diff options
Diffstat (limited to 'src/opt')
-rw-r--r-- | src/opt/dau/dauDsd2.c | 660 |
1 files changed, 660 insertions, 0 deletions
diff --git a/src/opt/dau/dauDsd2.c b/src/opt/dau/dauDsd2.c new file mode 100644 index 00000000..cf7dea0b --- /dev/null +++ b/src/opt/dau/dauDsd2.c @@ -0,0 +1,660 @@ +/**CFile**************************************************************** + + FileName [dauDsd2.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [DAG-aware unmapping.] + + Synopsis [Disjoint-support decomposition.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 20, 2005.] + + Revision [$Id: dauDsd2.c,v 1.00 2005/06/20 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include "dauInt.h" +#include "misc/util/utilTruth.h" + +ABC_NAMESPACE_IMPL_START + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +#include DSD_MAX_VAR 12 +#include DSD_MAX_WRD ((DSD_MAX_VAR > 6) ? (1 << (DSD_MAX_VAR-6)) : 1) + +typedef struct Dua_Obj_t_ Dua_Obj_t; +struct Dua_Obj_t_ +{ + int Type; // dec type (1=var; 2=and; 3=xor; 4=mux; 5=prime) + int nFans; // fanin count + char pFans[DSD_MAX_VAR]; // fanins +}; + +typedef struct Dua_Dsd_t_ Dua_Dsd_t; +struct Dua_Dsd_t_ +{ + int nSupp; // original variables + int nVars; // remaining variables + int nWords; // largest non-dec prime + int nObjs; // object count + int iRoot; // the root of the tree + Dua_Obj_t pObjs[DSD_MAX_VAR]; // objects + word pTruth[DSD_MAX_WRD]; // original/current truth table +}; + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/**Function************************************************************* + + Synopsis [Makes the fCof1-th cofactor of iVar the 0-th cofactor.] + + Description [Variable iVar becomes last varaible; others shift back. + Only the 0-th cofactor is computed.] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline word Abc_Tt6HalfUnShuffleVars( word t, int iVar, int fCof1 ) +{ + static word Masks[6] = { + ABC_CONST(0x5555555555555555), + ABC_CONST(0x3333333333333333), + ABC_CONST(0x0F0F0F0F0F0F0F0F), + ABC_CONST(0x00FF00FF00FF00FF), + ABC_CONST(0x0000FFFF0000FFFF), + ABC_CONST(0x00000000FFFFFFFF) + }; + int v, s = (1 << iVar); + t = (t >> (fCof1 ? 0 : s)) & Masks[iVar]; + for ( v = iVar, s = (1 << v); v < 5; v++, s <<= 1 ) + t = ((t >> s) | t) & Masks[v+1]; + return t; +} + +static inline void Abc_TtHalfUnShuffleVars( word * pTruth, int nVars, int iVar, int jVar, int fCof1 ) +{ + int w, nWords = Abc_TtWordNum( nVars ); + if ( iVar == jVar ) + return; + assert( iVar < jVar ); + if ( iVar < 5 ) + { + for ( w = 0; w < nWords; w++ ) + pTruth[w] = Abc_Tt6HalfUnShuffleVars( pTruth[w], iVar, fCof1 ); + iVar = 5; + } + if ( jVar < 6 ) + { + for ( w = 0; w < nWords; w++ ) + pTruth[w] = (pTruth[w] << 32) | pTruth[w]; + return; + } + if ( iVar == 5 ) + { + unsigned * pTruthU = (unsigned *)pTruth; + for ( w = 0; w < nWords; w += 2 ) + pTruthU[w] = pTruthU[w+1]; + iVar = 6; + } + { + word * pLimit = pTruth + nWords; + int i, iStep = Abc_TtWordNum(iVar); + int j, jStep = Abc_TtWordNum(jVar); + for ( ; pTruth < pLimit; pTruth += jStep ) + for ( i = 0; i < jStep; i += iStep ) + for ( j = 0; j < iStep; j++ ) + pTruth[w++] = pTruth[iStep + i + j]; + assert( w == (nWords >> 1) ); + return; + } +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Dua_DsdInit( Dua_Dsd_t * pRes, word * pTruth, int nVars ) +{ + int i; + pRes->nSupp = nVars; + pRes->nVars = nVars; + pRes->nWords = Abc_TtWordNum( nVars ); + pRes->nObjs = 1; + pRes->iRoot = Abc_Var2Lit( 0, 0 ); + pRes->pObjs[0].Type = 5; + pRes->pObjs[0].nFans = nVars; + for ( i = 0; i < nVars; i++ ) + pRes->pObjs[0].pFans[i] = (char)Abc_Var2Lit( i, 0 ); + memcpy( pRes->pTruth, pTruth, sizeof(word) * pRes->nWords ); +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +// returns 1 if the truth table was complemented +int Dua_DsdTryConst( word * pTruth, int nVars ) +{ + if ( !(pTruth[0] & 1) ) + return 0; + Abc_TtNot( pTruth, Abc_TtWordNum(nVars) ); + return 1; +} +int Dua_DsdTryVar( word * pTruth, int nWords, int iVar ) +{ + int nWordsI = Abc_TtWordNum(iVar); + word c0 = (iVar < 6) ? Abc_Tt6Cofactor0( pTruth[0], iVar ) : pTruth[0]; + word c1 = (iVar < 6) ? Abc_Tt6Cofactor1( pTruth[0], iVar ) : pTruth[nWords]; + if ( c0 != c1 ) + { + if ( c1 < c0 && c1 < ~c1 ) // flip + { + Abc_TtFlip( pTruth, nWords, iVar ); + return 0; + } + if ( ~c1 < c0 && ~c1 < c1 ) // flip and compl + { + Abc_TtFlipNot( pTruth, nWords, iVar ); + return 1; + } + } + if ( iVar < 6 ) + { + word * pLimit = pTruth + nWords; + for ( pTruth++; pTruth < pLimit; pTruth++ ) + { + c0 = Abc_Tt6Cofactor0( pTruth[0], iVar ); + c1 = Abc_Tt6Cofactor1( pTruth[0], iVar ); + if ( c0 == c1 ) + continue; + if ( c0 < c1 ) + return 0; + for ( ; pTruth < pLimit; pTruth++ ) + pTruth[0] = Abc_Tt6Flip( pTruth[0], iVar ); + return 0; + } + } + else + { + for ( ; pTruth < pLimit; pTruth += (nWordsI << 1) ) + for ( w = 0; w < nWordsI; w++ ) + { + c0 = pTruth[0]; + c1 = pTruth[nWordsI]; + if ( c0 == c1 ) + continue; + if ( c0 < c1 ) + return 0; + for ( ; pTruth < pLimit; pTruth += (nWordsI << 1) ) + for ( ; w < nWordsI; w++ ) + ABC_SWAP( word, pTruth[0], pTruth[nWordsI] ); + return 0; + } + } + assert( 0 ); + return -1; +} +int Dua_DsdCheckCof0Const0( word * pTruth, int nWords, int iVar ) +{ + if ( nWords == 1 ) + return (pTruth[0] & s_Truths6Neg[iVar]) == 0; + if ( iVar <= 5 ) + { + int w; + for ( w = 0; w < nWords; w++ ) + if ( (pTruth[w] & s_Truths6Neg[iVar]) ) + return 0; + return 1; + } + else // if ( iVar > 5 ) + { + word * pLimit = pTruth + nWords; + int i, iStep = Abc_TtWordNum(iVar); + for ( ; pTruth < pLimit; pTruth += (iStep << 1) ) + for ( i = 0; i < iStep; i++ ) + if ( pTruth[i] ) + return 0; + return 1; + } +} +int Dua_DsdCheckCofsEqualNot( word * pTruth, int nWords, int iVar ) +{ + if ( nWords == 1 ) + return (pTruth[0] & s_Truths6Neg[iVar]) == ((~pTruth[0] & s_Truths6[iVar]) >> (1 << iVar)); + if ( iVar <= 5 ) + { + int w, shift = (1 << iVar); + for ( w = 0; w < nWords; w++ ) + if ( (pTruth[w] & s_Truths6Neg[iVar]) != ((~pTruth[w] & s_Truths6[iVar]) >> shift) ) + return 0; + return 1; + } + else // if ( iVar > 5 ) + { + word * pLimit = pTruth + nWords; + int i, iStep = Abc_TtWordNum(iVar); + for ( ; pTruth < pLimit; pTruth += (iStep << 1) ) + for ( i = 0; i < iStep; i++ ) + if ( pTruth[i] != ~pTruth[i + iStep] ) + return 0; + return 1; + } +} +int Dua_DsdOneVar( Dua_Dsd_t * pRes ) +{ + int v, fCompl, fChange = 1; + fCompl = Dua_DsdTryConst( pRes->pTruth, pRes->nWords ); + while ( fChange && pRes->nVars > 2 ) + { + fChange = 0; + for ( v = 0; v < pRes->nVars; v++ ) + { + fCompl ^= Dua_DsdTryVar( pRes->pTruth, pRes->nWords, v ); + if ( Dua_DsdCheckCof0Const0( pRes->pTruth, pRes->nWords, v ) ) + { + fChange = 1; + // record AND(v, F) + } + else if ( Dua_DsdCheckCofsEqualNot( pRes->pTruth, pRes->nWords, v ) ) + { + fChange = 1; + // record XOR(v, F) + } + } + } + return fCompl; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Dua_DsdTrySwap( word * pTruth, int nWords, int iVar ) +{ + static word s_PMasks[5][3] = { + { ABC_CONST(0x9999999999999999), ABC_CONST(0x2222222222222222), ABC_CONST(0x4444444444444444) }, + { ABC_CONST(0xC3C3C3C3C3C3C3C3), ABC_CONST(0x0C0C0C0C0C0C0C0C), ABC_CONST(0x3030303030303030) }, + { ABC_CONST(0xF00FF00FF00FF00F), ABC_CONST(0x00F000F000F000F0), ABC_CONST(0x0F000F000F000F00) }, + { ABC_CONST(0xFF0000FFFF0000FF), ABC_CONST(0x0000FF000000FF00), ABC_CONST(0x00FF000000FF0000) }, + { ABC_CONST(0xFFFF00000000FFFF), ABC_CONST(0x00000000FFFF0000), ABC_CONST(0x0000FFFF00000000) } + }; + if ( iVar < 5 ) + { + int Shift = (1 << iVar); + word c01, c10, * pLimit = pTruth + nWords; + for ( ; pTruth < pLimit; pTruth++ ) + { + c01 = (pTruth[0] & s_PMasks[iVar][1]); + c10 = (pTruth[0] & s_PMasks[iVar][2]) >> Shift; + if ( c01 == c10 ) + continue; + if ( c01 < c10 ) + return 0; + pTruth[0] = (pTruth[0] & s_PMasks[iVar][0]) | ((pTruth[0] & s_PMasks[iVar][1]) << Shift) | ((pTruth[0] & s_PMasks[iVar][2]) >> Shift); + return 1; + } + } + else if ( iVar == 5 ) + { + unsigned * pTruthU = (unsigned *)pTruth; + unsigned * pLimitU = (unsigned *)(pTruth + nWords); + for ( ; pTruthU < pLimitU; pTruthU += 4 ) + { + c01 = pTruthU[1]; + c10 = pTruthU[2]; + if ( c01 == c10 ) + continue; + if ( c01 < c10 ) + return 0; + for ( ; pTruthU < pLimitU; pTruthU += 4 ) + ABC_SWAP( unsigned, pTruthU[1], pTruthU[2] ); + return 1; + } + } + else // if ( iVar > 5 ) + { + word * pLimit = pTruth + nWords; + int i, iStep = Abc_TtWordNum(iVar); + for ( ; pTruth < pLimit; pTruth += 4*iStep ) + for ( i = 0; i < iStep; i++ ) + { + c01 = pTruth[i + iStep]; + c10 = pTruth[i + 2*iStep]; + if ( c01 == c10 ) + continue; + if ( c01 < c10 ) + return 0; + for ( ; pTruth < pLimit; pTruth += 4*iStep ) + for ( ; i < iStep; i++ ) + ABC_SWAP( word, pTruth[1], pTruth[2] ); + return 1; + } + } + return 2; +} +int Dua_DsdCheckDecomp( word * pTruth, int nWords, int iVar ) +{ + static word s_PMasks[5][4] = { + { ABC_CONST(0x1111111111111111), ABC_CONST(0x2222222222222222), ABC_CONST(0x4444444444444444), ABC_CONST(0x8888888888888888) }, + { ABC_CONST(0x0303030303030303), ABC_CONST(0x0C0C0C0C0C0C0C0C), ABC_CONST(0x3030303030303030), ABC_CONST(0xC0C0C0C0C0C0C0C0) }, + { ABC_CONST(0x000F000F000F000F), ABC_CONST(0x00F000F000F000F0), ABC_CONST(0x0F000F000F000F00), ABC_CONST(0xF000F000F000F000) }, + { ABC_CONST(0x000000FF000000FF), ABC_CONST(0x0000FF000000FF00), ABC_CONST(0x00FF000000FF0000), ABC_CONST(0xFF000000FF000000) }, + { ABC_CONST(0x000000000000FFFF), ABC_CONST(0x00000000FFFF0000), ABC_CONST(0x0000FFFF00000000), ABC_CONST(0xFFFF000000000000) } + }; + int fC0eC1 = 1, fC0eC3 = 1; + if ( iVar < 5 ) + { + int Shift = (1 << iVar); + word c01, c10, * pLimit = pTruth + nWords; + for ( ; pTruth < pLimit; pTruth++ ) + { + if ( fC0eC1 && (pTruth[0] & s_PMasks[iVar][0]) != ((pTruth[0] & s_PMasks[iVar][1]) >> Shift) ) + fC0eC1 = 0; + if ( fC0eC3 && (pTruth[0] & s_PMasks[iVar][0]) != ((pTruth[0] & s_PMasks[iVar][3]) >> (3*Shift)) ) + fC0eC3 = 0; + if ( !fC0eC1 && !fC0eC3 ) + return 0; + } + } + if ( iVar == 5 ) + { + unsigned * pTruthU = (unsigned *)pTruth; + unsigned * pLimitU = (unsigned *)(pTruth + nWords); + for ( ; pTruthU < pLimitU; pTruthU += 4 ) + { + if ( fC0eC1 && pTruthU[0] != pTruthU[1] ) + fC0eC1 = 0; + if ( fC0eC3 && pTruthU[0] != pTruthU[3] ) + fC0eC3 = 0; + if ( !fC0eC1 && !fC0eC3 ) + return 0; + } + } + else // if ( iVar > 5 ) + { + word * pLimit = pTruth + nWords; + int i, iStep = Abc_TtWordNum(iVar); + for ( ; pTruth < pLimit; pTruth += 4*iStep ) + for ( i = 0; i < iStep; i++ ) + { + if ( fC0eC1 && pTruth[0] != pTruth[1] ) + fC0eC1 = 0; + if ( fC0eC3 && pTruth[0] != pTruth[3] ) + fC0eC3 = 0; + if ( !fC0eC1 && !fC0eC3 ) + return 0; + } + } + assert( fC0eC1 != fC0eC3 ); + return fC0eC1 ? 1 : 2; +} + +// returns 1 if decomposition detected +int Dua_DsdTwoVars( Dua_Dsd_t * pRes ) +{ + int v, RetValue, fChange = 1; + while ( fChange && pRes->nVars > 2 ) + { + fChange = 0; + for ( v = 0; v < pRes->nVars - 1; v++ ) + { + RetValue = Dua_DsdTrySwap( pRes->pTruth, pRes->nWords, v ); + if ( RetValue == 1 ) + fChange = 1; + if ( RetValue != 2 ) + continue; + // vars are symmetric, check decomp + RetValue = Dua_DsdCheckDecomp( pRes->pTruth, pRes->nWords, v ); + if ( RetValue == 0 ) + continue; + if ( RetValue == 1 ) + { + fChange = 1; + // record AND(a, b) + } + else + { + fChange = 1; + // record XOR(a, b) + } + } + } +} + +/**Function************************************************************* + + Synopsis [Check DSD for bound-set [iVar; jVar).] + + Description [Return D-func if decomposable.] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +word Dua_DsdRangeVars( word * pTruth, int nVars, int iVar, int jVar, int fPerform ) +{ + int Part, nParts = 1 << (nVars - jVar); + int Mint, nMints = 1 << (jVar - iVar); + word MaskOne, MaskAll = 0; + assert( jVar - iVar > 2 ); + assert( jVar - iVar < 7 ); + if ( iVar < 6 ) + { + int Shift = 6 - iVar, MaskF = (1 << Shift) - 1, iMint = 0; + word MaskFF = (((word)1) << (1 << iVar)) - 1; + word Cof0, Cof1, Value; + for ( Part = 0; Part < nParts; Part++ ) + { + MaskOne = 0; + Cof0 = Cof1 = ~(word)0; + for ( Mint = 0; Mint < nMints; Mint++, iMint++ ) + { + Value = (pTruth[iMint>>Shift] >> ((iMint & MaskF)<<iVar)) & MaskFF; + if ( !~Cof0 || Cof0 == Value ) + Cof0 = Value; + else if ( !~Cof1 || Cof1 == Value ) + { + Cof1 = Value; + MaskOne |= ((word)1) << Mint; + } + else + return 0; + } + if ( Part == 0 ) + MaskAll = MaskOne; + else if ( MaskAll != MaskOne ) + return 0; + if ( fPerform ) + { + assert( ~Cof0 && ~Cof1 ); + Mint = 2 * Part; + Value = (pTruth[Mint>>Shift] >> ((Mint & MaskF)<<nVarsF)) & MaskFF; + pTruth[Mint>>Shift] ^= (Value ^ Cof0) << ((Mint & MaskF)<<nVarsF) + Mint = 2 * Part + 1; + Value = (pTruth[Mint>>Shift] >> ((Mint & MaskF)<<nVarsF)) & MaskFF; + pTruth[Mint>>Shift] ^= (Value ^ Cof1) << ((Mint & MaskF)<<nVarsF) + } + } + // stretch + if ( nVars - (jVar - iVar) + 1 < 6 ) + pTruth[0] = Abc_Tt6Stretch( pTruth[0], nVars - (jVar - iVar) + 1 ); + } + else + { + int nWordsF = Abc_TtWordNum(iVar); + int iWord = 0, nBytes = sizeof(word) * nWordsF; + word * pCof0, * pCof1; + for ( Part = 0; Part < nParts; Part++ ) + { + MaskOne = 0; + pCof0 = pCof1 = NULL; + for ( Mint = 0; Mint < nMints; Mint++, iWord += nWordsF ) + { + if ( !pCof0 || !memcmp(pCof0, pTruth + iWord, nBytes) ) + pCof0 = pTruth + iWord; + else if ( !pCof1 || !memcmp(pCof1, pTruth + iWord, nBytes) ) + { + pCof1 = pTruth + iWord; + MaskOne |= ((word)1) << Mint; + } + else + return 0; + } + if ( Part == 0 ) + MaskAll = MaskOne; + else if ( MaskAll != MaskOne ) + return 0; + if ( fPerform ) + { + assert( pCof0 && pCof1 ); + memcpy( pTruth + (2 * Part + 0) * nWordsF, pCof0, nBytes ); + memcpy( pTruth + (2 * Part + 1) * nWordsF, pCof1, nBytes ); + } + } + } + return MaskAll; +} + +/**Function************************************************************* + + Synopsis [Check DSD for bound-set [0; iVar).] + + Description [Return D-func if decomposable.] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Dua_DsdRangeVars0( word * pTruth, int nVars, int iVar, int fPerform ) +{ + int i, nParts = 1 << (nVars - iVar); + assert( iVar > 2 && iVar < nVars ); + if ( iVar == 3 ) + { + unsigned char * pTruthP = (unsigned char *)pTruth, Dfunc = pTruthP[0]; + for ( i = 1; i < nParts; i++ ) + if ( pTruthP[i] != Dfunc && pTruthP[i] != ~Dfunc ) + return 0; + } + else if ( iVar == 4 ) + { + unsigned short * pTruthP = (unsigned short *)pTruth, Dfunc = pTruthP[0]; + for ( i = 1; i < nParts; i++ ) + if ( pTruthP[i] != Dfunc && pTruthP[i] != ~Dfunc ) + return 0; + } + else if ( iVar == 5 ) + { + unsigned int * pTruthP = (unsigned int *)pTruth, Dfunc = pTruthP[0]; + for ( i = 1; i < nParts; i++ ) + if ( pTruthP[i] != Dfunc && pTruthP[i] != ~Dfunc ) + return 0; + } + else + { + int nStep = 1 << (6 - iVar); + assert( iVar >= 6 ); + for ( i = 1; i < nParts; i++ ) + if ( !Abc_TtEqual(pTruth, pTruth + i * nStep, nStep) && !Abc_TtEqualNot(pTruth, pTruth + i * nStep, nStep) ) + return 0; + } + return 1; +} +void Dua_DsdRangeVars0Derive( word * pTruth, int nVars, int iVar ) +{ + int i, nParts = 1 << (nVars - iVar); + assert( iVar > 2 && iVar < nVars ); + if ( iVar == 3 ) + { + unsigned char * pTruthP = (unsigned char *)pTruth, Dfunc = pTruthP[0]; + for ( i = 0; i < nParts; i++ ) + if ( Abc_TtGetBit(pTruth, i) ^ (pTruthP[i] != Dfunc) ) + Abc_TtXorBit(pTruth, i); + } + else if ( iVar == 4 ) + { + unsigned short * pTruthP = (unsigned short *)pTruth, Dfunc = pTruthP[0]; + for ( i = 0; i < nParts; i++ ) + if ( Abc_TtGetBit(pTruth, i) ^ (pTruthP[i] != Dfunc) ) + Abc_TtXorBit(pTruth, i); + } + else if ( iVar == 5 ) + { + unsigned int * pTruthP = (unsigned int *)pTruth, Dfunc = pTruthP[0]; + for ( i = 0; i < nParts; i++ ) + if ( Abc_TtGetBit(pTruth, i) ^ (pTruthP[i] != Dfunc) ) + Abc_TtXorBit(pTruth, i); + } + else + { + word Dfunc = pTruth[0]; + assert( iVar == 6 ); + for ( i = 0; i < nParts; i++ ) + if ( Abc_TtGetBit(pTruth, i) ^ (pTruth[i] != Dfunc) ) + Abc_TtXorBit(pTruth, i); + } + // stretch + if ( nVars - iVar + 1 < 6 ) + pTruth[0] = Abc_Tt6Stretch( pTruth[0], nVars - iVar + 1 < 6 ); +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Dua_DsdTest( word * pTruth, int nVar ) +{ + Dua_Dsd_t Res, * pRes = &Res; + Dua_DsdInit( pRes, pTruth, nVars ); +} + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + + |