From 1d5cb52e4ab8649c7f02bddea086bbf57c9d3c20 Mon Sep 17 00:00:00 2001 From: Alan Mishchenko Date: Tue, 16 Sep 2014 11:56:40 -0700 Subject: Improvements to Boolean matching. --- src/map/if/ifTune.c | 755 ++++++++++++++++++++++++++++++++++++++-------------- 1 file changed, 554 insertions(+), 201 deletions(-) (limited to 'src/map/if') diff --git a/src/map/if/ifTune.c b/src/map/if/ifTune.c index 223882b8..d21ebad0 100644 --- a/src/map/if/ifTune.c +++ b/src/map/if/ifTune.c @@ -23,12 +23,17 @@ #include "sat/bsat/satStore.h" #include "sat/cnf/cnf.h" #include "misc/extra/extra.h" +#include "bool/kit/kit.h" ABC_NAMESPACE_IMPL_START //////////////////////////////////////////////////////////////////////// /// DECLARATIONS /// //////////////////////////////////////////////////////////////////////// + +#define IFN_INS 11 +#define IFN_WRD (IFN_INS > 6 ? 1 << (IFN_INS-6) : 1) +#define IFN_PAR 1024 // network types typedef enum { @@ -41,10 +46,119 @@ typedef enum { IF_DSD_PRIME // 6: PRIME } If_DsdType_t; +// object types +static char * Ifn_Symbs[16] = { + NULL, // 0: unknown + "const", // 1: constant + "var", // 2: variable + "()", // 3: AND + "[]", // 4: XOR + "<>", // 5: MUX + "{}" // 6: PRIME +}; + +typedef struct Ift_Obj_t_ Ift_Obj_t; +typedef struct Ift_Ntk_t_ Ift_Ntk_t; + +struct Ift_Obj_t_ +{ + unsigned Type : 3; // node type + unsigned nFanins : 5; // fanin counter + unsigned iFirst : 8; // first parameter + unsigned Var : 16; // current variable + int Fanins[IFN_INS]; // fanin IDs +}; +struct Ift_Ntk_t_ +{ + // cell structure + int nInps; // inputs + int nObjs; // objects + Ift_Obj_t Nodes[2*IFN_INS]; // nodes + // constraints + int pConstr[IFN_INS]; // constraint pairs + int nConstr; // number of pairs + // user data + int nVars; // variables + int nWords; // truth table words + int nParsVNum; // selection parameters per variable + int nParsVIni; // first selection parameter + int nPars; // total parameters + word * pTruth; // user truth table + // matching procedures + int Values[IFN_PAR]; // variable values + word pTtElems[IFN_INS*IFN_WRD]; // elementary truth tables + word pTtObjs[2*IFN_INS*IFN_WRD]; // object truth tables +}; + +static inline word * Ift_ElemTruth( Ift_Ntk_t * p, int i ) { return p->pTtElems + i * Abc_TtWordNum(p->nInps); } +static inline word * Ift_ObjTruth( Ift_Ntk_t * p, int i ) { return p->pTtObjs + i * p->nWords; } + +// variable ordering +// - primary inputs [0; p->nInps) +// - internal nodes [p->nInps; p->nObjs) +// - configuration params [p->nObjs; p->nParsVIni) +// - variable selection params [p->nParsVIni; p->pPars) + //////////////////////////////////////////////////////////////////////// /// FUNCTION DEFINITIONS /// //////////////////////////////////////////////////////////////////////// - + +/**Function************************************************************* + + Synopsis [Prepare network to check the given function.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Ifn_Prepare( Ift_Ntk_t * p, word * pTruth, int nVars ) +{ + int i, fVerbose = 0; + assert( nVars <= p->nInps ); + p->pTruth = pTruth; + p->nVars = nVars; + p->nWords = Abc_TtWordNum(nVars); + p->nPars = p->nObjs; + for ( i = p->nInps; i < p->nObjs; i++ ) + { + if ( p->Nodes[i].Type != IF_DSD_PRIME ) + continue; + p->Nodes[i].iFirst = p->nPars; + p->nPars += (1 << p->Nodes[i].nFanins); + if ( fVerbose ) + printf( "Node %d Start %d Vars %d\n", i, p->Nodes[i].iFirst, (1 << p->Nodes[i].nFanins) ); + } + if ( fVerbose ) + printf( "Groups start %d\n", p->nPars ); + p->nParsVIni = p->nPars; + p->nParsVNum = Abc_Base2Log(nVars); + p->nPars += p->nParsVNum * p->nInps; + assert( p->nPars <= IFN_PAR ); + memset( p->Values, 0xFF, sizeof(int) * p->nPars ); + return p->nPars; +} +void Ifn_NtkPrint( Ift_Ntk_t * p ) +{ + int i, k; + if ( p == NULL ) + printf( "String is empty.\n" ); + if ( p == NULL ) + return; + for ( i = p->nInps; i < p->nObjs; i++ ) + { + printf( "%c=", 'a'+i ); + printf( "%c", Ifn_Symbs[p->Nodes[i].Type][0] ); + for ( k = 0; k < (int)p->Nodes[i].nFanins; k++ ) + printf( "%c", 'a'+p->Nodes[i].Fanins[k] ); + printf( "%c", Ifn_Symbs[p->Nodes[i].Type][1] ); + printf( ";" ); + } + printf( "\n" ); +} + /**Function************************************************************* Synopsis [] @@ -56,7 +170,7 @@ typedef enum { SeeAlso [] ***********************************************************************/ -int If_ManStrCheck( char * pStr, int * pnVars, int * pnObjs ) +int Ifn_ManStrCheck( char * pStr, int * pnInps, int * pnObjs ) { int i, Marks[32] = {0}, MaxVar = 0, MaxDef = 0, RetValue = 1; for ( i = 0; pStr[i]; i++ ) @@ -110,141 +224,207 @@ int If_ManStrCheck( char * pStr, int * pnVars, int * pnObjs ) printf( "String \"%s\" has no definition for internal variable (%c).\n", pStr, 'a' + i ), RetValue = 0; if ( !RetValue ) return 0; - *pnVars = MaxVar; + *pnInps = MaxVar; *pnObjs = MaxDef; return 1; } -int If_ManStrParse( char * pStr, int nVars, int nObjs, int * pTypes, int * pnFans, int ppFans[][6], int * pFirsts, int * pnSatVars ) +Ift_Ntk_t * Ifn_ManStrParse( char * pStr ) { - int i, k, n, f, nPars = nVars; - char Next = 0; - assert( nVars < nObjs ); - for ( i = nVars; i < nObjs; i++ ) + int i, k, n, f, nFans, iFan; + static Ift_Ntk_t P, * p = &P; + memset( p, 0, sizeof(Ift_Ntk_t) ); + if ( !Ifn_ManStrCheck(pStr, &p->nInps, &p->nObjs) ) + return NULL; + if ( p->nInps > IFN_INS ) { + printf( "The number of variables (%d) exceeds predefined limit (%d). Recompile with different value of IFN_INS.\n", p->nInps, IFN_INS ); + return NULL; + } + assert( p->nInps > 1 && p->nInps < p->nObjs && p->nInps <= IFN_INS && p->nObjs < 2*IFN_INS ); + for ( i = p->nInps; i < p->nObjs; i++ ) + { + char Next = 0; for ( k = 0; pStr[k]; k++ ) if ( pStr[k] == 'a' + i && pStr[k+1] == '=' ) break; - assert( pStr[k] ); + if ( pStr[k] == 0 ) + { + printf( "Cannot find definition of signal %c.\n", 'a' + i ); + return NULL; + } if ( pStr[k+2] == '(' ) - pTypes[i] = IF_DSD_AND, Next = ')'; + p->Nodes[i].Type = IF_DSD_AND, Next = ')'; else if ( pStr[k+2] == '[' ) - pTypes[i] = IF_DSD_XOR, Next = ']'; + p->Nodes[i].Type = IF_DSD_XOR, Next = ']'; else if ( pStr[k+2] == '<' ) - pTypes[i] = IF_DSD_MUX, Next = '>'; + p->Nodes[i].Type = IF_DSD_MUX, Next = '>'; else if ( pStr[k+2] == '{' ) - pTypes[i] = IF_DSD_PRIME, Next = '}'; - else assert( 0 ); + p->Nodes[i].Type = IF_DSD_PRIME, Next = '}'; + else + { + printf( "Cannot find openning operation symbol in the defition of of signal %c.\n", 'a' + i ); + return NULL; + } for ( n = k + 3; pStr[n]; n++ ) if ( pStr[n] == Next ) break; - assert( pStr[k] ); - pnFans[i] = n - k - 3; - assert( pnFans[i] > 0 && pnFans[i] <= 6 ); - for ( f = 0; f < pnFans[i]; f++ ) + if ( pStr[n] == 0 ) { - ppFans[i][f] = pStr[k + 3 + f] - 'a'; - assert( ppFans[i][k] < i ); - if ( ppFans[i][f] < 0 || ppFans[i][f] >= nObjs ) - printf( "Error!\n" ); + printf( "Cannot find closing operation symbol in the defition of of signal %c.\n", 'a' + i ); + return NULL; } - if ( pTypes[i] != IF_DSD_PRIME ) - continue; - pFirsts[i] = nPars; - nPars += (1 << pnFans[i]); + nFans = n - k - 3; + if ( nFans < 1 || nFans > 8 ) + { + printf( "Cannot find matching operation symbol in the defition of of signal %c.\n", 'a' + i ); + return NULL; + } + for ( f = 0; f < nFans; f++ ) + { + iFan = pStr[k + 3 + f] - 'a'; + if ( iFan < 0 || iFan >= i ) + { + printf( "Fanin number %d is signal %d is out of range.\n", f, 'a' + i ); + return NULL; + } + p->Nodes[i].Fanins[f] = iFan; + } + p->Nodes[i].nFanins = nFans; } - *pnSatVars = nPars; - return 1; + // truth tables + Abc_TtElemInit2( p->pTtElems, p->nInps ); +/* + // constraints + p->nConstr = 5; + p->pConstr[0] = (0 << 16) | 1; + + p->pConstr[1] = (2 << 16) | 3; + p->pConstr[2] = (3 << 16) | 4; + + p->pConstr[3] = (6 << 16) | 7; + p->pConstr[4] = (7 << 16) | 8; +*/ + return p; } -Gia_Man_t * If_ManStrFindModel( int nVars, int nObjs, int nSatVars, int * pTypes, int * pnFans, int ppFans[][6], int * pFirsts ) + +/**Function************************************************************* + + Synopsis [Derive truth table given the configulation values.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +word * Ift_NtkDeriveTruth( Ift_Ntk_t * p, int * pValues ) { - Gia_Man_t * pNew, * pTemp; - int * pVarsPar, * pVarsObj; - int i, k, n, Step, iLit, nMints, nPars = 0; - pNew = Gia_ManStart( 1000 ); - pNew->pName = Abc_UtilStrsav( "model" ); - Gia_ManHashStart( pNew ); - pVarsPar = ABC_ALLOC( int, nSatVars ); - pVarsObj = ABC_ALLOC( int, nObjs ); - for ( i = 0; i < nSatVars; i++ ) - pVarsPar[i] = Gia_ManAppendCi(pNew); - for ( i = 0; i < nVars; i++ ) - pVarsObj[i] = pVarsPar[nSatVars - nVars + i]; - for ( i = nVars; i < nObjs; i++ ) + int i, v, f, iVar, iStart; + // elementary variables + for ( i = 0; i < p->nInps; i++ ) { - if ( pTypes[i] == IF_DSD_AND ) + // find variable + iStart = p->nParsVIni + i * p->nParsVNum; + for ( v = iVar = 0; v < p->nParsVNum; v++ ) + if ( p->Values[iStart+v] ) + iVar += (1 << v); + // assign variable + Abc_TtCopy( Ift_ObjTruth(p, i), Ift_ElemTruth(p, iVar), p->nWords, 0 ); + } + // internal variables + for ( i = p->nInps; i < p->nObjs; i++ ) + { + int nFans = p->Nodes[i].nFanins; + int * pFans = p->Nodes[i].Fanins; + word * pTruth = Ift_ObjTruth( p, i ); + if ( p->Nodes[i].Type == IF_DSD_AND ) { - iLit = 1; - for ( k = 0; k < pnFans[i]; k++ ) - iLit = Gia_ManHashAnd( pNew, iLit, pVarsObj[ppFans[i][k]] ); - pVarsObj[i] = iLit; + Abc_TtFill( pTruth, p->nWords ); + for ( f = 0; f < nFans; f++ ) + Abc_TtAnd( pTruth, pTruth, Ift_ObjTruth(p, pFans[f]), p->nWords, 0 ); } - else if ( pTypes[i] == IF_DSD_XOR ) + else if ( p->Nodes[i].Type == IF_DSD_XOR ) { - iLit = 0; - for ( k = 0; k < pnFans[i]; k++ ) - iLit = Gia_ManHashXor( pNew, iLit, pVarsObj[ppFans[i][k]] ); - pVarsObj[i] = iLit; + Abc_TtClear( pTruth, p->nWords ); + for ( f = 0; f < nFans; f++ ) + Abc_TtXor( pTruth, pTruth, Ift_ObjTruth(p, pFans[f]), p->nWords, 0 ); } - else if ( pTypes[i] == IF_DSD_MUX ) + else if ( p->Nodes[i].Type == IF_DSD_MUX ) { - assert( pnFans[i] == 3 ); - pVarsObj[i] = Gia_ManHashMux( pNew, pVarsObj[ppFans[i][0]], pVarsObj[ppFans[i][1]], pVarsObj[ppFans[i][2]] ); + assert( nFans == 3 ); + Abc_TtMux( pTruth, Ift_ObjTruth(p, pFans[0]), Ift_ObjTruth(p, pFans[1]), Ift_ObjTruth(p, pFans[2]), p->nWords ); } - else if ( pTypes[i] == IF_DSD_PRIME ) + else if ( p->Nodes[i].Type == IF_DSD_PRIME ) { - int pVarsData[64]; - assert( pnFans[i] >= 1 && pnFans[i] <= 6 ); - nMints = (1 << pnFans[i]); - for ( k = 0; k < nMints; k++ ) - pVarsData[k] = pVarsPar[nPars++]; - for ( Step = 1, k = 0; k < pnFans[i]; k++, Step <<= 1 ) - for ( n = 0; n < nMints; n += Step << 1 ) - pVarsData[n] = Gia_ManHashMux( pNew, pVarsObj[ppFans[i][k]], pVarsData[n+Step], pVarsData[n] ); - assert( Step == nMints ); - pVarsObj[i] = pVarsData[0]; + int nValues = (1 << nFans); + word * pTemp = Ift_ObjTruth(p, p->nObjs); + Abc_TtClear( pTruth, p->nWords ); + for ( v = 0; v < nValues; v++ ) + { + if ( pValues[p->Nodes[i].iFirst + v] == 0 ) + continue; + Abc_TtFill( pTemp, p->nWords ); + for ( f = 0; f < nFans; f++ ) + if ( (v >> f) & 1 ) + Abc_TtAnd( pTemp, pTemp, Ift_ObjTruth(p, pFans[f]), p->nWords, 0 ); + else + Abc_TtSharp( pTemp, pTemp, Ift_ObjTruth(p, pFans[f]), p->nWords ); + Abc_TtOr( pTruth, pTruth, pTemp, p->nWords ); + } } else assert( 0 ); +//Dau_DsdPrintFromTruth( pTruth, p->nVars ); } - assert( nPars + nVars == nSatVars ); - Gia_ManAppendCo( pNew, pVarsObj[nObjs-1] ); - pNew = Gia_ManCleanup( pTemp = pNew ); - Gia_ManStop( pTemp ); - ABC_FREE( pVarsPar ); - ABC_FREE( pVarsObj ); - assert( Gia_ManPiNum(pNew) == nSatVars ); - assert( Gia_ManPoNum(pNew) == 1 ); - return pNew; + return Ift_ObjTruth(p, p->nObjs-1); } -Gia_Man_t * If_ManStrFindCofactors( int nPars, Gia_Man_t * p ) + +/**Function************************************************************* + + Synopsis [Compute more or equal] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Ift_TtComparisonConstr( word * pTruth, int nVars, int fMore, int fEqual ) { - Gia_Man_t * pNew, * pTemp; - Gia_Obj_t * pObj; - int i, m, nMints = 1 << (Gia_ManCiNum(p) - nPars); - pNew = Gia_ManStart( Gia_ManObjNum(p) ); - pNew->pName = Abc_UtilStrsav( p->pName ); - Gia_ManHashAlloc( pNew ); - Gia_ManConst0(p)->Value = 0; - Gia_ManForEachCi( p, pObj, i ) - if ( i < nPars ) - pObj->Value = Gia_ManAppendCi( pNew ); - for ( m = 0; m < nMints; m++ ) + word Cond[4], Equa[4], Temp[4]; + word s_TtElems[8][4] = { + ABC_CONST(0xAAAAAAAAAAAAAAAA),ABC_CONST(0xAAAAAAAAAAAAAAAA),ABC_CONST(0xAAAAAAAAAAAAAAAA),ABC_CONST(0xAAAAAAAAAAAAAAAA), + ABC_CONST(0xCCCCCCCCCCCCCCCC),ABC_CONST(0xCCCCCCCCCCCCCCCC),ABC_CONST(0xCCCCCCCCCCCCCCCC),ABC_CONST(0xCCCCCCCCCCCCCCCC), + ABC_CONST(0xF0F0F0F0F0F0F0F0),ABC_CONST(0xF0F0F0F0F0F0F0F0),ABC_CONST(0xF0F0F0F0F0F0F0F0),ABC_CONST(0xF0F0F0F0F0F0F0F0), + ABC_CONST(0xFF00FF00FF00FF00),ABC_CONST(0xFF00FF00FF00FF00),ABC_CONST(0xFF00FF00FF00FF00),ABC_CONST(0xFF00FF00FF00FF00), + ABC_CONST(0xFFFF0000FFFF0000),ABC_CONST(0xFFFF0000FFFF0000),ABC_CONST(0xFFFF0000FFFF0000),ABC_CONST(0xFFFF0000FFFF0000), + ABC_CONST(0xFFFFFFFF00000000),ABC_CONST(0xFFFFFFFF00000000),ABC_CONST(0xFFFFFFFF00000000),ABC_CONST(0xFFFFFFFF00000000), + ABC_CONST(0x0000000000000000),ABC_CONST(0xFFFFFFFFFFFFFFFF),ABC_CONST(0x0000000000000000),ABC_CONST(0xFFFFFFFFFFFFFFFF), + ABC_CONST(0x0000000000000000),ABC_CONST(0x0000000000000000),ABC_CONST(0xFFFFFFFFFFFFFFFF),ABC_CONST(0xFFFFFFFFFFFFFFFF) + }; + int i, nWords = Abc_TtWordNum(2*nVars); + assert( nVars > 0 && nVars <= 4 ); + Abc_TtClear( pTruth, nWords ); + Abc_TtFill( Equa, nWords ); + for ( i = nVars - 1; i >= 0; i-- ) { - Gia_ManForEachCi( p, pObj, i ) - if ( i >= nPars ) - pObj->Value = ((m >> (i - nPars)) & 1); - Gia_ManForEachAnd( p, pObj, i ) - pObj->Value = Gia_ManHashAnd( pNew, Gia_ObjFanin0Copy(pObj), Gia_ObjFanin1Copy(pObj) ); - Gia_ManForEachPo( p, pObj, i ) - pObj->Value = Gia_ManAppendCo( pNew, Gia_ObjFanin0Copy(pObj) ); + if ( fMore ) + Abc_TtSharp( Cond, s_TtElems[2*i+1], s_TtElems[2*i+0], nWords ); + else + Abc_TtSharp( Cond, s_TtElems[2*i+0], s_TtElems[2*i+1], nWords ); + Abc_TtAnd( Temp, Equa, Cond, nWords, 0 ); + Abc_TtOr( pTruth, pTruth, Temp, nWords ); + Abc_TtXor( Temp, s_TtElems[2*i+0], s_TtElems[2*i+1], nWords, 1 ); + Abc_TtAnd( Equa, Equa, Temp, nWords, 0 ); } - pNew = Gia_ManCleanup( pTemp = pNew ); - Gia_ManStop( pTemp ); - return pNew; + if ( fEqual ) + Abc_TtNot( pTruth, nWords ); } /**Function************************************************************* - Synopsis [] + Synopsis [Adds parameter constraints.] Description [] @@ -253,70 +433,86 @@ Gia_Man_t * If_ManStrFindCofactors( int nPars, Gia_Man_t * p ) SeeAlso [] ***********************************************************************/ -static inline Cnf_Dat_t * Cnf_DeriveGiaRemapped( Gia_Man_t * p ) +void Ift_AddClause( sat_solver * pSat, int * pBeg, int * pEnd ) { - Cnf_Dat_t * pCnf; - Aig_Man_t * pAig = Gia_ManToAigSimple( p ); - pAig->nRegs = 0; - pCnf = Cnf_Derive( pAig, Aig_ManCoNum(pAig) ); - Aig_ManStop( pAig ); - return pCnf; + int fVerbose = 0; + int RetValue = sat_solver_addclause( pSat, pBeg, pEnd ); + if ( fVerbose ) + { + for ( ; pBeg < pEnd; pBeg++ ) + printf( "%c%d ", Abc_LitIsCompl(*pBeg) ? '-':'+', Abc_Lit2Var(*pBeg) ); + printf( "\n" ); + } + assert( RetValue ); } -sat_solver * If_ManStrFindSolver( Gia_Man_t * p, Vec_Int_t ** pvPiVars, Vec_Int_t ** pvPoVars ) +void Ift_NtkAddConstrOne( sat_solver * pSat, Vec_Int_t * vCover, int * pVars, int nVars ) { - sat_solver * pSat; - Gia_Obj_t * pObj; - Cnf_Dat_t * pCnf; - int i; - pCnf = Cnf_DeriveGiaRemapped( p ); - // start the SAT solver - pSat = sat_solver_new(); - sat_solver_setnvars( pSat, pCnf->nVars ); - // add timeframe clauses - for ( i = 0; i < pCnf->nClauses; i++ ) - if ( !sat_solver_addclause( pSat, pCnf->pClauses[i], pCnf->pClauses[i+1] ) ) - assert( 0 ); - // inputs/outputs - *pvPiVars = Vec_IntAlloc( Gia_ManPiNum(p) ); - Gia_ManForEachCi( p, pObj, i ) - Vec_IntPush( *pvPiVars, pCnf->pVarNums[Gia_ObjId(p, pObj)] ); - *pvPoVars = Vec_IntAlloc( Gia_ManPoNum(p) ); - Gia_ManForEachCo( p, pObj, i ) - Vec_IntPush( *pvPoVars, pCnf->pVarNums[Gia_ObjId(p, pObj)] ); - Cnf_DataFree( pCnf ); - return pSat; + int k, c, Cube, Literal, nLits, pLits[IFN_INS]; + Vec_IntForEachEntry( vCover, Cube, c ) + { + nLits = 0; + for ( k = 0; k < nVars; k++ ) + { + Literal = 3 & (Cube >> (k << 1)); + if ( Literal == 1 ) // '0' -> pos lit + pLits[nLits++] = Abc_Var2Lit(pVars[k], 0); + else if ( Literal == 2 ) // '1' -> neg lit + pLits[nLits++] = Abc_Var2Lit(pVars[k], 1); + else if ( Literal != 0 ) + assert( 0 ); + } + Ift_AddClause( pSat, pLits, pLits + nLits ); + } } - -sat_solver * If_ManSatBuild( char * pStr, Vec_Int_t ** pvPiVars, Vec_Int_t ** pvPoVars ) +void Ift_NtkAddConstraints( Ift_Ntk_t * p, sat_solver * pSat ) { - int nVars, nObjs, nSatVars; - int pTypes[32] = {0}; - int pnFans[32] = {0}; - int ppFans[32][6] = {{0}}; - int pFirsts[32] = {0}; - Gia_Man_t * p1, * p2; - sat_solver * pSat = NULL; - *pvPiVars = *pvPoVars = NULL; - if ( !If_ManStrCheck(pStr, &nVars, &nObjs) ) - return NULL; - if ( !If_ManStrParse(pStr, nVars, nObjs, pTypes, pnFans, ppFans, pFirsts, &nSatVars) ) - return NULL; - p1 = If_ManStrFindModel(nVars, nObjs, nSatVars, pTypes, pnFans, ppFans, pFirsts); - if ( p1 == NULL ) - return NULL; -// Gia_AigerWrite( p1, "satbuild.aig", 0, 0 ); - p2 = If_ManStrFindCofactors( nSatVars - nVars, p1 ); - Gia_ManStop( p1 ); - if ( p2 == NULL ) - return NULL; -// Gia_AigerWrite( p2, "satbuild2.aig", 0, 0 ); - pSat = If_ManStrFindSolver( p2, pvPiVars, pvPoVars ); - Gia_ManStop( p2 ); - return pSat; + int fAddConstr = 0; + Vec_Int_t * vCover = Vec_IntAlloc( 0 ); + word uTruth = Abc_Tt6Stretch( ~Abc_Tt6Mask(p->nVars), p->nParsVNum ); + assert( p->nParsVNum <= 4 ); + if ( uTruth ) + { + int i, k, pVars[IFN_INS]; + int RetValue = Kit_TruthIsop( (unsigned *)&uTruth, p->nParsVNum, vCover, 0 ); + assert( RetValue == 0 ); +// Dau_DsdPrintFromTruth( &uTruth, p->nParsVNum ); + // add capacity constraints + for ( i = 0; i < p->nInps; i++ ) + { + for ( k = 0; k < p->nParsVNum; k++ ) + pVars[k] = p->nParsVIni + i * p->nParsVNum + k; + Ift_NtkAddConstrOne( pSat, vCover, pVars, p->nParsVNum ); + } + } + // ordering constraints + if ( fAddConstr && p->nConstr ) + { + word pTruth[4]; + int i, k, RetValue, pVars[2*IFN_INS]; + int fForceDiff = (p->nVars == p->nInps); + Ift_TtComparisonConstr( pTruth, p->nParsVNum, fForceDiff, fForceDiff ); + RetValue = Kit_TruthIsop( (unsigned *)pTruth, 2*p->nParsVNum, vCover, 0 ); + assert( RetValue == 0 ); +// Kit_TruthIsopPrintCover( vCover, 2*p->nParsVNum, 0 ); + for ( i = 0; i < p->nConstr; i++ ) + { + int iVar1 = p->pConstr[i] >> 16; + int iVar2 = p->pConstr[i] & 0xFFFF; + for ( k = 0; k < p->nParsVNum; k++ ) + { + pVars[2*k+0] = p->nParsVIni + iVar1 * p->nParsVNum + k; + pVars[2*k+1] = p->nParsVIni + iVar2 * p->nParsVNum + k; + } + Ift_NtkAddConstrOne( pSat, vCover, pVars, 2*p->nParsVNum ); +// printf( "added constraint with %d clauses for %d and %d\n", Vec_IntSize(vCover), iVar1, iVar2 ); + } + } + Vec_IntFree( vCover ); } + /**Function************************************************************* - Synopsis [] + Synopsis [Derive clauses given variable assignment.] Description [] @@ -325,70 +521,227 @@ sat_solver * If_ManSatBuild( char * pStr, Vec_Int_t ** pvPiVars, Vec_Int_t ** pv SeeAlso [] ***********************************************************************/ -void If_ManSatPrintPerm( char * pPerms, int nVars ) +int Ift_NtkAddClauses( Ift_Ntk_t * p, int * pValues, sat_solver * pSat ) { - int i; - for ( i = 0; i < nVars; i++ ) - printf( "%c", 'a' + pPerms[i] ); - printf( "\n" ); -} -int If_ManSatCheckOne( sat_solver * pSat, Vec_Int_t * vPoVars, word * pTruth, int nVars, int * pPerm, int nVarsAll, Vec_Int_t * vLits ) -{ - int v, Value, m, mNew, nMints = (1 << nVars); - assert( (1 << nVarsAll) == Vec_IntSize(vPoVars) ); - assert( nMints <= Vec_IntSize(vPoVars) ); - // remap minterms - Vec_IntFill( vLits, Vec_IntSize(vPoVars), -1 ); - for ( m = 0; m < nMints; m++ ) + int i, f, v, nLits, pLits[IFN_INS+2], pLits2[IFN_INS+2]; + // assign new variables + int nSatVars = sat_solver_nvars(pSat); + for ( i = 0; i < p->nObjs-1; i++ ) + p->Nodes[i].Var = nSatVars++; + p->Nodes[p->nObjs-1].Var = -ABC_INFINITY; + sat_solver_setnvars( pSat, nSatVars ); + // verify variable values + for ( i = 0; i < p->nVars; i++ ) + assert( pValues[i] != -1 ); + for ( i = p->nVars; i < p->nObjs-1; i++ ) + assert( pValues[i] == -1 ); + assert( pValues[p->nObjs-1] != -1 ); + // internal variables +//printf( "\n" ); + for ( i = 0; i < p->nInps; i++ ) { - mNew = 0; - for ( v = 0; v < nVarsAll; v++ ) + int iParStart = p->nParsVIni + i * p->nParsVNum; + for ( v = 0; v < p->nVars; v++ ) { - assert( pPerm[v] < nVars ); - if ( ((m >> pPerm[v]) & 1) ) - mNew |= (1 << v); + // add output literal + pLits[0] = Abc_Var2Lit( p->Nodes[i].Var, pValues[v]==0 ); + // add clause literals + for ( f = 0; f < p->nParsVNum; f++ ) + pLits[f+1] = Abc_Var2Lit( iParStart + f, (v >> f) & 1 ); + Ift_AddClause( pSat, pLits, pLits+p->nParsVNum+1 ); } - assert( Vec_IntEntry(vLits, mNew) == -1 ); - Vec_IntWriteEntry( vLits, mNew, Abc_TtGetBit(pTruth, m) ); } - // find assumptions - v = 0; - Vec_IntForEachEntry( vLits, Value, m ) - if ( Value >= 0 ) - Vec_IntWriteEntry( vLits, v++, Abc_Var2Lit(Vec_IntEntry(vPoVars, m), !Value) ); - Vec_IntShrink( vLits, v ); - // run SAT solver - Value = sat_solver_solve( pSat, Vec_IntArray(vLits), Vec_IntArray(vLits) + Vec_IntSize(vLits), 0, 0, 0, 0 ); - return (int)(Value == l_True); +//printf( "\n" ); + for ( i = p->nInps; i < p->nObjs; i++ ) + { + int nFans = p->Nodes[i].nFanins; + int * pFans = p->Nodes[i].Fanins; + if ( p->Nodes[i].Type == IF_DSD_AND ) + { + nLits = 0; + pLits[nLits++] = Abc_Var2Lit( p->Nodes[i].Var, 0 ); + for ( f = 0; f < nFans; f++ ) + { + pLits[nLits++] = Abc_Var2Lit( p->Nodes[pFans[f]].Var, 1 ); + // add small clause + pLits2[0] = Abc_Var2Lit( p->Nodes[i].Var, 1 ); + pLits2[1] = Abc_Var2Lit( p->Nodes[pFans[f]].Var, 0 ); + Ift_AddClause( pSat, pLits2, pLits2 + 2 ); + } + // add big clause + Ift_AddClause( pSat, pLits, pLits + nLits ); + } + else if ( p->Nodes[i].Type == IF_DSD_XOR ) + { + assert( 0 ); + } + else if ( p->Nodes[i].Type == IF_DSD_MUX ) + { + assert( 0 ); + } + else if ( p->Nodes[i].Type == IF_DSD_PRIME ) + { + int nValues = (1 << nFans); + int iParStart = p->Nodes[i].iFirst; + for ( v = 0; v < nValues; v++ ) + { + nLits = 0; + if ( pValues[i] == -1 ) + { + pLits[nLits] = Abc_Var2Lit( p->Nodes[i].Var, 0 ); + pLits2[nLits] = Abc_Var2Lit( p->Nodes[i].Var, 1 ); + nLits++; + } + for ( f = 0; f < nFans; f++, nLits++ ) + pLits[nLits] = pLits2[nLits] = Abc_Var2Lit( p->Nodes[pFans[f]].Var, (v >> f) & 1 ); + pLits[nLits] = Abc_Var2Lit( iParStart + v, 1 ); + pLits2[nLits] = Abc_Var2Lit( iParStart + v, 0 ); + nLits++; + if ( pValues[i] != 0 ) + Ift_AddClause( pSat, pLits2, pLits2 + nLits ); + if ( pValues[i] != 1 ) + Ift_AddClause( pSat, pLits, pLits + nLits ); + } + } + else assert( 0 ); +//printf( "\n" ); + } + return 1; } -void If_ManSatDeriveOne( sat_solver * pSat, Vec_Int_t * vPiVars, Vec_Int_t * vValues ) + +/**Function************************************************************* + + Synopsis [Returns the minterm number for which there is a mismatch.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Ift_SatPrintStatus( sat_solver * p, int Iter, int status, int iMint, int Value, abctime clk ) { - int i, iVar; - Vec_IntClear( vValues ); - Vec_IntForEachEntry( vPiVars, iVar, i ) - Vec_IntPush( vValues, sat_solver_var_value(pSat, iVar) ); + printf( "Iter = %5d ", Iter ); + printf( "Mint = %5d ", iMint ); + printf( "Value = %2d ", Value ); + printf( "Var = %6d ", sat_solver_nvars(p) ); + printf( "Cla = %6d ", sat_solver_nclauses(p) ); + printf( "Conf = %6d ", sat_solver_nconflicts(p) ); + if ( status == l_False ) + printf( "status = unsat" ); + else if ( status == l_True ) + printf( "status = sat " ); + else + printf( "status = undec" ); + Abc_PrintTime( 1, "", clk ); } -int If_ManSatCheckAll_int( sat_solver * pSat, Vec_Int_t * vPoVars, word * pTruth, int nVars, Vec_Int_t * vLits, char ** pPerms, int nPerms ) +void Ift_SatPrintConfig( Ift_Ntk_t * p, sat_solver * pSat ) { - int pPerm[IF_MAX_FUNC_LUTSIZE]; - int p, i; - for ( p = 0; p < nPerms; p++ ) + int v; + for ( v = p->nObjs; v < p->nPars; v++ ) { - for ( i = 0; i < nVars; i++ ) - pPerm[i] = (int)pPerms[p][i]; - if ( If_ManSatCheckOne(pSat, vPoVars, pTruth, nVars, pPerm, nVars, vLits) ) - return p; + if ( v >= p->nParsVIni && (v - p->nParsVIni) % p->nParsVNum == 0 ) + printf( " %d=", (v - p->nParsVIni) / p->nParsVNum ); + printf( "%d", sat_solver_var_value(pSat, v) ); } - return -1; + printf( "\n" ); } -int If_ManSatCheckAll( sat_solver * pSat, Vec_Int_t * vPoVars, word * pTruth, int nVars, Vec_Int_t * vLits, char ** pPerms, int nPerms ) + +int Ift_NtkMatch( Ift_Ntk_t * p, word * pTruth, int nVars, int fVerbose ) { + word * pTruth1; + int RetValue = 0; + int nIterMax = (1<nPars ); + Ift_NtkAddConstraints( p, pSat ); + if ( fVerbose ) + Ift_SatPrintStatus( pSat, 0, l_True, -1, -1, Abc_Clock() - clk ); + for ( i = 0; i < nIterMax; i++ ) + { + // get variable assignment + for ( v = 0; v < p->nObjs; v++ ) + p->Values[v] = v < p->nVars ? (iMint >> v) & 1 : -1; + p->Values[p->nObjs-1] = Abc_TtGetBit( pTruth, iMint ); + // derive clauses + if ( !Ift_NtkAddClauses( p, p->Values, pSat ) ) + break; + // find assignment of parameters +// clk2 = Abc_Clock(); + status = sat_solver_solve( pSat, NULL, NULL, 0, 0, 0, 0 ); +// clkSat += Abc_Clock() - clk2; + if ( fVerbose ) + Ift_SatPrintStatus( pSat, i+1, status, iMint, p->Values[p->nObjs-1], Abc_Clock() - clk ); + if ( status == l_False ) + break; + assert( status == l_True ); + // collect assignment + for ( v = p->nObjs; v < p->nPars; v++ ) + p->Values[v] = sat_solver_var_value(pSat, v); + // find truth table +// clk2 = Abc_Clock(); + pTruth1 = Ift_NtkDeriveTruth( p, p->Values ); +// clkTru += Abc_Clock() - clk2; + Abc_TtXor( pTruth1, pTruth1, p->pTruth, p->nWords, 0 ); + // find mismatch if present + iMint = Abc_TtFindFirstBit( pTruth1, p->nVars ); + if ( iMint == -1 ) + { + Ift_SatPrintConfig( p, pSat ); + RetValue = 1; + break; + } + } + assert( i < nIterMax ); + sat_solver_delete( pSat ); + printf( "Matching = %d Iters = %d. ", RetValue, i ); +// Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); +// Abc_PrintTime( 1, "Sat", clkSat ); +// Abc_PrintTime( 1, "Tru", clkTru ); return RetValue; } +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Ifn_NtkRead() +{ + int RetValue; + int nVars = 9; +// int nVars = 8; +// int nVars = 3; +// word * pTruth = Dau_DsdToTruth( "(abcdefghi)", nVars ); + word * pTruth = Dau_DsdToTruth( "1008{(1008{(ab)cde}f)ghi}", nVars ); +// word * pTruth = Dau_DsdToTruth( "18{(1008{(ab)cde}f)gh}", nVars ); +// word * pTruth = Dau_DsdToTruth( "1008{(1008{[ab]cde}f)ghi}", nVars ); +// word * pTruth = Dau_DsdToTruth( "(abcd)", nVars ); +// word * pTruth = Dau_DsdToTruth( "(abc)", nVars ); +// char * pStr = "e={abc};f={ed};"; +// char * pStr = "d={ab};e={cd};"; + char * pStr = "j=(ab);k={jcde};l=(kf);m={lghi};"; +// char * pStr = "i={abc};j={ide};k={ifg};l={jkh};"; +// char * pStr = "h={abcde};i={abcdf};j=;"; +// char * pStr = "g=;h=;i={fgh};"; + Ift_Ntk_t * p = Ifn_ManStrParse( pStr ); + Ifn_NtkPrint( p ); + Dau_DsdPrintFromTruth( pTruth, nVars ); + // get the given function + RetValue = Ift_NtkMatch( p, pTruth, nVars, 1 ); +} + //////////////////////////////////////////////////////////////////////// /// END OF FILE /// //////////////////////////////////////////////////////////////////////// -- cgit v1.2.3