diff options
author | Alan Mishchenko <alanmi@berkeley.edu> | 2013-07-12 13:02:32 -0700 |
---|---|---|
committer | Alan Mishchenko <alanmi@berkeley.edu> | 2013-07-12 13:02:32 -0700 |
commit | fba33fbba407f96800863bde5a7061b09c2f9ff2 (patch) | |
tree | 28b8cf1f69d3e345c7953157c450efdd90531b7b /src/map/mpm/mpmPre.c | |
parent | 2ee26b00f9ac8dc93bd1335f89d4c3b165dbd7fd (diff) | |
download | abc-fba33fbba407f96800863bde5a7061b09c2f9ff2.tar.gz abc-fba33fbba407f96800863bde5a7061b09c2f9ff2.tar.bz2 abc-fba33fbba407f96800863bde5a7061b09c2f9ff2.zip |
New technology mapper.
Diffstat (limited to 'src/map/mpm/mpmPre.c')
-rw-r--r-- | src/map/mpm/mpmPre.c | 885 |
1 files changed, 885 insertions, 0 deletions
diff --git a/src/map/mpm/mpmPre.c b/src/map/mpm/mpmPre.c new file mode 100644 index 00000000..e070c71a --- /dev/null +++ b/src/map/mpm/mpmPre.c @@ -0,0 +1,885 @@ +/**CFile**************************************************************** + + FileName [mpmPre.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [Configurable technology mapper.] + + Synopsis [DSD-related precomputations.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 1, 2013.] + + Revision [$Id: mpmPre.c,v 1.00 2013/06/01 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include <stdio.h> +#include <stdlib.h> +#include <string.h> +#include <assert.h> + +#include "misc/vec/vec.h" +#include "misc/vec/vecHsh.h" +#include "misc/extra/extra.h" + +ABC_NAMESPACE_IMPL_START + + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +typedef struct Ifd_Obj_t_ Ifd_Obj_t; +struct Ifd_Obj_t_ +{ + unsigned nFreq : 24; // frequency + unsigned nSupp : 5; // support size + unsigned Type : 2; // type + unsigned fWay : 1; // transparent edge + unsigned pFans[3]; // fanins +}; + +typedef struct Ifd_Man_t_ Ifd_Man_t; +struct Ifd_Man_t_ +{ + Ifd_Obj_t * pObjs; + int nObjs; + int nObjsAlloc; + // hashing operations + Vec_Int_t * vArgs; // iDsd1 op iDsdC + Vec_Int_t * vRes; // result of operation + Vec_Int_t * vOffs; // offsets in the array of permutations + Vec_Str_t * vPerms; // storage for permutations + Hsh_IntMan_t * vHash; // hash table + Vec_Int_t * vMarks; // marks where given N begins + Vec_Wrd_t * vTruths; // truth tables + // other data + Vec_Int_t * vSuper; + +}; + +static inline int Ifd_ObjIsVar( Ifd_Obj_t * p ) { return p->Type == 0; } +static inline int Ifd_ObjIsAnd( Ifd_Obj_t * p ) { return p->Type == 1; } +static inline int Ifd_ObjIsXor( Ifd_Obj_t * p ) { return p->Type == 2; } +static inline int Ifd_ObjIsMux( Ifd_Obj_t * p ) { return p->Type == 3; } + +static inline Ifd_Obj_t * Ifd_ManObj( Ifd_Man_t * p, int i ) { assert( i >= 0 && i < p->nObjs ); return p->pObjs + i; } +static inline Ifd_Obj_t * Ifd_ManObjFromLit( Ifd_Man_t * p, int iLit ) { return Ifd_ManObj( p, Abc_Lit2Var(iLit) ); } +static inline int Ifd_ObjId( Ifd_Man_t * p, Ifd_Obj_t * pObj ) { assert( pObj - p->pObjs >= 0 && pObj - p->pObjs < p->nObjs ); return pObj - p->pObjs; } +static inline int Ifd_LitSuppSize( Ifd_Man_t * p, int iLit ) { return iLit > 0 ? Ifd_ManObjFromLit(p, iLit)->nSupp : 0; } + +#define Ifd_ManForEachNodeWithSupp( p, nVars, pLeaf, i ) \ + for ( i = Vec_IntEntry(p->vMarks, nVars); (i < Vec_IntEntry(p->vMarks, nVars+1)) && (pLeaf = Ifd_ManObj(p, i)); i++ ) + + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Ifd_Man_t * Ifd_ManStart() +{ + Ifd_Man_t * p; + p = ABC_CALLOC( Ifd_Man_t, 1 ); + p->nObjsAlloc = Abc_PrimeCudd( 50000000 ); + p->nObjs = 2; + p->pObjs = ABC_CALLOC( Ifd_Obj_t, p->nObjsAlloc ); + memset( p->pObjs, 0xFF, sizeof(Ifd_Obj_t) ); // const node + (p->pObjs + 1)->nSupp = 1; // variable + (p->pObjs + 1)->fWay = 1; // variable + // hashing operations + p->vArgs = Vec_IntAlloc( 4000 ); + p->vRes = Vec_IntAlloc( 1000 ); +// p->vOffs = Vec_IntAlloc( 1000 ); +// p->vPerms = Vec_StrAlloc( 1000 ); + p->vHash = Hsh_IntManStart( p->vArgs, 4, 1000 ); + p->vMarks = Vec_IntAlloc( 100 ); + Vec_IntPush( p->vMarks, 0 ); + Vec_IntPush( p->vMarks, 1 ); + Vec_IntPush( p->vMarks, p->nObjs ); + // other data + p->vSuper = Vec_IntAlloc( 1000 ); + p->vTruths = Vec_WrdAlloc( 1000 ); + return p; +} +void Ifd_ManStop( Ifd_Man_t * p ) +{ + int i, This, Prev = 0; + Vec_IntForEachEntryStart( p->vMarks, This, i, 1 ) + { + printf( "%d(%d:%d) ", i-1, This, This - Prev ); + Prev = This; + } + printf( "\n" ); + + Vec_IntFreeP( &p->vArgs ); + Vec_IntFreeP( &p->vRes ); +// Vec_IntFree( p->vOffs ); +// Vec_StrFree( p->vPerms ); + Vec_WrdFreeP( &p->vTruths ); + Vec_IntFreeP( &p->vMarks ); + Hsh_IntManStop( p->vHash ); + Vec_IntFreeP( &p->vSuper ); + ABC_FREE( p->pObjs ); + ABC_FREE( p ); +} + +/**Function************************************************************* + + Synopsis [Printing structures.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Ifd_ObjPrint_rec( Ifd_Man_t * p, int iLit, int * pCounter, int DiffType ) +{ + char Symb[2][4] = { {'?','(','[','<'}, {'?',')',']','>'} }; + Ifd_Obj_t * pDsd; + if ( Abc_LitIsCompl(iLit) ) + printf( "!" ), iLit = Abc_LitNot(iLit); + if ( iLit == 2 ) + { printf( "%c", 'a' + (*pCounter)++ ); return; } + pDsd = Ifd_ManObjFromLit( p, iLit ); + if ( DiffType ) + printf( "%c", Symb[0][pDsd->Type] ); + Ifd_ObjPrint_rec( p, pDsd->pFans[0], pCounter, pDsd->Type == 3 || Abc_LitIsCompl(pDsd->pFans[0]) || pDsd->Type != Ifd_ManObjFromLit(p, pDsd->pFans[0])->Type ); + Ifd_ObjPrint_rec( p, pDsd->pFans[1], pCounter, pDsd->Type == 3 || Abc_LitIsCompl(pDsd->pFans[1]) || pDsd->Type != Ifd_ManObjFromLit(p, pDsd->pFans[1])->Type ); + if ( pDsd->pFans[2] != -1 ) + Ifd_ObjPrint_rec( p, pDsd->pFans[2], pCounter, pDsd->Type == 3 || Abc_LitIsCompl(pDsd->pFans[2]) || pDsd->Type != Ifd_ManObjFromLit(p, pDsd->pFans[2])->Type ); + if ( DiffType ) + printf( "%c", Symb[1][pDsd->Type] ); +} +void Ifd_ObjPrint( Ifd_Man_t * p, int iLit ) +{ + int Counter = 0; + if ( iLit == 0 ) + { printf( "0\n" ); return; } + if ( iLit == 1 ) + { printf( "1\n" ); return; } + Ifd_ObjPrint_rec( p, iLit, &Counter, 1 ); + printf( "\n" ); +} +void Ifd_ManPrint( Ifd_Man_t * p ) +{ + int i; + for ( i = 0; i < p->nObjs; i++ ) + { + printf( "%4d : ", i ); + Ifd_ObjPrint( p, Abc_Var2Lit( i, 0 ) ); + } +} + + +/**Function************************************************************* + + Synopsis [Computing truth tables.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +word Ifd_ObjTruth_rec( Ifd_Man_t * p, int iLit, int * pCounter ) +{ + static word s_Truths6[6] = { + ABC_CONST(0xAAAAAAAAAAAAAAAA), + ABC_CONST(0xCCCCCCCCCCCCCCCC), + ABC_CONST(0xF0F0F0F0F0F0F0F0), + ABC_CONST(0xFF00FF00FF00FF00), + ABC_CONST(0xFFFF0000FFFF0000), + ABC_CONST(0xFFFFFFFF00000000) + }; + Ifd_Obj_t * pDsd; + word Fun0, Fun1, Fun2; + assert( !Abc_LitIsCompl(iLit) ); + if ( iLit == 2 ) + return s_Truths6[(*pCounter)++]; + pDsd = Ifd_ManObjFromLit( p, iLit ); + + Fun0 = Ifd_ObjTruth_rec( p, Abc_LitRegular(pDsd->pFans[0]), pCounter ); + Fun1 = Ifd_ObjTruth_rec( p, Abc_LitRegular(pDsd->pFans[1]), pCounter ); + if ( pDsd->pFans[2] != -1 ) + Fun2 = Ifd_ObjTruth_rec( p, Abc_LitRegular(pDsd->pFans[2]), pCounter ); + + Fun0 = Abc_LitIsCompl(pDsd->pFans[0]) ? ~Fun0 : Fun0; + Fun1 = Abc_LitIsCompl(pDsd->pFans[1]) ? ~Fun1 : Fun1; + if ( pDsd->pFans[2] != -1 ) + Fun2 = Abc_LitIsCompl(pDsd->pFans[2]) ? ~Fun2 : Fun2; + + if ( pDsd->Type == 1 ) + return Fun0 & Fun1; + if ( pDsd->Type == 2 ) + return Fun0 ^ Fun1; + if ( pDsd->Type == 3 ) + return (Fun2 & Fun1) | (~Fun2 & Fun0); + assert( 0 ); + return -1; +} +word Ifd_ObjTruth( Ifd_Man_t * p, int iLit ) +{ + word Fun; + int Counter = 0; + if ( iLit == 0 ) + return 0; + if ( iLit == 1 ) + return ~(word)0; + Fun = Ifd_ObjTruth_rec( p, Abc_LitRegular(iLit), &Counter ); + return Abc_LitIsCompl(iLit) ? ~Fun : Fun; +} +void Ifd_ManTruthAll( Ifd_Man_t * p ) +{ + word Fun; + int i; + assert( Vec_WrdSize(p->vTruths) == 0 ); + for ( i = 0; i < p->nObjs; i++ ) + { + Fun = Ifd_ObjTruth( p, Abc_Var2Lit( i, 0 ) ); + Vec_WrdPush( p->vTruths, Fun ); +// Extra_PrintHex( stdout, (unsigned *)&Fun, 6 ); printf( " " ); +// Kit_DsdPrintFromTruth( (unsigned *)&Fun, 6 ); printf( "\n" ); + } +} + +/**Function************************************************************* + + Synopsis [Canonicizing DSD structures.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Ifd_ManHashLookup( Ifd_Man_t * p, int iDsd0, int iDsd1, int iDsdC, int Type ) +{ + int pData[4]; + assert( iDsdC != -1 || iDsd0 >= iDsd1 ); + assert( iDsdC == -1 || !Abc_LitIsCompl(iDsd1) ); + pData[0] = iDsd0; + pData[1] = iDsd1; + pData[2] = iDsdC; + pData[3] = Type; + return *Hsh_IntManLookup( p->vHash, pData ); +} +void Ifd_ManHashInsert( Ifd_Man_t * p, int iDsd0, int iDsd1, int iDsdC, int Type, int Res ) +{ + int iObj; + assert( iDsdC != -1 || iDsd0 >= iDsd1 ); + assert( iDsdC == -1 || !Abc_LitIsCompl(iDsd1) ); + Vec_IntPush( p->vArgs, iDsd0 ); + Vec_IntPush( p->vArgs, iDsd1 ); + Vec_IntPush( p->vArgs, iDsdC ); + Vec_IntPush( p->vArgs, Type ); + iObj = Hsh_IntManAdd( p->vHash, Vec_IntSize(p->vRes) ); + assert( iObj == Vec_IntSize(p->vRes) ); + Vec_IntPush( p->vRes, Res ); + assert( 4 * Vec_IntSize(p->vRes) == Vec_IntSize(p->vArgs) ); +} +int Ifd_ManHashFindOrAdd( Ifd_Man_t * p, int iDsd0, int iDsd1, int iDsdC, int Type ) +{ + Ifd_Obj_t * pObj; + int iObj, Value; + assert( iDsdC != -1 || iDsd0 >= iDsd1 ); + assert( iDsdC == -1 || !Abc_LitIsCompl(iDsd1) ); + Vec_IntPush( p->vArgs, iDsd0 ); + Vec_IntPush( p->vArgs, iDsd1 ); + Vec_IntPush( p->vArgs, iDsdC ); + Vec_IntPush( p->vArgs, Type ); + Value = Hsh_IntManAdd( p->vHash, Vec_IntSize(p->vRes) ); + if ( Value < Vec_IntSize(p->vRes) ) + { + iObj = Vec_IntEntry(p->vRes, Value); + Vec_IntShrink( p->vArgs, Vec_IntSize(p->vArgs) - 4 ); + pObj = Ifd_ManObj( p, iObj ); + pObj->nFreq++; + assert( (int)pObj->Type == Type ); + assert( (int)pObj->nSupp == Ifd_LitSuppSize(p, iDsd0) + Ifd_LitSuppSize(p, iDsd1) + Ifd_LitSuppSize(p, iDsdC) ); + } + else + { + if ( p->nObjs == p->nObjsAlloc ) + printf( "The number of nodes is more than %d\n", p->nObjs ); + assert( p->nObjs < p->nObjsAlloc ); + iObj = p->nObjs; + pObj = Ifd_ManObj( p, p->nObjs++ ); + pObj->nFreq = 1; + pObj->nSupp = Ifd_LitSuppSize(p, iDsd0) + Ifd_LitSuppSize(p, iDsd1) + Ifd_LitSuppSize(p, iDsdC); + pObj->Type = Type; + if ( Type == 1 ) + pObj->fWay = 0; + else if ( Type == 2 ) + pObj->fWay = Ifd_ManObjFromLit(p, iDsd0)->fWay || Ifd_ManObjFromLit(p, iDsd1)->fWay; + else if ( Type == 3 ) +// pObj->fWay = (Ifd_ManObjFromLit(p, iDsd0)->fWay && Ifd_ManObjFromLit(p, iDsd1)->fWay) || (Abc_Lit2Var(iDsd0) == Abc_Lit2Var(iDsd1) && Ifd_ManObjFromLit(p, iDsdC)->fWay); + pObj->fWay = (Ifd_ManObjFromLit(p, iDsd0)->fWay && Ifd_ManObjFromLit(p, iDsd1)->fWay) || (iDsd0 == Abc_LitNot(iDsd1) && Ifd_ManObjFromLit(p, iDsdC)->fWay); + else assert( 0 ); + pObj->pFans[0] = iDsd0; + pObj->pFans[1] = iDsd1; + pObj->pFans[2] = iDsdC; + Vec_IntPush( p->vRes, iObj ); + } + assert( 4 * Vec_IntSize(p->vRes) == Vec_IntSize(p->vArgs) ); + return iObj; +} +void Ifd_ManOperSuper_rec( Ifd_Man_t * p, int iLit, int Type, Vec_Int_t * vObjs ) +{ + Ifd_Obj_t * pDsd = Ifd_ManObjFromLit( p, iLit ); + if ( Abc_LitIsCompl(iLit) || (int)pDsd->Type != Type ) + Vec_IntPush( vObjs, iLit ); + else + { + Ifd_ManOperSuper_rec( p, pDsd->pFans[0], Type, vObjs ); + Ifd_ManOperSuper_rec( p, pDsd->pFans[1], Type, vObjs ); + } +} +int Ifd_ManOper( Ifd_Man_t * p, int iDsd0, int iDsd1, int iDsdC, int Type ) +{ + int i, iLit0, iLit1, iThis, fCompl = 0; + if ( Type == 1 ) // AND + { + if ( iDsd0 == 0 || iDsd1 == 0 ) + return 0; + if ( iDsd0 == 1 || iDsd1 == 1 ) + return (iDsd0 == 1) ? iDsd1 : iDsd0; + } + else if ( Type == 2 ) // XOR + { + if ( iDsd0 < 2 ) + return Abc_LitNotCond( iDsd1, iDsd0 ); + if ( iDsd1 < 2 ) + return Abc_LitNotCond( iDsd0, iDsd1 ); + if ( Abc_LitIsCompl(iDsd0) ) + fCompl ^= 1, iDsd0 = Abc_LitNot(iDsd0); + if ( Abc_LitIsCompl(iDsd1) ) + fCompl ^= 1, iDsd1 = Abc_LitNot(iDsd1); + } + else if ( Type == 3 ) + { + if ( Abc_LitIsCompl(iDsdC) ) + { + ABC_SWAP( int, iDsd0, iDsd1 ); + iDsdC = Abc_LitNot(iDsdC); + } + if ( Abc_LitIsCompl(iDsd1) ) + fCompl ^= 1, iDsd0 = Abc_LitNot(iDsd0), iDsd1 = Abc_LitNot(iDsd1); + } + assert( iDsd0 > 1 && iDsd1 > 1 && Type >= 1 && Type <= 3 ); +/* + // check cache + iThis = Ifd_ManHashLookup( p, iDsd0, iDsd1, iDsdC, Type ); + if ( iThis != -1 ) + return Abc_Var2Lit( iThis, fCompl ); +*/ + // create new entry + if ( Type == 3 ) + { + iThis = Ifd_ManHashFindOrAdd( p, iDsd0, iDsd1, iDsdC, Type ); + return Abc_Var2Lit( iThis, fCompl ); + } + assert( iDsdC == -1 ); + Vec_IntClear( p->vSuper ); + Ifd_ManOperSuper_rec( p, iDsd0, Type, p->vSuper ); + Ifd_ManOperSuper_rec( p, iDsd1, Type, p->vSuper ); + Vec_IntSort( p->vSuper, 1 ); + iLit0 = Vec_IntEntry( p->vSuper, 0 ); + Vec_IntForEachEntryStart( p->vSuper, iLit1, i, 1 ) + iLit0 = Abc_Var2Lit( Ifd_ManHashFindOrAdd(p, iLit0, iLit1, -1, Type), 0 ); + assert( !Abc_LitIsCompl(iLit0) ); + // insert into cache +// if ( Vec_IntSize(p->vSuper) > 2 ) +// Ifd_ManHashInsert( p, iDsd0, iDsd1, iDsdC, Type, iLit0 ); + return Abc_LitNotCond( iLit0, fCompl ); +} + + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Ifd_ManFindDsd_rec( Ifd_Man_t * pMan, char * pStr, char ** p, int * pMatches ) +{ + int fCompl = 0; + if ( **p == '!' ) + (*p)++, fCompl = 1; + if ( **p >= 'a' && **p <= 'f' ) // var + { + assert( **p - 'a' >= 0 && **p - 'a' < 6 ); + return Abc_Var2Lit( 1, fCompl ); + } + if ( **p == '(' ) // and/or + { + char * q = pStr + pMatches[ *p - pStr ]; + int Lit, Res = 1; + assert( **p == '(' && *q == ')' ); + for ( (*p)++; *p < q; (*p)++ ) + { + Lit = Ifd_ManFindDsd_rec( pMan, pStr, p, pMatches ); + Res = Ifd_ManOper( pMan, Res, Lit, 0, 1 ); + } + assert( *p == q ); + return Abc_LitNotCond( Res, fCompl ); + } + if ( **p == '[' ) // xor + { + char * q = pStr + pMatches[ *p - pStr ]; + int Lit, Res = 0; + assert( **p == '[' && *q == ']' ); + for ( (*p)++; *p < q; (*p)++ ) + { + Lit = Ifd_ManFindDsd_rec( pMan, pStr, p, pMatches ); + Res = Ifd_ManOper( pMan, Res, Lit, 0, 2 ); + } + assert( *p == q ); + return Abc_LitNotCond( Res, fCompl ); + } + if ( **p == '<' ) // mux + { + int Temp[3], * pTemp = Temp, Res; + char * pOld = *p; + char * q = pStr + pMatches[ *p - pStr ]; + assert( **p == '<' && *q == '>' ); + // derive MAX components + for ( (*p)++; *p < q; (*p)++ ) + *pTemp++ = Ifd_ManFindDsd_rec( pMan, pStr, p, pMatches ); + assert( pTemp == Temp + 3 ); + assert( *p == q ); +// Res = (Temp[0] & Temp[1]) | (~Temp[0] & Temp[2]); + Res = Ifd_ManOper( pMan, Temp[2], Temp[1], Temp[0], 3 ); + return Abc_LitNotCond( Res, fCompl ); + } + assert( 0 ); + return 0; +} +#define IFM_MAX_STR 100 +#define IFM_MAX_VAR 16 +int * Ifd_ManComputeMatches( char * p ) +{ + static int pMatches[IFM_MAX_STR]; + int pNested[IFM_MAX_VAR]; + int v, nNested = 0; + for ( v = 0; p[v]; v++ ) + { + assert( v < IFM_MAX_STR ); + pMatches[v] = 0; + if ( p[v] == '(' || p[v] == '[' || p[v] == '<' || p[v] == '{' ) + pNested[nNested++] = v; + else if ( p[v] == ')' || p[v] == ']' || p[v] == '>' || p[v] == '}' ) + pMatches[pNested[--nNested]] = v; + assert( nNested < IFM_MAX_VAR ); + } + assert( nNested == 0 ); + return pMatches; +} +int Ifd_ManFindDsd( Ifd_Man_t * pMan, char * p ) +{ + int Res; + if ( *p == '0' && *(p+1) == 0 ) + Res = 0; + else if ( *p == '1' && *(p+1) == 0 ) + Res = 1; + else + Res = Ifd_ManFindDsd_rec( pMan, p, &p, Ifd_ManComputeMatches(p) ); + assert( *++p == 0 ); + return Res; +} + + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Ifd_ManDsdTest2() +{ + char * p = "(abc)"; + char * q = "(a[bc])"; + char * r = "[<abc>(def)]"; + Ifd_Man_t * pMan = Ifd_ManStart(); + int iLit = Ifd_ManFindDsd( pMan, p ); + Ifd_ObjPrint( pMan, iLit ); + Ifd_ManStop( pMan ); +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Vec_Wrd_t * Ifd_ManDsdTruths( int nVars ) +{ + int fUseMux = 1; + Vec_Wrd_t * vTruths; + Ifd_Man_t * pMan = Ifd_ManStart(); + Ifd_Obj_t * pLeaf0, * pLeaf1, * pLeaf2; + int v, i, j, k, c0, c1, c2; + for ( v = 2; v <= nVars; v++ ) + { + // create ANDs/XORs + for ( i = 1; i < v; i++ ) + for ( j = 1; j < v; j++ ) + if ( i + j == v ) + { + Ifd_ManForEachNodeWithSupp( pMan, i, pLeaf0, c0 ) + Ifd_ManForEachNodeWithSupp( pMan, j, pLeaf1, c1 ) + { + assert( (int)pLeaf0->nSupp == i ); + assert( (int)pLeaf1->nSupp == j ); + Ifd_ManOper( pMan, Abc_Var2Lit(c0, 0), Abc_Var2Lit(c1, 0), -1, 1 ); + if ( !pLeaf1->fWay ) + Ifd_ManOper( pMan, Abc_Var2Lit(c0, 0), Abc_Var2Lit(c1, 1), -1, 1 ); + if ( !pLeaf0->fWay ) + Ifd_ManOper( pMan, Abc_Var2Lit(c0, 1), Abc_Var2Lit(c1, 0), -1, 1 ); + if ( !pLeaf0->fWay && !pLeaf1->fWay ) + Ifd_ManOper( pMan, Abc_Var2Lit(c0, 1), Abc_Var2Lit(c1, 1), -1, 1 ); + Ifd_ManOper( pMan, Abc_Var2Lit(c0, 0), Abc_Var2Lit(c1, 0), -1, 2 ); + } + } + // create MUX + if ( fUseMux ) + for ( i = 1; i < v-1; i++ ) + for ( j = 1; j < v-1; j++ ) + for ( k = 1; k < v-1; k++ ) + if ( i + j + k == v ) + { + Ifd_ManForEachNodeWithSupp( pMan, i, pLeaf0, c0 ) + Ifd_ManForEachNodeWithSupp( pMan, j, pLeaf1, c1 ) + Ifd_ManForEachNodeWithSupp( pMan, k, pLeaf2, c2 ) + { + assert( (int)pLeaf0->nSupp == i ); + assert( (int)pLeaf1->nSupp == j ); + assert( (int)pLeaf2->nSupp == k ); +//printf( "%d %d %d ", i, j, k ); +//printf( "%d %d %d\n", Ifd_ObjId(pMan, pLeaf0), Ifd_ObjId(pMan, pLeaf1), Ifd_ObjId(pMan, pLeaf2) ); + if ( pLeaf2->fWay && c0 < c1 ) + continue; + Ifd_ManOper( pMan, Abc_Var2Lit(c0, 0), Abc_Var2Lit(c1, 0), Abc_Var2Lit(c2, 0), 3 ); + if ( !pLeaf0->fWay && !pLeaf1->fWay ) + Ifd_ManOper( pMan, Abc_Var2Lit(c0, 1), Abc_Var2Lit(c1, 0), Abc_Var2Lit(c2, 0), 3 ); + } + } + // bookmark + Vec_IntPush( pMan->vMarks, pMan->nObjs ); + } +// Ifd_ManPrint( pMan ); + Ifd_ManTruthAll( pMan ); + vTruths = pMan->vTruths; pMan->vTruths = NULL; + Ifd_ManStop( pMan ); + return vTruths; +} + + +/**Function************************************************************* + + Synopsis [Generating the guided array for minimal permutations.] + + Description [http://icodesnip.com/search/johnson%20trotter/] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Ifd_ManDsdPermPrint( int * perm, int size ) +{ + int i; + for ( i = 0; i < size; i++ ) + printf( "%d", perm[i] ); + printf( "\n" ); +} +Vec_Int_t * Ifd_ManDsdPermJT( int n ) +{ + Vec_Int_t * vGuide = Vec_IntAlloc( 100 ); + int *array, *dir, tmp, tmp2, i, max; + array = (int*)malloc(sizeof(int) * n); + dir = (int*)calloc(n, sizeof(int)); + for (i = 0; i < n; i++) + array[i] = i; + max = n - 1; + if (n != 1) + do + { +// Ifd_ManDsdPermPrint(array, n); + tmp = array[max]; + tmp2 = dir[max]; + i = !dir[max] ? max - 1 : max + 1; + array[max] = array[i]; + array[i] = tmp; + Vec_IntPush( vGuide, Abc_MinInt(max, i) ); + dir[max] = dir[i]; + dir[i] = tmp2; + for (i = 0; i < n; i++) + if (array[i] > tmp) + dir[i] = !dir[i]; + max = n; + for (i = 0; i < n; i++) + if (((!dir[i] && i != 0 && array[i] > array[i-1]) || (dir[i] && i != n-1 && array[i] > array[i+1])) && (array[i] > array[max] || max == n)) + max = i; + } + while (max < n); +// Ifd_ManDsdPermPrint(array,n); + Vec_IntPush( vGuide, 0 ); + free(dir); + free(array); + return vGuide; +} +int Ifd_ManDsdTest4() +{ + int pPerm[6] = { 0, 1, 2, 3, 4, 5 }; + Vec_Int_t * vGuide = Ifd_ManDsdPermJT( 6 ); + int i, Entry; + Vec_IntForEachEntry( vGuide, Entry, i ) + { + ABC_SWAP( int, pPerm[Entry], pPerm[Entry+1] ); + Ifd_ManDsdPermPrint( pPerm, 6 ); + } + Vec_IntFree( vGuide ); + return 1; +} + + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline word Extra_Truth6SwapAdjacent( word t, int iVar ) +{ + // variable swapping code + static word PMasks[5][3] = { + { ABC_CONST(0x9999999999999999), ABC_CONST(0x2222222222222222), ABC_CONST(0x4444444444444444) }, + { ABC_CONST(0xC3C3C3C3C3C3C3C3), ABC_CONST(0x0C0C0C0C0C0C0C0C), ABC_CONST(0x3030303030303030) }, + { ABC_CONST(0xF00FF00FF00FF00F), ABC_CONST(0x00F000F000F000F0), ABC_CONST(0x0F000F000F000F00) }, + { ABC_CONST(0xFF0000FFFF0000FF), ABC_CONST(0x0000FF000000FF00), ABC_CONST(0x00FF000000FF0000) }, + { ABC_CONST(0xFFFF00000000FFFF), ABC_CONST(0x00000000FFFF0000), ABC_CONST(0x0000FFFF00000000) } + }; + assert( iVar < 5 ); + return (t & PMasks[iVar][0]) | ((t & PMasks[iVar][1]) << (1 << iVar)) | ((t & PMasks[iVar][2]) >> (1 << iVar)); +} +static inline word Extra_Truth6ChangePhase( word t, int iVar) +{ + // elementary truth tables + static word Truth6[6] = { + ABC_CONST(0xAAAAAAAAAAAAAAAA), + ABC_CONST(0xCCCCCCCCCCCCCCCC), + ABC_CONST(0xF0F0F0F0F0F0F0F0), + ABC_CONST(0xFF00FF00FF00FF00), + ABC_CONST(0xFFFF0000FFFF0000), + ABC_CONST(0xFFFFFFFF00000000) + }; + assert( iVar < 6 ); + return ((t & ~Truth6[iVar]) << (1 << iVar)) | ((t & Truth6[iVar]) >> (1 << iVar)); +} +Vec_Wrd_t * Extra_Truth6AllConfigs2( word t, int * pComp, int * pPerm, int nVars ) +{ + int nPerms = Extra_Factorial( nVars ); + int nSwaps = (1 << nVars); + Vec_Wrd_t * vTruths = Vec_WrdStart( nPerms * (1 << (nVars+1)) ); + word tCur, tTemp1, tTemp2; + int i, p, c; + for ( i = 0; i < 2; i++ ) + { + tCur = i ? t : ~t; + tTemp1 = tCur; + for ( p = 0; p < nPerms; p++ ) + { + tTemp2 = tCur; + for ( c = 0; c < nSwaps; c++ ) + { + Vec_WrdWriteEntry( vTruths, (p << (nVars+1))|(i << nVars)|c, tCur ); + tCur = Extra_Truth6ChangePhase( tCur, pComp[c] ); + } + assert( tTemp2 == tCur ); + tCur = Extra_Truth6SwapAdjacent( tCur, pPerm[p] ); + } + assert( tTemp1 == tCur ); + } + if ( t ) + { + int i; + word Truth; + Vec_WrdForEachEntry( vTruths, Truth, i ) + assert( Truth ); + } + return vTruths; +} +Vec_Wrd_t * Extra_Truth6AllConfigs( word t, int * pComp, int * pPerm, int nVars ) +{ + int nPerms = Extra_Factorial( nVars ); + int nSwaps = (1 << nVars); + Vec_Wrd_t * vTruths = Vec_WrdStart( nPerms * nSwaps ); + word tCur, tTemp1, tTemp2; + int i, p, c; + for ( i = 1; i < 2; i++ ) + { + tCur = i ? ~t : t; + tTemp1 = tCur; + for ( p = 0; p < nPerms; p++ ) + { + tTemp2 = tCur; + for ( c = 0; c < nSwaps; c++ ) + { + Vec_WrdWriteEntry( vTruths, (p << (nVars))|c, tCur ); + tCur = Extra_Truth6ChangePhase( tCur, pComp[c] ); + } + assert( tTemp2 == tCur ); + tCur = Extra_Truth6SwapAdjacent( tCur, pPerm[p] ); + } + assert( tTemp1 == tCur ); + } + if ( t ) + { + int i; + word Truth; + Vec_WrdForEachEntry( vTruths, Truth, i ) + assert( Truth ); + } + return vTruths; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Ifd_ManDsdTest33() +{ + int nVars = 6; + FILE * pFile; + char pFileName[32]; + Vec_Wrd_t * vTruths = Ifd_ManDsdTruths( nVars ); + Vec_Wrd_t * vVariants; + Vec_Int_t * vUniques; + Vec_Wrd_t * vTruthRes = Vec_WrdAlloc( 4000000 ); + Vec_Int_t * vConfgRes = Vec_IntAlloc( 4000000 ); + int * pComp, * pPerm; + word Truth, Variant; + int i, k, Uniq, Runner, Counter = 0; + assert( nVars >= 3 && nVars <= 6 ); + assert( Vec_WrdSize(vTruths) < (1<<10) ); + pComp = Extra_GreyCodeSchedule( nVars ); + pPerm = Extra_PermSchedule( nVars ); + Vec_WrdForEachEntry( vTruths, Truth, i ) + { + vVariants = Extra_Truth6AllConfigs( Truth, pComp, pPerm, nVars ); + vUniques = Hsh_WrdManHashArray( vVariants, 1 ); + Runner = 0; + Vec_IntForEachEntry( vUniques, Uniq, k ) + if ( Runner == Uniq ) + { + Variant = Vec_WrdEntry(vVariants, k); + Vec_WrdPush( vTruthRes, Variant ); + Vec_IntPush( vConfgRes, (Extra_TruthSupportSize((unsigned *)&Variant, 6)<<26)|(i << 16)|k ); + Runner++; + } + Vec_IntUniqify( vUniques ); + assert( Runner == Vec_IntSize(vUniques) ); + Counter += Vec_IntSize(vUniques); +//printf( "%5d : ", i ); Kit_DsdPrintFromTruth( &Truth, nVars ), printf( " " ), Vec_IntPrint( vUniques ), printf( "\n" ); + Vec_IntFree( vUniques ); + Vec_WrdFree( vVariants ); + } + Vec_WrdFree( vTruths ); + ABC_FREE( pPerm ); + ABC_FREE( pComp ); + printf( "Total = %d.\n", Counter ); + assert( Vec_WrdSize(vTruthRes) == Counter ); + // write the data into a file + sprintf( pFileName, "dsdfuncs%d.dat", nVars ); + pFile = fopen( pFileName, "wb" ); + fwrite( Vec_WrdArray(vTruthRes), sizeof(word), Vec_WrdSize(vTruthRes), pFile ); + fwrite( Vec_IntArray(vConfgRes), sizeof(int), Vec_IntSize(vConfgRes), pFile ); + fclose( pFile ); + printf( "File \"%s\" with %d 6-input functions has been written out.\n", pFileName, Vec_IntSize(vConfgRes) ); + Vec_WrdFree( vTruthRes ); + Vec_IntFree( vConfgRes ); + return 1; +} + +int Ifd_ManDsdTest() +{ + abctime clk = Abc_Clock(); + FILE * pFile; + char * pFileName = "dsdfuncs6.dat"; + int size = Extra_FileSize( pFileName ) / 12; // 3504275 + Vec_Wrd_t * vTruthRes = Vec_WrdAlloc( size + 1 ); + Vec_Int_t * vConfgRes = Vec_IntAlloc( size ); + Hsh_IntMan_t * pHash; + + pFile = fopen( pFileName, "rb" ); + fread( Vec_WrdArray(vTruthRes), sizeof(word), size, pFile ); + fread( Vec_IntArray(vConfgRes), sizeof(int), size, pFile ); + vTruthRes->nSize = size; + vConfgRes->nSize = size; + // create hash table + pHash = Hsh_WrdManHashArrayStart( vTruthRes, 1 ); + // experiment with functions + + // cleanup + Hsh_IntManStop( pHash ); + Vec_WrdFree( vTruthRes ); + Vec_IntFree( vConfgRes ); + Abc_PrintTime( 1, "Reading file", Abc_Clock() - clk ); + return 1; +} + + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + |