = key || _Actions.POP; + key = _fourthArg; + } + + var pathname = location.pathname || '/'; + var search = location.search || ''; + var hash = location.hash || ''; + var state = location.state || null; + + return { + pathname: pathname, + search: search, + hash: hash, + state: state, + action: action, + key: key + }; +} + +exports['default'] = createLocation; +module.exports = exports['default']; +}).call(this,require('_process')) + +},{"./Actions":7,"./PathUtils":12,"_process":40,"warning":26}],18:[function(require,module,exports){ +(function (process){ +'use strict'; + +exports.__esModule = true; + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } + +var _warning = require('warning'); + +var _warning2 = _interopRequireDefault(_warning); + +var _invariant = require('invariant'); + +var _invariant2 = _interopRequireDefault(_invariant); + +var _PathUtils = require('./PathUtils'); + +var _Actions = require('./Actions'); + +var _createHistory = require('./createHistory'); + +var _createHistory2 = _interopRequireDefault(_createHistory); + +function createStateStorage(entries) { + return entries.filter(function (entry) { + return entry.state; + }).reduce(function (memo, entry) { + memo[entry.key] = entry.state; + return memo; + }, {}); +} + +function createMemoryHistory() { + var options = arguments.length <= 0 || arguments[0] === undefined ? {} : arguments[0]; + + if (Array.isArray(options)) { + options = { entries: options }; + } else if (typeof options === 'string') { + options = { entries: [options] }; + } + + var history = _createHistory2['default'](_extends({}, options, { + getCurrentLocation: getCurrentLocation, + finishTransition: finishTransition, + saveState: saveState, + go: go + })); + + var _options = options; + var entries = _options.entries; + var current = _options.current; + + if (typeof entries === 'string') { + entries = [entries]; + } else if (!Array.isArray(entries)) { + entries = ['/']; + } + + entries = entries.map(function (entry) { + var key = history.createKey(); + + if (typeof entry === 'string') return { pathname: entry, key: key }; + + if (typeof entry === 'object' && entry) return _extends({}, entry, { key: key }); + + !false ? process.env.NODE_ENV !== 'production' ? _invariant2['default'](false, 'Unable to create history entry from %s', entry) : _invariant2['default'](false) : undefined; + }); + + if (current == null) { + current = entries.length - 1; + } else { + !(current >= 0 && current < entries.length) ? process.env.NODE_ENV !== 'production' ? _invariant2['default'](false, 'Current index must be >= 0 and < %s, was %s', entries.length, current) : _invariant2['default'](false) : undefined; + } + + var storage = createStateStorage(entries); + + function saveState(key, state) { + storage[key] = state; + } + + function readState(key) { + return storage[key]; + } + + function getCurrentLocation() { + var entry = entries[current]; + var basename = entry.basename; + var pathname = entry.pathname; + var search = entry.search; + + var path = (basename || '') + pathname + (search || ''); + + var key = undefined, + state = undefined; + if (entry.key) { + key = entry.key; + state = readState(key); + } else { + key = history.createKey(); + state = null; + entry.key = key; + } + + var location = _PathUtils.parsePath(path); + + return history.createLocation(_extends({}, location, { state: state }), undefined, key); + } + + function canGo(n) { + var index = current + n; + return index >= 0 && index < entries.length; + } + + function go(n) { + if (n) { + if (!canGo(n)) { + process.env.NODE_ENV !== 'production' ? _warning2['default'](false, 'Cannot go(%s) there is not enough history', n) : undefined; + return; + } + + current += n; + + var currentLocation = getCurrentLocation(); + + // change action to POP + history.transitionTo(_extends({}, currentLocation, { action: _Actions.POP })); + } + } + + function finishTransition(location) { + switch (location.action) { + case _Actions.PUSH: + current += 1; + + // if we are not on the top of stack + // remove rest and push new + if (current < entries.length) entries.splice(current); + + entries.push(location); + saveState(location.key, location.state); + break; + case _Actions.REPLACE: + entries[current] = location; + saveState(location.key, location.state); + break; + } + } + + return history; +} + +exports['default'] = createMemoryHistory; +module.exports = exports['default']; +}).call(this,require('_process')) + +},{"./Actions":7,"./PathUtils":12,"./createHistory":16,"_process":40,"invariant":28,"warning":26}],19:[function(require,module,exports){ +(function (process){ +'use strict'; + +exports.__esModule = true; + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } + +var _warning = require('warning'); + +var _warning2 = _interopRequireDefault(_warning); + +function deprecate(fn, message) { + return function () { + process.env.NODE_ENV !== 'production' ? _warning2['default'](false, '[history] ' + message) : undefined; + return fn.apply(this, arguments); + }; +} + +exports['default'] = deprecate; +module.exports = exports['default']; +}).call(this,require('_process')) + +},{"_process":40,"warning":26}],20:[function(require,module,exports){ +'use strict'; + +exports.__esModule = true; + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } + +var _deprecate = require('./deprecate'); + +var _deprecate2 = _interopRequireDefault(_deprecate); + +var _useBeforeUnload = require('./useBeforeUnload'); + +var _useBeforeUnload2 = _interopRequireDefault(_useBeforeUnload); + +exports['default'] = _deprecate2['default'](_useBeforeUnload2['default'], 'enableBeforeUnload is deprecated, use useBeforeUnload instead'); +module.exports = exports['default']; +},{"./deprecate":19,"./useBeforeUnload":24}],21:[function(require,module,exports){ +'use strict'; + +exports.__esModule = true; + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } + +var _deprecate = require('./deprecate'); + +var _deprecate2 = _interopRequireDefault(_deprecate); + +var _useQueries = require('./useQueries'); + +var _useQueries2 = _interopRequireDefault(_useQueries); + +exports['default'] = _deprecate2['default'](_useQueries2['default'], 'enableQueries is deprecated, use useQueries instead'); +module.exports = exports['default']; +},{"./deprecate":19,"./useQueries":25}],22:[function(require,module,exports){ +(function (process){ +'use strict'; + +exports.__esModule = true; + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } + +var _warning = require('warning'); + +var _warning2 = _interopRequireDefault(_warning); + +function runTransitionHook(hook, location, callback) { + var result = hook(location, callback); + + if (hook.length < 2) { + // Assume the hook runs synchronously and automatically + // call the callback with the return value. + callback(result); + } else { + process.env.NODE_ENV !== 'production' ? _warning2['default'](result === undefined, 'You should not "return" in a transition hook with a callback argument; call the callback instead') : undefined; + } +} + +exports['default'] = runTransitionHook; +module.exports = exports['default']; +}).call(this,require('_process')) + +},{"_process":40,"warning":26}],23:[function(require,module,exports){ +(function (process){ +'use strict'; + +exports.__esModule = true; + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } + +var _warning = require('warning'); + +var _warning2 = _interopRequireDefault(_warning); + +var _ExecutionEnvironment = require('./ExecutionEnvironment'); + +var _PathUtils = require('./PathUtils'); + +var _runTransitionHook = require('./runTransitionHook'); + +var _runTransitionHook2 = _interopRequireDefault(_runTransitionHook); + +var _deprecate = require('./deprecate'); + +var _deprecate2 = _interopRequireDefault(_deprecate); + +function useBasename(createHistory) { + return function () { + var options = arguments.length <= 0 || arguments[0] === undefined ? {} : arguments[0]; + + var history = createHistory(options); + + var basename = options.basename; + + var checkedBaseHref = false; + + function checkBaseHref() { + if (checkedBaseHref) { + return; + } + + // Automatically use the value of in HTML + // documents as basename if it's not explicitly given. + if (basename == null && _ExecutionEnvironment.canUseDOM) { + var base = document.getElementsByTagName('base')[0]; + var baseHref = base && base.getAttribute('href'); + + if (baseHref != null) { + basename = baseHref; + + process.env.NODE_ENV !== 'production' ? _warning2['default'](false, 'Automatically setting basename using is deprecated and will ' + 'be removed in the next major release. The semantics of are ' + 'subtly different from basename. Please pass the basename explicitly in ' + 'the options to createHistory') : undefined; + } + } + + checkedBaseHref = true; + } + + function addBasename(location) { + checkBaseHref(); + + if (basename && location.basename == null) { + if (location.pathname.indexOf(basename) === 0) { + location.pathname = location.pathname.substring(basename.length); + location.basename = basename; + + if (location.pathname === '') location.pathname = '/'; + } else { + location.basename = ''; + } + } + + return location; + } + + function prependBasename(location) { + checkBaseHref(); + + if (!basename) return location; + + if (typeof location === 'string') location = _PathUtils.parsePath(location); + + var pname = location.pathname; + var normalizedBasename = basename.slice(-1) === '/' ? basename : basename + '/'; + var normalizedPathname = pname.charAt(0) === '/' ? pname.slice(1) : pname; + var pathname = normalizedBasename + normalizedPathname; + + return _extends({}, location, { + pathname: pathname + }); + } + + // Override all read methods with basename-aware versions. + function listenBefore(hook) { + return history.listenBefore(function (location, callback) { + _runTransitionHook2['default'](hook, addBasename(location), callback); + }); + } + + function listen(listener) { + return history.listen(function (location) { + listener(addBasename(location)); + }); + } + + // Override all write methods with basename-aware versions. + function push(location) { + history.push(prependBasename(location)); + } + + function replace(location) { + history.replace(prependBasename(location)); + } + + function createPath(location) { + return history.createPath(prependBasename(location)); + } + + function createHref(location) { + return history.createHref(prependBasename(location)); + } + + function createLocation(location) { + for (var _len = arguments.length, args = Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) { + args[_key - 1] = arguments[_key]; + } + + return addBasename(history.createLocation.apply(history, [prependBasename(location)].concat(args))); + } + + // deprecated + function pushState(state, path) { + if (typeof path === 'string') path = _PathUtils.parsePath(path); + + push(_extends({ state: state }, path)); + } + + // deprecated + function replaceState(state, path) { + if (typeof path === 'string') path = _PathUtils.parsePath(path); + + replace(_extends({ state: state }, path)); + } + + return _extends({}, history, { + listenBefore: listenBefore, + listen: listen, + push: push, + replace: replace, + createPath: createPath, + createHref: createHref, + createLocation: createLocation, + + pushState: _deprecate2['default'](pushState, 'pushState is deprecated; use push instead'), + replaceState: _deprecate2['default'](replaceState, 'replaceState is deprecated; use replace instead') + }); + }; +} + +exports['default'] = useBasename; +module.exports = exports['default']; +}).call(this,require('_process')) + +},{"./ExecutionEnvironment":11,"./PathUtils":12,"./deprecate":19,"./runTransitionHook":22,"_process":40,"warning":26}],24:[function(require,module,exports){ +(function (process){ +'use strict'; + +exports.__esModule = true; + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } + +var _warning = require('warning'); + +var _warning2 = _interopRequireDefault(_warning); + +var _ExecutionEnvironment = require('./ExecutionEnvironment'); + +var _DOMUtils = require('./DOMUtils'); + +var _deprecate = require('./deprecate'); + +var _deprecate2 = _interopRequireDefault(_deprecate); + +function startBeforeUnloadListener(getBeforeUnloadPromptMessage) { + function listener(event) { + var message = getBeforeUnloadPromptMessage(); + + if (typeof message === 'string') { + (event || window.event).returnValue = message; + return message; + } + } + + _DOMUtils.addEventListener(window, 'beforeunload', listener); + + return function () { + _DOMUtils.removeEventListener(window, 'beforeunload', listener); + }; +} + +/** + * Returns a new createHistory function that can be used to create + * history objects that know how to use the beforeunload event in web + * browsers to cancel navigation. + */ +function useBeforeUnload(createHistory) { + return function (options) { + var history = createHistory(options); + + var stopBeforeUnloadListener = undefined; + var beforeUnloadHooks = []; + + function getBeforeUnloadPromptMessage() { + var message = undefined; + + for (var i = 0, len = beforeUnloadHooks.length; message == null && i < len; ++i) { + message = beforeUnloadHooks[i].call(); + }return message; + } + + function listenBeforeUnload(hook) { + beforeUnloadHooks.push(hook); + + if (beforeUnloadHooks.length === 1) { + if (_ExecutionEnvironment.canUseDOM) { + stopBeforeUnloadListener = startBeforeUnloadListener(getBeforeUnloadPromptMessage); + } else { + process.env.NODE_ENV !== 'production' ? _warning2['default'](false, 'listenBeforeUnload only works in DOM environments') : undefined; + } + } + + return function () { + beforeUnloadHooks = beforeUnloadHooks.filter(function (item) { + return item !== hook; + }); + + if (beforeUnloadHooks.length === 0 && stopBeforeUnloadListener) { + stopBeforeUnloadListener(); + stopBeforeUnloadListener = null; + } + }; + } + + // deprecated + function registerBeforeUnloadHook(hook) { + if (_ExecutionEnvironment.canUseDOM && beforeUnloadHooks.indexOf(hook) === -1) { + beforeUnloadHooks.push(hook); + + if (beforeUnloadHooks.length === 1) stopBeforeUnloadListener = startBeforeUnloadListener(getBeforeUnloadPromptMessage); + } + } + + // deprecated + function unregisterBeforeUnloadHook(hook) { + if (beforeUnloadHooks.length > 0) { + beforeUnloadHooks = beforeUnloadHooks.filter(function (item) { + return item !== hook; + }); + + if (beforeUnloadHooks.length === 0) stopBeforeUnloadListener(); + } + } + + return _extends({}, history, { + listenBeforeUnload: listenBeforeUnload, + + registerBeforeUnloadHook: _deprecate2['default'](registerBeforeUnloadHook, 'registerBeforeUnloadHook is deprecated; use listenBeforeUnload instead'), + unregisterBeforeUnloadHook: _deprecate2['default'](unregisterBeforeUnloadHook, 'unregisterBeforeUnloadHook is deprecated; use the callback returned from listenBeforeUnload instead') + }); + }; +} + +exports['default'] = useBeforeUnload; +module.exports = exports['default']; +}).call(this,require('_process')) + +},{"./DOMUtils":10,"./ExecutionEnvironment":11,"./deprecate":19,"_process":40,"warning":26}],25:[function(require,module,exports){ +(function (process){ +'use strict'; + +exports.__esModule = true; + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; } + +var _warning = require('warning'); + +var _warning2 = _interopRequireDefault(_warning); + +var _queryString = require('query-string'); + +var _runTransitionHook = require('./runTransitionHook'); + +var _runTransitionHook2 = _interopRequireDefault(_runTransitionHook); + +var _PathUtils = require('./PathUtils'); + +var _deprecate = require('./deprecate'); + +var _deprecate2 = _interopRequireDefault(_deprecate); + +var SEARCH_BASE_KEY = '$searchBase'; + +function defaultStringifyQuery(query) { + return _queryString.stringify(query).replace(/%20/g, '+'); +} + +var defaultParseQueryString = _queryString.parse; + +function isNestedObject(object) { + for (var p in object) { + if (Object.prototype.hasOwnProperty.call(object, p) && typeof object[p] === 'object' && !Array.isArray(object[p]) && object[p] !== null) return true; + }return false; +} + +/** + * Returns a new createHistory function that may be used to create + * history objects that know how to handle URL queries. + */ +function useQueries(createHistory) { + return function () { + var options = arguments.length <= 0 || arguments[0] === undefined ? {} : arguments[0]; + + var history = createHistory(options); + + var stringifyQuery = options.stringifyQuery; + var parseQueryString = options.parseQueryString; + + if (typeof stringifyQuery !== 'function') stringifyQuery = defaultStringifyQuery; + + if (typeof parseQueryString !== 'function') parseQueryString = defaultParseQueryString; + + function addQuery(location) { + if (location.query == null) { + var search = location.search; + + location.query = parseQueryString(search.substring(1)); + location[SEARCH_BASE_KEY] = { search: search, searchBase: '' }; + } + + // TODO: Instead of all the book-keeping here, this should just strip the + // stringified query from the search. + + return location; + } + + function appendQuery(location, query) { + var _extends2; + + var searchBaseSpec = location[SEARCH_BASE_KEY]; + var queryString = query ? stringifyQuery(query) : ''; + if (!searchBaseSpec && !queryString) { + return location; + } + + process.env.NODE_ENV !== 'production' ? _warning2['default'](stringifyQuery !== defaultStringifyQuery || !isNestedObject(query), 'useQueries does not stringify nested query objects by default; ' + 'use a custom stringifyQuery function') : undefined; + + if (typeof location === 'string') location = _PathUtils.parsePath(location); + + var searchBase = undefined; + if (searchBaseSpec && location.search === searchBaseSpec.search) { + searchBase = searchBaseSpec.searchBase; + } else { + searchBase = location.search || ''; + } + + var search = searchBase; + if (queryString) { + search += (search ? '&' : '?') + queryString; + } + + return _extends({}, location, (_extends2 = { + search: search + }, _extends2[SEARCH_BASE_KEY] = { search: search, searchBase: searchBase }, _extends2)); + } + + // Override all read methods with query-aware versions. + function listenBefore(hook) { + return history.listenBefore(function (location, callback) { + _runTransitionHook2['default'](hook, addQuery(location), callback); + }); + } + + function listen(listener) { + return history.listen(function (location) { + listener(addQuery(location)); + }); + } + + // Override all write methods with query-aware versions. + function push(location) { + history.push(appendQuery(location, location.query)); + } + + function replace(location) { + history.replace(appendQuery(location, location.query)); + } + + function createPath(location, query) { + process.env.NODE_ENV !== 'production' ? _warning2['default'](!query, 'the query argument to createPath is deprecated; use a location descriptor instead') : undefined; + + return history.createPath(appendQuery(location, query || location.query)); + } + + function createHref(location, query) { + process.env.NODE_ENV !== 'production' ? _warning2['default'](!query, 'the query argument to createHref is deprecated; use a location descriptor instead') : undefined; + + return history.createHref(appendQuery(location, query || location.query)); + } + + function createLocation(location) { + for (var _len = arguments.length, args = Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) { + args[_key - 1] = arguments[_key]; + } + + var fullLocation = history.createLocation.apply(history, [appendQuery(location, location.query)].concat(args)); + if (location.query) { + fullLocation.query = location.query; + } + return addQuery(fullLocation); + } + + // deprecated + function pushState(state, path, query) { + if (typeof path === 'string') path = _PathUtils.parsePath(path); + + push(_extends({ state: state }, path, { query: query })); + } + + // deprecated + function replaceState(state, path, query) { + if (typeof path === 'string') path = _PathUtils.parsePath(path); + + replace(_extends({ state: state }, path, { query: query })); + } + + return _extends({}, history, { + listenBefore: listenBefore, + listen: listen, + push: push, + replace: replace, + createPath: createPath, + createHref: createHref, + createLocation: createLocation, + + pushState: _deprecate2['default'](pushState, 'pushState is deprecated; use push instead'), + replaceState: _deprecate2['default'](replaceState, 'replaceState is deprecated; use replace instead') + }); + }; +} + +exports['default'] = useQueries; +module.exports = exports['default']; +}).call(this,require('_process')) + +},{"./PathUtils":12,"./deprecate":19,"./runTransitionHook":22,"_process":40,"query-string":41,"warning":26}],26:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2014-2015, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + */ + +'use strict'; + +/** + * Similar to invariant but only logs a warning if the condition is not met. + * This can be used to log issues in development environments in critical + * paths. Removing the logging code for production environments will keep the + * same logic and follow the same code paths. + */ + +var warning = function() {}; + +if (process.env.NODE_ENV !== 'production') { + warning = function(condition, format, args) { + var len = arguments.length; + args = new Array(len > 2 ? len - 2 : 0); + for (var key = 2; key < len; key++) { + args[key - 2] = arguments[key]; + } + if (format === undefined) { + throw new Error( + '`warning(condition, format, ...args)` requires a warning ' + + 'message argument' + ); + } + + if (format.length < 10 || (/^[s\W]*$/).test(format)) { + throw new Error( + 'The warning format should be able to uniquely identify this ' + + 'warning. Please, use a more descriptive format than: ' + format + ); + } + + if (!condition) { + var argIndex = 0; + var message = 'Warning: ' + + format.replace(/%s/g, function() { + return args[argIndex++]; + }); + if (typeof console !== 'undefined') { + console.error(message); + } + try { + // This error was thrown as a convenience so that you can use this stack + // to find the callsite that caused this warning to fire. + throw new Error(message); + } catch(x) {} + } + }; +} + +module.exports = warning; + +}).call(this,require('_process')) + +},{"_process":40}],27:[function(require,module,exports){ +/** + * Copyright 2015, Yahoo! Inc. + * Copyrights licensed under the New BSD License. See the accompanying LICENSE file for terms. + */ +'use strict'; + +var REACT_STATICS = { + childContextTypes: true, + contextTypes: true, + defaultProps: true, + displayName: true, + getDefaultProps: true, + mixins: true, + propTypes: true, + type: true +}; + +var KNOWN_STATICS = { + name: true, + length: true, + prototype: true, + caller: true, + arguments: true, + arity: true +}; + +var isGetOwnPropertySymbolsAvailable = typeof Object.getOwnPropertySymbols === 'function'; + +module.exports = function hoistNonReactStatics(targetComponent, sourceComponent, customStatics) { + if (typeof sourceComponent !== 'string') { // don't hoist over string (html) components + var keys = Object.getOwnPropertyNames(sourceComponent); + + /* istanbul ignore else */ + if (isGetOwnPropertySymbolsAvailable) { + keys = keys.concat(Object.getOwnPropertySymbols(sourceComponent)); + } + + for (var i = 0; i < keys.length; ++i) { + if (!REACT_STATICS[keys[i]] && !KNOWN_STATICS[keys[i]] && (!customStatics || !customStatics[keys[i]])) { + try { + targetComponent[keys[i]] = sourceComponent[keys[i]]; + } catch (error) { + + } + } + } + } + + return targetComponent; +}; + +},{}],28:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2013-2015, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + */ + +'use strict'; + +/** + * Use invariant() to assert state which your program assumes to be true. + * + * Provide sprintf-style format (only %s is supported) and arguments + * to provide information about what broke and what you were + * expecting. + * + * The invariant message will be stripped in production, but the invariant + * will remain to ensure logic does not differ in production. + */ + +var invariant = function(condition, format, a, b, c, d, e, f) { + if (process.env.NODE_ENV !== 'production') { + if (format === undefined) { + throw new Error('invariant requires an error message argument'); + } + } + + if (!condition) { + var error; + if (format === undefined) { + error = new Error( + 'Minified exception occurred; use the non-minified dev environment ' + + 'for the full error message and additional helpful warnings.' + ); + } else { + var args = [a, b, c, d, e, f]; + var argIndex = 0; + error = new Error( + format.replace(/%s/g, function() { return args[argIndex++]; }) + ); + error.name = 'Invariant Violation'; + } + + error.framesToPop = 1; // we don't care about invariant's own frame + throw error; + } +}; + +module.exports = invariant; + +}).call(this,require('_process')) + +},{"_process":40}],29:[function(require,module,exports){ +/** + * lodash 3.9.1 (Custom Build) + * Build: `lodash modern modularize exports="npm" -o ./` + * Copyright 2012-2015 The Dojo Foundation + * Based on Underscore.js 1.8.3 + * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + * Available under MIT license + */ + +/** `Object#toString` result references. */ +var funcTag = '[object Function]'; + +/** Used to detect host constructors (Safari > 5). */ +var reIsHostCtor = /^\[object .+?Constructor\]$/; + +/** + * Checks if `value` is object-like. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is object-like, else `false`. + */ +function isObjectLike(value) { + return !!value && typeof value == 'object'; +} + +/** Used for native method references. */ +var objectProto = Object.prototype; + +/** Used to resolve the decompiled source of functions. */ +var fnToString = Function.prototype.toString; + +/** Used to check objects for own properties. */ +var hasOwnProperty = objectProto.hasOwnProperty; + +/** + * Used to resolve the [`toStringTag`](http://ecma-international.org/ecma-262/6.0/#sec-object.prototype.tostring) + * of values. + */ +var objToString = objectProto.toString; + +/** Used to detect if a method is native. */ +var reIsNative = RegExp('^' + + fnToString.call(hasOwnProperty).replace(/[\\^$.*+?()[\]{}|]/g, '\\$&') + .replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$' +); + +/** + * Gets the native function at `key` of `object`. + * + * @private + * @param {Object} object The object to query. + * @param {string} key The key of the method to get. + * @returns {*} Returns the function if it's native, else `undefined`. + */ +function getNative(object, key) { + var value = object == null ? undefined : object[key]; + return isNative(value) ? value : undefined; +} + +/** + * Checks if `value` is classified as a `Function` object. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`. + * @example + * + * _.isFunction(_); + * // => true + * + * _.isFunction(/abc/); + * // => false + */ +function isFunction(value) { + // The use of `Object#toString` avoids issues with the `typeof` operator + // in older versions of Chrome and Safari which return 'function' for regexes + // and Safari 8 equivalents which return 'object' for typed array constructors. + return isObject(value) && objToString.call(value) == funcTag; +} + +/** + * Checks if `value` is the [language type](https://es5.github.io/#x8) of `Object`. + * (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an object, else `false`. + * @example + * + * _.isObject({}); + * // => true + * + * _.isObject([1, 2, 3]); + * // => true + * + * _.isObject(1); + * // => false + */ +function isObject(value) { + // Avoid a V8 JIT bug in Chrome 19-20. + // See https://code.google.com/p/v8/issues/detail?id=2291 for more details. + var type = typeof value; + return !!value && (type == 'object' || type == 'function'); +} + +/** + * Checks if `value` is a native function. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a native function, else `false`. + * @example + * + * _.isNative(Array.prototype.push); + * // => true + * + * _.isNative(_); + * // => false + */ +function isNative(value) { + if (value == null) { + return false; + } + if (isFunction(value)) { + return reIsNative.test(fnToString.call(value)); + } + return isObjectLike(value) && reIsHostCtor.test(value); +} + +module.exports = getNative; + +},{}],30:[function(require,module,exports){ +/** + * lodash (Custom Build) + * Build: `lodash modularize exports="npm" -o ./` + * Copyright jQuery Foundation and other contributors + * Released under MIT license + * Based on Underscore.js 1.8.3 + * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + */ + +/** Used as the `TypeError` message for "Functions" methods. */ +var FUNC_ERROR_TEXT = 'Expected a function'; + +/** Used as references for various `Number` constants. */ +var NAN = 0 / 0; + +/** `Object#toString` result references. */ +var funcTag = '[object Function]', + genTag = '[object GeneratorFunction]', + symbolTag = '[object Symbol]'; + +/** Used to match leading and trailing whitespace. */ +var reTrim = /^\s+|\s+$/g; + +/** Used to detect bad signed hexadecimal string values. */ +var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; + +/** Used to detect binary string values. */ +var reIsBinary = /^0b[01]+$/i; + +/** Used to detect octal string values. */ +var reIsOctal = /^0o[0-7]+$/i; + +/** Built-in method references without a dependency on `root`. */ +var freeParseInt = parseInt; + +/** Used for built-in method references. */ +var objectProto = Object.prototype; + +/** + * Used to resolve the + * [`toStringTag`](http://ecma-international.org/ecma-262/6.0/#sec-object.prototype.tostring) + * of values. + */ +var objectToString = objectProto.toString; + +/* Built-in method references for those with the same name as other `lodash` methods. */ +var nativeMax = Math.max, + nativeMin = Math.min; + +/** + * Gets the timestamp of the number of milliseconds that have elapsed since + * the Unix epoch (1 January 1970 00:00:00 UTC). + * + * @static + * @memberOf _ + * @since 2.4.0 + * @category Date + * @returns {number} Returns the timestamp. + * @example + * + * _.defer(function(stamp) { + * console.log(_.now() - stamp); + * }, _.now()); + * // => Logs the number of milliseconds it took for the deferred invocation. + */ +function now() { + return Date.now(); +} + +/** + * Creates a debounced function that delays invoking `func` until after `wait` + * milliseconds have elapsed since the last time the debounced function was + * invoked. The debounced function comes with a `cancel` method to cancel + * delayed `func` invocations and a `flush` method to immediately invoke them. + * Provide an options object to indicate whether `func` should be invoked on + * the leading and/or trailing edge of the `wait` timeout. The `func` is invoked + * with the last arguments provided to the debounced function. Subsequent calls + * to the debounced function return the result of the last `func` invocation. + * + * **Note:** If `leading` and `trailing` options are `true`, `func` is invoked + * on the trailing edge of the timeout only if the debounced function is + * invoked more than once during the `wait` timeout. + * + * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) + * for details over the differences between `_.debounce` and `_.throttle`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to debounce. + * @param {number} [wait=0] The number of milliseconds to delay. + * @param {Object} [options={}] The options object. + * @param {boolean} [options.leading=false] + * Specify invoking on the leading edge of the timeout. + * @param {number} [options.maxWait] + * The maximum time `func` is allowed to be delayed before it's invoked. + * @param {boolean} [options.trailing=true] + * Specify invoking on the trailing edge of the timeout. + * @returns {Function} Returns the new debounced function. + * @example + * + * // Avoid costly calculations while the window size is in flux. + * jQuery(window).on('resize', _.debounce(calculateLayout, 150)); + * + * // Invoke `sendMail` when clicked, debouncing subsequent calls. + * jQuery(element).on('click', _.debounce(sendMail, 300, { + * 'leading': true, + * 'trailing': false + * })); + * + * // Ensure `batchLog` is invoked once after 1 second of debounced calls. + * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 }); + * var source = new EventSource('/stream'); + * jQuery(source).on('message', debounced); + * + * // Cancel the trailing debounced invocation. + * jQuery(window).on('popstate', debounced.cancel); + */ +function debounce(func, wait, options) { + var lastArgs, + lastThis, + maxWait, + result, + timerId, + lastCallTime, + lastInvokeTime = 0, + leading = false, + maxing = false, + trailing = true; + + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + wait = toNumber(wait) || 0; + if (isObject(options)) { + leading = !!options.leading; + maxing = 'maxWait' in options; + maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait; + trailing = 'trailing' in options ? !!options.trailing : trailing; + } + + function invokeFunc(time) { + var args = lastArgs, + thisArg = lastThis; + + lastArgs = lastThis = undefined; + lastInvokeTime = time; + result = func.apply(thisArg, args); + return result; + } + + function leadingEdge(time) { + // Reset any `maxWait` timer. + lastInvokeTime = time; + // Start the timer for the trailing edge. + timerId = setTimeout(timerExpired, wait); + // Invoke the leading edge. + return leading ? invokeFunc(time) : result; + } + + function remainingWait(time) { + var timeSinceLastCall = time - lastCallTime, + timeSinceLastInvoke = time - lastInvokeTime, + result = wait - timeSinceLastCall; + + return maxing ? nativeMin(result, maxWait - timeSinceLastInvoke) : result; + } + + function shouldInvoke(time) { + var timeSinceLastCall = time - lastCallTime, + timeSinceLastInvoke = time - lastInvokeTime; + + // Either this is the first call, activity has stopped and we're at the + // trailing edge, the system time has gone backwards and we're treating + // it as the trailing edge, or we've hit the `maxWait` limit. + return (lastCallTime === undefined || (timeSinceLastCall >= wait) || + (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait)); + } + + function timerExpired() { + var time = now(); + if (shouldInvoke(time)) { + return trailingEdge(time); + } + // Restart the timer. + timerId = setTimeout(timerExpired, remainingWait(time)); + } + + function trailingEdge(time) { + timerId = undefined; + + // Only invoke if we have `lastArgs` which means `func` has been + // debounced at least once. + if (trailing && lastArgs) { + return invokeFunc(time); + } + lastArgs = lastThis = undefined; + return result; + } + + function cancel() { + if (timerId !== undefined) { + clearTimeout(timerId); + } + lastInvokeTime = 0; + lastArgs = lastCallTime = lastThis = timerId = undefined; + } + + function flush() { + return timerId === undefined ? result : trailingEdge(now()); + } + + function debounced() { + var time = now(), + isInvoking = shouldInvoke(time); + + lastArgs = arguments; + lastThis = this; + lastCallTime = time; + + if (isInvoking) { + if (timerId === undefined) { + return leadingEdge(lastCallTime); + } + if (maxing) { + // Handle invocations in a tight loop. + timerId = setTimeout(timerExpired, wait); + return invokeFunc(lastCallTime); + } + } + if (timerId === undefined) { + timerId = setTimeout(timerExpired, wait); + } + return result; + } + debounced.cancel = cancel; + debounced.flush = flush; + return debounced; +} + +/** + * Checks if `value` is classified as a `Function` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a function, else `false`. + * @example + * + * _.isFunction(_); + * // => true + * + * _.isFunction(/abc/); + * // => false + */ +function isFunction(value) { + // The use of `Object#toString` avoids issues with the `typeof` operator + // in Safari 8 which returns 'object' for typed array and weak map constructors, + // and PhantomJS 1.9 which returns 'function' for `NodeList` instances. + var tag = isObject(value) ? objectToString.call(value) : ''; + return tag == funcTag || tag == genTag; +} + +/** + * Checks if `value` is the + * [language type](http://www.ecma-international.org/ecma-262/6.0/#sec-ecmascript-language-types) + * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an object, else `false`. + * @example + * + * _.isObject({}); + * // => true + * + * _.isObject([1, 2, 3]); + * // => true + * + * _.isObject(_.noop); + * // => true + * + * _.isObject(null); + * // => false + */ +function isObject(value) { + var type = typeof value; + return !!value && (type == 'object' || type == 'function'); +} + +/** + * Checks if `value` is object-like. A value is object-like if it's not `null` + * and has a `typeof` result of "object". + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is object-like, else `false`. + * @example + * + * _.isObjectLike({}); + * // => true + * + * _.isObjectLike([1, 2, 3]); + * // => true + * + * _.isObjectLike(_.noop); + * // => false + * + * _.isObjectLike(null); + * // => false + */ +function isObjectLike(value) { + return !!value && typeof value == 'object'; +} + +/** + * Checks if `value` is classified as a `Symbol` primitive or object. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a symbol, else `false`. + * @example + * + * _.isSymbol(Symbol.iterator); + * // => true + * + * _.isSymbol('abc'); + * // => false + */ +function isSymbol(value) { + return typeof value == 'symbol' || + (isObjectLike(value) && objectToString.call(value) == symbolTag); +} + +/** + * Converts `value` to a number. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to process. + * @returns {number} Returns the number. + * @example + * + * _.toNumber(3.2); + * // => 3.2 + * + * _.toNumber(Number.MIN_VALUE); + * // => 5e-324 + * + * _.toNumber(Infinity); + * // => Infinity + * + * _.toNumber('3.2'); + * // => 3.2 + */ +function toNumber(value) { + if (typeof value == 'number') { + return value; + } + if (isSymbol(value)) { + return NAN; + } + if (isObject(value)) { + var other = isFunction(value.valueOf) ? value.valueOf() : value; + value = isObject(other) ? (other + '') : other; + } + if (typeof value != 'string') { + return value === 0 ? value : +value; + } + value = value.replace(reTrim, ''); + var isBinary = reIsBinary.test(value); + return (isBinary || reIsOctal.test(value)) + ? freeParseInt(value.slice(2), isBinary ? 2 : 8) + : (reIsBadHex.test(value) ? NAN : +value); +} + +module.exports = debounce; + +},{}],31:[function(require,module,exports){ +/** + * lodash (Custom Build) + * Build: `lodash modularize exports="npm" -o ./` + * Copyright jQuery Foundation and other contributors + * Released under MIT license + * Based on Underscore.js 1.8.3 + * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + */ + +/** Used as references for various `Number` constants. */ +var MAX_SAFE_INTEGER = 9007199254740991; + +/** `Object#toString` result references. */ +var argsTag = '[object Arguments]', + funcTag = '[object Function]', + genTag = '[object GeneratorFunction]'; + +/** + * The base implementation of `_.property` without support for deep paths. + * + * @private + * @param {string} key The key of the property to get. + * @returns {Function} Returns the new accessor function. + */ +function baseProperty(key) { + return function(object) { + return object == null ? undefined : object[key]; + }; +} + +/** Used for built-in method references. */ +var objectProto = Object.prototype; + +/** Used to check objects for own properties. */ +var hasOwnProperty = objectProto.hasOwnProperty; + +/** + * Used to resolve the + * [`toStringTag`](http://ecma-international.org/ecma-262/6.0/#sec-object.prototype.tostring) + * of values. + */ +var objectToString = objectProto.toString; + +/** Built-in value references. */ +var propertyIsEnumerable = objectProto.propertyIsEnumerable; + +/** + * Gets the "length" property value of `object`. + * + * **Note:** This function is used to avoid a + * [JIT bug](https://bugs.webkit.org/show_bug.cgi?id=142792) that affects + * Safari on at least iOS 8.1-8.3 ARM64. + * + * @private + * @param {Object} object The object to query. + * @returns {*} Returns the "length" value. + */ +var getLength = baseProperty('length'); + +/** + * Checks if `value` is likely an `arguments` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an `arguments` object, + * else `false`. + * @example + * + * _.isArguments(function() { return arguments; }()); + * // => true + * + * _.isArguments([1, 2, 3]); + * // => false + */ +function isArguments(value) { + // Safari 8.1 incorrectly makes `arguments.callee` enumerable in strict mode. + return isArrayLikeObject(value) && hasOwnProperty.call(value, 'callee') && + (!propertyIsEnumerable.call(value, 'callee') || objectToString.call(value) == argsTag); +} + +/** + * Checks if `value` is array-like. A value is considered array-like if it's + * not a function and has a `value.length` that's an integer greater than or + * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is array-like, else `false`. + * @example + * + * _.isArrayLike([1, 2, 3]); + * // => true + * + * _.isArrayLike(document.body.children); + * // => true + * + * _.isArrayLike('abc'); + * // => true + * + * _.isArrayLike(_.noop); + * // => false + */ +function isArrayLike(value) { + return value != null && isLength(getLength(value)) && !isFunction(value); +} + +/** + * This method is like `_.isArrayLike` except that it also checks if `value` + * is an object. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an array-like object, + * else `false`. + * @example + * + * _.isArrayLikeObject([1, 2, 3]); + * // => true + * + * _.isArrayLikeObject(document.body.children); + * // => true + * + * _.isArrayLikeObject('abc'); + * // => false + * + * _.isArrayLikeObject(_.noop); + * // => false + */ +function isArrayLikeObject(value) { + return isObjectLike(value) && isArrayLike(value); +} + +/** + * Checks if `value` is classified as a `Function` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a function, else `false`. + * @example + * + * _.isFunction(_); + * // => true + * + * _.isFunction(/abc/); + * // => false + */ +function isFunction(value) { + // The use of `Object#toString` avoids issues with the `typeof` operator + // in Safari 8 which returns 'object' for typed array and weak map constructors, + // and PhantomJS 1.9 which returns 'function' for `NodeList` instances. + var tag = isObject(value) ? objectToString.call(value) : ''; + return tag == funcTag || tag == genTag; +} + +/** + * Checks if `value` is a valid array-like length. + * + * **Note:** This function is loosely based on + * [`ToLength`](http://ecma-international.org/ecma-262/6.0/#sec-tolength). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a valid length, + * else `false`. + * @example + * + * _.isLength(3); + * // => true + * + * _.isLength(Number.MIN_VALUE); + * // => false + * + * _.isLength(Infinity); + * // => false + * + * _.isLength('3'); + * // => false + */ +function isLength(value) { + return typeof value == 'number' && + value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER; +} + +/** + * Checks if `value` is the + * [language type](http://www.ecma-international.org/ecma-262/6.0/#sec-ecmascript-language-types) + * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an object, else `false`. + * @example + * + * _.isObject({}); + * // => true + * + * _.isObject([1, 2, 3]); + * // => true + * + * _.isObject(_.noop); + * // => true + * + * _.isObject(null); + * // => false + */ +function isObject(value) { + var type = typeof value; + return !!value && (type == 'object' || type == 'function'); +} + +/** + * Checks if `value` is object-like. A value is object-like if it's not `null` + * and has a `typeof` result of "object". + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is object-like, else `false`. + * @example + * + * _.isObjectLike({}); + * // => true + * + * _.isObjectLike([1, 2, 3]); + * // => true + * + * _.isObjectLike(_.noop); + * // => false + * + * _.isObjectLike(null); + * // => false + */ +function isObjectLike(value) { + return !!value && typeof value == 'object'; +} + +module.exports = isArguments; + +},{}],32:[function(require,module,exports){ +/** + * lodash 3.0.4 (Custom Build) + * Build: `lodash modern modularize exports="npm" -o ./` + * Copyright 2012-2015 The Dojo Foundation + * Based on Underscore.js 1.8.3 + * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + * Available under MIT license + */ + +/** `Object#toString` result references. */ +var arrayTag = '[object Array]', + funcTag = '[object Function]'; + +/** Used to detect host constructors (Safari > 5). */ +var reIsHostCtor = /^\[object .+?Constructor\]$/; + +/** + * Checks if `value` is object-like. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is object-like, else `false`. + */ +function isObjectLike(value) { + return !!value && typeof value == 'object'; +} + +/** Used for native method references. */ +var objectProto = Object.prototype; + +/** Used to resolve the decompiled source of functions. */ +var fnToString = Function.prototype.toString; + +/** Used to check objects for own properties. */ +var hasOwnProperty = objectProto.hasOwnProperty; + +/** + * Used to resolve the [`toStringTag`](http://ecma-international.org/ecma-262/6.0/#sec-object.prototype.tostring) + * of values. + */ +var objToString = objectProto.toString; + +/** Used to detect if a method is native. */ +var reIsNative = RegExp('^' + + fnToString.call(hasOwnProperty).replace(/[\\^$.*+?()[\]{}|]/g, '\\$&') + .replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$' +); + +/* Native method references for those with the same name as other `lodash` methods. */ +var nativeIsArray = getNative(Array, 'isArray'); + +/** + * Used as the [maximum length](http://ecma-international.org/ecma-262/6.0/#sec-number.max_safe_integer) + * of an array-like value. + */ +var MAX_SAFE_INTEGER = 9007199254740991; + +/** + * Gets the native function at `key` of `object`. + * + * @private + * @param {Object} object The object to query. + * @param {string} key The key of the method to get. + * @returns {*} Returns the function if it's native, else `undefined`. + */ +function getNative(object, key) { + var value = object == null ? undefined : object[key]; + return isNative(value) ? value : undefined; +} + +/** + * Checks if `value` is a valid array-like length. + * + * **Note:** This function is based on [`ToLength`](http://ecma-international.org/ecma-262/6.0/#sec-tolength). + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a valid length, else `false`. + */ +function isLength(value) { + return typeof value == 'number' && value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER; +} + +/** + * Checks if `value` is classified as an `Array` object. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`. + * @example + * + * _.isArray([1, 2, 3]); + * // => true + * + * _.isArray(function() { return arguments; }()); + * // => false + */ +var isArray = nativeIsArray || function(value) { + return isObjectLike(value) && isLength(value.length) && objToString.call(value) == arrayTag; +}; + +/** + * Checks if `value` is classified as a `Function` object. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`. + * @example + * + * _.isFunction(_); + * // => true + * + * _.isFunction(/abc/); + * // => false + */ +function isFunction(value) { + // The use of `Object#toString` avoids issues with the `typeof` operator + // in older versions of Chrome and Safari which return 'function' for regexes + // and Safari 8 equivalents which return 'object' for typed array constructors. + return isObject(value) && objToString.call(value) == funcTag; +} + +/** + * Checks if `value` is the [language type](https://es5.github.io/#x8) of `Object`. + * (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an object, else `false`. + * @example + * + * _.isObject({}); + * // => true + * + * _.isObject([1, 2, 3]); + * // => true + * + * _.isObject(1); + * // => false + */ +function isObject(value) { + // Avoid a V8 JIT bug in Chrome 19-20. + // See https://code.google.com/p/v8/issues/detail?id=2291 for more details. + var type = typeof value; + return !!value && (type == 'object' || type == 'function'); +} + +/** + * Checks if `value` is a native function. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a native function, else `false`. + * @example + * + * _.isNative(Array.prototype.push); + * // => true + * + * _.isNative(_); + * // => false + */ +function isNative(value) { + if (value == null) { + return false; + } + if (isFunction(value)) { + return reIsNative.test(fnToString.call(value)); + } + return isObjectLike(value) && reIsHostCtor.test(value); +} + +module.exports = isArray; + +},{}],33:[function(require,module,exports){ +/** + * lodash 3.1.2 (Custom Build) + * Build: `lodash modern modularize exports="npm" -o ./` + * Copyright 2012-2015 The Dojo Foundation + * Based on Underscore.js 1.8.3 + * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + * Available under MIT license + */ +var getNative = require('lodash._getnative'), + isArguments = require('lodash.isarguments'), + isArray = require('lodash.isarray'); + +/** Used to detect unsigned integer values. */ +var reIsUint = /^\d+$/; + +/** Used for native method references. */ +var objectProto = Object.prototype; + +/** Used to check objects for own properties. */ +var hasOwnProperty = objectProto.hasOwnProperty; + +/* Native method references for those with the same name as other `lodash` methods. */ +var nativeKeys = getNative(Object, 'keys'); + +/** + * Used as the [maximum length](http://ecma-international.org/ecma-262/6.0/#sec-number.max_safe_integer) + * of an array-like value. + */ +var MAX_SAFE_INTEGER = 9007199254740991; + +/** + * The base implementation of `_.property` without support for deep paths. + * + * @private + * @param {string} key The key of the property to get. + * @returns {Function} Returns the new function. + */ +function baseProperty(key) { + return function(object) { + return object == null ? undefined : object[key]; + }; +} + +/** + * Gets the "length" property value of `object`. + * + * **Note:** This function is used to avoid a [JIT bug](https://bugs.webkit.org/show_bug.cgi?id=142792) + * that affects Safari on at least iOS 8.1-8.3 ARM64. + * + * @private + * @param {Object} object The object to query. + * @returns {*} Returns the "length" value. + */ +var getLength = baseProperty('length'); + +/** + * Checks if `value` is array-like. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is array-like, else `false`. + */ +function isArrayLike(value) { + return value != null && isLength(getLength(value)); +} + +/** + * Checks if `value` is a valid array-like index. + * + * @private + * @param {*} value The value to check. + * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index. + * @returns {boolean} Returns `true` if `value` is a valid index, else `false`. + */ +function isIndex(value, length) { + value = (typeof value == 'number' || reIsUint.test(value)) ? +value : -1; + length = length == null ? MAX_SAFE_INTEGER : length; + return value > -1 && value % 1 == 0 && value < length; +} + +/** + * Checks if `value` is a valid array-like length. + * + * **Note:** This function is based on [`ToLength`](http://ecma-international.org/ecma-262/6.0/#sec-tolength). + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a valid length, else `false`. + */ +function isLength(value) { + return typeof value == 'number' && value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER; +} + +/** + * A fallback implementation of `Object.keys` which creates an array of the + * own enumerable property names of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + */ +function shimKeys(object) { + var props = keysIn(object), + propsLength = props.length, + length = propsLength && object.length; + + var allowIndexes = !!length && isLength(length) && + (isArray(object) || isArguments(object)); + + var index = -1, + result = []; + + while (++index < propsLength) { + var key = props[index]; + if ((allowIndexes && isIndex(key, length)) || hasOwnProperty.call(object, key)) { + result.push(key); + } + } + return result; +} + +/** + * Checks if `value` is the [language type](https://es5.github.io/#x8) of `Object`. + * (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an object, else `false`. + * @example + * + * _.isObject({}); + * // => true + * + * _.isObject([1, 2, 3]); + * // => true + * + * _.isObject(1); + * // => false + */ +function isObject(value) { + // Avoid a V8 JIT bug in Chrome 19-20. + // See https://code.google.com/p/v8/issues/detail?id=2291 for more details. + var type = typeof value; + return !!value && (type == 'object' || type == 'function'); +} + +/** + * Creates an array of the own enumerable property names of `object`. + * + * **Note:** Non-object values are coerced to objects. See the + * [ES spec](http://ecma-international.org/ecma-262/6.0/#sec-object.keys) + * for more details. + * + * @static + * @memberOf _ + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.keys(new Foo); + * // => ['a', 'b'] (iteration order is not guaranteed) + * + * _.keys('hi'); + * // => ['0', '1'] + */ +var keys = !nativeKeys ? shimKeys : function(object) { + var Ctor = object == null ? undefined : object.constructor; + if ((typeof Ctor == 'function' && Ctor.prototype === object) || + (typeof object != 'function' && isArrayLike(object))) { + return shimKeys(object); + } + return isObject(object) ? nativeKeys(object) : []; +}; + +/** + * Creates an array of the own and inherited enumerable property names of `object`. + * + * **Note:** Non-object values are coerced to objects. + * + * @static + * @memberOf _ + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.keysIn(new Foo); + * // => ['a', 'b', 'c'] (iteration order is not guaranteed) + */ +function keysIn(object) { + if (object == null) { + return []; + } + if (!isObject(object)) { + object = Object(object); + } + var length = object.length; + length = (length && isLength(length) && + (isArray(object) || isArguments(object)) && length) || 0; + + var Ctor = object.constructor, + index = -1, + isProto = typeof Ctor == 'function' && Ctor.prototype === object, + result = Array(length), + skipIndexes = length > 0; + + while (++index < length) { + result[index] = (index + ''); + } + for (var key in object) { + if (!(skipIndexes && isIndex(key, length)) && + !(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) { + result.push(key); + } + } + return result; +} + +module.exports = keys; + +},{"lodash._getnative":29,"lodash.isarguments":31,"lodash.isarray":32}],34:[function(require,module,exports){ +var overArg = require('./_overArg'); + +/* Built-in method references for those with the same name as other `lodash` methods. */ +var nativeGetPrototype = Object.getPrototypeOf; + +/** + * Gets the `[[Prototype]]` of `value`. + * + * @private + * @param {*} value The value to query. + * @returns {null|Object} Returns the `[[Prototype]]`. + */ +var getPrototype = overArg(nativeGetPrototype, Object); + +module.exports = getPrototype; + +},{"./_overArg":36}],35:[function(require,module,exports){ +/** + * Checks if `value` is a host object in IE < 9. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a host object, else `false`. + */ +function isHostObject(value) { + // Many host objects are `Object` objects that can coerce to strings + // despite having improperly defined `toString` methods. + var result = false; + if (value != null && typeof value.toString != 'function') { + try { + result = !!(value + ''); + } catch (e) {} + } + return result; +} + +module.exports = isHostObject; + +},{}],36:[function(require,module,exports){ +/** + * Creates a function that invokes `func` with its first argument transformed. + * + * @private + * @param {Function} func The function to wrap. + * @param {Function} transform The argument transform. + * @returns {Function} Returns the new function. + */ +function overArg(func, transform) { + return function(arg) { + return func(transform(arg)); + }; +} + +module.exports = overArg; + +},{}],37:[function(require,module,exports){ +/** + * Checks if `value` is object-like. A value is object-like if it's not `null` + * and has a `typeof` result of "object". + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is object-like, else `false`. + * @example + * + * _.isObjectLike({}); + * // => true + * + * _.isObjectLike([1, 2, 3]); + * // => true + * + * _.isObjectLike(_.noop); + * // => false + * + * _.isObjectLike(null); + * // => false + */ +function isObjectLike(value) { + return !!value && typeof value == 'object'; +} + +module.exports = isObjectLike; + +},{}],38:[function(require,module,exports){ +var getPrototype = require('./_getPrototype'), + isHostObject = require('./_isHostObject'), + isObjectLike = require('./isObjectLike'); + +/** `Object#toString` result references. */ +var objectTag = '[object Object]'; + +/** Used for built-in method references. */ +var objectProto = Object.prototype; + +/** Used to resolve the decompiled source of functions. */ +var funcToString = Function.prototype.toString; + +/** Used to check objects for own properties. */ +var hasOwnProperty = objectProto.hasOwnProperty; + +/** Used to infer the `Object` constructor. */ +var objectCtorString = funcToString.call(Object); + +/** + * Used to resolve the + * [`toStringTag`](http://ecma-international.org/ecma-262/6.0/#sec-object.prototype.tostring) + * of values. + */ +var objectToString = objectProto.toString; + +/** + * Checks if `value` is a plain object, that is, an object created by the + * `Object` constructor or one with a `[[Prototype]]` of `null`. + * + * @static + * @memberOf _ + * @since 0.8.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a plain object, + * else `false`. + * @example + * + * function Foo() { + * this.a = 1; + * } + * + * _.isPlainObject(new Foo); + * // => false + * + * _.isPlainObject([1, 2, 3]); + * // => false + * + * _.isPlainObject({ 'x': 0, 'y': 0 }); + * // => true + * + * _.isPlainObject(Object.create(null)); + * // => true + */ +function isPlainObject(value) { + if (!isObjectLike(value) || + objectToString.call(value) != objectTag || isHostObject(value)) { + return false; + } + var proto = getPrototype(value); + if (proto === null) { + return true; + } + var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor; + return (typeof Ctor == 'function' && + Ctor instanceof Ctor && funcToString.call(Ctor) == objectCtorString); +} + +module.exports = isPlainObject; + +},{"./_getPrototype":34,"./_isHostObject":35,"./isObjectLike":37}],39:[function(require,module,exports){ +'use strict'; +/* eslint-disable no-unused-vars */ +var hasOwnProperty = Object.prototype.hasOwnProperty; +var propIsEnumerable = Object.prototype.propertyIsEnumerable; + +function toObject(val) { + if (val === null || val === undefined) { + throw new TypeError('Object.assign cannot be called with null or undefined'); + } + + return Object(val); +} + +function shouldUseNative() { + try { + if (!Object.assign) { + return false; + } + + // Detect buggy property enumeration order in older V8 versions. + + // https://bugs.chromium.org/p/v8/issues/detail?id=4118 + var test1 = new String('abc'); // eslint-disable-line + test1[5] = 'de'; + if (Object.getOwnPropertyNames(test1)[0] === '5') { + return false; + } + + // https://bugs.chromium.org/p/v8/issues/detail?id=3056 + var test2 = {}; + for (var i = 0; i < 10; i++) { + test2['_' + String.fromCharCode(i)] = i; + } + var order2 = Object.getOwnPropertyNames(test2).map(function (n) { + return test2[n]; + }); + if (order2.join('') !== '0123456789') { + return false; + } + + // https://bugs.chromium.org/p/v8/issues/detail?id=3056 + var test3 = {}; + 'abcdefghijklmnopqrst'.split('').forEach(function (letter) { + test3[letter] = letter; + }); + if (Object.keys(Object.assign({}, test3)).join('') !== + 'abcdefghijklmnopqrst') { + return false; + } + + return true; + } catch (e) { + // We don't expect any of the above to throw, but better to be safe. + return false; + } +} + +module.exports = shouldUseNative() ? Object.assign : function (target, source) { + var from; + var to = toObject(target); + var symbols; + + for (var s = 1; s < arguments.length; s++) { + from = Object(arguments[s]); + + for (var key in from) { + if (hasOwnProperty.call(from, key)) { + to[key] = from[key]; + } + } + + if (Object.getOwnPropertySymbols) { + symbols = Object.getOwnPropertySymbols(from); + for (var i = 0; i < symbols.length; i++) { + if (propIsEnumerable.call(from, symbols[i])) { + to[symbols[i]] = from[symbols[i]]; + } + } + } + } + + return to; +}; + +},{}],40:[function(require,module,exports){ +// shim for using process in browser +var process = module.exports = {}; + +// cached from whatever global is present so that test runners that stub it +// don't break things. But we need to wrap it in a try catch in case it is +// wrapped in strict mode code which doesn't define any globals. It's inside a +// function because try/catches deoptimize in certain engines. + +var cachedSetTimeout; +var cachedClearTimeout; + +(function () { + try { + cachedSetTimeout = setTimeout; + } catch (e) { + cachedSetTimeout = function () { + throw new Error('setTimeout is not defined'); + } + } + try { + cachedClearTimeout = clearTimeout; + } catch (e) { + cachedClearTimeout = function () { + throw new Error('clearTimeout is not defined'); + } + } +} ()) +function runTimeout(fun) { + if (cachedSetTimeout === setTimeout) { + return setTimeout(fun, 0); + } else { + return cachedSetTimeout.call(null, fun, 0); + } +} +function runClearTimeout(marker) { + if (cachedClearTimeout === clearTimeout) { + clearTimeout(marker); + } else { + cachedClearTimeout.call(null, marker); + } +} +var queue = []; +var draining = false; +var currentQueue; +var queueIndex = -1; + +function cleanUpNextTick() { + if (!draining || !currentQueue) { + return; + } + draining = false; + if (currentQueue.length) { + queue = currentQueue.concat(queue); + } else { + queueIndex = -1; + } + if (queue.length) { + drainQueue(); + } +} + +function drainQueue() { + if (draining) { + return; + } + var timeout = runTimeout(cleanUpNextTick); + draining = true; + + var len = queue.length; + while(len) { + currentQueue = queue; + queue = []; + while (++queueIndex < len) { + if (currentQueue) { + currentQueue[queueIndex].run(); + } + } + queueIndex = -1; + len = queue.length; + } + currentQueue = null; + draining = false; + runClearTimeout(timeout); +} + +process.nextTick = function (fun) { + var args = new Array(arguments.length - 1); + if (arguments.length > 1) { + for (var i = 1; i < arguments.length; i++) { + args[i - 1] = arguments[i]; + } + } + queue.push(new Item(fun, args)); + if (queue.length === 1 && !draining) { + runTimeout(drainQueue); + } +}; + +// v8 likes predictible objects +function Item(fun, array) { + this.fun = fun; + this.array = array; +} +Item.prototype.run = function () { + this.fun.apply(null, this.array); +}; +process.title = 'browser'; +process.browser = true; +process.env = {}; +process.argv = []; +process.version = ''; // empty string to avoid regexp issues +process.versions = {}; + +function noop() {} + +process.on = noop; +process.addListener = noop; +process.once = noop; +process.off = noop; +process.removeListener = noop; +process.removeAllListeners = noop; +process.emit = noop; + +process.binding = function (name) { + throw new Error('process.binding is not supported'); +}; + +process.cwd = function () { return '/' }; +process.chdir = function (dir) { + throw new Error('process.chdir is not supported'); +}; +process.umask = function() { return 0; }; + +},{}],41:[function(require,module,exports){ +'use strict'; +var strictUriEncode = require('strict-uri-encode'); + +exports.extract = function (str) { + return str.split('?')[1] || ''; +}; + +exports.parse = function (str) { + if (typeof str !== 'string') { + return {}; + } + + str = str.trim().replace(/^(\?|#|&)/, ''); + + if (!str) { + return {}; + } + + return str.split('&').reduce(function (ret, param) { + var parts = param.replace(/\+/g, ' ').split('='); + // Firefox (pre 40) decodes `%3D` to `=` + // https://github.com/sindresorhus/query-string/pull/37 + var key = parts.shift(); + var val = parts.length > 0 ? parts.join('=') : undefined; + + key = decodeURIComponent(key); + + // missing `=` should be `null`: + // http://w3.org/TR/2012/WD-url-20120524/#collect-url-parameters + val = val === undefined ? null : decodeURIComponent(val); + + if (!ret.hasOwnProperty(key)) { + ret[key] = val; + } else if (Array.isArray(ret[key])) { + ret[key].push(val); + } else { + ret[key] = [ret[key], val]; + } + + return ret; + }, {}); +}; + +exports.stringify = function (obj) { + return obj ? Object.keys(obj).sort().map(function (key) { + var val = obj[key]; + + if (val === undefined) { + return ''; + } + + if (val === null) { + return key; + } + + if (Array.isArray(val)) { + return val.slice().sort().map(function (val2) { + return strictUriEncode(key) + '=' + strictUriEncode(val2); + }).join('&'); + } + + return strictUriEncode(key) + '=' + strictUriEncode(val); + }).filter(function (x) { + return x.length > 0; + }).join('&') : ''; +}; + +},{"strict-uri-encode":224}],42:[function(require,module,exports){ +(function (process){ +'use strict'; + +exports.__esModule = true; +exports["default"] = undefined; + +var _react = require('react'); + +var _storeShape = require('../utils/storeShape'); + +var _storeShape2 = _interopRequireDefault(_storeShape); + +var _warning = require('../utils/warning'); + +var _warning2 = _interopRequireDefault(_warning); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { "default": obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; } + +function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; } + +var didWarnAboutReceivingStore = false; +function warnAboutReceivingStore() { + if (didWarnAboutReceivingStore) { + return; + } + didWarnAboutReceivingStore = true; + + (0, _warning2["default"])(' does not support changing `store` on the fly. ' + 'It is most likely that you see this error because you updated to ' + 'Redux 2.x and React Redux 2.x which no longer hot reload reducers ' + 'automatically. See https://github.com/reactjs/react-redux/releases/' + 'tag/v2.0.0 for the migration instructions.'); +} + +var Provider = function (_Component) { + _inherits(Provider, _Component); + + Provider.prototype.getChildContext = function getChildContext() { + return { store: this.store }; + }; + + function Provider(props, context) { + _classCallCheck(this, Provider); + + var _this = _possibleConstructorReturn(this, _Component.call(this, props, context)); + + _this.store = props.store; + return _this; + } + + Provider.prototype.render = function render() { + var children = this.props.children; + + return _react.Children.only(children); + }; + + return Provider; +}(_react.Component); + +exports["default"] = Provider; + +if (process.env.NODE_ENV !== 'production') { + Provider.prototype.componentWillReceiveProps = function (nextProps) { + var store = this.store; + var nextStore = nextProps.store; + + if (store !== nextStore) { + warnAboutReceivingStore(); + } + }; +} + +Provider.propTypes = { + store: _storeShape2["default"].isRequired, + children: _react.PropTypes.element.isRequired +}; +Provider.childContextTypes = { + store: _storeShape2["default"].isRequired +}; +}).call(this,require('_process')) + +},{"../utils/storeShape":45,"../utils/warning":46,"_process":40,"react":"react"}],43:[function(require,module,exports){ +(function (process){ +'use strict'; + +var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; + +exports.__esModule = true; +exports["default"] = connect; + +var _react = require('react'); + +var _storeShape = require('../utils/storeShape'); + +var _storeShape2 = _interopRequireDefault(_storeShape); + +var _shallowEqual = require('../utils/shallowEqual'); + +var _shallowEqual2 = _interopRequireDefault(_shallowEqual); + +var _wrapActionCreators = require('../utils/wrapActionCreators'); + +var _wrapActionCreators2 = _interopRequireDefault(_wrapActionCreators); + +var _warning = require('../utils/warning'); + +var _warning2 = _interopRequireDefault(_warning); + +var _isPlainObject = require('lodash/isPlainObject'); + +var _isPlainObject2 = _interopRequireDefault(_isPlainObject); + +var _hoistNonReactStatics = require('hoist-non-react-statics'); + +var _hoistNonReactStatics2 = _interopRequireDefault(_hoistNonReactStatics); + +var _invariant = require('invariant'); + +var _invariant2 = _interopRequireDefault(_invariant); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { "default": obj }; } + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; } + +function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; } + +var defaultMapStateToProps = function defaultMapStateToProps(state) { + return {}; +}; // eslint-disable-line no-unused-vars +var defaultMapDispatchToProps = function defaultMapDispatchToProps(dispatch) { + return { dispatch: dispatch }; +}; +var defaultMergeProps = function defaultMergeProps(stateProps, dispatchProps, parentProps) { + return _extends({}, parentProps, stateProps, dispatchProps); +}; + +function getDisplayName(WrappedComponent) { + return WrappedComponent.displayName || WrappedComponent.name || 'Component'; +} + +var errorObject = { value: null }; +function tryCatch(fn, ctx) { + try { + return fn.apply(ctx); + } catch (e) { + errorObject.value = e; + return errorObject; + } +} + +// Helps track hot reloading. +var nextVersion = 0; + +function connect(mapStateToProps, mapDispatchToProps, mergeProps) { + var options = arguments.length <= 3 || arguments[3] === undefined ? {} : arguments[3]; + + var shouldSubscribe = Boolean(mapStateToProps); + var mapState = mapStateToProps || defaultMapStateToProps; + + var mapDispatch = undefined; + if (typeof mapDispatchToProps === 'function') { + mapDispatch = mapDispatchToProps; + } else if (!mapDispatchToProps) { + mapDispatch = defaultMapDispatchToProps; + } else { + mapDispatch = (0, _wrapActionCreators2["default"])(mapDispatchToProps); + } + + var finalMergeProps = mergeProps || defaultMergeProps; + var _options$pure = options.pure; + var pure = _options$pure === undefined ? true : _options$pure; + var _options$withRef = options.withRef; + var withRef = _options$withRef === undefined ? false : _options$withRef; + + var checkMergedEquals = pure && finalMergeProps !== defaultMergeProps; + + // Helps track hot reloading. + var version = nextVersion++; + + return function wrapWithConnect(WrappedComponent) { + var connectDisplayName = 'Connect(' + getDisplayName(WrappedComponent) + ')'; + + function checkStateShape(props, methodName) { + if (!(0, _isPlainObject2["default"])(props)) { + (0, _warning2["default"])(methodName + '() in ' + connectDisplayName + ' must return a plain object. ' + ('Instead received ' + props + '.')); + } + } + + function computeMergedProps(stateProps, dispatchProps, parentProps) { + var mergedProps = finalMergeProps(stateProps, dispatchProps, parentProps); + if (process.env.NODE_ENV !== 'production') { + checkStateShape(mergedProps, 'mergeProps'); + } + return mergedProps; + } + + var Connect = function (_Component) { + _inherits(Connect, _Component); + + Connect.prototype.shouldComponentUpdate = function shouldComponentUpdate() { + return !pure || this.haveOwnPropsChanged || this.hasStoreStateChanged; + }; + + function Connect(props, context) { + _classCallCheck(this, Connect); + + var _this = _possibleConstructorReturn(this, _Component.call(this, props, context)); + + _this.version = version; + _this.store = props.store || context.store; + + (0, _invariant2["default"])(_this.store, 'Could not find "store" in either the context or ' + ('props of "' + connectDisplayName + '". ') + 'Either wrap the root component in a , ' + ('or explicitly pass "store" as a prop to "' + connectDisplayName + '".')); + + var storeState = _this.store.getState(); + _this.state = { storeState: storeState }; + _this.clearCache(); + return _this; + } + + Connect.prototype.computeStateProps = function computeStateProps(store, props) { + if (!this.finalMapStateToProps) { + return this.configureFinalMapState(store, props); + } + + var state = store.getState(); + var stateProps = this.doStatePropsDependOnOwnProps ? this.finalMapStateToProps(state, props) : this.finalMapStateToProps(state); + + if (process.env.NODE_ENV !== 'production') { + checkStateShape(stateProps, 'mapStateToProps'); + } + return stateProps; + }; + + Connect.prototype.configureFinalMapState = function configureFinalMapState(store, props) { + var mappedState = mapState(store.getState(), props); + var isFactory = typeof mappedState === 'function'; + + this.finalMapStateToProps = isFactory ? mappedState : mapState; + this.doStatePropsDependOnOwnProps = this.finalMapStateToProps.length !== 1; + + if (isFactory) { + return this.computeStateProps(store, props); + } + + if (process.env.NODE_ENV !== 'production') { + checkStateShape(mappedState, 'mapStateToProps'); + } + return mappedState; + }; + + Connect.prototype.computeDispatchProps = function computeDispatchProps(store, props) { + if (!this.finalMapDispatchToProps) { + return this.configureFinalMapDispatch(store, props); + } + + var dispatch = store.dispatch; + + var dispatchProps = this.doDispatchPropsDependOnOwnProps ? this.finalMapDispatchToProps(dispatch, props) : this.finalMapDispatchToProps(dispatch); + + if (process.env.NODE_ENV !== 'production') { + checkStateShape(dispatchProps, 'mapDispatchToProps'); + } + return dispatchProps; + }; + + Connect.prototype.configureFinalMapDispatch = function configureFinalMapDispatch(store, props) { + var mappedDispatch = mapDispatch(store.dispatch, props); + var isFactory = typeof mappedDispatch === 'function'; + + this.finalMapDispatchToProps = isFactory ? mappedDispatch : mapDispatch; + this.doDispatchPropsDependOnOwnProps = this.finalMapDispatchToProps.length !== 1; + + if (isFactory) { + return this.computeDispatchProps(store, props); + } + + if (process.env.NODE_ENV !== 'production') { + checkStateShape(mappedDispatch, 'mapDispatchToProps'); + } + return mappedDispatch; + }; + + Connect.prototype.updateStatePropsIfNeeded = function updateStatePropsIfNeeded() { + var nextStateProps = this.computeStateProps(this.store, this.props); + if (this.stateProps && (0, _shallowEqual2["default"])(nextStateProps, this.stateProps)) { + return false; + } + + this.stateProps = nextStateProps; + return true; + }; + + Connect.prototype.updateDispatchPropsIfNeeded = function updateDispatchPropsIfNeeded() { + var nextDispatchProps = this.computeDispatchProps(this.store, this.props); + if (this.dispatchProps && (0, _shallowEqual2["default"])(nextDispatchProps, this.dispatchProps)) { + return false; + } + + this.dispatchProps = nextDispatchProps; + return true; + }; + + Connect.prototype.updateMergedPropsIfNeeded = function updateMergedPropsIfNeeded() { + var nextMergedProps = computeMergedProps(this.stateProps, this.dispatchProps, this.props); + if (this.mergedProps && checkMergedEquals && (0, _shallowEqual2["default"])(nextMergedProps, this.mergedProps)) { + return false; + } + + this.mergedProps = nextMergedProps; + return true; + }; + + Connect.prototype.isSubscribed = function isSubscribed() { + return typeof this.unsubscribe === 'function'; + }; + + Connect.prototype.trySubscribe = function trySubscribe() { + if (shouldSubscribe && !this.unsubscribe) { + this.unsubscribe = this.store.subscribe(this.handleChange.bind(this)); + this.handleChange(); + } + }; + + Connect.prototype.tryUnsubscribe = function tryUnsubscribe() { + if (this.unsubscribe) { + this.unsubscribe(); + this.unsubscribe = null; + } + }; + + Connect.prototype.componentDidMount = function componentDidMount() { + this.trySubscribe(); + }; + + Connect.prototype.componentWillReceiveProps = function componentWillReceiveProps(nextProps) { + if (!pure || !(0, _shallowEqual2["default"])(nextProps, this.props)) { + this.haveOwnPropsChanged = true; + } + }; + + Connect.prototype.componentWillUnmount = function componentWillUnmount() { + this.tryUnsubscribe(); + this.clearCache(); + }; + + Connect.prototype.clearCache = function clearCache() { + this.dispatchProps = null; + this.stateProps = null; + this.mergedProps = null; + this.haveOwnPropsChanged = true; + this.hasStoreStateChanged = true; + this.haveStatePropsBeenPrecalculated = false; + this.statePropsPrecalculationError = null; + this.renderedElement = null; + this.finalMapDispatchToProps = null; + this.finalMapStateToProps = null; + }; + + Connect.prototype.handleChange = function handleChange() { + if (!this.unsubscribe) { + return; + } + + var storeState = this.store.getState(); + var prevStoreState = this.state.storeState; + if (pure && prevStoreState === storeState) { + return; + } + + if (pure && !this.doStatePropsDependOnOwnProps) { + var haveStatePropsChanged = tryCatch(this.updateStatePropsIfNeeded, this); + if (!haveStatePropsChanged) { + return; + } + if (haveStatePropsChanged === errorObject) { + this.statePropsPrecalculationError = errorObject.value; + } + this.haveStatePropsBeenPrecalculated = true; + } + + this.hasStoreStateChanged = true; + this.setState({ storeState: storeState }); + }; + + Connect.prototype.getWrappedInstance = function getWrappedInstance() { + (0, _invariant2["default"])(withRef, 'To access the wrapped instance, you need to specify ' + '{ withRef: true } as the fourth argument of the connect() call.'); + + return this.refs.wrappedInstance; + }; + + Connect.prototype.render = function render() { + var haveOwnPropsChanged = this.haveOwnPropsChanged; + var hasStoreStateChanged = this.hasStoreStateChanged; + var haveStatePropsBeenPrecalculated = this.haveStatePropsBeenPrecalculated; + var statePropsPrecalculationError = this.statePropsPrecalculationError; + var renderedElement = this.renderedElement; + + this.haveOwnPropsChanged = false; + this.hasStoreStateChanged = false; + this.haveStatePropsBeenPrecalculated = false; + this.statePropsPrecalculationError = null; + + if (statePropsPrecalculationError) { + throw statePropsPrecalculationError; + } + + var shouldUpdateStateProps = true; + var shouldUpdateDispatchProps = true; + if (pure && renderedElement) { + shouldUpdateStateProps = hasStoreStateChanged || haveOwnPropsChanged && this.doStatePropsDependOnOwnProps; + shouldUpdateDispatchProps = haveOwnPropsChanged && this.doDispatchPropsDependOnOwnProps; + } + + var haveStatePropsChanged = false; + var haveDispatchPropsChanged = false; + if (haveStatePropsBeenPrecalculated) { + haveStatePropsChanged = true; + } else if (shouldUpdateStateProps) { + haveStatePropsChanged = this.updateStatePropsIfNeeded(); + } + if (shouldUpdateDispatchProps) { + haveDispatchPropsChanged = this.updateDispatchPropsIfNeeded(); + } + + var haveMergedPropsChanged = true; + if (haveStatePropsChanged || haveDispatchPropsChanged || haveOwnPropsChanged) { + haveMergedPropsChanged = this.updateMergedPropsIfNeeded(); + } else { + haveMergedPropsChanged = false; + } + + if (!haveMergedPropsChanged && renderedElement) { + return renderedElement; + } + + if (withRef) { + this.renderedElement = (0, _react.createElement)(WrappedComponent, _extends({}, this.mergedProps, { + ref: 'wrappedInstance' + })); + } else { + this.renderedElement = (0, _react.createElement)(WrappedComponent, this.mergedProps); + } + + return this.renderedElement; + }; + + return Connect; + }(_react.Component); + + Connect.displayName = connectDisplayName; + Connect.WrappedComponent = WrappedComponent; + Connect.contextTypes = { + store: _storeShape2["default"] + }; + Connect.propTypes = { + store: _storeShape2["default"] + }; + + if (process.env.NODE_ENV !== 'production') { + Connect.prototype.componentWillUpdate = function componentWillUpdate() { + if (this.version === version) { + return; + } + + // We are hot reloading! + this.version = version; + this.trySubscribe(); + this.clearCache(); + }; + } + + return (0, _hoistNonReactStatics2["default"])(Connect, WrappedComponent); + }; +} +}).call(this,require('_process')) + +},{"../utils/shallowEqual":44,"../utils/storeShape":45,"../utils/warning":46,"../utils/wrapActionCreators":47,"_process":40,"hoist-non-react-statics":27,"invariant":28,"lodash/isPlainObject":38,"react":"react"}],44:[function(require,module,exports){ +"use strict"; + +exports.__esModule = true; +exports["default"] = shallowEqual; +function shallowEqual(objA, objB) { + if (objA === objB) { + return true; + } + + var keysA = Object.keys(objA); + var keysB = Object.keys(objB); + + if (keysA.length !== keysB.length) { + return false; + } + + // Test for A's keys different from B. + var hasOwn = Object.prototype.hasOwnProperty; + for (var i = 0; i < keysA.length; i++) { + if (!hasOwn.call(objB, keysA[i]) || objA[keysA[i]] !== objB[keysA[i]]) { + return false; + } + } + + return true; +} +},{}],45:[function(require,module,exports){ +'use strict'; + +exports.__esModule = true; + +var _react = require('react'); + +exports["default"] = _react.PropTypes.shape({ + subscribe: _react.PropTypes.func.isRequired, + dispatch: _react.PropTypes.func.isRequired, + getState: _react.PropTypes.func.isRequired +}); +},{"react":"react"}],46:[function(require,module,exports){ +'use strict'; + +exports.__esModule = true; +exports["default"] = warning; +/** + * Prints a warning in the console if it exists. + * + * @param {String} message The warning message. + * @returns {void} + */ +function warning(message) { + /* eslint-disable no-console */ + if (typeof console !== 'undefined' && typeof console.error === 'function') { + console.error(message); + } + /* eslint-enable no-console */ + try { + // This error was thrown as a convenience so that you can use this stack + // to find the callsite that caused this warning to fire. + throw new Error(message); + /* eslint-disable no-empty */ + } catch (e) {} + /* eslint-enable no-empty */ +} +},{}],47:[function(require,module,exports){ +'use strict'; + +exports.__esModule = true; +exports["default"] = wrapActionCreators; + +var _redux = require('redux'); + +function wrapActionCreators(actionCreators) { + return function (dispatch) { + return (0, _redux.bindActionCreators)(actionCreators, dispatch); + }; +} +},{"redux":"redux"}],48:[function(require,module,exports){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule AutoFocusUtils + */ + +'use strict'; + +var ReactDOMComponentTree = require('./ReactDOMComponentTree'); + +var focusNode = require('fbjs/lib/focusNode'); + +var AutoFocusUtils = { + focusDOMComponent: function () { + focusNode(ReactDOMComponentTree.getNodeFromInstance(this)); + } +}; + +module.exports = AutoFocusUtils; +},{"./ReactDOMComponentTree":89,"fbjs/lib/focusNode":201}],49:[function(require,module,exports){ +/** + * Copyright 2013-present Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule BeforeInputEventPlugin + */ + +'use strict'; + +var EventConstants = require('./EventConstants'); +var EventPropagators = require('./EventPropagators'); +var ExecutionEnvironment = require('fbjs/lib/ExecutionEnvironment'); +var FallbackCompositionState = require('./FallbackCompositionState'); +var SyntheticCompositionEvent = require('./SyntheticCompositionEvent'); +var SyntheticInputEvent = require('./SyntheticInputEvent'); + +var keyOf = require('fbjs/lib/keyOf'); + +var END_KEYCODES = [9, 13, 27, 32]; // Tab, Return, Esc, Space +var START_KEYCODE = 229; + +var canUseCompositionEvent = ExecutionEnvironment.canUseDOM && 'CompositionEvent' in window; + +var documentMode = null; +if (ExecutionEnvironment.canUseDOM && 'documentMode' in document) { + documentMode = document.documentMode; +} + +// Webkit offers a very useful `textInput` event that can be used to +// directly represent `beforeInput`. The IE `textinput` event is not as +// useful, so we don't use it. +var canUseTextInputEvent = ExecutionEnvironment.canUseDOM && 'TextEvent' in window && !documentMode && !isPresto(); + +// In IE9+, we have access to composition events, but the data supplied +// by the native compositionend event may be incorrect. Japanese ideographic +// spaces, for instance (\u3000) are not recorded correctly. +var useFallbackCompositionData = ExecutionEnvironment.canUseDOM && (!canUseCompositionEvent || documentMode && documentMode > 8 && documentMode <= 11); + +/** + * Opera <= 12 includes TextEvent in window, but does not fire + * text input events. Rely on keypress instead. + */ +function isPresto() { + var opera = window.opera; + return typeof opera === 'object' && typeof opera.version === 'function' && parseInt(opera.version(), 10) <= 12; +} + +var SPACEBAR_CODE = 32; +var SPACEBAR_CHAR = String.fromCharCode(SPACEBAR_CODE); + +var topLevelTypes = EventConstants.topLevelTypes; + +// Events and their corresponding property names. +var eventTypes = { + beforeInput: { + phasedRegistrationNames: { + bubbled: keyOf({ onBeforeInput: null }), + captured: keyOf({ onBeforeInputCapture: null }) + }, + dependencies: [topLevelTypes.topCompositionEnd, topLevelTypes.topKeyPress, topLevelTypes.topTextInput, topLevelTypes.topPaste] + }, + compositionEnd: { + phasedRegistrationNames: { + bubbled: keyOf({ onCompositionEnd: null }), + captured: keyOf({ onCompositionEndCapture: null }) + }, + dependencies: [topLevelTypes.topBlur, topLevelTypes.topCompositionEnd, topLevelTypes.topKeyDown, topLevelTypes.topKeyPress, topLevelTypes.topKeyUp, topLevelTypes.topMouseDown] + }, + compositionStart: { + phasedRegistrationNames: { + bubbled: keyOf({ onCompositionStart: null }), + captured: keyOf({ onCompositionStartCapture: null }) + }, + dependencies: [topLevelTypes.topBlur, topLevelTypes.topCompositionStart, topLevelTypes.topKeyDown, topLevelTypes.topKeyPress, topLevelTypes.topKeyUp, topLevelTypes.topMouseDown] + }, + compositionUpdate: { + phasedRegistrationNames: { + bubbled: keyOf({ onCompositionUpdate: null }), + captured: keyOf({ onCompositionUpdateCapture: null }) + }, + dependencies: [topLevelTypes.topBlur, topLevelTypes.topCompositionUpdate, topLevelTypes.topKeyDown, topLevelTypes.topKeyPress, topLevelTypes.topKeyUp, topLevelTypes.topMouseDown] + } +}; + +// Track whether we've ever handled a keypress on the space key. +var hasSpaceKeypress = false; + +/** + * Return whether a native keypress event is assumed to be a command. + * This is required because Firefox fires `keypress` events for key commands + * (cut, copy, select-all, etc.) even though no character is inserted. + */ +function isKeypressCommand(nativeEvent) { + return (nativeEvent.ctrlKey || nativeEvent.altKey || nativeEvent.metaKey) && + // ctrlKey && altKey is equivalent to AltGr, and is not a command. + !(nativeEvent.ctrlKey && nativeEvent.altKey); +} + +/** + * Translate native top level events into event types. + * + * @param {string} topLevelType + * @return {object} + */ +function getCompositionEventType(topLevelType) { + switch (topLevelType) { + case topLevelTypes.topCompositionStart: + return eventTypes.compositionStart; + case topLevelTypes.topCompositionEnd: + return eventTypes.compositionEnd; + case topLevelTypes.topCompositionUpdate: + return eventTypes.compositionUpdate; + } +} + +/** + * Does our fallback best-guess model think this event signifies that + * composition has begun? + * + * @param {string} topLevelType + * @param {object} nativeEvent + * @return {boolean} + */ +function isFallbackCompositionStart(topLevelType, nativeEvent) { + return topLevelType === topLevelTypes.topKeyDown && nativeEvent.keyCode === START_KEYCODE; +} + +/** + * Does our fallback mode think that this event is the end of composition? + * + * @param {string} topLevelType + * @param {object} nativeEvent + * @return {boolean} + */ +function isFallbackCompositionEnd(topLevelType, nativeEvent) { + switch (topLevelType) { + case topLevelTypes.topKeyUp: + // Command keys insert or clear IME input. + return END_KEYCODES.indexOf(nativeEvent.keyCode) !== -1; + case topLevelTypes.topKeyDown: + // Expect IME keyCode on each keydown. If we get any other + // code we must have exited earlier. + return nativeEvent.keyCode !== START_KEYCODE; + case topLevelTypes.topKeyPress: + case topLevelTypes.topMouseDown: + case topLevelTypes.topBlur: + // Events are not possible without cancelling IME. + return true; + default: + return false; + } +} + +/** + * Google Input Tools provides composition data via a CustomEvent, + * with the `data` property populated in the `detail` object. If this + * is available on the event object, use it. If not, this is a plain + * composition event and we have nothing special to extract. + * + * @param {object} nativeEvent + * @return {?string} + */ +function getDataFromCustomEvent(nativeEvent) { + var detail = nativeEvent.detail; + if (typeof detail === 'object' && 'data' in detail) { + return detail.data; + } + return null; +} + +// Track the current IME composition fallback object, if any. +var currentComposition = null; + +/** + * @return {?object} A SyntheticCompositionEvent. + */ +function extractCompositionEvent(topLevelType, targetInst, nativeEvent, nativeEventTarget) { + var eventType; + var fallbackData; + + if (canUseCompositionEvent) { + eventType = getCompositionEventType(topLevelType); + } else if (!currentComposition) { + if (isFallbackCompositionStart(topLevelType, nativeEvent)) { + eventType = eventTypes.compositionStart; + } + } else if (isFallbackCompositionEnd(topLevelType, nativeEvent)) { + eventType = eventTypes.compositionEnd; + } + + if (!eventType) { + return null; + } + + if (useFallbackCompositionData) { + // The current composition is stored statically and must not be + // overwritten while composition continues. + if (!currentComposition && eventType === eventTypes.compositionStart) { + currentComposition = FallbackCompositionState.getPooled(nativeEventTarget); + } else if (eventType === eventTypes.compositionEnd) { + if (currentComposition) { + fallbackData = currentComposition.getData(); + } + } + } + + var event = SyntheticCompositionEvent.getPooled(eventType, targetInst, nativeEvent, nativeEventTarget); + + if (fallbackData) { + // Inject data generated from fallback path into the synthetic event. + // This matches the property of native CompositionEventInterface. + event.data = fallbackData; + } else { + var customData = getDataFromCustomEvent(nativeEvent); + if (customData !== null) { + event.data = customData; + } + } + + EventPropagators.accumulateTwoPhaseDispatches(event); + return event; +} + +/** + * @param {string} topLevelType Record from `EventConstants`. + * @param {object} nativeEvent Native browser event. + * @return {?string} The string corresponding to this `beforeInput` event. + */ +function getNativeBeforeInputChars(topLevelType, nativeEvent) { + switch (topLevelType) { + case topLevelTypes.topCompositionEnd: + return getDataFromCustomEvent(nativeEvent); + case topLevelTypes.topKeyPress: + /** + * If native `textInput` events are available, our goal is to make + * use of them. However, there is a special case: the spacebar key. + * In Webkit, preventing default on a spacebar `textInput` event + * cancels character insertion, but it *also* causes the browser + * to fall back to its default spacebar behavior of scrolling the + * page. + * + * Tracking at: + * https://code.google.com/p/chromium/issues/detail?id=355103 + * + * To avoid this issue, use the keypress event as if no `textInput` + * event is available. + */ + var which = nativeEvent.which; + if (which !== SPACEBAR_CODE) { + return null; + } + + hasSpaceKeypress = true; + return SPACEBAR_CHAR; + + case topLevelTypes.topTextInput: + // Record the characters to be added to the DOM. + var chars = nativeEvent.data; + + // If it's a spacebar character, assume that we have already handled + // it at the keypress level and bail immediately. Android Chrome + // doesn't give us keycodes, so we need to blacklist it. + if (chars === SPACEBAR_CHAR && hasSpaceKeypress) { + return null; + } + + return chars; + + default: + // For other native event types, do nothing. + return null; + } +} + +/** + * For browsers that do not provide the `textInput` event, extract the + * appropriate string to use for SyntheticInputEvent. + * + * @param {string} topLevelType Record from `EventConstants`. + * @param {object} nativeEvent Native browser event. + * @return {?string} The fallback string for this `beforeInput` event. + */ +function getFallbackBeforeInputChars(topLevelType, nativeEvent) { + // If we are currently composing (IME) and using a fallback to do so, + // try to extract the composed characters from the fallback object. + if (currentComposition) { + if (topLevelType === topLevelTypes.topCompositionEnd || isFallbackCompositionEnd(topLevelType, nativeEvent)) { + var chars = currentComposition.getData(); + FallbackCompositionState.release(currentComposition); + currentComposition = null; + return chars; + } + return null; + } + + switch (topLevelType) { + case topLevelTypes.topPaste: + // If a paste event occurs after a keypress, throw out the input + // chars. Paste events should not lead to BeforeInput events. + return null; + case topLevelTypes.topKeyPress: + /** + * As of v27, Firefox may fire keypress events even when no character + * will be inserted. A few possibilities: + * + * - `which` is `0`. Arrow keys, Esc key, etc. + * + * - `which` is the pressed key code, but no char is available. + * Ex: 'AltGr + d` in Polish. There is no modified character for + * this key combination and no character is inserted into the + * document, but FF fires the keypress for char code `100` anyway. + * No `input` event will occur. + * + * - `which` is the pressed key code, but a command combination is + * being used. Ex: `Cmd+C`. No character is inserted, and no + * `input` event will occur. + */ + if (nativeEvent.which && !isKeypressCommand(nativeEvent)) { + return String.fromCharCode(nativeEvent.which); + } + return null; + case topLevelTypes.topCompositionEnd: + return useFallbackCompositionData ? null : nativeEvent.data; + default: + return null; + } +} + +/** + * Extract a SyntheticInputEvent for `beforeInput`, based on either native + * `textInput` or fallback behavior. + * + * @return {?object} A SyntheticInputEvent. + */ +function extractBeforeInputEvent(topLevelType, targetInst, nativeEvent, nativeEventTarget) { + var chars; + + if (canUseTextInputEvent) { + chars = getNativeBeforeInputChars(topLevelType, nativeEvent); + } else { + chars = getFallbackBeforeInputChars(topLevelType, nativeEvent); + } + + // If no characters are being inserted, no BeforeInput event should + // be fired. + if (!chars) { + return null; + } + + var event = SyntheticInputEvent.getPooled(eventTypes.beforeInput, targetInst, nativeEvent, nativeEventTarget); + + event.data = chars; + EventPropagators.accumulateTwoPhaseDispatches(event); + return event; +} + +/** + * Create an `onBeforeInput` event to match + * http://www.w3.org/TR/2013/WD-DOM-Level-3-Events-20131105/#events-inputevents. + * + * This event plugin is based on the native `textInput` event + * available in Chrome, Safari, Opera, and IE. This event fires after + * `onKeyPress` and `onCompositionEnd`, but before `onInput`. + * + * `beforeInput` is spec'd but not implemented in any browsers, and + * the `input` event does not provide any useful information about what has + * actually been added, contrary to the spec. Thus, `textInput` is the best + * available event to identify the characters that have actually been inserted + * into the target node. + * + * This plugin is also responsible for emitting `composition` events, thus + * allowing us to share composition fallback code for both `beforeInput` and + * `composition` event types. + */ +var BeforeInputEventPlugin = { + + eventTypes: eventTypes, + + extractEvents: function (topLevelType, targetInst, nativeEvent, nativeEventTarget) { + return [extractCompositionEvent(topLevelType, targetInst, nativeEvent, nativeEventTarget), extractBeforeInputEvent(topLevelType, targetInst, nativeEvent, nativeEventTarget)]; + } +}; + +module.exports = BeforeInputEventPlugin; +},{"./EventConstants":63,"./EventPropagators":67,"./FallbackCompositionState":68,"./SyntheticCompositionEvent":148,"./SyntheticInputEvent":152,"fbjs/lib/ExecutionEnvironment":193,"fbjs/lib/keyOf":211}],50:[function(require,module,exports){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule CSSProperty + */ + +'use strict'; + +/** + * CSS properties which accept numbers but are not in units of "px". + */ + +var isUnitlessNumber = { + animationIterationCount: true, + borderImageOutset: true, + borderImageSlice: true, + borderImageWidth: true, + boxFlex: true, + boxFlexGroup: true, + boxOrdinalGroup: true, + columnCount: true, + flex: true, + flexGrow: true, + flexPositive: true, + flexShrink: true, + flexNegative: true, + flexOrder: true, + gridRow: true, + gridColumn: true, + fontWeight: true, + lineClamp: true, + lineHeight: true, + opacity: true, + order: true, + orphans: true, + tabSize: true, + widows: true, + zIndex: true, + zoom: true, + + // SVG-related properties + fillOpacity: true, + floodOpacity: true, + stopOpacity: true, + strokeDasharray: true, + strokeDashoffset: true, + strokeMiterlimit: true, + strokeOpacity: true, + strokeWidth: true +}; + +/** + * @param {string} prefix vendor-specific prefix, eg: Webkit + * @param {string} key style name, eg: transitionDuration + * @return {string} style name prefixed with `prefix`, properly camelCased, eg: + * WebkitTransitionDuration + */ +function prefixKey(prefix, key) { + return prefix + key.charAt(0).toUpperCase() + key.substring(1); +} + +/** + * Support style names that may come passed in prefixed by adding permutations + * of vendor prefixes. + */ +var prefixes = ['Webkit', 'ms', 'Moz', 'O']; + +// Using Object.keys here, or else the vanilla for-in loop makes IE8 go into an +// infinite loop, because it iterates over the newly added props too. +Object.keys(isUnitlessNumber).forEach(function (prop) { + prefixes.forEach(function (prefix) { + isUnitlessNumber[prefixKey(prefix, prop)] = isUnitlessNumber[prop]; + }); +}); + +/** + * Most style properties can be unset by doing .style[prop] = '' but IE8 + * doesn't like doing that with shorthand properties so for the properties that + * IE8 breaks on, which are listed here, we instead unset each of the + * individual properties. See http://bugs.jquery.com/ticket/12385. + * The 4-value 'clock' properties like margin, padding, border-width seem to + * behave without any problems. Curiously, list-style works too without any + * special prodding. + */ +var shorthandPropertyExpansions = { + background: { + backgroundAttachment: true, + backgroundColor: true, + backgroundImage: true, + backgroundPositionX: true, + backgroundPositionY: true, + backgroundRepeat: true + }, + backgroundPosition: { + backgroundPositionX: true, + backgroundPositionY: true + }, + border: { + borderWidth: true, + borderStyle: true, + borderColor: true + }, + borderBottom: { + borderBottomWidth: true, + borderBottomStyle: true, + borderBottomColor: true + }, + borderLeft: { + borderLeftWidth: true, + borderLeftStyle: true, + borderLeftColor: true + }, + borderRight: { + borderRightWidth: true, + borderRightStyle: true, + borderRightColor: true + }, + borderTop: { + borderTopWidth: true, + borderTopStyle: true, + borderTopColor: true + }, + font: { + fontStyle: true, + fontVariant: true, + fontWeight: true, + fontSize: true, + lineHeight: true, + fontFamily: true + }, + outline: { + outlineWidth: true, + outlineStyle: true, + outlineColor: true + } +}; + +var CSSProperty = { + isUnitlessNumber: isUnitlessNumber, + shorthandPropertyExpansions: shorthandPropertyExpansions +}; + +module.exports = CSSProperty; +},{}],51:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule CSSPropertyOperations + */ + +'use strict'; + +var CSSProperty = require('./CSSProperty'); +var ExecutionEnvironment = require('fbjs/lib/ExecutionEnvironment'); +var ReactInstrumentation = require('./ReactInstrumentation'); + +var camelizeStyleName = require('fbjs/lib/camelizeStyleName'); +var dangerousStyleValue = require('./dangerousStyleValue'); +var hyphenateStyleName = require('fbjs/lib/hyphenateStyleName'); +var memoizeStringOnly = require('fbjs/lib/memoizeStringOnly'); +var warning = require('fbjs/lib/warning'); + +var processStyleName = memoizeStringOnly(function (styleName) { + return hyphenateStyleName(styleName); +}); + +var hasShorthandPropertyBug = false; +var styleFloatAccessor = 'cssFloat'; +if (ExecutionEnvironment.canUseDOM) { + var tempStyle = document.createElement('div').style; + try { + // IE8 throws "Invalid argument." if resetting shorthand style properties. + tempStyle.font = ''; + } catch (e) { + hasShorthandPropertyBug = true; + } + // IE8 only supports accessing cssFloat (standard) as styleFloat + if (document.documentElement.style.cssFloat === undefined) { + styleFloatAccessor = 'styleFloat'; + } +} + +if (process.env.NODE_ENV !== 'production') { + // 'msTransform' is correct, but the other prefixes should be capitalized + var badVendoredStyleNamePattern = /^(?:webkit|moz|o)[A-Z]/; + + // style values shouldn't contain a semicolon + var badStyleValueWithSemicolonPattern = /;\s*$/; + + var warnedStyleNames = {}; + var warnedStyleValues = {}; + var warnedForNaNValue = false; + + var warnHyphenatedStyleName = function (name, owner) { + if (warnedStyleNames.hasOwnProperty(name) && warnedStyleNames[name]) { + return; + } + + warnedStyleNames[name] = true; + process.env.NODE_ENV !== 'production' ? warning(false, 'Unsupported style property %s. Did you mean %s?%s', name, camelizeStyleName(name), checkRenderMessage(owner)) : void 0; + }; + + var warnBadVendoredStyleName = function (name, owner) { + if (warnedStyleNames.hasOwnProperty(name) && warnedStyleNames[name]) { + return; + } + + warnedStyleNames[name] = true; + process.env.NODE_ENV !== 'production' ? warning(false, 'Unsupported vendor-prefixed style property %s. Did you mean %s?%s', name, name.charAt(0).toUpperCase() + name.slice(1), checkRenderMessage(owner)) : void 0; + }; + + var warnStyleValueWithSemicolon = function (name, value, owner) { + if (warnedStyleValues.hasOwnProperty(value) && warnedStyleValues[value]) { + return; + } + + warnedStyleValues[value] = true; + process.env.NODE_ENV !== 'production' ? warning(false, 'Style property values shouldn\'t contain a semicolon.%s ' + 'Try "%s: %s" instead.', checkRenderMessage(owner), name, value.replace(badStyleValueWithSemicolonPattern, '')) : void 0; + }; + + var warnStyleValueIsNaN = function (name, value, owner) { + if (warnedForNaNValue) { + return; + } + + warnedForNaNValue = true; + process.env.NODE_ENV !== 'production' ? warning(false, '`NaN` is an invalid value for the `%s` css style property.%s', name, checkRenderMessage(owner)) : void 0; + }; + + var checkRenderMessage = function (owner) { + if (owner) { + var name = owner.getName(); + if (name) { + return ' Check the render method of `' + name + '`.'; + } + } + return ''; + }; + + /** + * @param {string} name + * @param {*} value + * @param {ReactDOMComponent} component + */ + var warnValidStyle = function (name, value, component) { + var owner; + if (component) { + owner = component._currentElement._owner; + } + if (name.indexOf('-') > -1) { + warnHyphenatedStyleName(name, owner); + } else if (badVendoredStyleNamePattern.test(name)) { + warnBadVendoredStyleName(name, owner); + } else if (badStyleValueWithSemicolonPattern.test(value)) { + warnStyleValueWithSemicolon(name, value, owner); + } + + if (typeof value === 'number' && isNaN(value)) { + warnStyleValueIsNaN(name, value, owner); + } + }; +} + +/** + * Operations for dealing with CSS properties. + */ +var CSSPropertyOperations = { + + /** + * Serializes a mapping of style properties for use as inline styles: + * + * > createMarkupForStyles({width: '200px', height: 0}) + * "width:200px;height:0;" + * + * Undefined values are ignored so that declarative programming is easier. + * The result should be HTML-escaped before insertion into the DOM. + * + * @param {object} styles + * @param {ReactDOMComponent} component + * @return {?string} + */ + createMarkupForStyles: function (styles, component) { + var serialized = ''; + for (var styleName in styles) { + if (!styles.hasOwnProperty(styleName)) { + continue; + } + var styleValue = styles[styleName]; + if (process.env.NODE_ENV !== 'production') { + warnValidStyle(styleName, styleValue, component); + } + if (styleValue != null) { + serialized += processStyleName(styleName) + ':'; + serialized += dangerousStyleValue(styleName, styleValue, component) + ';'; + } + } + return serialized || null; + }, + + /** + * Sets the value for multiple styles on a node. If a value is specified as + * '' (empty string), the corresponding style property will be unset. + * + * @param {DOMElement} node + * @param {object} styles + * @param {ReactDOMComponent} component + */ + setValueForStyles: function (node, styles, component) { + if (process.env.NODE_ENV !== 'production') { + ReactInstrumentation.debugTool.onHostOperation(component._debugID, 'update styles', styles); + } + + var style = node.style; + for (var styleName in styles) { + if (!styles.hasOwnProperty(styleName)) { + continue; + } + if (process.env.NODE_ENV !== 'production') { + warnValidStyle(styleName, styles[styleName], component); + } + var styleValue = dangerousStyleValue(styleName, styles[styleName], component); + if (styleName === 'float' || styleName === 'cssFloat') { + styleName = styleFloatAccessor; + } + if (styleValue) { + style[styleName] = styleValue; + } else { + var expansion = hasShorthandPropertyBug && CSSProperty.shorthandPropertyExpansions[styleName]; + if (expansion) { + // Shorthand property that IE8 won't like unsetting, so unset each + // component to placate it + for (var individualStyleName in expansion) { + style[individualStyleName] = ''; + } + } else { + style[styleName] = ''; + } + } + } + } + +}; + +module.exports = CSSPropertyOperations; +}).call(this,require('_process')) + +},{"./CSSProperty":50,"./ReactInstrumentation":121,"./dangerousStyleValue":166,"_process":40,"fbjs/lib/ExecutionEnvironment":193,"fbjs/lib/camelizeStyleName":195,"fbjs/lib/hyphenateStyleName":206,"fbjs/lib/memoizeStringOnly":213,"fbjs/lib/warning":217}],52:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule CallbackQueue + */ + +'use strict'; + +var _prodInvariant = require('./reactProdInvariant'), + _assign = require('object-assign'); + +var PooledClass = require('./PooledClass'); + +var invariant = require('fbjs/lib/invariant'); + +/** + * A specialized pseudo-event module to help keep track of components waiting to + * be notified when their DOM representations are available for use. + * + * This implements `PooledClass`, so you should never need to instantiate this. + * Instead, use `CallbackQueue.getPooled()`. + * + * @class ReactMountReady + * @implements PooledClass + * @internal + */ +function CallbackQueue() { + this._callbacks = null; + this._contexts = null; +} + +_assign(CallbackQueue.prototype, { + + /** + * Enqueues a callback to be invoked when `notifyAll` is invoked. + * + * @param {function} callback Invoked when `notifyAll` is invoked. + * @param {?object} context Context to call `callback` with. + * @internal + */ + enqueue: function (callback, context) { + this._callbacks = this._callbacks || []; + this._contexts = this._contexts || []; + this._callbacks.push(callback); + this._contexts.push(context); + }, + + /** + * Invokes all enqueued callbacks and clears the queue. This is invoked after + * the DOM representation of a component has been created or updated. + * + * @internal + */ + notifyAll: function () { + var callbacks = this._callbacks; + var contexts = this._contexts; + if (callbacks) { + !(callbacks.length === contexts.length) ? process.env.NODE_ENV !== 'production' ? invariant(false, 'Mismatched list of contexts in callback queue') : _prodInvariant('24') : void 0; + this._callbacks = null; + this._contexts = null; + for (var i = 0; i < callbacks.length; i++) { + callbacks[i].call(contexts[i]); + } + callbacks.length = 0; + contexts.length = 0; + } + }, + + checkpoint: function () { + return this._callbacks ? this._callbacks.length : 0; + }, + + rollback: function (len) { + if (this._callbacks) { + this._callbacks.length = len; + this._contexts.length = len; + } + }, + + /** + * Resets the internal queue. + * + * @internal + */ + reset: function () { + this._callbacks = null; + this._contexts = null; + }, + + /** + * `PooledClass` looks for this. + */ + destructor: function () { + this.reset(); + } + +}); + +PooledClass.addPoolingTo(CallbackQueue); + +module.exports = CallbackQueue; +}).call(this,require('_process')) + +},{"./PooledClass":72,"./reactProdInvariant":185,"_process":40,"fbjs/lib/invariant":207,"object-assign":39}],53:[function(require,module,exports){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule ChangeEventPlugin + */ + +'use strict'; + +var EventConstants = require('./EventConstants'); +var EventPluginHub = require('./EventPluginHub'); +var EventPropagators = require('./EventPropagators'); +var ExecutionEnvironment = require('fbjs/lib/ExecutionEnvironment'); +var ReactDOMComponentTree = require('./ReactDOMComponentTree'); +var ReactUpdates = require('./ReactUpdates'); +var SyntheticEvent = require('./SyntheticEvent'); + +var getEventTarget = require('./getEventTarget'); +var isEventSupported = require('./isEventSupported'); +var isTextInputElement = require('./isTextInputElement'); +var keyOf = require('fbjs/lib/keyOf'); + +var topLevelTypes = EventConstants.topLevelTypes; + +var eventTypes = { + change: { + phasedRegistrationNames: { + bubbled: keyOf({ onChange: null }), + captured: keyOf({ onChangeCapture: null }) + }, + dependencies: [topLevelTypes.topBlur, topLevelTypes.topChange, topLevelTypes.topClick, topLevelTypes.topFocus, topLevelTypes.topInput, topLevelTypes.topKeyDown, topLevelTypes.topKeyUp, topLevelTypes.topSelectionChange] + } +}; + +/** + * For IE shims + */ +var activeElement = null; +var activeElementInst = null; +var activeElementValue = null; +var activeElementValueProp = null; + +/** + * SECTION: handle `change` event + */ +function shouldUseChangeEvent(elem) { + var nodeName = elem.nodeName && elem.nodeName.toLowerCase(); + return nodeName === 'select' || nodeName === 'input' && elem.type === 'file'; +} + +var doesChangeEventBubble = false; +if (ExecutionEnvironment.canUseDOM) { + // See `handleChange` comment below + doesChangeEventBubble = isEventSupported('change') && (!('documentMode' in document) || document.documentMode > 8); +} + +function manualDispatchChangeEvent(nativeEvent) { + var event = SyntheticEvent.getPooled(eventTypes.change, activeElementInst, nativeEvent, getEventTarget(nativeEvent)); + EventPropagators.accumulateTwoPhaseDispatches(event); + + // If change and propertychange bubbled, we'd just bind to it like all the + // other events and have it go through ReactBrowserEventEmitter. Since it + // doesn't, we manually listen for the events and so we have to enqueue and + // process the abstract event manually. + // + // Batching is necessary here in order to ensure that all event handlers run + // before the next rerender (including event handlers attached to ancestor + // elements instead of directly on the input). Without this, controlled + // components don't work properly in conjunction with event bubbling because + // the component is rerendered and the value reverted before all the event + // handlers can run. See https://github.com/facebook/react/issues/708. + ReactUpdates.batchedUpdates(runEventInBatch, event); +} + +function runEventInBatch(event) { + EventPluginHub.enqueueEvents(event); + EventPluginHub.processEventQueue(false); +} + +function startWatchingForChangeEventIE8(target, targetInst) { + activeElement = target; + activeElementInst = targetInst; + activeElement.attachEvent('onchange', manualDispatchChangeEvent); +} + +function stopWatchingForChangeEventIE8() { + if (!activeElement) { + return; + } + activeElement.detachEvent('onchange', manualDispatchChangeEvent); + activeElement = null; + activeElementInst = null; +} + +function getTargetInstForChangeEvent(topLevelType, targetInst) { + if (topLevelType === topLevelTypes.topChange) { + return targetInst; + } +} +function handleEventsForChangeEventIE8(topLevelType, target, targetInst) { + if (topLevelType === topLevelTypes.topFocus) { + // stopWatching() should be a noop here but we call it just in case we + // missed a blur event somehow. + stopWatchingForChangeEventIE8(); + startWatchingForChangeEventIE8(target, targetInst); + } else if (topLevelType === topLevelTypes.topBlur) { + stopWatchingForChangeEventIE8(); + } +} + +/** + * SECTION: handle `input` event + */ +var isInputEventSupported = false; +if (ExecutionEnvironment.canUseDOM) { + // IE9 claims to support the input event but fails to trigger it when + // deleting text, so we ignore its input events. + // IE10+ fire input events to often, such when a placeholder + // changes or when an input with a placeholder is focused. + isInputEventSupported = isEventSupported('input') && (!('documentMode' in document) || document.documentMode > 11); +} + +/** + * (For IE <=11) Replacement getter/setter for the `value` property that gets + * set on the active element. + */ +var newValueProp = { + get: function () { + return activeElementValueProp.get.call(this); + }, + set: function (val) { + // Cast to a string so we can do equality checks. + activeElementValue = '' + val; + activeElementValueProp.set.call(this, val); + } +}; + +/** + * (For IE <=11) Starts tracking propertychange events on the passed-in element + * and override the value property so that we can distinguish user events from + * value changes in JS. + */ +function startWatchingForValueChange(target, targetInst) { + activeElement = target; + activeElementInst = targetInst; + activeElementValue = target.value; + activeElementValueProp = Object.getOwnPropertyDescriptor(target.constructor.prototype, 'value'); + + // Not guarded in a canDefineProperty check: IE8 supports defineProperty only + // on DOM elements + Object.defineProperty(activeElement, 'value', newValueProp); + if (activeElement.attachEvent) { + activeElement.attachEvent('onpropertychange', handlePropertyChange); + } else { + activeElement.addEventListener('propertychange', handlePropertyChange, false); + } +} + +/** + * (For IE <=11) Removes the event listeners from the currently-tracked element, + * if any exists. + */ +function stopWatchingForValueChange() { + if (!activeElement) { + return; + } + + // delete restores the original property definition + delete activeElement.value; + + if (activeElement.detachEvent) { + activeElement.detachEvent('onpropertychange', handlePropertyChange); + } else { + activeElement.removeEventListener('propertychange', handlePropertyChange, false); + } + + activeElement = null; + activeElementInst = null; + activeElementValue = null; + activeElementValueProp = null; +} + +/** + * (For IE <=11) Handles a propertychange event, sending a `change` event if + * the value of the active element has changed. + */ +function handlePropertyChange(nativeEvent) { + if (nativeEvent.propertyName !== 'value') { + return; + } + var value = nativeEvent.srcElement.value; + if (value === activeElementValue) { + return; + } + activeElementValue = value; + + manualDispatchChangeEvent(nativeEvent); +} + +/** + * If a `change` event should be fired, returns the target's ID. + */ +function getTargetInstForInputEvent(topLevelType, targetInst) { + if (topLevelType === topLevelTypes.topInput) { + // In modern browsers (i.e., not IE8 or IE9), the input event is exactly + // what we want so fall through here and trigger an abstract event + return targetInst; + } +} + +function handleEventsForInputEventIE(topLevelType, target, targetInst) { + if (topLevelType === topLevelTypes.topFocus) { + // In IE8, we can capture almost all .value changes by adding a + // propertychange handler and looking for events with propertyName + // equal to 'value' + // In IE9-11, propertychange fires for most input events but is buggy and + // doesn't fire when text is deleted, but conveniently, selectionchange + // appears to fire in all of the remaining cases so we catch those and + // forward the event if the value has changed + // In either case, we don't want to call the event handler if the value + // is changed from JS so we redefine a setter for `.value` that updates + // our activeElementValue variable, allowing us to ignore those changes + // + // stopWatching() should be a noop here but we call it just in case we + // missed a blur event somehow. + stopWatchingForValueChange(); + startWatchingForValueChange(target, targetInst); + } else if (topLevelType === topLevelTypes.topBlur) { + stopWatchingForValueChange(); + } +} + +// For IE8 and IE9. +function getTargetInstForInputEventIE(topLevelType, targetInst) { + if (topLevelType === topLevelTypes.topSelectionChange || topLevelType === topLevelTypes.topKeyUp || topLevelType === topLevelTypes.topKeyDown) { + // On the selectionchange event, the target is just document which isn't + // helpful for us so just check activeElement instead. + // + // 99% of the time, keydown and keyup aren't necessary. IE8 fails to fire + // propertychange on the first input event after setting `value` from a + // script and fires only keydown, keypress, keyup. Catching keyup usually + // gets it and catching keydown lets us fire an event for the first + // keystroke if user does a key repeat (it'll be a little delayed: right + // before the second keystroke). Other input methods (e.g., paste) seem to + // fire selectionchange normally. + if (activeElement && activeElement.value !== activeElementValue) { + activeElementValue = activeElement.value; + return activeElementInst; + } + } +} + +/** + * SECTION: handle `click` event + */ +function shouldUseClickEvent(elem) { + // Use the `click` event to detect changes to checkbox and radio inputs. + // This approach works across all browsers, whereas `change` does not fire + // until `blur` in IE8. + return elem.nodeName && elem.nodeName.toLowerCase() === 'input' && (elem.type === 'checkbox' || elem.type === 'radio'); +} + +function getTargetInstForClickEvent(topLevelType, targetInst) { + if (topLevelType === topLevelTypes.topClick) { + return targetInst; + } +} + +/** + * This plugin creates an `onChange` event that normalizes change events + * across form elements. This event fires at a time when it's possible to + * change the element's value without seeing a flicker. + * + * Supported elements are: + * - input (see `isTextInputElement`) + * - textarea + * - select + */ +var ChangeEventPlugin = { + + eventTypes: eventTypes, + + extractEvents: function (topLevelType, targetInst, nativeEvent, nativeEventTarget) { + var targetNode = targetInst ? ReactDOMComponentTree.getNodeFromInstance(targetInst) : window; + + var getTargetInstFunc, handleEventFunc; + if (shouldUseChangeEvent(targetNode)) { + if (doesChangeEventBubble) { + getTargetInstFunc = getTargetInstForChangeEvent; + } else { + handleEventFunc = handleEventsForChangeEventIE8; + } + } else if (isTextInputElement(targetNode)) { + if (isInputEventSupported) { + getTargetInstFunc = getTargetInstForInputEvent; + } else { + getTargetInstFunc = getTargetInstForInputEventIE; + handleEventFunc = handleEventsForInputEventIE; + } + } else if (shouldUseClickEvent(targetNode)) { + getTargetInstFunc = getTargetInstForClickEvent; + } + + if (getTargetInstFunc) { + var inst = getTargetInstFunc(topLevelType, targetInst); + if (inst) { + var event = SyntheticEvent.getPooled(eventTypes.change, inst, nativeEvent, nativeEventTarget); + event.type = 'change'; + EventPropagators.accumulateTwoPhaseDispatches(event); + return event; + } + } + + if (handleEventFunc) { + handleEventFunc(topLevelType, targetNode, targetInst); + } + } + +}; + +module.exports = ChangeEventPlugin; +},{"./EventConstants":63,"./EventPluginHub":64,"./EventPropagators":67,"./ReactDOMComponentTree":89,"./ReactUpdates":141,"./SyntheticEvent":150,"./getEventTarget":174,"./isEventSupported":181,"./isTextInputElement":182,"fbjs/lib/ExecutionEnvironment":193,"fbjs/lib/keyOf":211}],54:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule DOMChildrenOperations + */ + +'use strict'; + +var DOMLazyTree = require('./DOMLazyTree'); +var Danger = require('./Danger'); +var ReactMultiChildUpdateTypes = require('./ReactMultiChildUpdateTypes'); +var ReactDOMComponentTree = require('./ReactDOMComponentTree'); +var ReactInstrumentation = require('./ReactInstrumentation'); + +var createMicrosoftUnsafeLocalFunction = require('./createMicrosoftUnsafeLocalFunction'); +var setInnerHTML = require('./setInnerHTML'); +var setTextContent = require('./setTextContent'); + +function getNodeAfter(parentNode, node) { + // Special case for text components, which return [open, close] comments + // from getHostNode. + if (Array.isArray(node)) { + node = node[1]; + } + return node ? node.nextSibling : parentNode.firstChild; +} + +/** + * Inserts `childNode` as a child of `parentNode` at the `index`. + * + * @param {DOMElement} parentNode Parent node in which to insert. + * @param {DOMElement} childNode Child node to insert. + * @param {number} index Index at which to insert the child. + * @internal + */ +var insertChildAt = createMicrosoftUnsafeLocalFunction(function (parentNode, childNode, referenceNode) { + // We rely exclusively on `insertBefore(node, null)` instead of also using + // `appendChild(node)`. (Using `undefined` is not allowed by all browsers so + // we are careful to use `null`.) + parentNode.insertBefore(childNode, referenceNode); +}); + +function insertLazyTreeChildAt(parentNode, childTree, referenceNode) { + DOMLazyTree.insertTreeBefore(parentNode, childTree, referenceNode); +} + +function moveChild(parentNode, childNode, referenceNode) { + if (Array.isArray(childNode)) { + moveDelimitedText(parentNode, childNode[0], childNode[1], referenceNode); + } else { + insertChildAt(parentNode, childNode, referenceNode); + } +} + +function removeChild(parentNode, childNode) { + if (Array.isArray(childNode)) { + var closingComment = childNode[1]; + childNode = childNode[0]; + removeDelimitedText(parentNode, childNode, closingComment); + parentNode.removeChild(closingComment); + } + parentNode.removeChild(childNode); +} + +function moveDelimitedText(parentNode, openingComment, closingComment, referenceNode) { + var node = openingComment; + while (true) { + var nextNode = node.nextSibling; + insertChildAt(parentNode, node, referenceNode); + if (node === closingComment) { + break; + } + node = nextNode; + } +} + +function removeDelimitedText(parentNode, startNode, closingComment) { + while (true) { + var node = startNode.nextSibling; + if (node === closingComment) { + // The closing comment is removed by ReactMultiChild. + break; + } else { + parentNode.removeChild(node); + } + } +} + +function replaceDelimitedText(openingComment, closingComment, stringText) { + var parentNode = openingComment.parentNode; + var nodeAfterComment = openingComment.nextSibling; + if (nodeAfterComment === closingComment) { + // There are no text nodes between the opening and closing comments; insert + // a new one if stringText isn't empty. + if (stringText) { + insertChildAt(parentNode, document.createTextNode(stringText), nodeAfterComment); + } + } else { + if (stringText) { + // Set the text content of the first node after the opening comment, and + // remove all following nodes up until the closing comment. + setTextContent(nodeAfterComment, stringText); + removeDelimitedText(parentNode, nodeAfterComment, closingComment); + } else { + removeDelimitedText(parentNode, openingComment, closingComment); + } + } + + if (process.env.NODE_ENV !== 'production') { + ReactInstrumentation.debugTool.onHostOperation(ReactDOMComponentTree.getInstanceFromNode(openingComment)._debugID, 'replace text', stringText); + } +} + +var dangerouslyReplaceNodeWithMarkup = Danger.dangerouslyReplaceNodeWithMarkup; +if (process.env.NODE_ENV !== 'production') { + dangerouslyReplaceNodeWithMarkup = function (oldChild, markup, prevInstance) { + Danger.dangerouslyReplaceNodeWithMarkup(oldChild, markup); + if (prevInstance._debugID !== 0) { + ReactInstrumentation.debugTool.onHostOperation(prevInstance._debugID, 'replace with', markup.toString()); + } else { + var nextInstance = ReactDOMComponentTree.getInstanceFromNode(markup.node); + if (nextInstance._debugID !== 0) { + ReactInstrumentation.debugTool.onHostOperation(nextInstance._debugID, 'mount', markup.toString()); + } + } + }; +} + +/** + * Operations for updating with DOM children. + */ +var DOMChildrenOperations = { + + dangerouslyReplaceNodeWithMarkup: dangerouslyReplaceNodeWithMarkup, + + replaceDelimitedText: replaceDelimitedText, + + /** + * Updates a component's children by processing a series of updates. The + * update configurations are each expected to have a `parentNode` property. + * + * @param {array} updates List of update configurations. + * @internal + */ + processUpdates: function (parentNode, updates) { + if (process.env.NODE_ENV !== 'production') { + var parentNodeDebugID = ReactDOMComponentTree.getInstanceFromNode(parentNode)._debugID; + } + + for (var k = 0; k < updates.length; k++) { + var update = updates[k]; + switch (update.type) { + case ReactMultiChildUpdateTypes.INSERT_MARKUP: + insertLazyTreeChildAt(parentNode, update.content, getNodeAfter(parentNode, update.afterNode)); + if (process.env.NODE_ENV !== 'production') { + ReactInstrumentation.debugTool.onHostOperation(parentNodeDebugID, 'insert child', { toIndex: update.toIndex, content: update.content.toString() }); + } + break; + case ReactMultiChildUpdateTypes.MOVE_EXISTING: + moveChild(parentNode, update.fromNode, getNodeAfter(parentNode, update.afterNode)); + if (process.env.NODE_ENV !== 'production') { + ReactInstrumentation.debugTool.onHostOperation(parentNodeDebugID, 'move child', { fromIndex: update.fromIndex, toIndex: update.toIndex }); + } + break; + case ReactMultiChildUpdateTypes.SET_MARKUP: + setInnerHTML(parentNode, update.content); + if (process.env.NODE_ENV !== 'production') { + ReactInstrumentation.debugTool.onHostOperation(parentNodeDebugID, 'replace children', update.content.toString()); + } + break; + case ReactMultiChildUpdateTypes.TEXT_CONTENT: + setTextContent(parentNode, update.content); + if (process.env.NODE_ENV !== 'production') { + ReactInstrumentation.debugTool.onHostOperation(parentNodeDebugID, 'replace text', update.content.toString()); + } + break; + case ReactMultiChildUpdateTypes.REMOVE_NODE: + removeChild(parentNode, update.fromNode); + if (process.env.NODE_ENV !== 'production') { + ReactInstrumentation.debugTool.onHostOperation(parentNodeDebugID, 'remove child', { fromIndex: update.fromIndex }); + } + break; + } + } + } + +}; + +module.exports = DOMChildrenOperations; +}).call(this,require('_process')) + +},{"./DOMLazyTree":55,"./Danger":59,"./ReactDOMComponentTree":89,"./ReactInstrumentation":121,"./ReactMultiChildUpdateTypes":126,"./createMicrosoftUnsafeLocalFunction":165,"./setInnerHTML":187,"./setTextContent":188,"_process":40}],55:[function(require,module,exports){ +/** + * Copyright 2015-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule DOMLazyTree + */ + +'use strict'; + +var DOMNamespaces = require('./DOMNamespaces'); +var setInnerHTML = require('./setInnerHTML'); + +var createMicrosoftUnsafeLocalFunction = require('./createMicrosoftUnsafeLocalFunction'); +var setTextContent = require('./setTextContent'); + +var ELEMENT_NODE_TYPE = 1; +var DOCUMENT_FRAGMENT_NODE_TYPE = 11; + +/** + * In IE (8-11) and Edge, appending nodes with no children is dramatically + * faster than appending a full subtree, so we essentially queue up the + * .appendChild calls here and apply them so each node is added to its parent + * before any children are added. + * + * In other browsers, doing so is slower or neutral compared to the other order + * (in Firefox, twice as slow) so we only do this inversion in IE. + * + * See https://github.com/spicyj/innerhtml-vs-createelement-vs-clonenode. + */ +var enableLazy = typeof document !== 'undefined' && typeof document.documentMode === 'number' || typeof navigator !== 'undefined' && typeof navigator.userAgent === 'string' && /\bEdge\/\d/.test(navigator.userAgent); + +function insertTreeChildren(tree) { + if (!enableLazy) { + return; + } + var node = tree.node; + var children = tree.children; + if (children.length) { + for (var i = 0; i < children.length; i++) { + insertTreeBefore(node, children[i], null); + } + } else if (tree.html != null) { + setInnerHTML(node, tree.html); + } else if (tree.text != null) { + setTextContent(node, tree.text); + } +} + +var insertTreeBefore = createMicrosoftUnsafeLocalFunction(function (parentNode, tree, referenceNode) { + // DocumentFragments aren't actually part of the DOM after insertion so + // appending children won't update the DOM. We need to ensure the fragment + // is properly populated first, breaking out of our lazy approach for just + // this level. Also, some plugins (like Flash Player) will read + // nodes immediately upon insertion into the DOM, so + // must also be populated prior to insertion into the DOM. + if (tree.node.nodeType === DOCUMENT_FRAGMENT_NODE_TYPE || tree.node.nodeType === ELEMENT_NODE_TYPE && tree.node.nodeName.toLowerCase() === 'object' && (tree.node.namespaceURI == null || tree.node.namespaceURI === DOMNamespaces.html)) { + insertTreeChildren(tree); + parentNode.insertBefore(tree.node, referenceNode); + } else { + parentNode.insertBefore(tree.node, referenceNode); + insertTreeChildren(tree); + } +}); + +function replaceChildWithTree(oldNode, newTree) { + oldNode.parentNode.replaceChild(newTree.node, oldNode); + insertTreeChildren(newTree); +} + +function queueChild(parentTree, childTree) { + if (enableLazy) { + parentTree.children.push(childTree); + } else { + parentTree.node.appendChild(childTree.node); + } +} + +function queueHTML(tree, html) { + if (enableLazy) { + tree.html = html; + } else { + setInnerHTML(tree.node, html); + } +} + +function queueText(tree, text) { + if (enableLazy) { + tree.text = text; + } else { + setTextContent(tree.node, text); + } +} + +function toString() { + return this.node.nodeName; +} + +function DOMLazyTree(node) { + return { + node: node, + children: [], + html: null, + text: null, + toString: toString + }; +} + +DOMLazyTree.insertTreeBefore = insertTreeBefore; +DOMLazyTree.replaceChildWithTree = replaceChildWithTree; +DOMLazyTree.queueChild = queueChild; +DOMLazyTree.queueHTML = queueHTML; +DOMLazyTree.queueText = queueText; + +module.exports = DOMLazyTree; +},{"./DOMNamespaces":56,"./createMicrosoftUnsafeLocalFunction":165,"./setInnerHTML":187,"./setTextContent":188}],56:[function(require,module,exports){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule DOMNamespaces + */ + +'use strict'; + +var DOMNamespaces = { + html: 'http://www.w3.org/1999/xhtml', + mathml: 'http://www.w3.org/1998/Math/MathML', + svg: 'http://www.w3.org/2000/svg' +}; + +module.exports = DOMNamespaces; +},{}],57:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule DOMProperty + */ + +'use strict'; + +var _prodInvariant = require('./reactProdInvariant'); + +var invariant = require('fbjs/lib/invariant'); + +function checkMask(value, bitmask) { + return (value & bitmask) === bitmask; +} + +var DOMPropertyInjection = { + /** + * Mapping from normalized, camelcased property names to a configuration that + * specifies how the associated DOM property should be accessed or rendered. + */ + MUST_USE_PROPERTY: 0x1, + HAS_BOOLEAN_VALUE: 0x4, + HAS_NUMERIC_VALUE: 0x8, + HAS_POSITIVE_NUMERIC_VALUE: 0x10 | 0x8, + HAS_OVERLOADED_BOOLEAN_VALUE: 0x20, + + /** + * Inject some specialized knowledge about the DOM. This takes a config object + * with the following properties: + * + * isCustomAttribute: function that given an attribute name will return true + * if it can be inserted into the DOM verbatim. Useful for data-* or aria-* + * attributes where it's impossible to enumerate all of the possible + * attribute names, + * + * Properties: object mapping DOM property name to one of the + * DOMPropertyInjection constants or null. If your attribute isn't in here, + * it won't get written to the DOM. + * + * DOMAttributeNames: object mapping React attribute name to the DOM + * attribute name. Attribute names not specified use the **lowercase** + * normalized name. + * + * DOMAttributeNamespaces: object mapping React attribute name to the DOM + * attribute namespace URL. (Attribute names not specified use no namespace.) + * + * DOMPropertyNames: similar to DOMAttributeNames but for DOM properties. + * Property names not specified use the normalized name. + * + * DOMMutationMethods: Properties that require special mutation methods. If + * `value` is undefined, the mutation method should unset the property. + * + * @param {object} domPropertyConfig the config as described above. + */ + injectDOMPropertyConfig: function (domPropertyConfig) { + var Injection = DOMPropertyInjection; + var Properties = domPropertyConfig.Properties || {}; + var DOMAttributeNamespaces = domPropertyConfig.DOMAttributeNamespaces || {}; + var DOMAttributeNames = domPropertyConfig.DOMAttributeNames || {}; + var DOMPropertyNames = domPropertyConfig.DOMPropertyNames || {}; + var DOMMutationMethods = domPropertyConfig.DOMMutationMethods || {}; + + if (domPropertyConfig.isCustomAttribute) { + DOMProperty._isCustomAttributeFunctions.push(domPropertyConfig.isCustomAttribute); + } + + for (var propName in Properties) { + !!DOMProperty.properties.hasOwnProperty(propName) ? process.env.NODE_ENV !== 'production' ? invariant(false, 'injectDOMPropertyConfig(...): You\'re trying to inject DOM property \'%s\' which has already been injected. You may be accidentally injecting the same DOM property config twice, or you may be injecting two configs that have conflicting property names.', propName) : _prodInvariant('48', propName) : void 0; + + var lowerCased = propName.toLowerCase(); + var propConfig = Properties[propName]; + + var propertyInfo = { + attributeName: lowerCased, + attributeNamespace: null, + propertyName: propName, + mutationMethod: null, + + mustUseProperty: checkMask(propConfig, Injection.MUST_USE_PROPERTY), + hasBooleanValue: checkMask(propConfig, Injection.HAS_BOOLEAN_VALUE), + hasNumericValue: checkMask(propConfig, Injection.HAS_NUMERIC_VALUE), + hasPositiveNumericValue: checkMask(propConfig, Injection.HAS_POSITIVE_NUMERIC_VALUE), + hasOverloadedBooleanValue: checkMask(propConfig, Injection.HAS_OVERLOADED_BOOLEAN_VALUE) + }; + !(propertyInfo.hasBooleanValue + propertyInfo.hasNumericValue + propertyInfo.hasOverloadedBooleanValue <= 1) ? process.env.NODE_ENV !== 'production' ? invariant(false, 'DOMProperty: Value can be one of boolean, overloaded boolean, or numeric value, but not a combination: %s', propName) : _prodInvariant('50', propName) : void 0; + + if (process.env.NODE_ENV !== 'production') { + DOMProperty.getPossibleStandardName[lowerCased] = propName; + } + + if (DOMAttributeNames.hasOwnProperty(propName)) { + var attributeName = DOMAttributeNames[propName]; + propertyInfo.attributeName = attributeName; + if (process.env.NODE_ENV !== 'production') { + DOMProperty.getPossibleStandardName[attributeName] = propName; + } + } + + if (DOMAttributeNamespaces.hasOwnProperty(propName)) { + propertyInfo.attributeNamespace = DOMAttributeNamespaces[propName]; + } + + if (DOMPropertyNames.hasOwnProperty(propName)) { + propertyInfo.propertyName = DOMPropertyNames[propName]; + } + + if (DOMMutationMethods.hasOwnProperty(propName)) { + propertyInfo.mutationMethod = DOMMutationMethods[propName]; + } + + DOMProperty.properties[propName] = propertyInfo; + } + } +}; + +/* eslint-disable max-len */ +var ATTRIBUTE_NAME_START_CHAR = ':A-Z_a-z\\u00C0-\\u00D6\\u00D8-\\u00F6\\u00F8-\\u02FF\\u0370-\\u037D\\u037F-\\u1FFF\\u200C-\\u200D\\u2070-\\u218F\\u2C00-\\u2FEF\\u3001-\\uD7FF\\uF900-\\uFDCF\\uFDF0-\\uFFFD'; +/* eslint-enable max-len */ + +/** + * DOMProperty exports lookup objects that can be used like functions: + * + * > DOMProperty.isValid['id'] + * true + * > DOMProperty.isValid['foobar'] + * undefined + * + * Although this may be confusing, it performs better in general. + * + * @see http://jsperf.com/key-exists + * @see http://jsperf.com/key-missing + */ +var DOMProperty = { + + ID_ATTRIBUTE_NAME: 'data-reactid', + ROOT_ATTRIBUTE_NAME: 'data-reactroot', + + ATTRIBUTE_NAME_START_CHAR: ATTRIBUTE_NAME_START_CHAR, + ATTRIBUTE_NAME_CHAR: ATTRIBUTE_NAME_START_CHAR + '\\-.0-9\\u00B7\\u0300-\\u036F\\u203F-\\u2040', + + /** + * Map from property "standard name" to an object with info about how to set + * the property in the DOM. Each object contains: + * + * attributeName: + * Used when rendering markup or with `*Attribute()`. + * attributeNamespace + * propertyName: + * Used on DOM node instances. (This includes properties that mutate due to + * external factors.) + * mutationMethod: + * If non-null, used instead of the property or `setAttribute()` after + * initial render. + * mustUseProperty: + * Whether the property must be accessed and mutated as an object property. + * hasBooleanValue: + * Whether the property should be removed when set to a falsey value. + * hasNumericValue: + * Whether the property must be numeric or parse as a numeric and should be + * removed when set to a falsey value. + * hasPositiveNumericValue: + * Whether the property must be positive numeric or parse as a positive + * numeric and should be removed when set to a falsey value. + * hasOverloadedBooleanValue: + * Whether the property can be used as a flag as well as with a value. + * Removed when strictly equal to false; present without a value when + * strictly equal to true; present with a value otherwise. + */ + properties: {}, + + /** + * Mapping from lowercase property names to the properly cased version, used + * to warn in the case of missing properties. Available only in __DEV__. + * @type {Object} + */ + getPossibleStandardName: process.env.NODE_ENV !== 'production' ? {} : null, + + /** + * All of the isCustomAttribute() functions that have been injected. + */ + _isCustomAttributeFunctions: [], + + /** + * Checks whether a property name is a custom attribute. + * @method + */ + isCustomAttribute: function (attributeName) { + for (var i = 0; i < DOMProperty._isCustomAttributeFunctions.length; i++) { + var isCustomAttributeFn = DOMProperty._isCustomAttributeFunctions[i]; + if (isCustomAttributeFn(attributeName)) { + return true; + } + } + return false; + }, + + injection: DOMPropertyInjection +}; + +module.exports = DOMProperty; +}).call(this,require('_process')) + +},{"./reactProdInvariant":185,"_process":40,"fbjs/lib/invariant":207}],58:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule DOMPropertyOperations + */ + +'use strict'; + +var DOMProperty = require('./DOMProperty'); +var ReactDOMComponentTree = require('./ReactDOMComponentTree'); +var ReactDOMInstrumentation = require('./ReactDOMInstrumentation'); +var ReactInstrumentation = require('./ReactInstrumentation'); + +var quoteAttributeValueForBrowser = require('./quoteAttributeValueForBrowser'); +var warning = require('fbjs/lib/warning'); + +var VALID_ATTRIBUTE_NAME_REGEX = new RegExp('^[' + DOMProperty.ATTRIBUTE_NAME_START_CHAR + '][' + DOMProperty.ATTRIBUTE_NAME_CHAR + ']*$'); +var illegalAttributeNameCache = {}; +var validatedAttributeNameCache = {}; + +function isAttributeNameSafe(attributeName) { + if (validatedAttributeNameCache.hasOwnProperty(attributeName)) { + return true; + } + if (illegalAttributeNameCache.hasOwnProperty(attributeName)) { + return false; + } + if (VALID_ATTRIBUTE_NAME_REGEX.test(attributeName)) { + validatedAttributeNameCache[attributeName] = true; + return true; + } + illegalAttributeNameCache[attributeName] = true; + process.env.NODE_ENV !== 'production' ? warning(false, 'Invalid attribute name: `%s`', attributeName) : void 0; + return false; +} + +function shouldIgnoreValue(propertyInfo, value) { + return value == null || propertyInfo.hasBooleanValue && !value || propertyInfo.hasNumericValue && isNaN(value) || propertyInfo.hasPositiveNumericValue && value < 1 || propertyInfo.hasOverloadedBooleanValue && value === false; +} + +/** + * Operations for dealing with DOM properties. + */ +var DOMPropertyOperations = { + + /** + * Creates markup for the ID property. + * + * @param {string} id Unescaped ID. + * @return {string} Markup string. + */ + createMarkupForID: function (id) { + return DOMProperty.ID_ATTRIBUTE_NAME + '=' + quoteAttributeValueForBrowser(id); + }, + + setAttributeForID: function (node, id) { + node.setAttribute(DOMProperty.ID_ATTRIBUTE_NAME, id); + }, + + createMarkupForRoot: function () { + return DOMProperty.ROOT_ATTRIBUTE_NAME + '=""'; + }, + + setAttributeForRoot: function (node) { + node.setAttribute(DOMProperty.ROOT_ATTRIBUTE_NAME, ''); + }, + + /** + * Creates markup for a property. + * + * @param {string} name + * @param {*} value + * @return {?string} Markup string, or null if the property was invalid. + */ + createMarkupForProperty: function (name, value) { + if (process.env.NODE_ENV !== 'production') { + ReactDOMInstrumentation.debugTool.onCreateMarkupForProperty(name, value); + } + var propertyInfo = DOMProperty.properties.hasOwnProperty(name) ? DOMProperty.properties[name] : null; + if (propertyInfo) { + if (shouldIgnoreValue(propertyInfo, value)) { + return ''; + } + var attributeName = propertyInfo.attributeName; + if (propertyInfo.hasBooleanValue || propertyInfo.hasOverloadedBooleanValue && value === true) { + return attributeName + '=""'; + } + return attributeName + '=' + quoteAttributeValueForBrowser(value); + } else if (DOMProperty.isCustomAttribute(name)) { + if (value == null) { + return ''; + } + return name + '=' + quoteAttributeValueForBrowser(value); + } + return null; + }, + + /** + * Creates markup for a custom property. + * + * @param {string} name + * @param {*} value + * @return {string} Markup string, or empty string if the property was invalid. + */ + createMarkupForCustomAttribute: function (name, value) { + if (!isAttributeNameSafe(name) || value == null) { + return ''; + } + return name + '=' + quoteAttributeValueForBrowser(value); + }, + + /** + * Sets the value for a property on a node. + * + * @param {DOMElement} node + * @param {string} name + * @param {*} value + */ + setValueForProperty: function (node, name, value) { + var propertyInfo = DOMProperty.properties.hasOwnProperty(name) ? DOMProperty.properties[name] : null; + if (propertyInfo) { + var mutationMethod = propertyInfo.mutationMethod; + if (mutationMethod) { + mutationMethod(node, value); + } else if (shouldIgnoreValue(propertyInfo, value)) { + this.deleteValueForProperty(node, name); + return; + } else if (propertyInfo.mustUseProperty) { + // Contrary to `setAttribute`, object properties are properly + // `toString`ed by IE8/9. + node[propertyInfo.propertyName] = value; + } else { + var attributeName = propertyInfo.attributeName; + var namespace = propertyInfo.attributeNamespace; + // `setAttribute` with objects becomes only `[object]` in IE8/9, + // ('' + value) makes it output the correct toString()-value. + if (namespace) { + node.setAttributeNS(namespace, attributeName, '' + value); + } else if (propertyInfo.hasBooleanValue || propertyInfo.hasOverloadedBooleanValue && value === true) { + node.setAttribute(attributeName, ''); + } else { + node.setAttribute(attributeName, '' + value); + } + } + } else if (DOMProperty.isCustomAttribute(name)) { + DOMPropertyOperations.setValueForAttribute(node, name, value); + return; + } + + if (process.env.NODE_ENV !== 'production') { + ReactDOMInstrumentation.debugTool.onSetValueForProperty(node, name, value); + var payload = {}; + payload[name] = value; + ReactInstrumentation.debugTool.onHostOperation(ReactDOMComponentTree.getInstanceFromNode(node)._debugID, 'update attribute', payload); + } + }, + + setValueForAttribute: function (node, name, value) { + if (!isAttributeNameSafe(name)) { + return; + } + if (value == null) { + node.removeAttribute(name); + } else { + node.setAttribute(name, '' + value); + } + + if (process.env.NODE_ENV !== 'production') { + var payload = {}; + payload[name] = value; + ReactInstrumentation.debugTool.onHostOperation(ReactDOMComponentTree.getInstanceFromNode(node)._debugID, 'update attribute', payload); + } + }, + + /** + * Deletes an attributes from a node. + * + * @param {DOMElement} node + * @param {string} name + */ + deleteValueForAttribute: function (node, name) { + node.removeAttribute(name); + if (process.env.NODE_ENV !== 'production') { + ReactDOMInstrumentation.debugTool.onDeleteValueForProperty(node, name); + ReactInstrumentation.debugTool.onHostOperation(ReactDOMComponentTree.getInstanceFromNode(node)._debugID, 'remove attribute', name); + } + }, + + /** + * Deletes the value for a property on a node. + * + * @param {DOMElement} node + * @param {string} name + */ + deleteValueForProperty: function (node, name) { + var propertyInfo = DOMProperty.properties.hasOwnProperty(name) ? DOMProperty.properties[name] : null; + if (propertyInfo) { + var mutationMethod = propertyInfo.mutationMethod; + if (mutationMethod) { + mutationMethod(node, undefined); + } else if (propertyInfo.mustUseProperty) { + var propName = propertyInfo.propertyName; + if (propertyInfo.hasBooleanValue) { + node[propName] = false; + } else { + node[propName] = ''; + } + } else { + node.removeAttribute(propertyInfo.attributeName); + } + } else if (DOMProperty.isCustomAttribute(name)) { + node.removeAttribute(name); + } + + if (process.env.NODE_ENV !== 'production') { + ReactDOMInstrumentation.debugTool.onDeleteValueForProperty(node, name); + ReactInstrumentation.debugTool.onHostOperation(ReactDOMComponentTree.getInstanceFromNode(node)._debugID, 'remove attribute', name); + } + } + +}; + +module.exports = DOMPropertyOperations; +}).call(this,require('_process')) + +},{"./DOMProperty":57,"./ReactDOMComponentTree":89,"./ReactDOMInstrumentation":97,"./ReactInstrumentation":121,"./quoteAttributeValueForBrowser":184,"_process":40,"fbjs/lib/warning":217}],59:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule Danger + */ + +'use strict'; + +var _prodInvariant = require('./reactProdInvariant'); + +var DOMLazyTree = require('./DOMLazyTree'); +var ExecutionEnvironment = require('fbjs/lib/ExecutionEnvironment'); + +var createNodesFromMarkup = require('fbjs/lib/createNodesFromMarkup'); +var emptyFunction = require('fbjs/lib/emptyFunction'); +var invariant = require('fbjs/lib/invariant'); + +var Danger = { + + /** + * Replaces a node with a string of markup at its current position within its + * parent. The markup must render into a single root node. + * + * @param {DOMElement} oldChild Child node to replace. + * @param {string} markup Markup to render in place of the child node. + * @internal + */ + dangerouslyReplaceNodeWithMarkup: function (oldChild, markup) { + !ExecutionEnvironment.canUseDOM ? process.env.NODE_ENV !== 'production' ? invariant(false, 'dangerouslyReplaceNodeWithMarkup(...): Cannot render markup in a worker thread. Make sure `window` and `document` are available globally before requiring React when unit testing or use ReactDOMServer.renderToString() for server rendering.') : _prodInvariant('56') : void 0; + !markup ? process.env.NODE_ENV !== 'production' ? invariant(false, 'dangerouslyReplaceNodeWithMarkup(...): Missing markup.') : _prodInvariant('57') : void 0; + !(oldChild.nodeName !== 'HTML') ? process.env.NODE_ENV !== 'production' ? invariant(false, 'dangerouslyReplaceNodeWithMarkup(...): Cannot replace markup of the node. This is because browser quirks make this unreliable and/or slow. If you want to render to the root you must use server rendering. See ReactDOMServer.renderToString().') : _prodInvariant('58') : void 0; + + if (typeof markup === 'string') { + var newChild = createNodesFromMarkup(markup, emptyFunction)[0]; + oldChild.parentNode.replaceChild(newChild, oldChild); + } else { + DOMLazyTree.replaceChildWithTree(oldChild, markup); + } + } + +}; + +module.exports = Danger; +}).call(this,require('_process')) + +},{"./DOMLazyTree":55,"./reactProdInvariant":185,"_process":40,"fbjs/lib/ExecutionEnvironment":193,"fbjs/lib/createNodesFromMarkup":198,"fbjs/lib/emptyFunction":199,"fbjs/lib/invariant":207}],60:[function(require,module,exports){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule DefaultEventPluginOrder + */ + +'use strict'; + +var keyOf = require('fbjs/lib/keyOf'); + +/** + * Module that is injectable into `EventPluginHub`, that specifies a + * deterministic ordering of `EventPlugin`s. A convenient way to reason about + * plugins, without having to package every one of them. This is better than + * having plugins be ordered in the same order that they are injected because + * that ordering would be influenced by the packaging order. + * `ResponderEventPlugin` must occur before `SimpleEventPlugin` so that + * preventing default on events is convenient in `SimpleEventPlugin` handlers. + */ +var DefaultEventPluginOrder = [keyOf({ ResponderEventPlugin: null }), keyOf({ SimpleEventPlugin: null }), keyOf({ TapEventPlugin: null }), keyOf({ EnterLeaveEventPlugin: null }), keyOf({ ChangeEventPlugin: null }), keyOf({ SelectEventPlugin: null }), keyOf({ BeforeInputEventPlugin: null })]; + +module.exports = DefaultEventPluginOrder; +},{"fbjs/lib/keyOf":211}],61:[function(require,module,exports){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule DisabledInputUtils + */ + +'use strict'; + +var disableableMouseListenerNames = { + onClick: true, + onDoubleClick: true, + onMouseDown: true, + onMouseMove: true, + onMouseUp: true, + + onClickCapture: true, + onDoubleClickCapture: true, + onMouseDownCapture: true, + onMouseMoveCapture: true, + onMouseUpCapture: true +}; + +/** + * Implements a host component that does not receive mouse events + * when `disabled` is set. + */ +var DisabledInputUtils = { + getHostProps: function (inst, props) { + if (!props.disabled) { + return props; + } + + // Copy the props, except the mouse listeners + var hostProps = {}; + for (var key in props) { + if (!disableableMouseListenerNames[key] && props.hasOwnProperty(key)) { + hostProps[key] = props[key]; + } + } + + return hostProps; + } +}; + +module.exports = DisabledInputUtils; +},{}],62:[function(require,module,exports){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule EnterLeaveEventPlugin + */ + +'use strict'; + +var EventConstants = require('./EventConstants'); +var EventPropagators = require('./EventPropagators'); +var ReactDOMComponentTree = require('./ReactDOMComponentTree'); +var SyntheticMouseEvent = require('./SyntheticMouseEvent'); + +var keyOf = require('fbjs/lib/keyOf'); + +var topLevelTypes = EventConstants.topLevelTypes; + +var eventTypes = { + mouseEnter: { + registrationName: keyOf({ onMouseEnter: null }), + dependencies: [topLevelTypes.topMouseOut, topLevelTypes.topMouseOver] + }, + mouseLeave: { + registrationName: keyOf({ onMouseLeave: null }), + dependencies: [topLevelTypes.topMouseOut, topLevelTypes.topMouseOver] + } +}; + +var EnterLeaveEventPlugin = { + + eventTypes: eventTypes, + + /** + * For almost every interaction we care about, there will be both a top-level + * `mouseover` and `mouseout` event that occurs. Only use `mouseout` so that + * we do not extract duplicate events. However, moving the mouse into the + * browser from outside will not fire a `mouseout` event. In this case, we use + * the `mouseover` top-level event. + */ + extractEvents: function (topLevelType, targetInst, nativeEvent, nativeEventTarget) { + if (topLevelType === topLevelTypes.topMouseOver && (nativeEvent.relatedTarget || nativeEvent.fromElement)) { + return null; + } + if (topLevelType !== topLevelTypes.topMouseOut && topLevelType !== topLevelTypes.topMouseOver) { + // Must not be a mouse in or mouse out - ignoring. + return null; + } + + var win; + if (nativeEventTarget.window === nativeEventTarget) { + // `nativeEventTarget` is probably a window object. + win = nativeEventTarget; + } else { + // TODO: Figure out why `ownerDocument` is sometimes undefined in IE8. + var doc = nativeEventTarget.ownerDocument; + if (doc) { + win = doc.defaultView || doc.parentWindow; + } else { + win = window; + } + } + + var from; + var to; + if (topLevelType === topLevelTypes.topMouseOut) { + from = targetInst; + var related = nativeEvent.relatedTarget || nativeEvent.toElement; + to = related ? ReactDOMComponentTree.getClosestInstanceFromNode(related) : null; + } else { + // Moving to a node from outside the window. + from = null; + to = targetInst; + } + + if (from === to) { + // Nothing pertains to our managed components. + return null; + } + + var fromNode = from == null ? win : ReactDOMComponentTree.getNodeFromInstance(from); + var toNode = to == null ? win : ReactDOMComponentTree.getNodeFromInstance(to); + + var leave = SyntheticMouseEvent.getPooled(eventTypes.mouseLeave, from, nativeEvent, nativeEventTarget); + leave.type = 'mouseleave'; + leave.target = fromNode; + leave.relatedTarget = toNode; + + var enter = SyntheticMouseEvent.getPooled(eventTypes.mouseEnter, to, nativeEvent, nativeEventTarget); + enter.type = 'mouseenter'; + enter.target = toNode; + enter.relatedTarget = fromNode; + + EventPropagators.accumulateEnterLeaveDispatches(leave, enter, from, to); + + return [leave, enter]; + } + +}; + +module.exports = EnterLeaveEventPlugin; +},{"./EventConstants":63,"./EventPropagators":67,"./ReactDOMComponentTree":89,"./SyntheticMouseEvent":154,"fbjs/lib/keyOf":211}],63:[function(require,module,exports){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule EventConstants + */ + +'use strict'; + +var keyMirror = require('fbjs/lib/keyMirror'); + +var PropagationPhases = keyMirror({ bubbled: null, captured: null }); + +/** + * Types of raw signals from the browser caught at the top level. + */ +var topLevelTypes = keyMirror({ + topAbort: null, + topAnimationEnd: null, + topAnimationIteration: null, + topAnimationStart: null, + topBlur: null, + topCanPlay: null, + topCanPlayThrough: null, + topChange: null, + topClick: null, + topCompositionEnd: null, + topCompositionStart: null, + topCompositionUpdate: null, + topContextMenu: null, + topCopy: null, + topCut: null, + topDoubleClick: null, + topDrag: null, + topDragEnd: null, + topDragEnter: null, + topDragExit: null, + topDragLeave: null, + topDragOver: null, + topDragStart: null, + topDrop: null, + topDurationChange: null, + topEmptied: null, + topEncrypted: null, + topEnded: null, + topError: null, + topFocus: null, + topInput: null, + topInvalid: null, + topKeyDown: null, + topKeyPress: null, + topKeyUp: null, + topLoad: null, + topLoadedData: null, + topLoadedMetadata: null, + topLoadStart: null, + topMouseDown: null, + topMouseMove: null, + topMouseOut: null, + topMouseOver: null, + topMouseUp: null, + topPaste: null, + topPause: null, + topPlay: null, + topPlaying: null, + topProgress: null, + topRateChange: null, + topReset: null, + topScroll: null, + topSeeked: null, + topSeeking: null, + topSelectionChange: null, + topStalled: null, + topSubmit: null, + topSuspend: null, + topTextInput: null, + topTimeUpdate: null, + topTouchCancel: null, + topTouchEnd: null, + topTouchMove: null, + topTouchStart: null, + topTransitionEnd: null, + topVolumeChange: null, + topWaiting: null, + topWheel: null +}); + +var EventConstants = { + topLevelTypes: topLevelTypes, + PropagationPhases: PropagationPhases +}; + +module.exports = EventConstants; +},{"fbjs/lib/keyMirror":210}],64:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule EventPluginHub + */ + +'use strict'; + +var _prodInvariant = require('./reactProdInvariant'); + +var EventPluginRegistry = require('./EventPluginRegistry'); +var EventPluginUtils = require('./EventPluginUtils'); +var ReactErrorUtils = require('./ReactErrorUtils'); + +var accumulateInto = require('./accumulateInto'); +var forEachAccumulated = require('./forEachAccumulated'); +var invariant = require('fbjs/lib/invariant'); + +/** + * Internal store for event listeners + */ +var listenerBank = {}; + +/** + * Internal queue of events that have accumulated their dispatches and are + * waiting to have their dispatches executed. + */ +var eventQueue = null; + +/** + * Dispatches an event and releases it back into the pool, unless persistent. + * + * @param {?object} event Synthetic event to be dispatched. + * @param {boolean} simulated If the event is simulated (changes exn behavior) + * @private + */ +var executeDispatchesAndRelease = function (event, simulated) { + if (event) { + EventPluginUtils.executeDispatchesInOrder(event, simulated); + + if (!event.isPersistent()) { + event.constructor.release(event); + } + } +}; +var executeDispatchesAndReleaseSimulated = function (e) { + return executeDispatchesAndRelease(e, true); +}; +var executeDispatchesAndReleaseTopLevel = function (e) { + return executeDispatchesAndRelease(e, false); +}; + +var getDictionaryKey = function (inst) { + return '.' + inst._rootNodeID; +}; + +/** + * This is a unified interface for event plugins to be installed and configured. + * + * Event plugins can implement the following properties: + * + * `extractEvents` {function(string, DOMEventTarget, string, object): *} + * Required. When a top-level event is fired, this method is expected to + * extract synthetic events that will in turn be queued and dispatched. + * + * `eventTypes` {object} + * Optional, plugins that fire events must publish a mapping of registration + * names that are used to register listeners. Values of this mapping must + * be objects that contain `registrationName` or `phasedRegistrationNames`. + * + * `executeDispatch` {function(object, function, string)} + * Optional, allows plugins to override how an event gets dispatched. By + * default, the listener is simply invoked. + * + * Each plugin that is injected into `EventsPluginHub` is immediately operable. + * + * @public + */ +var EventPluginHub = { + + /** + * Methods for injecting dependencies. + */ + injection: { + + /** + * @param {array} InjectedEventPluginOrder + * @public + */ + injectEventPluginOrder: EventPluginRegistry.injectEventPluginOrder, + + /** + * @param {object} injectedNamesToPlugins Map from names to plugin modules. + */ + injectEventPluginsByName: EventPluginRegistry.injectEventPluginsByName + + }, + + /** + * Stores `listener` at `listenerBank[registrationName][key]`. Is idempotent. + * + * @param {object} inst The instance, which is the source of events. + * @param {string} registrationName Name of listener (e.g. `onClick`). + * @param {function} listener The callback to store. + */ + putListener: function (inst, registrationName, listener) { + !(typeof listener === 'function') ? process.env.NODE_ENV !== 'production' ? invariant(false, 'Expected %s listener to be a function, instead got type %s', registrationName, typeof listener) : _prodInvariant('94', registrationName, typeof listener) : void 0; + + var key = getDictionaryKey(inst); + var bankForRegistrationName = listenerBank[registrationName] || (listenerBank[registrationName] = {}); + bankForRegistrationName[key] = listener; + + var PluginModule = EventPluginRegistry.registrationNameModules[registrationName]; + if (PluginModule && PluginModule.didPutListener) { + PluginModule.didPutListener(inst, registrationName, listener); + } + }, + + /** + * @param {object} inst The instance, which is the source of events. + * @param {string} registrationName Name of listener (e.g. `onClick`). + * @return {?function} The stored callback. + */ + getListener: function (inst, registrationName) { + var bankForRegistrationName = listenerBank[registrationName]; + var key = getDictionaryKey(inst); + return bankForRegistrationName && bankForRegistrationName[key]; + }, + + /** + * Deletes a listener from the registration bank. + * + * @param {object} inst The instance, which is the source of events. + * @param {string} registrationName Name of listener (e.g. `onClick`). + */ + deleteListener: function (inst, registrationName) { + var PluginModule = EventPluginRegistry.registrationNameModules[registrationName]; + if (PluginModule && PluginModule.willDeleteListener) { + PluginModule.willDeleteListener(inst, registrationName); + } + + var bankForRegistrationName = listenerBank[registrationName]; + // TODO: This should never be null -- when is it? + if (bankForRegistrationName) { + var key = getDictionaryKey(inst); + delete bankForRegistrationName[key]; + } + }, + + /** + * Deletes all listeners for the DOM element with the supplied ID. + * + * @param {object} inst The instance, which is the source of events. + */ + deleteAllListeners: function (inst) { + var key = getDictionaryKey(inst); + for (var registrationName in listenerBank) { + if (!listenerBank.hasOwnProperty(registrationName)) { + continue; + } + + if (!listenerBank[registrationName][key]) { + continue; + } + + var PluginModule = EventPluginRegistry.registrationNameModules[registrationName]; + if (PluginModule && PluginModule.willDeleteListener) { + PluginModule.willDeleteListener(inst, registrationName); + } + + delete listenerBank[registrationName][key]; + } + }, + + /** + * Allows registered plugins an opportunity to extract events from top-level + * native browser events. + * + * @return {*} An accumulation of synthetic events. + * @internal + */ + extractEvents: function (topLevelType, targetInst, nativeEvent, nativeEventTarget) { + var events; + var plugins = EventPluginRegistry.plugins; + for (var i = 0; i < plugins.length; i++) { + // Not every plugin in the ordering may be loaded at runtime. + var possiblePlugin = plugins[i]; + if (possiblePlugin) { + var extractedEvents = possiblePlugin.extractEvents(topLevelType, targetInst, nativeEvent, nativeEventTarget); + if (extractedEvents) { + events = accumulateInto(events, extractedEvents); + } + } + } + return events; + }, + + /** + * Enqueues a synthetic event that should be dispatched when + * `processEventQueue` is invoked. + * + * @param {*} events An accumulation of synthetic events. + * @internal + */ + enqueueEvents: function (events) { + if (events) { + eventQueue = accumulateInto(eventQueue, events); + } + }, + + /** + * Dispatches all synthetic events on the event queue. + * + * @internal + */ + processEventQueue: function (simulated) { + // Set `eventQueue` to null before processing it so that we can tell if more + // events get enqueued while processing. + var processingEventQueue = eventQueue; + eventQueue = null; + if (simulated) { + forEachAccumulated(processingEventQueue, executeDispatchesAndReleaseSimulated); + } else { + forEachAccumulated(processingEventQueue, executeDispatchesAndReleaseTopLevel); + } + !!eventQueue ? process.env.NODE_ENV !== 'production' ? invariant(false, 'processEventQueue(): Additional events were enqueued while processing an event queue. Support for this has not yet been implemented.') : _prodInvariant('95') : void 0; + // This would be a good time to rethrow if any of the event handlers threw. + ReactErrorUtils.rethrowCaughtError(); + }, + + /** + * These are needed for tests only. Do not use! + */ + __purge: function () { + listenerBank = {}; + }, + + __getListenerBank: function () { + return listenerBank; + } + +}; + +module.exports = EventPluginHub; +}).call(this,require('_process')) + +},{"./EventPluginRegistry":65,"./EventPluginUtils":66,"./ReactErrorUtils":112,"./accumulateInto":161,"./forEachAccumulated":170,"./reactProdInvariant":185,"_process":40,"fbjs/lib/invariant":207}],65:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule EventPluginRegistry + */ + +'use strict'; + +var _prodInvariant = require('./reactProdInvariant'); + +var invariant = require('fbjs/lib/invariant'); + +/** + * Injectable ordering of event plugins. + */ +var EventPluginOrder = null; + +/** + * Injectable mapping from names to event plugin modules. + */ +var namesToPlugins = {}; + +/** + * Recomputes the plugin list using the injected plugins and plugin ordering. + * + * @private + */ +function recomputePluginOrdering() { + if (!EventPluginOrder) { + // Wait until an `EventPluginOrder` is injected. + return; + } + for (var pluginName in namesToPlugins) { + var PluginModule = namesToPlugins[pluginName]; + var pluginIndex = EventPluginOrder.indexOf(pluginName); + !(pluginIndex > -1) ? process.env.NODE_ENV !== 'production' ? invariant(false, 'EventPluginRegistry: Cannot inject event plugins that do not exist in the plugin ordering, `%s`.', pluginName) : _prodInvariant('96', pluginName) : void 0; + if (EventPluginRegistry.plugins[pluginIndex]) { + continue; + } + !PluginModule.extractEvents ? process.env.NODE_ENV !== 'production' ? invariant(false, 'EventPluginRegistry: Event plugins must implement an `extractEvents` method, but `%s` does not.', pluginName) : _prodInvariant('97', pluginName) : void 0; + EventPluginRegistry.plugins[pluginIndex] = PluginModule; + var publishedEvents = PluginModule.eventTypes; + for (var eventName in publishedEvents) { + !publishEventForPlugin(publishedEvents[eventName], PluginModule, eventName) ? process.env.NODE_ENV !== 'production' ? invariant(false, 'EventPluginRegistry: Failed to publish event `%s` for plugin `%s`.', eventName, pluginName) : _prodInvariant('98', eventName, pluginName) : void 0; + } + } +} + +/** + * Publishes an event so that it can be dispatched by the supplied plugin. + * + * @param {object} dispatchConfig Dispatch configuration for the event. + * @param {object} PluginModule Plugin publishing the event. + * @return {boolean} True if the event was successfully published. + * @private + */ +function publishEventForPlugin(dispatchConfig, PluginModule, eventName) { + !!EventPluginRegistry.eventNameDispatchConfigs.hasOwnProperty(eventName) ? process.env.NODE_ENV !== 'production' ? invariant(false, 'EventPluginHub: More than one plugin attempted to publish the same event name, `%s`.', eventName) : _prodInvariant('99', eventName) : void 0; + EventPluginRegistry.eventNameDispatchConfigs[eventName] = dispatchConfig; + + var phasedRegistrationNames = dispatchConfig.phasedRegistrationNames; + if (phasedRegistrationNames) { + for (var phaseName in phasedRegistrationNames) { + if (phasedRegistrationNames.hasOwnProperty(phaseName)) { + var phasedRegistrationName = phasedRegistrationNames[phaseName]; + publishRegistrationName(phasedRegistrationName, PluginModule, eventName); + } + } + return true; + } else if (dispatchConfig.registrationName) { + publishRegistrationName(dispatchConfig.registrationName, PluginModule, eventName); + return true; + } + return false; +} + +/** + * Publishes a registration name that is used to identify dispatched events and + * can be used with `EventPluginHub.putListener` to register listeners. + * + * @param {string} registrationName Registration name to add. + * @param {object} PluginModule Plugin publishing the event. + * @private + */ +function publishRegistrationName(registrationName, PluginModule, eventName) { + !!EventPluginRegistry.registrationNameModules[registrationName] ? process.env.NODE_ENV !== 'production' ? invariant(false, 'EventPluginHub: More than one plugin attempted to publish the same registration name, `%s`.', registrationName) : _prodInvariant('100', registrationName) : void 0; + EventPluginRegistry.registrationNameModules[registrationName] = PluginModule; + EventPluginRegistry.registrationNameDependencies[registrationName] = PluginModule.eventTypes[eventName].dependencies; + + if (process.env.NODE_ENV !== 'production') { + var lowerCasedName = registrationName.toLowerCase(); + EventPluginRegistry.possibleRegistrationNames[lowerCasedName] = registrationName; + + if (registrationName === 'onDoubleClick') { + EventPluginRegistry.possibleRegistrationNames.ondblclick = registrationName; + } + } +} + +/** + * Registers plugins so that they can extract and dispatch events. + * + * @see {EventPluginHub} + */ +var EventPluginRegistry = { + + /** + * Ordered list of injected plugins. + */ + plugins: [], + + /** + * Mapping from event name to dispatch config + */ + eventNameDispatchConfigs: {}, + + /** + * Mapping from registration name to plugin module + */ + registrationNameModules: {}, + + /** + * Mapping from registration name to event name + */ + registrationNameDependencies: {}, + + /** + * Mapping from lowercase registration names to the properly cased version, + * used to warn in the case of missing event handlers. Available + * only in __DEV__. + * @type {Object} + */ + possibleRegistrationNames: process.env.NODE_ENV !== 'production' ? {} : null, + + /** + * Injects an ordering of plugins (by plugin name). This allows the ordering + * to be decoupled from injection of the actual plugins so that ordering is + * always deterministic regardless of packaging, on-the-fly injection, etc. + * + * @param {array} InjectedEventPluginOrder + * @internal + * @see {EventPluginHub.injection.injectEventPluginOrder} + */ + injectEventPluginOrder: function (InjectedEventPluginOrder) { + !!EventPluginOrder ? process.env.NODE_ENV !== 'production' ? invariant(false, 'EventPluginRegistry: Cannot inject event plugin ordering more than once. You are likely trying to load more than one copy of React.') : _prodInvariant('101') : void 0; + // Clone the ordering so it cannot be dynamically mutated. + EventPluginOrder = Array.prototype.slice.call(InjectedEventPluginOrder); + recomputePluginOrdering(); + }, + + /** + * Injects plugins to be used by `EventPluginHub`. The plugin names must be + * in the ordering injected by `injectEventPluginOrder`. + * + * Plugins can be injected as part of page initialization or on-the-fly. + * + * @param {object} injectedNamesToPlugins Map from names to plugin modules. + * @internal + * @see {EventPluginHub.injection.injectEventPluginsByName} + */ + injectEventPluginsByName: function (injectedNamesToPlugins) { + var isOrderingDirty = false; + for (var pluginName in injectedNamesToPlugins) { + if (!injectedNamesToPlugins.hasOwnProperty(pluginName)) { + continue; + } + var PluginModule = injectedNamesToPlugins[pluginName]; + if (!namesToPlugins.hasOwnProperty(pluginName) || namesToPlugins[pluginName] !== PluginModule) { + !!namesToPlugins[pluginName] ? process.env.NODE_ENV !== 'production' ? invariant(false, 'EventPluginRegistry: Cannot inject two different event plugins using the same name, `%s`.', pluginName) : _prodInvariant('102', pluginName) : void 0; + namesToPlugins[pluginName] = PluginModule; + isOrderingDirty = true; + } + } + if (isOrderingDirty) { + recomputePluginOrdering(); + } + }, + + /** + * Looks up the plugin for the supplied event. + * + * @param {object} event A synthetic event. + * @return {?object} The plugin that created the supplied event. + * @internal + */ + getPluginModuleForEvent: function (event) { + var dispatchConfig = event.dispatchConfig; + if (dispatchConfig.registrationName) { + return EventPluginRegistry.registrationNameModules[dispatchConfig.registrationName] || null; + } + for (var phase in dispatchConfig.phasedRegistrationNames) { + if (!dispatchConfig.phasedRegistrationNames.hasOwnProperty(phase)) { + continue; + } + var PluginModule = EventPluginRegistry.registrationNameModules[dispatchConfig.phasedRegistrationNames[phase]]; + if (PluginModule) { + return PluginModule; + } + } + return null; + }, + + /** + * Exposed for unit testing. + * @private + */ + _resetEventPlugins: function () { + EventPluginOrder = null; + for (var pluginName in namesToPlugins) { + if (namesToPlugins.hasOwnProperty(pluginName)) { + delete namesToPlugins[pluginName]; + } + } + EventPluginRegistry.plugins.length = 0; + + var eventNameDispatchConfigs = EventPluginRegistry.eventNameDispatchConfigs; + for (var eventName in eventNameDispatchConfigs) { + if (eventNameDispatchConfigs.hasOwnProperty(eventName)) { + delete eventNameDispatchConfigs[eventName]; + } + } + + var registrationNameModules = EventPluginRegistry.registrationNameModules; + for (var registrationName in registrationNameModules) { + if (registrationNameModules.hasOwnProperty(registrationName)) { + delete registrationNameModules[registrationName]; + } + } + + if (process.env.NODE_ENV !== 'production') { + var possibleRegistrationNames = EventPluginRegistry.possibleRegistrationNames; + for (var lowerCasedName in possibleRegistrationNames) { + if (possibleRegistrationNames.hasOwnProperty(lowerCasedName)) { + delete possibleRegistrationNames[lowerCasedName]; + } + } + } + } + +}; + +module.exports = EventPluginRegistry; +}).call(this,require('_process')) + +},{"./reactProdInvariant":185,"_process":40,"fbjs/lib/invariant":207}],66:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule EventPluginUtils + */ + +'use strict'; + +var _prodInvariant = require('./reactProdInvariant'); + +var EventConstants = require('./EventConstants'); +var ReactErrorUtils = require('./ReactErrorUtils'); + +var invariant = require('fbjs/lib/invariant'); +var warning = require('fbjs/lib/warning'); + +/** + * Injected dependencies: + */ + +/** + * - `ComponentTree`: [required] Module that can convert between React instances + * and actual node references. + */ +var ComponentTree; +var TreeTraversal; +var injection = { + injectComponentTree: function (Injected) { + ComponentTree = Injected; + if (process.env.NODE_ENV !== 'production') { + process.env.NODE_ENV !== 'production' ? warning(Injected && Injected.getNodeFromInstance && Injected.getInstanceFromNode, 'EventPluginUtils.injection.injectComponentTree(...): Injected ' + 'module is missing getNodeFromInstance or getInstanceFromNode.') : void 0; + } + }, + injectTreeTraversal: function (Injected) { + TreeTraversal = Injected; + if (process.env.NODE_ENV !== 'production') { + process.env.NODE_ENV !== 'production' ? warning(Injected && Injected.isAncestor && Injected.getLowestCommonAncestor, 'EventPluginUtils.injection.injectTreeTraversal(...): Injected ' + 'module is missing isAncestor or getLowestCommonAncestor.') : void 0; + } + } +}; + +var topLevelTypes = EventConstants.topLevelTypes; + +function isEndish(topLevelType) { + return topLevelType === topLevelTypes.topMouseUp || topLevelType === topLevelTypes.topTouchEnd || topLevelType === topLevelTypes.topTouchCancel; +} + +function isMoveish(topLevelType) { + return topLevelType === topLevelTypes.topMouseMove || topLevelType === topLevelTypes.topTouchMove; +} +function isStartish(topLevelType) { + return topLevelType === topLevelTypes.topMouseDown || topLevelType === topLevelTypes.topTouchStart; +} + +var validateEventDispatches; +if (process.env.NODE_ENV !== 'production') { + validateEventDispatches = function (event) { + var dispatchListeners = event._dispatchListeners; + var dispatchInstances = event._dispatchInstances; + + var listenersIsArr = Array.isArray(dispatchListeners); + var listenersLen = listenersIsArr ? dispatchListeners.length : dispatchListeners ? 1 : 0; + + var instancesIsArr = Array.isArray(dispatchInstances); + var instancesLen = instancesIsArr ? dispatchInstances.length : dispatchInstances ? 1 : 0; + + process.env.NODE_ENV !== 'production' ? warning(instancesIsArr === listenersIsArr && instancesLen === listenersLen, 'EventPluginUtils: Invalid `event`.') : void 0; + }; +} + +/** + * Dispatch the event to the listener. + * @param {SyntheticEvent} event SyntheticEvent to handle + * @param {boolean} simulated If the event is simulated (changes exn behavior) + * @param {function} listener Application-level callback + * @param {*} inst Internal component instance + */ +function executeDispatch(event, simulated, listener, inst) { + var type = event.type || 'unknown-event'; + event.currentTarget = EventPluginUtils.getNodeFromInstance(inst); + if (simulated) { + ReactErrorUtils.invokeGuardedCallbackWithCatch(type, listener, event); + } else { + ReactErrorUtils.invokeGuardedCallback(type, listener, event); + } + event.currentTarget = null; +} + +/** + * Standard/simple iteration through an event's collected dispatches. + */ +function executeDispatchesInOrder(event, simulated) { + var dispatchListeners = event._dispatchListeners; + var dispatchInstances = event._dispatchInstances; + if (process.env.NODE_ENV !== 'production') { + validateEventDispatches(event); + } + if (Array.isArray(dispatchListeners)) { + for (var i = 0; i < dispatchListeners.length; i++) { + if (event.isPropagationStopped()) { + break; + } + // Listeners and Instances are two parallel arrays that are always in sync. + executeDispatch(event, simulated, dispatchListeners[i], dispatchInstances[i]); + } + } else if (dispatchListeners) { + executeDispatch(event, simulated, dispatchListeners, dispatchInstances); + } + event._dispatchListeners = null; + event._dispatchInstances = null; +} + +/** + * Standard/simple iteration through an event's collected dispatches, but stops + * at the first dispatch execution returning true, and returns that id. + * + * @return {?string} id of the first dispatch execution who's listener returns + * true, or null if no listener returned true. + */ +function executeDispatchesInOrderStopAtTrueImpl(event) { + var dispatchListeners = event._dispatchListeners; + var dispatchInstances = event._dispatchInstances; + if (process.env.NODE_ENV !== 'production') { + validateEventDispatches(event); + } + if (Array.isArray(dispatchListeners)) { + for (var i = 0; i < dispatchListeners.length; i++) { + if (event.isPropagationStopped()) { + break; + } + // Listeners and Instances are two parallel arrays that are always in sync. + if (dispatchListeners[i](event, dispatchInstances[i])) { + return dispatchInstances[i]; + } + } + } else if (dispatchListeners) { + if (dispatchListeners(event, dispatchInstances)) { + return dispatchInstances; + } + } + return null; +} + +/** + * @see executeDispatchesInOrderStopAtTrueImpl + */ +function executeDispatchesInOrderStopAtTrue(event) { + var ret = executeDispatchesInOrderStopAtTrueImpl(event); + event._dispatchInstances = null; + event._dispatchListeners = null; + return ret; +} + +/** + * Execution of a "direct" dispatch - there must be at most one dispatch + * accumulated on the event or it is considered an error. It doesn't really make + * sense for an event with multiple dispatches (bubbled) to keep track of the + * return values at each dispatch execution, but it does tend to make sense when + * dealing with "direct" dispatches. + * + * @return {*} The return value of executing the single dispatch. + */ +function executeDirectDispatch(event) { + if (process.env.NODE_ENV !== 'production') { + validateEventDispatches(event); + } + var dispatchListener = event._dispatchListeners; + var dispatchInstance = event._dispatchInstances; + !!Array.isArray(dispatchListener) ? process.env.NODE_ENV !== 'production' ? invariant(false, 'executeDirectDispatch(...): Invalid `event`.') : _prodInvariant('103') : void 0; + event.currentTarget = dispatchListener ? EventPluginUtils.getNodeFromInstance(dispatchInstance) : null; + var res = dispatchListener ? dispatchListener(event) : null; + event.currentTarget = null; + event._dispatchListeners = null; + event._dispatchInstances = null; + return res; +} + +/** + * @param {SyntheticEvent} event + * @return {boolean} True iff number of dispatches accumulated is greater than 0. + */ +function hasDispatches(event) { + return !!event._dispatchListeners; +} + +/** + * General utilities that are useful in creating custom Event Plugins. + */ +var EventPluginUtils = { + isEndish: isEndish, + isMoveish: isMoveish, + isStartish: isStartish, + + executeDirectDispatch: executeDirectDispatch, + executeDispatchesInOrder: executeDispatchesInOrder, + executeDispatchesInOrderStopAtTrue: executeDispatchesInOrderStopAtTrue, + hasDispatches: hasDispatches, + + getInstanceFromNode: function (node) { + return ComponentTree.getInstanceFromNode(node); + }, + getNodeFromInstance: function (node) { + return ComponentTree.getNodeFromInstance(node); + }, + isAncestor: function (a, b) { + return TreeTraversal.isAncestor(a, b); + }, + getLowestCommonAncestor: function (a, b) { + return TreeTraversal.getLowestCommonAncestor(a, b); + }, + getParentInstance: function (inst) { + return TreeTraversal.getParentInstance(inst); + }, + traverseTwoPhase: function (target, fn, arg) { + return TreeTraversal.traverseTwoPhase(target, fn, arg); + }, + traverseEnterLeave: function (from, to, fn, argFrom, argTo) { + return TreeTraversal.traverseEnterLeave(from, to, fn, argFrom, argTo); + }, + + injection: injection +}; + +module.exports = EventPluginUtils; +}).call(this,require('_process')) + +},{"./EventConstants":63,"./ReactErrorUtils":112,"./reactProdInvariant":185,"_process":40,"fbjs/lib/invariant":207,"fbjs/lib/warning":217}],67:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule EventPropagators + */ + +'use strict'; + +var EventConstants = require('./EventConstants'); +var EventPluginHub = require('./EventPluginHub'); +var EventPluginUtils = require('./EventPluginUtils'); + +var accumulateInto = require('./accumulateInto'); +var forEachAccumulated = require('./forEachAccumulated'); +var warning = require('fbjs/lib/warning'); + +var PropagationPhases = EventConstants.PropagationPhases; +var getListener = EventPluginHub.getListener; + +/** + * Some event types have a notion of different registration names for different + * "phases" of propagation. This finds listeners by a given phase. + */ +function listenerAtPhase(inst, event, propagationPhase) { + var registrationName = event.dispatchConfig.phasedRegistrationNames[propagationPhase]; + return getListener(inst, registrationName); +} + +/** + * Tags a `SyntheticEvent` with dispatched listeners. Creating this function + * here, allows us to not have to bind or create functions for each event. + * Mutating the event's members allows us to not have to create a wrapping + * "dispatch" object that pairs the event with the listener. + */ +function accumulateDirectionalDispatches(inst, upwards, event) { + if (process.env.NODE_ENV !== 'production') { + process.env.NODE_ENV !== 'production' ? warning(inst, 'Dispatching inst must not be null') : void 0; + } + var phase = upwards ? PropagationPhases.bubbled : PropagationPhases.captured; + var listener = listenerAtPhase(inst, event, phase); + if (listener) { + event._dispatchListeners = accumulateInto(event._dispatchListeners, listener); + event._dispatchInstances = accumulateInto(event._dispatchInstances, inst); + } +} + +/** + * Collect dispatches (must be entirely collected before dispatching - see unit + * tests). Lazily allocate the array to conserve memory. We must loop through + * each event and perform the traversal for each one. We cannot perform a + * single traversal for the entire collection of events because each event may + * have a different target. + */ +function accumulateTwoPhaseDispatchesSingle(event) { + if (event && event.dispatchConfig.phasedRegistrationNames) { + EventPluginUtils.traverseTwoPhase(event._targetInst, accumulateDirectionalDispatches, event); + } +} + +/** + * Same as `accumulateTwoPhaseDispatchesSingle`, but skips over the targetID. + */ +function accumulateTwoPhaseDispatchesSingleSkipTarget(event) { + if (event && event.dispatchConfig.phasedRegistrationNames) { + var targetInst = event._targetInst; + var parentInst = targetInst ? EventPluginUtils.getParentInstance(targetInst) : null; + EventPluginUtils.traverseTwoPhase(parentInst, accumulateDirectionalDispatches, event); + } +} + +/** + * Accumulates without regard to direction, does not look for phased + * registration names. Same as `accumulateDirectDispatchesSingle` but without + * requiring that the `dispatchMarker` be the same as the dispatched ID. + */ +function accumulateDispatches(inst, ignoredDirection, event) { + if (event && event.dispatchConfig.registrationName) { + var registrationName = event.dispatchConfig.registrationName; + var listener = getListener(inst, registrationName); + if (listener) { + event._dispatchListeners = accumulateInto(event._dispatchListeners, listener); + event._dispatchInstances = accumulateInto(event._dispatchInstances, inst); + } + } +} + +/** + * Accumulates dispatches on an `SyntheticEvent`, but only for the + * `dispatchMarker`. + * @param {SyntheticEvent} event + */ +function accumulateDirectDispatchesSingle(event) { + if (event && event.dispatchConfig.registrationName) { + accumulateDispatches(event._targetInst, null, event); + } +} + +function accumulateTwoPhaseDispatches(events) { + forEachAccumulated(events, accumulateTwoPhaseDispatchesSingle); +} + +function accumulateTwoPhaseDispatchesSkipTarget(events) { + forEachAccumulated(events, accumulateTwoPhaseDispatchesSingleSkipTarget); +} + +function accumulateEnterLeaveDispatches(leave, enter, from, to) { + EventPluginUtils.traverseEnterLeave(from, to, accumulateDispatches, leave, enter); +} + +function accumulateDirectDispatches(events) { + forEachAccumulated(events, accumulateDirectDispatchesSingle); +} + +/** + * A small set of propagation patterns, each of which will accept a small amount + * of information, and generate a set of "dispatch ready event objects" - which + * are sets of events that have already been annotated with a set of dispatched + * listener functions/ids. The API is designed this way to discourage these + * propagation strategies from actually executing the dispatches, since we + * always want to collect the entire set of dispatches before executing event a + * single one. + * + * @constructor EventPropagators + */ +var EventPropagators = { + accumulateTwoPhaseDispatches: accumulateTwoPhaseDispatches, + accumulateTwoPhaseDispatchesSkipTarget: accumulateTwoPhaseDispatchesSkipTarget, + accumulateDirectDispatches: accumulateDirectDispatches, + accumulateEnterLeaveDispatches: accumulateEnterLeaveDispatches +}; + +module.exports = EventPropagators; +}).call(this,require('_process')) + +},{"./EventConstants":63,"./EventPluginHub":64,"./EventPluginUtils":66,"./accumulateInto":161,"./forEachAccumulated":170,"_process":40,"fbjs/lib/warning":217}],68:[function(require,module,exports){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule FallbackCompositionState + */ + +'use strict'; + +var _assign = require('object-assign'); + +var PooledClass = require('./PooledClass'); + +var getTextContentAccessor = require('./getTextContentAccessor'); + +/** + * This helper class stores information about text content of a target node, + * allowing comparison of content before and after a given event. + * + * Identify the node where selection currently begins, then observe + * both its text content and its current position in the DOM. Since the + * browser may natively replace the target node during composition, we can + * use its position to find its replacement. + * + * @param {DOMEventTarget} root + */ +function FallbackCompositionState(root) { + this._root = root; + this._startText = this.getText(); + this._fallbackText = null; +} + +_assign(FallbackCompositionState.prototype, { + destructor: function () { + this._root = null; + this._startText = null; + this._fallbackText = null; + }, + + /** + * Get current text of input. + * + * @return {string} + */ + getText: function () { + if ('value' in this._root) { + return this._root.value; + } + return this._root[getTextContentAccessor()]; + }, + + /** + * Determine the differing substring between the initially stored + * text content and the current content. + * + * @return {string} + */ + getData: function () { + if (this._fallbackText) { + return this._fallbackText; + } + + var start; + var startValue = this._startText; + var startLength = startValue.length; + var end; + var endValue = this.getText(); + var endLength = endValue.length; + + for (start = 0; start < startLength; start++) { + if (startValue[start] !== endValue[start]) { + break; + } + } + + var minEnd = startLength - start; + for (end = 1; end <= minEnd; end++) { + if (startValue[startLength - end] !== endValue[endLength - end]) { + break; + } + } + + var sliceTail = end > 1 ? 1 - end : undefined; + this._fallbackText = endValue.slice(start, sliceTail); + return this._fallbackText; + } +}); + +PooledClass.addPoolingTo(FallbackCompositionState); + +module.exports = FallbackCompositionState; +},{"./PooledClass":72,"./getTextContentAccessor":178,"object-assign":39}],69:[function(require,module,exports){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule HTMLDOMPropertyConfig + */ + +'use strict'; + +var DOMProperty = require('./DOMProperty'); + +var MUST_USE_PROPERTY = DOMProperty.injection.MUST_USE_PROPERTY; +var HAS_BOOLEAN_VALUE = DOMProperty.injection.HAS_BOOLEAN_VALUE; +var HAS_NUMERIC_VALUE = DOMProperty.injection.HAS_NUMERIC_VALUE; +var HAS_POSITIVE_NUMERIC_VALUE = DOMProperty.injection.HAS_POSITIVE_NUMERIC_VALUE; +var HAS_OVERLOADED_BOOLEAN_VALUE = DOMProperty.injection.HAS_OVERLOADED_BOOLEAN_VALUE; + +var HTMLDOMPropertyConfig = { + isCustomAttribute: RegExp.prototype.test.bind(new RegExp('^(data|aria)-[' + DOMProperty.ATTRIBUTE_NAME_CHAR + ']*$')), + Properties: { + /** + * Standard Properties + */ + accept: 0, + acceptCharset: 0, + accessKey: 0, + action: 0, + allowFullScreen: HAS_BOOLEAN_VALUE, + allowTransparency: 0, + alt: 0, + async: HAS_BOOLEAN_VALUE, + autoComplete: 0, + // autoFocus is polyfilled/normalized by AutoFocusUtils + // autoFocus: HAS_BOOLEAN_VALUE, + autoPlay: HAS_BOOLEAN_VALUE, + capture: HAS_BOOLEAN_VALUE, + cellPadding: 0, + cellSpacing: 0, + charSet: 0, + challenge: 0, + checked: MUST_USE_PROPERTY | HAS_BOOLEAN_VALUE, + cite: 0, + classID: 0, + className: 0, + cols: HAS_POSITIVE_NUMERIC_VALUE, + colSpan: 0, + content: 0, + contentEditable: 0, + contextMenu: 0, + controls: HAS_BOOLEAN_VALUE, + coords: 0, + crossOrigin: 0, + data: 0, // For `` acts as `src`. + dateTime: 0, + 'default': HAS_BOOLEAN_VALUE, + defer: HAS_BOOLEAN_VALUE, + dir: 0, + disabled: HAS_BOOLEAN_VALUE, + download: HAS_OVERLOADED_BOOLEAN_VALUE, + draggable: 0, + encType: 0, + form: 0, + formAction: 0, + formEncType: 0, + formMethod: 0, + formNoValidate: HAS_BOOLEAN_VALUE, + formTarget: 0, + frameBorder: 0, + headers: 0, + height: 0, + hidden: HAS_BOOLEAN_VALUE, + high: 0, + href: 0, + hrefLang: 0, + htmlFor: 0, + httpEquiv: 0, + icon: 0, + id: 0, + inputMode: 0, + integrity: 0, + is: 0, + keyParams: 0, + keyType: 0, + kind: 0, + label: 0, + lang: 0, + list: 0, + loop: HAS_BOOLEAN_VALUE, + low: 0, + manifest: 0, + marginHeight: 0, + marginWidth: 0, + max: 0, + maxLength: 0, + media: 0, + mediaGroup: 0, + method: 0, + min: 0, + minLength: 0, + // Caution; `option.selected` is not updated if `select.multiple` is + // disabled with `removeAttribute`. + multiple: MUST_USE_PROPERTY | HAS_BOOLEAN_VALUE, + muted: MUST_USE_PROPERTY | HAS_BOOLEAN_VALUE, + name: 0, + nonce: 0, + noValidate: HAS_BOOLEAN_VALUE, + open: HAS_BOOLEAN_VALUE, + optimum: 0, + pattern: 0, + placeholder: 0, + poster: 0, + preload: 0, + profile: 0, + radioGroup: 0, + readOnly: HAS_BOOLEAN_VALUE, + referrerPolicy: 0, + rel: 0, + required: HAS_BOOLEAN_VALUE, + reversed: HAS_BOOLEAN_VALUE, + role: 0, + rows: HAS_POSITIVE_NUMERIC_VALUE, + rowSpan: HAS_NUMERIC_VALUE, + sandbox: 0, + scope: 0, + scoped: HAS_BOOLEAN_VALUE, + scrolling: 0, + seamless: HAS_BOOLEAN_VALUE, + selected: MUST_USE_PROPERTY | HAS_BOOLEAN_VALUE, + shape: 0, + size: HAS_POSITIVE_NUMERIC_VALUE, + sizes: 0, + span: HAS_POSITIVE_NUMERIC_VALUE, + spellCheck: 0, + src: 0, + srcDoc: 0, + srcLang: 0, + srcSet: 0, + start: HAS_NUMERIC_VALUE, + step: 0, + style: 0, + summary: 0, + tabIndex: 0, + target: 0, + title: 0, + // Setting .type throws on non- tags + type: 0, + useMap: 0, + value: 0, + width: 0, + wmode: 0, + wrap: 0, + + /** + * RDFa Properties + */ + about: 0, + datatype: 0, + inlist: 0, + prefix: 0, + // property is also supported for OpenGraph in meta tags. + property: 0, + resource: 0, + 'typeof': 0, + vocab: 0, + + /** + * Non-standard Properties + */ + // autoCapitalize and autoCorrect are supported in Mobile Safari for + // keyboard hints. + autoCapitalize: 0, + autoCorrect: 0, + // autoSave allows WebKit/Blink to persist values of input fields on page reloads + autoSave: 0, + // color is for Safari mask-icon link + color: 0, + // itemProp, itemScope, itemType are for + // Microdata support. See http://schema.org/docs/gs.html + itemProp: 0, + itemScope: HAS_BOOLEAN_VALUE, + itemType: 0, + // itemID and itemRef are for Microdata support as well but + // only specified in the WHATWG spec document. See + // https://html.spec.whatwg.org/multipage/microdata.html#microdata-dom-api + itemID: 0, + itemRef: 0, + // results show looking glass icon and recent searches on input + // search fields in WebKit/Blink + results: 0, + // IE-only attribute that specifies security restrictions on an iframe + // as an alternative to the sandbox attribute on IE<10 + security: 0, + // IE-only attribute that controls focus behavior + unselectable: 0 + }, + DOMAttributeNames: { + acceptCharset: 'accept-charset', + className: 'class', + htmlFor: 'for', + httpEquiv: 'http-equiv' + }, + DOMPropertyNames: {} +}; + +module.exports = HTMLDOMPropertyConfig; +},{"./DOMProperty":57}],70:[function(require,module,exports){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule KeyEscapeUtils + * + */ + +'use strict'; + +/** + * Escape and wrap key so it is safe to use as a reactid + * + * @param {string} key to be escaped. + * @return {string} the escaped key. + */ + +function escape(key) { + var escapeRegex = /[=:]/g; + var escaperLookup = { + '=': '=0', + ':': '=2' + }; + var escapedString = ('' + key).replace(escapeRegex, function (match) { + return escaperLookup[match]; + }); + + return '$' + escapedString; +} + +/** + * Unescape and unwrap key for human-readable display + * + * @param {string} key to unescape. + * @return {string} the unescaped key. + */ +function unescape(key) { + var unescapeRegex = /(=0|=2)/g; + var unescaperLookup = { + '=0': '=', + '=2': ':' + }; + var keySubstring = key[0] === '.' && key[1] === '$' ? key.substring(2) : key.substring(1); + + return ('' + keySubstring).replace(unescapeRegex, function (match) { + return unescaperLookup[match]; + }); +} + +var KeyEscapeUtils = { + escape: escape, + unescape: unescape +}; + +module.exports = KeyEscapeUtils; +},{}],71:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule LinkedValueUtils + */ + +'use strict'; + +var _prodInvariant = require('./reactProdInvariant'); + +var ReactPropTypes = require('./ReactPropTypes'); +var ReactPropTypeLocations = require('./ReactPropTypeLocations'); +var ReactPropTypesSecret = require('./ReactPropTypesSecret'); + +var invariant = require('fbjs/lib/invariant'); +var warning = require('fbjs/lib/warning'); + +var hasReadOnlyValue = { + 'button': true, + 'checkbox': true, + 'image': true, + 'hidden': true, + 'radio': true, + 'reset': true, + 'submit': true +}; + +function _assertSingleLink(inputProps) { + !(inputProps.checkedLink == null || inputProps.valueLink == null) ? process.env.NODE_ENV !== 'production' ? invariant(false, 'Cannot provide a checkedLink and a valueLink. If you want to use checkedLink, you probably don\'t want to use valueLink and vice versa.') : _prodInvariant('87') : void 0; +} +function _assertValueLink(inputProps) { + _assertSingleLink(inputProps); + !(inputProps.value == null && inputProps.onChange == null) ? process.env.NODE_ENV !== 'production' ? invariant(false, 'Cannot provide a valueLink and a value or onChange event. If you want to use value or onChange, you probably don\'t want to use valueLink.') : _prodInvariant('88') : void 0; +} + +function _assertCheckedLink(inputProps) { + _assertSingleLink(inputProps); + !(inputProps.checked == null && inputProps.onChange == null) ? process.env.NODE_ENV !== 'production' ? invariant(false, 'Cannot provide a checkedLink and a checked property or onChange event. If you want to use checked or onChange, you probably don\'t want to use checkedLink') : _prodInvariant('89') : void 0; +} + +var propTypes = { + value: function (props, propName, componentName) { + if (!props[propName] || hasReadOnlyValue[props.type] || props.onChange || props.readOnly || props.disabled) { + return null; + } + return new Error('You provided a `value` prop to a form field without an ' + '`onChange` handler. This will render a read-only field. If ' + 'the field should be mutable use `defaultValue`. Otherwise, ' + 'set either `onChange` or `readOnly`.'); + }, + checked: function (props, propName, componentName) { + if (!props[propName] || props.onChange || props.readOnly || props.disabled) { + return null; + } + return new Error('You provided a `checked` prop to a form field without an ' + '`onChange` handler. This will render a read-only field. If ' + 'the field should be mutable use `defaultChecked`. Otherwise, ' + 'set either `onChange` or `readOnly`.'); + }, + onChange: ReactPropTypes.func +}; + +var loggedTypeFailures = {}; +function getDeclarationErrorAddendum(owner) { + if (owner) { + var name = owner.getName(); + if (name) { + return ' Check the render method of `' + name + '`.'; + } + } + return ''; +} + +/** + * Provide a linked `value` attribute for controlled forms. You should not use + * this outside of the ReactDOM controlled form components. + */ +var LinkedValueUtils = { + checkPropTypes: function (tagName, props, owner) { + for (var propName in propTypes) { + if (propTypes.hasOwnProperty(propName)) { + var error = propTypes[propName](props, propName, tagName, ReactPropTypeLocations.prop, null, ReactPropTypesSecret); + } + if (error instanceof Error && !(error.message in loggedTypeFailures)) { + // Only monitor this failure once because there tends to be a lot of the + // same error. + loggedTypeFailures[error.message] = true; + + var addendum = getDeclarationErrorAddendum(owner); + process.env.NODE_ENV !== 'production' ? warning(false, 'Failed form propType: %s%s', error.message, addendum) : void 0; + } + } + }, + + /** + * @param {object} inputProps Props for form component + * @return {*} current value of the input either from value prop or link. + */ + getValue: function (inputProps) { + if (inputProps.valueLink) { + _assertValueLink(inputProps); + return inputProps.valueLink.value; + } + return inputProps.value; + }, + + /** + * @param {object} inputProps Props for form component + * @return {*} current checked status of the input either from checked prop + * or link. + */ + getChecked: function (inputProps) { + if (inputProps.checkedLink) { + _assertCheckedLink(inputProps); + return inputProps.checkedLink.value; + } + return inputProps.checked; + }, + + /** + * @param {object} inputProps Props for form component + * @param {SyntheticEvent} event change event to handle + */ + executeOnChange: function (inputProps, event) { + if (inputProps.valueLink) { + _assertValueLink(inputProps); + return inputProps.valueLink.requestChange(event.target.value); + } else if (inputProps.checkedLink) { + _assertCheckedLink(inputProps); + return inputProps.checkedLink.requestChange(event.target.checked); + } else if (inputProps.onChange) { + return inputProps.onChange.call(undefined, event); + } + } +}; + +module.exports = LinkedValueUtils; +}).call(this,require('_process')) + +},{"./ReactPropTypeLocations":131,"./ReactPropTypes":132,"./ReactPropTypesSecret":133,"./reactProdInvariant":185,"_process":40,"fbjs/lib/invariant":207,"fbjs/lib/warning":217}],72:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule PooledClass + */ + +'use strict'; + +var _prodInvariant = require('./reactProdInvariant'); + +var invariant = require('fbjs/lib/invariant'); + +/** + * Static poolers. Several custom versions for each potential number of + * arguments. A completely generic pooler is easy to implement, but would + * require accessing the `arguments` object. In each of these, `this` refers to + * the Class itself, not an instance. If any others are needed, simply add them + * here, or in their own files. + */ +var oneArgumentPooler = function (copyFieldsFrom) { + var Klass = this; + if (Klass.instancePool.length) { + var instance = Klass.instancePool.pop(); + Klass.call(instance, copyFieldsFrom); + return instance; + } else { + return new Klass(copyFieldsFrom); + } +}; + +var twoArgumentPooler = function (a1, a2) { + var Klass = this; + if (Klass.instancePool.length) { + var instance = Klass.instancePool.pop(); + Klass.call(instance, a1, a2); + return instance; + } else { + return new Klass(a1, a2); + } +}; + +var threeArgumentPooler = function (a1, a2, a3) { + var Klass = this; + if (Klass.instancePool.length) { + var instance = Klass.instancePool.pop(); + Klass.call(instance, a1, a2, a3); + return instance; + } else { + return new Klass(a1, a2, a3); + } +}; + +var fourArgumentPooler = function (a1, a2, a3, a4) { + var Klass = this; + if (Klass.instancePool.length) { + var instance = Klass.instancePool.pop(); + Klass.call(instance, a1, a2, a3, a4); + return instance; + } else { + return new Klass(a1, a2, a3, a4); + } +}; + +var fiveArgumentPooler = function (a1, a2, a3, a4, a5) { + var Klass = this; + if (Klass.instancePool.length) { + var instance = Klass.instancePool.pop(); + Klass.call(instance, a1, a2, a3, a4, a5); + return instance; + } else { + return new Klass(a1, a2, a3, a4, a5); + } +}; + +var standardReleaser = function (instance) { + var Klass = this; + !(instance instanceof Klass) ? process.env.NODE_ENV !== 'production' ? invariant(false, 'Trying to release an instance into a pool of a different type.') : _prodInvariant('25') : void 0; + instance.destructor(); + if (Klass.instancePool.length < Klass.poolSize) { + Klass.instancePool.push(instance); + } +}; + +var DEFAULT_POOL_SIZE = 10; +var DEFAULT_POOLER = oneArgumentPooler; + +/** + * Augments `CopyConstructor` to be a poolable class, augmenting only the class + * itself (statically) not adding any prototypical fields. Any CopyConstructor + * you give this may have a `poolSize` property, and will look for a + * prototypical `destructor` on instances. + * + * @param {Function} CopyConstructor Constructor that can be used to reset. + * @param {Function} pooler Customizable pooler. + */ +var addPoolingTo = function (CopyConstructor, pooler) { + var NewKlass = CopyConstructor; + NewKlass.instancePool = []; + NewKlass.getPooled = pooler || DEFAULT_POOLER; + if (!NewKlass.poolSize) { + NewKlass.poolSize = DEFAULT_POOL_SIZE; + } + NewKlass.release = standardReleaser; + return NewKlass; +}; + +var PooledClass = { + addPoolingTo: addPoolingTo, + oneArgumentPooler: oneArgumentPooler, + twoArgumentPooler: twoArgumentPooler, + threeArgumentPooler: threeArgumentPooler, + fourArgumentPooler: fourArgumentPooler, + fiveArgumentPooler: fiveArgumentPooler +}; + +module.exports = PooledClass; +}).call(this,require('_process')) + +},{"./reactProdInvariant":185,"_process":40,"fbjs/lib/invariant":207}],73:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule React + */ + +'use strict'; + +var _assign = require('object-assign'); + +var ReactChildren = require('./ReactChildren'); +var ReactComponent = require('./ReactComponent'); +var ReactPureComponent = require('./ReactPureComponent'); +var ReactClass = require('./ReactClass'); +var ReactDOMFactories = require('./ReactDOMFactories'); +var ReactElement = require('./ReactElement'); +var ReactPropTypes = require('./ReactPropTypes'); +var ReactVersion = require('./ReactVersion'); + +var onlyChild = require('./onlyChild'); +var warning = require('fbjs/lib/warning'); + +var createElement = ReactElement.createElement; +var createFactory = ReactElement.createFactory; +var cloneElement = ReactElement.cloneElement; + +if (process.env.NODE_ENV !== 'production') { + var ReactElementValidator = require('./ReactElementValidator'); + createElement = ReactElementValidator.createElement; + createFactory = ReactElementValidator.createFactory; + cloneElement = ReactElementValidator.cloneElement; +} + +var __spread = _assign; + +if (process.env.NODE_ENV !== 'production') { + var warned = false; + __spread = function () { + process.env.NODE_ENV !== 'production' ? warning(warned, 'React.__spread is deprecated and should not be used. Use ' + 'Object.assign directly or another helper function with similar ' + 'semantics. You may be seeing this warning due to your compiler. ' + 'See https://fb.me/react-spread-deprecation for more details.') : void 0; + warned = true; + return _assign.apply(null, arguments); + }; +} + +var React = { + + // Modern + + Children: { + map: ReactChildren.map, + forEach: ReactChildren.forEach, + count: ReactChildren.count, + toArray: ReactChildren.toArray, + only: onlyChild + }, + + Component: ReactComponent, + PureComponent: ReactPureComponent, + + createElement: createElement, + cloneElement: cloneElement, + isValidElement: ReactElement.isValidElement, + + // Classic + + PropTypes: ReactPropTypes, + createClass: ReactClass.createClass, + createFactory: createFactory, + createMixin: function (mixin) { + // Currently a noop. Will be used to validate and trace mixins. + return mixin; + }, + + // This looks DOM specific but these are actually isomorphic helpers + // since they are just generating DOM strings. + DOM: ReactDOMFactories, + + version: ReactVersion, + + // Deprecated hook for JSX spread, don't use this for anything. + __spread: __spread +}; + +module.exports = React; +}).call(this,require('_process')) + +},{"./ReactChildren":76,"./ReactClass":78,"./ReactComponent":79,"./ReactDOMFactories":93,"./ReactElement":109,"./ReactElementValidator":110,"./ReactPropTypes":132,"./ReactPureComponent":134,"./ReactVersion":142,"./onlyChild":183,"_process":40,"fbjs/lib/warning":217,"object-assign":39}],74:[function(require,module,exports){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule ReactBrowserEventEmitter + */ + +'use strict'; + +var _assign = require('object-assign'); + +var EventConstants = require('./EventConstants'); +var EventPluginRegistry = require('./EventPluginRegistry'); +var ReactEventEmitterMixin = require('./ReactEventEmitterMixin'); +var ViewportMetrics = require('./ViewportMetrics'); + +var getVendorPrefixedEventName = require('./getVendorPrefixedEventName'); +var isEventSupported = require('./isEventSupported'); + +/** + * Summary of `ReactBrowserEventEmitter` event handling: + * + * - Top-level delegation is used to trap most native browser events. This + * may only occur in the main thread and is the responsibility of + * ReactEventListener, which is injected and can therefore support pluggable + * event sources. This is the only work that occurs in the main thread. + * + * - We normalize and de-duplicate events to account for browser quirks. This + * may be done in the worker thread. + * + * - Forward these native events (with the associated top-level type used to + * trap it) to `EventPluginHub`, which in turn will ask plugins if they want + * to extract any synthetic events. + * + * - The `EventPluginHub` will then process each event by annotating them with + * "dispatches", a sequence of listeners and IDs that care about that event. + * + * - The `EventPluginHub` then dispatches the events. + * + * Overview of React and the event system: + * + * +------------+ . + * | DOM | . + * +------------+ . + * | . + * v . + * +------------+ . + * | ReactEvent | . + * | Listener | . + * +------------+ . +-----------+ + * | . +--------+|SimpleEvent| + * | . | |Plugin | + * +-----|------+ . v +-----------+ + * | | | . +--------------+ +------------+ + * | +-----------.--->|EventPluginHub| | Event | + * | | . | | +-----------+ | Propagators| + * | ReactEvent | . | | |TapEvent | |------------| + * | Emitter | . | |<---+|Plugin | |other plugin| + * | | . | | +-----------+ | utilities | + * | +-----------.--->| | +------------+ + * | | | . +--------------+ + * +-----|------+ . ^ +-----------+ + * | . | |Enter/Leave| + * + . +-------+|Plugin | + * +-------------+ . +-----------+ + * | application | . + * |-------------| . + * | | . + * | | . + * +-------------+ . + * . + * React Core . General Purpose Event Plugin System + */ + +var hasEventPageXY; +var alreadyListeningTo = {}; +var isMonitoringScrollValue = false; +var reactTopListenersCounter = 0; + +// For events like 'submit' which don't consistently bubble (which we trap at a +// lower node than `document`), binding at `document` would cause duplicate +// events so we don't include them here +var topEventMapping = { + topAbort: 'abort', + topAnimationEnd: getVendorPrefixedEventName('animationend') || 'animationend', + topAnimationIteration: getVendorPrefixedEventName('animationiteration') || 'animationiteration', + topAnimationStart: getVendorPrefixedEventName('animationstart') || 'animationstart', + topBlur: 'blur', + topCanPlay: 'canplay', + topCanPlayThrough: 'canplaythrough', + topChange: 'change', + topClick: 'click', + topCompositionEnd: 'compositionend', + topCompositionStart: 'compositionstart', + topCompositionUpdate: 'compositionupdate', + topContextMenu: 'contextmenu', + topCopy: 'copy', + topCut: 'cut', + topDoubleClick: 'dblclick', + topDrag: 'drag', + topDragEnd: 'dragend', + topDragEnter: 'dragenter', + topDragExit: 'dragexit', + topDragLeave: 'dragleave', + topDragOver: 'dragover', + topDragStart: 'dragstart', + topDrop: 'drop', + topDurationChange: 'durationchange', + topEmptied: 'emptied', + topEncrypted: 'encrypted', + topEnded: 'ended', + topError: 'error', + topFocus: 'focus', + topInput: 'input', + topKeyDown: 'keydown', + topKeyPress: 'keypress', + topKeyUp: 'keyup', + topLoadedData: 'loadeddata', + topLoadedMetadata: 'loadedmetadata', + topLoadStart: 'loadstart', + topMouseDown: 'mousedown', + topMouseMove: 'mousemove', + topMouseOut: 'mouseout', + topMouseOver: 'mouseover', + topMouseUp: 'mouseup', + topPaste: 'paste', + topPause: 'pause', + topPlay: 'play', + topPlaying: 'playing', + topProgress: 'progress', + topRateChange: 'ratechange', + topScroll: 'scroll', + topSeeked: 'seeked', + topSeeking: 'seeking', + topSelectionChange: 'selectionchange', + topStalled: 'stalled', + topSuspend: 'suspend', + topTextInput: 'textInput', + topTimeUpdate: 'timeupdate', + topTouchCancel: 'touchcancel', + topTouchEnd: 'touchend', + topTouchMove: 'touchmove', + topTouchStart: 'touchstart', + topTransitionEnd: getVendorPrefixedEventName('transitionend') || 'transitionend', + topVolumeChange: 'volumechange', + topWaiting: 'waiting', + topWheel: 'wheel' +}; + +/** + * To ensure no conflicts with other potential React instances on the page + */ +var topListenersIDKey = '_reactListenersID' + String(Math.random()).slice(2); + +function getListeningForDocument(mountAt) { + // In IE8, `mountAt` is a host object and doesn't have `hasOwnProperty` + // directly. + if (!Object.prototype.hasOwnProperty.call(mountAt, topListenersIDKey)) { + mountAt[topListenersIDKey] = reactTopListenersCounter++; + alreadyListeningTo[mountAt[topListenersIDKey]] = {}; + } + return alreadyListeningTo[mountAt[topListenersIDKey]]; +} + +/** + * `ReactBrowserEventEmitter` is used to attach top-level event listeners. For + * example: + * + * EventPluginHub.putListener('myID', 'onClick', myFunction); + * + * This would allocate a "registration" of `('onClick', myFunction)` on 'myID'. + * + * @internal + */ +var ReactBrowserEventEmitter = _assign({}, ReactEventEmitterMixin, { + + /** + * Injectable event backend + */ + ReactEventListener: null, + + injection: { + /** + * @param {object} ReactEventListener + */ + injectReactEventListener: function (ReactEventListener) { + ReactEventListener.setHandleTopLevel(ReactBrowserEventEmitter.handleTopLevel); + ReactBrowserEventEmitter.ReactEventListener = ReactEventListener; + } + }, + + /** + * Sets whether or not any created callbacks should be enabled. + * + * @param {boolean} enabled True if callbacks should be enabled. + */ + setEnabled: function (enabled) { + if (ReactBrowserEventEmitter.ReactEventListener) { + ReactBrowserEventEmitter.ReactEventListener.setEnabled(enabled); + } + }, + + /** + * @return {boolean} True if callbacks are enabled. + */ + isEnabled: function () { + return !!(ReactBrowserEventEmitter.ReactEventListener && ReactBrowserEventEmitter.ReactEventListener.isEnabled()); + }, + + /** + * We listen for bubbled touch events on the document object. + * + * Firefox v8.01 (and possibly others) exhibited strange behavior when + * mounting `onmousemove` events at some node that was not the document + * element. The symptoms were that if your mouse is not moving over something + * contained within that mount point (for example on the background) the + * top-level listeners for `onmousemove` won't be called. However, if you + * register the `mousemove` on the document object, then it will of course + * catch all `mousemove`s. This along with iOS quirks, justifies restricting + * top-level listeners to the document object only, at least for these + * movement types of events and possibly all events. + * + * @see http://www.quirksmode.org/blog/archives/2010/09/click_event_del.html + * + * Also, `keyup`/`keypress`/`keydown` do not bubble to the window on IE, but + * they bubble to document. + * + * @param {string} registrationName Name of listener (e.g. `onClick`). + * @param {object} contentDocumentHandle Document which owns the container + */ + listenTo: function (registrationName, contentDocumentHandle) { + var mountAt = contentDocumentHandle; + var isListening = getListeningForDocument(mountAt); + var dependencies = EventPluginRegistry.registrationNameDependencies[registrationName]; + + var topLevelTypes = EventConstants.topLevelTypes; + for (var i = 0; i < dependencies.length; i++) { + var dependency = dependencies[i]; + if (!(isListening.hasOwnProperty(dependency) && isListening[dependency])) { + if (dependency === topLevelTypes.topWheel) { + if (isEventSupported('wheel')) { + ReactBrowserEventEmitter.ReactEventListener.trapBubbledEvent(topLevelTypes.topWheel, 'wheel', mountAt); + } else if (isEventSupported('mousewheel')) { + ReactBrowserEventEmitter.ReactEventListener.trapBubbledEvent(topLevelTypes.topWheel, 'mousewheel', mountAt); + } else { + // Firefox needs to capture a different mouse scroll event. + // @see http://www.quirksmode.org/dom/events/tests/scroll.html + ReactBrowserEventEmitter.ReactEventListener.trapBubbledEvent(topLevelTypes.topWheel, 'DOMMouseScroll', mountAt); + } + } else if (dependency === topLevelTypes.topScroll) { + + if (isEventSupported('scroll', true)) { + ReactBrowserEventEmitter.ReactEventListener.trapCapturedEvent(topLevelTypes.topScroll, 'scroll', mountAt); + } else { + ReactBrowserEventEmitter.ReactEventListener.trapBubbledEvent(topLevelTypes.topScroll, 'scroll', ReactBrowserEventEmitter.ReactEventListener.WINDOW_HANDLE); + } + } else if (dependency === topLevelTypes.topFocus || dependency === topLevelTypes.topBlur) { + + if (isEventSupported('focus', true)) { + ReactBrowserEventEmitter.ReactEventListener.trapCapturedEvent(topLevelTypes.topFocus, 'focus', mountAt); + ReactBrowserEventEmitter.ReactEventListener.trapCapturedEvent(topLevelTypes.topBlur, 'blur', mountAt); + } else if (isEventSupported('focusin')) { + // IE has `focusin` and `focusout` events which bubble. + // @see http://www.quirksmode.org/blog/archives/2008/04/delegating_the.html + ReactBrowserEventEmitter.ReactEventListener.trapBubbledEvent(topLevelTypes.topFocus, 'focusin', mountAt); + ReactBrowserEventEmitter.ReactEventListener.trapBubbledEvent(topLevelTypes.topBlur, 'focusout', mountAt); + } + + // to make sure blur and focus event listeners are only attached once + isListening[topLevelTypes.topBlur] = true; + isListening[topLevelTypes.topFocus] = true; + } else if (topEventMapping.hasOwnProperty(dependency)) { + ReactBrowserEventEmitter.ReactEventListener.trapBubbledEvent(dependency, topEventMapping[dependency], mountAt); + } + + isListening[dependency] = true; + } + } + }, + + trapBubbledEvent: function (topLevelType, handlerBaseName, handle) { + return ReactBrowserEventEmitter.ReactEventListener.trapBubbledEvent(topLevelType, handlerBaseName, handle); + }, + + trapCapturedEvent: function (topLevelType, handlerBaseName, handle) { + return ReactBrowserEventEmitter.ReactEventListener.trapCapturedEvent(topLevelType, handlerBaseName, handle); + }, + + /** + * Listens to window scroll and resize events. We cache scroll values so that + * application code can access them without triggering reflows. + * + * ViewportMetrics is only used by SyntheticMouse/TouchEvent and only when + * pageX/pageY isn't supported (legacy browsers). + * + * NOTE: Scroll events do not bubble. + * + * @see http://www.quirksmode.org/dom/events/scroll.html + */ + ensureScrollValueMonitoring: function () { + if (hasEventPageXY === undefined) { + hasEventPageXY = document.createEvent && 'pageX' in document.createEvent('MouseEvent'); + } + if (!hasEventPageXY && !isMonitoringScrollValue) { + var refresh = ViewportMetrics.refreshScrollValues; + ReactBrowserEventEmitter.ReactEventListener.monitorScrollValue(refresh); + isMonitoringScrollValue = true; + } + } + +}); + +module.exports = ReactBrowserEventEmitter; +},{"./EventConstants":63,"./EventPluginRegistry":65,"./ReactEventEmitterMixin":113,"./ViewportMetrics":160,"./getVendorPrefixedEventName":179,"./isEventSupported":181,"object-assign":39}],75:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2014-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule ReactChildReconciler + */ + +'use strict'; + +var ReactReconciler = require('./ReactReconciler'); + +var instantiateReactComponent = require('./instantiateReactComponent'); +var KeyEscapeUtils = require('./KeyEscapeUtils'); +var shouldUpdateReactComponent = require('./shouldUpdateReactComponent'); +var traverseAllChildren = require('./traverseAllChildren'); +var warning = require('fbjs/lib/warning'); + +var ReactComponentTreeDevtool; + +if (typeof process !== 'undefined' && process.env && process.env.NODE_ENV === 'test') { + // Temporary hack. + // Inline requires don't work well with Jest: + // https://github.com/facebook/react/issues/7240 + // Remove the inline requires when we don't need them anymore: + // https://github.com/facebook/react/pull/7178 + ReactComponentTreeDevtool = require('./ReactComponentTreeDevtool'); +} + +function instantiateChild(childInstances, child, name, selfDebugID) { + // We found a component instance. + var keyUnique = childInstances[name] === undefined; + if (process.env.NODE_ENV !== 'production') { + if (!ReactComponentTreeDevtool) { + ReactComponentTreeDevtool = require('./ReactComponentTreeDevtool'); + } + process.env.NODE_ENV !== 'production' ? warning(keyUnique, 'flattenChildren(...): Encountered two children with the same key, ' + '`%s`. Child keys must be unique; when two children share a key, only ' + 'the first child will be used.%s', KeyEscapeUtils.unescape(name), ReactComponentTreeDevtool.getStackAddendumByID(selfDebugID)) : void 0; + } + if (child != null && keyUnique) { + childInstances[name] = instantiateReactComponent(child, true); + } +} + +/** + * ReactChildReconciler provides helpers for initializing or updating a set of + * children. Its output is suitable for passing it onto ReactMultiChild which + * does diffed reordering and insertion. + */ +var ReactChildReconciler = { + /** + * Generates a "mount image" for each of the supplied children. In the case + * of `ReactDOMComponent`, a mount image is a string of markup. + * + * @param {?object} nestedChildNodes Nested child maps. + * @return {?object} A set of child instances. + * @internal + */ + instantiateChildren: function (nestedChildNodes, transaction, context, selfDebugID // __DEV__ only + ) { + if (nestedChildNodes == null) { + return null; + } + var childInstances = {}; + + if (process.env.NODE_ENV !== 'production') { + traverseAllChildren(nestedChildNodes, function (childInsts, child, name) { + return instantiateChild(childInsts, child, name, selfDebugID); + }, childInstances); + } else { + traverseAllChildren(nestedChildNodes, instantiateChild, childInstances); + } + return childInstances; + }, + + /** + * Updates the rendered children and returns a new set of children. + * + * @param {?object} prevChildren Previously initialized set of children. + * @param {?object} nextChildren Flat child element maps. + * @param {ReactReconcileTransaction} transaction + * @param {object} context + * @return {?object} A new set of child instances. + * @internal + */ + updateChildren: function (prevChildren, nextChildren, mountImages, removedNodes, transaction, hostParent, hostContainerInfo, context) { + // We currently don't have a way to track moves here but if we use iterators + // instead of for..in we can zip the iterators and check if an item has + // moved. + // TODO: If nothing has changed, return the prevChildren object so that we + // can quickly bailout if nothing has changed. + if (!nextChildren && !prevChildren) { + return; + } + var name; + var prevChild; + for (name in nextChildren) { + if (!nextChildren.hasOwnProperty(name)) { + continue; + } + prevChild = prevChildren && prevChildren[name]; + var prevElement = prevChild && prevChild._currentElement; + var nextElement = nextChildren[name]; + if (prevChild != null && shouldUpdateReactComponent(prevElement, nextElement)) { + ReactReconciler.receiveComponent(prevChild, nextElement, transaction, context); + nextChildren[name] = prevChild; + } else { + if (prevChild) { + removedNodes[name] = ReactReconciler.getHostNode(prevChild); + ReactReconciler.unmountComponent(prevChild, false); + } + // The child must be instantiated before it's mounted. + var nextChildInstance = instantiateReactComponent(nextElement, true); + nextChildren[name] = nextChildInstance; + // Creating mount image now ensures refs are resolved in right order + // (see https://github.com/facebook/react/pull/7101 for explanation). + var nextChildMountImage = ReactReconciler.mountComponent(nextChildInstance, transaction, hostParent, hostContainerInfo, context); + mountImages.push(nextChildMountImage); + } + } + // Unmount children that are no longer present. + for (name in prevChildren) { + if (prevChildren.hasOwnProperty(name) && !(nextChildren && nextChildren.hasOwnProperty(name))) { + prevChild = prevChildren[name]; + removedNodes[name] = ReactReconciler.getHostNode(prevChild); + ReactReconciler.unmountComponent(prevChild, false); + } + } + }, + + /** + * Unmounts all rendered children. This should be used to clean up children + * when this component is unmounted. + * + * @param {?object} renderedChildren Previously initialized set of children. + * @internal + */ + unmountChildren: function (renderedChildren, safely) { + for (var name in renderedChildren) { + if (renderedChildren.hasOwnProperty(name)) { + var renderedChild = renderedChildren[name]; + ReactReconciler.unmountComponent(renderedChild, safely); + } + } + } + +}; + +module.exports = ReactChildReconciler; +}).call(this,require('_process')) + +},{"./KeyEscapeUtils":70,"./ReactComponentTreeDevtool":82,"./ReactReconciler":136,"./instantiateReactComponent":180,"./shouldUpdateReactComponent":189,"./traverseAllChildren":190,"_process":40,"fbjs/lib/warning":217}],76:[function(require,module,exports){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule ReactChildren + */ + +'use strict'; + +var PooledClass = require('./PooledClass'); +var ReactElement = require('./ReactElement'); + +var emptyFunction = require('fbjs/lib/emptyFunction'); +var traverseAllChildren = require('./traverseAllChildren'); + +var twoArgumentPooler = PooledClass.twoArgumentPooler; +var fourArgumentPooler = PooledClass.fourArgumentPooler; + +var userProvidedKeyEscapeRegex = /\/+/g; +function escapeUserProvidedKey(text) { + return ('' + text).replace(userProvidedKeyEscapeRegex, '$&/'); +} + +/** + * PooledClass representing the bookkeeping associated with performing a child + * traversal. Allows avoiding binding callbacks. + * + * @constructor ForEachBookKeeping + * @param {!function} forEachFunction Function to perform traversal with. + * @param {?*} forEachContext Context to perform context with. + */ +function ForEachBookKeeping(forEachFunction, forEachContext) { + this.func = forEachFunction; + this.context = forEachContext; + this.count = 0; +} +ForEachBookKeeping.prototype.destructor = function () { + this.func = null; + this.context = null; + this.count = 0; +}; +PooledClass.addPoolingTo(ForEachBookKeeping, twoArgumentPooler); + +function forEachSingleChild(bookKeeping, child, name) { + var func = bookKeeping.func; + var context = bookKeeping.context; + + func.call(context, child, bookKeeping.count++); +} + +/** + * Iterates through children that are typically specified as `props.children`. + * + * See https://facebook.github.io/react/docs/top-level-api.html#react.children.foreach + * + * The provided forEachFunc(child, index) will be called for each + * leaf child. + * + * @param {?*} children Children tree container. + * @param {function(*, int)} forEachFunc + * @param {*} forEachContext Context for forEachContext. + */ +function forEachChildren(children, forEachFunc, forEachContext) { + if (children == null) { + return children; + } + var traverseContext = ForEachBookKeeping.getPooled(forEachFunc, forEachContext); + traverseAllChildren(children, forEachSingleChild, traverseContext); + ForEachBookKeeping.release(traverseContext); +} + +/** + * PooledClass representing the bookkeeping associated with performing a child + * mapping. Allows avoiding binding callbacks. + * + * @constructor MapBookKeeping + * @param {!*} mapResult Object containing the ordered map of results. + * @param {!function} mapFunction Function to perform mapping with. + * @param {?*} mapContext Context to perform mapping with. + */ +function MapBookKeeping(mapResult, keyPrefix, mapFunction, mapContext) { + this.result = mapResult; + this.keyPrefix = keyPrefix; + this.func = mapFunction; + this.context = mapContext; + this.count = 0; +} +MapBookKeeping.prototype.destructor = function () { + this.result = null; + this.keyPrefix = null; + this.func = null; + this.context = null; + this.count = 0; +}; +PooledClass.addPoolingTo(MapBookKeeping, fourArgumentPooler); + +function mapSingleChildIntoContext(bookKeeping, child, childKey) { + var result = bookKeeping.result; + var keyPrefix = bookKeeping.keyPrefix; + var func = bookKeeping.func; + var context = bookKeeping.context; + + + var mappedChild = func.call(context, child, bookKeeping.count++); + if (Array.isArray(mappedChild)) { + mapIntoWithKeyPrefixInternal(mappedChild, result, childKey, emptyFunction.thatReturnsArgument); + } else if (mappedChild != null) { + if (ReactElement.isValidElement(mappedChild)) { + mappedChild = ReactElement.cloneAndReplaceKey(mappedChild, + // Keep both the (mapped) and old keys if they differ, just as + // traverseAllChildren used to do for objects as children + keyPrefix + (mappedChild.key && (!child || child.key !== mappedChild.key) ? escapeUserProvidedKey(mappedChild.key) + '/' : '') + childKey); + } + result.push(mappedChild); + } +} + +function mapIntoWithKeyPrefixInternal(children, array, prefix, func, context) { + var escapedPrefix = ''; + if (prefix != null) { + escapedPrefix = escapeUserProvidedKey(prefix) + '/'; + } + var traverseContext = MapBookKeeping.getPooled(array, escapedPrefix, func, context); + traverseAllChildren(children, mapSingleChildIntoContext, traverseContext); + MapBookKeeping.release(traverseContext); +} + +/** + * Maps children that are typically specified as `props.children`. + * + * See https://facebook.github.io/react/docs/top-level-api.html#react.children.map + * + * The provided mapFunction(child, key, index) will be called for each + * leaf child. + * + * @param {?*} children Children tree container. + * @param {function(*, int)} func The map function. + * @param {*} context Context for mapFunction. + * @return {object} Object containing the ordered map of results. + */ +function mapChildren(children, func, context) { + if (children == null) { + return children; + } + var result = []; + mapIntoWithKeyPrefixInternal(children, result, null, func, context); + return result; +} + +function forEachSingleChildDummy(traverseContext, child, name) { + return null; +} + +/** + * Count the number of children that are typically specified as + * `props.children`. + * + * See https://facebook.github.io/react/docs/top-level-api.html#react.children.count + * + * @param {?*} children Children tree container. + * @return {number} The number of children. + */ +function countChildren(children, context) { + return traverseAllChildren(children, forEachSingleChildDummy, null); +} + +/** + * Flatten a children object (typically specified as `props.children`) and + * return an array with appropriately re-keyed children. + * + * See https://facebook.github.io/react/docs/top-level-api.html#react.children.toarray + */ +function toArray(children) { + var result = []; + mapIntoWithKeyPrefixInternal(children, result, null, emptyFunction.thatReturnsArgument); + return result; +} + +var ReactChildren = { + forEach: forEachChildren, + map: mapChildren, + mapIntoWithKeyPrefixInternal: mapIntoWithKeyPrefixInternal, + count: countChildren, + toArray: toArray +}; + +module.exports = ReactChildren; +},{"./PooledClass":72,"./ReactElement":109,"./traverseAllChildren":190,"fbjs/lib/emptyFunction":199}],77:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule ReactChildrenMutationWarningDevtool + */ + +'use strict'; + +var ReactComponentTreeDevtool = require('./ReactComponentTreeDevtool'); + +var warning = require('fbjs/lib/warning'); + +var elements = {}; + +function handleElement(debugID, element) { + if (element == null) { + return; + } + if (element._shadowChildren === undefined) { + return; + } + if (element._shadowChildren === element.props.children) { + return; + } + var isMutated = false; + if (Array.isArray(element._shadowChildren)) { + if (element._shadowChildren.length === element.props.children.length) { + for (var i = 0; i < element._shadowChildren.length; i++) { + if (element._shadowChildren[i] !== element.props.children[i]) { + isMutated = true; + } + } + } else { + isMutated = true; + } + } + process.env.NODE_ENV !== 'production' ? warning(Array.isArray(element._shadowChildren) && !isMutated, 'Component\'s children should not be mutated.%s', ReactComponentTreeDevtool.getStackAddendumByID(debugID)) : void 0; +} + +var ReactDOMUnknownPropertyDevtool = { + onBeforeMountComponent: function (debugID, element) { + elements[debugID] = element; + }, + onBeforeUpdateComponent: function (debugID, element) { + elements[debugID] = element; + }, + onComponentHasMounted: function (debugID) { + handleElement(debugID, elements[debugID]); + delete elements[debugID]; + }, + onComponentHasUpdated: function (debugID) { + handleElement(debugID, elements[debugID]); + delete elements[debugID]; + } +}; + +module.exports = ReactDOMUnknownPropertyDevtool; +}).call(this,require('_process')) + +},{"./ReactComponentTreeDevtool":82,"_process":40,"fbjs/lib/warning":217}],78:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule ReactClass + */ + +'use strict'; + +var _prodInvariant = require('./reactProdInvariant'), + _assign = require('object-assign'); + +var ReactComponent = require('./ReactComponent'); +var ReactElement = require('./ReactElement'); +var ReactPropTypeLocations = require('./ReactPropTypeLocations'); +var ReactPropTypeLocationNames = require('./ReactPropTypeLocationNames'); +var ReactNoopUpdateQueue = require('./ReactNoopUpdateQueue'); + +var emptyObject = require('fbjs/lib/emptyObject'); +var invariant = require('fbjs/lib/invariant'); +var keyMirror = require('fbjs/lib/keyMirror'); +var keyOf = require('fbjs/lib/keyOf'); +var warning = require('fbjs/lib/warning'); + +var MIXINS_KEY = keyOf({ mixins: null }); + +/** + * Policies that describe methods in `ReactClassInterface`. + */ +var SpecPolicy = keyMirror({ + /** + * These methods may be defined only once by the class specification or mixin. + */ + DEFINE_ONCE: null, + /** + * These methods may be defined by both the class specification and mixins. + * Subsequent definitions will be chained. These methods must return void. + */ + DEFINE_MANY: null, + /** + * These methods are overriding the base class. + */ + OVERRIDE_BASE: null, + /** + * These methods are similar to DEFINE_MANY, except we assume they return + * objects. We try to merge the keys of the return values of all the mixed in + * functions. If there is a key conflict we throw. + */ + DEFINE_MANY_MERGED: null +}); + +var injectedMixins = []; + +/** + * Composite components are higher-level components that compose other composite + * or host components. + * + * To create a new type of `ReactClass`, pass a specification of + * your new class to `React.createClass`. The only requirement of your class + * specification is that you implement a `render` method. + * + * var MyComponent = React.createClass({ + * render: function() { + * return
Hello World
; + * } + * }); + * + * The class specification supports a specific protocol of methods that have + * special meaning (e.g. `render`). See `ReactClassInterface` for + * more the comprehensive protocol. Any other properties and methods in the + * class specification will be available on the prototype. + * + * @interface ReactClassInterface + * @internal + */ +var ReactClassInterface = { + + /** + * An array of Mixin objects to include when defining your component. + * + * @type {array} + * @optional + */ + mixins: SpecPolicy.DEFINE_MANY, + + /** + * An object containing properties and methods that should be defined on + * the component's constructor instead of its prototype (static methods). + * + * @type {object} + * @optional + */ + statics: SpecPolicy.DEFINE_MANY, + + /** + * Definition of prop types for this component. + * + * @type {object} + * @optional + */ + propTypes: SpecPolicy.DEFINE_MANY, + + /** + * Definition of context types for this component. + * + * @type {object} + * @optional + */ + contextTypes: SpecPolicy.DEFINE_MANY, + + /** + * Definition of context types this component sets for its children. + * + * @type {object} + * @optional + */ + childContextTypes: SpecPolicy.DEFINE_MANY, + + // ==== Definition methods ==== + + /** + * Invoked when the component is mounted. Values in the mapping will be set on + * `this.props` if that prop is not specified (i.e. using an `in` check). + * + * This method is invoked before `getInitialState` and therefore cannot rely + * on `this.state` or use `this.setState`. + * + * @return {object} + * @optional + */ + getDefaultProps: SpecPolicy.DEFINE_MANY_MERGED, + + /** + * Invoked once before the component is mounted. The return value will be used + * as the initial value of `this.state`. + * + * getInitialState: function() { + * return { + * isOn: false, + * fooBaz: new BazFoo() + * } + * } + * + * @return {object} + * @optional + */ + getInitialState: SpecPolicy.DEFINE_MANY_MERGED, + + /** + * @return {object} + * @optional + */ + getChildContext: SpecPolicy.DEFINE_MANY_MERGED, + + /** + * Uses props from `this.props` and state from `this.state` to render the + * structure of the component. + * + * No guarantees are made about when or how often this method is invoked, so + * it must not have side effects. + * + * render: function() { + * var name = this.props.name; + * return
Hello, {name}!
; + * } + * + * @return {ReactComponent} + * @nosideeffects + * @required + */ + render: SpecPolicy.DEFINE_ONCE, + + // ==== Delegate methods ==== + + /** + * Invoked when the component is initially created and about to be mounted. + * This may have side effects, but any external subscriptions or data created + * by this method must be cleaned up in `componentWillUnmount`. + * + * @optional + */ + componentWillMount: SpecPolicy.DEFINE_MANY, + + /** + * Invoked when the component has been mounted and has a DOM representation. + * However, there is no guarantee that the DOM node is in the document. + * + * Use this as an opportunity to operate on the DOM when the component has + * been mounted (initialized and rendered) for the first time. + * + * @param {DOMElement} rootNode DOM element representing the component. + * @optional + */ + componentDidMount: SpecPolicy.DEFINE_MANY, + + /** + * Invoked before the component receives new props. + * + * Use this as an opportunity to react to a prop transition by updating the + * state using `this.setState`. Current props are accessed via `this.props`. + * + * componentWillReceiveProps: function(nextProps, nextContext) { + * this.setState({ + * likesIncreasing: nextProps.likeCount > this.props.likeCount + * }); + * } + * + * NOTE: There is no equivalent `componentWillReceiveState`. An incoming prop + * transition may cause a state change, but the opposite is not true. If you + * need it, you are probably looking for `componentWillUpdate`. + * + * @param {object} nextProps + * @optional + */ + componentWillReceiveProps: SpecPolicy.DEFINE_MANY, + + /** + * Invoked while deciding if the component should be updated as a result of + * receiving new props, state and/or context. + * + * Use this as an opportunity to `return false` when you're certain that the + * transition to the new props/state/context will not require a component + * update. + * + * shouldComponentUpdate: function(nextProps, nextState, nextContext) { + * return !equal(nextProps, this.props) || + * !equal(nextState, this.state) || + * !equal(nextContext, this.context); + * } + * + * @param {object} nextProps + * @param {?object} nextState + * @param {?object} nextContext + * @return {boolean} True if the component should update. + * @optional + */ + shouldComponentUpdate: SpecPolicy.DEFINE_ONCE, + + /** + * Invoked when the component is about to update due to a transition from + * `this.props`, `this.state` and `this.context` to `nextProps`, `nextState` + * and `nextContext`. + * + * Use this as an opportunity to perform preparation before an update occurs. + * + * NOTE: You **cannot** use `this.setState()` in this method. + * + * @param {object} nextProps + * @param {?object} nextState + * @param {?object} nextContext + * @param {ReactReconcileTransaction} transaction + * @optional + */ + componentWillUpdate: SpecPolicy.DEFINE_MANY, + + /** + * Invoked when the component's DOM representation has been updated. + * + * Use this as an opportunity to operate on the DOM when the component has + * been updated. + * + * @param {object} prevProps + * @param {?object} prevState + * @param {?object} prevContext + * @param {DOMElement} rootNode DOM element representing the component. + * @optional + */ + componentDidUpdate: SpecPolicy.DEFINE_MANY, + + /** + * Invoked when the component is about to be removed from its parent and have + * its DOM representation destroyed. + * + * Use this as an opportunity to deallocate any external resources. + * + * NOTE: There is no `componentDidUnmount` since your component will have been + * destroyed by that point. + * + * @optional + */ + componentWillUnmount: SpecPolicy.DEFINE_MANY, + + // ==== Advanced methods ==== + + /** + * Updates the component's currently mounted DOM representation. + * + * By default, this implements React's rendering and reconciliation algorithm. + * Sophisticated clients may wish to override this. + * + * @param {ReactReconcileTransaction} transaction + * @internal + * @overridable + */ + updateComponent: SpecPolicy.OVERRIDE_BASE + +}; + +/** + * Mapping from class specification keys to special processing functions. + * + * Although these are declared like instance properties in the specification + * when defining classes using `React.createClass`, they are actually static + * and are accessible on the constructor instead of the prototype. Despite + * being static, they must be defined outside of the "statics" key under + * which all other static methods are defined. + */ +var RESERVED_SPEC_KEYS = { + displayName: function (Constructor, displayName) { + Constructor.displayName = displayName; + }, + mixins: function (Constructor, mixins) { + if (mixins) { + for (var i = 0; i < mixins.length; i++) { + mixSpecIntoComponent(Constructor, mixins[i]); + } + } + }, + childContextTypes: function (Constructor, childContextTypes) { + if (process.env.NODE_ENV !== 'production') { + validateTypeDef(Constructor, childContextTypes, ReactPropTypeLocations.childContext); + } + Constructor.childContextTypes = _assign({}, Constructor.childContextTypes, childContextTypes); + }, + contextTypes: function (Constructor, contextTypes) { + if (process.env.NODE_ENV !== 'production') { + validateTypeDef(Constructor, contextTypes, ReactPropTypeLocations.context); + } + Constructor.contextTypes = _assign({}, Constructor.contextTypes, contextTypes); + }, + /** + * Special case getDefaultProps which should move into statics but requires + * automatic merging. + */ + getDefaultProps: function (Constructor, getDefaultProps) { + if (Constructor.getDefaultProps) { + Constructor.getDefaultProps = createMergedResultFunction(Constructor.getDefaultProps, getDefaultProps); + } else { + Constructor.getDefaultProps = getDefaultProps; + } + }, + propTypes: function (Constructor, propTypes) { + if (process.env.NODE_ENV !== 'production') { + validateTypeDef(Constructor, propTypes, ReactPropTypeLocations.prop); + } + Constructor.propTypes = _assign({}, Constructor.propTypes, propTypes); + }, + statics: function (Constructor, statics) { + mixStaticSpecIntoComponent(Constructor, statics); + }, + autobind: function () {} }; + +// noop +function validateTypeDef(Constructor, typeDef, location) { + for (var propName in typeDef) { + if (typeDef.hasOwnProperty(propName)) { + // use a warning instead of an invariant so components + // don't show up in prod but only in __DEV__ + process.env.NODE_ENV !== 'production' ? warning(typeof typeDef[propName] === 'function', '%s: %s type `%s` is invalid; it must be a function, usually from ' + 'React.PropTypes.', Constructor.displayName || 'ReactClass', ReactPropTypeLocationNames[location], propName) : void 0; + } + } +} + +function validateMethodOverride(isAlreadyDefined, name) { + var specPolicy = ReactClassInterface.hasOwnProperty(name) ? ReactClassInterface[name] : null; + + // Disallow overriding of base class methods unless explicitly allowed. + if (ReactClassMixin.hasOwnProperty(name)) { + !(specPolicy === SpecPolicy.OVERRIDE_BASE) ? process.env.NODE_ENV !== 'production' ? invariant(false, 'ReactClassInterface: You are attempting to override `%s` from your class specification. Ensure that your method names do not overlap with React methods.', name) : _prodInvariant('73', name) : void 0; + } + + // Disallow defining methods more than once unless explicitly allowed. + if (isAlreadyDefined) { + !(specPolicy === SpecPolicy.DEFINE_MANY || specPolicy === SpecPolicy.DEFINE_MANY_MERGED) ? process.env.NODE_ENV !== 'production' ? invariant(false, 'ReactClassInterface: You are attempting to define `%s` on your component more than once. This conflict may be due to a mixin.', name) : _prodInvariant('74', name) : void 0; + } +} + +/** + * Mixin helper which handles policy validation and reserved + * specification keys when building React classes. + */ +function mixSpecIntoComponent(Constructor, spec) { + if (!spec) { + if (process.env.NODE_ENV !== 'production') { + var typeofSpec = typeof spec; + var isMixinValid = typeofSpec === 'object' && spec !== null; + + process.env.NODE_ENV !== 'production' ? warning(isMixinValid, '%s: You\'re attempting to include a mixin that is either null ' + 'or not an object. Check the mixins included by the component, ' + 'as well as any mixins they include themselves. ' + 'Expected object but got %s.', Constructor.displayName || 'ReactClass', spec === null ? null : typeofSpec) : void 0; + } + + return; + } + + !(typeof spec !== 'function') ? process.env.NODE_ENV !== 'production' ? invariant(false, 'ReactClass: You\'re attempting to use a component class or function as a mixin. Instead, just use a regular object.') : _prodInvariant('75') : void 0; + !!ReactElement.isValidElement(spec) ? process.env.NODE_ENV !== 'production' ? invariant(false, 'ReactClass: You\'re attempting to use a component as a mixin. Instead, just use a regular object.') : _prodInvariant('76') : void 0; + + var proto = Constructor.prototype; + var autoBindPairs = proto.__reactAutoBindPairs; + + // By handling mixins before any other properties, we ensure the same + // chaining order is applied to methods with DEFINE_MANY policy, whether + // mixins are listed before or after these methods in the spec. + if (spec.hasOwnProperty(MIXINS_KEY)) { + RESERVED_SPEC_KEYS.mixins(Constructor, spec.mixins); + } + + for (var name in spec) { + if (!spec.hasOwnProperty(name)) { + continue; + } + + if (name === MIXINS_KEY) { + // We have already handled mixins in a special case above. + continue; + } + + var property = spec[name]; + var isAlreadyDefined = proto.hasOwnProperty(name); + validateMethodOverride(isAlreadyDefined, name); + + if (RESERVED_SPEC_KEYS.hasOwnProperty(name)) { + RESERVED_SPEC_KEYS[name](Constructor, property); + } else { + // Setup methods on prototype: + // The following member methods should not be automatically bound: + // 1. Expected ReactClass methods (in the "interface"). + // 2. Overridden methods (that were mixed in). + var isReactClassMethod = ReactClassInterface.hasOwnProperty(name); + var isFunction = typeof property === 'function'; + var shouldAutoBind = isFunction && !isReactClassMethod && !isAlreadyDefined && spec.autobind !== false; + + if (shouldAutoBind) { + autoBindPairs.push(name, property); + proto[name] = property; + } else { + if (isAlreadyDefined) { + var specPolicy = ReactClassInterface[name]; + + // These cases should already be caught by validateMethodOverride. + !(isReactClassMethod && (specPolicy === SpecPolicy.DEFINE_MANY_MERGED || specPolicy === SpecPolicy.DEFINE_MANY)) ? process.env.NODE_ENV !== 'production' ? invariant(false, 'ReactClass: Unexpected spec policy %s for key %s when mixing in component specs.', specPolicy, name) : _prodInvariant('77', specPolicy, name) : void 0; + + // For methods which are defined more than once, call the existing + // methods before calling the new property, merging if appropriate. + if (specPolicy === SpecPolicy.DEFINE_MANY_MERGED) { + proto[name] = createMergedResultFunction(proto[name], property); + } else if (specPolicy === SpecPolicy.DEFINE_MANY) { + proto[name] = createChainedFunction(proto[name], property); + } + } else { + proto[name] = property; + if (process.env.NODE_ENV !== 'production') { + // Add verbose displayName to the function, which helps when looking + // at profiling tools. + if (typeof property === 'function' && spec.displayName) { + proto[name].displayName = spec.displayName + '_' + name; + } + } + } + } + } + } +} + +function mixStaticSpecIntoComponent(Constructor, statics) { + if (!statics) { + return; + } + for (var name in statics) { + var property = statics[name]; + if (!statics.hasOwnProperty(name)) { + continue; + } + + var isReserved = name in RESERVED_SPEC_KEYS; + !!isReserved ? process.env.NODE_ENV !== 'production' ? invariant(false, 'ReactClass: You are attempting to define a reserved property, `%s`, that shouldn\'t be on the "statics" key. Define it as an instance property instead; it will still be accessible on the constructor.', name) : _prodInvariant('78', name) : void 0; + + var isInherited = name in Constructor; + !!isInherited ? process.env.NODE_ENV !== 'production' ? invariant(false, 'ReactClass: You are attempting to define `%s` on your component more than once. This conflict may be due to a mixin.', name) : _prodInvariant('79', name) : void 0; + Constructor[name] = property; + } +} + +/** + * Merge two objects, but throw if both contain the same key. + * + * @param {object} one The first object, which is mutated. + * @param {object} two The second object + * @return {object} one after it has been mutated to contain everything in two. + */ +function mergeIntoWithNoDuplicateKeys(one, two) { + !(one && two && typeof one === 'object' && typeof two === 'object') ? process.env.NODE_ENV !== 'production' ? invariant(false, 'mergeIntoWithNoDuplicateKeys(): Cannot merge non-objects.') : _prodInvariant('80') : void 0; + + for (var key in two) { + if (two.hasOwnProperty(key)) { + !(one[key] === undefined) ? process.env.NODE_ENV !== 'production' ? invariant(false, 'mergeIntoWithNoDuplicateKeys(): Tried to merge two objects with the same key: `%s`. This conflict may be due to a mixin; in particular, this may be caused by two getInitialState() or getDefaultProps() methods returning objects with clashing keys.', key) : _prodInvariant('81', key) : void 0; + one[key] = two[key]; + } + } + return one; +} + +/** + * Creates a function that invokes two functions and merges their return values. + * + * @param {function} one Function to invoke first. + * @param {function} two Function to invoke second. + * @return {function} Function that invokes the two argument functions. + * @private + */ +function createMergedResultFunction(one, two) { + return function mergedResult() { + var a = one.apply(this, arguments); + var b = two.apply(this, arguments); + if (a == null) { + return b; + } else if (b == null) { + return a; + } + var c = {}; + mergeIntoWithNoDuplicateKeys(c, a); + mergeIntoWithNoDuplicateKeys(c, b); + return c; + }; +} + +/** + * Creates a function that invokes two functions and ignores their return vales. + * + * @param {function} one Function to invoke first. + * @param {function} two Function to invoke second. + * @return {function} Function that invokes the two argument functions. + * @private + */ +function createChainedFunction(one, two) { + return function chainedFunction() { + one.apply(this, arguments); + two.apply(this, arguments); + }; +} + +/** + * Binds a method to the component. + * + * @param {object} component Component whose method is going to be bound. + * @param {function} method Method to be bound. + * @return {function} The bound method. + */ +function bindAutoBindMethod(component, method) { + var boundMethod = method.bind(component); + if (process.env.NODE_ENV !== 'production') { + boundMethod.__reactBoundContext = component; + boundMethod.__reactBoundMethod = method; + boundMethod.__reactBoundArguments = null; + var componentName = component.constructor.displayName; + var _bind = boundMethod.bind; + boundMethod.bind = function (newThis) { + for (var _len = arguments.length, args = Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) { + args[_key - 1] = arguments[_key]; + } + + // User is trying to bind() an autobound method; we effectively will + // ignore the value of "this" that the user is trying to use, so + // let's warn. + if (newThis !== component && newThis !== null) { + process.env.NODE_ENV !== 'production' ? warning(false, 'bind(): React component methods may only be bound to the ' + 'component instance. See %s', componentName) : void 0; + } else if (!args.length) { + process.env.NODE_ENV !== 'production' ? warning(false, 'bind(): You are binding a component method to the component. ' + 'React does this for you automatically in a high-performance ' + 'way, so you can safely remove this call. See %s', componentName) : void 0; + return boundMethod; + } + var reboundMethod = _bind.apply(boundMethod, arguments); + reboundMethod.__reactBoundContext = component; + reboundMethod.__reactBoundMethod = method; + reboundMethod.__reactBoundArguments = args; + return reboundMethod; + }; + } + return boundMethod; +} + +/** + * Binds all auto-bound methods in a component. + * + * @param {object} component Component whose method is going to be bound. + */ +function bindAutoBindMethods(component) { + var pairs = component.__reactAutoBindPairs; + for (var i = 0; i < pairs.length; i += 2) { + var autoBindKey = pairs[i]; + var method = pairs[i + 1]; + component[autoBindKey] = bindAutoBindMethod(component, method); + } +} + +/** + * Add more to the ReactClass base class. These are all legacy features and + * therefore not already part of the modern ReactComponent. + */ +var ReactClassMixin = { + + /** + * TODO: This will be deprecated because state should always keep a consistent + * type signature and the only use case for this, is to avoid that. + */ + replaceState: function (newState, callback) { + this.updater.enqueueReplaceState(this, newState); + if (callback) { + this.updater.enqueueCallback(this, callback, 'replaceState'); + } + }, + + /** + * Checks whether or not this composite component is mounted. + * @return {boolean} True if mounted, false otherwise. + * @protected + * @final + */ + isMounted: function () { + return this.updater.isMounted(this); + } +}; + +var ReactClassComponent = function () {}; +_assign(ReactClassComponent.prototype, ReactComponent.prototype, ReactClassMixin); + +/** + * Module for creating composite components. + * + * @class ReactClass + */ +var ReactClass = { + + /** + * Creates a composite component class given a class specification. + * See https://facebook.github.io/react/docs/top-level-api.html#react.createclass + * + * @param {object} spec Class specification (which must define `render`). + * @return {function} Component constructor function. + * @public + */ + createClass: function (spec) { + var Constructor = function (props, context, updater) { + // This constructor gets overridden by mocks. The argument is used + // by mocks to assert on what gets mounted. + + if (process.env.NODE_ENV !== 'production') { + process.env.NODE_ENV !== 'production' ? warning(this instanceof Constructor, 'Something is calling a React component directly. Use a factory or ' + 'JSX instead. See: https://fb.me/react-legacyfactory') : void 0; + } + + // Wire up auto-binding + if (this.__reactAutoBindPairs.length) { + bindAutoBindMethods(this); + } + + this.props = props; + this.context = context; + this.refs = emptyObject; + this.updater = updater || ReactNoopUpdateQueue; + + this.state = null; + + // ReactClasses doesn't have constructors. Instead, they use the + // getInitialState and componentWillMount methods for initialization. + + var initialState = this.getInitialState ? this.getInitialState() : null; + if (process.env.NODE_ENV !== 'production') { + // We allow auto-mocks to proceed as if they're returning null. + if (initialState === undefined && this.getInitialState._isMockFunction) { + // This is probably bad practice. Consider warning here and + // deprecating this convenience. + initialState = null; + } + } + !(typeof initialState === 'object' && !Array.isArray(initialState)) ? process.env.NODE_ENV !== 'production' ? invariant(false, '%s.getInitialState(): must return an object or null', Constructor.displayName || 'ReactCompositeComponent') : _prodInvariant('82', Constructor.displayName || 'ReactCompositeComponent') : void 0; + + this.state = initialState; + }; + Constructor.prototype = new ReactClassComponent(); + Constructor.prototype.constructor = Constructor; + Constructor.prototype.__reactAutoBindPairs = []; + + injectedMixins.forEach(mixSpecIntoComponent.bind(null, Constructor)); + + mixSpecIntoComponent(Constructor, spec); + + // Initialize the defaultProps property after all mixins have been merged. + if (Constructor.getDefaultProps) { + Constructor.defaultProps = Constructor.getDefaultProps(); + } + + if (process.env.NODE_ENV !== 'production') { + // This is a tag to indicate that the use of these method names is ok, + // since it's used with createClass. If it's not, then it's likely a + // mistake so we'll warn you to use the static property, property + // initializer or constructor respectively. + if (Constructor.getDefaultProps) { + Constructor.getDefaultProps.isReactClassApproved = {}; + } + if (Constructor.prototype.getInitialState) { + Constructor.prototype.getInitialState.isReactClassApproved = {}; + } + } + + !Constructor.prototype.render ? process.env.NODE_ENV !== 'production' ? invariant(false, 'createClass(...): Class specification must implement a `render` method.') : _prodInvariant('83') : void 0; + + if (process.env.NODE_ENV !== 'production') { + process.env.NODE_ENV !== 'production' ? warning(!Constructor.prototype.componentShouldUpdate, '%s has a method called ' + 'componentShouldUpdate(). Did you mean shouldComponentUpdate()? ' + 'The name is phrased as a question because the function is ' + 'expected to return a value.', spec.displayName || 'A component') : void 0; + process.env.NODE_ENV !== 'production' ? warning(!Constructor.prototype.componentWillRecieveProps, '%s has a method called ' + 'componentWillRecieveProps(). Did you mean componentWillReceiveProps()?', spec.displayName || 'A component') : void 0; + } + + // Reduce time spent doing lookups by setting these on the prototype. + for (var methodName in ReactClassInterface) { + if (!Constructor.prototype[methodName]) { + Constructor.prototype[methodName] = null; + } + } + + return Constructor; + }, + + injection: { + injectMixin: function (mixin) { + injectedMixins.push(mixin); + } + } + +}; + +module.exports = ReactClass; +}).call(this,require('_process')) + +},{"./ReactComponent":79,"./ReactElement":109,"./ReactNoopUpdateQueue":128,"./ReactPropTypeLocationNames":130,"./ReactPropTypeLocations":131,"./reactProdInvariant":185,"_process":40,"fbjs/lib/emptyObject":200,"fbjs/lib/invariant":207,"fbjs/lib/keyMirror":210,"fbjs/lib/keyOf":211,"fbjs/lib/warning":217,"object-assign":39}],79:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule ReactComponent + */ + +'use strict'; + +var _prodInvariant = require('./reactProdInvariant'); + +var ReactNoopUpdateQueue = require('./ReactNoopUpdateQueue'); + +var canDefineProperty = require('./canDefineProperty'); +var emptyObject = require('fbjs/lib/emptyObject'); +var invariant = require('fbjs/lib/invariant'); +var warning = require('fbjs/lib/warning'); + +/** + * Base class helpers for the updating state of a component. + */ +function ReactComponent(props, context, updater) { + this.props = props; + this.context = context; + this.refs = emptyObject; + // We initialize the default updater but the real one gets injected by the + // renderer. + this.updater = updater || ReactNoopUpdateQueue; +} + +ReactComponent.prototype.isReactComponent = {}; + +/** + * Sets a subset of the state. Always use this to mutate + * state. You should treat `this.state` as immutable. + * + * There is no guarantee that `this.state` will be immediately updated, so + * accessing `this.state` after calling this method may return the old value. + * + * There is no guarantee that calls to `setState` will run synchronously, + * as they may eventually be batched together. You can provide an optional + * callback that will be executed when the call to setState is actually + * completed. + * + * When a function is provided to setState, it will be called at some point in + * the future (not synchronously). It will be called with the up to date + * component arguments (state, props, context). These values can be different + * from this.* because your function may be called after receiveProps but before + * shouldComponentUpdate, and this new state, props, and context will not yet be + * assigned to this. + * + * @param {object|function} partialState Next partial state or function to + * produce next partial state to be merged with current state. + * @param {?function} callback Called after state is updated. + * @final + * @protected + */ +ReactComponent.prototype.setState = function (partialState, callback) { + !(typeof partialState === 'object' || typeof partialState === 'function' || partialState == null) ? process.env.NODE_ENV !== 'production' ? invariant(false, 'setState(...): takes an object of state variables to update or a function which returns an object of state variables.') : _prodInvariant('85') : void 0; + this.updater.enqueueSetState(this, partialState); + if (callback) { + this.updater.enqueueCallback(this, callback, 'setState'); + } +}; + +/** + * Forces an update. This should only be invoked when it is known with + * certainty that we are **not** in a DOM transaction. + * + * You may want to call this when you know that some deeper aspect of the + * component's state has changed but `setState` was not called. + * + * This will not invoke `shouldComponentUpdate`, but it will invoke + * `componentWillUpdate` and `componentDidUpdate`. + * + * @param {?function} callback Called after update is complete. + * @final + * @protected + */ +ReactComponent.prototype.forceUpdate = function (callback) { + this.updater.enqueueForceUpdate(this); + if (callback) { + this.updater.enqueueCallback(this, callback, 'forceUpdate'); + } +}; + +/** + * Deprecated APIs. These APIs used to exist on classic React classes but since + * we would like to deprecate them, we're not going to move them over to this + * modern base class. Instead, we define a getter that warns if it's accessed. + */ +if (process.env.NODE_ENV !== 'production') { + var deprecatedAPIs = { + isMounted: ['isMounted', 'Instead, make sure to clean up subscriptions and pending requests in ' + 'componentWillUnmount to prevent memory leaks.'], + replaceState: ['replaceState', 'Refactor your code to use setState instead (see ' + 'https://github.com/facebook/react/issues/3236).'] + }; + var defineDeprecationWarning = function (methodName, info) { + if (canDefineProperty) { + Object.defineProperty(ReactComponent.prototype, methodName, { + get: function () { + process.env.NODE_ENV !== 'production' ? warning(false, '%s(...) is deprecated in plain JavaScript React classes. %s', info[0], info[1]) : void 0; + return undefined; + } + }); + } + }; + for (var fnName in deprecatedAPIs) { + if (deprecatedAPIs.hasOwnProperty(fnName)) { + defineDeprecationWarning(fnName, deprecatedAPIs[fnName]); + } + } +} + +module.exports = ReactComponent; +}).call(this,require('_process')) + +},{"./ReactNoopUpdateQueue":128,"./canDefineProperty":163,"./reactProdInvariant":185,"_process":40,"fbjs/lib/emptyObject":200,"fbjs/lib/invariant":207,"fbjs/lib/warning":217}],80:[function(require,module,exports){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule ReactComponentBrowserEnvironment + */ + +'use strict'; + +var DOMChildrenOperations = require('./DOMChildrenOperations'); +var ReactDOMIDOperations = require('./ReactDOMIDOperations'); + +/** + * Abstracts away all functionality of the reconciler that requires knowledge of + * the browser context. TODO: These callers should be refactored to avoid the + * need for this injection. + */ +var ReactComponentBrowserEnvironment = { + + processChildrenUpdates: ReactDOMIDOperations.dangerouslyProcessChildrenUpdates, + + replaceNodeWithMarkup: DOMChildrenOperations.dangerouslyReplaceNodeWithMarkup, + + /** + * If a particular environment requires that some resources be cleaned up, + * specify this in the injected Mixin. In the DOM, we would likely want to + * purge any cached node ID lookups. + * + * @private + */ + unmountIDFromEnvironment: function (rootNodeID) {} + +}; + +module.exports = ReactComponentBrowserEnvironment; +},{"./DOMChildrenOperations":54,"./ReactDOMIDOperations":95}],81:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2014-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule ReactComponentEnvironment + */ + +'use strict'; + +var _prodInvariant = require('./reactProdInvariant'); + +var invariant = require('fbjs/lib/invariant'); + +var injected = false; + +var ReactComponentEnvironment = { + + /** + * Optionally injectable environment dependent cleanup hook. (server vs. + * browser etc). Example: A browser system caches DOM nodes based on component + * ID and must remove that cache entry when this instance is unmounted. + */ + unmountIDFromEnvironment: null, + + /** + * Optionally injectable hook for swapping out mount images in the middle of + * the tree. + */ + replaceNodeWithMarkup: null, + + /** + * Optionally injectable hook for processing a queue of child updates. Will + * later move into MultiChildComponents. + */ + processChildrenUpdates: null, + + injection: { + injectEnvironment: function (environment) { + !!injected ? process.env.NODE_ENV !== 'production' ? invariant(false, 'ReactCompositeComponent: injectEnvironment() can only be called once.') : _prodInvariant('104') : void 0; + ReactComponentEnvironment.unmountIDFromEnvironment = environment.unmountIDFromEnvironment; + ReactComponentEnvironment.replaceNodeWithMarkup = environment.replaceNodeWithMarkup; + ReactComponentEnvironment.processChildrenUpdates = environment.processChildrenUpdates; + injected = true; + } + } + +}; + +module.exports = ReactComponentEnvironment; +}).call(this,require('_process')) + +},{"./reactProdInvariant":185,"_process":40,"fbjs/lib/invariant":207}],82:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2016-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule ReactComponentTreeDevtool + */ + +'use strict'; + +var _prodInvariant = require('./reactProdInvariant'); + +var ReactCurrentOwner = require('./ReactCurrentOwner'); + +var invariant = require('fbjs/lib/invariant'); +var warning = require('fbjs/lib/warning'); + +var tree = {}; +var unmountedIDs = {}; +var rootIDs = {}; + +function updateTree(id, update) { + if (!tree[id]) { + tree[id] = { + element: null, + parentID: null, + ownerID: null, + text: null, + childIDs: [], + displayName: 'Unknown', + isMounted: false, + updateCount: 0 + }; + } + update(tree[id]); +} + +function purgeDeep(id) { + var item = tree[id]; + if (item) { + var childIDs = item.childIDs; + + delete tree[id]; + childIDs.forEach(purgeDeep); + } +} + +function describeComponentFrame(name, source, ownerName) { + return '\n in ' + name + (source ? ' (at ' + source.fileName.replace(/^.*[\\\/]/, '') + ':' + source.lineNumber + ')' : ownerName ? ' (created by ' + ownerName + ')' : ''); +} + +function describeID(id) { + var name = ReactComponentTreeDevtool.getDisplayName(id); + var element = ReactComponentTreeDevtool.getElement(id); + var ownerID = ReactComponentTreeDevtool.getOwnerID(id); + var ownerName; + if (ownerID) { + ownerName = ReactComponentTreeDevtool.getDisplayName(ownerID); + } + process.env.NODE_ENV !== 'production' ? warning(element, 'ReactComponentTreeDevtool: Missing React element for debugID %s when ' + 'building stack', id) : void 0; + return describeComponentFrame(name, element && element._source, ownerName); +} + +var ReactComponentTreeDevtool = { + onSetDisplayName: function (id, displayName) { + updateTree(id, function (item) { + return item.displayName = displayName; + }); + }, + onSetChildren: function (id, nextChildIDs) { + updateTree(id, function (item) { + item.childIDs = nextChildIDs; + + nextChildIDs.forEach(function (nextChildID) { + var nextChild = tree[nextChildID]; + !nextChild ? process.env.NODE_ENV !== 'production' ? invariant(false, 'Expected devtool events to fire for the child before its parent includes it in onSetChildren().') : _prodInvariant('68') : void 0; + !(nextChild.displayName != null) ? process.env.NODE_ENV !== 'production' ? invariant(false, 'Expected onSetDisplayName() to fire for the child before its parent includes it in onSetChildren().') : _prodInvariant('69') : void 0; + !(nextChild.childIDs != null || nextChild.text != null) ? process.env.NODE_ENV !== 'production' ? invariant(false, 'Expected onSetChildren() or onSetText() to fire for the child before its parent includes it in onSetChildren().') : _prodInvariant('70') : void 0; + !nextChild.isMounted ? process.env.NODE_ENV !== 'production' ? invariant(false, 'Expected onMountComponent() to fire for the child before its parent includes it in onSetChildren().') : _prodInvariant('71') : void 0; + if (nextChild.parentID == null) { + nextChild.parentID = id; + // TODO: This shouldn't be necessary but mounting a new root during in + // componentWillMount currently causes not-yet-mounted components to + // be purged from our tree data so their parent ID is missing. + } + !(nextChild.parentID === id) ? process.env.NODE_ENV !== 'production' ? invariant(false, 'Expected onSetParent() and onSetChildren() to be consistent (%s has parents %s and %s).', nextChildID, nextChild.parentID, id) : _prodInvariant('72', nextChildID, nextChild.parentID, id) : void 0; + }); + }); + }, + onSetOwner: function (id, ownerID) { + updateTree(id, function (item) { + return item.ownerID = ownerID; + }); + }, + onSetParent: function (id, parentID) { + updateTree(id, function (item) { + return item.parentID = parentID; + }); + }, + onSetText: function (id, text) { + updateTree(id, function (item) { + return item.text = text; + }); + }, + onBeforeMountComponent: function (id, element) { + updateTree(id, function (item) { + return item.element = element; + }); + }, + onBeforeUpdateComponent: function (id, element) { + updateTree(id, function (item) { + return item.element = element; + }); + }, + onMountComponent: function (id) { + updateTree(id, function (item) { + return item.isMounted = true; + }); + }, + onMountRootComponent: function (id) { + rootIDs[id] = true; + }, + onUpdateComponent: function (id) { + updateTree(id, function (item) { + return item.updateCount++; + }); + }, + onUnmountComponent: function (id) { + updateTree(id, function (item) { + return item.isMounted = false; + }); + unmountedIDs[id] = true; + delete rootIDs[id]; + }, + purgeUnmountedComponents: function () { + if (ReactComponentTreeDevtool._preventPurging) { + // Should only be used for testing. + return; + } + + for (var id in unmountedIDs) { + purgeDeep(id); + } + unmountedIDs = {}; + }, + isMounted: function (id) { + var item = tree[id]; + return item ? item.isMounted : false; + }, + getCurrentStackAddendum: function (topElement) { + var info = ''; + if (topElement) { + var type = topElement.type; + var name = typeof type === 'function' ? type.displayName || type.name : type; + var owner = topElement._owner; + info += describeComponentFrame(name || 'Unknown', topElement._source, owner && owner.getName()); + } + + var currentOwner = ReactCurrentOwner.current; + var id = currentOwner && currentOwner._debugID; + + info += ReactComponentTreeDevtool.getStackAddendumByID(id); + return info; + }, + getStackAddendumByID: function (id) { + var info = ''; + while (id) { + info += describeID(id); + id = ReactComponentTreeDevtool.getParentID(id); + } + return info; + }, + getChildIDs: function (id) { + var item = tree[id]; + return item ? item.childIDs : []; + }, + getDisplayName: function (id) { + var item = tree[id]; + return item ? item.displayName : 'Unknown'; + }, + getElement: function (id) { + var item = tree[id]; + return item ? item.element : null; + }, + getOwnerID: function (id) { + var item = tree[id]; + return item ? item.ownerID : null; + }, + getParentID: function (id) { + var item = tree[id]; + return item ? item.parentID : null; + }, + getSource: function (id) { + var item = tree[id]; + var element = item ? item.element : null; + var source = element != null ? element._source : null; + return source; + }, + getText: function (id) { + var item = tree[id]; + return item ? item.text : null; + }, + getUpdateCount: function (id) { + var item = tree[id]; + return item ? item.updateCount : 0; + }, + getRootIDs: function () { + return Object.keys(rootIDs); + }, + getRegisteredIDs: function () { + return Object.keys(tree); + } +}; + +module.exports = ReactComponentTreeDevtool; +}).call(this,require('_process')) + +},{"./ReactCurrentOwner":84,"./reactProdInvariant":185,"_process":40,"fbjs/lib/invariant":207,"fbjs/lib/warning":217}],83:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule ReactCompositeComponent + */ + +'use strict'; + +var _prodInvariant = require('./reactProdInvariant'), + _assign = require('object-assign'); + +var ReactComponentEnvironment = require('./ReactComponentEnvironment'); +var ReactCurrentOwner = require('./ReactCurrentOwner'); +var ReactElement = require('./ReactElement'); +var ReactErrorUtils = require('./ReactErrorUtils'); +var ReactInstanceMap = require('./ReactInstanceMap'); +var ReactInstrumentation = require('./ReactInstrumentation'); +var ReactNodeTypes = require('./ReactNodeTypes'); +var ReactPropTypeLocations = require('./ReactPropTypeLocations'); +var ReactReconciler = require('./ReactReconciler'); + +var checkReactTypeSpec = require('./checkReactTypeSpec'); +var emptyObject = require('fbjs/lib/emptyObject'); +var invariant = require('fbjs/lib/invariant'); +var shallowEqual = require('fbjs/lib/shallowEqual'); +var shouldUpdateReactComponent = require('./shouldUpdateReactComponent'); +var warning = require('fbjs/lib/warning'); + +var CompositeTypes = { + ImpureClass: 0, + PureClass: 1, + StatelessFunctional: 2 +}; + +function StatelessComponent(Component) {} +StatelessComponent.prototype.render = function () { + var Component = ReactInstanceMap.get(this)._currentElement.type; + var element = Component(this.props, this.context, this.updater); + warnIfInvalidElement(Component, element); + return element; +}; + +function warnIfInvalidElement(Component, element) { + if (process.env.NODE_ENV !== 'production') { + process.env.NODE_ENV !== 'production' ? warning(element === null || element === false || ReactElement.isValidElement(element), '%s(...): A valid React element (or null) must be returned. You may have ' + 'returned undefined, an array or some other invalid object.', Component.displayName || Component.name || 'Component') : void 0; + process.env.NODE_ENV !== 'production' ? warning(!Component.childContextTypes, '%s(...): childContextTypes cannot be defined on a functional component.', Component.displayName || Component.name || 'Component') : void 0; + } +} + +function invokeComponentDidMountWithTimer() { + var publicInstance = this._instance; + if (this._debugID !== 0) { + ReactInstrumentation.debugTool.onBeginLifeCycleTimer(this._debugID, 'componentDidMount'); + } + publicInstance.componentDidMount(); + if (this._debugID !== 0) { + ReactInstrumentation.debugTool.onEndLifeCycleTimer(this._debugID, 'componentDidMount'); + } +} + +function invokeComponentDidUpdateWithTimer(prevProps, prevState, prevContext) { + var publicInstance = this._instance; + if (this._debugID !== 0) { + ReactInstrumentation.debugTool.onBeginLifeCycleTimer(this._debugID, 'componentDidUpdate'); + } + publicInstance.componentDidUpdate(prevProps, prevState, prevContext); + if (this._debugID !== 0) { + ReactInstrumentation.debugTool.onEndLifeCycleTimer(this._debugID, 'componentDidUpdate'); + } +} + +function shouldConstruct(Component) { + return !!(Component.prototype && Component.prototype.isReactComponent); +} + +function isPureComponent(Component) { + return !!(Component.prototype && Component.prototype.isPureReactComponent); +} + +/** + * ------------------ The Life-Cycle of a Composite Component ------------------ + * + * - constructor: Initialization of state. The instance is now retained. + * - componentWillMount + * - render + * - [children's constructors] + * - [children's componentWillMount and render] + * - [children's componentDidMount] + * - componentDidMount + * + * Update Phases: + * - componentWillReceiveProps (only called if parent updated) + * - shouldComponentUpdate + * - componentWillUpdate + * - render + * - [children's constructors or receive props phases] + * - componentDidUpdate + * + * - componentWillUnmount + * - [children's componentWillUnmount] + * - [children destroyed] + * - (destroyed): The instance is now blank, released by React and ready for GC. + * + * ----------------------------------------------------------------------------- + */ + +/** + * An incrementing ID assigned to each component when it is mounted. This is + * used to enforce the order in which `ReactUpdates` updates dirty components. + * + * @private + */ +var nextMountID = 1; + +/** + * @lends {ReactCompositeComponent.prototype} + */ +var ReactCompositeComponentMixin = { + + /** + * Base constructor for all composite component. + * + * @param {ReactElement} element + * @final + * @internal + */ + construct: function (element) { + this._currentElement = element; + this._rootNodeID = null; + this._compositeType = null; + this._instance = null; + this._hostParent = null; + this._hostContainerInfo = null; + + // See ReactUpdateQueue + this._updateBatchNumber = null; + this._pendingElement = null; + this._pendingStateQueue = null; + this._pendingReplaceState = false; + this._pendingForceUpdate = false; + + this._renderedNodeType = null; + this._renderedComponent = null; + this._context = null; + this._mountOrder = 0; + this._topLevelWrapper = null; + + // See ReactUpdates and ReactUpdateQueue. + this._pendingCallbacks = null; + + // ComponentWillUnmount shall only be called once + this._calledComponentWillUnmount = false; + + if (process.env.NODE_ENV !== 'production') { + this._warnedAboutRefsInRender = false; + } + }, + + /** + * Initializes the component, renders markup, and registers event listeners. + * + * @param {ReactReconcileTransaction|ReactServerRenderingTransaction} transaction + * @param {?object} hostParent + * @param {?object} hostContainerInfo + * @param {?object} context + * @return {?string} Rendered markup to be inserted into the DOM. + * @final + * @internal + */ + mountComponent: function (transaction, hostParent, hostContainerInfo, context) { + var _this = this; + + this._context = context; + this._mountOrder = nextMountID++; + this._hostParent = hostParent; + this._hostContainerInfo = hostContainerInfo; + + var publicProps = this._currentElement.props; + var publicContext = this._processContext(context); + + var Component = this._currentElement.type; + + var updateQueue = transaction.getUpdateQueue(); + + // Initialize the public class + var doConstruct = shouldConstruct(Component); + var inst = this._constructComponent(doConstruct, publicProps, publicContext, updateQueue); + var renderedElement; + + // Support functional components + if (!doConstruct && (inst == null || inst.render == null)) { + renderedElement = inst; + warnIfInvalidElement(Component, renderedElement); + !(inst === null || inst === false || ReactElement.isValidElement(inst)) ? process.env.NODE_ENV !== 'production' ? invariant(false, '%s(...): A valid React element (or null) must be returned. You may have returned undefined, an array or some other invalid object.', Component.displayName || Component.name || 'Component') : _prodInvariant('105', Component.displayName || Component.name || 'Component') : void 0; + inst = new StatelessComponent(Component); + this._compositeType = CompositeTypes.StatelessFunctional; + } else { + if (isPureComponent(Component)) { + this._compositeType = CompositeTypes.PureClass; + } else { + this._compositeType = CompositeTypes.ImpureClass; + } + } + + if (process.env.NODE_ENV !== 'production') { + // This will throw later in _renderValidatedComponent, but add an early + // warning now to help debugging + if (inst.render == null) { + process.env.NODE_ENV !== 'production' ? warning(false, '%s(...): No `render` method found on the returned component ' + 'instance: you may have forgotten to define `render`.', Component.displayName || Component.name || 'Component') : void 0; + } + + var propsMutated = inst.props !== publicProps; + var componentName = Component.displayName || Component.name || 'Component'; + + process.env.NODE_ENV !== 'production' ? warning(inst.props === undefined || !propsMutated, '%s(...): When calling super() in `%s`, make sure to pass ' + 'up the same props that your component\'s constructor was passed.', componentName, componentName) : void 0; + } + + // These should be set up in the constructor, but as a convenience for + // simpler class abstractions, we set them up after the fact. + inst.props = publicProps; + inst.context = publicContext; + inst.refs = emptyObject; + inst.updater = updateQueue; + + this._instance = inst; + + // Store a reference from the instance back to the internal representation + ReactInstanceMap.set(inst, this); + + if (process.env.NODE_ENV !== 'production') { + // Since plain JS classes are defined without any special initialization + // logic, we can not catch common errors early. Therefore, we have to + // catch them here, at initialization time, instead. + process.env.NODE_ENV !== 'production' ? warning(!inst.getInitialState || inst.getInitialState.isReactClassApproved, 'getInitialState was defined on %s, a plain JavaScript class. ' + 'This is only supported for classes created using React.createClass. ' + 'Did you mean to define a state property instead?', this.getName() || 'a component') : void 0; + process.env.NODE_ENV !== 'production' ? warning(!inst.getDefaultProps || inst.getDefaultProps.isReactClassApproved, 'getDefaultProps was defined on %s, a plain JavaScript class. ' + 'This is only supported for classes created using React.createClass. ' + 'Use a static property to define defaultProps instead.', this.getName() || 'a component') : void 0; + process.env.NODE_ENV !== 'production' ? warning(!inst.propTypes, 'propTypes was defined as an instance property on %s. Use a static ' + 'property to define propTypes instead.', this.getName() || 'a component') : void 0; + process.env.NODE_ENV !== 'production' ? warning(!inst.contextTypes, 'contextTypes was defined as an instance property on %s. Use a ' + 'static property to define contextTypes instead.', this.getName() || 'a component') : void 0; + process.env.NODE_ENV !== 'production' ? warning(typeof inst.componentShouldUpdate !== 'function', '%s has a method called ' + 'componentShouldUpdate(). Did you mean shouldComponentUpdate()? ' + 'The name is phrased as a question because the function is ' + 'expected to return a value.', this.getName() || 'A component') : void 0; + process.env.NODE_ENV !== 'production' ? warning(typeof inst.componentDidUnmount !== 'function', '%s has a method called ' + 'componentDidUnmount(). But there is no such lifecycle method. ' + 'Did you mean componentWillUnmount()?', this.getName() || 'A component') : void 0; + process.env.NODE_ENV !== 'production' ? warning(typeof inst.componentWillRecieveProps !== 'function', '%s has a method called ' + 'componentWillRecieveProps(). Did you mean componentWillReceiveProps()?', this.getName() || 'A component') : void 0; + } + + var initialState = inst.state; + if (initialState === undefined) { + inst.state = initialState = null; + } + !(typeof initialState === 'object' && !Array.isArray(initialState)) ? process.env.NODE_ENV !== 'production' ? invariant(false, '%s.state: must be set to an object or null', this.getName() || 'ReactCompositeComponent') : _prodInvariant('106', this.getName() || 'ReactCompositeComponent') : void 0; + + this._pendingStateQueue = null; + this._pendingReplaceState = false; + this._pendingForceUpdate = false; + + var markup; + if (inst.unstable_handleError) { + markup = this.performInitialMountWithErrorHandling(renderedElement, hostParent, hostContainerInfo, transaction, context); + } else { + markup = this.performInitialMount(renderedElement, hostParent, hostContainerInfo, transaction, context); + } + + if (inst.componentDidMount) { + if (process.env.NODE_ENV !== 'production') { + transaction.getReactMountReady().enqueue(invokeComponentDidMountWithTimer, this); + } else { + transaction.getReactMountReady().enqueue(inst.componentDidMount, inst); + } + } + + if (process.env.NODE_ENV !== 'production') { + if (this._debugID) { + var callback = function (component) { + return ReactInstrumentation.debugTool.onComponentHasMounted(_this._debugID); + }; + transaction.getReactMountReady().enqueue(callback, this); + } + } + + return markup; + }, + + _constructComponent: function (doConstruct, publicProps, publicContext, updateQueue) { + if (process.env.NODE_ENV !== 'production') { + ReactCurrentOwner.current = this; + try { + return this._constructComponentWithoutOwner(doConstruct, publicProps, publicContext, updateQueue); + } finally { + ReactCurrentOwner.current = null; + } + } else { + return this._constructComponentWithoutOwner(doConstruct, publicProps, publicContext, updateQueue); + } + }, + + _constructComponentWithoutOwner: function (doConstruct, publicProps, publicContext, updateQueue) { + var Component = this._currentElement.type; + var instanceOrElement; + if (doConstruct) { + if (process.env.NODE_ENV !== 'production') { + if (this._debugID !== 0) { + ReactInstrumentation.debugTool.onBeginLifeCycleTimer(this._debugID, 'ctor'); + } + } + instanceOrElement = new Component(publicProps, publicContext, updateQueue); + if (process.env.NODE_ENV !== 'production') { + if (this._debugID !== 0) { + ReactInstrumentation.debugTool.onEndLifeCycleTimer(this._debugID, 'ctor'); + } + } + } else { + // This can still be an instance in case of factory components + // but we'll count this as time spent rendering as the more common case. + if (process.env.NODE_ENV !== 'production') { + if (this._debugID !== 0) { + ReactInstrumentation.debugTool.onBeginLifeCycleTimer(this._debugID, 'render'); + } + } + instanceOrElement = Component(publicProps, publicContext, updateQueue); + if (process.env.NODE_ENV !== 'production') { + if (this._debugID !== 0) { + ReactInstrumentation.debugTool.onEndLifeCycleTimer(this._debugID, 'render'); + } + } + } + return instanceOrElement; + }, + + performInitialMountWithErrorHandling: function (renderedElement, hostParent, hostContainerInfo, transaction, context) { + var markup; + var checkpoint = transaction.checkpoint(); + try { + markup = this.performInitialMount(renderedElement, hostParent, hostContainerInfo, transaction, context); + } catch (e) { + if (process.env.NODE_ENV !== 'production') { + if (this._debugID !== 0) { + ReactInstrumentation.debugTool.onError(); + } + } + // Roll back to checkpoint, handle error (which may add items to the transaction), and take a new checkpoint + transaction.rollback(checkpoint); + this._instance.unstable_handleError(e); + if (this._pendingStateQueue) { + this._instance.state = this._processPendingState(this._instance.props, this._instance.context); + } + checkpoint = transaction.checkpoint(); + + this._renderedComponent.unmountComponent(true); + transaction.rollback(checkpoint); + + // Try again - we've informed the component about the error, so they can render an error message this time. + // If this throws again, the error will bubble up (and can be caught by a higher error boundary). + markup = this.performInitialMount(renderedElement, hostParent, hostContainerInfo, transaction, context); + } + return markup; + }, + + performInitialMount: function (renderedElement, hostParent, hostContainerInfo, transaction, context) { + var inst = this._instance; + if (inst.componentWillMount) { + if (process.env.NODE_ENV !== 'production') { + if (this._debugID !== 0) { + ReactInstrumentation.debugTool.onBeginLifeCycleTimer(this._debugID, 'componentWillMount'); + } + } + inst.componentWillMount(); + if (process.env.NODE_ENV !== 'production') { + if (this._debugID !== 0) { + ReactInstrumentation.debugTool.onEndLifeCycleTimer(this._debugID, 'componentWillMount'); + } + } + // When mounting, calls to `setState` by `componentWillMount` will set + // `this._pendingStateQueue` without triggering a re-render. + if (this._pendingStateQueue) { + inst.state = this._processPendingState(inst.props, inst.context); + } + } + + // If not a stateless component, we now render + if (renderedElement === undefined) { + renderedElement = this._renderValidatedComponent(); + } + + var nodeType = ReactNodeTypes.getType(renderedElement); + this._renderedNodeType = nodeType; + var child = this._instantiateReactComponent(renderedElement, nodeType !== ReactNodeTypes.EMPTY /* shouldHaveDebugID */ + ); + this._renderedComponent = child; + if (process.env.NODE_ENV !== 'production') { + if (child._debugID !== 0 && this._debugID !== 0) { + ReactInstrumentation.debugTool.onSetParent(child._debugID, this._debugID); + } + } + + var markup = ReactReconciler.mountComponent(child, transaction, hostParent, hostContainerInfo, this._processChildContext(context)); + + if (process.env.NODE_ENV !== 'production') { + if (this._debugID !== 0) { + ReactInstrumentation.debugTool.onSetChildren(this._debugID, child._debugID !== 0 ? [child._debugID] : []); + } + } + + return markup; + }, + + getHostNode: function () { + return ReactReconciler.getHostNode(this._renderedComponent); + }, + + /** + * Releases any resources allocated by `mountComponent`. + * + * @final + * @internal + */ + unmountComponent: function (safely) { + if (!this._renderedComponent) { + return; + } + var inst = this._instance; + + if (inst.componentWillUnmount && !inst._calledComponentWillUnmount) { + inst._calledComponentWillUnmount = true; + if (process.env.NODE_ENV !== 'production') { + if (this._debugID !== 0) { + ReactInstrumentation.debugTool.onBeginLifeCycleTimer(this._debugID, 'componentWillUnmount'); + } + } + if (safely) { + var name = this.getName() + '.componentWillUnmount()'; + ReactErrorUtils.invokeGuardedCallback(name, inst.componentWillUnmount.bind(inst)); + } else { + inst.componentWillUnmount(); + } + if (process.env.NODE_ENV !== 'production') { + if (this._debugID !== 0) { + ReactInstrumentation.debugTool.onEndLifeCycleTimer(this._debugID, 'componentWillUnmount'); + } + } + } + + if (this._renderedComponent) { + ReactReconciler.unmountComponent(this._renderedComponent, safely); + this._renderedNodeType = null; + this._renderedComponent = null; + this._instance = null; + } + + // Reset pending fields + // Even if this component is scheduled for another update in ReactUpdates, + // it would still be ignored because these fields are reset. + this._pendingStateQueue = null; + this._pendingReplaceState = false; + this._pendingForceUpdate = false; + this._pendingCallbacks = null; + this._pendingElement = null; + + // These fields do not really need to be reset since this object is no + // longer accessible. + this._context = null; + this._rootNodeID = null; + this._topLevelWrapper = null; + + // Delete the reference from the instance to this internal representation + // which allow the internals to be properly cleaned up even if the user + // leaks a reference to the public instance. + ReactInstanceMap.remove(inst); + + // Some existing components rely on inst.props even after they've been + // destroyed (in event handlers). + // TODO: inst.props = null; + // TODO: inst.state = null; + // TODO: inst.context = null; + }, + + /** + * Filters the context object to only contain keys specified in + * `contextTypes` + * + * @param {object} context + * @return {?object} + * @private + */ + _maskContext: function (context) { + var Component = this._currentElement.type; + var contextTypes = Component.contextTypes; + if (!contextTypes) { + return emptyObject; + } + var maskedContext = {}; + for (var contextName in contextTypes) { + maskedContext[contextName] = context[contextName]; + } + return maskedContext; + }, + + /** + * Filters the context object to only contain keys specified in + * `contextTypes`, and asserts that they are valid. + * + * @param {object} context + * @return {?object} + * @private + */ + _processContext: function (context) { + var maskedContext = this._maskContext(context); + if (process.env.NODE_ENV !== 'production') { + var Component = this._currentElement.type; + if (Component.contextTypes) { + this._checkContextTypes(Component.contextTypes, maskedContext, ReactPropTypeLocations.context); + } + } + return maskedContext; + }, + + /** + * @param {object} currentContext + * @return {object} + * @private + */ + _processChildContext: function (currentContext) { + var Component = this._currentElement.type; + var inst = this._instance; + if (process.env.NODE_ENV !== 'production') { + ReactInstrumentation.debugTool.onBeginProcessingChildContext(); + } + var childContext = inst.getChildContext && inst.getChildContext(); + if (process.env.NODE_ENV !== 'production') { + ReactInstrumentation.debugTool.onEndProcessingChildContext(); + } + if (childContext) { + !(typeof Component.childContextTypes === 'object') ? process.env.NODE_ENV !== 'production' ? invariant(false, '%s.getChildContext(): childContextTypes must be defined in order to use getChildContext().', this.getName() || 'ReactCompositeComponent') : _prodInvariant('107', this.getName() || 'ReactCompositeComponent') : void 0; + if (process.env.NODE_ENV !== 'production') { + this._checkContextTypes(Component.childContextTypes, childContext, ReactPropTypeLocations.childContext); + } + for (var name in childContext) { + !(name in Component.childContextTypes) ? process.env.NODE_ENV !== 'production' ? invariant(false, '%s.getChildContext(): key "%s" is not defined in childContextTypes.', this.getName() || 'ReactCompositeComponent', name) : _prodInvariant('108', this.getName() || 'ReactCompositeComponent', name) : void 0; + } + return _assign({}, currentContext, childContext); + } + return currentContext; + }, + + /** + * Assert that the context types are valid + * + * @param {object} typeSpecs Map of context field to a ReactPropType + * @param {object} values Runtime values that need to be type-checked + * @param {string} location e.g. "prop", "context", "child context" + * @private + */ + _checkContextTypes: function (typeSpecs, values, location) { + checkReactTypeSpec(typeSpecs, values, location, this.getName(), null, this._debugID); + }, + + receiveComponent: function (nextElement, transaction, nextContext) { + var prevElement = this._currentElement; + var prevContext = this._context; + + this._pendingElement = null; + + this.updateComponent(transaction, prevElement, nextElement, prevContext, nextContext); + }, + + /** + * If any of `_pendingElement`, `_pendingStateQueue`, or `_pendingForceUpdate` + * is set, update the component. + * + * @param {ReactReconcileTransaction} transaction + * @internal + */ + performUpdateIfNecessary: function (transaction) { + if (this._pendingElement != null) { + ReactReconciler.receiveComponent(this, this._pendingElement, transaction, this._context); + } else if (this._pendingStateQueue !== null || this._pendingForceUpdate) { + this.updateComponent(transaction, this._currentElement, this._currentElement, this._context, this._context); + } else { + this._updateBatchNumber = null; + } + }, + + /** + * Perform an update to a mounted component. The componentWillReceiveProps and + * shouldComponentUpdate methods are called, then (assuming the update isn't + * skipped) the remaining update lifecycle methods are called and the DOM + * representation is updated. + * + * By default, this implements React's rendering and reconciliation algorithm. + * Sophisticated clients may wish to override this. + * + * @param {ReactReconcileTransaction} transaction + * @param {ReactElement} prevParentElement + * @param {ReactElement} nextParentElement + * @internal + * @overridable + */ + updateComponent: function (transaction, prevParentElement, nextParentElement, prevUnmaskedContext, nextUnmaskedContext) { + var inst = this._instance; + !(inst != null) ? process.env.NODE_ENV !== 'production' ? invariant(false, 'Attempted to update component `%s` that has already been unmounted (or failed to mount).', this.getName() || 'ReactCompositeComponent') : _prodInvariant('136', this.getName() || 'ReactCompositeComponent') : void 0; + + var willReceive = false; + var nextContext; + + // Determine if the context has changed or not + if (this._context === nextUnmaskedContext) { + nextContext = inst.context; + } else { + nextContext = this._processContext(nextUnmaskedContext); + willReceive = true; + } + + var prevProps = prevParentElement.props; + var nextProps = nextParentElement.props; + + // Not a simple state update but a props update + if (prevParentElement !== nextParentElement) { + willReceive = true; + } + + // An update here will schedule an update but immediately set + // _pendingStateQueue which will ensure that any state updates gets + // immediately reconciled instead of waiting for the next batch. + if (willReceive && inst.componentWillReceiveProps) { + if (process.env.NODE_ENV !== 'production') { + if (this._debugID !== 0) { + ReactInstrumentation.debugTool.onBeginLifeCycleTimer(this._debugID, 'componentWillReceiveProps'); + } + } + inst.componentWillReceiveProps(nextProps, nextContext); + if (process.env.NODE_ENV !== 'production') { + if (this._debugID !== 0) { + ReactInstrumentation.debugTool.onEndLifeCycleTimer(this._debugID, 'componentWillReceiveProps'); + } + } + } + + var nextState = this._processPendingState(nextProps, nextContext); + var shouldUpdate = true; + + if (!this._pendingForceUpdate) { + if (inst.shouldComponentUpdate) { + if (process.env.NODE_ENV !== 'production') { + if (this._debugID !== 0) { + ReactInstrumentation.debugTool.onBeginLifeCycleTimer(this._debugID, 'shouldComponentUpdate'); + } + } + shouldUpdate = inst.shouldComponentUpdate(nextProps, nextState, nextContext); + if (process.env.NODE_ENV !== 'production') { + if (this._debugID !== 0) { + ReactInstrumentation.debugTool.onEndLifeCycleTimer(this._debugID, 'shouldComponentUpdate'); + } + } + } else { + if (this._compositeType === CompositeTypes.PureClass) { + shouldUpdate = !shallowEqual(prevProps, nextProps) || !shallowEqual(inst.state, nextState); + } + } + } + + if (process.env.NODE_ENV !== 'production') { + process.env.NODE_ENV !== 'production' ? warning(shouldUpdate !== undefined, '%s.shouldComponentUpdate(): Returned undefined instead of a ' + 'boolean value. Make sure to return true or false.', this.getName() || 'ReactCompositeComponent') : void 0; + } + + this._updateBatchNumber = null; + if (shouldUpdate) { + this._pendingForceUpdate = false; + // Will set `this.props`, `this.state` and `this.context`. + this._performComponentUpdate(nextParentElement, nextProps, nextState, nextContext, transaction, nextUnmaskedContext); + } else { + // If it's determined that a component should not update, we still want + // to set props and state but we shortcut the rest of the update. + this._currentElement = nextParentElement; + this._context = nextUnmaskedContext; + inst.props = nextProps; + inst.state = nextState; + inst.context = nextContext; + } + }, + + _processPendingState: function (props, context) { + var inst = this._instance; + var queue = this._pendingStateQueue; + var replace = this._pendingReplaceState; + this._pendingReplaceState = false; + this._pendingStateQueue = null; + + if (!queue) { + return inst.state; + } + + if (replace && queue.length === 1) { + return queue[0]; + } + + var nextState = _assign({}, replace ? queue[0] : inst.state); + for (var i = replace ? 1 : 0; i < queue.length; i++) { + var partial = queue[i]; + _assign(nextState, typeof partial === 'function' ? partial.call(inst, nextState, props, context) : partial); + } + + return nextState; + }, + + /** + * Merges new props and state, notifies delegate methods of update and + * performs update. + * + * @param {ReactElement} nextElement Next element + * @param {object} nextProps Next public object to set as properties. + * @param {?object} nextState Next object to set as state. + * @param {?object} nextContext Next public object to set as context. + * @param {ReactReconcileTransaction} transaction + * @param {?object} unmaskedContext + * @private + */ + _performComponentUpdate: function (nextElement, nextProps, nextState, nextContext, transaction, unmaskedContext) { + var _this2 = this; + + var inst = this._instance; + + var hasComponentDidUpdate = Boolean(inst.componentDidUpdate); + var prevProps; + var prevState; + var prevContext; + if (hasComponentDidUpdate) { + prevProps = inst.props; + prevState = inst.state; + prevContext = inst.context; + } + + if (inst.componentWillUpdate) { + if (process.env.NODE_ENV !== 'production') { + if (this._debugID !== 0) { + ReactInstrumentation.debugTool.onBeginLifeCycleTimer(this._debugID, 'componentWillUpdate'); + } + } + inst.componentWillUpdate(nextProps, nextState, nextContext); + if (process.env.NODE_ENV !== 'production') { + if (this._debugID !== 0) { + ReactInstrumentation.debugTool.onEndLifeCycleTimer(this._debugID, 'componentWillUpdate'); + } + } + } + + this._currentElement = nextElement; + this._context = unmaskedContext; + inst.props = nextProps; + inst.state = nextState; + inst.context = nextContext; + + this._updateRenderedComponent(transaction, unmaskedContext); + + if (hasComponentDidUpdate) { + if (process.env.NODE_ENV !== 'production') { + transaction.getReactMountReady().enqueue(invokeComponentDidUpdateWithTimer.bind(this, prevProps, prevState, prevContext), this); + } else { + transaction.getReactMountReady().enqueue(inst.componentDidUpdate.bind(inst, prevProps, prevState, prevContext), inst); + } + } + + if (process.env.NODE_ENV !== 'production') { + if (this._debugID) { + var callback = function () { + return ReactInstrumentation.debugTool.onComponentHasUpdated(_this2._debugID); + }; + transaction.getReactMountReady().enqueue(callback, this); + } + } + }, + + /** + * Call the component's `render` method and update the DOM accordingly. + * + * @param {ReactReconcileTransaction} transaction + * @internal + */ + _updateRenderedComponent: function (transaction, context) { + var prevComponentInstance = this._renderedComponent; + var prevRenderedElement = prevComponentInstance._currentElement; + var nextRenderedElement = this._renderValidatedComponent(); + if (shouldUpdateReactComponent(prevRenderedElement, nextRenderedElement)) { + ReactReconciler.receiveComponent(prevComponentInstance, nextRenderedElement, transaction, this._processChildContext(context)); + } else { + var oldHostNode = ReactReconciler.getHostNode(prevComponentInstance); + ReactReconciler.unmountComponent(prevComponentInstance, false); + + var nodeType = ReactNodeTypes.getType(nextRenderedElement); + this._renderedNodeType = nodeType; + var child = this._instantiateReactComponent(nextRenderedElement, nodeType !== ReactNodeTypes.EMPTY /* shouldHaveDebugID */ + ); + this._renderedComponent = child; + if (process.env.NODE_ENV !== 'production') { + if (child._debugID !== 0 && this._debugID !== 0) { + ReactInstrumentation.debugTool.onSetParent(child._debugID, this._debugID); + } + } + + var nextMarkup = ReactReconciler.mountComponent(child, transaction, this._hostParent, this._hostContainerInfo, this._processChildContext(context)); + + if (process.env.NODE_ENV !== 'production') { + if (this._debugID !== 0) { + ReactInstrumentation.debugTool.onSetChildren(this._debugID, child._debugID !== 0 ? [child._debugID] : []); + } + } + + this._replaceNodeWithMarkup(oldHostNode, nextMarkup, prevComponentInstance); + } + }, + + /** + * Overridden in shallow rendering. + * + * @protected + */ + _replaceNodeWithMarkup: function (oldHostNode, nextMarkup, prevInstance) { + ReactComponentEnvironment.replaceNodeWithMarkup(oldHostNode, nextMarkup, prevInstance); + }, + + /** + * @protected + */ + _renderValidatedComponentWithoutOwnerOrContext: function () { + var inst = this._instance; + + if (process.env.NODE_ENV !== 'production') { + if (this._debugID !== 0) { + ReactInstrumentation.debugTool.onBeginLifeCycleTimer(this._debugID, 'render'); + } + } + var renderedComponent = inst.render(); + if (process.env.NODE_ENV !== 'production') { + if (this._debugID !== 0) { + ReactInstrumentation.debugTool.onEndLifeCycleTimer(this._debugID, 'render'); + } + } + + if (process.env.NODE_ENV !== 'production') { + // We allow auto-mocks to proceed as if they're returning null. + if (renderedComponent === undefined && inst.render._isMockFunction) { + // This is probably bad practice. Consider warning here and + // deprecating this convenience. + renderedComponent = null; + } + } + + return renderedComponent; + }, + + /** + * @private + */ + _renderValidatedComponent: function () { + var renderedComponent; + if (process.env.NODE_ENV !== 'production' || this._compositeType !== CompositeTypes.StatelessFunctional) { + ReactCurrentOwner.current = this; + try { + renderedComponent = this._renderValidatedComponentWithoutOwnerOrContext(); + } finally { + ReactCurrentOwner.current = null; + } + } else { + renderedComponent = this._renderValidatedComponentWithoutOwnerOrContext(); + } + !( + // TODO: An `isValidNode` function would probably be more appropriate + renderedComponent === null || renderedComponent === false || ReactElement.isValidElement(renderedComponent)) ? process.env.NODE_ENV !== 'production' ? invariant(false, '%s.render(): A valid React element (or null) must be returned. You may have returned undefined, an array or some other invalid object.', this.getName() || 'ReactCompositeComponent') : _prodInvariant('109', this.getName() || 'ReactCompositeComponent') : void 0; + + return renderedComponent; + }, + + /** + * Lazily allocates the refs object and stores `component` as `ref`. + * + * @param {string} ref Reference name. + * @param {component} component Component to store as `ref`. + * @final + * @private + */ + attachRef: function (ref, component) { + var inst = this.getPublicInstance(); + !(inst != null) ? process.env.NODE_ENV !== 'production' ? invariant(false, 'Stateless function components cannot have refs.') : _prodInvariant('110') : void 0; + var publicComponentInstance = component.getPublicInstance(); + if (process.env.NODE_ENV !== 'production') { + var componentName = component && component.getName ? component.getName() : 'a component'; + process.env.NODE_ENV !== 'production' ? warning(publicComponentInstance != null, 'Stateless function components cannot be given refs ' + '(See ref "%s" in %s created by %s). ' + 'Attempts to access this ref will fail.', ref, componentName, this.getName()) : void 0; + } + var refs = inst.refs === emptyObject ? inst.refs = {} : inst.refs; + refs[ref] = publicComponentInstance; + }, + + /** + * Detaches a reference name. + * + * @param {string} ref Name to dereference. + * @final + * @private + */ + detachRef: function (ref) { + var refs = this.getPublicInstance().refs; + delete refs[ref]; + }, + + /** + * Get a text description of the component that can be used to identify it + * in error messages. + * @return {string} The name or null. + * @internal + */ + getName: function () { + var type = this._currentElement.type; + var constructor = this._instance && this._instance.constructor; + return type.displayName || constructor && constructor.displayName || type.name || constructor && constructor.name || null; + }, + + /** + * Get the publicly accessible representation of this component - i.e. what + * is exposed by refs and returned by render. Can be null for stateless + * components. + * + * @return {ReactComponent} the public component instance. + * @internal + */ + getPublicInstance: function () { + var inst = this._instance; + if (this._compositeType === CompositeTypes.StatelessFunctional) { + return null; + } + return inst; + }, + + // Stub + _instantiateReactComponent: null + +}; + +var ReactCompositeComponent = { + + Mixin: ReactCompositeComponentMixin + +}; + +module.exports = ReactCompositeComponent; +}).call(this,require('_process')) + +},{"./ReactComponentEnvironment":81,"./ReactCurrentOwner":84,"./ReactElement":109,"./ReactErrorUtils":112,"./ReactInstanceMap":120,"./ReactInstrumentation":121,"./ReactNodeTypes":127,"./ReactPropTypeLocations":131,"./ReactReconciler":136,"./checkReactTypeSpec":164,"./reactProdInvariant":185,"./shouldUpdateReactComponent":189,"_process":40,"fbjs/lib/emptyObject":200,"fbjs/lib/invariant":207,"fbjs/lib/shallowEqual":216,"fbjs/lib/warning":217,"object-assign":39}],84:[function(require,module,exports){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule ReactCurrentOwner + */ + +'use strict'; + +/** + * Keeps track of the current owner. + * + * The current owner is the component who should own any components that are + * currently being constructed. + */ + +var ReactCurrentOwner = { + + /** + * @internal + * @type {ReactComponent} + */ + current: null + +}; + +module.exports = ReactCurrentOwner; +},{}],85:[function(require,module,exports){ +(function (process){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule ReactDOM + */ + +/* globals __REACT_DEVTOOLS_GLOBAL_HOOK__*/ + +'use strict'; + +var ReactDOMComponentTree = require('./ReactDOMComponentTree'); +var ReactDefaultInjection = require('./ReactDefaultInjection'); +var ReactMount = require('./ReactMount'); +var ReactReconciler = require('./ReactReconciler'); +var ReactUpdates = require('./ReactUpdates'); +var ReactVersion = require('./ReactVersion'); + +var findDOMNode = require('./findDOMNode'); +var getHostComponentFromComposite = require('./getHostComponentFromComposite'); +var renderSubtreeIntoContainer = require('./renderSubtreeIntoContainer'); +var warning = require('fbjs/lib/warning'); + +ReactDefaultInjection.inject(); + +var ReactDOM = { + findDOMNode: findDOMNode, + render: ReactMount.render, + unmountComponentAtNode: ReactMount.unmountComponentAtNode, + version: ReactVersion, + + /* eslint-disable camelcase */ + unstable_batchedUpdates: ReactUpdates.batchedUpdates, + unstable_renderSubtreeIntoContainer: renderSubtreeIntoContainer +}; + +// Inject the runtime into a devtools global hook regardless of browser. +// Allows for debugging when the hook is injected on the page. +/* eslint-enable camelcase */ +if (typeof __REACT_DEVTOOLS_GLOBAL_HOOK__ !== 'undefined' && typeof __REACT_DEVTOOLS_GLOBAL_HOOK__.inject === 'function') { + __REACT_DEVTOOLS_GLOBAL_HOOK__.inject({ + ComponentTree: { + getClosestInstanceFromNode: ReactDOMComponentTree.getClosestInstanceFromNode, + getNodeFromInstance: function (inst) { + // inst is an internal instance (but could be a composite) + if (inst._renderedComponent) { + inst = getHostComponentFromComposite(inst); + } + if (inst) { + return ReactDOMComponentTree.getNodeFromInstance(inst); + } else { + return null; + } + } + }, + Mount: ReactMount, + Reconciler: ReactReconciler + }); +} + +if (process.env.NODE_ENV !== 'production') { + var ExecutionEnvironment = require('fbjs/lib/ExecutionEnvironment'); + if (ExecutionEnvironment.canUseDOM && window.top === window.self) { + + // First check if devtools is not installed + if (typeof __REACT_DEVTOOLS_GLOBAL_HOOK__ === 'undefined') { + // If we're in Chrome or Firefox, provide a download link if not installed. + if (navigator.userAgent.indexOf('Chrome') > -1 && navigator.userAgent.indexOf('Edge') === -1 || navigator.userAgent.indexOf('Firefox') > -1) { + // Firefox does not have the issue with devtools loaded over file:// + var showFileUrlMessage = window.location.protocol.indexOf('http') === -1 && navigator.userAgent.indexOf('Firefox') === -1; + console.debug('Download the React DevTools ' + (showFileUrlMessage ? 'and use an HTTP server (instead of a file: URL) ' : '') + 'for a better development experience: ' + 'https://fb.me/react-devtools'); + } + } + + var testFunc = function testFn() {}; + process.env.NODE_ENV !== 'production' ? warning((testFunc.name || testFunc.toString()).indexOf('testFn') !== -1, 'It looks like you\'re using a minified copy of the development build ' + 'of React. When deploying React apps to production, make sure to use ' + 'the production build which skips development warnings and is faster. ' + 'See https://fb.me/react-minification for more details.') : void 0; + + // If we're in IE8, check to see if we are in compatibility mode and provide + // information on preventing compatibility mode + var ieCompatibilityMode = document.documentMode && document.documentMode < 8; + + process.env.NODE_ENV !== 'production' ? warning(!ieCompatibilityMode, 'Internet Explorer is running in compatibility mode; please add the ' + 'following tag to your HTML to prevent this from happening: ' + '') : void 0; + + var expectedFeatures = [ + // shims + Array.isArray, Array.prototype.every, Array.prototype.forEach, Array.prototype.indexOf, Array.prototype.map, Date.now, Function.prototype.bind, Object.keys, String.prototype.split, String.prototype.trim]; + + for (var i = 0; i < expectedFeatures.length; i++) { + if (!expectedFeatures[i]) { + process.env.NODE_ENV !== 'production' ? warning(false, 'One or more ES5 shims expected by React are not available: ' + 'https://fb.me/react-warning-polyfills') : void 0; + break; + } + } + } +} + +module.exports = ReactDOM; +}).call(this,require('_process')) + +},{"./ReactDOMComponentTree":89,"./ReactDefaultInjection":108,"./ReactMount":124,"./ReactReconciler":136,"./ReactUpdates":141,"./ReactVersion":142,"./findDOMNode":168,"./getHostComponentFromComposite":175,"./renderSubtreeIntoContainer":186,"_process":40,"fbjs/lib/ExecutionEnvironment":193,"fbjs/lib/warning":217}],86:[function(require,module,exports){ +/** + * Copyright 2013-present, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + * + * @providesModule ReactDOMButton + */ + +'use strict'; + +var DisabledInputUtils = require('./DisabledInputUtils'); + +/** + * Implements a