diff options
author | Alan Mishchenko <alanmi@berkeley.edu> | 2015-01-31 19:52:32 -0800 |
---|---|---|
committer | Alan Mishchenko <alanmi@berkeley.edu> | 2015-01-31 19:52:32 -0800 |
commit | 77dbe2b6565dbc68a04a315fb51b50a35b763228 (patch) | |
tree | 8b8c4bddbd01a69314178d33a8b739867d38f78d /src/base/cba/cbaPtr.c | |
parent | a523ab792c4627c11a57fce9a002f3a5bd4bae45 (diff) | |
download | abc-77dbe2b6565dbc68a04a315fb51b50a35b763228.tar.gz abc-77dbe2b6565dbc68a04a315fb51b50a35b763228.tar.bz2 abc-77dbe2b6565dbc68a04a315fb51b50a35b763228.zip |
Major rehash of the CBA code.
Diffstat (limited to 'src/base/cba/cbaPtr.c')
-rw-r--r-- | src/base/cba/cbaPtr.c | 404 |
1 files changed, 404 insertions, 0 deletions
diff --git a/src/base/cba/cbaPtr.c b/src/base/cba/cbaPtr.c new file mode 100644 index 00000000..d9b00ec0 --- /dev/null +++ b/src/base/cba/cbaPtr.c @@ -0,0 +1,404 @@ +/**CFile**************************************************************** + + FileName [cbaPtr.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [Hierarchical word-level netlist.] + + Synopsis [Simple interface with external tools.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - November 29, 2014.] + + Revision [$Id: cbaPtr.c,v 1.00 2014/11/29 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include "base/abc/abc.h" +#include "base/main/mainInt.h" +#include "map/mio/mio.h" + +ABC_NAMESPACE_IMPL_START + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +/* +design = array containing design name (as the first entry in the array) followed by pointers to modules +module = array containing module name (as the first entry in the array) followed by pointers to 6 arrays: + {array of input names; array of output names; array of nodes; array of boxes, + array of floating-point input-arrival times; array of floating-point output-required times} +node = array containing output name, followed by node type, followed by input names +box = array containing model name, instance name, followed by pairs of formal/actual names for each port + + Comments: + - in describing boxes + - input formal/actual name pairs should be listed before output name pairs + - the order of formal names should be the same as the order of inputs/outputs in the module description + - all formal names present in the module description should be listed + - if an input pin is not driven or an output pin has no fanout, the actual pin name is NULL + - word-level formal name "a" is written as bit-level names (a[0]. a[1], etc) ordered LSB to MSB + - primitive names should be given as char*-strings in description of nodes and boxes + - primitive modules should not be written, but the list of primitives and formal names should be provided + - constant 0/1 nets can be specified as char*-strings "NetConst0" and "NetConst1". + - arrays of input-arrival/output-required times in the module description are optional +*/ + +// elementary gates +typedef enum { + PTR_GATE_NONE = 0, + PTR_GATE_C0, // Const0T + PTR_GATE_C1, // Const1T + PTR_GATE_BUF, // BufT + PTR_GATE_INV, // InvT + PTR_GATE_AND, // AndT + PTR_GATE_NAND, // NandT + PTR_GATE_OR, // OrT + PTR_GATE_NOR, // NorT + PTR_GATE_XOR, // XorT + PTR_GATE_XNOR, // XnorT + PTR_GATE_UNKNOWN +} Ptr_ObjType_t; + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/**Function************************************************************* + + Synopsis [Free Ptr.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Cba_PtrFreeNtk( Vec_Ptr_t * vNtk ) +{ + Vec_PtrFree( (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 1) ); + Vec_PtrFree( (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 2) ); + Vec_VecFree( (Vec_Vec_t *)Vec_PtrEntry(vNtk, 3) ); + Vec_VecFree( (Vec_Vec_t *)Vec_PtrEntry(vNtk, 4) ); + if ( Vec_PtrSize(vNtk) > 5 ) + Vec_FltFree( (Vec_Flt_t *)Vec_PtrEntry(vNtk, 5) ); + if ( Vec_PtrSize(vNtk) > 6 ) + Vec_FltFree( (Vec_Flt_t *)Vec_PtrEntry(vNtk, 6) ); + Vec_PtrFree( vNtk ); +} +void Cba_PtrFree( Vec_Ptr_t * vDes ) +{ + Vec_Ptr_t * vNtk; int i; + if ( !vDes ) return; + Vec_PtrForEachEntryStart( Vec_Ptr_t *, vDes, vNtk, i, 1 ) + Cba_PtrFreeNtk( vNtk ); + Vec_PtrFree( vDes ); +} + +/**Function************************************************************* + + Synopsis [Count memory used by Ptr.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Cba_PtrMemoryArray( Vec_Ptr_t * vArray ) +{ + return (int)Vec_PtrMemory(vArray); +} +int Cba_PtrMemoryArrayArray( Vec_Ptr_t * vArrayArray ) +{ + Vec_Ptr_t * vArray; int i, nBytes = 0; + Vec_PtrForEachEntry( Vec_Ptr_t *, vArrayArray, vArray, i ) + nBytes += Cba_PtrMemoryArray(vArray); + return nBytes; +} +int Cba_PtrMemoryNtk( Vec_Ptr_t * vNtk ) +{ + int nBytes = (int)Vec_PtrMemory(vNtk); + nBytes += Cba_PtrMemoryArray( (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 1) ); + nBytes += Cba_PtrMemoryArray( (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 2) ); + nBytes += Cba_PtrMemoryArrayArray( (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 3) ); + nBytes += Cba_PtrMemoryArrayArray( (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 4) ); + return nBytes; +} +int Cba_PtrMemory( Vec_Ptr_t * vDes ) +{ + Vec_Ptr_t * vNtk; int i, nBytes = (int)Vec_PtrMemory(vDes); + Vec_PtrForEachEntryStart( Vec_Ptr_t *, vDes, vNtk, i, 1 ) + nBytes += Cba_PtrMemoryNtk(vNtk); + return nBytes; +} + +/**Function************************************************************* + + Synopsis [Dumping Ptr into a BLIF file.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Cba_PtrDumpSignalsBlif( FILE * pFile, Vec_Ptr_t * vSigs, int fSkipLastComma ) +{ + char * pSig; int i; + Vec_PtrForEachEntry( char *, vSigs, pSig, i ) + fprintf( pFile, " %s", pSig ); +} +void Cba_PtrDumpBoxBlif( FILE * pFile, Vec_Ptr_t * vBox ) +{ + char * pName; int i; + fprintf( pFile, ".subckt" ); + fprintf( pFile, " %s", (char *)Vec_PtrEntry(vBox, 0) ); + //fprintf( pFile, " %s", (char *)Vec_PtrEntry(vBox, 1) ); // do not write intance name in BLIF + Vec_PtrForEachEntryStart( char *, vBox, pName, i, 2 ) + fprintf( pFile, " %s=%s", pName, (char *)Vec_PtrEntry(vBox, i+1) ), i++; + fprintf( pFile, "\n" ); +} +void Cba_PtrDumpBoxesBlif( FILE * pFile, Vec_Ptr_t * vBoxes ) +{ + Vec_Ptr_t * vBox; int i; + Vec_PtrForEachEntry( Vec_Ptr_t *, vBoxes, vBox, i ) + Cba_PtrDumpBoxBlif( pFile, vBox ); +} +void Cba_PtrDumpModuleBlif( FILE * pFile, Vec_Ptr_t * vNtk ) +{ + fprintf( pFile, ".model %s\n", (char *)Vec_PtrEntry(vNtk, 0) ); + fprintf( pFile, ".inputs" ); + Cba_PtrDumpSignalsBlif( pFile, (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 1), 0 ); + fprintf( pFile, "\n" ); + fprintf( pFile, ".outputs" ); + Cba_PtrDumpSignalsBlif( pFile, (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 2), 1 ); + fprintf( pFile, "\n" ); + assert( Vec_PtrSize((Vec_Ptr_t *)Vec_PtrEntry(vNtk, 3)) == 0 ); // no nodes; only boxes + Cba_PtrDumpBoxesBlif( pFile, (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 4) ); + fprintf( pFile, ".end\n\n" ); +} +void Cba_PtrDumpBlif( char * pFileName, Vec_Ptr_t * vDes ) +{ + FILE * pFile; + Vec_Ptr_t * vNtk; int i; + pFile = fopen( pFileName, "wb" ); + if ( pFile == NULL ) + { + printf( "Cannot open output file \"%s\".\n", pFileName ); + return; + } + fprintf( pFile, "// Design \"%s\" written by ABC on %s\n\n", (char *)Vec_PtrEntry(vDes, 0), Extra_TimeStamp() ); + Vec_PtrForEachEntryStart( Vec_Ptr_t *, vDes, vNtk, i, 1 ) + Cba_PtrDumpModuleBlif( pFile, vNtk ); + fclose( pFile ); +} + + +/**Function************************************************************* + + Synopsis [Collect elementary gates from the library.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Cba_ManCollectGateNameOne( Mio_Library_t * pLib, Ptr_ObjType_t Type, word Truth, Vec_Ptr_t * vGateNames ) +{ + Mio_Gate_t * pGate = Mio_LibraryReadGateByTruth( pLib, Truth ); + if ( pGate != NULL ) + Vec_PtrWriteEntry( vGateNames, Type, Mio_GateReadName(pGate) ); +} +Vec_Ptr_t * Cba_ManCollectGateNamesByTruth( Mio_Library_t * pLib ) +{ + static word uTruth, uTruths6[3] = { + ABC_CONST(0xAAAAAAAAAAAAAAAA), + ABC_CONST(0xCCCCCCCCCCCCCCCC), + ABC_CONST(0xF0F0F0F0F0F0F0F0), + }; + Vec_Ptr_t * vGateNames = Vec_PtrStart( PTR_GATE_UNKNOWN ); + Cba_ManCollectGateNameOne( pLib, PTR_GATE_C0, 0, vGateNames ); + Cba_ManCollectGateNameOne( pLib, PTR_GATE_C1, ~(word)0, vGateNames ); + Cba_ManCollectGateNameOne( pLib, PTR_GATE_BUF, uTruths6[0], vGateNames ); + Cba_ManCollectGateNameOne( pLib, PTR_GATE_INV, ~uTruths6[0], vGateNames ); + Cba_ManCollectGateNameOne( pLib, PTR_GATE_AND, (uTruths6[0] & uTruths6[1]), vGateNames ); + Cba_ManCollectGateNameOne( pLib, PTR_GATE_NAND, ~(uTruths6[0] & uTruths6[1]), vGateNames ); + Cba_ManCollectGateNameOne( pLib, PTR_GATE_OR, (uTruths6[0] | uTruths6[1]), vGateNames ); + Cba_ManCollectGateNameOne( pLib, PTR_GATE_NOR, ~(uTruths6[0] | uTruths6[1]), vGateNames ); + Cba_ManCollectGateNameOne( pLib, PTR_GATE_XOR, (uTruths6[0] ^ uTruths6[1]), vGateNames ); + Cba_ManCollectGateNameOne( pLib, PTR_GATE_XNOR, ~(uTruths6[0] ^ uTruths6[1]), vGateNames ); + return vGateNames; +} + +/**Function************************************************************* + + Synopsis [This procedure transforms tech-ind Ptr into mapped Ptr.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Cba_PtrUpdateBox( Vec_Ptr_t * vBox, Vec_Ptr_t * vGatesNames ) +{ + Mio_Gate_t * pGate; Mio_Pin_t * pPin; int i = 1; + Mio_Library_t * pLib = (Mio_Library_t *)Abc_FrameReadLibGen( Abc_FrameGetGlobalFrame() ); + // update gate name + char * pNameNew, * pName = (char *)Vec_PtrEntry(vBox, 0); + if ( !strcmp(pName, "Const0T") ) + pNameNew = (char *)Vec_PtrEntry(vGatesNames, PTR_GATE_C0); + else if ( !strcmp(pName, "Const1T") ) + pNameNew = (char *)Vec_PtrEntry(vGatesNames, PTR_GATE_C1); + else if ( !strcmp(pName, "BufT") ) + pNameNew = (char *)Vec_PtrEntry(vGatesNames, PTR_GATE_BUF); + else if ( !strcmp(pName, "InvT") ) + pNameNew = (char *)Vec_PtrEntry(vGatesNames, PTR_GATE_INV); + else if ( !strcmp(pName, "AndT") ) + pNameNew = (char *)Vec_PtrEntry(vGatesNames, PTR_GATE_AND); + else if ( !strcmp(pName, "NandT") ) + pNameNew = (char *)Vec_PtrEntry(vGatesNames, PTR_GATE_NAND); + else if ( !strcmp(pName, "OrT") ) + pNameNew = (char *)Vec_PtrEntry(vGatesNames, PTR_GATE_OR); + else if ( !strcmp(pName, "NorT") ) + pNameNew = (char *)Vec_PtrEntry(vGatesNames, PTR_GATE_NOR); + else if ( !strcmp(pName, "XorT") ) + pNameNew = (char *)Vec_PtrEntry(vGatesNames, PTR_GATE_XOR); + else if ( !strcmp(pName, "XnorT") ) + pNameNew = (char *)Vec_PtrEntry(vGatesNames, PTR_GATE_XNOR); + else // user hierarchy + return; + ABC_FREE( pName ); + Vec_PtrWriteEntry( vBox, 0, Abc_UtilStrsav(pNameNew) ); + // remove instance name + pName = (char *)Vec_PtrEntry(vBox, 1); + ABC_FREE( pName ); + Vec_PtrWriteEntry( vBox, 1, NULL ); + // update formal input names + pGate = Mio_LibraryReadGateByName( pLib, pNameNew, NULL ); + Mio_GateForEachPin( pGate, pPin ) + { + pName = (char *)Vec_PtrEntry( vBox, 2 * i ); + ABC_FREE( pName ); + pNameNew = Mio_PinReadName(pPin); + Vec_PtrWriteEntry( vBox, 2 * i++, Abc_UtilStrsav(pNameNew) ); + } + // update output name + pName = (char *)Vec_PtrEntry( vBox, 2 * i ); + pNameNew = Mio_GateReadOutName(pGate); + Vec_PtrWriteEntry( vBox, 2 * i++, Abc_UtilStrsav(pNameNew) ); + assert( 2 * i == Vec_PtrSize(vBox) ); +} +Vec_Ptr_t * Cba_PtrTransformSigs( Vec_Ptr_t * vSig ) +{ + char * pName; int i; + Vec_Ptr_t * vNew = Vec_PtrAllocExact( Vec_PtrSize(vSig) ); + Vec_PtrForEachEntry( char *, vSig, pName, i ) + Vec_PtrPush( vNew, Abc_UtilStrsav(pName) ); + return vNew; +} +Vec_Ptr_t * Cba_PtrTransformBox( Vec_Ptr_t * vBox, Vec_Ptr_t * vGatesNames ) +{ + char * pName; int i; + Vec_Ptr_t * vNew = Vec_PtrAllocExact( Vec_PtrSize(vBox) ); + Vec_PtrForEachEntry( char *, vBox, pName, i ) + Vec_PtrPush( vNew, Abc_UtilStrsav(pName) ); + if ( vGatesNames ) + Cba_PtrUpdateBox( vNew, vGatesNames ); + return vNew; +} +Vec_Ptr_t * Cba_PtrTransformBoxes( Vec_Ptr_t * vBoxes, Vec_Ptr_t * vGatesNames ) +{ + Vec_Ptr_t * vBox; int i; + Vec_Ptr_t * vNew = Vec_PtrAllocExact( Vec_PtrSize(vBoxes) ); + Vec_PtrForEachEntry( Vec_Ptr_t *, vBoxes, vBox, i ) + Vec_PtrPush( vNew, Cba_PtrTransformBox(vBox, vGatesNames) ); + return vNew; +} +Vec_Ptr_t * Cba_PtrTransformNtk( Vec_Ptr_t * vNtk, Vec_Ptr_t * vGatesNames ) +{ + char * pName = (char *)Vec_PtrEntry(vNtk, 0); + Vec_Ptr_t * vInputs = (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 1); + Vec_Ptr_t * vOutputs = (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 2); + Vec_Ptr_t * vBoxes = (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 4); + Vec_Ptr_t * vNew = Vec_PtrAllocExact( Vec_PtrSize(vNtk) ); + Vec_PtrPush( vNew, Abc_UtilStrsav(pName) ); + Vec_PtrPush( vNew, Cba_PtrTransformSigs(vInputs) ); + Vec_PtrPush( vNew, Cba_PtrTransformSigs(vOutputs) ); + Vec_PtrPush( vNew, Vec_PtrAllocExact(0) ); + Vec_PtrPush( vNew, Cba_PtrTransformBoxes(vBoxes, vGatesNames) ); + return vNew; +} +Vec_Ptr_t * Cba_PtrTransformTest( Vec_Ptr_t * vDes ) +{ + Mio_Library_t * pLib; + Vec_Ptr_t * vGatesNames; + Vec_Ptr_t * vNtk, * vNew; int i; + // dump BLIF before transformation + Cba_PtrDumpBlif( "test1.blif", vDes ); + if ( Abc_FrameGetGlobalFrame() == NULL ) + { + printf( "ABC framework is not started.\n" ); + return NULL; + } + pLib = (Mio_Library_t *)Abc_FrameReadLibGen( Abc_FrameGetGlobalFrame() ); + if ( pLib == NULL ) + { + printf( "Standard cell library is not entered.\n" ); + return NULL; + } + vGatesNames = Cba_ManCollectGateNamesByTruth( pLib ); + // transform + vNew = Vec_PtrAllocExact( Vec_PtrSize(vDes) ); + Vec_PtrPush( vNew, Abc_UtilStrsav((char *)Vec_PtrEntry(vDes, 0)) ); + Vec_PtrForEachEntryStart( Vec_Ptr_t *, vDes, vNtk, i, 1 ) + Vec_PtrPush( vNew, Cba_PtrTransformNtk(vNtk, vGatesNames) ); + // dump BLIF after transformation + Cba_PtrDumpBlif( "test2.blif", vNew ); + Vec_PtrFree( vGatesNames ); + return vNew; +} + +/**Function************************************************************* + + Synopsis [Test the testing procedure.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ + +void Cba_PtrTransformTestTest() +{ + char * pFileName = "c/hie/dump/1/netlist_1.v"; + Abc_Ntk_t * pNtk = Io_ReadNetlist( pFileName, Io_ReadFileType(pFileName), 0 ); + extern Vec_Ptr_t * Ptr_AbcDeriveDes( Abc_Ntk_t * pNtk ); + Vec_Ptr_t * vDes = Ptr_AbcDeriveDes( pNtk ); + Vec_Ptr_t * vNew = Cba_PtrTransformTest( vDes ); + Cba_PtrFree( vDes ); + Cba_PtrFree( vNew ); +} + + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + |