summaryrefslogtreecommitdiffstats
path: root/src/map/mpm/mpmPre.c
diff options
context:
space:
mode:
authorAlan Mishchenko <alanmi@berkeley.edu>2013-07-12 13:02:32 -0700
committerAlan Mishchenko <alanmi@berkeley.edu>2013-07-12 13:02:32 -0700
commitfba33fbba407f96800863bde5a7061b09c2f9ff2 (patch)
tree28b8cf1f69d3e345c7953157c450efdd90531b7b /src/map/mpm/mpmPre.c
parent2ee26b00f9ac8dc93bd1335f89d4c3b165dbd7fd (diff)
downloadabc-fba33fbba407f96800863bde5a7061b09c2f9ff2.tar.gz
abc-fba33fbba407f96800863bde5a7061b09c2f9ff2.tar.bz2
abc-fba33fbba407f96800863bde5a7061b09c2f9ff2.zip
New technology mapper.
Diffstat (limited to 'src/map/mpm/mpmPre.c')
-rw-r--r--src/map/mpm/mpmPre.c885
1 files changed, 885 insertions, 0 deletions
diff --git a/src/map/mpm/mpmPre.c b/src/map/mpm/mpmPre.c
new file mode 100644
index 00000000..e070c71a
--- /dev/null
+++ b/src/map/mpm/mpmPre.c
@@ -0,0 +1,885 @@
+/**CFile****************************************************************
+
+ FileName [mpmPre.c]
+
+ SystemName [ABC: Logic synthesis and verification system.]
+
+ PackageName [Configurable technology mapper.]
+
+ Synopsis [DSD-related precomputations.]
+
+ Author [Alan Mishchenko]
+
+ Affiliation [UC Berkeley]
+
+ Date [Ver. 1.0. Started - June 1, 2013.]
+
+ Revision [$Id: mpmPre.c,v 1.00 2013/06/01 00:00:00 alanmi Exp $]
+
+***********************************************************************/
+
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include <assert.h>
+
+#include "misc/vec/vec.h"
+#include "misc/vec/vecHsh.h"
+#include "misc/extra/extra.h"
+
+ABC_NAMESPACE_IMPL_START
+
+
+////////////////////////////////////////////////////////////////////////
+/// DECLARATIONS ///
+////////////////////////////////////////////////////////////////////////
+
+typedef struct Ifd_Obj_t_ Ifd_Obj_t;
+struct Ifd_Obj_t_
+{
+ unsigned nFreq : 24; // frequency
+ unsigned nSupp : 5; // support size
+ unsigned Type : 2; // type
+ unsigned fWay : 1; // transparent edge
+ unsigned pFans[3]; // fanins
+};
+
+typedef struct Ifd_Man_t_ Ifd_Man_t;
+struct Ifd_Man_t_
+{
+ Ifd_Obj_t * pObjs;
+ int nObjs;
+ int nObjsAlloc;
+ // hashing operations
+ Vec_Int_t * vArgs; // iDsd1 op iDsdC
+ Vec_Int_t * vRes; // result of operation
+ Vec_Int_t * vOffs; // offsets in the array of permutations
+ Vec_Str_t * vPerms; // storage for permutations
+ Hsh_IntMan_t * vHash; // hash table
+ Vec_Int_t * vMarks; // marks where given N begins
+ Vec_Wrd_t * vTruths; // truth tables
+ // other data
+ Vec_Int_t * vSuper;
+
+};
+
+static inline int Ifd_ObjIsVar( Ifd_Obj_t * p ) { return p->Type == 0; }
+static inline int Ifd_ObjIsAnd( Ifd_Obj_t * p ) { return p->Type == 1; }
+static inline int Ifd_ObjIsXor( Ifd_Obj_t * p ) { return p->Type == 2; }
+static inline int Ifd_ObjIsMux( Ifd_Obj_t * p ) { return p->Type == 3; }
+
+static inline Ifd_Obj_t * Ifd_ManObj( Ifd_Man_t * p, int i ) { assert( i >= 0 && i < p->nObjs ); return p->pObjs + i; }
+static inline Ifd_Obj_t * Ifd_ManObjFromLit( Ifd_Man_t * p, int iLit ) { return Ifd_ManObj( p, Abc_Lit2Var(iLit) ); }
+static inline int Ifd_ObjId( Ifd_Man_t * p, Ifd_Obj_t * pObj ) { assert( pObj - p->pObjs >= 0 && pObj - p->pObjs < p->nObjs ); return pObj - p->pObjs; }
+static inline int Ifd_LitSuppSize( Ifd_Man_t * p, int iLit ) { return iLit > 0 ? Ifd_ManObjFromLit(p, iLit)->nSupp : 0; }
+
+#define Ifd_ManForEachNodeWithSupp( p, nVars, pLeaf, i ) \
+ for ( i = Vec_IntEntry(p->vMarks, nVars); (i < Vec_IntEntry(p->vMarks, nVars+1)) && (pLeaf = Ifd_ManObj(p, i)); i++ )
+
+
+////////////////////////////////////////////////////////////////////////
+/// FUNCTION DEFINITIONS ///
+////////////////////////////////////////////////////////////////////////
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+Ifd_Man_t * Ifd_ManStart()
+{
+ Ifd_Man_t * p;
+ p = ABC_CALLOC( Ifd_Man_t, 1 );
+ p->nObjsAlloc = Abc_PrimeCudd( 50000000 );
+ p->nObjs = 2;
+ p->pObjs = ABC_CALLOC( Ifd_Obj_t, p->nObjsAlloc );
+ memset( p->pObjs, 0xFF, sizeof(Ifd_Obj_t) ); // const node
+ (p->pObjs + 1)->nSupp = 1; // variable
+ (p->pObjs + 1)->fWay = 1; // variable
+ // hashing operations
+ p->vArgs = Vec_IntAlloc( 4000 );
+ p->vRes = Vec_IntAlloc( 1000 );
+// p->vOffs = Vec_IntAlloc( 1000 );
+// p->vPerms = Vec_StrAlloc( 1000 );
+ p->vHash = Hsh_IntManStart( p->vArgs, 4, 1000 );
+ p->vMarks = Vec_IntAlloc( 100 );
+ Vec_IntPush( p->vMarks, 0 );
+ Vec_IntPush( p->vMarks, 1 );
+ Vec_IntPush( p->vMarks, p->nObjs );
+ // other data
+ p->vSuper = Vec_IntAlloc( 1000 );
+ p->vTruths = Vec_WrdAlloc( 1000 );
+ return p;
+}
+void Ifd_ManStop( Ifd_Man_t * p )
+{
+ int i, This, Prev = 0;
+ Vec_IntForEachEntryStart( p->vMarks, This, i, 1 )
+ {
+ printf( "%d(%d:%d) ", i-1, This, This - Prev );
+ Prev = This;
+ }
+ printf( "\n" );
+
+ Vec_IntFreeP( &p->vArgs );
+ Vec_IntFreeP( &p->vRes );
+// Vec_IntFree( p->vOffs );
+// Vec_StrFree( p->vPerms );
+ Vec_WrdFreeP( &p->vTruths );
+ Vec_IntFreeP( &p->vMarks );
+ Hsh_IntManStop( p->vHash );
+ Vec_IntFreeP( &p->vSuper );
+ ABC_FREE( p->pObjs );
+ ABC_FREE( p );
+}
+
+/**Function*************************************************************
+
+ Synopsis [Printing structures.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Ifd_ObjPrint_rec( Ifd_Man_t * p, int iLit, int * pCounter, int DiffType )
+{
+ char Symb[2][4] = { {'?','(','[','<'}, {'?',')',']','>'} };
+ Ifd_Obj_t * pDsd;
+ if ( Abc_LitIsCompl(iLit) )
+ printf( "!" ), iLit = Abc_LitNot(iLit);
+ if ( iLit == 2 )
+ { printf( "%c", 'a' + (*pCounter)++ ); return; }
+ pDsd = Ifd_ManObjFromLit( p, iLit );
+ if ( DiffType )
+ printf( "%c", Symb[0][pDsd->Type] );
+ Ifd_ObjPrint_rec( p, pDsd->pFans[0], pCounter, pDsd->Type == 3 || Abc_LitIsCompl(pDsd->pFans[0]) || pDsd->Type != Ifd_ManObjFromLit(p, pDsd->pFans[0])->Type );
+ Ifd_ObjPrint_rec( p, pDsd->pFans[1], pCounter, pDsd->Type == 3 || Abc_LitIsCompl(pDsd->pFans[1]) || pDsd->Type != Ifd_ManObjFromLit(p, pDsd->pFans[1])->Type );
+ if ( pDsd->pFans[2] != -1 )
+ Ifd_ObjPrint_rec( p, pDsd->pFans[2], pCounter, pDsd->Type == 3 || Abc_LitIsCompl(pDsd->pFans[2]) || pDsd->Type != Ifd_ManObjFromLit(p, pDsd->pFans[2])->Type );
+ if ( DiffType )
+ printf( "%c", Symb[1][pDsd->Type] );
+}
+void Ifd_ObjPrint( Ifd_Man_t * p, int iLit )
+{
+ int Counter = 0;
+ if ( iLit == 0 )
+ { printf( "0\n" ); return; }
+ if ( iLit == 1 )
+ { printf( "1\n" ); return; }
+ Ifd_ObjPrint_rec( p, iLit, &Counter, 1 );
+ printf( "\n" );
+}
+void Ifd_ManPrint( Ifd_Man_t * p )
+{
+ int i;
+ for ( i = 0; i < p->nObjs; i++ )
+ {
+ printf( "%4d : ", i );
+ Ifd_ObjPrint( p, Abc_Var2Lit( i, 0 ) );
+ }
+}
+
+
+/**Function*************************************************************
+
+ Synopsis [Computing truth tables.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+word Ifd_ObjTruth_rec( Ifd_Man_t * p, int iLit, int * pCounter )
+{
+ static word s_Truths6[6] = {
+ ABC_CONST(0xAAAAAAAAAAAAAAAA),
+ ABC_CONST(0xCCCCCCCCCCCCCCCC),
+ ABC_CONST(0xF0F0F0F0F0F0F0F0),
+ ABC_CONST(0xFF00FF00FF00FF00),
+ ABC_CONST(0xFFFF0000FFFF0000),
+ ABC_CONST(0xFFFFFFFF00000000)
+ };
+ Ifd_Obj_t * pDsd;
+ word Fun0, Fun1, Fun2;
+ assert( !Abc_LitIsCompl(iLit) );
+ if ( iLit == 2 )
+ return s_Truths6[(*pCounter)++];
+ pDsd = Ifd_ManObjFromLit( p, iLit );
+
+ Fun0 = Ifd_ObjTruth_rec( p, Abc_LitRegular(pDsd->pFans[0]), pCounter );
+ Fun1 = Ifd_ObjTruth_rec( p, Abc_LitRegular(pDsd->pFans[1]), pCounter );
+ if ( pDsd->pFans[2] != -1 )
+ Fun2 = Ifd_ObjTruth_rec( p, Abc_LitRegular(pDsd->pFans[2]), pCounter );
+
+ Fun0 = Abc_LitIsCompl(pDsd->pFans[0]) ? ~Fun0 : Fun0;
+ Fun1 = Abc_LitIsCompl(pDsd->pFans[1]) ? ~Fun1 : Fun1;
+ if ( pDsd->pFans[2] != -1 )
+ Fun2 = Abc_LitIsCompl(pDsd->pFans[2]) ? ~Fun2 : Fun2;
+
+ if ( pDsd->Type == 1 )
+ return Fun0 & Fun1;
+ if ( pDsd->Type == 2 )
+ return Fun0 ^ Fun1;
+ if ( pDsd->Type == 3 )
+ return (Fun2 & Fun1) | (~Fun2 & Fun0);
+ assert( 0 );
+ return -1;
+}
+word Ifd_ObjTruth( Ifd_Man_t * p, int iLit )
+{
+ word Fun;
+ int Counter = 0;
+ if ( iLit == 0 )
+ return 0;
+ if ( iLit == 1 )
+ return ~(word)0;
+ Fun = Ifd_ObjTruth_rec( p, Abc_LitRegular(iLit), &Counter );
+ return Abc_LitIsCompl(iLit) ? ~Fun : Fun;
+}
+void Ifd_ManTruthAll( Ifd_Man_t * p )
+{
+ word Fun;
+ int i;
+ assert( Vec_WrdSize(p->vTruths) == 0 );
+ for ( i = 0; i < p->nObjs; i++ )
+ {
+ Fun = Ifd_ObjTruth( p, Abc_Var2Lit( i, 0 ) );
+ Vec_WrdPush( p->vTruths, Fun );
+// Extra_PrintHex( stdout, (unsigned *)&Fun, 6 ); printf( " " );
+// Kit_DsdPrintFromTruth( (unsigned *)&Fun, 6 ); printf( "\n" );
+ }
+}
+
+/**Function*************************************************************
+
+ Synopsis [Canonicizing DSD structures.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+int Ifd_ManHashLookup( Ifd_Man_t * p, int iDsd0, int iDsd1, int iDsdC, int Type )
+{
+ int pData[4];
+ assert( iDsdC != -1 || iDsd0 >= iDsd1 );
+ assert( iDsdC == -1 || !Abc_LitIsCompl(iDsd1) );
+ pData[0] = iDsd0;
+ pData[1] = iDsd1;
+ pData[2] = iDsdC;
+ pData[3] = Type;
+ return *Hsh_IntManLookup( p->vHash, pData );
+}
+void Ifd_ManHashInsert( Ifd_Man_t * p, int iDsd0, int iDsd1, int iDsdC, int Type, int Res )
+{
+ int iObj;
+ assert( iDsdC != -1 || iDsd0 >= iDsd1 );
+ assert( iDsdC == -1 || !Abc_LitIsCompl(iDsd1) );
+ Vec_IntPush( p->vArgs, iDsd0 );
+ Vec_IntPush( p->vArgs, iDsd1 );
+ Vec_IntPush( p->vArgs, iDsdC );
+ Vec_IntPush( p->vArgs, Type );
+ iObj = Hsh_IntManAdd( p->vHash, Vec_IntSize(p->vRes) );
+ assert( iObj == Vec_IntSize(p->vRes) );
+ Vec_IntPush( p->vRes, Res );
+ assert( 4 * Vec_IntSize(p->vRes) == Vec_IntSize(p->vArgs) );
+}
+int Ifd_ManHashFindOrAdd( Ifd_Man_t * p, int iDsd0, int iDsd1, int iDsdC, int Type )
+{
+ Ifd_Obj_t * pObj;
+ int iObj, Value;
+ assert( iDsdC != -1 || iDsd0 >= iDsd1 );
+ assert( iDsdC == -1 || !Abc_LitIsCompl(iDsd1) );
+ Vec_IntPush( p->vArgs, iDsd0 );
+ Vec_IntPush( p->vArgs, iDsd1 );
+ Vec_IntPush( p->vArgs, iDsdC );
+ Vec_IntPush( p->vArgs, Type );
+ Value = Hsh_IntManAdd( p->vHash, Vec_IntSize(p->vRes) );
+ if ( Value < Vec_IntSize(p->vRes) )
+ {
+ iObj = Vec_IntEntry(p->vRes, Value);
+ Vec_IntShrink( p->vArgs, Vec_IntSize(p->vArgs) - 4 );
+ pObj = Ifd_ManObj( p, iObj );
+ pObj->nFreq++;
+ assert( (int)pObj->Type == Type );
+ assert( (int)pObj->nSupp == Ifd_LitSuppSize(p, iDsd0) + Ifd_LitSuppSize(p, iDsd1) + Ifd_LitSuppSize(p, iDsdC) );
+ }
+ else
+ {
+ if ( p->nObjs == p->nObjsAlloc )
+ printf( "The number of nodes is more than %d\n", p->nObjs );
+ assert( p->nObjs < p->nObjsAlloc );
+ iObj = p->nObjs;
+ pObj = Ifd_ManObj( p, p->nObjs++ );
+ pObj->nFreq = 1;
+ pObj->nSupp = Ifd_LitSuppSize(p, iDsd0) + Ifd_LitSuppSize(p, iDsd1) + Ifd_LitSuppSize(p, iDsdC);
+ pObj->Type = Type;
+ if ( Type == 1 )
+ pObj->fWay = 0;
+ else if ( Type == 2 )
+ pObj->fWay = Ifd_ManObjFromLit(p, iDsd0)->fWay || Ifd_ManObjFromLit(p, iDsd1)->fWay;
+ else if ( Type == 3 )
+// pObj->fWay = (Ifd_ManObjFromLit(p, iDsd0)->fWay && Ifd_ManObjFromLit(p, iDsd1)->fWay) || (Abc_Lit2Var(iDsd0) == Abc_Lit2Var(iDsd1) && Ifd_ManObjFromLit(p, iDsdC)->fWay);
+ pObj->fWay = (Ifd_ManObjFromLit(p, iDsd0)->fWay && Ifd_ManObjFromLit(p, iDsd1)->fWay) || (iDsd0 == Abc_LitNot(iDsd1) && Ifd_ManObjFromLit(p, iDsdC)->fWay);
+ else assert( 0 );
+ pObj->pFans[0] = iDsd0;
+ pObj->pFans[1] = iDsd1;
+ pObj->pFans[2] = iDsdC;
+ Vec_IntPush( p->vRes, iObj );
+ }
+ assert( 4 * Vec_IntSize(p->vRes) == Vec_IntSize(p->vArgs) );
+ return iObj;
+}
+void Ifd_ManOperSuper_rec( Ifd_Man_t * p, int iLit, int Type, Vec_Int_t * vObjs )
+{
+ Ifd_Obj_t * pDsd = Ifd_ManObjFromLit( p, iLit );
+ if ( Abc_LitIsCompl(iLit) || (int)pDsd->Type != Type )
+ Vec_IntPush( vObjs, iLit );
+ else
+ {
+ Ifd_ManOperSuper_rec( p, pDsd->pFans[0], Type, vObjs );
+ Ifd_ManOperSuper_rec( p, pDsd->pFans[1], Type, vObjs );
+ }
+}
+int Ifd_ManOper( Ifd_Man_t * p, int iDsd0, int iDsd1, int iDsdC, int Type )
+{
+ int i, iLit0, iLit1, iThis, fCompl = 0;
+ if ( Type == 1 ) // AND
+ {
+ if ( iDsd0 == 0 || iDsd1 == 0 )
+ return 0;
+ if ( iDsd0 == 1 || iDsd1 == 1 )
+ return (iDsd0 == 1) ? iDsd1 : iDsd0;
+ }
+ else if ( Type == 2 ) // XOR
+ {
+ if ( iDsd0 < 2 )
+ return Abc_LitNotCond( iDsd1, iDsd0 );
+ if ( iDsd1 < 2 )
+ return Abc_LitNotCond( iDsd0, iDsd1 );
+ if ( Abc_LitIsCompl(iDsd0) )
+ fCompl ^= 1, iDsd0 = Abc_LitNot(iDsd0);
+ if ( Abc_LitIsCompl(iDsd1) )
+ fCompl ^= 1, iDsd1 = Abc_LitNot(iDsd1);
+ }
+ else if ( Type == 3 )
+ {
+ if ( Abc_LitIsCompl(iDsdC) )
+ {
+ ABC_SWAP( int, iDsd0, iDsd1 );
+ iDsdC = Abc_LitNot(iDsdC);
+ }
+ if ( Abc_LitIsCompl(iDsd1) )
+ fCompl ^= 1, iDsd0 = Abc_LitNot(iDsd0), iDsd1 = Abc_LitNot(iDsd1);
+ }
+ assert( iDsd0 > 1 && iDsd1 > 1 && Type >= 1 && Type <= 3 );
+/*
+ // check cache
+ iThis = Ifd_ManHashLookup( p, iDsd0, iDsd1, iDsdC, Type );
+ if ( iThis != -1 )
+ return Abc_Var2Lit( iThis, fCompl );
+*/
+ // create new entry
+ if ( Type == 3 )
+ {
+ iThis = Ifd_ManHashFindOrAdd( p, iDsd0, iDsd1, iDsdC, Type );
+ return Abc_Var2Lit( iThis, fCompl );
+ }
+ assert( iDsdC == -1 );
+ Vec_IntClear( p->vSuper );
+ Ifd_ManOperSuper_rec( p, iDsd0, Type, p->vSuper );
+ Ifd_ManOperSuper_rec( p, iDsd1, Type, p->vSuper );
+ Vec_IntSort( p->vSuper, 1 );
+ iLit0 = Vec_IntEntry( p->vSuper, 0 );
+ Vec_IntForEachEntryStart( p->vSuper, iLit1, i, 1 )
+ iLit0 = Abc_Var2Lit( Ifd_ManHashFindOrAdd(p, iLit0, iLit1, -1, Type), 0 );
+ assert( !Abc_LitIsCompl(iLit0) );
+ // insert into cache
+// if ( Vec_IntSize(p->vSuper) > 2 )
+// Ifd_ManHashInsert( p, iDsd0, iDsd1, iDsdC, Type, iLit0 );
+ return Abc_LitNotCond( iLit0, fCompl );
+}
+
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+int Ifd_ManFindDsd_rec( Ifd_Man_t * pMan, char * pStr, char ** p, int * pMatches )
+{
+ int fCompl = 0;
+ if ( **p == '!' )
+ (*p)++, fCompl = 1;
+ if ( **p >= 'a' && **p <= 'f' ) // var
+ {
+ assert( **p - 'a' >= 0 && **p - 'a' < 6 );
+ return Abc_Var2Lit( 1, fCompl );
+ }
+ if ( **p == '(' ) // and/or
+ {
+ char * q = pStr + pMatches[ *p - pStr ];
+ int Lit, Res = 1;
+ assert( **p == '(' && *q == ')' );
+ for ( (*p)++; *p < q; (*p)++ )
+ {
+ Lit = Ifd_ManFindDsd_rec( pMan, pStr, p, pMatches );
+ Res = Ifd_ManOper( pMan, Res, Lit, 0, 1 );
+ }
+ assert( *p == q );
+ return Abc_LitNotCond( Res, fCompl );
+ }
+ if ( **p == '[' ) // xor
+ {
+ char * q = pStr + pMatches[ *p - pStr ];
+ int Lit, Res = 0;
+ assert( **p == '[' && *q == ']' );
+ for ( (*p)++; *p < q; (*p)++ )
+ {
+ Lit = Ifd_ManFindDsd_rec( pMan, pStr, p, pMatches );
+ Res = Ifd_ManOper( pMan, Res, Lit, 0, 2 );
+ }
+ assert( *p == q );
+ return Abc_LitNotCond( Res, fCompl );
+ }
+ if ( **p == '<' ) // mux
+ {
+ int Temp[3], * pTemp = Temp, Res;
+ char * pOld = *p;
+ char * q = pStr + pMatches[ *p - pStr ];
+ assert( **p == '<' && *q == '>' );
+ // derive MAX components
+ for ( (*p)++; *p < q; (*p)++ )
+ *pTemp++ = Ifd_ManFindDsd_rec( pMan, pStr, p, pMatches );
+ assert( pTemp == Temp + 3 );
+ assert( *p == q );
+// Res = (Temp[0] & Temp[1]) | (~Temp[0] & Temp[2]);
+ Res = Ifd_ManOper( pMan, Temp[2], Temp[1], Temp[0], 3 );
+ return Abc_LitNotCond( Res, fCompl );
+ }
+ assert( 0 );
+ return 0;
+}
+#define IFM_MAX_STR 100
+#define IFM_MAX_VAR 16
+int * Ifd_ManComputeMatches( char * p )
+{
+ static int pMatches[IFM_MAX_STR];
+ int pNested[IFM_MAX_VAR];
+ int v, nNested = 0;
+ for ( v = 0; p[v]; v++ )
+ {
+ assert( v < IFM_MAX_STR );
+ pMatches[v] = 0;
+ if ( p[v] == '(' || p[v] == '[' || p[v] == '<' || p[v] == '{' )
+ pNested[nNested++] = v;
+ else if ( p[v] == ')' || p[v] == ']' || p[v] == '>' || p[v] == '}' )
+ pMatches[pNested[--nNested]] = v;
+ assert( nNested < IFM_MAX_VAR );
+ }
+ assert( nNested == 0 );
+ return pMatches;
+}
+int Ifd_ManFindDsd( Ifd_Man_t * pMan, char * p )
+{
+ int Res;
+ if ( *p == '0' && *(p+1) == 0 )
+ Res = 0;
+ else if ( *p == '1' && *(p+1) == 0 )
+ Res = 1;
+ else
+ Res = Ifd_ManFindDsd_rec( pMan, p, &p, Ifd_ManComputeMatches(p) );
+ assert( *++p == 0 );
+ return Res;
+}
+
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Ifd_ManDsdTest2()
+{
+ char * p = "(abc)";
+ char * q = "(a[bc])";
+ char * r = "[<abc>(def)]";
+ Ifd_Man_t * pMan = Ifd_ManStart();
+ int iLit = Ifd_ManFindDsd( pMan, p );
+ Ifd_ObjPrint( pMan, iLit );
+ Ifd_ManStop( pMan );
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+Vec_Wrd_t * Ifd_ManDsdTruths( int nVars )
+{
+ int fUseMux = 1;
+ Vec_Wrd_t * vTruths;
+ Ifd_Man_t * pMan = Ifd_ManStart();
+ Ifd_Obj_t * pLeaf0, * pLeaf1, * pLeaf2;
+ int v, i, j, k, c0, c1, c2;
+ for ( v = 2; v <= nVars; v++ )
+ {
+ // create ANDs/XORs
+ for ( i = 1; i < v; i++ )
+ for ( j = 1; j < v; j++ )
+ if ( i + j == v )
+ {
+ Ifd_ManForEachNodeWithSupp( pMan, i, pLeaf0, c0 )
+ Ifd_ManForEachNodeWithSupp( pMan, j, pLeaf1, c1 )
+ {
+ assert( (int)pLeaf0->nSupp == i );
+ assert( (int)pLeaf1->nSupp == j );
+ Ifd_ManOper( pMan, Abc_Var2Lit(c0, 0), Abc_Var2Lit(c1, 0), -1, 1 );
+ if ( !pLeaf1->fWay )
+ Ifd_ManOper( pMan, Abc_Var2Lit(c0, 0), Abc_Var2Lit(c1, 1), -1, 1 );
+ if ( !pLeaf0->fWay )
+ Ifd_ManOper( pMan, Abc_Var2Lit(c0, 1), Abc_Var2Lit(c1, 0), -1, 1 );
+ if ( !pLeaf0->fWay && !pLeaf1->fWay )
+ Ifd_ManOper( pMan, Abc_Var2Lit(c0, 1), Abc_Var2Lit(c1, 1), -1, 1 );
+ Ifd_ManOper( pMan, Abc_Var2Lit(c0, 0), Abc_Var2Lit(c1, 0), -1, 2 );
+ }
+ }
+ // create MUX
+ if ( fUseMux )
+ for ( i = 1; i < v-1; i++ )
+ for ( j = 1; j < v-1; j++ )
+ for ( k = 1; k < v-1; k++ )
+ if ( i + j + k == v )
+ {
+ Ifd_ManForEachNodeWithSupp( pMan, i, pLeaf0, c0 )
+ Ifd_ManForEachNodeWithSupp( pMan, j, pLeaf1, c1 )
+ Ifd_ManForEachNodeWithSupp( pMan, k, pLeaf2, c2 )
+ {
+ assert( (int)pLeaf0->nSupp == i );
+ assert( (int)pLeaf1->nSupp == j );
+ assert( (int)pLeaf2->nSupp == k );
+//printf( "%d %d %d ", i, j, k );
+//printf( "%d %d %d\n", Ifd_ObjId(pMan, pLeaf0), Ifd_ObjId(pMan, pLeaf1), Ifd_ObjId(pMan, pLeaf2) );
+ if ( pLeaf2->fWay && c0 < c1 )
+ continue;
+ Ifd_ManOper( pMan, Abc_Var2Lit(c0, 0), Abc_Var2Lit(c1, 0), Abc_Var2Lit(c2, 0), 3 );
+ if ( !pLeaf0->fWay && !pLeaf1->fWay )
+ Ifd_ManOper( pMan, Abc_Var2Lit(c0, 1), Abc_Var2Lit(c1, 0), Abc_Var2Lit(c2, 0), 3 );
+ }
+ }
+ // bookmark
+ Vec_IntPush( pMan->vMarks, pMan->nObjs );
+ }
+// Ifd_ManPrint( pMan );
+ Ifd_ManTruthAll( pMan );
+ vTruths = pMan->vTruths; pMan->vTruths = NULL;
+ Ifd_ManStop( pMan );
+ return vTruths;
+}
+
+
+/**Function*************************************************************
+
+ Synopsis [Generating the guided array for minimal permutations.]
+
+ Description [http://icodesnip.com/search/johnson%20trotter/]
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Ifd_ManDsdPermPrint( int * perm, int size )
+{
+ int i;
+ for ( i = 0; i < size; i++ )
+ printf( "%d", perm[i] );
+ printf( "\n" );
+}
+Vec_Int_t * Ifd_ManDsdPermJT( int n )
+{
+ Vec_Int_t * vGuide = Vec_IntAlloc( 100 );
+ int *array, *dir, tmp, tmp2, i, max;
+ array = (int*)malloc(sizeof(int) * n);
+ dir = (int*)calloc(n, sizeof(int));
+ for (i = 0; i < n; i++)
+ array[i] = i;
+ max = n - 1;
+ if (n != 1)
+ do
+ {
+// Ifd_ManDsdPermPrint(array, n);
+ tmp = array[max];
+ tmp2 = dir[max];
+ i = !dir[max] ? max - 1 : max + 1;
+ array[max] = array[i];
+ array[i] = tmp;
+ Vec_IntPush( vGuide, Abc_MinInt(max, i) );
+ dir[max] = dir[i];
+ dir[i] = tmp2;
+ for (i = 0; i < n; i++)
+ if (array[i] > tmp)
+ dir[i] = !dir[i];
+ max = n;
+ for (i = 0; i < n; i++)
+ if (((!dir[i] && i != 0 && array[i] > array[i-1]) || (dir[i] && i != n-1 && array[i] > array[i+1])) && (array[i] > array[max] || max == n))
+ max = i;
+ }
+ while (max < n);
+// Ifd_ManDsdPermPrint(array,n);
+ Vec_IntPush( vGuide, 0 );
+ free(dir);
+ free(array);
+ return vGuide;
+}
+int Ifd_ManDsdTest4()
+{
+ int pPerm[6] = { 0, 1, 2, 3, 4, 5 };
+ Vec_Int_t * vGuide = Ifd_ManDsdPermJT( 6 );
+ int i, Entry;
+ Vec_IntForEachEntry( vGuide, Entry, i )
+ {
+ ABC_SWAP( int, pPerm[Entry], pPerm[Entry+1] );
+ Ifd_ManDsdPermPrint( pPerm, 6 );
+ }
+ Vec_IntFree( vGuide );
+ return 1;
+}
+
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+static inline word Extra_Truth6SwapAdjacent( word t, int iVar )
+{
+ // variable swapping code
+ static word PMasks[5][3] = {
+ { ABC_CONST(0x9999999999999999), ABC_CONST(0x2222222222222222), ABC_CONST(0x4444444444444444) },
+ { ABC_CONST(0xC3C3C3C3C3C3C3C3), ABC_CONST(0x0C0C0C0C0C0C0C0C), ABC_CONST(0x3030303030303030) },
+ { ABC_CONST(0xF00FF00FF00FF00F), ABC_CONST(0x00F000F000F000F0), ABC_CONST(0x0F000F000F000F00) },
+ { ABC_CONST(0xFF0000FFFF0000FF), ABC_CONST(0x0000FF000000FF00), ABC_CONST(0x00FF000000FF0000) },
+ { ABC_CONST(0xFFFF00000000FFFF), ABC_CONST(0x00000000FFFF0000), ABC_CONST(0x0000FFFF00000000) }
+ };
+ assert( iVar < 5 );
+ return (t & PMasks[iVar][0]) | ((t & PMasks[iVar][1]) << (1 << iVar)) | ((t & PMasks[iVar][2]) >> (1 << iVar));
+}
+static inline word Extra_Truth6ChangePhase( word t, int iVar)
+{
+ // elementary truth tables
+ static word Truth6[6] = {
+ ABC_CONST(0xAAAAAAAAAAAAAAAA),
+ ABC_CONST(0xCCCCCCCCCCCCCCCC),
+ ABC_CONST(0xF0F0F0F0F0F0F0F0),
+ ABC_CONST(0xFF00FF00FF00FF00),
+ ABC_CONST(0xFFFF0000FFFF0000),
+ ABC_CONST(0xFFFFFFFF00000000)
+ };
+ assert( iVar < 6 );
+ return ((t & ~Truth6[iVar]) << (1 << iVar)) | ((t & Truth6[iVar]) >> (1 << iVar));
+}
+Vec_Wrd_t * Extra_Truth6AllConfigs2( word t, int * pComp, int * pPerm, int nVars )
+{
+ int nPerms = Extra_Factorial( nVars );
+ int nSwaps = (1 << nVars);
+ Vec_Wrd_t * vTruths = Vec_WrdStart( nPerms * (1 << (nVars+1)) );
+ word tCur, tTemp1, tTemp2;
+ int i, p, c;
+ for ( i = 0; i < 2; i++ )
+ {
+ tCur = i ? t : ~t;
+ tTemp1 = tCur;
+ for ( p = 0; p < nPerms; p++ )
+ {
+ tTemp2 = tCur;
+ for ( c = 0; c < nSwaps; c++ )
+ {
+ Vec_WrdWriteEntry( vTruths, (p << (nVars+1))|(i << nVars)|c, tCur );
+ tCur = Extra_Truth6ChangePhase( tCur, pComp[c] );
+ }
+ assert( tTemp2 == tCur );
+ tCur = Extra_Truth6SwapAdjacent( tCur, pPerm[p] );
+ }
+ assert( tTemp1 == tCur );
+ }
+ if ( t )
+ {
+ int i;
+ word Truth;
+ Vec_WrdForEachEntry( vTruths, Truth, i )
+ assert( Truth );
+ }
+ return vTruths;
+}
+Vec_Wrd_t * Extra_Truth6AllConfigs( word t, int * pComp, int * pPerm, int nVars )
+{
+ int nPerms = Extra_Factorial( nVars );
+ int nSwaps = (1 << nVars);
+ Vec_Wrd_t * vTruths = Vec_WrdStart( nPerms * nSwaps );
+ word tCur, tTemp1, tTemp2;
+ int i, p, c;
+ for ( i = 1; i < 2; i++ )
+ {
+ tCur = i ? ~t : t;
+ tTemp1 = tCur;
+ for ( p = 0; p < nPerms; p++ )
+ {
+ tTemp2 = tCur;
+ for ( c = 0; c < nSwaps; c++ )
+ {
+ Vec_WrdWriteEntry( vTruths, (p << (nVars))|c, tCur );
+ tCur = Extra_Truth6ChangePhase( tCur, pComp[c] );
+ }
+ assert( tTemp2 == tCur );
+ tCur = Extra_Truth6SwapAdjacent( tCur, pPerm[p] );
+ }
+ assert( tTemp1 == tCur );
+ }
+ if ( t )
+ {
+ int i;
+ word Truth;
+ Vec_WrdForEachEntry( vTruths, Truth, i )
+ assert( Truth );
+ }
+ return vTruths;
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+int Ifd_ManDsdTest33()
+{
+ int nVars = 6;
+ FILE * pFile;
+ char pFileName[32];
+ Vec_Wrd_t * vTruths = Ifd_ManDsdTruths( nVars );
+ Vec_Wrd_t * vVariants;
+ Vec_Int_t * vUniques;
+ Vec_Wrd_t * vTruthRes = Vec_WrdAlloc( 4000000 );
+ Vec_Int_t * vConfgRes = Vec_IntAlloc( 4000000 );
+ int * pComp, * pPerm;
+ word Truth, Variant;
+ int i, k, Uniq, Runner, Counter = 0;
+ assert( nVars >= 3 && nVars <= 6 );
+ assert( Vec_WrdSize(vTruths) < (1<<10) );
+ pComp = Extra_GreyCodeSchedule( nVars );
+ pPerm = Extra_PermSchedule( nVars );
+ Vec_WrdForEachEntry( vTruths, Truth, i )
+ {
+ vVariants = Extra_Truth6AllConfigs( Truth, pComp, pPerm, nVars );
+ vUniques = Hsh_WrdManHashArray( vVariants, 1 );
+ Runner = 0;
+ Vec_IntForEachEntry( vUniques, Uniq, k )
+ if ( Runner == Uniq )
+ {
+ Variant = Vec_WrdEntry(vVariants, k);
+ Vec_WrdPush( vTruthRes, Variant );
+ Vec_IntPush( vConfgRes, (Extra_TruthSupportSize((unsigned *)&Variant, 6)<<26)|(i << 16)|k );
+ Runner++;
+ }
+ Vec_IntUniqify( vUniques );
+ assert( Runner == Vec_IntSize(vUniques) );
+ Counter += Vec_IntSize(vUniques);
+//printf( "%5d : ", i ); Kit_DsdPrintFromTruth( &Truth, nVars ), printf( " " ), Vec_IntPrint( vUniques ), printf( "\n" );
+ Vec_IntFree( vUniques );
+ Vec_WrdFree( vVariants );
+ }
+ Vec_WrdFree( vTruths );
+ ABC_FREE( pPerm );
+ ABC_FREE( pComp );
+ printf( "Total = %d.\n", Counter );
+ assert( Vec_WrdSize(vTruthRes) == Counter );
+ // write the data into a file
+ sprintf( pFileName, "dsdfuncs%d.dat", nVars );
+ pFile = fopen( pFileName, "wb" );
+ fwrite( Vec_WrdArray(vTruthRes), sizeof(word), Vec_WrdSize(vTruthRes), pFile );
+ fwrite( Vec_IntArray(vConfgRes), sizeof(int), Vec_IntSize(vConfgRes), pFile );
+ fclose( pFile );
+ printf( "File \"%s\" with %d 6-input functions has been written out.\n", pFileName, Vec_IntSize(vConfgRes) );
+ Vec_WrdFree( vTruthRes );
+ Vec_IntFree( vConfgRes );
+ return 1;
+}
+
+int Ifd_ManDsdTest()
+{
+ abctime clk = Abc_Clock();
+ FILE * pFile;
+ char * pFileName = "dsdfuncs6.dat";
+ int size = Extra_FileSize( pFileName ) / 12; // 3504275
+ Vec_Wrd_t * vTruthRes = Vec_WrdAlloc( size + 1 );
+ Vec_Int_t * vConfgRes = Vec_IntAlloc( size );
+ Hsh_IntMan_t * pHash;
+
+ pFile = fopen( pFileName, "rb" );
+ fread( Vec_WrdArray(vTruthRes), sizeof(word), size, pFile );
+ fread( Vec_IntArray(vConfgRes), sizeof(int), size, pFile );
+ vTruthRes->nSize = size;
+ vConfgRes->nSize = size;
+ // create hash table
+ pHash = Hsh_WrdManHashArrayStart( vTruthRes, 1 );
+ // experiment with functions
+
+ // cleanup
+ Hsh_IntManStop( pHash );
+ Vec_WrdFree( vTruthRes );
+ Vec_IntFree( vConfgRes );
+ Abc_PrintTime( 1, "Reading file", Abc_Clock() - clk );
+ return 1;
+}
+
+
+////////////////////////////////////////////////////////////////////////
+/// END OF FILE ///
+////////////////////////////////////////////////////////////////////////
+
+
+ABC_NAMESPACE_IMPL_END
+