diff options
author | Bruno Schmitt <bruno@oschmitt.com> | 2017-01-25 13:40:31 +0900 |
---|---|---|
committer | Bruno Schmitt <bruno@oschmitt.com> | 2017-01-25 13:40:31 +0900 |
commit | 876eb5a52e67911ccc19d5f732aa9e1c9279fd26 (patch) | |
tree | 4a78999c29676235f613b4e1f8e1d1d0983107ba | |
parent | 123b425052636beceaa52e47ea695d35b75fb40a (diff) | |
parent | 51f4dab475af1ffd22d23b5aeb8d7cf243739f75 (diff) | |
download | abc-876eb5a52e67911ccc19d5f732aa9e1c9279fd26.tar.gz abc-876eb5a52e67911ccc19d5f732aa9e1c9279fd26.tar.bz2 abc-876eb5a52e67911ccc19d5f732aa9e1c9279fd26.zip |
Merged alanmi/abc into default
80 files changed, 7381 insertions, 659 deletions
@@ -139,6 +139,8 @@ OBJ := \ $(patsubst %.c, %.o, $(filter %.c, $(SRC))) \ $(patsubst %.y, %.o, $(filter %.y, $(SRC))) +LIBOBJ := $(filter-out src/base/main/main.o,$(OBJ)) + DEP := $(OBJ:.o=.d) # implicit rules @@ -186,11 +188,15 @@ $(PROG): $(OBJ) @echo "$(MSG_PREFIX)\`\` Building binary:" $(notdir $@) $(VERBOSE)$(LD) -o $@ $^ $(LIBS) -lib$(PROG).a: $(OBJ) +lib$(PROG).a: $(LIBOBJ) @echo "$(MSG_PREFIX)\`\` Linking:" $(notdir $@) $(VERBOSE)ar rv $@ $? $(VERBOSE)ranlib $@ +lib$(PROG).so: $(LIBOBJ) + @echo "$(MSG_PREFIX)\`\` Linking:" $(notdir $@) + $(VERBOSE)$(CXX) -shared -o $@ $^ $(LIBS) + docs: @echo "$(MSG_PREFIX)\`\` Building documentation." $(notdir $@) $(VERBOSE)doxygen doxygen.conf @@ -88,6 +88,10 @@ LINK32=link.exe # PROP Default_Filter "cpp;c;cxx;rc;def;r;odl;idl;hpj;bat" # Begin Source File +SOURCE=.\src\proof\acec\acecTree.c +# End Source File +# Begin Source File + SOURCE=.\src\base\main\main.c # End Source File # End Group @@ -2759,10 +2759,26 @@ SOURCE=.\src\opt\sbd\sbdCore.c # End Source File # Begin Source File +SOURCE=.\src\opt\sbd\sbdCut.c +# End Source File +# Begin Source File + +SOURCE=.\src\opt\sbd\sbdCut2.c +# End Source File +# Begin Source File + SOURCE=.\src\opt\sbd\sbdInt.h # End Source File # Begin Source File +SOURCE=.\src\opt\sbd\sbdLut.c +# End Source File +# Begin Source File + +SOURCE=.\src\opt\sbd\sbdPath.c +# End Source File +# Begin Source File + SOURCE=.\src\opt\sbd\sbdSat.c # End Source File # Begin Source File @@ -5463,6 +5479,10 @@ SOURCE=.\src\proof\acec\acec.h # End Source File # Begin Source File +SOURCE=.\src\proof\acec\acecBo.c +# End Source File +# Begin Source File + SOURCE=.\src\proof\acec\acecCl.c # End Source File # Begin Source File @@ -5487,6 +5507,14 @@ SOURCE=.\src\proof\acec\acecInt.h # End Source File # Begin Source File +SOURCE=.\src\proof\acec\acecMult.c +# End Source File +# Begin Source File + +SOURCE=.\src\proof\acec\acecNorm.c +# End Source File +# Begin Source File + SOURCE=.\src\proof\acec\acecOrder.c # End Source File # Begin Source File @@ -5515,6 +5543,10 @@ SOURCE=.\src\proof\acec\acecSt.c # End Source File # Begin Source File +SOURCE=.\src\proof\acec\acecTree.c +# End Source File +# Begin Source File + SOURCE=.\src\proof\acec\acecUtil.c # End Source File # End Group @@ -53,6 +53,13 @@ The current version of ABC can be compiled with C compiler or C++ compiler. * To compile as C++ code with namespaces: make sure that `CC=g++` and `ABC_NAMESPACE` is set to the name of the requested namespace. For example, add `-DABC_NAMESPACE=xxx` to OPTFLAGS. +## Building a shared library + + * Compile the code as position-independent by adding `ABC_USE_PIC=1`. + * Build the `libabc.so` target: + + make ABC_USE_PIC=1 libabc.so + ## Bug reporting: Please try to reproduce all the reported bugs and unexpected features using the latest diff --git a/src/aig/aig/aigShow.c b/src/aig/aig/aigShow.c index eac2a510..d983602a 100644 --- a/src/aig/aig/aigShow.c +++ b/src/aig/aig/aigShow.c @@ -19,6 +19,7 @@ ***********************************************************************/ #include "aig.h" +#include "misc/extra/extra.h" ABC_NAMESPACE_IMPL_START @@ -340,12 +341,10 @@ void Aig_WriteDotAig( Aig_Man_t * pMan, char * pFileName, int fHaig, Vec_Ptr_t * void Aig_ManShow( Aig_Man_t * pMan, int fHaig, Vec_Ptr_t * vBold ) { extern void Abc_ShowFile( char * FileNameDot ); - static int Counter = 0; char FileNameDot[200]; FILE * pFile; // create the file name -// Aig_ShowGetFileName( pMan->pName, FileNameDot ); - sprintf( FileNameDot, "temp%02d.dot", Counter++ ); + sprintf( FileNameDot, "%s", Extra_FileNameGenericAppend(pMan->pName, ".dot") ); // check that the file can be opened if ( (pFile = fopen( FileNameDot, "w" )) == NULL ) { diff --git a/src/aig/gia/gia.h b/src/aig/gia/gia.h index bf7bf349..3bc97e6b 100644 --- a/src/aig/gia/gia.h +++ b/src/aig/gia/gia.h @@ -665,21 +665,6 @@ static inline int Gia_ManAppendAnd( Gia_Man_t * p, int iLit0, int iLit1 ) } return Gia_ObjId( p, pObj ) << 1; } -static inline int Gia_ManAppendAnd2( Gia_Man_t * p, int iLit0, int iLit1 ) -{ - if ( !p->fGiaSimple ) - { - if ( iLit0 < 2 ) - return iLit0 ? iLit1 : 0; - if ( iLit1 < 2 ) - return iLit1 ? iLit0 : 0; - if ( iLit0 == iLit1 ) - return iLit1; - if ( iLit0 == Abc_LitNot(iLit1) ) - return 0; - } - return Gia_ManAppendAnd( p, iLit0, iLit1 ); -} static inline int Gia_ManAppendXorReal( Gia_Man_t * p, int iLit0, int iLit1 ) { Gia_Obj_t * pObj = Gia_ManAppendObj( p ); @@ -780,6 +765,44 @@ static inline int Gia_ManAppendXor( Gia_Man_t * p, int iLit0, int iLit1 ) { return Gia_ManAppendMux( p, iLit0, Abc_LitNot(iLit1), iLit1 ); } + +static inline int Gia_ManAppendAnd2( Gia_Man_t * p, int iLit0, int iLit1 ) +{ + if ( !p->fGiaSimple ) + { + if ( iLit0 < 2 ) + return iLit0 ? iLit1 : 0; + if ( iLit1 < 2 ) + return iLit1 ? iLit0 : 0; + if ( iLit0 == iLit1 ) + return iLit1; + if ( iLit0 == Abc_LitNot(iLit1) ) + return 0; + } + return Gia_ManAppendAnd( p, iLit0, iLit1 ); +} +static inline int Gia_ManAppendOr2( Gia_Man_t * p, int iLit0, int iLit1 ) +{ + return Abc_LitNot(Gia_ManAppendAnd2( p, Abc_LitNot(iLit0), Abc_LitNot(iLit1) )); +} +static inline int Gia_ManAppendMux2( Gia_Man_t * p, int iCtrl, int iData1, int iData0 ) +{ + int iTemp0 = Gia_ManAppendAnd2( p, Abc_LitNot(iCtrl), iData0 ); + int iTemp1 = Gia_ManAppendAnd2( p, iCtrl, iData1 ); + return Abc_LitNotCond( Gia_ManAppendAnd2( p, Abc_LitNot(iTemp0), Abc_LitNot(iTemp1) ), 1 ); +} +static inline int Gia_ManAppendMaj2( Gia_Man_t * p, int iData0, int iData1, int iData2 ) +{ + int iTemp0 = Gia_ManAppendOr2( p, iData1, iData2 ); + int iTemp1 = Gia_ManAppendAnd2( p, iData0, iTemp0 ); + int iTemp2 = Gia_ManAppendAnd2( p, iData1, iData2 ); + return Gia_ManAppendOr2( p, iTemp1, iTemp2 ); +} +static inline int Gia_ManAppendXor2( Gia_Man_t * p, int iLit0, int iLit1 ) +{ + return Gia_ManAppendMux2( p, iLit0, Abc_LitNot(iLit1), iLit1 ); +} + static inline void Gia_ManPatchCoDriver( Gia_Man_t * p, int iCoIndex, int iLit0 ) { Gia_Obj_t * pObjCo = Gia_ManCo( p, iCoIndex ); @@ -1219,6 +1242,8 @@ extern Gia_Man_t * Gia_ManChoiceMiter( Vec_Ptr_t * vGias ); extern Gia_Man_t * Gia_ManDupWithConstraints( Gia_Man_t * p, Vec_Int_t * vPoTypes ); extern Gia_Man_t * Gia_ManDupCones( Gia_Man_t * p, int * pPos, int nPos, int fTrimPis ); extern Gia_Man_t * Gia_ManDupAndCones( Gia_Man_t * p, int * pAnds, int nAnds, int fTrimPis ); +extern Gia_Man_t * Gia_ManDupAndConesLimit( Gia_Man_t * p, int * pAnds, int nAnds, int Level ); +extern Gia_Man_t * Gia_ManDupAndConesLimit2( Gia_Man_t * p, int * pAnds, int nAnds, int Level ); extern Gia_Man_t * Gia_ManDupOneHot( Gia_Man_t * p ); extern Gia_Man_t * Gia_ManDupLevelized( Gia_Man_t * p ); extern Gia_Man_t * Gia_ManDupFromVecs( Gia_Man_t * p, Vec_Int_t * vCis, Vec_Int_t * vAnds, Vec_Int_t * vCos, int nRegs ); @@ -1247,6 +1272,7 @@ extern void Gia_ManOrigIdsInit( Gia_Man_t * p ); extern void Gia_ManOrigIdsStart( Gia_Man_t * p ); extern void Gia_ManOrigIdsRemap( Gia_Man_t * p, Gia_Man_t * pNew ); extern Gia_Man_t * Gia_ManOrigIdsReduce( Gia_Man_t * p, Vec_Int_t * vPairs ); +extern Gia_Man_t * Gia_ManComputeGiaEquivs( Gia_Man_t * pGia, int nConfs, int fVerbose ); extern void Gia_ManEquivFixOutputPairs( Gia_Man_t * p ); extern int Gia_ManCheckTopoOrder( Gia_Man_t * p ); extern int * Gia_ManDeriveNexts( Gia_Man_t * p ); @@ -1403,7 +1429,7 @@ extern Gia_Man_t * Gia_ManCleanupOutputs( Gia_Man_t * p, int nOutputs ); extern Gia_Man_t * Gia_ManSeqCleanup( Gia_Man_t * p ); extern Gia_Man_t * Gia_ManSeqStructSweep( Gia_Man_t * p, int fConst, int fEquiv, int fVerbose ); /*=== giaShow.c ===========================================================*/ -extern void Gia_ManShow( Gia_Man_t * pMan, Vec_Int_t * vBold, int fAdders ); +extern void Gia_ManShow( Gia_Man_t * pMan, Vec_Int_t * vBold, int fAdders, int fFadds, int fPath ); /*=== giaShrink.c ===========================================================*/ extern Gia_Man_t * Gia_ManMapShrink4( Gia_Man_t * p, int fKeepLevel, int fVerbose ); extern Gia_Man_t * Gia_ManMapShrink6( Gia_Man_t * p, int nFanoutMax, int fKeepLevel, int fVerbose ); @@ -1491,6 +1517,7 @@ extern int Gia_ManVerifyWithBoxes( Gia_Man_t * pGia, int nBTLimi extern word Gia_LutComputeTruth6( Gia_Man_t * p, int iObj, Vec_Wrd_t * vTruths ); extern word Gia_ObjComputeTruthTable6Lut( Gia_Man_t * p, int iObj, Vec_Wrd_t * vTemp ); extern word Gia_ObjComputeTruthTable6( Gia_Man_t * p, Gia_Obj_t * pObj, Vec_Int_t * vSupp, Vec_Wrd_t * vTruths ); +extern word Gia_ObjComputeTruth6Cis( Gia_Man_t * p, int iLit, Vec_Int_t * vSupp, Vec_Wrd_t * vTemp ); extern void Gia_ObjCollectInternal( Gia_Man_t * p, Gia_Obj_t * pObj ); extern word * Gia_ObjComputeTruthTable( Gia_Man_t * p, Gia_Obj_t * pObj ); extern void Gia_ObjComputeTruthTableStart( Gia_Man_t * p, int nVarsMax ); diff --git a/src/aig/gia/giaAig.c b/src/aig/gia/giaAig.c index 3cf01c70..dfd4a467 100644 --- a/src/aig/gia/giaAig.c +++ b/src/aig/gia/giaAig.c @@ -22,6 +22,7 @@ #include "proof/fra/fra.h" #include "proof/dch/dch.h" #include "opt/dar/dar.h" +#include "opt/dau/dau.h" ABC_NAMESPACE_IMPL_START @@ -576,11 +577,17 @@ Gia_Man_t * Gia_ManCompress2( Gia_Man_t * p, int fUpdateLevel, int fVerbose ) ***********************************************************************/ Gia_Man_t * Gia_ManPerformDch( Gia_Man_t * p, void * pPars ) { - Gia_Man_t * pGia; + int fUseMapping = 0; + Gia_Man_t * pGia, * pGia1; Aig_Man_t * pNew; if ( p->pManTime && p->vLevels == NULL ) Gia_ManLevelWithBoxes( p ); - pNew = Gia_ManToAig( p, 0 ); + if ( fUseMapping && Gia_ManHasMapping(p) ) + pGia1 = (Gia_Man_t *)Dsm_ManDeriveGia( p, 0 ); + else + pGia1 = Gia_ManDup( p ); + pNew = Gia_ManToAig( pGia1, 0 ); + Gia_ManStop( pGia1 ); pNew = Dar_ManChoiceNew( pNew, (Dch_Pars_t *)pPars ); // pGia = Gia_ManFromAig( pNew ); pGia = Gia_ManFromAigChoices( pNew ); diff --git a/src/aig/gia/giaDup.c b/src/aig/gia/giaDup.c index 7ced54a4..b0ba3472 100644 --- a/src/aig/gia/giaDup.c +++ b/src/aig/gia/giaDup.c @@ -3046,6 +3046,71 @@ Gia_Man_t * Gia_ManDupAndCones( Gia_Man_t * p, int * pAnds, int nAnds, int fTrim return pNew; } +void Gia_ManDupAndConesLimit_rec( Gia_Man_t * pNew, Gia_Man_t * p, int iObj, int Level ) +{ + Gia_Obj_t * pObj = Gia_ManObj(p, iObj); + if ( ~pObj->Value ) + return; + if ( !Gia_ObjIsAnd(pObj) || Gia_ObjLevel(p, pObj) < Level ) + { + pObj->Value = Gia_ManAppendCi( pNew ); + //printf( "PI %d for %d.\n", Abc_Lit2Var(pObj->Value), iObj ); + return; + } + Gia_ManDupAndConesLimit_rec( pNew, p, Gia_ObjFaninId0(pObj, iObj), Level ); + Gia_ManDupAndConesLimit_rec( pNew, p, Gia_ObjFaninId1(pObj, iObj), Level ); + pObj->Value = Gia_ManAppendAnd( pNew, Gia_ObjFanin0Copy(pObj), Gia_ObjFanin1Copy(pObj) ); + //printf( "Obj %d for %d.\n", Abc_Lit2Var(pObj->Value), iObj ); +} +Gia_Man_t * Gia_ManDupAndConesLimit( Gia_Man_t * p, int * pAnds, int nAnds, int Level ) +{ + Gia_Man_t * pNew; + int i; + pNew = Gia_ManStart( 1000 ); + pNew->pName = Abc_UtilStrsav( p->pName ); + pNew->pSpec = Abc_UtilStrsav( p->pSpec ); + Gia_ManLevelNum( p ); + Gia_ManFillValue( p ); + Gia_ManConst0(p)->Value = 0; + for ( i = 0; i < nAnds; i++ ) + Gia_ManDupAndConesLimit_rec( pNew, p, pAnds[i], Level ); + for ( i = 0; i < nAnds; i++ ) + Gia_ManAppendCo( pNew, Gia_ManObj(p, pAnds[i])->Value ); + return pNew; +} + +void Gia_ManDupAndConesLimit2_rec( Gia_Man_t * pNew, Gia_Man_t * p, int iObj, int Level ) +{ + Gia_Obj_t * pObj = Gia_ManObj(p, iObj); + if ( ~pObj->Value ) + return; + if ( !Gia_ObjIsAnd(pObj) || Level <= 0 ) + { + pObj->Value = Gia_ManAppendCi( pNew ); + //printf( "PI %d for %d.\n", Abc_Lit2Var(pObj->Value), iObj ); + return; + } + Gia_ManDupAndConesLimit2_rec( pNew, p, Gia_ObjFaninId0(pObj, iObj), Level-1 ); + Gia_ManDupAndConesLimit2_rec( pNew, p, Gia_ObjFaninId1(pObj, iObj), Level-1 ); + pObj->Value = Gia_ManAppendAnd( pNew, Gia_ObjFanin0Copy(pObj), Gia_ObjFanin1Copy(pObj) ); + //printf( "Obj %d for %d.\n", Abc_Lit2Var(pObj->Value), iObj ); +} +Gia_Man_t * Gia_ManDupAndConesLimit2( Gia_Man_t * p, int * pAnds, int nAnds, int Level ) +{ + Gia_Man_t * pNew; + int i; + pNew = Gia_ManStart( 1000 ); + pNew->pName = Abc_UtilStrsav( p->pName ); + pNew->pSpec = Abc_UtilStrsav( p->pSpec ); + Gia_ManFillValue( p ); + Gia_ManConst0(p)->Value = 0; + for ( i = 0; i < nAnds; i++ ) + Gia_ManDupAndConesLimit2_rec( pNew, p, pAnds[i], Level ); + for ( i = 0; i < nAnds; i++ ) + Gia_ManAppendCo( pNew, Gia_ManObj(p, pAnds[i])->Value ); + return pNew; + +} /**Function************************************************************* @@ -3377,6 +3442,26 @@ Gia_Man_t * Gia_ManDupOuts( Gia_Man_t * p ) SeeAlso [] ***********************************************************************/ +Vec_Wec_t * Gia_ManCreateNodeSupps( Gia_Man_t * p, Vec_Int_t * vNodes, int fVerbose ) +{ + abctime clk = Abc_Clock(); + Gia_Obj_t * pObj; int i, Id; + Vec_Wec_t * vSuppsNo = Vec_WecStart( Vec_IntSize(vNodes) ); + Vec_Wec_t * vSupps = Vec_WecStart( Gia_ManObjNum(p) ); + Gia_ManForEachCiId( p, Id, i ) + Vec_IntPush( Vec_WecEntry(vSupps, Id), i ); + Gia_ManForEachAnd( p, pObj, Id ) + Vec_IntTwoMerge2( Vec_WecEntry(vSupps, Gia_ObjFaninId0(pObj, Id)), + Vec_WecEntry(vSupps, Gia_ObjFaninId1(pObj, Id)), + Vec_WecEntry(vSupps, Id) ); + Gia_ManForEachObjVec( vNodes, p, pObj, i ) + Vec_IntAppend( Vec_WecEntry(vSuppsNo, i), Vec_WecEntry(vSupps, Gia_ObjId(p, pObj)) ); + Vec_WecFree( vSupps ); + if ( fVerbose ) + Abc_PrintTime( 1, "Support computation", Abc_Clock() - clk ); + return vSuppsNo; +} + Vec_Wec_t * Gia_ManCreateCoSupps( Gia_Man_t * p, int fVerbose ) { abctime clk = Abc_Clock(); @@ -3690,6 +3775,81 @@ Gia_Man_t * Gia_ManDupDemiter( Gia_Man_t * p, int fVerbose ) SeeAlso [] ***********************************************************************/ +void Gia_ManDupDemiterOrderXors2( Gia_Man_t * p, Vec_Int_t * vXors ) +{ + int i, iObj, * pPerm; + Vec_Int_t * vSizes = Vec_IntAlloc( 100 ); + Vec_IntForEachEntry( vXors, iObj, i ) + Vec_IntPush( vSizes, Gia_ManSuppSize(p, &iObj, 1) ); + pPerm = Abc_MergeSortCost( Vec_IntArray(vSizes), Vec_IntSize(vSizes) ); + Vec_IntClear( vSizes ); + for ( i = 0; i < Vec_IntSize(vXors); i++ ) + Vec_IntPush( vSizes, Vec_IntEntry(vXors, pPerm[i]) ); + ABC_FREE( pPerm ); + Vec_IntClear( vXors ); + Vec_IntAppend( vXors, vSizes ); + Vec_IntFree( vSizes ); +} +int Gia_ManDupDemiterFindMin( Vec_Wec_t * vSupps, Vec_Int_t * vTakenIns, Vec_Int_t * vTakenOuts ) +{ + Vec_Int_t * vLevel; + int i, k, iObj, iObjBest = -1; + int Count, CountBest = ABC_INFINITY; + Vec_WecForEachLevel( vSupps, vLevel, i ) + { + if ( Vec_IntEntry(vTakenOuts, i) ) + continue; + Count = 0; + Vec_IntForEachEntry( vLevel, iObj, k ) + Count += !Vec_IntEntry(vTakenIns, iObj); + if ( CountBest > Count ) + { + CountBest = Count; + iObjBest = i; + } + } + return iObjBest; +} +void Gia_ManDupDemiterOrderXors( Gia_Man_t * p, Vec_Int_t * vXors ) +{ + extern Vec_Wec_t * Gia_ManCreateNodeSupps( Gia_Man_t * p, Vec_Int_t * vNodes, int fVerbose ); + Vec_Wec_t * vSupps = Gia_ManCreateNodeSupps( p, vXors, 0 ); + Vec_Int_t * vTakenIns = Vec_IntStart( Gia_ManCiNum(p) ); + Vec_Int_t * vTakenOuts = Vec_IntStart( Vec_IntSize(vXors) ); + Vec_Int_t * vOrder = Vec_IntAlloc( Vec_IntSize(vXors) ); + int i, k, iObj; + // add outputs in the order of increasing supports + for ( i = 0; i < Vec_IntSize(vXors); i++ ) + { + int Index = Gia_ManDupDemiterFindMin( vSupps, vTakenIns, vTakenOuts ); + assert( Index >= 0 && Index < Vec_IntSize(vXors) ); + Vec_IntPush( vOrder, Vec_IntEntry(vXors, Index) ); + assert( !Vec_IntEntry( vTakenOuts, Index ) ); + Vec_IntWriteEntry( vTakenOuts, Index, 1 ); + Vec_IntForEachEntry( Vec_WecEntry(vSupps, Index), iObj, k ) + Vec_IntWriteEntry( vTakenIns, iObj, 1 ); + } + Vec_WecFree( vSupps ); + Vec_IntFree( vTakenIns ); + Vec_IntFree( vTakenOuts ); + // reload + Vec_IntClear( vXors ); + Vec_IntAppend( vXors, vOrder ); + Vec_IntFree( vOrder ); +} + + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ void Gia_ManSetMark0Dfs_rec( Gia_Man_t * p, int iObj ) { Gia_Obj_t * pObj; @@ -3781,27 +3941,26 @@ void Gia_ManCollectTopXors_rec( Gia_Man_t * p, Gia_Obj_t * pObj, Vec_Int_t * vXo } Vec_Int_t * Gia_ManCollectTopXors( Gia_Man_t * p ) { - int i, iObj, iObj2, fFlip, * pPerm, Count1 = 0; - Vec_Int_t * vXors, * vSizes, * vPart[2], * vOrder; + int i, iObj, iObj2, fFlip, Count1 = 0; + Vec_Int_t * vXors, * vPart[2], * vOrder; Gia_Obj_t * pFan[2], * pObj = Gia_ManCo(p, 0); - assert( Gia_ManCoNum(p) == 1 ); vXors = Vec_IntAlloc( 100 ); - if ( Gia_ObjFaninC0(pObj) ) - Gia_ManCollectTopXors_rec( p, Gia_ObjFanin0(pObj), vXors ); + if ( Gia_ManCoNum(p) == 1 ) + { + if ( Gia_ObjFaninC0(pObj) ) + Gia_ManCollectTopXors_rec( p, Gia_ObjFanin0(pObj), vXors ); + else + Vec_IntPush( vXors, Gia_ObjId(p, Gia_ObjFanin0(pObj)) ); + } else - Vec_IntPush( vXors, Gia_ObjId(p, Gia_ObjFanin0(pObj)) ); + { + Gia_ManForEachCo( p, pObj, i ) + if ( Gia_ObjFaninId0p(p, pObj) > 0 ) + Vec_IntPush( vXors, Gia_ObjFaninId0p(p, pObj) ); + } // order by support size - vSizes = Vec_IntAlloc( 100 ); - Vec_IntForEachEntry( vXors, iObj, i ) - Vec_IntPush( vSizes, Gia_ManSuppSize(p, &iObj, 1) ); - pPerm = Abc_MergeSortCost( Vec_IntArray(vSizes), Vec_IntSize(vSizes) ); - Vec_IntClear( vSizes ); - for ( i = 0; i < Vec_IntSize(vXors); i++ ) - Vec_IntPush( vSizes, Vec_IntEntry(vXors, pPerm[i]) ); - ABC_FREE( pPerm ); - Vec_IntClear( vXors ); - Vec_IntAppend( vXors, vSizes ); - Vec_IntFree( vSizes ); + Gia_ManDupDemiterOrderXors( p, vXors ); + //Vec_IntPrint( vXors ); Vec_IntReverseOrder( vXors ); // from MSB to LSB // divide into groups Gia_ManCleanMark01(p); diff --git a/src/aig/gia/giaEquiv.c b/src/aig/gia/giaEquiv.c index 584be4cd..1b0bce07 100644 --- a/src/aig/gia/giaEquiv.c +++ b/src/aig/gia/giaEquiv.c @@ -129,7 +129,7 @@ Gia_Man_t * Gia_ManOrigIdsReduce( Gia_Man_t * p, Vec_Int_t * vPairs ) } Gia_ManHashStop( pNew ); Gia_ManForEachCo( p, pObj, i ) - Gia_ManAppendCo( pNew, Gia_ObjFanin0Copy(pObj) ); + pObj->Value = Gia_ManAppendCo( pNew, Gia_ObjFanin0Copy(pObj) ); Vec_IntFree( vMap ); // compute equivalences assert( !p->pReprs && !p->pNexts ); @@ -171,6 +171,31 @@ Gia_Man_t * Gia_ManOrigIdsReduceTest( Gia_Man_t * p, Vec_Int_t * vPairs ) /**Function************************************************************* + Synopsis [Compute equivalence classes of nodes.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Gia_Man_t * Gia_ManComputeGiaEquivs( Gia_Man_t * pGia, int nConfs, int fVerbose ) +{ + Gia_Man_t * pTemp; + Cec_ParFra_t ParsFra, * pPars = &ParsFra; + Cec_ManFraSetDefaultParams( pPars ); + pPars->fUseOrigIds = 1; + pPars->fSatSweeping = 1; + pPars->nBTLimit = nConfs; + pPars->fVerbose = fVerbose; + pTemp = Cec_ManSatSweeping( pGia, pPars, 0 ); + Gia_ManStop( pTemp ); + return Gia_ManOrigIdsReduce( pGia, pGia->vIdsEquiv ); +} + +/**Function************************************************************* + Synopsis [Returns 1 if AIG is not in the required topo order.] Description [] diff --git a/src/aig/gia/giaIf.c b/src/aig/gia/giaIf.c index 26f549d0..ab80a762 100644 --- a/src/aig/gia/giaIf.c +++ b/src/aig/gia/giaIf.c @@ -539,33 +539,25 @@ void Gia_ManPrintMappingStats( Gia_Man_t * p, char * pDumpFile ) { sprintf( FileNameOld, "%s", p->pName ); fprintf( pTable, "\n" ); - fprintf( pTable, "%s ", p->pName ); -// fprintf( pTable, "%d ", Gia_ManCiNum(p) ); -// fprintf( pTable, "%d ", Gia_ManCoNum(p) ); -// fprintf( pTable, "%d ", Gia_ManAndNum(p) ); -// fprintf( pTable, "%d ", Gia_ManPiNum(p) - Gia_ManBoxCiNum(p) - Gia_ManRegBoxNum(p) ); -// fprintf( pTable, "%d ", Gia_ManPoNum(p) - Gia_ManBoxCoNum(p) - Gia_ManRegBoxNum(p) ); -// fprintf( pTable, "%d ", Gia_ManClockDomainNum(p) ); - + fprintf( pTable, "%s ", p->pName ); fprintf( pTable, " " ); - fprintf( pTable, "%d ", p->MappedDelay ); - fprintf( pTable, "%d ", p->MappedArea ); - fprintf( pTable, "%d ", nFanins ); - fprintf( pTable, "%d ", LevelMax ); + fprintf( pTable, "%d ", Gia_ManAndNum(p) ); fprintf( pTable, "%d ", nLuts ); -// fprintf( pTable, "%d ", Gia_ManRegBoxNum(p) ); -// fprintf( pTable, "%d ", Gia_ManNonRegBoxNum(p) ); + fprintf( pTable, "%d ", Gia_ManLutLevelWithBoxes(p) ); + //fprintf( pTable, "%d ", Gia_ManRegBoxNum(p) ); + //fprintf( pTable, "%d ", Gia_ManNonRegBoxNum(p) ); + //fprintf( pTable, "%.2f", 1.0*(Abc_Clock() - clk)/CLOCKS_PER_SEC ); clk = Abc_Clock(); } else { - printf( "This part of the code is currently not used.\n" ); - assert( 0 ); + //printf( "This part of the code is currently not used.\n" ); + //assert( 0 ); fprintf( pTable, " " ); fprintf( pTable, "%d ", nLuts ); - fprintf( pTable, "%d ", LevelMax ); - fprintf( pTable, "%d ", Gia_ManRegBoxNum(p) ); - fprintf( pTable, "%d ", Gia_ManNonRegBoxNum(p) ); + fprintf( pTable, "%d ", Gia_ManLutLevelWithBoxes(p) ); + //fprintf( pTable, "%d ", Gia_ManRegBoxNum(p) ); + //fprintf( pTable, "%d ", Gia_ManNonRegBoxNum(p) ); fprintf( pTable, "%.2f", 1.0*(Abc_Clock() - clk)/CLOCKS_PER_SEC ); clk = Abc_Clock(); } @@ -2014,7 +2006,7 @@ void Gia_ManMappingVerify( Gia_Man_t * p ) void Gia_ManTransferMapping( Gia_Man_t * p, Gia_Man_t * pGia ) { Gia_Obj_t * pObj; - int i, k, iFan; + int i, k, iFan, iPlace; if ( !Gia_ManHasMapping(pGia) ) return; Gia_ManMappingVerify( pGia ); @@ -2023,12 +2015,20 @@ void Gia_ManTransferMapping( Gia_Man_t * p, Gia_Man_t * pGia ) Vec_IntFill( p->vMapping, Gia_ManObjNum(p), 0 ); Gia_ManForEachLut( pGia, i ) { + if ( Gia_ObjValue(Gia_ManObj(pGia, i)) == ~0 ) // handle dangling LUT + continue; assert( !Abc_LitIsCompl(Gia_ObjValue(Gia_ManObj(pGia, i))) ); pObj = Gia_ManObj( p, Abc_Lit2Var(Gia_ObjValue(Gia_ManObj(pGia, i))) ); Vec_IntWriteEntry( p->vMapping, Gia_ObjId(p, pObj), Vec_IntSize(p->vMapping) ); + iPlace = Vec_IntSize( p->vMapping ); Vec_IntPush( p->vMapping, Gia_ObjLutSize(pGia, i) ); Gia_LutForEachFanin( pGia, i, iFan, k ) - Vec_IntPush( p->vMapping, Abc_Lit2Var(Gia_ObjValue(Gia_ManObj(pGia, iFan))) ); + { + if ( Gia_ObjValue(Gia_ManObj(pGia, iFan)) == ~0 ) // handle dangling LUT fanin + Vec_IntAddToEntry( p->vMapping, iPlace, -1 ); + else + Vec_IntPush( p->vMapping, Abc_Lit2Var(Gia_ObjValue(Gia_ManObj(pGia, iFan))) ); + } iFan = Abc_Lit2Var( Gia_ObjValue(Gia_ManObj(pGia, Abc_AbsInt(Gia_ObjLutMuxId(pGia, i)))) ); Vec_IntPush( p->vMapping, Gia_ObjLutIsMux(pGia, i) ? -iFan : iFan ); } diff --git a/src/aig/gia/giaJf.c b/src/aig/gia/giaJf.c index 93dac301..2d75581d 100644 --- a/src/aig/gia/giaJf.c +++ b/src/aig/gia/giaJf.c @@ -1256,10 +1256,10 @@ void Jf_ManComputeCuts( Jf_Man_t * p, int fEdge ) } if ( p->pPars->fVerbose ) { - printf( "CutPair = %lu ", p->CutCount[0] ); - printf( "Merge = %lu ", p->CutCount[1] ); - printf( "Eval = %lu ", p->CutCount[2] ); - printf( "Cut = %lu ", p->CutCount[3] ); + printf( "CutPair = %lu ", (long)p->CutCount[0] ); + printf( "Merge = %lu ", (long)p->CutCount[1] ); + printf( "Eval = %lu ", (long)p->CutCount[2] ); + printf( "Cut = %lu ", (long)p->CutCount[3] ); Abc_PrintTime( 1, "Time", Abc_Clock() - p->clkStart ); printf( "Memory: " ); printf( "Gia = %.2f MB ", Gia_ManMemory(p->pGia) / (1<<20) ); @@ -1702,11 +1702,11 @@ void Jf_ManPrintStats( Jf_Man_t * p, char * pTitle ) if ( !p->pPars->fVerbose ) return; printf( "%s : ", pTitle ); - printf( "Level =%6lu ", p->pPars->Delay ); - printf( "Area =%9lu ", p->pPars->Area ); - printf( "Edge =%9lu ", p->pPars->Edge ); + printf( "Level =%6lu ", (long)p->pPars->Delay ); + printf( "Area =%9lu ", (long)p->pPars->Area ); + printf( "Edge =%9lu ", (long)p->pPars->Edge ); if ( p->pPars->fGenCnf ) - printf( "Cnf =%9lu ", p->pPars->Clause ); + printf( "Cnf =%9lu ", (long)p->pPars->Clause ); Abc_PrintTime( 1, "Time", Abc_Clock() - p->clkStart ); fflush( stdout ); } diff --git a/src/aig/gia/giaKf.c b/src/aig/gia/giaKf.c index caa88bfc..a823f726 100644 --- a/src/aig/gia/giaKf.c +++ b/src/aig/gia/giaKf.c @@ -1125,9 +1125,9 @@ void Kf_ManPrintStats( Kf_Man_t * p, char * pTitle ) if ( !p->pPars->fVerbose ) return; printf( "%s : ", pTitle ); - printf( "Level =%6lu ", p->pPars->Delay ); - printf( "Area =%9lu ", p->pPars->Area ); - printf( "Edge =%9lu ", p->pPars->Edge ); + printf( "Level =%6lu ", (long)p->pPars->Delay ); + printf( "Area =%9lu ", (long)p->pPars->Area ); + printf( "Edge =%9lu ", (long)p->pPars->Edge ); Abc_PrintTime( 1, "Time", Abc_Clock() - p->clkStart ); fflush( stdout ); } @@ -1173,10 +1173,10 @@ void Kf_ManComputeMapping( Kf_Man_t * p ) Kf_ManComputeRefs( p ); if ( p->pPars->fVerbose ) { - printf( "CutPair = %lu ", p->pSett->CutCount[0] ); - printf( "Merge = %lu ", p->pSett->CutCount[1] ); - printf( "Eval = %lu ", p->pSett->CutCount[2] ); - printf( "Cut = %lu ", p->pSett->CutCount[3] ); + printf( "CutPair = %lu ", (long)p->pSett->CutCount[0] ); + printf( "Merge = %lu ", (long)p->pSett->CutCount[1] ); + printf( "Eval = %lu ", (long)p->pSett->CutCount[2] ); + printf( "Cut = %lu ", (long)p->pSett->CutCount[3] ); Abc_PrintTime( 1, "Time", Abc_Clock() - p->clkStart ); printf( "Memory: " ); printf( "Gia = %.2f MB ", Gia_ManMemory(p->pGia) / (1<<20) ); diff --git a/src/aig/gia/giaLf.c b/src/aig/gia/giaLf.c index 082b1928..7973966a 100644 --- a/src/aig/gia/giaLf.c +++ b/src/aig/gia/giaLf.c @@ -2012,14 +2012,14 @@ void Lf_ManPrintStats( Lf_Man_t * p, char * pTitle ) if ( !p->pPars->fVerbose ) return; printf( "%s : ", pTitle ); - printf( "Level =%6lu ", p->pPars->Delay ); - printf( "Area =%9lu ", p->pPars->Area ); - printf( "Edge =%9lu ", p->pPars->Edge ); - printf( "LUT =%9lu ", p->pPars->Area+p->nInverters ); + printf( "Level =%6lu ", (long)p->pPars->Delay ); + printf( "Area =%9lu ", (long)p->pPars->Area ); + printf( "Edge =%9lu ", (long)p->pPars->Edge ); + printf( "LUT =%9lu ", (long)p->pPars->Area+p->nInverters ); if ( Vec_FltSize(&p->vSwitches) ) printf( "Swt =%8.1f ", p->Switches ); if ( p->pPars->fUseMux7 ) - printf( "Mux7 =%7lu ", p->pPars->Mux7 ); + printf( "Mux7 =%7lu ", (long)p->pPars->Mux7 ); Abc_PrintTime( 1, "Time", Abc_Clock() - p->clkStart ); fflush( stdout ); } diff --git a/src/aig/gia/giaMf.c b/src/aig/gia/giaMf.c index 591f5bc5..2ded34bd 100644 --- a/src/aig/gia/giaMf.c +++ b/src/aig/gia/giaMf.c @@ -1415,11 +1415,11 @@ void Mf_ManPrintStats( Mf_Man_t * p, char * pTitle ) if ( !p->pPars->fVerbose ) return; printf( "%s : ", pTitle ); - printf( "Level =%6lu ", p->pPars->Delay ); - printf( "Area =%9lu ", p->pPars->Area ); - printf( "Edge =%9lu ", p->pPars->Edge ); + printf( "Level =%6lu ", (long)p->pPars->Delay ); + printf( "Area =%9lu ", (long)p->pPars->Area ); + printf( "Edge =%9lu ", (long)p->pPars->Edge ); if ( p->pPars->fGenCnf ) - printf( "CNF =%9lu ", p->pPars->Clause ); + printf( "CNF =%9lu ", (long)p->pPars->Clause ); Abc_PrintTime( 1, "Time", Abc_Clock() - p->clkStart ); fflush( stdout ); } diff --git a/src/aig/gia/giaMini.c b/src/aig/gia/giaMini.c index a886311f..4ee92cdd 100644 --- a/src/aig/gia/giaMini.c +++ b/src/aig/gia/giaMini.c @@ -21,6 +21,7 @@ #include "gia.h" #include "opt/dau/dau.h" #include "base/main/main.h" +#include "misc/util/utilTruth.h" #include "aig/miniaig/miniaig.h" #include "aig/miniaig/minilut.h" @@ -247,6 +248,34 @@ Gia_Man_t * Gia_ManFromMiniLut( Mini_Lut_t * p ) /**Function************************************************************* + Synopsis [Marks LUTs that should be complemented.] + + Description [These are LUTs whose all PO fanouts require them + in negative polarity. Other fanouts may require them in + positive polarity.] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Vec_Bit_t * Gia_ManFindComplLuts( Gia_Man_t * pGia ) +{ + Gia_Obj_t * pObj; int i; + // mark objects pointed by COs in negative polarity + Vec_Bit_t * vMarks = Vec_BitStart( Gia_ManObjNum(pGia) ); + Gia_ManForEachCo( pGia, pObj, i ) + if ( Gia_ObjIsAnd(Gia_ObjFanin0(pObj)) && Gia_ObjFaninC0(pObj) ) + Vec_BitWriteEntry( vMarks, Gia_ObjFaninId0p(pGia, pObj), 1 ); + // unmark objects pointed by COs in positive polarity + Gia_ManForEachCo( pGia, pObj, i ) + if ( Gia_ObjIsAnd(Gia_ObjFanin0(pObj)) && !Gia_ObjFaninC0(pObj) ) + Vec_BitWriteEntry( vMarks, Gia_ObjFaninId0p(pGia, pObj), 0 ); + return vMarks; +} + +/**Function************************************************************* + Synopsis [Converts GIA into MiniLUT.] Description [] @@ -260,8 +289,9 @@ Mini_Lut_t * Gia_ManToMiniLut( Gia_Man_t * pGia ) { Mini_Lut_t * p; Vec_Wrd_t * vTruths; + Vec_Bit_t * vMarks; Gia_Obj_t * pObj, * pFanin; - int i, k, LutSize, pVars[16]; + int i, k, iFanin, LutSize, pVars[16]; word Truth; assert( Gia_ManHasMapping(pGia) ); LutSize = Gia_ManLutSizeMax( pGia ); @@ -274,12 +304,17 @@ Mini_Lut_t * Gia_ManToMiniLut( Gia_Man_t * pGia ) pObj->Value = Mini_LutCreatePi(p); // create internal nodes vTruths = Vec_WrdStart( Gia_ManObjNum(pGia) ); + vMarks = Gia_ManFindComplLuts( pGia ); Gia_ManForEachLut( pGia, i ) { pObj = Gia_ManObj( pGia, i ); Gia_LutForEachFaninObj( pGia, i, pFanin, k ) pVars[k] = pFanin->Value; Truth = Gia_LutComputeTruth6( pGia, i, vTruths ); + Truth = Vec_BitEntry(vMarks, i) ? ~Truth : Truth; + Gia_LutForEachFanin( pGia, i, iFanin, k ) + if ( Vec_BitEntry(vMarks, iFanin) ) + Truth = Abc_Tt6Flip( Truth, k ); pObj->Value = Mini_LutCreateNode( p, Gia_ObjLutSize(pGia, i), pVars, (unsigned *)&Truth ); } Vec_WrdFree( vTruths ); @@ -288,7 +323,7 @@ Mini_Lut_t * Gia_ManToMiniLut( Gia_Man_t * pGia ) { if ( Gia_ObjFanin0(pObj) == Gia_ManConst0(pGia) ) pObj->Value = Mini_LutCreatePo( p, Gia_ObjFaninC0(pObj) ); - else if ( !Gia_ObjFaninC0(pObj) ) + else if ( Gia_ObjFaninC0(pObj) == Vec_BitEntry(vMarks, Gia_ObjFaninId0p(pGia, pObj)) ) pObj->Value = Mini_LutCreatePo( p, Gia_ObjFanin0(pObj)->Value ); else // add inverter LUT { @@ -298,6 +333,7 @@ Mini_Lut_t * Gia_ManToMiniLut( Gia_Man_t * pGia ) pObj->Value = Mini_LutCreatePo( p, LutInv ); } } + Vec_BitFree( vMarks ); // set registers Mini_LutSetRegNum( p, Gia_ManRegNum(pGia) ); //Mini_LutPrintStats( p ); diff --git a/src/aig/gia/giaShow.c b/src/aig/gia/giaShow.c index afc58bf8..4deebd7a 100644 --- a/src/aig/gia/giaShow.c +++ b/src/aig/gia/giaShow.c @@ -21,6 +21,7 @@ #include "gia.h" #include "proof/cec/cec.h" #include "proof/acec/acec.h" +#include "misc/extra/extra.h" ABC_NAMESPACE_IMPL_START @@ -29,6 +30,8 @@ ABC_NAMESPACE_IMPL_START /// DECLARATIONS /// //////////////////////////////////////////////////////////////////////// +#define NODE_MAX 2000 + //////////////////////////////////////////////////////////////////////// /// FUNCTION DEFINITIONS /// //////////////////////////////////////////////////////////////////////// @@ -45,6 +48,294 @@ ABC_NAMESPACE_IMPL_START SeeAlso [] ***********************************************************************/ +void Gia_ShowPath( Gia_Man_t * p, char * pFileName ) +{ + FILE * pFile; + Gia_Obj_t * pNode; + Vec_Bit_t * vPath = Vec_BitStart( Gia_ManObjNum(p) ); + int i, k, iFan, LevelMax, nLevels, * pLevels, Level, Prev; + int nLuts = 0, nNodes = 0, nEdges = 0; + assert( Gia_ManHasMapping(p) ); + + // set critical CO drivers + nLevels = Gia_ManLutLevel( p, &pLevels ); + Gia_ManForEachCoDriverId( p, iFan, i ) + if ( pLevels[iFan] == nLevels ) + Vec_BitWriteEntry( vPath, iFan, 1 ); + + // set critical internal nodes + Gia_ManForEachLutReverse( p, i ) + { + nLuts++; + if ( !Vec_BitEntry(vPath, i) ) + continue; + nNodes++; + Gia_LutForEachFanin( p, i, iFan, k ) + { + if ( pLevels[iFan] +1 < pLevels[i] ) + continue; + assert( pLevels[iFan] + 1 == pLevels[i] ); + Vec_BitWriteEntry( vPath, iFan, 1 ); + nEdges++; + //printf( "%d -> %d\n", i, iFan ); + } + } + + if ( nNodes > NODE_MAX ) + { + ABC_FREE( pLevels ); + Vec_BitFree( vPath ); + fprintf( stdout, "Cannot visualize AIG with more than %d critical nodes.\n", NODE_MAX ); + return; + } + if ( (pFile = fopen( pFileName, "w" )) == NULL ) + { + ABC_FREE( pLevels ); + Vec_BitFree( vPath ); + fprintf( stdout, "Cannot open the intermediate file \"%s\".\n", pFileName ); + return; + } + + Vec_IntFreeP( &p->vLevels ); + p->vLevels = Vec_IntAllocArray( pLevels, Gia_ManObjNum(p) ); + + // compute CO levels + LevelMax = 1 + nLevels; + Gia_ManForEachCo( p, pNode, i ) + Vec_IntWriteEntry( p->vLevels, Gia_ObjId(p, pNode), LevelMax ); + + // write the DOT header + fprintf( pFile, "# %s\n", "AIG structure generated by GIA package" ); + fprintf( pFile, "\n" ); + fprintf( pFile, "digraph AIG {\n" ); + fprintf( pFile, "size = \"7.5,10\";\n" ); +// fprintf( pFile, "ranksep = 0.5;\n" ); +// fprintf( pFile, "nodesep = 0.5;\n" ); + fprintf( pFile, "center = true;\n" ); +// fprintf( pFile, "orientation = landscape;\n" ); +// fprintf( pFile, "edge [fontsize = 10];\n" ); +// fprintf( pFile, "edge [dir = none];\n" ); + fprintf( pFile, "edge [dir = back];\n" ); + fprintf( pFile, "\n" ); + + // labels on the left of the picture + fprintf( pFile, "{\n" ); + fprintf( pFile, " node [shape = plaintext];\n" ); + fprintf( pFile, " edge [style = invis];\n" ); + fprintf( pFile, " LevelTitle1 [label=\"\"];\n" ); + fprintf( pFile, " LevelTitle2 [label=\"\"];\n" ); + // generate node names with labels + for ( Level = LevelMax; Level >= 0; Level-- ) + { + // the visible node name + fprintf( pFile, " Level%d", Level ); + fprintf( pFile, " [label = " ); + // label name + fprintf( pFile, "\"" ); + fprintf( pFile, "\"" ); + fprintf( pFile, "];\n" ); + } + + // genetate the sequence of visible/invisible nodes to mark levels + fprintf( pFile, " LevelTitle1 -> LevelTitle2 ->" ); + for ( Level = LevelMax; Level >= 0; Level-- ) + { + // the visible node name + fprintf( pFile, " Level%d", Level ); + // the connector + if ( Level != 0 ) + fprintf( pFile, " ->" ); + else + fprintf( pFile, ";" ); + } + fprintf( pFile, "\n" ); + fprintf( pFile, "}" ); + fprintf( pFile, "\n" ); + fprintf( pFile, "\n" ); + + // generate title box on top + fprintf( pFile, "{\n" ); + fprintf( pFile, " rank = same;\n" ); + fprintf( pFile, " LevelTitle1;\n" ); + fprintf( pFile, " title1 [shape=plaintext,\n" ); + fprintf( pFile, " fontsize=20,\n" ); + fprintf( pFile, " fontname = \"Times-Roman\",\n" ); + fprintf( pFile, " label=\"" ); + fprintf( pFile, "%s", "AIG structure visualized by ABC" ); + fprintf( pFile, "\\n" ); + fprintf( pFile, "Benchmark \\\"%s\\\". ", "aig" ); +// fprintf( pFile, "Time was %s. ", Extra_TimeStamp() ); + fprintf( pFile, "\"\n" ); + fprintf( pFile, " ];\n" ); + fprintf( pFile, "}" ); + fprintf( pFile, "\n" ); + fprintf( pFile, "\n" ); + + // generate statistics box + fprintf( pFile, "{\n" ); + fprintf( pFile, " rank = same;\n" ); + fprintf( pFile, " LevelTitle2;\n" ); + fprintf( pFile, " title2 [shape=plaintext,\n" ); + fprintf( pFile, " fontsize=18,\n" ); + fprintf( pFile, " fontname = \"Times-Roman\",\n" ); + fprintf( pFile, " label=\"" ); + fprintf( pFile, "The critical path contains %d LUTs with %d critical edges and spans %d levels.", nNodes, nEdges, nLevels ); + fprintf( pFile, "\\n" ); + fprintf( pFile, "\"\n" ); + fprintf( pFile, " ];\n" ); + fprintf( pFile, "}" ); + fprintf( pFile, "\n" ); + fprintf( pFile, "\n" ); + + // generate the COs + fprintf( pFile, "{\n" ); + fprintf( pFile, " rank = same;\n" ); + // the labeling node of this level + fprintf( pFile, " Level%d;\n", LevelMax ); + // generate the CO nodes + Gia_ManForEachCo( p, pNode, i ) + { + if ( Gia_ObjLevel(p, Gia_ObjFanin0(pNode)) < nLevels ) + continue; + assert( Gia_ObjLevel(p, Gia_ObjFanin0(pNode)) == nLevels ); + fprintf( pFile, " Node%d [label = \"%d\"", Gia_ObjId(p, pNode), Gia_ObjId(p, pNode) ); + fprintf( pFile, ", shape = %s", "invtriangle" ); + fprintf( pFile, ", color = coral, fillcolor = coral" ); + fprintf( pFile, "];\n" ); + } + fprintf( pFile, "}" ); + fprintf( pFile, "\n" ); + fprintf( pFile, "\n" ); + + // generate nodes of each rank + for ( Level = LevelMax - 1; Level > 0; Level-- ) + { + fprintf( pFile, "{\n" ); + fprintf( pFile, " rank = same;\n" ); + // the labeling node of this level + fprintf( pFile, " Level%d;\n", Level ); + Gia_ManForEachObj( p, pNode, i ) + { + if ( (int)Gia_ObjLevel(p, pNode) != Level || !Vec_BitEntry(vPath, i) ) + continue; + fprintf( pFile, " Node%d [label = \"%d:%d\"", i, i, Gia_ObjIsAnd(pNode)? Gia_ObjLutSize(p, i) : 0 ); + fprintf( pFile, ", shape = ellipse" ); + if ( pNode->fMark0 ) + fprintf( pFile, ", style = filled" ); + fprintf( pFile, "];\n" ); + } + fprintf( pFile, "}" ); + fprintf( pFile, "\n" ); + fprintf( pFile, "\n" ); + } + + // generate the CI nodes + fprintf( pFile, "{\n" ); + fprintf( pFile, " rank = same;\n" ); + // the labeling node of this level + fprintf( pFile, " Level%d;\n", 0 ); + // generate the CI nodes + Gia_ManForEachCi( p, pNode, i ) + { + if ( !Vec_BitEntry(vPath, Gia_ObjId(p, pNode)) ) + continue; + fprintf( pFile, " Node%d [label = \"%d\"", Gia_ObjId(p, pNode), Gia_ObjId(p, pNode) ); + fprintf( pFile, ", shape = %s", "triangle" ); + fprintf( pFile, ", color = coral, fillcolor = coral" ); + fprintf( pFile, "];\n" ); + } + fprintf( pFile, "}" ); + fprintf( pFile, "\n" ); + fprintf( pFile, "\n" ); + + // generate invisible edges from the square down + fprintf( pFile, "title1 -> title2 [style = invis];\n" ); + Gia_ManForEachCo( p, pNode, i ) + { + if ( Gia_ObjLevel(p, Gia_ObjFanin0(pNode)) < nLevels ) + continue; + fprintf( pFile, "title2 -> Node%d [style = invis];\n", Gia_ObjId(p, pNode) ); + } + // generate invisible edges among the COs + Prev = -1; + Gia_ManForEachCo( p, pNode, i ) + { + if ( Gia_ObjLevel(p, Gia_ObjFanin0(pNode)) < nLevels ) + continue; + assert( Gia_ObjLevel(p, Gia_ObjFanin0(pNode)) == nLevels ); + if ( Prev >= 0 ) + fprintf( pFile, "Node%d -> Node%d [style = invis];\n", Prev, Gia_ObjId(p, pNode) ); + Prev = Gia_ObjId(p, pNode); + } + // generate invisible edges among the CIs + Prev = -1; + Gia_ManForEachCi( p, pNode, i ) + { + if ( !Vec_BitEntry(vPath, Gia_ObjId(p, pNode)) ) + continue; + if ( Prev >= 0 ) + fprintf( pFile, "Node%d -> Node%d [style = invis];\n", Prev, Gia_ObjId(p, pNode) ); + Prev = Gia_ObjId(p, pNode); + } + + // generate edges + Gia_ManForEachObj( p, pNode, i ) + { + if ( Gia_ObjIsCo(pNode) ) + { + if ( Gia_ObjLevel(p, Gia_ObjFanin0(pNode)) == nLevels ) + { + // generate the edge from this node to the next + fprintf( pFile, "Node%d", i ); + fprintf( pFile, " -> " ); + fprintf( pFile, "Node%d", Gia_ObjFaninId0p(p, pNode) ); + fprintf( pFile, " [" ); + fprintf( pFile, "style = %s", "bold" ); + fprintf( pFile, "]" ); + fprintf( pFile, ";\n" ); + } + continue; + } + if ( !Gia_ObjIsAnd(pNode) || !Vec_BitEntry(vPath, i) ) + continue; + Gia_LutForEachFanin( p, i, iFan, k ) + { + if ( pLevels[iFan] + 1 < pLevels[i] ) + continue; + assert( pLevels[iFan] + 1 == pLevels[i] ); + // generate the edge from this node to the next + fprintf( pFile, "Node%d", i ); + fprintf( pFile, " -> " ); + fprintf( pFile, "Node%d", iFan ); + fprintf( pFile, " [" ); + fprintf( pFile, "style = %s", "bold" ); + fprintf( pFile, "]" ); + fprintf( pFile, ";\n" ); + } + } + + fprintf( pFile, "}" ); + fprintf( pFile, "\n" ); + fprintf( pFile, "\n" ); + fclose( pFile ); + + Vec_IntFreeP( &p->vLevels ); + Vec_BitFree( vPath ); +} + + +/**Function************************************************************* + + Synopsis [Writes the graph structure of AIG for DOT.] + + Description [Useful for graph visualization using tools such as GraphViz: + http://www.graphviz.org/] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ void Gia_WriteDotAigSimple( Gia_Man_t * p, char * pFileName, Vec_Int_t * vBold ) { FILE * pFile; @@ -52,9 +343,9 @@ void Gia_WriteDotAigSimple( Gia_Man_t * p, char * pFileName, Vec_Int_t * vBold ) int LevelMax, Prev, Level, i; int fConstIsUsed = 0; - if ( Gia_ManAndNum(p) > 500 ) + if ( Gia_ManAndNum(p) > NODE_MAX ) { - fprintf( stdout, "Cannot visualize AIG with more than 500 nodes.\n" ); + fprintf( stdout, "Cannot visualize AIG with more than %d nodes.\n", NODE_MAX ); return; } if ( (pFile = fopen( pFileName, "w" )) == NULL ) @@ -78,7 +369,7 @@ void Gia_WriteDotAigSimple( Gia_Man_t * p, char * pFileName, Vec_Int_t * vBold ) Vec_IntWriteEntry( p->vLevels, Gia_ObjId(p, pNode), LevelMax ); // write the DOT header - fprintf( pFile, "# %s\n", "AIG structure generated by IVY package" ); + fprintf( pFile, "# %s\n", "AIG structure generated by GIA package" ); fprintf( pFile, "\n" ); fprintf( pFile, "digraph AIG {\n" ); fprintf( pFile, "size = \"7.5,10\";\n" ); @@ -152,7 +443,7 @@ void Gia_WriteDotAigSimple( Gia_Man_t * p, char * pFileName, Vec_Int_t * vBold ) fprintf( pFile, " fontsize=18,\n" ); fprintf( pFile, " fontname = \"Times-Roman\",\n" ); fprintf( pFile, " label=\"" ); - fprintf( pFile, "The set contains %d logic nodes and spans %d levels.", Gia_ManAndNum(p), LevelMax ); + fprintf( pFile, "The AIG contains %d nodes and spans %d levels.", Gia_ManAndNum(p), LevelMax-1 ); fprintf( pFile, "\\n" ); fprintf( pFile, "\"\n" ); fprintf( pFile, " ];\n" ); @@ -381,16 +672,17 @@ int Gia_ShowAddOut( Vec_Int_t * vAdds, Vec_Int_t * vMapAdds, int Node ) return Vec_IntEntry( vAdds, 6*iBox+4 ); return Node; } -void Gia_WriteDotAig( Gia_Man_t * p, char * pFileName, Vec_Int_t * vAdds, Vec_Int_t * vXors, Vec_Int_t * vMapAdds, Vec_Int_t * vMapXors, Vec_Int_t * vOrder ) +void Gia_WriteDotAig( Gia_Man_t * p, char * pFileName, Vec_Int_t * vBold, Vec_Int_t * vAdds, Vec_Int_t * vXors, Vec_Int_t * vMapAdds, Vec_Int_t * vMapXors, Vec_Int_t * vOrder ) { FILE * pFile; Gia_Obj_t * pNode;//, * pTemp, * pPrev; int LevelMax, Prev, Level, i; int fConstIsUsed = 0; + int nFadds = Ree_ManCountFadds( vAdds ); - if ( Gia_ManAndNum(p) > 1000 ) + if ( Gia_ManAndNum(p) > NODE_MAX ) { - fprintf( stdout, "Cannot visualize AIG with more than 1000 nodes.\n" ); + fprintf( stdout, "Cannot visualize AIG with more than %d nodes.\n", NODE_MAX ); return; } if ( (pFile = fopen( pFileName, "w" )) == NULL ) @@ -399,13 +691,18 @@ void Gia_WriteDotAig( Gia_Man_t * p, char * pFileName, Vec_Int_t * vAdds, Vec_In return; } + // mark the nodes + if ( vBold ) + Gia_ManForEachObjVec( vBold, p, pNode, i ) + pNode->fMark0 = 1; + // compute levels LevelMax = 1 + p->nLevels; Gia_ManForEachCo( p, pNode, i ) Vec_IntWriteEntry( p->vLevels, Gia_ObjId(p, pNode), LevelMax ); // write the DOT header - fprintf( pFile, "# %s\n", "AIG structure generated by IVY package" ); + fprintf( pFile, "# %s\n", "AIG structure generated by GIA package" ); fprintf( pFile, "\n" ); fprintf( pFile, "digraph AIG {\n" ); fprintf( pFile, "size = \"7.5,10\";\n" ); @@ -479,7 +776,8 @@ void Gia_WriteDotAig( Gia_Man_t * p, char * pFileName, Vec_Int_t * vAdds, Vec_In fprintf( pFile, " fontsize=18,\n" ); fprintf( pFile, " fontname = \"Times-Roman\",\n" ); fprintf( pFile, " label=\"" ); - fprintf( pFile, "The set contains %d logic nodes and spans %d levels.", Gia_ManAndNum(p), LevelMax ); + fprintf( pFile, "The AIG contains %d nodes, %d full-adders, and %d half-adders, and spans %d levels.", + Gia_ManAndNum(p), nFadds, Vec_IntSize(vAdds)/6-nFadds, LevelMax-1 ); fprintf( pFile, "\\n" ); fprintf( pFile, "\"\n" ); fprintf( pFile, " ];\n" ); @@ -528,7 +826,7 @@ void Gia_WriteDotAig( Gia_Man_t * p, char * pFileName, Vec_Int_t * vAdds, Vec_In else fprintf( pFile, ", shape = ellipse" ); */ - if ( Vec_IntEntry(vMapAdds, iNode) >= 0 ) + if ( !pNode->fMark0 && Vec_IntEntry(vMapAdds, iNode) >= 0 ) { int iBox = Vec_IntEntry(vMapAdds, iNode); fprintf( pFile, " Node%d [label = \"%d_%d\"", Gia_ShowAddOut(vAdds, vMapAdds, iNode), Vec_IntEntry(vAdds, 6*iBox+3), Vec_IntEntry(vAdds, 6*iBox+4) ); @@ -557,8 +855,8 @@ void Gia_WriteDotAig( Gia_Man_t * p, char * pFileName, Vec_Int_t * vAdds, Vec_In fprintf( pFile, " Node%d [label = \"%d\"", iNode, iNode ); fprintf( pFile, ", shape = ellipse" ); } -// if ( pNode->fMark0 ) -// fprintf( pFile, ", style = filled" ); + if ( pNode->fMark0 ) + fprintf( pFile, ", style = filled" ); fprintf( pFile, "];\n" ); } fprintf( pFile, "}" ); @@ -629,8 +927,6 @@ void Gia_WriteDotAig( Gia_Man_t * p, char * pFileName, Vec_Int_t * vAdds, Vec_In Gia_ManForEachObjVec( vOrder, p, pNode, i ) { int iNode = Gia_ObjId( p, pNode ); -// if ( !Gia_ObjIsAnd(pNode) && !Gia_ObjIsCo(pNode) && !Gia_ObjIsBuf(pNode) ) -// continue; if ( Vec_IntEntry(vMapAdds, Gia_ObjId(p, pNode)) >= 0 ) { int k, iBox = Vec_IntEntry(vMapAdds, iNode); @@ -699,6 +995,11 @@ void Gia_WriteDotAig( Gia_Man_t * p, char * pFileName, Vec_Int_t * vAdds, Vec_In fprintf( pFile, "\n" ); fclose( pFile ); + // unmark nodes + if ( vBold ) + Gia_ManForEachObjVec( vBold, p, pNode, i ) + pNode->fMark0 = 0; + Vec_IntFreeP( &p->vLevels ); } @@ -713,14 +1014,23 @@ void Gia_WriteDotAig( Gia_Man_t * p, char * pFileName, Vec_Int_t * vAdds, Vec_In SeeAlso [] ***********************************************************************/ -Vec_Int_t * Gia_ShowMapAdds( Gia_Man_t * p, Vec_Int_t * vAdds ) +Vec_Int_t * Gia_ShowMapAdds( Gia_Man_t * p, Vec_Int_t * vAdds, int fFadds, Vec_Int_t * vBold ) { - Vec_Int_t * vMapAdds = Vec_IntStartFull( Gia_ManObjNum(p) ); int i; + Vec_Bit_t * vIsBold = Vec_BitStart( Gia_ManObjNum(p) ); + Vec_Int_t * vMapAdds = Vec_IntStartFull( Gia_ManObjNum(p) ); int i, Entry; + if ( vBold ) + Vec_IntForEachEntry( vBold, Entry, i ) + Vec_BitWriteEntry( vIsBold, Entry, 1 ); for ( i = 0; 6*i < Vec_IntSize(vAdds); i++ ) { + if ( fFadds && Vec_IntEntry(vAdds, 6*i+2) == 0 ) + continue; + if ( Vec_BitEntry(vIsBold, Vec_IntEntry(vAdds, 6*i+3)) || Vec_BitEntry(vIsBold, Vec_IntEntry(vAdds, 6*i+4)) ) + continue; Vec_IntWriteEntry( vMapAdds, Vec_IntEntry(vAdds, 6*i+3), i ); Vec_IntWriteEntry( vMapAdds, Vec_IntEntry(vAdds, 6*i+4), i ); } + Vec_BitFree( vIsBold ); return vMapAdds; } Vec_Int_t * Gia_ShowMapXors( Gia_Man_t * p, Vec_Int_t * vXors ) @@ -800,34 +1110,23 @@ Vec_Int_t * Gia_ShowCollectObjs( Gia_Man_t * p, Vec_Int_t * vAdds, Vec_Int_t * v SeeAlso [] ***********************************************************************/ -void Gia_ShowProcess( Gia_Man_t * p, char * pFileName, Vec_Int_t * vAdds, Vec_Int_t * vXors ) +void Gia_ShowProcess( Gia_Man_t * p, char * pFileName, Vec_Int_t * vBold, Vec_Int_t * vAdds, Vec_Int_t * vXors, int fFadds ) { - Vec_Int_t * vMapAdds = Gia_ShowMapAdds( p, vAdds ); + Vec_Int_t * vMapAdds = Gia_ShowMapAdds( p, vAdds, fFadds, vBold ); Vec_Int_t * vMapXors = Gia_ShowMapXors( p, vXors ); Vec_Int_t * vOrder = Gia_ShowCollectObjs( p, vAdds, vXors, vMapAdds, vMapXors ); - Gia_WriteDotAig( p, pFileName, vAdds, vXors, vMapAdds, vMapXors, vOrder ); + Gia_WriteDotAig( p, pFileName, vBold, vAdds, vXors, vMapAdds, vMapXors, vOrder ); Vec_IntFree( vMapAdds ); Vec_IntFree( vMapXors ); Vec_IntFree( vOrder ); } -void Gia_ManShow( Gia_Man_t * pMan, Vec_Int_t * vBold, int fAdders ) +void Gia_ManShow( Gia_Man_t * pMan, Vec_Int_t * vBold, int fAdders, int fFadds, int fPath ) { - extern Vec_Int_t * Ree_ManComputeCuts( Gia_Man_t * p, Vec_Int_t ** pvXors, int fVerbose ); - extern void Ree_ManRemoveTrivial( Gia_Man_t * p, Vec_Int_t * vAdds ); - extern void Ree_ManRemoveContained( Gia_Man_t * p, Vec_Int_t * vAdds ); - extern void Abc_ShowFile( char * FileNameDot ); - static int Counter = 0; char FileNameDot[200]; FILE * pFile; - - Vec_Int_t * vXors, * vAdds = Ree_ManComputeCuts( pMan, &vXors, 0 ); - Ree_ManRemoveTrivial( pMan, vAdds ); - Ree_ManRemoveContained( pMan, vAdds ); - - // create the file name -// Gia_ShowGetFileName( pMan->pName, FileNameDot ); - sprintf( FileNameDot, "temp%02d.dot", Counter++ ); + Vec_Int_t * vXors = NULL, * vAdds = fAdders ? Ree_ManComputeCuts( pMan, &vXors, 0 ) : NULL; + sprintf( FileNameDot, "%s", Extra_FileNameGenericAppend(pMan->pName, ".dot") ); // check that the file can be opened if ( (pFile = fopen( FileNameDot, "w" )) == NULL ) { @@ -836,15 +1135,17 @@ void Gia_ManShow( Gia_Man_t * pMan, Vec_Int_t * vBold, int fAdders ) } fclose( pFile ); // generate the file - if ( fAdders ) - Gia_ShowProcess( pMan, FileNameDot, vAdds, vXors ); + if ( fPath ) + Gia_ShowPath( pMan, FileNameDot ); + else if ( fAdders ) + Gia_ShowProcess( pMan, FileNameDot, vBold, vAdds, vXors, fFadds ); else Gia_WriteDotAigSimple( pMan, FileNameDot, vBold ); // visualize the file Abc_ShowFile( FileNameDot ); - Vec_IntFree( vAdds ); - Vec_IntFree( vXors ); + Vec_IntFreeP( &vAdds ); + Vec_IntFreeP( &vXors ); } diff --git a/src/aig/gia/giaTim.c b/src/aig/gia/giaTim.c index 71b9a475..29aa93f8 100644 --- a/src/aig/gia/giaTim.c +++ b/src/aig/gia/giaTim.c @@ -584,6 +584,8 @@ int Gia_ManLutLevelWithBoxes( Gia_Man_t * p ) Gia_Obj_t * pObj, * pObjIn; int i, k, j, curCi, curCo, LevelMax; assert( Gia_ManRegNum(p) == 0 ); + if ( pManTime == NULL ) + return Gia_ManLutLevel(p, NULL); // copy const and real PIs Gia_ManCleanLevels( p, Gia_ManObjNum(p) ); Gia_ObjSetLevel( p, Gia_ManConst0(p), 0 ); diff --git a/src/aig/gia/giaTruth.c b/src/aig/gia/giaTruth.c index ce06fa0b..ab5f569e 100644 --- a/src/aig/gia/giaTruth.c +++ b/src/aig/gia/giaTruth.c @@ -139,6 +139,59 @@ word Gia_ObjComputeTruthTable6Lut( Gia_Man_t * p, int iObj, Vec_Wrd_t * vTemp ) /**Function************************************************************* + Synopsis [Computes truth table up to 6 inputs in terms of CIs.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +word Gia_ObjComputeTruth6( Gia_Man_t * p, int iObj, Vec_Int_t * vSupp, Vec_Wrd_t * vTemp ) +{ + int i, Fanin; + assert( Vec_WrdSize(vTemp) == Gia_ManObjNum(p) ); + assert( Vec_IntSize(vSupp) <= 6 ); + Gia_ManIncrementTravId( p ); + Vec_IntForEachEntry( vSupp, Fanin, i ) + { + Gia_ObjSetTravIdCurrentId( p, Fanin ); + Vec_WrdWriteEntry( vTemp, Fanin, s_Truth6[i] ); + } + Gia_ObjComputeTruthTable6Lut_rec( p, iObj, vTemp ); + return Vec_WrdEntry( vTemp, iObj ); +} +void Gia_ObjComputeTruth6CisSupport_rec( Gia_Man_t * p, int iObj, Vec_Int_t * vSupp ) +{ + Gia_Obj_t * pObj = Gia_ManObj( p, iObj ); + if ( Gia_ObjIsTravIdCurrentId(p, iObj) ) + return; + Gia_ObjSetTravIdCurrentId(p, iObj); + if ( Gia_ObjIsCi(pObj) ) + { + Vec_IntPushOrder( vSupp, iObj ); + return; + } + assert( Gia_ObjIsAnd(pObj) ); + Gia_ObjComputeTruth6CisSupport_rec( p, Gia_ObjFaninId0p(p, pObj), vSupp ); + Gia_ObjComputeTruth6CisSupport_rec( p, Gia_ObjFaninId1p(p, pObj), vSupp ); +} +word Gia_ObjComputeTruth6Cis( Gia_Man_t * p, int iLit, Vec_Int_t * vSupp, Vec_Wrd_t * vTemp ) +{ + int iObj = Abc_Lit2Var(iLit); + Vec_IntClear( vSupp ); + if ( !iObj ) return Abc_LitIsCompl(iLit) ? ~(word)0 : (word)0; + Gia_ManIncrementTravId( p ); + Gia_ObjComputeTruth6CisSupport_rec( p, iObj, vSupp ); + if ( Vec_IntSize(vSupp) > 6 ) + return 0; + Gia_ObjComputeTruth6( p, iObj, vSupp, vTemp ); + return Abc_LitIsCompl(iLit) ? ~Vec_WrdEntry(vTemp, iObj) : Vec_WrdEntry(vTemp, iObj); +} + +/**Function************************************************************* + Synopsis [Computes truth table up to 6 inputs.] Description [] diff --git a/src/aig/miniaig/abcapis.h b/src/aig/miniaig/abcapis.h index 38c0591d..eb8586fe 100644 --- a/src/aig/miniaig/abcapis.h +++ b/src/aig/miniaig/abcapis.h @@ -52,11 +52,13 @@ extern int Cmd_CommandExecute( void * pAbc, char * pCommandLine ); // procedures to input/output 'mini AIG' extern void Abc_NtkInputMiniAig( void * pAbc, void * pMiniAig ); extern void * Abc_NtkOutputMiniAig( void * pAbc ); +extern void Abc_FrameGiaInputMiniAig( void * pAbc, void * p ); +extern void * Abc_FrameGiaOutputMiniAig( void * pAbc ); extern void Abc_NtkSetFlopNum( void * pAbc, int nFlops ); -// procedures to input/output 'mini AIG' -extern void Abc_NtkInputMiniLut( void * pAbc, void * pMiniLut ); -extern void * Abc_NtkOutputMiniLut( void * pAbc ); +// procedures to input/output 'mini LUT' +extern void Abc_FrameGiaInputMiniLut( void * pAbc, void * pMiniLut ); +extern void * Abc_FrameGiaOutputMiniLut( void * pAbc ); // procedures to set CI/CO arrival/required times extern void Abc_NtkSetCiArrivalTime( void * pAbc, int iCi, float Rise, float Fall ); diff --git a/src/aig/saig/saigMiter.c b/src/aig/saig/saigMiter.c index 67aed490..598103de 100644 --- a/src/aig/saig/saigMiter.c +++ b/src/aig/saig/saigMiter.c @@ -1111,12 +1111,12 @@ int Ssw_SecSpecial( Aig_Man_t * pPart0, Aig_Man_t * pPart1, int nFrames, int fVe // report the miter if ( RetValue == 1 ) { - printf( "Networks are equivalent. " ); + printf( "Networks are equivalent. " ); ABC_PRT( "Time", Abc_Clock() - clkTotal ); } else if ( RetValue == 0 ) { - printf( "Networks are NOT EQUIVALENT. " ); + printf( "Networks are NOT EQUIVALENT. " ); ABC_PRT( "Time", Abc_Clock() - clkTotal ); if ( pMiterCec->pData == NULL ) printf( "Counter-example is not available.\n" ); diff --git a/src/base/abc/abcUtil.c b/src/base/abc/abcUtil.c index f01ef07a..dd3a75b7 100644 --- a/src/base/abc/abcUtil.c +++ b/src/base/abc/abcUtil.c @@ -1077,6 +1077,7 @@ void Abc_NtkLogicMakeSimpleCosTest( Abc_Ntk_t * pNtk, int fDuplicate ) ***********************************************************************/ int Abc_NtkLogicMakeSimpleCos( Abc_Ntk_t * pNtk, int fDuplicate ) { + int fAddBuffers = 1; Vec_Ptr_t * vDrivers, * vCoTerms; Abc_Obj_t * pNode, * pDriver, * pDriverNew, * pFanin; int i, k, LevelMax, nTotal = 0; @@ -1191,6 +1192,12 @@ int Abc_NtkLogicMakeSimpleCos( Abc_Ntk_t * pNtk, int fDuplicate ) // collect COs that needs fixing by adding buffers or duplicating vCoTerms = Vec_PtrAlloc( 100 ); Abc_NtkIncrementTravId( pNtk ); + + // The following cases should be addressed only if the network is written + // into a BLIF file. Otherwise, it is possible to skip them: + // (1) if a CO points to a CI with a different name + // (2) if an internal node drives more than one CO + if ( fAddBuffers ) Abc_NtkForEachCo( pNtk, pNode, i ) { // if the driver is a CI and has different name, this is an error diff --git a/src/base/abci/abc.c b/src/base/abci/abc.c index dabeb982..806a5de7 100644 --- a/src/base/abci/abc.c +++ b/src/base/abci/abc.c @@ -481,6 +481,8 @@ static int Abc_CommandAbc9Fadds ( Abc_Frame_t * pAbc, int argc, cha static int Abc_CommandAbc9ATree ( Abc_Frame_t * pAbc, int argc, char ** argv ); static int Abc_CommandAbc9Polyn ( Abc_Frame_t * pAbc, int argc, char ** argv ); static int Abc_CommandAbc9Acec ( Abc_Frame_t * pAbc, int argc, char ** argv ); +static int Abc_CommandAbc9Anorm ( Abc_Frame_t * pAbc, int argc, char ** argv ); +static int Abc_CommandAbc9Decla ( Abc_Frame_t * pAbc, int argc, char ** argv ); static int Abc_CommandAbc9Esop ( Abc_Frame_t * pAbc, int argc, char ** argv ); static int Abc_CommandAbc9Exorcism ( Abc_Frame_t * pAbc, int argc, char ** argv ); static int Abc_CommandAbc9Mfs ( Abc_Frame_t * pAbc, int argc, char ** argv ); @@ -1124,6 +1126,8 @@ void Abc_Init( Abc_Frame_t * pAbc ) Cmd_CommandAdd( pAbc, "ABC9", "&atree", Abc_CommandAbc9ATree, 0 ); Cmd_CommandAdd( pAbc, "ABC9", "&polyn", Abc_CommandAbc9Polyn, 0 ); Cmd_CommandAdd( pAbc, "ABC9", "&acec", Abc_CommandAbc9Acec, 0 ); + Cmd_CommandAdd( pAbc, "ABC9", "&anorm", Abc_CommandAbc9Anorm, 0 ); + Cmd_CommandAdd( pAbc, "ABC9", "&decla", Abc_CommandAbc9Decla, 0 ); Cmd_CommandAdd( pAbc, "ABC9", "&esop", Abc_CommandAbc9Esop, 0 ); Cmd_CommandAdd( pAbc, "ABC9", "&exorcism", Abc_CommandAbc9Exorcism, 0 ); Cmd_CommandAdd( pAbc, "ABC9", "&mfs", Abc_CommandAbc9Mfs, 0 ); @@ -19532,7 +19536,7 @@ int Abc_CommandSeqSweep( Abc_Frame_t * pAbc, int argc, char ** argv ) if ( Abc_NtkIsComb(pNtk) ) { - Abc_Print( -1, "The network is combinational (run \"fraig\" or \"fraig_sweep\").\n" ); + Abc_Print( 0, "The network is combinational (run \"fraig\" or \"fraig_sweep\").\n" ); return 0; } @@ -28592,15 +28596,21 @@ usage: int Abc_CommandAbc9Show( Abc_Frame_t * pAbc, int argc, char ** argv ) { Vec_Int_t * vBold = NULL; - int c, fAdders = 0; + int c, fAdders = 0, fFadds = 0, fPath = 0; Extra_UtilGetoptReset(); - while ( ( c = Extra_UtilGetopt( argc, argv, "ah" ) ) != EOF ) + while ( ( c = Extra_UtilGetopt( argc, argv, "afph" ) ) != EOF ) { switch ( c ) { case 'a': fAdders ^= 1; break; + case 'f': + fFadds ^= 1; + break; + case 'p': + fPath ^= 1; + break; case 'h': goto usage; default: @@ -28623,14 +28633,16 @@ int Abc_CommandAbc9Show( Abc_Frame_t * pAbc, int argc, char ** argv ) Gia_ManForEachLut( pAbc->pGia, c ) Vec_IntPush( vBold, c ); } - Gia_ManShow( pAbc->pGia, vBold, fAdders ); + Gia_ManShow( pAbc->pGia, vBold, fAdders, fFadds, fPath ); Vec_IntFreeP( &vBold ); return 0; usage: - Abc_Print( -2, "usage: &show [-ah]\n" ); + Abc_Print( -2, "usage: &show [-afph]\n" ); Abc_Print( -2, "\t shows the current GIA using GSView\n" ); Abc_Print( -2, "\t-a : toggle visualazing adders [default = %s]\n", fAdders? "yes": "no" ); + Abc_Print( -2, "\t-f : toggle showing only full-adders with \"-a\" [default = %s]\n", fFadds? "yes": "no" ); + Abc_Print( -2, "\t-p : toggle showing the critical path of a LUT mapping [default = %s]\n", fPath? "yes": "no" ); Abc_Print( -2, "\t-h : print the command usage\n"); return 1; } @@ -31954,7 +31966,7 @@ int Abc_CommandAbc9Scorr( Abc_Frame_t * pAbc, int argc, char ** argv ) } if ( Gia_ManRegNum(pAbc->pGia) == 0 ) { - Abc_Print( -1, "The network is combinational.\n" ); + Abc_Print( 0, "The network is combinational.\n" ); return 0; } pTemp = Cec_ManLSCorrespondence( pAbc->pGia, pPars ); @@ -32915,8 +32927,7 @@ int Abc_CommandAbc9Cec( Abc_Frame_t * pAbc, int argc, char ** argv ) { Cec_ParCec_t ParsCec, * pPars = &ParsCec; FILE * pFile; - Gia_Man_t * pSecond, * pMiter; - char * FileName, * pTemp; + Gia_Man_t * pGias[2] = {NULL, NULL}, * pMiter; char ** pArgvNew; int c, nArgcNew, fMiter = 0, fDualOutput = 0, fDumpMiter = 0; Cec_ManCecSetDefaultParams( pPars ); @@ -32971,13 +32982,15 @@ int Abc_CommandAbc9Cec( Abc_Frame_t * pAbc, int argc, char ** argv ) goto usage; } } - if ( pAbc->pGia == NULL ) - { - Abc_Print( -1, "Abc_CommandAbc9Cec(): There is no AIG.\n" ); - return 1; - } + pArgvNew = argv + globalUtilOptind; + nArgcNew = argc - globalUtilOptind; if ( fMiter ) { + if ( pAbc->pGia == NULL || nArgcNew != 0 ) + { + Abc_Print( -1, "Abc_CommandAbc9Cec(): A miter cannot be given as an argument of command &cec and should be entered using &r.\n" ); + return 1; + } if ( fDualOutput ) { if ( Gia_ManPoNum(pAbc->pGia) & 1 ) @@ -32986,14 +32999,14 @@ int Abc_CommandAbc9Cec( Abc_Frame_t * pAbc, int argc, char ** argv ) return 1; } if ( !pPars->fSilent ) - Abc_Print( 1, "Assuming the current network is a double-output miter. (Conflict limit = %d.)\n", pPars->nBTLimit ); + Abc_Print( 1, "Assuming the current network is a double-output miter.\n" ); pAbc->Status = Cec_ManVerify( pAbc->pGia, pPars ); } else { Gia_Man_t * pTemp; if ( !pPars->fSilent ) - Abc_Print( 1, "Assuming the current network is a single-output miter. (Conflict limit = %d.)\n", pPars->nBTLimit ); + Abc_Print( 1, "Assuming the current network is a single-output miter.\n" ); pTemp = Gia_ManDemiterToDual( pAbc->pGia ); pAbc->Status = Cec_ManVerify( pTemp, pPars ); ABC_SWAP( Abc_Cex_t *, pAbc->pGia->pCexComb, pTemp->pCexComb ); @@ -33002,41 +33015,81 @@ int Abc_CommandAbc9Cec( Abc_Frame_t * pAbc, int argc, char ** argv ) Abc_FrameReplaceCex( pAbc, &pAbc->pGia->pCexComb ); return 0; } - - pArgvNew = argv + globalUtilOptind; - nArgcNew = argc - globalUtilOptind; - if ( nArgcNew != 1 ) + if ( nArgcNew > 2 ) + { + Abc_Print( -1, "Abc_CommandAbc9Cec(): Wrong number of command-line arguments.\n" ); + return 1; + } + if ( nArgcNew == 2 ) { - if ( pAbc->pGia->pSpec == NULL ) + char * pFileNames[2] = { pArgvNew[0], pArgvNew[1] }, * pTemp; + int n; + for ( n = 0; n < 2; n++ ) { - Abc_Print( -1, "File name is not given on the command line.\n" ); - return 1; + // fix the wrong symbol + for ( pTemp = pFileNames[n]; *pTemp; pTemp++ ) + if ( *pTemp == '>' ) + *pTemp = '\\'; + if ( (pFile = fopen( pFileNames[n], "r" )) == NULL ) + { + Abc_Print( -1, "Cannot open input file \"%s\". ", pFileNames[n] ); + if ( (pFileNames[n] = Extra_FileGetSimilarName( pFileNames[n], ".aig", NULL, NULL, NULL, NULL )) ) + Abc_Print( 1, "Did you mean \"%s\"?", pFileNames[n] ); + Abc_Print( 1, "\n" ); + return 1; + } + fclose( pFile ); + pGias[n] = Gia_AigerRead( pFileNames[n], 0, 0, 0 ); + if ( pGias[n] == NULL ) + { + Abc_Print( -1, "Reading AIGER from file \"%s\" has failed.\n", pFileNames[n] ); + return 0; + } } - FileName = pAbc->pGia->pSpec; } else - FileName = pArgvNew[0]; - // fix the wrong symbol - for ( pTemp = FileName; *pTemp; pTemp++ ) - if ( *pTemp == '>' ) - *pTemp = '\\'; - if ( (pFile = fopen( FileName, "r" )) == NULL ) { - Abc_Print( -1, "Cannot open input file \"%s\". ", FileName ); - if ( (FileName = Extra_FileGetSimilarName( FileName, ".aig", NULL, NULL, NULL, NULL )) ) - Abc_Print( 1, "Did you mean \"%s\"?", FileName ); - Abc_Print( 1, "\n" ); - return 1; - } - fclose( pFile ); - pSecond = Gia_AigerRead( FileName, 0, 0, 0 ); - if ( pSecond == NULL ) - { - Abc_Print( -1, "Reading AIGER has failed.\n" ); - return 0; + char * FileName, * pTemp; + if ( pAbc->pGia == NULL ) + { + Abc_Print( -1, "Abc_CommandAbc9Cec(): There is no current AIG.\n" ); + return 1; + } + pGias[0] = pAbc->pGia; + if ( nArgcNew == 1 ) + FileName = pArgvNew[0]; + else + { + assert( nArgcNew == 0 ); + if ( pAbc->pGia->pSpec == NULL ) + { + Abc_Print( -1, "File name is not given on the command line.\n" ); + return 1; + } + FileName = pAbc->pGia->pSpec; + } + // fix the wrong symbol + for ( pTemp = FileName; *pTemp; pTemp++ ) + if ( *pTemp == '>' ) + *pTemp = '\\'; + if ( (pFile = fopen( FileName, "r" )) == NULL ) + { + Abc_Print( -1, "Cannot open input file \"%s\". ", FileName ); + if ( (FileName = Extra_FileGetSimilarName( FileName, ".aig", NULL, NULL, NULL, NULL )) ) + Abc_Print( 1, "Did you mean \"%s\"?", FileName ); + Abc_Print( 1, "\n" ); + return 1; + } + fclose( pFile ); + pGias[1] = Gia_AigerRead( FileName, 0, 0, 0 ); + if ( pGias[1] == NULL ) + { + Abc_Print( -1, "Reading AIGER has failed.\n" ); + return 0; + } } // compute the miter - pMiter = Gia_ManMiter( pAbc->pGia, pSecond, 0, 1, 0, 0, pPars->fVerbose ); + pMiter = Gia_ManMiter( pGias[0], pGias[1], 0, 1, 0, 0, pPars->fVerbose ); if ( pMiter ) { if ( fDumpMiter ) @@ -33045,10 +33098,12 @@ int Abc_CommandAbc9Cec( Abc_Frame_t * pAbc, int argc, char ** argv ) Gia_AigerWrite( pMiter, "cec_miter.aig", 0, 0 ); } pAbc->Status = Cec_ManVerify( pMiter, pPars ); - Abc_FrameReplaceCex( pAbc, &pAbc->pGia->pCexComb ); + Abc_FrameReplaceCex( pAbc, &pGias[0]->pCexComb ); Gia_ManStop( pMiter ); } - Gia_ManStop( pSecond ); + if ( pGias[0] != pAbc->pGia ) + Gia_ManStop( pGias[0] ); + Gia_ManStop( pGias[1] ); return 0; usage: @@ -36166,7 +36221,7 @@ int Abc_CommandAbc9SatLut( Abc_Frame_t * pAbc, int argc, char ** argv ) usage: Abc_Print( -2, "usage: &satlut [-NICDQ num] [-drwvh]\n" ); - Abc_Print( -2, "\t performs SAT-based remapping of the 4-LUT network\n" ); + Abc_Print( -2, "\t performs SAT-based remapping of the LUT-mapped network\n" ); Abc_Print( -2, "\t-N num : the limit on AIG nodes in the window (num <= 128) [default = %d]\n", nNumber ); Abc_Print( -2, "\t-I num : the limit on the number of improved windows [default = %d]\n", nImproves ); Abc_Print( -2, "\t-C num : the limit on the number of conflicts [default = %d]\n", nBTLimit ); @@ -40528,14 +40583,12 @@ usage: int Abc_CommandAbc9Acec( Abc_Frame_t * pAbc, int argc, char ** argv ) { FILE * pFile; - Cec_ParCec_t ParsCec, * pPars = &ParsCec; - Gia_Man_t * pSecond; - char * FileName, * pTemp; + Acec_ParCec_t ParsCec, * pPars = &ParsCec; char ** pArgvNew; - int c, nArgcNew, fMiter = 0, fDualOutput = 0, fTwoOutput = 0; - Cec_ManCecSetDefaultParams( pPars ); + int c, nArgcNew; + Acec_ManCecSetDefaultParams( pPars ); Extra_UtilGetoptReset(); - while ( ( c = Extra_UtilGetopt( argc, argv, "CTnmdtvh" ) ) != EOF ) + while ( ( c = Extra_UtilGetopt( argc, argv, "CTmdtbvh" ) ) != EOF ) { switch ( c ) { @@ -40561,17 +40614,17 @@ int Abc_CommandAbc9Acec( Abc_Frame_t * pAbc, int argc, char ** argv ) if ( pPars->TimeLimit < 0 ) goto usage; break; - case 'n': - pPars->fNaive ^= 1; - break; case 'm': - fMiter ^= 1; + pPars->fMiter ^= 1; break; case 'd': - fDualOutput ^= 1; + pPars->fDualOutput ^= 1; break; case 't': - fTwoOutput ^= 1; + pPars->fTwoOutput ^= 1; + break; + case 'b': + pPars->fBooth ^= 1; break; case 'v': pPars->fVerbose ^= 1; @@ -40582,15 +40635,20 @@ int Abc_CommandAbc9Acec( Abc_Frame_t * pAbc, int argc, char ** argv ) goto usage; } } - if ( fMiter ) + if ( pPars->fMiter ) { Gia_Man_t * pGia0, * pGia1, * pDual; + if ( argc != globalUtilOptind ) + { + Abc_Print( -1, "Abc_CommandAbc9Acec(): If the input is a miter, it cannot be given on the command line.\n" ); + return 1; + } if ( pAbc->pGia == NULL ) { Abc_Print( -1, "Abc_CommandAbc9Acec(): There is no AIG.\n" ); return 1; } - if ( fDualOutput ) + if ( pPars->fDualOutput ) { if ( Gia_ManPoNum(pAbc->pGia) & 1 ) { @@ -40600,28 +40658,28 @@ int Abc_CommandAbc9Acec( Abc_Frame_t * pAbc, int argc, char ** argv ) if ( !pPars->fSilent ) Abc_Print( 1, "Assuming the current network is a double-output miter. (Conflict limit = %d.)\n", pPars->nBTLimit ); Gia_ManDemiterDual( pAbc->pGia, &pGia0, &pGia1 ); - pAbc->Status = Gia_PolynCec( pGia0, pGia1, pPars ); + pAbc->Status = Acec_Solve( pGia0, pGia1, pPars ); } - else if ( fTwoOutput ) + else if ( pPars->fTwoOutput ) { if ( Gia_ManPoNum(pAbc->pGia) & 1 ) { - Abc_Print( -1, "The dual-output miter should have an even number of outputs.\n" ); + Abc_Print( -1, "The two-output miter should have an even number of outputs.\n" ); return 1; } if ( !pPars->fSilent ) Abc_Print( 1, "Assuming the current network is a two-word miter. (Conflict limit = %d.)\n", pPars->nBTLimit ); Gia_ManDemiterTwoWords( pAbc->pGia, &pGia0, &pGia1 ); - pAbc->Status = Gia_PolynCec( pGia0, pGia1, pPars ); + pAbc->Status = Acec_Solve( pGia0, pGia1, pPars ); } - else + else // regular single- or multi-output miter { if ( !pPars->fSilent ) - Abc_Print( 1, "Assuming the current network is a single-output miter. (Conflict limit = %d.)\n", pPars->nBTLimit ); + Abc_Print( 1, "Assuming the current network is a regular single- or multi-output miter. (Conflict limit = %d.)\n", pPars->nBTLimit ); pDual = Gia_ManDemiterToDual( pAbc->pGia ); Gia_ManDemiterDual( pDual, &pGia0, &pGia1 ); Gia_ManStop( pDual ); - pAbc->Status = Gia_PolynCec( pGia0, pGia1, pPars ); + pAbc->Status = Acec_Solve( pGia0, pGia1, pPars ); } Abc_FrameReplaceCex( pAbc, &pGia0->pCexComb ); Gia_ManStop( pGia0 ); @@ -40631,52 +40689,97 @@ int Abc_CommandAbc9Acec( Abc_Frame_t * pAbc, int argc, char ** argv ) pArgvNew = argv + globalUtilOptind; nArgcNew = argc - globalUtilOptind; - if ( nArgcNew != 1 ) + if ( nArgcNew == 0 || nArgcNew == 1 ) { - if ( pAbc->pGia->pSpec == NULL ) + Gia_Man_t * pSecond; + char * pTemp, * FileName = NULL; + if ( nArgcNew == 0 ) { - Abc_Print( -1, "File name is not given on the command line.\n" ); - return 1; + FileName = pAbc->pGia->pSpec; + if ( FileName == NULL ) + { + Abc_Print( -1, "File name is not given on the command line.\n" ); + return 1; + } } - FileName = pAbc->pGia->pSpec; + else // if ( nArgcNew == 1 ) + { + FileName = pArgvNew[0]; + // fix the wrong symbol + for ( pTemp = FileName; *pTemp; pTemp++ ) + if ( *pTemp == '>' ) + *pTemp = '\\'; + if ( (pFile = fopen( FileName, "r" )) == NULL ) + { + Abc_Print( -1, "Cannot open input file \"%s\". ", FileName ); + if ( (FileName = Extra_FileGetSimilarName( FileName, ".aig", NULL, NULL, NULL, NULL )) ) + Abc_Print( 1, "Did you mean \"%s\"?", FileName ); + Abc_Print( 1, "\n" ); + return 1; + } + fclose( pFile ); + } + pSecond = Gia_AigerRead( FileName, 0, 0, 0 ); + if ( pSecond == NULL ) + { + Abc_Print( -1, "Reading AIGER has failed.\n" ); + return 0; + } + pAbc->Status = Acec_Solve( pAbc->pGia, pSecond, pPars ); + Abc_FrameReplaceCex( pAbc, &pAbc->pGia->pCexComb ); + Gia_ManStop( pSecond ); } - else - FileName = pArgvNew[0]; - // fix the wrong symbol - for ( pTemp = FileName; *pTemp; pTemp++ ) - if ( *pTemp == '>' ) - *pTemp = '\\'; - if ( (pFile = fopen( FileName, "r" )) == NULL ) + else if ( nArgcNew == 2 ) { - Abc_Print( -1, "Cannot open input file \"%s\". ", FileName ); - if ( (FileName = Extra_FileGetSimilarName( FileName, ".aig", NULL, NULL, NULL, NULL )) ) - Abc_Print( 1, "Did you mean \"%s\"?", FileName ); - Abc_Print( 1, "\n" ); - return 1; + Gia_Man_t * pGias[2] = {NULL}; int i; + char * pTemp, * FileName[2] = { pArgvNew[0], pArgvNew[1] }; + for ( i = 0; i < 2; i++ ) + { + // fix the wrong symbol + for ( pTemp = FileName[i]; *pTemp; pTemp++ ) + if ( *pTemp == '>' ) + *pTemp = '\\'; + if ( (pFile = fopen( FileName[i], "r" )) == NULL ) + { + Abc_Print( -1, "Cannot open input file \"%s\". ", FileName[i] ); + if ( (FileName[i] = Extra_FileGetSimilarName( FileName[i], ".aig", NULL, NULL, NULL, NULL )) ) + Abc_Print( 1, "Did you mean \"%s\"?", FileName[i] ); + Abc_Print( 1, "\n" ); + return 1; + } + fclose( pFile ); + pGias[i] = Gia_AigerRead( FileName[i], 0, 0, 0 ); + if ( pGias[i] == NULL ) + { + Abc_Print( -1, "Reading AIGER has failed.\n" ); + return 0; + } + } + pAbc->Status = Acec_Solve( pGias[0], pGias[1], pPars ); + Abc_FrameReplaceCex( pAbc, &pGias[0]->pCexComb ); + Gia_ManStop( pGias[0] ); + Gia_ManStop( pGias[1] ); } - fclose( pFile ); - pSecond = Gia_AigerRead( FileName, 0, 0, 0 ); - if ( pSecond == NULL ) + else { - Abc_Print( -1, "Reading AIGER has failed.\n" ); - return 0; + Abc_Print( -1, "Too many command-line arguments.\n" ); + return 1; } - pAbc->Status = Gia_PolynCec( pAbc->pGia, pSecond, pPars ); - Abc_FrameReplaceCex( pAbc, &pAbc->pGia->pCexComb ); - Gia_ManStop( pSecond ); return 0; usage: - Abc_Print( -2, "usage: &acec [-CT num] [-nmdtvh]\n" ); + Abc_Print( -2, "usage: &acec [-CT num] [-mdtbvh] <file1> <file2>\n" ); Abc_Print( -2, "\t combinational equivalence checking for arithmetic circuits\n" ); Abc_Print( -2, "\t-C num : the max number of conflicts at a node [default = %d]\n", pPars->nBTLimit ); Abc_Print( -2, "\t-T num : approximate runtime limit in seconds [default = %d]\n", pPars->TimeLimit ); - Abc_Print( -2, "\t-n : toggle using naive SAT-based checking [default = %s]\n", pPars->fNaive? "yes":"no"); - Abc_Print( -2, "\t-m : toggle miter vs. two circuits [default = %s]\n", fMiter? "miter":"two circuits"); - Abc_Print( -2, "\t-d : toggle using dual output miter [default = %s]\n", fDualOutput? "yes":"no"); - Abc_Print( -2, "\t-t : toggle using two-word miter [default = %s]\n", fTwoOutput? "yes":"no"); + Abc_Print( -2, "\t-m : toggle miter vs. two circuits [default = %s]\n", pPars->fMiter? "miter":"two circuits"); + Abc_Print( -2, "\t-d : toggle using dual output miter [default = %s]\n", pPars->fDualOutput? "yes":"no"); + Abc_Print( -2, "\t-t : toggle using two-word miter [default = %s]\n", pPars->fTwoOutput? "yes":"no"); + Abc_Print( -2, "\t-b : toggle working with Booth multipliers [default = %s]\n", pPars->fBooth? "yes":"no"); Abc_Print( -2, "\t-v : toggle verbose output [default = %s]\n", pPars->fVerbose? "yes":"no"); Abc_Print( -2, "\t-h : print the command usage\n"); + Abc_Print( -2, "\tfile1 : (optional) the file with the first network\n"); + Abc_Print( -2, "\tfile2 : (optional) the file with the second network\n"); return 1; } @@ -40691,6 +40794,107 @@ usage: SeeAlso [] ***********************************************************************/ +int Abc_CommandAbc9Anorm( Abc_Frame_t * pAbc, int argc, char ** argv ) +{ + Gia_Man_t * pTemp; + int c, fBooth = 0, fVerbose = 0; + Extra_UtilGetoptReset(); + while ( ( c = Extra_UtilGetopt( argc, argv, "bvh" ) ) != EOF ) + { + switch ( c ) + { + case 'b': + fBooth ^= 1; + break; + case 'v': + fVerbose ^= 1; + break; + case 'h': + goto usage; + default: + goto usage; + } + } + if ( pAbc->pGia == NULL ) + { + Abc_Print( -1, "Abc_CommandAbc9Anorm(): There is no AIG.\n" ); + return 0; + } + pTemp = Acec_Normalize( pAbc->pGia, fBooth, fVerbose ); + Abc_FrameUpdateGia( pAbc, pTemp ); + return 0; + +usage: + Abc_Print( -2, "usage: &anorm [-bvh]\n" ); + Abc_Print( -2, "\t normalize adder trees in the current AIG\n" ); + Abc_Print( -2, "\t-b : toggles working with Booth multipliers [default = %s]\n", fBooth? "yes": "no" ); + Abc_Print( -2, "\t-v : toggles printing verbose information [default = %s]\n", fVerbose? "yes": "no" ); + Abc_Print( -2, "\t-h : print the command usage\n"); + return 1; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Abc_CommandAbc9Decla( Abc_Frame_t * pAbc, int argc, char ** argv ) +{ + Gia_Man_t * pTemp; + int c, fBooth = 0, fVerbose = 0; + Extra_UtilGetoptReset(); + while ( ( c = Extra_UtilGetopt( argc, argv, "bvh" ) ) != EOF ) + { + switch ( c ) + { + case 'b': + fBooth ^= 1; + break; + case 'v': + fVerbose ^= 1; + break; + case 'h': + goto usage; + default: + goto usage; + } + } + if ( pAbc->pGia == NULL ) + { + Abc_Print( -1, "Abc_CommandAbc9Decla(): There is no AIG.\n" ); + return 0; + } + pTemp = Acec_ManDecla( pAbc->pGia, fBooth, fVerbose ); + Abc_FrameUpdateGia( pAbc, pTemp ); + return 0; + +usage: + Abc_Print( -2, "usage: &decla [-bvh]\n" ); + Abc_Print( -2, "\t removes carry look ahead adders\n" ); + Abc_Print( -2, "\t-b : toggles working with Booth multipliers [default = %s]\n", fBooth? "yes": "no" ); + Abc_Print( -2, "\t-v : toggles printing verbose information [default = %s]\n", fVerbose? "yes": "no" ); + Abc_Print( -2, "\t-h : print the command usage\n"); + return 1; +} + + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ int Abc_CommandAbc9Esop( Abc_Frame_t * pAbc, int argc, char ** argv ) { extern Gia_Man_t * Eso_ManCompute( Gia_Man_t * pGia, int fVerbose, Vec_Wec_t ** pvRes ); @@ -41006,7 +41210,7 @@ int Abc_CommandAbc9Mfsd( Abc_Frame_t * pAbc, int argc, char ** argv ) Sbd_Par_t Pars, * pPars = &Pars; Sbd_ParSetDefault( pPars ); Extra_UtilGetoptReset(); - while ( ( c = Extra_UtilGetopt( argc, argv, "KWFMCacvwh" ) ) != EOF ) + while ( ( c = Extra_UtilGetopt( argc, argv, "KSNPWFMCmcdpvwh" ) ) != EOF ) { switch ( c ) { @@ -41021,6 +41225,39 @@ int Abc_CommandAbc9Mfsd( Abc_Frame_t * pAbc, int argc, char ** argv ) if ( pPars->nLutSize < 0 ) goto usage; break; + case 'S': + if ( globalUtilOptind >= argc ) + { + Abc_Print( -1, "Command line switch \"-S\" should be followed by an integer.\n" ); + goto usage; + } + pPars->nLutNum = atoi(argv[globalUtilOptind]); + globalUtilOptind++; + if ( pPars->nLutNum < 0 ) + goto usage; + break; + case 'N': + if ( globalUtilOptind >= argc ) + { + Abc_Print( -1, "Command line switch \"-N\" should be followed by an integer.\n" ); + goto usage; + } + pPars->nCutSize = atoi(argv[globalUtilOptind]); + globalUtilOptind++; + if ( pPars->nCutSize < 0 ) + goto usage; + break; + case 'P': + if ( globalUtilOptind >= argc ) + { + Abc_Print( -1, "Command line switch \"-P\" should be followed by an integer.\n" ); + goto usage; + } + pPars->nCutNum = atoi(argv[globalUtilOptind]); + globalUtilOptind++; + if ( pPars->nCutNum < 0 ) + goto usage; + break; case 'W': if ( globalUtilOptind >= argc ) { @@ -41065,11 +41302,17 @@ int Abc_CommandAbc9Mfsd( Abc_Frame_t * pAbc, int argc, char ** argv ) if ( pPars->nBTLimit < 0 ) goto usage; break; - case 'a': - pPars->fArea ^= 1; + case 'm': + pPars->fMapping ^= 1; break; case 'c': - pPars->fCover ^= 1; + pPars->fMoreCuts ^= 1; + break; + case 'd': + pPars->fFindDivs ^= 1; + break; + case 'p': + pPars->fUsePath ^= 1; break; case 'v': pPars->fVerbose ^= 1; @@ -41085,33 +41328,35 @@ int Abc_CommandAbc9Mfsd( Abc_Frame_t * pAbc, int argc, char ** argv ) } if ( pAbc->pGia == NULL ) { - Abc_Print( -1, "Abc_CommandAbc9Mfs(): There is no AIG.\n" ); + Abc_Print( -1, "Abc_CommandAbc9Mfsd(): There is no AIG.\n" ); return 0; } if ( Gia_ManBufNum(pAbc->pGia) ) { - Abc_Print( -1, "Abc_CommandAbc9Mfs(): This command does not work with barrier buffers.\n" ); + Abc_Print( -1, "Abc_CommandAbc9Mfsd(): This command does not work with barrier buffers.\n" ); return 1; } if ( Gia_ManHasMapping(pAbc->pGia) ) - { - Abc_Print( -1, "Abc_CommandAbc9Mfs(): The current AIG has mapping (run &st to unmap).\n" ); - return 0; - } + Abc_Print( 1, "The current AIG has mapping, which can be used to determine critical path if \"-p\" is selected.\n" ); pTemp = Sbd_NtkPerform( pAbc->pGia, pPars ); Abc_FrameUpdateGia( pAbc, pTemp ); return 0; usage: - Abc_Print( -2, "usage: &mfsd [-KWFMC <num>] [-acvwh]\n" ); + Abc_Print( -2, "usage: &mfsd [-KSNPWFMC <num>] [-mcdpvwh]\n" ); Abc_Print( -2, "\t performs SAT-based delay-oriented AIG optimization\n" ); Abc_Print( -2, "\t-K <num> : the LUT size for delay minimization (2 <= num <= 6) [default = %d]\n", pPars->nLutSize ); + Abc_Print( -2, "\t-S <num> : the LUT structure size (1 <= num <= 2) [default = %d]\n", pPars->nLutNum ); + Abc_Print( -2, "\t-N <num> : the cut size considered for optimization (2 <= num <= 10) [default = %d]\n", pPars->nCutSize ); + Abc_Print( -2, "\t-P <num> : the number of cuts computed at a node (1 <= num <= 500) [default = %d]\n", pPars->nCutNum ); Abc_Print( -2, "\t-W <num> : the number of levels in the TFO cone (0 <= num) [default = %d]\n", pPars->nTfoLevels ); Abc_Print( -2, "\t-F <num> : the max number of fanouts to skip (1 <= num) [default = %d]\n", pPars->nTfoFanMax ); Abc_Print( -2, "\t-M <num> : the max node count of windows to consider (0 = no limit) [default = %d]\n", pPars->nWinSizeMax ); Abc_Print( -2, "\t-C <num> : the max number of conflicts in one SAT run (0 = no limit) [default = %d]\n", pPars->nBTLimit ); - Abc_Print( -2, "\t-a : toggle minimizing area or area+edges [default = %s]\n", pPars->fArea? "area": "area+edges" ); - Abc_Print( -2, "\t-c : toggle using complete slow covering procedure [default = %s]\n", pPars->fCover? "yes": "no" ); + Abc_Print( -2, "\t-m : toggle generating delay-oriented mapping [default = %s]\n", pPars->fMapping? "yes": "no" ); + Abc_Print( -2, "\t-c : toggle using several cuts at each node [default = %s]\n", pPars->fMoreCuts? "yes": "no" ); + Abc_Print( -2, "\t-d : toggle additional search for good divisors [default = %s]\n", pPars->fFindDivs? "yes": "no" ); + Abc_Print( -2, "\t-p : toggle optimizing critical path only [default = %s]\n", pPars->fUsePath? "yes": "no" ); Abc_Print( -2, "\t-v : toggle printing optimization summary [default = %s]\n", pPars->fVerbose? "yes": "no" ); Abc_Print( -2, "\t-w : toggle printing detailed stats for each node [default = %s]\n", pPars->fVeryVerbose? "yes": "no" ); Abc_Print( -2, "\t-h : print the command usage\n"); @@ -42541,8 +42786,6 @@ int Abc_CommandAbc9Test( Abc_Frame_t * pAbc, int argc, char ** argv ) // Jf_ManTestCnf( pAbc->pGia ); // Gia_ManCheckFalseTest( pAbc->pGia, nFrames ); // Gia_ParTest( pAbc->pGia, nWords, nProcs ); -// Gia_PolynExplore( pAbc->pGia ); -// Gia_ManTestSatEnum( pAbc->pGia ); // printf( "\nThis command is currently disabled.\n\n" ); return 0; diff --git a/src/base/abci/abcDar.c b/src/base/abci/abcDar.c index 9f672485..147f7c2f 100644 --- a/src/base/abci/abcDar.c +++ b/src/base/abci/abcDar.c @@ -1946,17 +1946,17 @@ finish: // report the miter if ( RetValue == 1 ) { - Abc_Print( 1, "Networks are equivalent. " ); + Abc_Print( 1, "Networks are equivalent. " ); ABC_PRT( "Time", Abc_Clock() - clkTotal ); } else if ( RetValue == 0 ) { - Abc_Print( 1, "Networks are NOT EQUIVALENT. " ); + Abc_Print( 1, "Networks are NOT EQUIVALENT. " ); ABC_PRT( "Time", Abc_Clock() - clkTotal ); } else { - Abc_Print( 1, "Networks are UNDECIDED. " ); + Abc_Print( 1, "Networks are UNDECIDED. " ); ABC_PRT( "Time", Abc_Clock() - clkTotal ); } fflush( stdout ); @@ -3695,17 +3695,17 @@ int Abc_NtkDarInduction( Abc_Ntk_t * pNtk, int nTimeOut, int nFramesMax, int nCo RetValue = Saig_ManInduction( pMan, nTimeOut, nFramesMax, nConfMax, fUnique, fUniqueAll, fGetCex, fVerbose, fVeryVerbose ); if ( RetValue == 1 ) { - Abc_Print( 1, "Networks are equivalent. " ); + Abc_Print( 1, "Networks are equivalent. " ); ABC_PRT( "Time", Abc_Clock() - clkTotal ); } else if ( RetValue == 0 ) { - Abc_Print( 1, "Networks are NOT EQUIVALENT. " ); + Abc_Print( 1, "Networks are NOT EQUIVALENT. " ); ABC_PRT( "Time", Abc_Clock() - clkTotal ); } else { - Abc_Print( 1, "Networks are UNDECIDED. " ); + Abc_Print( 1, "Networks are UNDECIDED. " ); ABC_PRT( "Time", Abc_Clock() - clkTotal ); } if ( fGetCex ) diff --git a/src/base/abci/abcDress3.c b/src/base/abci/abcDress3.c index 33545f0a..ce0cb7f5 100644 --- a/src/base/abci/abcDress3.c +++ b/src/base/abci/abcDress3.c @@ -35,32 +35,6 @@ ABC_NAMESPACE_IMPL_START /**Function************************************************************* - Synopsis [Compute equivalence classes of nodes.] - - Description [] - - SideEffects [] - - SeeAlso [] - -***********************************************************************/ -void Abc_NtkComputeGiaEquivs( Gia_Man_t * pGia, int nConfs, int fVerbose ) -{ - Gia_Man_t * pTemp; - Cec_ParFra_t ParsFra, * pPars = &ParsFra; - Cec_ManFraSetDefaultParams( pPars ); - pPars->fUseOrigIds = 1; - pPars->fSatSweeping = 1; - pPars->nBTLimit = nConfs; - pPars->fVerbose = fVerbose; - pTemp = Cec_ManSatSweeping( pGia, pPars, 0 ); - Gia_ManStop( pTemp ); - pTemp = Gia_ManOrigIdsReduce( pGia, pGia->vIdsEquiv ); - Gia_ManStop( pTemp ); -} - -/**Function************************************************************* - Synopsis [Converts AIG from HOP to GIA.] Description [] @@ -315,13 +289,15 @@ void Abc_NtkDumpEquivFile( char * pFileName, Vec_Int_t * vClasses, Abc_Ntk_t * p void Abc_NtkDumpEquiv( Abc_Ntk_t * pNtks[2], char * pFileName, int nConfs, int fByName, int fVerbose ) { //abctime clk = Abc_Clock(); + Gia_Man_t * pTemp; Vec_Int_t * vClasses; // derive shared AIG for the two networks Gia_Man_t * pGia = Abc_NtkAigToGiaTwo( pNtks[0], pNtks[1], fByName ); if ( fVerbose ) printf( "Computing equivalences for networks \"%s\" and \"%s\" with conflict limit %d.\n", Abc_NtkName(pNtks[0]), Abc_NtkName(pNtks[1]), nConfs ); // compute equivalences in this AIG - Abc_NtkComputeGiaEquivs( pGia, nConfs, fVerbose ); + pTemp = Gia_ManComputeGiaEquivs( pGia, nConfs, fVerbose ); + Gia_ManStop( pTemp ); //if ( fVerbose ) // Abc_PrintTime( 1, "Equivalence computation time", Abc_Clock() - clk ); if ( fVerbose ) diff --git a/src/base/abci/abcExact.c b/src/base/abci/abcExact.c index 757034cd..adb64d79 100644 --- a/src/base/abci/abcExact.c +++ b/src/base/abci/abcExact.c @@ -873,7 +873,7 @@ static void Ses_StoreRead( Ses_Store_t * pStore, const char * pFilename, int fSy fclose( pFile ); - printf( "read %lu entries from file\n", nEntries ); + printf( "read %lu entries from file\n", (long)nEntries ); } // computes top decomposition of variables wrt. to AND and OR diff --git a/src/base/abci/abcMfs.c b/src/base/abci/abcMfs.c index e33d6c73..d44ca1a0 100644 --- a/src/base/abci/abcMfs.c +++ b/src/base/abci/abcMfs.c @@ -259,7 +259,7 @@ int Abc_NtkPerformMfs( Abc_Ntk_t * pNtk, Sfm_Par_t * pPars ) if ( nFaninMax > 6 ) { Abc_Print( 1, "Currently \"mfs\" cannot process the network containing nodes with more than 6 fanins.\n" ); - return 0; + return 1; } if ( !Abc_NtkHasSop(pNtk) ) if ( !Abc_NtkToSop( pNtk, -1, ABC_INFINITY ) ) diff --git a/src/base/abci/abcVerify.c b/src/base/abci/abcVerify.c index 25d1d113..7199c529 100644 --- a/src/base/abci/abcVerify.c +++ b/src/base/abci/abcVerify.c @@ -122,6 +122,7 @@ void Abc_NtkCecSat( Abc_Ntk_t * pNtk1, Abc_Ntk_t * pNtk2, int nConfLimit, int nI ***********************************************************************/ void Abc_NtkCecFraig( Abc_Ntk_t * pNtk1, Abc_Ntk_t * pNtk2, int nSeconds, int fVerbose ) { + abctime clk = Abc_Clock(); Prove_Params_t Params, * pParams = &Params; // Fraig_Params_t Params; // Fraig_Man_t * pMan; @@ -170,18 +171,20 @@ void Abc_NtkCecFraig( Abc_Ntk_t * pNtk1, Abc_Ntk_t * pNtk2, int nSeconds, int fV RetValue = Abc_NtkMiterIsConstant( pMiter ); if ( RetValue == 0 ) { - printf( "Networks are NOT EQUIVALENT after structural hashing.\n" ); + printf( "Networks are NOT EQUIVALENT after structural hashing. " ); // report the error pMiter->pModel = Abc_NtkVerifyGetCleanModel( pMiter, 1 ); Abc_NtkVerifyReportError( pNtk1, pNtk2, pMiter->pModel ); ABC_FREE( pMiter->pModel ); Abc_NtkDelete( pMiter ); + Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); return; } if ( RetValue == 1 ) { - printf( "Networks are equivalent after structural hashing.\n" ); + printf( "Networks are equivalent after structural hashing. " ); Abc_NtkDelete( pMiter ); + Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); return; } /* @@ -220,18 +223,19 @@ void Abc_NtkCecFraig( Abc_Ntk_t * pNtk1, Abc_Ntk_t * pNtk2, int nSeconds, int fV // pParams->fVerbose = 1; RetValue = Abc_NtkIvyProve( &pMiter, pParams ); if ( RetValue == -1 ) - printf( "Networks are undecided (resource limits is reached).\n" ); + printf( "Networks are undecided (resource limits is reached). " ); else if ( RetValue == 0 ) { int * pSimInfo = Abc_NtkVerifySimulatePattern( pMiter, pMiter->pModel ); if ( pSimInfo[0] != 1 ) printf( "ERROR in Abc_NtkMiterProve(): Generated counter-example is invalid.\n" ); else - printf( "Networks are NOT EQUIVALENT.\n" ); + printf( "Networks are NOT EQUIVALENT. " ); ABC_FREE( pSimInfo ); } else - printf( "Networks are equivalent.\n" ); + printf( "Networks are equivalent. " ); + Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); if ( pMiter->pModel ) Abc_NtkVerifyReportError( pNtk1, pNtk2, pMiter->pModel ); Abc_NtkDelete( pMiter ); diff --git a/src/base/cmd/cmd.c b/src/base/cmd/cmd.c index 0b7c1788..ab037139 100644 --- a/src/base/cmd/cmd.c +++ b/src/base/cmd/cmd.c @@ -1147,26 +1147,7 @@ usage: #if defined(WIN32) && !defined(__cplusplus) #include <direct.h> - -// these structures are defined in <io.h> but are for some reason invisible -typedef unsigned long _fsize_t; // Could be 64 bits for Win32 - -struct _finddata_t { - unsigned attrib; - time_t time_create; // -1 for FAT file systems - time_t time_access; // -1 for FAT file systems - time_t time_write; - _fsize_t size; - char name[260]; -}; - -extern long _findfirst( char *filespec, struct _finddata_t *fileinfo ); -extern int _findnext( long handle, struct _finddata_t *fileinfo ); -extern int _findclose( long handle ); - -//extern char * _getcwd( char * buffer, int maxlen ); -//extern int _chdir( const char *dirname ); - +#include <io.h> /**Function************************************************************* diff --git a/src/base/cmd/cmdLoad.c b/src/base/cmd/cmdLoad.c index 7f7c1b60..accd9440 100644 --- a/src/base/cmd/cmdLoad.c +++ b/src/base/cmd/cmdLoad.c @@ -97,26 +97,7 @@ int CmdCommandLoad( Abc_Frame_t * pAbc, int argc, char ** argv ) #if defined(WIN32) && !defined(__cplusplus) #include <direct.h> - - -// these structures are defined in <io.h> but are for some reason invisible -typedef unsigned long _fsize_t; // Could be 64 bits for Win32 - -struct _finddata_t { - unsigned attrib; - time_t time_create; // -1 for FAT file systems - time_t time_access; // -1 for FAT file systems - time_t time_write; - _fsize_t size; - char name[260]; -}; - -extern long _findfirst( char *filespec, struct _finddata_t *fileinfo ); -extern int _findnext( long handle, struct _finddata_t *fileinfo ); -extern int _findclose( long handle ); - -//extern char * _getcwd( char * buffer, int maxlen ); -//extern int _chdir( const char *dirname ); +#include <io.h> /**Function************************************************************* diff --git a/src/base/main/mainFrame.c b/src/base/main/mainFrame.c index 05cb09c1..9647d020 100644 --- a/src/base/main/mainFrame.c +++ b/src/base/main/mainFrame.c @@ -95,8 +95,6 @@ void Abc_FrameSetStatus( int Status ) { ABC_FREE( s_Globa void Abc_FrameSetManDsd( void * pMan ) { if (s_GlobalFrame->pManDsd && s_GlobalFrame->pManDsd != pMan) If_DsdManFree((If_DsdMan_t *)s_GlobalFrame->pManDsd, 0); s_GlobalFrame->pManDsd = pMan; } void Abc_FrameSetManDsd2( void * pMan ) { if (s_GlobalFrame->pManDsd2 && s_GlobalFrame->pManDsd2 != pMan) If_DsdManFree((If_DsdMan_t *)s_GlobalFrame->pManDsd2, 0); s_GlobalFrame->pManDsd2 = pMan; } void Abc_FrameSetInv( Vec_Int_t * vInv ) { Vec_IntFreeP(&s_GlobalFrame->pAbcWlcInv); s_GlobalFrame->pAbcWlcInv = vInv; } -void Abc_FrameSetCnf( Vec_Int_t * vCnf ) { Vec_IntFreeP(&s_GlobalFrame->pAbcWlcCnf); s_GlobalFrame->pAbcWlcCnf = vCnf; } -void Abc_FrameSetStr( Vec_Str_t * vStr ) { Vec_StrFreeP(&s_GlobalFrame->pAbcWlcStr); s_GlobalFrame->pAbcWlcStr = vStr; } void Abc_FrameSetJsonStrs( Abc_Nam_t * pStrs ) { Abc_NamDeref( s_GlobalFrame->pJsonStrs ); s_GlobalFrame->pJsonStrs = pStrs; } void Abc_FrameSetJsonObjs( Vec_Wec_t * vObjs ) { Vec_WecFreeP(&s_GlobalFrame->vJsonObjs ); s_GlobalFrame->vJsonObjs = vObjs; } @@ -227,8 +225,6 @@ void Abc_FrameDeallocate( Abc_Frame_t * p ) ABC_FREE( p->pCex2 ); ABC_FREE( p->pCex ); Vec_IntFreeP( &p->pAbcWlcInv ); - Vec_IntFreeP( &p->pAbcWlcCnf ); - Vec_StrFreeP( &p->pAbcWlcStr ); Abc_NamDeref( s_GlobalFrame->pJsonStrs ); Vec_WecFreeP(&s_GlobalFrame->vJsonObjs ); ABC_FREE( p ); diff --git a/src/base/main/mainInt.h b/src/base/main/mainInt.h index ff59b81a..278a9191 100644 --- a/src/base/main/mainInt.h +++ b/src/base/main/mainInt.h @@ -129,8 +129,6 @@ struct Abc_Frame_t_ void * pAbc85Delay; void * pAbcWlc; Vec_Int_t * pAbcWlcInv; - Vec_Int_t * pAbcWlcCnf; - Vec_Str_t * pAbcWlcStr; void * pAbcBac; void * pAbcCba; void * pAbcPla; diff --git a/src/base/main/mainReal.c b/src/base/main/mainReal.c index ee43d38d..31bfef75 100644 --- a/src/base/main/mainReal.c +++ b/src/base/main/mainReal.c @@ -196,7 +196,7 @@ int Abc_RealMain( int argc, char * argv[] ) case 't': if ( TypeCheck( pAbc, globalUtilOptarg ) ) { - if ( !strcmp(globalUtilOptarg, "none") == 0 ) + if ( (!strcmp(globalUtilOptarg, "none")) == 0 ) { fInitRead = 1; sprintf( sReadCmd, "read_%s", globalUtilOptarg ); @@ -211,7 +211,7 @@ int Abc_RealMain( int argc, char * argv[] ) case 'T': if ( TypeCheck( pAbc, globalUtilOptarg ) ) { - if (!strcmp(globalUtilOptarg, "none") == 0) + if ( (!strcmp(globalUtilOptarg, "none")) == 0) { fFinalWrite = 1; sprintf( sWriteCmd, "write_%s", globalUtilOptarg); diff --git a/src/base/wlc/wlcAbc.c b/src/base/wlc/wlcAbc.c index 0bf27f7b..1a98fb71 100644 --- a/src/base/wlc/wlcAbc.c +++ b/src/base/wlc/wlcAbc.c @@ -42,7 +42,7 @@ ABC_NAMESPACE_IMPL_START SeeAlso [] ***********************************************************************/ -void Wlc_NtkPrintInvStats( Wlc_Ntk_t * pNtk, Vec_Int_t * vInv, int fVerbose ) +void Wlc_NtkPrintInvStats( Wlc_Ntk_t * pNtk, Vec_Int_t * vCounts, int fVerbose ) { Wlc_Obj_t * pObj; int i, k, nNum, nRange, nBits = 0; @@ -53,7 +53,7 @@ void Wlc_NtkPrintInvStats( Wlc_Ntk_t * pNtk, Vec_Int_t * vInv, int fVerbose ) nRange = Wlc_ObjRange(pObj); for ( k = 0; k < nRange; k++ ) { - nNum = Vec_IntEntry(vInv, nBits + k); + nNum = Vec_IntEntry(vCounts, nBits + k); if ( nNum ) break; } @@ -65,7 +65,7 @@ void Wlc_NtkPrintInvStats( Wlc_Ntk_t * pNtk, Vec_Int_t * vInv, int fVerbose ) printf( "%s[%d:%d] : ", Wlc_ObjName(pNtk, Wlc_ObjId(pNtk, pObj)), pObj->End, pObj->Beg ); for ( k = 0; k < nRange; k++ ) { - nNum = Vec_IntEntry( vInv, nBits + k ); + nNum = Vec_IntEntry( vCounts, nBits + k ); if ( nNum == 0 ) continue; printf( " [%d] -> %d", k, nNum ); @@ -73,8 +73,8 @@ void Wlc_NtkPrintInvStats( Wlc_Ntk_t * pNtk, Vec_Int_t * vInv, int fVerbose ) printf( "\n"); nBits += nRange; } - //printf( "%d %d\n", Vec_IntSize(vInv), nBits ); - assert( Vec_IntSize(vInv) == nBits ); + //printf( "%d %d\n", Vec_IntSize(vCounts), nBits ); + assert( Vec_IntSize(vCounts) == nBits ); } /**Function************************************************************* @@ -88,8 +88,14 @@ void Wlc_NtkPrintInvStats( Wlc_Ntk_t * pNtk, Vec_Int_t * vInv, int fVerbose ) SeeAlso [] ***********************************************************************/ -Abc_Ntk_t * Wlc_NtkGetInv( Wlc_Ntk_t * pNtk, Vec_Int_t * vInv, Vec_Str_t * vSop, int fVerbose ) +Abc_Ntk_t * Wlc_NtkGetInv( Wlc_Ntk_t * pNtk, Vec_Int_t * vInv ) { + extern Vec_Int_t * Pdr_InvCounts( Vec_Int_t * vInv ); + extern Vec_Str_t * Pdr_InvPrintStr( Vec_Int_t * vInv, Vec_Int_t * vCounts ); + + Vec_Int_t * vCounts = Pdr_InvCounts( vInv ); + Vec_Str_t * vSop = Pdr_InvPrintStr( vInv, vCounts ); + Wlc_Obj_t * pObj; int i, k, nNum, nRange, nBits = 0; Abc_Ntk_t * pMainNtk = NULL; @@ -98,46 +104,69 @@ Abc_Ntk_t * Wlc_NtkGetInv( Wlc_Ntk_t * pNtk, Vec_Int_t * vInv, Vec_Str_t * vSop, // start the network pMainNtk = Abc_NtkAlloc( ABC_NTK_LOGIC, ABC_FUNC_SOP, 1 ); // duplicate the name and the spec - pMainNtk->pName = Extra_UtilStrsav(pNtk->pName); + pMainNtk->pName = Extra_UtilStrsav(pNtk ? pNtk->pName : "inv"); // create primary inputs - Wlc_NtkForEachCi( pNtk, pObj, i ) + if ( pNtk == NULL ) { - if ( pObj->Type != WLC_OBJ_FO ) - continue; - nRange = Wlc_ObjRange(pObj); - for ( k = 0; k < nRange; k++ ) + int Entry, nInputs = Abc_SopGetVarNum( Vec_StrArray(vSop) ); + Vec_IntForEachEntry( vCounts, Entry, i ) { - nNum = Vec_IntEntry(vInv, nBits + k); - if ( nNum ) - break; + if ( Entry == 0 ) + continue; + pMainObj = Abc_NtkCreatePi( pMainNtk ); + sprintf( Buffer, "pi%d", i ); + Abc_ObjAssignName( pMainObj, Buffer, NULL ); } - if ( k == nRange ) + if ( Abc_NtkPiNum(pMainNtk) != nInputs ) { - nBits += nRange; - continue; + printf( "Mismatch between number of inputs and the number of literals in the invariant.\n" ); + Abc_NtkDelete( pMainNtk ); + return NULL; } - //printf( "%s[%d:%d] : ", Wlc_ObjName(pNtk, Wlc_ObjId(pNtk, pObj)), pObj->End, pObj->Beg ); - for ( k = 0; k < nRange; k++ ) + } + else + { + Wlc_NtkForEachCi( pNtk, pObj, i ) { - nNum = Vec_IntEntry( vInv, nBits + k ); - if ( nNum == 0 ) + if ( pObj->Type != WLC_OBJ_FO ) continue; - //printf( " [%d] -> %d", k, nNum ); - pMainObj = Abc_NtkCreatePi( pMainNtk ); - sprintf( Buffer, "%s[%d]", Wlc_ObjName(pNtk, Wlc_ObjId(pNtk, pObj)), k ); - Abc_ObjAssignName( pMainObj, Buffer, NULL ); - + nRange = Wlc_ObjRange(pObj); + for ( k = 0; k < nRange; k++ ) + { + nNum = Vec_IntEntry(vCounts, nBits + k); + if ( nNum ) + break; + } + if ( k == nRange ) + { + nBits += nRange; + continue; + } + //printf( "%s[%d:%d] : ", Wlc_ObjName(pNtk, Wlc_ObjId(pNtk, pObj)), pObj->End, pObj->Beg ); + for ( k = 0; k < nRange; k++ ) + { + nNum = Vec_IntEntry( vCounts, nBits + k ); + if ( nNum == 0 ) + continue; + //printf( " [%d] -> %d", k, nNum ); + pMainObj = Abc_NtkCreatePi( pMainNtk ); + sprintf( Buffer, "%s[%d]", Wlc_ObjName(pNtk, Wlc_ObjId(pNtk, pObj)), k ); + Abc_ObjAssignName( pMainObj, Buffer, NULL ); + + } + //printf( "\n"); + nBits += nRange; } - //printf( "\n"); - nBits += nRange; } - //printf( "%d %d\n", Vec_IntSize(vInv), nBits ); - assert( Vec_IntSize(vInv) == nBits ); + //printf( "%d %d\n", Vec_IntSize(vCounts), nBits ); + assert( pNtk == NULL || Vec_IntSize(vCounts) == nBits ); // create node pMainObj = Abc_NtkCreateNode( pMainNtk ); Abc_NtkForEachPi( pMainNtk, pMainTemp, i ) Abc_ObjAddFanin( pMainObj, pMainTemp ); pMainObj->pData = Abc_SopRegister( (Mem_Flex_t *)pMainNtk->pManFunc, Vec_StrArray(vSop) ); + Vec_IntFree( vCounts ); + Vec_StrFree( vSop ); // create PO pMainTemp = Abc_NtkCreatePo( pMainNtk ); Abc_ObjAddFanin( pMainTemp, pMainObj ); @@ -145,6 +174,66 @@ Abc_Ntk_t * Wlc_NtkGetInv( Wlc_Ntk_t * pNtk, Vec_Int_t * vInv, Vec_Str_t * vSop, return pMainNtk; } +/**Function************************************************************* + + Synopsis [Translate current network into an interpolant.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Vec_Int_t * Wlc_NtkGetPut( Abc_Ntk_t * pNtk, int nRegs ) +{ + Vec_Int_t * vRes = NULL; + if ( Abc_NtkPoNum(pNtk) != 1 ) + printf( "The number of outputs is other than 1.\n" ); + else if ( Abc_NtkNodeNum(pNtk) != 1 ) + printf( "The number of internal nodes is other than 1.\n" ); + else + { + Abc_Obj_t * pNode = Abc_ObjFanin0( Abc_NtkCo(pNtk, 0) ); + char * pName, * pCube, * pSop = (char *)pNode->pData; + Vec_Int_t * vFanins = Vec_IntAlloc( Abc_ObjFaninNum(pNode) ); + Abc_Obj_t * pFanin; int i, k, Value, nLits; + Abc_ObjForEachFanin( pNode, pFanin, i ) + { + assert( Abc_ObjIsCi(pFanin) ); + pName = Abc_ObjName(pFanin); + for ( k = (int)strlen(pName)-1; k >= 0; k-- ) + if ( pName[k] < '0' || pName[k] > '9' ) + break; + if ( k == (int)strlen(pName)-1 ) + { + printf( "Cannot read input name of fanin %d.\n", i ); + Value = i; + } + else + Value = atoi(pName + k + 1); + Vec_IntPush( vFanins, Value ); + } + assert( Vec_IntSize(vFanins) == Abc_ObjFaninNum(pNode) ); + vRes = Vec_IntAlloc( 1000 ); + Vec_IntPush( vRes, Abc_SopGetCubeNum(pSop) ); + Abc_SopForEachCube( pSop, Abc_ObjFaninNum(pNode), pCube ) + { + nLits = 0; + Abc_CubeForEachVar( pCube, Value, k ) + if ( Value != '-' ) + nLits++; + Vec_IntPush( vRes, nLits ); + Abc_CubeForEachVar( pCube, Value, k ) + if ( Value != '-' ) + Vec_IntPush( vRes, Abc_Var2Lit(Vec_IntEntry(vFanins, k), (int)Value == '0') ); + } + Vec_IntPush( vRes, nRegs ); + Vec_IntFree( vFanins ); + } + return vRes; +} + //////////////////////////////////////////////////////////////////////// /// END OF FILE /// //////////////////////////////////////////////////////////////////////// diff --git a/src/base/wlc/wlcBlast.c b/src/base/wlc/wlcBlast.c index ec3b040d..b49c2dd7 100644 --- a/src/base/wlc/wlcBlast.c +++ b/src/base/wlc/wlcBlast.c @@ -643,6 +643,41 @@ void Wlc_IntInsert( Vec_Int_t * vProd, Vec_Int_t * vLevel, int Node, int Level ) Vec_IntInsert( vProd, i + 1, Node ); Vec_IntInsert( vLevel, i + 1, Level ); } +void Wlc_BlastPrintMatrix( Gia_Man_t * p, Vec_Wec_t * vProds ) +{ + int fVerbose = 0; + Vec_Int_t * vSupp = Vec_IntAlloc( 100 ); + Vec_Wrd_t * vTemp = Vec_WrdStart( Gia_ManObjNum(p) ); + Vec_Int_t * vLevel; word Truth; + int i, k, iLit; + Vec_WecForEachLevel( vProds, vLevel, i ) + Vec_IntForEachEntry( vLevel, iLit, k ) + if ( Gia_ObjIsAnd(Gia_ManObj(p, Abc_Lit2Var(iLit))) ) + Vec_IntPushUnique( vSupp, Abc_Lit2Var(iLit) ); + printf( "Booth partial products: %d pps, %d unique, %d nodes.\n", + Vec_WecSizeSize(vProds), Vec_IntSize(vSupp), Gia_ManAndNum(p) ); + Vec_IntPrint( vSupp ); + + if ( fVerbose ) + Vec_WecForEachLevel( vProds, vLevel, i ) + Vec_IntForEachEntry( vLevel, iLit, k ) + { + printf( "Obj = %4d : ", Abc_Lit2Var(iLit) ); + printf( "Compl = %d ", Abc_LitIsCompl(iLit) ); + printf( "Rank = %2d ", i ); + Truth = Gia_ObjComputeTruth6Cis( p, iLit, vSupp, vTemp ); + Extra_PrintHex( stdout, (unsigned*)&Truth, Vec_IntSize(vSupp) ); + if ( Vec_IntSize(vSupp) == 4 ) printf( " " ); + if ( Vec_IntSize(vSupp) == 3 ) printf( " " ); + if ( Vec_IntSize(vSupp) <= 2 ) printf( " " ); + printf( " " ); + Vec_IntPrint( vSupp ); + if ( k == Vec_IntSize(vLevel)-1 ) + printf( "\n" ); + } + Vec_IntFree( vSupp ); + Vec_WrdFree( vTemp ); +} void Wlc_BlastReduceMatrix( Gia_Man_t * pNew, Vec_Wec_t * vProds, Vec_Wec_t * vLevels, Vec_Int_t * vRes ) { Vec_Int_t * vLevel, * vProd; @@ -812,6 +847,7 @@ void Wlc_BlastBooth( Gia_Man_t * pNew, int * pArgA, int * pArgB, int nArgA, int Vec_WecPush( vLevels, k, 0 ); } //Vec_WecPrint( vProds, 0 ); + //Wlc_BlastPrintMatrix( pNew, vProds ); //printf( "Cutoff ID for partial products = %d.\n", Gia_ManObjNum(pNew) ); Wlc_BlastReduceMatrix( pNew, vProds, vLevels, vRes ); @@ -1509,7 +1545,7 @@ Gia_Man_t * Wlc_NtkBitBlast( Wlc_Ntk_t * p, Vec_Int_t * vBoxIds, int iOutput, in assert( Vec_PtrSize(pNew->vNamesOut) == Gia_ManCoNum(pNew) ); } - pNew->pSpec = Abc_UtilStrsav( p->pSpec ? p->pSpec : p->pName ); + //pNew->pSpec = Abc_UtilStrsav( p->pSpec ? p->pSpec : p->pName ); // dump the miter parts if ( 0 ) { diff --git a/src/base/wlc/wlcCom.c b/src/base/wlc/wlcCom.c index f3eb6dd7..93614938 100644 --- a/src/base/wlc/wlcCom.c +++ b/src/base/wlc/wlcCom.c @@ -32,18 +32,21 @@ static int Abc_CommandReadWlc ( Abc_Frame_t * pAbc, int argc, char ** argv ); static int Abc_CommandWriteWlc ( Abc_Frame_t * pAbc, int argc, char ** argv ); static int Abc_CommandPs ( Abc_Frame_t * pAbc, int argc, char ** argv ); static int Abc_CommandBlast ( Abc_Frame_t * pAbc, int argc, char ** argv ); -static int Abc_CommandPsInv ( Abc_Frame_t * pAbc, int argc, char ** argv ); -static int Abc_CommandGetInv ( Abc_Frame_t * pAbc, int argc, char ** argv ); static int Abc_CommandProfile ( Abc_Frame_t * pAbc, int argc, char ** argv ); static int Abc_CommandTest ( Abc_Frame_t * pAbc, int argc, char ** argv ); +static int Abc_CommandInvPs ( Abc_Frame_t * pAbc, int argc, char ** argv ); +static int Abc_CommandInvPrint ( Abc_Frame_t * pAbc, int argc, char ** argv ); +static int Abc_CommandInvCheck ( Abc_Frame_t * pAbc, int argc, char ** argv ); +static int Abc_CommandInvGet ( Abc_Frame_t * pAbc, int argc, char ** argv ); +static int Abc_CommandInvPut ( Abc_Frame_t * pAbc, int argc, char ** argv ); +static int Abc_CommandInvMin ( Abc_Frame_t * pAbc, int argc, char ** argv ); + static inline Wlc_Ntk_t * Wlc_AbcGetNtk( Abc_Frame_t * pAbc ) { return (Wlc_Ntk_t *)pAbc->pAbcWlc; } static inline void Wlc_AbcFreeNtk( Abc_Frame_t * pAbc ) { if ( pAbc->pAbcWlc ) Wlc_NtkFree(Wlc_AbcGetNtk(pAbc)); } static inline void Wlc_AbcUpdateNtk( Abc_Frame_t * pAbc, Wlc_Ntk_t * pNtk ) { Wlc_AbcFreeNtk(pAbc); pAbc->pAbcWlc = pNtk; } static inline Vec_Int_t * Wlc_AbcGetInv( Abc_Frame_t * pAbc ) { return pAbc->pAbcWlcInv; } -static inline Vec_Int_t * Wlc_AbcGetCnf( Abc_Frame_t * pAbc ) { return pAbc->pAbcWlcCnf; } -static inline Vec_Str_t * Wlc_AbcGetStr( Abc_Frame_t * pAbc ) { return pAbc->pAbcWlcStr; } //////////////////////////////////////////////////////////////////////// /// FUNCTION DEFINITIONS /// @@ -66,10 +69,15 @@ void Wlc_Init( Abc_Frame_t * pAbc ) Cmd_CommandAdd( pAbc, "Word level", "%write", Abc_CommandWriteWlc, 0 ); Cmd_CommandAdd( pAbc, "Word level", "%ps", Abc_CommandPs, 0 ); Cmd_CommandAdd( pAbc, "Word level", "%blast", Abc_CommandBlast, 0 ); - Cmd_CommandAdd( pAbc, "Word level", "%psinv", Abc_CommandPsInv, 0 ); - Cmd_CommandAdd( pAbc, "Word level", "%getinv", Abc_CommandGetInv, 0 ); Cmd_CommandAdd( pAbc, "Word level", "%profile", Abc_CommandProfile, 0 ); Cmd_CommandAdd( pAbc, "Word level", "%test", Abc_CommandTest, 0 ); + + Cmd_CommandAdd( pAbc, "Word level", "inv_ps", Abc_CommandInvPs, 0 ); + Cmd_CommandAdd( pAbc, "Word level", "inv_print", Abc_CommandInvPrint, 0 ); + Cmd_CommandAdd( pAbc, "Word level", "inv_check", Abc_CommandInvCheck, 0 ); + Cmd_CommandAdd( pAbc, "Word level", "inv_get", Abc_CommandInvGet, 0 ); + Cmd_CommandAdd( pAbc, "Word level", "inv_put", Abc_CommandInvPut, 0 ); + Cmd_CommandAdd( pAbc, "Word level", "inv_min", Abc_CommandInvMin, 0 ); } /**Function******************************************************************** @@ -440,10 +448,108 @@ usage: SeeAlso [] ******************************************************************************/ -int Abc_CommandPsInv( Abc_Frame_t * pAbc, int argc, char ** argv ) +int Abc_CommandProfile( Abc_Frame_t * pAbc, int argc, char ** argv ) { + Wlc_Ntk_t * pNtk = Wlc_AbcGetNtk(pAbc); + int c, fVerbose = 0; + Extra_UtilGetoptReset(); + while ( ( c = Extra_UtilGetopt( argc, argv, "vh" ) ) != EOF ) + { + switch ( c ) + { + case 'v': + fVerbose ^= 1; + break; + case 'h': + goto usage; + default: + goto usage; + } + } + if ( pNtk == NULL ) + { + Abc_Print( 1, "Abc_CommandProfile(): There is no current design.\n" ); + return 0; + } + Wlc_WinProfileArith( pNtk ); + return 0; +usage: + Abc_Print( -2, "usage: %%profile [-vh]\n" ); + Abc_Print( -2, "\t profiles arithmetic components in the word-level networks\n" ); + Abc_Print( -2, "\t-v : toggle printing verbose information [default = %s]\n", fVerbose? "yes": "no" ); + Abc_Print( -2, "\t-h : print the command usage\n"); + return 1; +} + +/**Function******************************************************************** + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +******************************************************************************/ +int Abc_CommandTest( Abc_Frame_t * pAbc, int argc, char ** argv ) +{ + extern void Wlc_NtkSimulateTest( Wlc_Ntk_t * p ); + Wlc_Ntk_t * pNtk = Wlc_AbcGetNtk(pAbc); + int c, fVerbose = 0; + Extra_UtilGetoptReset(); + while ( ( c = Extra_UtilGetopt( argc, argv, "vh" ) ) != EOF ) + { + switch ( c ) + { + case 'v': + fVerbose ^= 1; + break; + case 'h': + goto usage; + default: + goto usage; + } + } + if ( pNtk == NULL ) + { + Abc_Print( 1, "Abc_CommandTest(): There is no current design.\n" ); + return 0; + } + // transform + //pNtk = Wlc_NtkUifNodePairs( pNtk, NULL ); + //pNtk = Wlc_NtkAbstractNodes( pNtk, NULL ); + //Wlc_AbcUpdateNtk( pAbc, pNtk ); + //Wlc_GenerateSmtStdout( pAbc ); + //Wlc_NtkSimulateTest( (Wlc_Ntk_t *)pAbc->pAbcWlc ); + pNtk = Wlc_NtkDupSingleNodes( pNtk ); + Wlc_AbcUpdateNtk( pAbc, pNtk ); + return 0; +usage: + Abc_Print( -2, "usage: %%test [-vh]\n" ); + Abc_Print( -2, "\t experiments with word-level networks\n" ); + Abc_Print( -2, "\t-v : toggle printing verbose information [default = %s]\n", fVerbose? "yes": "no" ); + Abc_Print( -2, "\t-h : print the command usage\n"); + return 1; +} + +/**Function******************************************************************** + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +******************************************************************************/ +int Abc_CommandInvPs( Abc_Frame_t * pAbc, int argc, char ** argv ) +{ + extern Vec_Int_t * Pdr_InvCounts( Vec_Int_t * vInv ); extern void Wlc_NtkPrintInvStats( Wlc_Ntk_t * pNtk, Vec_Int_t * vInv, int fVerbose ); Wlc_Ntk_t * pNtk = Wlc_AbcGetNtk(pAbc); + Vec_Int_t * vCounts; int c, fVerbose = 0; Extra_UtilGetoptReset(); while ( ( c = Extra_UtilGetopt( argc, argv, "vh" ) ) != EOF ) @@ -461,24 +567,66 @@ int Abc_CommandPsInv( Abc_Frame_t * pAbc, int argc, char ** argv ) } if ( pNtk == NULL ) { - Abc_Print( 1, "Abc_CommandPsInv(): There is no current design.\n" ); + Abc_Print( 1, "Abc_CommandInvPs(): There is no current design.\n" ); return 0; } - if ( Wlc_AbcGetNtk(pAbc) == NULL ) + if ( Wlc_AbcGetInv(pAbc) == NULL ) { - Abc_Print( 1, "Abc_CommandPsInv(): There is no saved invariant.\n" ); + Abc_Print( 1, "Abc_CommandInvPs(): Invariant is not available.\n" ); return 0; } + vCounts = Pdr_InvCounts( Wlc_AbcGetInv(pAbc) ); + Wlc_NtkPrintInvStats( pNtk, vCounts, fVerbose ); + Vec_IntFree( vCounts ); + return 0; +usage: + Abc_Print( -2, "usage: inv_ps [-vh]\n" ); + Abc_Print( -2, "\t prints statistics for inductive invariant\n" ); + Abc_Print( -2, "\t (in the case of \'sat\' or \'undecided\', inifity clauses are used)\n" ); + Abc_Print( -2, "\t-v : toggle printing verbose information [default = %s]\n", fVerbose? "yes": "no" ); + Abc_Print( -2, "\t-h : print the command usage\n"); + return 1; +} + +/**Function******************************************************************** + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +******************************************************************************/ +int Abc_CommandInvPrint( Abc_Frame_t * pAbc, int argc, char ** argv ) +{ + extern void Pdr_InvPrint( Vec_Int_t * vInv ); + int c, fVerbose = 0; + Extra_UtilGetoptReset(); + while ( ( c = Extra_UtilGetopt( argc, argv, "vh" ) ) != EOF ) + { + switch ( c ) + { + case 'v': + fVerbose ^= 1; + break; + case 'h': + goto usage; + default: + goto usage; + } + } if ( Wlc_AbcGetInv(pAbc) == NULL ) { - Abc_Print( 1, "Abc_CommandPsInv(): Invariant is not available.\n" ); + Abc_Print( 1, "Abc_CommandInvPs(): Invariant is not available.\n" ); return 0; } - Wlc_NtkPrintInvStats( pNtk, Wlc_AbcGetInv(pAbc), fVerbose ); + Pdr_InvPrint( Wlc_AbcGetInv(pAbc) ); return 0; - usage: - Abc_Print( -2, "usage: %%psinv [-vh]\n" ); - Abc_Print( -2, "\t prints statistics for inductive invariant\n" ); +usage: + Abc_Print( -2, "usage: inv_print [-vh]\n" ); + Abc_Print( -2, "\t prints the current inductive invariant\n" ); Abc_Print( -2, "\t (in the case of \'sat\' or \'undecided\', inifity clauses are used)\n" ); Abc_Print( -2, "\t-v : toggle printing verbose information [default = %s]\n", fVerbose? "yes": "no" ); Abc_Print( -2, "\t-h : print the command usage\n"); @@ -496,11 +644,9 @@ int Abc_CommandPsInv( Abc_Frame_t * pAbc, int argc, char ** argv ) SeeAlso [] ******************************************************************************/ -int Abc_CommandGetInv( Abc_Frame_t * pAbc, int argc, char ** argv ) +int Abc_CommandInvCheck( Abc_Frame_t * pAbc, int argc, char ** argv ) { - extern Abc_Ntk_t * Wlc_NtkGetInv( Wlc_Ntk_t * pNtk, Vec_Int_t * vInv, Vec_Str_t * vSop, int fVerbose ); - Abc_Ntk_t * pMainNtk; - Wlc_Ntk_t * pNtk = Wlc_AbcGetNtk(pAbc); + extern Vec_Int_t * Pdr_InvCheck( Gia_Man_t * p, Vec_Int_t * vInv ); int c, fVerbose = 0; Extra_UtilGetoptReset(); while ( ( c = Extra_UtilGetopt( argc, argv, "vh" ) ) != EOF ) @@ -516,28 +662,76 @@ int Abc_CommandGetInv( Abc_Frame_t * pAbc, int argc, char ** argv ) goto usage; } } - if ( pNtk == NULL ) + if ( pAbc->pGia == NULL ) + { + Abc_Print( 1, "Abc_CommandInvMin(): There is no current design.\n" ); + return 0; + } + if ( Wlc_AbcGetInv(pAbc) == NULL ) { - Abc_Print( 1, "Abc_CommandGetInv(): There is no current design.\n" ); + Abc_Print( 1, "Abc_CommandInvMin(): There is no saved invariant.\n" ); return 0; } - if ( Wlc_AbcGetNtk(pAbc) == NULL ) + if ( Gia_ManRegNum(pAbc->pGia) != Vec_IntEntryLast(Wlc_AbcGetInv(pAbc)) ) { - Abc_Print( 1, "Abc_CommandGetInv(): There is no saved invariant.\n" ); + Abc_Print( 1, "Abc_CommandInvMin(): The number of flops in the invariant and in GIA should be the same.\n" ); return 0; } + Pdr_InvCheck( pAbc->pGia, Wlc_AbcGetInv(pAbc) ); + return 0; +usage: + Abc_Print( -2, "usage: inv_check [-vh]\n" ); + Abc_Print( -2, "\t checks that the invariant is indeed an inductive invariant\n" ); + Abc_Print( -2, "\t (AIG representing the design should be in the &-space)\n" ); + Abc_Print( -2, "\t-v : toggle printing verbose information [default = %s]\n", fVerbose? "yes": "no" ); + Abc_Print( -2, "\t-h : print the command usage\n"); + return 1; +} + +/**Function******************************************************************** + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +******************************************************************************/ +int Abc_CommandInvGet( Abc_Frame_t * pAbc, int argc, char ** argv ) +{ + extern Abc_Ntk_t * Wlc_NtkGetInv( Wlc_Ntk_t * pNtk, Vec_Int_t * vInv ); + Abc_Ntk_t * pMainNtk; + Wlc_Ntk_t * pNtk = Wlc_AbcGetNtk(pAbc); + int c, fVerbose = 0; + Extra_UtilGetoptReset(); + while ( ( c = Extra_UtilGetopt( argc, argv, "vh" ) ) != EOF ) + { + switch ( c ) + { + case 'v': + fVerbose ^= 1; + break; + case 'h': + goto usage; + default: + goto usage; + } + } if ( Wlc_AbcGetInv(pAbc) == NULL ) { - Abc_Print( 1, "Abc_CommandGetInv(): Invariant is not available.\n" ); + Abc_Print( 1, "Abc_CommandInvGet(): Invariant is not available.\n" ); return 0; } // derive the network - pMainNtk = Wlc_NtkGetInv( pNtk, Wlc_AbcGetInv(pAbc), Wlc_AbcGetStr(pAbc), fVerbose ); + pMainNtk = Wlc_NtkGetInv( pNtk, Wlc_AbcGetInv(pAbc) ); // replace the current network - Abc_FrameReplaceCurrentNetwork( pAbc, pMainNtk ); + if ( pMainNtk ) + Abc_FrameReplaceCurrentNetwork( pAbc, pMainNtk ); return 0; - usage: - Abc_Print( -2, "usage: %%getinv [-vh]\n" ); +usage: + Abc_Print( -2, "usage: inv_get [-vh]\n" ); Abc_Print( -2, "\t places invariant found by PDR as the current network in the main-space\n" ); Abc_Print( -2, "\t (in the case of \'sat\' or \'undecided\', inifity clauses are used)\n" ); Abc_Print( -2, "\t-v : toggle printing verbose information [default = %s]\n", fVerbose? "yes": "no" ); @@ -556,34 +750,45 @@ int Abc_CommandGetInv( Abc_Frame_t * pAbc, int argc, char ** argv ) SeeAlso [] ******************************************************************************/ -int Abc_CommandProfile( Abc_Frame_t * pAbc, int argc, char ** argv ) +int Abc_CommandInvPut( Abc_Frame_t * pAbc, int argc, char ** argv ) { - Wlc_Ntk_t * pNtk = Wlc_AbcGetNtk(pAbc); + extern Vec_Int_t * Wlc_NtkGetPut( Abc_Ntk_t * pNtk, int nRegs ); + Vec_Int_t * vInv = NULL; + Abc_Ntk_t * pNtk = Abc_FrameReadNtk(pAbc); int c, fVerbose = 0; Extra_UtilGetoptReset(); while ( ( c = Extra_UtilGetopt( argc, argv, "vh" ) ) != EOF ) { switch ( c ) { - case 'v': - fVerbose ^= 1; - break; - case 'h': - goto usage; - default: - goto usage; + case 'v': + fVerbose ^= 1; + break; + case 'h': + goto usage; + default: + goto usage; } } if ( pNtk == NULL ) { - Abc_Print( 1, "Abc_CommandProfile(): There is no current design.\n" ); + Abc_Print( 1, "Abc_CommandInvPut(): There is no current design.\n" ); return 0; } - Wlc_WinProfileArith( pNtk ); + if ( pAbc->pGia == NULL ) + { + Abc_Print( 1, "Abc_CommandInvPut(): There is no current AIG.\n" ); + return 0; + } + // derive the network + vInv = Wlc_NtkGetPut( pNtk, Gia_ManRegNum(pAbc->pGia) ); + if ( vInv ) + Abc_FrameSetInv( vInv ); return 0; usage: - Abc_Print( -2, "usage: %%profile [-vh]\n" ); - Abc_Print( -2, "\t profiles arithmetic components in the word-level networks\n" ); + Abc_Print( -2, "usage: inv_put [-vh]\n" ); + Abc_Print( -2, "\t inputs the current network in the main-space as an invariant\n" ); + Abc_Print( -2, "\t (AIG representing the design should be in the &-space)\n" ); Abc_Print( -2, "\t-v : toggle printing verbose information [default = %s]\n", fVerbose? "yes": "no" ); Abc_Print( -2, "\t-h : print the command usage\n"); return 1; @@ -600,42 +805,49 @@ usage: SeeAlso [] ******************************************************************************/ -int Abc_CommandTest( Abc_Frame_t * pAbc, int argc, char ** argv ) +int Abc_CommandInvMin( Abc_Frame_t * pAbc, int argc, char ** argv ) { - extern void Wlc_NtkSimulateTest( Wlc_Ntk_t * p ); - Wlc_Ntk_t * pNtk = Wlc_AbcGetNtk(pAbc); + extern Vec_Int_t * Pdr_InvMinimize( Gia_Man_t * p, Vec_Int_t * vInv ); + Vec_Int_t * vInv, * vInv2; int c, fVerbose = 0; Extra_UtilGetoptReset(); while ( ( c = Extra_UtilGetopt( argc, argv, "vh" ) ) != EOF ) { switch ( c ) { - case 'v': - fVerbose ^= 1; - break; - case 'h': - goto usage; - default: - goto usage; + case 'v': + fVerbose ^= 1; + break; + case 'h': + goto usage; + default: + goto usage; } } - if ( pNtk == NULL ) + if ( pAbc->pGia == NULL ) { - Abc_Print( 1, "Abc_CommandTest(): There is no current design.\n" ); + Abc_Print( 1, "Abc_CommandInvMin(): There is no current design.\n" ); return 0; } - // transform - //pNtk = Wlc_NtkUifNodePairs( pNtk, NULL ); - //pNtk = Wlc_NtkAbstractNodes( pNtk, NULL ); - //Wlc_AbcUpdateNtk( pAbc, pNtk ); - //Wlc_GenerateSmtStdout( pAbc ); - //Wlc_NtkSimulateTest( (Wlc_Ntk_t *)pAbc->pAbcWlc ); - pNtk = Wlc_NtkDupSingleNodes( pNtk ); - Wlc_AbcUpdateNtk( pAbc, pNtk ); + if ( Wlc_AbcGetInv(pAbc) == NULL ) + { + Abc_Print( 1, "Abc_CommandInvMin(): Invariant is not available.\n" ); + return 0; + } + vInv = Wlc_AbcGetInv(pAbc); + if ( Gia_ManRegNum(pAbc->pGia) != Vec_IntEntryLast(vInv) ) + { + Abc_Print( 1, "Abc_CommandInvMin(): The number of flops in the invariant and in GIA should be the same.\n" ); + return 0; + } + vInv2 = Pdr_InvMinimize( pAbc->pGia, vInv ); + if ( vInv2 ) + Abc_FrameSetInv( vInv2 ); return 0; usage: - Abc_Print( -2, "usage: %%test [-vh]\n" ); - Abc_Print( -2, "\t experiments with word-level networks\n" ); + Abc_Print( -2, "usage: inv_min [-vh]\n" ); + Abc_Print( -2, "\t minimizes the number of clauses in the current invariant\n" ); + Abc_Print( -2, "\t (AIG representing the design should be in the &-space)\n" ); Abc_Print( -2, "\t-v : toggle printing verbose information [default = %s]\n", fVerbose? "yes": "no" ); Abc_Print( -2, "\t-h : print the command usage\n"); return 1; diff --git a/src/map/if/ifDec16.c b/src/map/if/ifDec16.c index 22de91ba..4b555bf8 100644 --- a/src/map/if/ifDec16.c +++ b/src/map/if/ifDec16.c @@ -902,7 +902,7 @@ void If_CluReverseOrder_old( word * pF, int nVars, int * V2P, int * P2V, int iVa // return the number of cofactors w.r.t. the topmost vars (nBSsize) int If_CluCountCofs( word * pF, int nVars, int nBSsize, int iShift, word pCofs[3][CLU_WRD_MAX/4] ) { - word iCofs[128], iCof, Result = 0; + word iCofs[128] = {0}, iCof, Result = 0; word * pCofA, * pCofB; int nMints = (1 << nBSsize); int i, c, w, nCofs; diff --git a/src/map/if/ifLibLut.c b/src/map/if/ifLibLut.c index 26fa137b..1033cc1f 100644 --- a/src/map/if/ifLibLut.c +++ b/src/map/if/ifLibLut.c @@ -75,6 +75,7 @@ If_LibLut_t * If_LibLutRead( char * FileName ) Abc_Print( 1, "Error in the LUT library file \"%s\".\n", FileName ); ABC_FREE( p->pName ); ABC_FREE( p ); + fclose( pFile ); return NULL; } @@ -93,6 +94,7 @@ If_LibLut_t * If_LibLutRead( char * FileName ) ABC_FREE( p->pName ); ABC_FREE( p ); Abc_Print( 1, "LUT %d has too many pins (%d). Max allowed is %d.\n", i, k, i ); + fclose( pFile ); return NULL; } @@ -105,6 +107,7 @@ If_LibLut_t * If_LibLutRead( char * FileName ) ABC_FREE( p->pName ); ABC_FREE( p ); Abc_Print( 1, "Skipping LUTs of size more than %d.\n", i ); + fclose( pFile ); return NULL; } i++; @@ -136,6 +139,7 @@ If_LibLut_t * If_LibLutRead( char * FileName ) } } + fclose( pFile ); return p; } diff --git a/src/map/scl/sclLiberty.c b/src/map/scl/sclLiberty.c index 50e69d08..b48cfbe1 100644 --- a/src/map/scl/sclLiberty.c +++ b/src/map/scl/sclLiberty.c @@ -509,7 +509,7 @@ char * Scl_LibertyFileContents( char * pFileName, int nContents ) { FILE * pFile = fopen( pFileName, "rb" ); char * pContents = ABC_ALLOC( char, nContents+1 ); - int RetValue; + int RetValue = 0; RetValue = fread( pContents, nContents, 1, pFile ); fclose( pFile ); pContents[nContents] = 0; @@ -518,7 +518,7 @@ char * Scl_LibertyFileContents( char * pFileName, int nContents ) void Scl_LibertyStringDump( char * pFileName, Vec_Str_t * vStr ) { FILE * pFile = fopen( pFileName, "wb" ); - int RetValue; + int RetValue = 0; if ( pFile == NULL ) { printf( "Scl_LibertyStringDump(): The output file is unavailable.\n" ); @@ -583,7 +583,7 @@ Scl_Tree_t * Scl_LibertyParse( char * pFileName, int fVerbose ) return NULL; pPos = p->pContents; Scl_LibertyWipeOutComments( p->pContents, p->pContents+p->nContents ); - if ( !Scl_LibertyBuildItem( p, &pPos, p->pContents + p->nContents ) == 0 ) + if ( (!Scl_LibertyBuildItem( p, &pPos, p->pContents + p->nContents )) == 0 ) { if ( p->pError ) printf( "%s", p->pError ); printf( "Parsing failed. " ); @@ -765,10 +765,10 @@ Vec_Str_t * Scl_LibertyParseGenlibStr( char * pFileName, int fVerbose ) ***********************************************************************/ //#define SCL_DEBUG #ifdef SCL_DEBUG -static inline void Vec_StrPutI_( Vec_Str_t * vOut, int Val ) { printf( "%d ", Val ); Vec_StrPutI( vOut, Val ); } -static inline void Vec_StrPutW_( Vec_Str_t * vOut, word Val ) { printf( "%lu ", Val ); Vec_StrPutW( vOut, Val ); } -static inline void Vec_StrPutF_( Vec_Str_t * vOut, float Val ) { printf( "%f ", Val ); Vec_StrPutF( vOut, Val ); } -static inline void Vec_StrPutS_( Vec_Str_t * vOut, char * Val ) { printf( "%s ", Val ); Vec_StrPutS( vOut, Val ); } +static inline void Vec_StrPutI_( Vec_Str_t * vOut, int Val ) { printf( "%d ", Val ); Vec_StrPutI( vOut, Val ); } +static inline void Vec_StrPutW_( Vec_Str_t * vOut, word Val ) { printf( "%lu ", (long)Val ); Vec_StrPutW( vOut, Val ); } +static inline void Vec_StrPutF_( Vec_Str_t * vOut, float Val ) { printf( "%f ", Val ); Vec_StrPutF( vOut, Val ); } +static inline void Vec_StrPutS_( Vec_Str_t * vOut, char * Val ) { printf( "%s ", Val ); Vec_StrPutS( vOut, Val ); } static inline void Vec_StrPut_( Vec_Str_t * vOut ) { printf( "\n" ); } #else static inline void Vec_StrPutI_( Vec_Str_t * vOut, int Val ) { Vec_StrPutI( vOut, Val ); } diff --git a/src/misc/util/utilTruth.h b/src/misc/util/utilTruth.h index b8a34da7..d77ed64d 100644 --- a/src/misc/util/utilTruth.h +++ b/src/misc/util/utilTruth.h @@ -2612,7 +2612,7 @@ static inline int Abc_TtProcessBiDec( word * pTruth, int nVars, int nSuppLim ) static inline void Abc_TtProcessBiDecTest( word * pTruth, int nVars, int nSuppLim ) { word This, That, pTemp[64]; - int Res, resThis, resThat, nThis, nThat; + int Res, resThis, resThat;//, nThis, nThat; int nWords = Abc_TtWordNum(nVars); Abc_TtCopy( pTemp, pTruth, nWords, 0 ); Res = Abc_TtProcessBiDec( pTemp, nVars, nSuppLim ); @@ -2634,8 +2634,8 @@ static inline void Abc_TtProcessBiDecTest( word * pTruth, int nVars, int nSuppLi // Dau_DsdPrintFromTruth( pTemp, nVars ); - nThis = Abc_TtBitCount16(resThis); - nThat = Abc_TtBitCount16(resThat); + //nThis = Abc_TtBitCount16(resThis); + //nThat = Abc_TtBitCount16(resThat); printf( "Variable sets: " ); Abc_TtPrintVarSet( resThis, nVars ); diff --git a/src/misc/vec/vecInt.h b/src/misc/vec/vecInt.h index f09b8783..d952518f 100644 --- a/src/misc/vec/vecInt.h +++ b/src/misc/vec/vecInt.h @@ -1692,6 +1692,24 @@ static inline int Vec_IntTwoFindCommon( Vec_Int_t * vArr1, Vec_Int_t * vArr2, Ve } return Vec_IntSize(vArr); } +static inline int Vec_IntTwoFindCommonReverse( Vec_Int_t * vArr1, Vec_Int_t * vArr2, Vec_Int_t * vArr ) +{ + int * pBeg1 = vArr1->pArray; + int * pBeg2 = vArr2->pArray; + int * pEnd1 = vArr1->pArray + vArr1->nSize; + int * pEnd2 = vArr2->pArray + vArr2->nSize; + Vec_IntClear( vArr ); + while ( pBeg1 < pEnd1 && pBeg2 < pEnd2 ) + { + if ( *pBeg1 == *pBeg2 ) + Vec_IntPush( vArr, *pBeg1 ), pBeg1++, pBeg2++; + else if ( *pBeg1 > *pBeg2 ) + pBeg1++; + else + pBeg2++; + } + return Vec_IntSize(vArr); +} /**Function************************************************************* diff --git a/src/misc/vec/vecPtr.h b/src/misc/vec/vecPtr.h index 5b40665f..015aa1be 100644 --- a/src/misc/vec/vecPtr.h +++ b/src/misc/vec/vecPtr.h @@ -65,7 +65,7 @@ struct Vec_Ptr_t_ #define Vec_PtrForEachEntryTwo( Type1, vVec1, Type2, vVec2, pEntry1, pEntry2, i ) \ for ( i = 0; (i < Vec_PtrSize(vVec1)) && (((pEntry1) = (Type1)Vec_PtrEntry(vVec1, i)), 1) && (((pEntry2) = (Type2)Vec_PtrEntry(vVec2, i)), 1); i++ ) #define Vec_PtrForEachEntryDouble( Type1, Type2, vVec, Entry1, Entry2, i ) \ - for ( i = 0; (i+1 < Vec_IntSize(vVec)) && (((Entry1) = (Type1)Vec_PtrEntry(vVec, i)), 1) && (((Entry2) = (Type2)Vec_PtrEntry(vVec, i+1)), 1); i += 2 ) + for ( i = 0; (i+1 < Vec_PtrSize(vVec)) && (((Entry1) = (Type1)Vec_PtrEntry(vVec, i)), 1) && (((Entry2) = (Type2)Vec_PtrEntry(vVec, i+1)), 1); i += 2 ) //////////////////////////////////////////////////////////////////////// /// FUNCTION DEFINITIONS /// diff --git a/src/misc/vec/vecWec.h b/src/misc/vec/vecWec.h index e4e92503..c8c89701 100644 --- a/src/misc/vec/vecWec.h +++ b/src/misc/vec/vecWec.h @@ -303,6 +303,23 @@ static inline Vec_Int_t * Vec_WecPushLevel( Vec_Wec_t * p ) ++p->nSize; return Vec_WecEntryLast( p ); } +static inline Vec_Int_t * Vec_WecInsertLevel( Vec_Wec_t * p, int i ) +{ + Vec_Int_t * pTemp; + if ( p->nSize == p->nCap ) + { + if ( p->nCap < 16 ) + Vec_WecGrow( p, 16 ); + else + Vec_WecGrow( p, 2 * p->nCap ); + } + ++p->nSize; + assert( i >= 0 && i < p->nSize ); + for ( pTemp = p->pArray + p->nSize - 2; pTemp >= p->pArray + i; pTemp-- ) + pTemp[1] = pTemp[0]; + Vec_IntZero( p->pArray + i ); + return p->pArray + i; +} /**Function************************************************************* @@ -544,6 +561,18 @@ static inline void Vec_WecPrint( Vec_Wec_t * p, int fSkipSingles ) printf( " }\n" ); } } +static inline void Vec_WecPrintLits( Vec_Wec_t * p ) +{ + Vec_Int_t * vVec; + int i, k, iLit; + Vec_WecForEachLevel( p, vVec, i ) + { + printf( " %4d : %2d {", i, Vec_IntSize(vVec) ); + Vec_IntForEachEntry( vVec, iLit, k ) + printf( " %c%d", Abc_LitIsCompl(iLit) ? '-' : '+', Abc_Lit2Var(iLit) ); + printf( " }\n" ); + } +} /**Function************************************************************* diff --git a/src/misc/zlib/inflate.c b/src/misc/zlib/inflate.c index 449779a9..9fae7045 100644 --- a/src/misc/zlib/inflate.c +++ b/src/misc/zlib/inflate.c @@ -1445,7 +1445,7 @@ long ZEXPORT inflateMark(z_streamp strm) { struct inflate_state FAR *state; - if (strm == Z_NULL || strm->state == Z_NULL) return -1L << 16; + if (strm == Z_NULL || strm->state == Z_NULL) return -(1L << 16); state = (struct inflate_state FAR *)strm->state; return ((long)(state->back) << 16) + (state->mode == COPY ? state->length : diff --git a/src/opt/dau/dauGia.c b/src/opt/dau/dauGia.c index 5e74ad21..fa757e62 100644 --- a/src/opt/dau/dauGia.c +++ b/src/opt/dau/dauGia.c @@ -241,7 +241,7 @@ int Dau_DsdBalance( Gia_Man_t * pGia, int * pFans, int nFans, int fAnd ) if ( pGia->pHTable == NULL ) { if ( fAnd ) - iFan = Gia_ManAppendAnd( pGia, iFan0, iFan1 ); + iFan = Gia_ManAppendAnd2( pGia, iFan0, iFan1 ); else if ( pGia->pMuxes ) { int fCompl = Abc_LitIsCompl(iFan0) ^ Abc_LitIsCompl(iFan1); @@ -249,7 +249,7 @@ int Dau_DsdBalance( Gia_Man_t * pGia, int * pFans, int nFans, int fAnd ) iFan = Abc_LitNotCond( iFan, fCompl ); } else - iFan = Gia_ManAppendXor( pGia, iFan0, iFan1 ); + iFan = Gia_ManAppendXor2( pGia, iFan0, iFan1 ); } else { @@ -361,7 +361,7 @@ int Dau_DsdToGia_rec( Gia_Man_t * pGia, char * pStr, char ** p, int * pMatches, if ( pGia->pMuxes ) Res = Gia_ManAppendMux( pGia, Temp[0], Temp[1], Temp[2] ); else - Res = Gia_ManAppendMux( pGia, Temp[0], Temp[1], Temp[2] ); + Res = Gia_ManAppendMux2( pGia, Temp[0], Temp[1], Temp[2] ); } else { diff --git a/src/opt/lpk/lpkCore.c b/src/opt/lpk/lpkCore.c index a9088d10..6595b365 100644 --- a/src/opt/lpk/lpkCore.c +++ b/src/opt/lpk/lpkCore.c @@ -96,12 +96,12 @@ void Lpk_IfManStart( Lpk_Man_t * p ) int Lpk_NodeHasChanged( Lpk_Man_t * p, int iNode ) { Vec_Ptr_t * vNodes; - Abc_Obj_t * pTemp; + Abc_Obj_t * pTemp, * pTemp2; int i; vNodes = Vec_VecEntry( p->vVisited, iNode ); if ( Vec_PtrSize(vNodes) == 0 ) return 1; - Vec_PtrForEachEntry( Abc_Obj_t *, vNodes, pTemp, i ) + Vec_PtrForEachEntryDouble( Abc_Obj_t *, Abc_Obj_t *, vNodes, pTemp, pTemp2, i ) { // check if the node has changed pTemp = Abc_NtkObj( p->pNtk, (int)(ABC_PTRUINT_T)pTemp ); @@ -110,7 +110,7 @@ int Lpk_NodeHasChanged( Lpk_Man_t * p, int iNode ) // check if the number of fanouts has changed // if ( Abc_ObjFanoutNum(pTemp) != (int)Vec_PtrEntry(vNodes, i+1) ) // return 1; - i++; +// i++; } return 0; } diff --git a/src/opt/lpk/lpkCut.c b/src/opt/lpk/lpkCut.c index 73711f2b..208facf2 100644 --- a/src/opt/lpk/lpkCut.c +++ b/src/opt/lpk/lpkCut.c @@ -234,7 +234,7 @@ void Lpk_NodeRecordImpact( Lpk_Man_t * p ) { Lpk_Cut_t * pCut; Vec_Ptr_t * vNodes = Vec_VecEntry( p->vVisited, p->pObj->Id ); - Abc_Obj_t * pNode; + Abc_Obj_t * pNode, * pNode2; int i, k; // collect the nodes that impact the given node Vec_PtrClear( vNodes ); @@ -252,11 +252,11 @@ void Lpk_NodeRecordImpact( Lpk_Man_t * p ) } } // clear the marks - Vec_PtrForEachEntry( Abc_Obj_t *, vNodes, pNode, i ) + Vec_PtrForEachEntryDouble( Abc_Obj_t *, Abc_Obj_t *, vNodes, pNode, pNode2, i ) { pNode = Abc_NtkObj( p->pNtk, (int)(ABC_PTRUINT_T)pNode ); pNode->fMarkC = 0; - i++; +// i++; } //printf( "%d ", Vec_PtrSize(vNodes) ); } diff --git a/src/opt/sbd/module.make b/src/opt/sbd/module.make index d966e577..fc176715 100644 --- a/src/opt/sbd/module.make +++ b/src/opt/sbd/module.make @@ -1,5 +1,9 @@ SRC += src/opt/sbd/sbd.c \ src/opt/sbd/sbdCnf.c \ src/opt/sbd/sbdCore.c \ + src/opt/sbd/sbdCut.c \ + src/opt/sbd/sbdCut2.c \ + src/opt/sbd/sbdLut.c \ + src/opt/sbd/sbdPath.c \ src/opt/sbd/sbdSat.c \ src/opt/sbd/sbdWin.c diff --git a/src/opt/sbd/sbd.h b/src/opt/sbd/sbd.h index 89d29958..9c419b16 100644 --- a/src/opt/sbd/sbd.h +++ b/src/opt/sbd/sbd.h @@ -39,11 +39,18 @@ typedef struct Sbd_Par_t_ Sbd_Par_t; struct Sbd_Par_t_ { int nLutSize; // target LUT size + int nLutNum; // target LUT count + int nCutSize; // target cut size + int nCutNum; // target cut count int nTfoLevels; // the number of TFO levels (windowing) int nTfoFanMax; // the max number of fanouts (windowing) int nWinSizeMax; // maximum window size (windowing) int nBTLimit; // maximum number of SAT conflicts int nWords; // simulation word count + int fMapping; // generate mapping + int fMoreCuts; // use several cuts + int fFindDivs; // perform divisor search + int fUsePath; // optimize only critical path int fArea; // area-oriented optimization int fCover; // use complete cover procedure int fVerbose; // verbose flag diff --git a/src/opt/sbd/sbdCnf.c b/src/opt/sbd/sbdCnf.c index 6291baed..8705858e 100644 --- a/src/opt/sbd/sbdCnf.c +++ b/src/opt/sbd/sbdCnf.c @@ -44,7 +44,7 @@ ABC_NAMESPACE_IMPL_START ***********************************************************************/ void Sbd_PrintCnf( Vec_Str_t * vCnf ) { - char Entry; + signed char Entry; int i, Lit; Vec_StrForEachEntry( vCnf, Entry, i ) { @@ -121,7 +121,7 @@ int Sbd_TruthToCnf( word Truth, int nVars, Vec_Int_t * vCover, Vec_Str_t * vCnf void Sbd_TranslateCnf( Vec_Wec_t * vRes, Vec_Str_t * vCnf, Vec_Int_t * vFaninMap, int iPivotVar ) { Vec_Int_t * vClause; - char Entry; + signed char Entry; int i, Lit; Vec_WecClear( vRes ); vClause = Vec_WecPushLevel( vRes ); diff --git a/src/opt/sbd/sbdCore.c b/src/opt/sbd/sbdCore.c index b6ec70f9..4f560a0a 100644 --- a/src/opt/sbd/sbdCore.c +++ b/src/opt/sbd/sbdCore.c @@ -1,12 +1,12 @@ /**CFile**************************************************************** - FileName [sbd.c] + FileName [sbdCore.c] SystemName [ABC: Logic synthesis and verification system.] PackageName [SAT-based optimization using internal don't-cares.] - Synopsis [] + Synopsis [Core procedures.] Author [Alan Mishchenko] @@ -14,7 +14,7 @@ Date [Ver. 1.0. Started - June 20, 2005.] - Revision [$Id: sbd.c,v 1.00 2005/06/20 00:00:00 alanmi Exp $] + Revision [$Id: sbdCore.c,v 1.00 2005/06/20 00:00:00 alanmi Exp $] ***********************************************************************/ @@ -30,7 +30,6 @@ ABC_NAMESPACE_IMPL_START #define SBD_MAX_LUTSIZE 6 - typedef struct Sbd_Man_t_ Sbd_Man_t; struct Sbd_Man_t_ { @@ -39,25 +38,34 @@ struct Sbd_Man_t_ Vec_Wec_t * vTfos; // TFO for each node (roots are marked) (windowing) Vec_Int_t * vLutLevs; // LUT level for each node after resynthesis Vec_Int_t * vLutCuts; // LUT cut for each nodes after resynthesis + Vec_Int_t * vLutCuts2; // LUT cut for each nodes after resynthesis Vec_Int_t * vMirrors; // alternative node Vec_Wrd_t * vSims[4]; // simulation information (main, backup, controlability) Vec_Int_t * vCover; // temporary Vec_Int_t * vLits; // temporary - int nConsts; // constants - int nChanges; // changes + Vec_Int_t * vLits2; // temporary + int nLuts[6]; // 0=const, 1=1lut, 2=2lut, 3=3lut + int nTried; + int nUsed; abctime timeWin; + abctime timeCut; + abctime timeCov; abctime timeCnf; abctime timeSat; - abctime timeCov; - abctime timeEnu; + abctime timeQbf; + abctime timeNew; abctime timeOther; abctime timeTotal; + Sbd_Sto_t * pSto; + Sbd_Srv_t * pSrv; // target node int Pivot; // target node + int DivCutoff; // the place where D-2 divisors begin Vec_Int_t * vTfo; // TFO (excludes node, includes roots) - precomputed Vec_Int_t * vRoots; // TFO root nodes Vec_Int_t * vWinObjs; // TFI + Pivot + sideTFI + TFO (including roots) Vec_Int_t * vObj2Var; // SAT variables for the window (indexes of objects in vWinObjs) + Vec_Int_t * vDivSet; // divisor variables Vec_Int_t * vDivVars; // divisor variables Vec_Int_t * vDivValues; // SAT variables values for the divisor variables Vec_Wec_t * vDivLevels; // divisors collected by levels @@ -66,7 +74,8 @@ struct Sbd_Man_t_ sat_solver * pSat; // SAT solver }; -static inline int * Sbd_ObjCut( Sbd_Man_t * p, int i ) { return Vec_IntEntryP( p->vLutCuts, (p->pPars->nLutSize + 1) * i ); } +static inline int * Sbd_ObjCut( Sbd_Man_t * p, int i ) { return Vec_IntEntryP( p->vLutCuts, (p->pPars->nLutSize + 1) * i ); } +static inline int * Sbd_ObjCut2( Sbd_Man_t * p, int i ) { return Vec_IntEntryP( p->vLutCuts2, (p->pPars->nLutSize + 1) * i ); } static inline word * Sbd_ObjSim0( Sbd_Man_t * p, int i ) { return Vec_WrdEntryP( p->vSims[0], p->pPars->nWords * i ); } static inline word * Sbd_ObjSim1( Sbd_Man_t * p, int i ) { return Vec_WrdEntryP( p->vSims[1], p->pPars->nWords * i ); } @@ -91,16 +100,23 @@ static inline word * Sbd_ObjSim3( Sbd_Man_t * p, int i ) { return Vec_WrdEntryP( void Sbd_ParSetDefault( Sbd_Par_t * pPars ) { memset( pPars, 0, sizeof(Sbd_Par_t) ); - pPars->nLutSize = 4; // target LUT size - pPars->nTfoLevels = 2; // the number of TFO levels (windowing) - pPars->nTfoFanMax = 4; // the max number of fanouts (windowing) - pPars->nWinSizeMax = 0; // maximum window size (windowing) - pPars->nBTLimit = 0; // maximum number of SAT conflicts - pPars->nWords = 1; // simulation word count - pPars->fArea = 0; // area-oriented optimization - pPars->fCover = 0; // use complete cover procedure - pPars->fVerbose = 0; // verbose flag - pPars->fVeryVerbose = 0; // verbose flag + pPars->nLutSize = 4; // target LUT size + pPars->nLutNum = 3; // target LUT count + pPars->nCutSize = (pPars->nLutSize - 1) * pPars->nLutNum + 1; // target cut size + pPars->nCutNum = 128; // target cut count + pPars->nTfoLevels = 5; // the number of TFO levels (windowing) + pPars->nTfoFanMax = 4; // the max number of fanouts (windowing) + pPars->nWinSizeMax = 2000; // maximum window size (windowing) + pPars->nBTLimit = 0; // maximum number of SAT conflicts + pPars->nWords = 1; // simulation word count + pPars->fMapping = 1; // generate mapping + pPars->fMoreCuts = 0; // use several cuts + pPars->fFindDivs = 0; // perform divisor search + pPars->fUsePath = 0; // optimize only critical path + pPars->fArea = 0; // area-oriented optimization + pPars->fCover = 0; // use complete cover procedure + pPars->fVerbose = 0; // verbose flag + pPars->fVeryVerbose = 0; // verbose flag } /**Function************************************************************* @@ -197,9 +213,11 @@ Sbd_Man_t * Sbd_ManStart( Gia_Man_t * pGia, Sbd_Par_t * pPars ) // target node p->vCover = Vec_IntAlloc( 100 ); p->vLits = Vec_IntAlloc( 100 ); + p->vLits2 = Vec_IntAlloc( 100 ); p->vRoots = Vec_IntAlloc( 100 ); p->vWinObjs = Vec_IntAlloc( Gia_ManObjNum(pGia) ); p->vObj2Var = Vec_IntStart( Gia_ManObjNum(pGia) ); + p->vDivSet = Vec_IntAlloc( 100 ); p->vDivVars = Vec_IntAlloc( 100 ); p->vDivValues = Vec_IntAlloc( 100 ); p->vDivLevels = Vec_WecAlloc( 100 ); @@ -218,6 +236,14 @@ Sbd_Man_t * Sbd_ManStart( Gia_Man_t * pGia, Sbd_Par_t * pPars ) Gia_ManForEachCiId( pGia, Id, i ) for ( w = 0; w < p->pPars->nWords; w++ ) Sbd_ObjSim0(p, Id)[w] = Gia_ManRandomW( 0 ); + // cut enumeration + if ( pPars->fMoreCuts ) + p->pSto = Sbd_StoAlloc( pGia, p->vMirrors, pPars->nLutSize, pPars->nCutSize, pPars->nCutNum, !pPars->fMapping, 1 ); + else + { + p->pSto = Sbd_StoAlloc( pGia, p->vMirrors, pPars->nLutSize, pPars->nLutSize, pPars->nCutNum, !pPars->fMapping, 1 ); + p->pSrv = Sbd_ManCutServerStart( pGia, p->vMirrors, p->vLutLevs, NULL, NULL, pPars->nLutSize, pPars->nCutSize, pPars->nCutNum, 0 ); + } return p; } void Sbd_ManStop( Sbd_Man_t * p ) @@ -231,16 +257,20 @@ void Sbd_ManStop( Sbd_Man_t * p ) Vec_WrdFree( p->vSims[i] ); Vec_IntFree( p->vCover ); Vec_IntFree( p->vLits ); + Vec_IntFree( p->vLits2 ); Vec_IntFree( p->vRoots ); Vec_IntFree( p->vWinObjs ); Vec_IntFree( p->vObj2Var ); + Vec_IntFree( p->vDivSet ); Vec_IntFree( p->vDivVars ); Vec_IntFree( p->vDivValues ); Vec_WecFree( p->vDivLevels ); Vec_IntFree( p->vCounts[0] ); Vec_IntFree( p->vCounts[1] ); Vec_WrdFree( p->vMatrix ); - if ( p->pSat ) sat_solver_delete( p->pSat ); + sat_solver_delete_p( &p->pSat ); + if ( p->pSto ) Sbd_StoFree( p->pSto ); + if ( p->pSrv ) Sbd_ManCutServerStop( p->pSrv ); ABC_FREE( p ); } @@ -318,12 +348,11 @@ void Sbd_ManUpdateOrder( Sbd_Man_t * p, int Pivot ) Vec_WecInit( p->vDivLevels, LevelMax + 1 ); Vec_IntForEachEntry( p->vWinObjs, Node, i ) Vec_WecPush( p->vDivLevels, Vec_IntEntry(p->vLutLevs, Node), Node ); - // sort primary inputs - Vec_IntSort( Vec_WecEntry(p->vDivLevels, 0), 0 ); // reload divisors Vec_IntClear( p->vWinObjs ); Vec_WecForEachLevel( p->vDivLevels, vLevel, i ) { + Vec_IntSort( vLevel, 0 ); Vec_IntForEachEntry( vLevel, Node, k ) { Vec_IntWriteEntry( p->vObj2Var, Node, Vec_IntSize(p->vWinObjs) ); @@ -334,8 +363,28 @@ void Sbd_ManUpdateOrder( Sbd_Man_t * p, int Pivot ) nTimeValidDivs = Vec_IntSize(p->vWinObjs); } assert( nTimeValidDivs > 0 ); - Vec_IntFill( p->vDivValues, Abc_MinInt(63, nTimeValidDivs), 0 ); - //printf( "%d ", Abc_MinInt(63, nTimeValidDivs) ); + Vec_IntClear( p->vDivVars ); + p->DivCutoff = -1; + Vec_IntForEachEntryStartStop( p->vWinObjs, Node, i, Abc_MaxInt(0, nTimeValidDivs-63), nTimeValidDivs ) + { + if ( p->DivCutoff == -1 && Vec_IntEntry(p->vLutLevs, Node) == LevelMax - 2 ) + p->DivCutoff = Vec_IntSize(p->vDivVars); + Vec_IntPush( p->vDivVars, i ); + } + if ( p->DivCutoff == -1 ) + p->DivCutoff = 0; + // verify +/* + assert( Vec_IntSize(p->vDivVars) < 64 ); + Vec_IntForEachEntryStart( p->vDivVars, Node, i, p->DivCutoff ) + assert( Vec_IntEntry(p->vLutLevs, Vec_IntEntry(p->vWinObjs, Node)) == LevelMax - 2 ); + Vec_IntForEachEntryStop( p->vDivVars, Node, i, p->DivCutoff ) + assert( Vec_IntEntry(p->vLutLevs, Vec_IntEntry(p->vWinObjs, Node)) < LevelMax - 2 ); +*/ + Vec_IntFill( p->vDivValues, Vec_IntSize(p->vDivVars), 0 ); + //printf( "%d ", Vec_IntSize(p->vDivVars) ); +// printf( "Node %4d : Win = %5d. Divs = %5d. D1 = %5d. D2 = %5d.\n", +// Pivot, Vec_IntSize(p->vWinObjs), Vec_IntSize(p->vDivVars), Vec_IntSize(p->vDivVars)-p->DivCutoff, p->DivCutoff ); } void Sbd_ManWindowSim_rec( Sbd_Man_t * p, int NodeInit ) { @@ -407,7 +456,14 @@ int Sbd_ManWindow( Sbd_Man_t * p, int Pivot ) Gia_ManIncrementTravId( p->pGia ); Gia_ObjSetTravIdCurrentId(p->pGia, 0); Sbd_ManWindowSim_rec( p, Pivot ); + if ( p->pPars->nWinSizeMax && Vec_IntSize(p->vWinObjs) > p->pPars->nWinSizeMax ) + { + p->timeWin += Abc_Clock() - clk; + return 0; + } Sbd_ManUpdateOrder( p, Pivot ); + assert( Vec_IntSize(p->vDivVars) == Vec_IntSize(p->vDivValues) ); + assert( Vec_IntSize(p->vDivVars) < Vec_IntSize(p->vWinObjs) ); // simulate node Gia_ManObj(p->pGia, Pivot)->fMark0 = 1; Abc_TtCopy( Sbd_ObjSim1(p, Pivot), Sbd_ObjSim0(p, Pivot), p->pPars->nWords, 1 ); @@ -429,6 +485,11 @@ int Sbd_ManWindow( Sbd_Man_t * p, int Pivot ) Vec_IntWriteEntry( p->vObj2Var, Abc_Lit2Var(Node), Vec_IntSize(p->vWinObjs) ); Vec_IntPush( p->vWinObjs, Abc_Lit2Var(Node) ); } + if ( p->pPars->nWinSizeMax && Vec_IntSize(p->vWinObjs) > p->pPars->nWinSizeMax ) + { + p->timeWin += Abc_Clock() - clk; + return 0; + } // compute controlability for node if ( Vec_IntSize(p->vTfo) == 0 ) Abc_TtFill( Sbd_ObjSim2(p, Pivot), p->pPars->nWords ); @@ -440,8 +501,8 @@ int Sbd_ManWindow( Sbd_Man_t * p, int Pivot ) p->timeWin += Abc_Clock() - clk; // propagate controlability to fanins for the TFI nodes starting from the pivot Sbd_ManPropagateControl( p, Pivot ); - assert( Vec_IntSize(p->vDivValues) < 64 ); - return (int)(Vec_IntSize(p->vDivValues) >= 64); + assert( Vec_IntSize(p->vDivValues) <= 64 ); + return (int)(Vec_IntSize(p->vDivValues) <= 64); } /**Function************************************************************* @@ -457,24 +518,22 @@ int Sbd_ManWindow( Sbd_Man_t * p, int Pivot ) ***********************************************************************/ int Sbd_ManCheckConst( Sbd_Man_t * p, int Pivot ) { - extern void Sbd_ManPrintObj( Sbd_Man_t * p, int Pivot ); int nMintCount = 1; Vec_Ptr_t * vSims; word * pSims = Sbd_ObjSim0( p, Pivot ); word * pCtrl = Sbd_ObjSim2( p, Pivot ); int PivotVar = Vec_IntEntry(p->vObj2Var, Pivot); int RetValue, i, iObj, Ind, fFindOnset, nCares[2] = {0}; + abctime clk = Abc_Clock(); - extern int Sbd_ManCollectConstants( sat_solver * pSat, int nCareMints[2], int PivotVar, word * pVarSims[], Vec_Int_t * vInds ); - extern sat_solver * Sbd_ManSatSolver( sat_solver * pSat, Gia_Man_t * p, Vec_Int_t * vMirrors, int Pivot, Vec_Int_t * vWinObjs, Vec_Int_t * vObj2Var, Vec_Int_t * vTfo, Vec_Int_t * vRoots ); - p->pSat = Sbd_ManSatSolver( p->pSat, p->pGia, p->vMirrors, Pivot, p->vWinObjs, p->vObj2Var, p->vTfo, p->vRoots ); + p->pSat = Sbd_ManSatSolver( p->pSat, p->pGia, p->vMirrors, Pivot, p->vWinObjs, p->vObj2Var, p->vTfo, p->vRoots, 0 ); p->timeCnf += Abc_Clock() - clk; if ( p->pSat == NULL ) { - if ( p->pPars->fVerbose ) - printf( "Found stuck-at-%d node %d.\n", 0, Pivot ); + //if ( p->pPars->fVerbose ) + // printf( "Found stuck-at-%d node %d.\n", 0, Pivot ); Vec_IntWriteEntry( p->vLutLevs, Pivot, 0 ); - p->nConsts++; + p->nLuts[0]++; return 0; } //return -1; @@ -494,7 +553,7 @@ int Sbd_ManCheckConst( Sbd_Man_t * p, int Pivot ) nCares[0] = nCares[0] < nMintCount ? nMintCount - nCares[0] : 0; nCares[1] = nCares[1] < nMintCount ? nMintCount - nCares[1] : 0; - if ( p->pPars->fVerbose ) + if ( p->pPars->fVeryVerbose ) printf( "Computing %d offset and %d onset minterms for node %d.\n", nCares[0], nCares[1], Pivot ); if ( Vec_IntSize(p->vLits) >= nCares[0] + nCares[1] ) @@ -533,10 +592,10 @@ int Sbd_ManCheckConst( Sbd_Man_t * p, int Pivot ) Vec_PtrFree( vSims ); if ( RetValue >= 0 ) { - if ( p->pPars->fVerbose ) + if ( p->pPars->fVeryVerbose ) printf( "Found stuck-at-%d node %d.\n", RetValue, Pivot ); Vec_IntWriteEntry( p->vLutLevs, Pivot, 0 ); - p->nConsts++; + p->nLuts[0]++; return RetValue; } // set controlability of these minterms @@ -754,15 +813,15 @@ void Sbd_ManPrintObj( Sbd_Man_t * p, int Pivot ) } } -void Sbd_ManMatrPrint( word Cover[64], int nCol, int nRows ) +void Sbd_ManMatrPrint( Sbd_Man_t * p, word Cover[], int nCol, int nRows ) { int i, k; for ( i = 0; i <= nCol; i++ ) { printf( "%2d : ", i ); + printf( "%d ", i == nCol ? Vec_IntEntry(p->vLutLevs, p->Pivot) : Vec_IntEntry(p->vLutLevs, Vec_IntEntry(p->vWinObjs, Vec_IntEntry(p->vDivVars, i))) ); for ( k = 0; k < nRows; k++ ) - for ( k = 0; k < nRows; k++ ) - printf( "%d", (int)((Cover[i] >> k) & 1) ); + printf( "%d", (int)((Cover[i] >> k) & 1) ); printf( "\n"); } printf( "\n"); @@ -778,18 +837,18 @@ static inline void Sbd_ManCoverReverseOrder( word Cover[64] ) } } -static inline int Sbd_ManAddCube1( word Cover[64], int nRows, word Cube ) +static inline int Sbd_ManAddCube1( int nRowLimit, word Cover[], int nRows, word Cube ) { int n, m; if ( 0 ) { printf( "Adding cube: " ); - for ( n = 0; n < 64; n++ ) + for ( n = 0; n < nRowLimit; n++ ) printf( "%d", (int)((Cube >> n) & 1) ); printf( "\n" ); } // do not add contained Cube - assert( nRows <= 64 ); + assert( nRows <= nRowLimit ); for ( n = 0; n < nRows; n++ ) if ( (Cover[n] & Cube) == Cover[n] ) // Cube is contained return nRows; @@ -797,7 +856,7 @@ static inline int Sbd_ManAddCube1( word Cover[64], int nRows, word Cube ) for ( n = m = 0; n < nRows; n++ ) if ( (Cover[n] & Cube) != Cube ) // Cover[n] is not contained Cover[m++] = Cover[n]; - if ( m < 64 ) + if ( m < nRowLimit ) Cover[m++] = Cube; for ( n = m; n < nRows; n++ ) Cover[n] = 0; @@ -832,15 +891,15 @@ static inline int Sbd_ManAddCube2( word Cover[2][64], int nRows, word Cube[2] ) return nRows; } -static inline int Sbd_ManFindCandsSimple( Sbd_Man_t * p, word Cover[64], int nDivs ) +static inline int Sbd_ManFindCandsSimple( Sbd_Man_t * p, word Cover[], int nDivs ) { int c0, c1, c2, c3; word Target = Cover[nDivs]; - Vec_IntClear( p->vDivVars ); + Vec_IntClear( p->vDivSet ); for ( c0 = 0; c0 < nDivs; c0++ ) if ( Cover[c0] == Target ) { - Vec_IntPush( p->vDivVars, c0 ); + Vec_IntPush( p->vDivSet, c0 ); return 1; } @@ -848,8 +907,8 @@ static inline int Sbd_ManFindCandsSimple( Sbd_Man_t * p, word Cover[64], int nDi for ( c1 = c0+1; c1 < nDivs; c1++ ) if ( (Cover[c0] | Cover[c1]) == Target ) { - Vec_IntPush( p->vDivVars, c0 ); - Vec_IntPush( p->vDivVars, c1 ); + Vec_IntPush( p->vDivSet, c0 ); + Vec_IntPush( p->vDivSet, c1 ); return 1; } @@ -858,9 +917,9 @@ static inline int Sbd_ManFindCandsSimple( Sbd_Man_t * p, word Cover[64], int nDi for ( c2 = c1+1; c2 < nDivs; c2++ ) if ( (Cover[c0] | Cover[c1] | Cover[c2]) == Target ) { - Vec_IntPush( p->vDivVars, c0 ); - Vec_IntPush( p->vDivVars, c1 ); - Vec_IntPush( p->vDivVars, c2 ); + Vec_IntPush( p->vDivSet, c0 ); + Vec_IntPush( p->vDivSet, c1 ); + Vec_IntPush( p->vDivSet, c2 ); return 1; } @@ -871,10 +930,10 @@ static inline int Sbd_ManFindCandsSimple( Sbd_Man_t * p, word Cover[64], int nDi { if ( (Cover[c0] | Cover[c1] | Cover[c2] | Cover[c3]) == Target ) { - Vec_IntPush( p->vDivVars, c0 ); - Vec_IntPush( p->vDivVars, c1 ); - Vec_IntPush( p->vDivVars, c2 ); - Vec_IntPush( p->vDivVars, c3 ); + Vec_IntPush( p->vDivSet, c0 ); + Vec_IntPush( p->vDivSet, c1 ); + Vec_IntPush( p->vDivSet, c2 ); + Vec_IntPush( p->vDivSet, c3 ); return 1; } } @@ -891,11 +950,11 @@ static inline int Sbd_ManFindCands( Sbd_Man_t * p, word Cover[64], int nDivs ) if ( nDivs < 8 || p->pPars->fCover ) return Sbd_ManFindCandsSimple( p, Cover, nDivs ); - Vec_IntClear( p->vDivVars ); + Vec_IntClear( p->vDivSet ); for ( c0 = 0; c0 < nDivs; c0++ ) if ( Cover[c0] == Target ) { - Vec_IntPush( p->vDivVars, c0 ); + Vec_IntPush( p->vDivSet, c0 ); return 1; } @@ -903,8 +962,8 @@ static inline int Sbd_ManFindCands( Sbd_Man_t * p, word Cover[64], int nDivs ) for ( c1 = c0+1; c1 < nDivs; c1++ ) if ( (Cover[c0] | Cover[c1]) == Target ) { - Vec_IntPush( p->vDivVars, c0 ); - Vec_IntPush( p->vDivVars, c1 ); + Vec_IntPush( p->vDivSet, c0 ); + Vec_IntPush( p->vDivSet, c1 ); return 1; } @@ -923,9 +982,9 @@ static inline int Sbd_ManFindCands( Sbd_Man_t * p, word Cover[64], int nDivs ) for ( c2 = c1+1; c2 < Limits[2]; c2++ ) if ( (Cover[Order[c0]] | Cover[Order[c1]] | Cover[Order[c2]]) == Target ) { - Vec_IntPush( p->vDivVars, Order[c0] ); - Vec_IntPush( p->vDivVars, Order[c1] ); - Vec_IntPush( p->vDivVars, Order[c2] ); + Vec_IntPush( p->vDivSet, Order[c0] ); + Vec_IntPush( p->vDivSet, Order[c1] ); + Vec_IntPush( p->vDivSet, Order[c2] ); return 1; } @@ -936,10 +995,10 @@ static inline int Sbd_ManFindCands( Sbd_Man_t * p, word Cover[64], int nDivs ) { if ( (Cover[Order[c0]] | Cover[Order[c1]] | Cover[Order[c2]] | Cover[Order[c3]]) == Target ) { - Vec_IntPush( p->vDivVars, Order[c0] ); - Vec_IntPush( p->vDivVars, Order[c1] ); - Vec_IntPush( p->vDivVars, Order[c2] ); - Vec_IntPush( p->vDivVars, Order[c3] ); + Vec_IntPush( p->vDivSet, Order[c0] ); + Vec_IntPush( p->vDivSet, Order[c1] ); + Vec_IntPush( p->vDivSet, Order[c2] ); + Vec_IntPush( p->vDivSet, Order[c3] ); return 1; } } @@ -950,12 +1009,11 @@ static inline int Sbd_ManFindCands( Sbd_Man_t * p, word Cover[64], int nDivs ) int Sbd_ManExplore( Sbd_Man_t * p, int Pivot, word * pTruth ) { int fVerbose = 0; - abctime clk, clkSat = 0, clkEnu = 0, clkAll = Abc_Clock(); + abctime clk; int nIters, nItersMax = 32; - extern word Sbd_ManSolve( sat_solver * pSat, int PivotVar, int FreeVar, Vec_Int_t * vDivVars, Vec_Int_t * vValues, Vec_Int_t * vTemp ); word MatrS[64] = {0}, MatrC[2][64] = {{0}}, Cubes[2][2][64] = {{{0}}}, Cover[64] = {0}, Cube, CubeNew[2]; - int i, k, n, Index, nCubes[2] = {0}, nRows = 0, nRowsOld; + int i, k, n, Node, Index, nCubes[2] = {0}, nRows = 0, nRowsOld; int nDivs = Vec_IntSize(p->vDivValues); int PivotVar = Vec_IntEntry(p->vObj2Var, Pivot); @@ -969,11 +1027,11 @@ int Sbd_ManExplore( Sbd_Man_t * p, int Pivot, word * pTruth ) Sbd_ManPrintObj( p, Pivot ); // collect bit-matrices - for ( i = 0; i < nDivs; i++ ) + Vec_IntForEachEntry( p->vDivVars, Node, i ) { - MatrS[63-i] = *Sbd_ObjSim0( p, Vec_IntEntry(p->vWinObjs, i) ); - MatrC[0][63-i] = *Sbd_ObjSim2( p, Vec_IntEntry(p->vWinObjs, i) ); - MatrC[1][63-i] = *Sbd_ObjSim3( p, Vec_IntEntry(p->vWinObjs, i) ); + MatrS[63-i] = *Sbd_ObjSim0( p, Vec_IntEntry(p->vWinObjs, Node) ); + MatrC[0][63-i] = *Sbd_ObjSim2( p, Vec_IntEntry(p->vWinObjs, Node) ); + MatrC[1][63-i] = *Sbd_ObjSim3( p, Vec_IntEntry(p->vWinObjs, Node) ); } MatrS[63-i] = *Sbd_ObjSim0( p, Pivot ); MatrC[0][63-i] = *Sbd_ObjSim2( p, Pivot ); @@ -1029,7 +1087,7 @@ int Sbd_ManExplore( Sbd_Man_t * p, int Pivot, word * pTruth ) { Cube = (Cubes[0][1][i] & Cubes[1][0][k]) | (Cubes[0][0][i] & Cubes[1][1][k]); assert( Cube ); - nRows = Sbd_ManAddCube1( Cover, nRows, Cube ); + nRows = Sbd_ManAddCube1( 64, Cover, nRows, Cube ); } Sbd_ManCoverReverseOrder( Cover ); @@ -1049,29 +1107,25 @@ int Sbd_ManExplore( Sbd_Man_t * p, int Pivot, word * pTruth ) for ( nIters = 0; nIters < nItersMax && nRows < 64; nIters++ ) { if ( p->pPars->fVerbose ) - Sbd_ManMatrPrint( Cover, nDivs, nRows ); + Sbd_ManMatrPrint( p, Cover, nDivs, nRows ); clk = Abc_Clock(); if ( !Sbd_ManFindCands( p, Cover, nDivs ) ) { if ( p->pPars->fVerbose ) printf( "Cannot find a feasible cover.\n" ); - clkEnu += Abc_Clock() - clk; - clkAll = Abc_Clock() - clkAll - clkSat - clkEnu; - p->timeSat += clkSat; - p->timeCov += clkAll; - p->timeEnu += clkEnu; + p->timeCov += Abc_Clock() - clk; return RetValue; } - clkEnu += Abc_Clock() - clk; + p->timeCov += Abc_Clock() - clk; if ( p->pPars->fVerbose ) printf( "Candidate support: " ), - Vec_IntPrint( p->vDivVars ); + Vec_IntPrint( p->vDivSet ); clk = Abc_Clock(); - *pTruth = Sbd_ManSolve( p->pSat, PivotVar, FreeVar+nIters, p->vDivVars, p->vDivValues, p->vLits ); - clkSat += Abc_Clock() - clk; + *pTruth = Sbd_ManSolve( p->pSat, PivotVar, FreeVar+nIters, p->vDivSet, p->vDivVars, p->vDivValues, p->vLits ); + p->timeSat += Abc_Clock() - clk; if ( *pTruth == SBD_SAT_UNDEC ) printf( "Node %d: Undecided.\n", Pivot ); @@ -1103,21 +1157,445 @@ int Sbd_ManExplore( Sbd_Man_t * p, int Pivot, word * pTruth ) if ( p->pPars->fVerbose ) { printf( "Node %d: UNSAT.\n", Pivot ); - Extra_PrintBinary( stdout, (unsigned *)pTruth, 1 << Vec_IntSize(p->vDivVars) ), printf( "\n" ); + Extra_PrintBinary( stdout, (unsigned *)pTruth, 1 << Vec_IntSize(p->vDivSet) ), printf( "\n" ); } RetValue = 1; break; } //break; } - //printf( "Node %4d : Iter = %4d Start table = %4d Final table = %4d\n", Pivot, nIters, nRowsOld, nRows ); - clkAll = Abc_Clock() - clkAll - clkSat - clkEnu; - p->timeSat += clkSat; - p->timeCov += clkAll; - p->timeEnu += clkEnu; return RetValue; } +int Sbd_ManExplore2( Sbd_Man_t * p, int Pivot, word * pTruth ) +{ + abctime clk; + word Onset[64] = {0}, Offset[64] = {0}, Cube; + word CoverRows[64] = {0}, CoverCols[64] = {0}; + int nIters, nItersMax = 32; + int i, k, nRows = 0; + + int PivotVar = Vec_IntEntry(p->vObj2Var, Pivot); + int FreeVar = Vec_IntSize(p->vWinObjs) + Vec_IntSize(p->vTfo) + Vec_IntSize(p->vRoots); + int nDivs = Vec_IntSize( p->vDivVars ); + int nConsts = 4; + int RetValue; + + clk = Abc_Clock(); + //sat_solver_delete_p( &p->pSat ); + p->pSat = Sbd_ManSatSolver( p->pSat, p->pGia, p->vMirrors, Pivot, p->vWinObjs, p->vObj2Var, p->vTfo, p->vRoots, 0 ); + p->timeCnf += Abc_Clock() - clk; + + assert( nConsts <= 8 ); + clk = Abc_Clock(); + RetValue = Sbd_ManCollectConstantsNew( p->pSat, p->vDivVars, nConsts, PivotVar, Onset, Offset ); + p->timeSat += Abc_Clock() - clk; + if ( RetValue >= 0 ) + { + if ( p->pPars->fVeryVerbose ) + printf( "Found stuck-at-%d node %d.\n", RetValue, Pivot ); + Vec_IntWriteEntry( p->vLutLevs, Pivot, 0 ); + p->nLuts[0]++; + return RetValue; + } + RetValue = 0; + + // create rows of the table + nRows = 0; + for ( i = 0; i < nConsts; i++ ) + for ( k = 0; k < nConsts; k++ ) + { + Cube = Onset[i] ^ Offset[k]; + assert( Cube ); + nRows = Sbd_ManAddCube1( 256, CoverRows, nRows, Cube ); + } + assert( nRows <= 64 ); + + // create columns of the table + for ( i = 0; i < nRows; i++ ) + for ( k = 0; k <= nDivs; k++ ) + if ( (CoverRows[i] >> k) & 1 ) + Abc_TtXorBit(&CoverCols[k], i); + + // solve the covering problem + for ( nIters = 0; nIters < nItersMax && nRows < 64; nIters++ ) + { + if ( p->pPars->fVeryVerbose ) + Sbd_ManMatrPrint( p, CoverCols, nDivs, nRows ); + + clk = Abc_Clock(); + if ( !Sbd_ManFindCands( p, CoverCols, nDivs ) ) + { + if ( p->pPars->fVeryVerbose ) + printf( "Cannot find a feasible cover.\n" ); + p->timeCov += Abc_Clock() - clk; + return 0; + } + p->timeCov += Abc_Clock() - clk; + + if ( p->pPars->fVeryVerbose ) + printf( "Candidate support: " ), + Vec_IntPrint( p->vDivSet ); + + clk = Abc_Clock(); + *pTruth = Sbd_ManSolve( p->pSat, PivotVar, FreeVar+nIters, p->vDivSet, p->vDivVars, p->vDivValues, p->vLits ); + p->timeSat += Abc_Clock() - clk; + + if ( *pTruth == SBD_SAT_UNDEC ) + printf( "Node %d: Undecided.\n", Pivot ); + else if ( *pTruth == SBD_SAT_SAT ) + { + if ( p->pPars->fVeryVerbose ) + { + int i; + printf( "Node %d: SAT.\n", Pivot ); + for ( i = 0; i < nDivs; i++ ) + printf( "%d", Vec_IntEntry(p->vLutLevs, Vec_IntEntry(p->vWinObjs, Vec_IntEntry(p->vDivVars, i))) ); + printf( "\n" ); + for ( i = 0; i < nDivs; i++ ) + printf( "%d", i % 10 ); + printf( "\n" ); + for ( i = 0; i < nDivs; i++ ) + printf( "%c", (Vec_IntEntry(p->vDivValues, i) & 0x4) ? '0' + (Vec_IntEntry(p->vDivValues, i) & 1) : 'x' ); + printf( "\n" ); + for ( i = 0; i < nDivs; i++ ) + printf( "%c", (Vec_IntEntry(p->vDivValues, i) & 0x8) ? '0' + ((Vec_IntEntry(p->vDivValues, i) >> 1) & 1) : 'x' ); + printf( "\n" ); + } + // add row to the covering table + for ( i = 0; i < nDivs; i++ ) + if ( Vec_IntEntry(p->vDivValues, i) == 0xE || Vec_IntEntry(p->vDivValues, i) == 0xD ) + CoverCols[i] |= ((word)1 << nRows); + CoverCols[nDivs] |= ((word)1 << nRows); + nRows++; + } + else + { + if ( p->pPars->fVeryVerbose ) + { + printf( "Node %d: UNSAT. ", Pivot ); + Extra_PrintBinary( stdout, (unsigned *)pTruth, 1 << Vec_IntSize(p->vDivSet) ), printf( "\n" ); + } + p->nLuts[1]++; + RetValue = 1; + break; + } + } + return RetValue; +} + +int Sbd_ManExploreCut( Sbd_Man_t * p, int Pivot, int nLeaves, int * pLeaves, int * pnStrs, Sbd_Str_t * Strs, int * pFreeVar ) +{ + abctime clk = Abc_Clock(); + int PivotVar = Vec_IntEntry(p->vObj2Var, Pivot); + int Delay = Vec_IntEntry( p->vLutLevs, Pivot ); + int pNodesTop[SBD_DIV_MAX], pNodesBot[SBD_DIV_MAX], pNodesBot1[SBD_DIV_MAX], pNodesBot2[SBD_DIV_MAX]; + int nNodesTop = 0, nNodesBot = 0, nNodesBot1 = 0, nNodesBot2 = 0, nNodesDiff = 0, nNodesDiff1 = 0, nNodesDiff2 = 0; + int i, k, iObj, nIters, RetValue = 0; + + // try to remove fanins + for ( nIters = 0; nIters < nLeaves; nIters++ ) + { + word Truth; + // try to remove one variable from divisors + Vec_IntClear( p->vDivSet ); + for ( i = 0; i < nLeaves; i++ ) + if ( i != nLeaves-1-nIters && pLeaves[i] != -1 ) + Vec_IntPush( p->vDivSet, Vec_IntEntry(p->vObj2Var, pLeaves[i]) ); + assert( Vec_IntSize(p->vDivSet) < nLeaves ); + // compute truth table + clk = Abc_Clock(); + Truth = Sbd_ManSolve( p->pSat, PivotVar, (*pFreeVar)++, p->vDivSet, p->vDivVars, p->vDivValues, p->vLits ); + p->timeSat += Abc_Clock() - clk; + if ( Truth == SBD_SAT_UNDEC ) + printf( "Node %d: Undecided.\n", Pivot ); + else if ( Truth == SBD_SAT_SAT ) + { + int DelayDiff = Vec_IntEntry(p->vLutLevs, pLeaves[nLeaves-1-nIters]) - Delay; + if ( DelayDiff > -2 ) + return 0; + } + else + pLeaves[nLeaves-1-nIters] = -1; + } + Vec_IntClear( p->vDivSet ); + for ( i = 0; i < nLeaves; i++ ) + if ( pLeaves[i] != -1 ) + Vec_IntPush( p->vDivSet, pLeaves[i] ); + //printf( "Reduced %d -> %d\n", nLeaves, Vec_IntSize(p->vDivSet) ); + if ( Vec_IntSize(p->vDivSet) <= p->pPars->nLutSize ) + { + word Truth; + *pnStrs = 1; + // remap divisors + Vec_IntForEachEntry( p->vDivSet, iObj, i ) + Vec_IntWriteEntry( p->vDivSet, i, Vec_IntEntry(p->vObj2Var, iObj) ); + // compute truth table + clk = Abc_Clock(); + Truth = Sbd_ManSolve( p->pSat, PivotVar, (*pFreeVar)++, p->vDivSet, p->vDivVars, p->vDivValues, p->vLits ); + p->timeSat += Abc_Clock() - clk; + if ( Truth == SBD_SAT_SAT ) + { + printf( "The cut at node %d is not topological.\n", p->Pivot ); + return 0; + } + assert( Truth != SBD_SAT_UNDEC && Truth != SBD_SAT_SAT ); + // create structure + Strs->fLut = 1; + Strs->nVarIns = Vec_IntSize( p->vDivSet ); + for ( i = 0; i < Strs->nVarIns; i++ ) + Strs->VarIns[i] = i; + Strs->Res = Truth; + p->nLuts[1]++; + //Extra_PrintBinary( stdout, (unsigned *)&Truth, 1 << Strs->nVarIns ), printf( "\n" ); + return 1; + } + assert( Vec_IntSize(p->vDivSet) > p->pPars->nLutSize ); + + // count number of nodes on each level + nNodesTop = nNodesBot = nNodesBot1 = nNodesBot2 = 0; + Vec_IntForEachEntry( p->vDivSet, iObj, i ) + { + int DelayDiff = Vec_IntEntry(p->vLutLevs, iObj) - Delay; + if ( DelayDiff > -2 ) + break; + if ( DelayDiff == -2 ) + pNodesTop[nNodesTop++] = i; + else // if ( DelayDiff < -2 ) + { + pNodesBot[nNodesBot++] = i; + if ( DelayDiff == -3 ) + pNodesBot1[nNodesBot1++] = i; + else // if ( DelayDiff < -3 ) + pNodesBot2[nNodesBot2++] = i; + } + Vec_IntWriteEntry( p->vDivSet, i, Vec_IntEntry(p->vObj2Var, iObj) ); + } + assert( nNodesBot == nNodesBot1 + nNodesBot2 ); + if ( i < Vec_IntSize(p->vDivSet) ) + return 0; + if ( nNodesTop > p->pPars->nLutSize-1 ) + return 0; + + // try 44 + if ( Vec_IntSize(p->vDivSet) <= 2*p->pPars->nLutSize-1 ) + { + int nMoved = 0; + if ( nNodesBot > p->pPars->nLutSize ) // need to move bottom left-over to the top + { + while ( nNodesBot > p->pPars->nLutSize ) + pNodesTop[nNodesTop++] = pNodesBot[--nNodesBot], nMoved++; + assert( nNodesBot == p->pPars->nLutSize ); + } + assert( nNodesBot <= p->pPars->nLutSize ); + assert( nNodesTop <= p->pPars->nLutSize-1 ); + + Strs[0].fLut = 1; + Strs[0].nVarIns = p->pPars->nLutSize; + for ( i = 0; i < nNodesTop; i++ ) + Strs[0].VarIns[i] = pNodesTop[i]; + for ( ; i < p->pPars->nLutSize; i++ ) + Strs[0].VarIns[i] = Vec_IntSize(p->vDivSet)+1 + i-nNodesTop; + Strs[0].Res = 0; + + Strs[1].fLut = 1; + Strs[1].nVarIns = nNodesBot; + for ( i = 0; i < nNodesBot; i++ ) + Strs[1].VarIns[i] = pNodesBot[i]; + Strs[1].Res = 0; + + nNodesDiff = p->pPars->nLutSize-1 - nNodesTop; + assert( nNodesDiff >= 0 && nNodesDiff <= 3 ); + for ( k = 0; k < nNodesDiff; k++ ) + { + Strs[2+k].fLut = 0; + Strs[2+k].nVarIns = nNodesBot; + for ( i = 0; i < nNodesBot; i++ ) + Strs[2+k].VarIns[i] = pNodesBot[i]; + Strs[2+k].Res = 0; + } + + *pnStrs = 2 + nNodesDiff; + clk = Abc_Clock(); + RetValue = Sbd_ProblemSolve( p->pGia, p->vMirrors, Pivot, p->vWinObjs, p->vObj2Var, p->vTfo, p->vRoots, p->vDivSet, *pnStrs, Strs ); + p->timeQbf += Abc_Clock() - clk; + if ( RetValue ) + p->nLuts[2]++; + + while ( nMoved-- ) + pNodesBot[nNodesBot++] = pNodesTop[--nNodesTop]; + } + + if ( RetValue ) + return RetValue; + if ( p->pPars->nLutNum < 3 ) + return 0; + if ( Vec_IntSize(p->vDivSet) < 2*p->pPars->nLutSize-1 ) + return 0; + + // try 444 -- LUT(LUT, LUT) + if ( nNodesTop <= p->pPars->nLutSize-2 ) + { + int nMoved = 0; + if ( nNodesBot > 2*p->pPars->nLutSize ) // need to move bottom left-over to the top + { + while ( nNodesBot > 2*p->pPars->nLutSize ) + pNodesTop[nNodesTop++] = pNodesBot[--nNodesBot], nMoved++; + assert( nNodesBot == 2*p->pPars->nLutSize ); + } + assert( nNodesBot > p->pPars->nLutSize ); + assert( nNodesBot <= 2*p->pPars->nLutSize ); + assert( nNodesTop <= p->pPars->nLutSize-2 ); + + Strs[0].fLut = 1; + Strs[0].nVarIns = p->pPars->nLutSize; + for ( i = 0; i < nNodesTop; i++ ) + Strs[0].VarIns[i] = pNodesTop[i]; + for ( ; i < p->pPars->nLutSize; i++ ) + Strs[0].VarIns[i] = Vec_IntSize(p->vDivSet)+1 + i-nNodesTop; + Strs[0].Res = 0; + + Strs[1].fLut = 1; + Strs[1].nVarIns = p->pPars->nLutSize; + for ( i = 0; i < Strs[1].nVarIns; i++ ) + Strs[1].VarIns[i] = pNodesBot[i]; + Strs[1].Res = 0; + + Strs[2].fLut = 1; + Strs[2].nVarIns = p->pPars->nLutSize; + for ( i = 0; i < Strs[2].nVarIns; i++ ) + Strs[2].VarIns[i] = pNodesBot[nNodesBot-p->pPars->nLutSize+i]; + Strs[2].Res = 0; + + nNodesDiff = p->pPars->nLutSize-2 - nNodesTop; + assert( nNodesDiff >= 0 && nNodesDiff <= 2 ); + for ( k = 0; k < nNodesDiff; k++ ) + { + Strs[3+k].fLut = 0; + Strs[3+k].nVarIns = nNodesBot; + for ( i = 0; i < nNodesBot; i++ ) + Strs[3+k].VarIns[i] = pNodesBot[i]; + Strs[3+k].Res = 0; + } + + *pnStrs = 3 + nNodesDiff; + clk = Abc_Clock(); + RetValue = Sbd_ProblemSolve( p->pGia, p->vMirrors, Pivot, p->vWinObjs, p->vObj2Var, p->vTfo, p->vRoots, p->vDivSet, *pnStrs, Strs ); + p->timeQbf += Abc_Clock() - clk; + if ( RetValue ) + p->nLuts[3]++; + + while ( nMoved-- ) + pNodesBot[nNodesBot++] = pNodesTop[--nNodesTop]; + } + if ( RetValue ) + return RetValue; + + // try 444 -- LUT(LUT(LUT)) + if ( nNodesBot1 + nNodesTop <= 2*p->pPars->nLutSize-2 ) + { + if ( nNodesBot2 > p->pPars->nLutSize ) // need to move bottom left-over to the top + { + while ( nNodesBot2 > p->pPars->nLutSize ) + pNodesBot1[nNodesBot1++] = pNodesBot2[--nNodesBot2]; + assert( nNodesBot2 == p->pPars->nLutSize ); + } + if ( nNodesBot1 > p->pPars->nLutSize-1 ) // need to move bottom left-over to the top + { + while ( nNodesBot1 > p->pPars->nLutSize-1 ) + pNodesTop[nNodesTop++] = pNodesBot1[--nNodesBot1]; + assert( nNodesBot1 == p->pPars->nLutSize-1 ); + } + assert( nNodesBot2 <= p->pPars->nLutSize ); + assert( nNodesBot1 <= p->pPars->nLutSize-1 ); + assert( nNodesTop <= p->pPars->nLutSize-1 ); + + Strs[0].fLut = 1; + Strs[0].nVarIns = p->pPars->nLutSize; + for ( i = 0; i < nNodesTop; i++ ) + Strs[0].VarIns[i] = pNodesTop[i]; + Strs[0].VarIns[i++] = Vec_IntSize(p->vDivSet)+1; + for ( ; i < p->pPars->nLutSize; i++ ) + Strs[0].VarIns[i] = Vec_IntSize(p->vDivSet)+2 + i-nNodesTop; + Strs[0].Res = 0; + nNodesDiff1 = p->pPars->nLutSize-1 - nNodesTop; + + Strs[1].fLut = 1; + Strs[1].nVarIns = p->pPars->nLutSize; + for ( i = 0; i < nNodesBot1; i++ ) + Strs[1].VarIns[i] = pNodesBot1[i]; + Strs[1].VarIns[i++] = Vec_IntSize(p->vDivSet)+2; + for ( ; i < p->pPars->nLutSize; i++ ) + Strs[1].VarIns[i] = Vec_IntSize(p->vDivSet)+2+nNodesDiff1 + i-nNodesBot1; + Strs[1].Res = 0; + nNodesDiff2 = p->pPars->nLutSize-1 - nNodesBot1; + + Strs[2].fLut = 1; + Strs[2].nVarIns = nNodesBot2; + for ( i = 0; i < Strs[2].nVarIns; i++ ) + Strs[2].VarIns[i] = pNodesBot2[i]; + Strs[2].Res = 0; + + nNodesDiff = nNodesDiff1 + nNodesDiff2; + assert( nNodesDiff >= 0 && nNodesDiff <= 3 ); + for ( k = 0; k < nNodesDiff; k++ ) + { + Strs[3+k].fLut = 0; + Strs[3+k].nVarIns = nNodesBot2; + for ( i = 0; i < nNodesBot2; i++ ) + Strs[3+k].VarIns[i] = pNodesBot2[i]; + Strs[3+k].Res = 0; + if ( k >= nNodesDiff1 ) + continue; + Strs[3+k].nVarIns += nNodesBot1; + for ( i = 0; i < nNodesBot1; i++ ) + Strs[3+k].VarIns[nNodesBot2 + i] = pNodesBot1[i]; + } + + *pnStrs = 3 + nNodesDiff; + clk = Abc_Clock(); + RetValue = Sbd_ProblemSolve( p->pGia, p->vMirrors, Pivot, p->vWinObjs, p->vObj2Var, p->vTfo, p->vRoots, p->vDivSet, *pnStrs, Strs ); + p->timeQbf += Abc_Clock() - clk; + if ( RetValue ) + p->nLuts[4]++; + } + return RetValue; +} +int Sbd_ManExplore3( Sbd_Man_t * p, int Pivot, int * pnStrs, Sbd_Str_t * Strs ) +{ + int FreeVar = Vec_IntSize(p->vWinObjs) + Vec_IntSize(p->vTfo) + Vec_IntSize(p->vRoots); + int FreeVarStart = FreeVar; + int nSize, nLeaves, pLeaves[SBD_DIV_MAX]; + //sat_solver_delete_p( &p->pSat ); + abctime clk = Abc_Clock(); + p->pSat = Sbd_ManSatSolver( p->pSat, p->pGia, p->vMirrors, Pivot, p->vWinObjs, p->vObj2Var, p->vTfo, p->vRoots, 0 ); + p->timeCnf += Abc_Clock() - clk; + // extract one cut + if ( p->pSrv ) + { + nLeaves = Sbd_ManCutServerFirst( p->pSrv, Pivot, pLeaves ); + if ( nLeaves == -1 ) + return 0; + assert( nLeaves <= p->pPars->nCutSize ); + if ( Sbd_ManExploreCut( p, Pivot, nLeaves, pLeaves, pnStrs, Strs, &FreeVar ) ) + return 1; + return 0; + } + // extract one cut + for ( nSize = p->pPars->nLutSize + 1; nSize <= p->pPars->nCutSize; nSize++ ) + { + nLeaves = Sbd_StoObjBestCut( p->pSto, Pivot, nSize, pLeaves ); + if ( nLeaves == -1 ) + continue; + assert( nLeaves == nSize ); + if ( Sbd_ManExploreCut( p, Pivot, nLeaves, pLeaves, pnStrs, Strs, &FreeVar ) ) + return 1; + } + assert( FreeVar - FreeVarStart <= SBD_FVAR_MAX ); + return 0; +} + + /**Function************************************************************* Synopsis [Computes delay-oriented k-feasible cut at the node.] @@ -1231,9 +1709,10 @@ int Sbd_ManMergeCuts( Sbd_Man_t * p, int Node ) assert( iFan0 != iFan1 ); assert( Vec_IntEntry(p->vLutLevs, Node) == 0 ); Vec_IntWriteEntry( p->vLutLevs, Node, LevCur ); + //Vec_IntWriteEntry( p->vLevs, Node, 1+Abc_MaxInt(Vec_IntEntry(p->vLevs, iFan0), Vec_IntEntry(p->vLevs, iFan1)) ); assert( pCutRes[0] <= p->pPars->nLutSize ); memcpy( Sbd_ObjCut(p, Node), pCutRes, sizeof(int) * (pCutRes[0] + 1) ); - //printf( "Setting node %d with delay %d.\n", Node, LevCur ); +//printf( "Setting node %d with delay %d.\n", Node, LevCur ); return LevCur == 1; // LevCur == Abc_MaxInt(Level0, Level1); } int Sbd_ManDelay( Sbd_Man_t * p ) @@ -1294,6 +1773,7 @@ void Sbd_ManFindCut( Sbd_Man_t * p, int Node, Vec_Int_t * vCutLits ) // create cut assert( Vec_IntEntry(p->vLutLevs, Node) == 0 ); Vec_IntWriteEntry( p->vLutLevs, Node, LevelMax+1 ); + //Vec_IntWriteEntry( p->vLevs, Node, 1+Abc_MaxInt(Vec_IntEntry(p->vLevs, Gia_ObjFaninId0(pObj, Node)), Vec_IntEntry(p->vLevs, Gia_ObjFaninId1(pObj, Node))) ); memcpy( Sbd_ObjCut(p, Node), pCut, sizeof(int) * (pCut[0] + 1) ); } @@ -1306,7 +1786,7 @@ int Sbd_ManImplement( Sbd_Man_t * p, int Pivot, word Truth ) int iNewLev; // collect leaf literals Vec_IntClear( p->vLits ); - Vec_IntForEachEntry( p->vDivVars, Node, i ) + Vec_IntForEachEntry( p->vDivSet, Node, i ) { Node = Vec_IntEntry( p->vWinObjs, Node ); if ( Vec_IntEntry(p->vMirrors, Node) >= 0 ) @@ -1355,7 +1835,99 @@ int Sbd_ManImplement( Sbd_Man_t * p, int Pivot, word Truth ) // update delay of the initial node assert( Vec_IntEntry(p->vLutLevs, Pivot) == iCurLev ); Vec_IntWriteEntry( p->vLutLevs, Pivot, iNewLev ); - p->nChanges++; + //Vec_IntWriteEntry( p->vLevs, Pivot, 1+Abc_MaxInt(Vec_IntEntry(p->vLevs, Gia_ObjFaninId0(pObj, Pivot)), Vec_IntEntry(p->vLevs, Gia_ObjFaninId1(pObj, Pivot))) ); + return 0; +} + +int Sbd_ManImplement2( Sbd_Man_t * p, int Pivot, int nStrs, Sbd_Str_t * pStrs ) +{ + //Gia_Obj_t * pObj = NULL; + int i, k, w, iLit, Node; + int iObjLast = Gia_ManObjNum(p->pGia); + int iCurLev = Vec_IntEntry(p->vLutLevs, Pivot); + int iNewLev; + // collect leaf literals + Vec_IntClear( p->vLits ); + Vec_IntForEachEntry( p->vDivSet, Node, i ) + { + Node = Vec_IntEntry( p->vWinObjs, Node ); + if ( Vec_IntEntry(p->vMirrors, Node) >= 0 ) + Vec_IntPush( p->vLits, Vec_IntEntry(p->vMirrors, Node) ); + else + Vec_IntPush( p->vLits, Abc_Var2Lit(Node, 0) ); + } + // collect structure nodes + for ( i = 0; i < nStrs; i++ ) + Vec_IntPush( p->vLits, -1 ); + // implement structures + for ( i = nStrs-1; i >= 0; i-- ) + { + if ( pStrs[i].fLut ) + { + // collect local literals + Vec_IntClear( p->vLits2 ); + for ( k = 0; k < (int)pStrs[i].nVarIns; k++ ) + Vec_IntPush( p->vLits2, Vec_IntEntry(p->vLits, pStrs[i].VarIns[k]) ); + // pretend to have MUXes + // assert( p->pGia->pMuxes == NULL ); + if ( p->pGia->nXors && p->pGia->pMuxes == NULL ) + p->pGia->pMuxes = (unsigned *)p; + // derive new function of the node + iLit = Dsm_ManTruthToGia( p->pGia, &pStrs[i].Res, p->vLits2, p->vCover ); + if ( p->pGia->pMuxes == (unsigned *)p ) + p->pGia->pMuxes = NULL; + } + else + { + iLit = Vec_IntEntry( p->vLits, (int)pStrs[i].Res ); + assert( iLit > 0 ); + } + // update literal + assert( Vec_IntEntry(p->vLits, Vec_IntSize(p->vLits)-nStrs+i) == -1 ); + Vec_IntWriteEntry( p->vLits, Vec_IntSize(p->vLits)-nStrs+i, iLit ); + } + iLit = Vec_IntEntry( p->vLits, Vec_IntSize(p->vDivSet) ); + //assert( iObjLast == Gia_ManObjNum(p->pGia) || Abc_Lit2Var(iLit) == Gia_ManObjNum(p->pGia)-1 ); + // remember this function + assert( Vec_IntEntry(p->vMirrors, Pivot) == -1 ); + Vec_IntWriteEntry( p->vMirrors, Pivot, iLit ); + if ( p->pPars->fVeryVerbose ) + printf( "Replacing node %d by literal %d.\n", Pivot, iLit ); + + // extend data-structure to accommodate new nodes + assert( Vec_IntSize(p->vLutLevs) == iObjLast ); + for ( i = iObjLast; i < Gia_ManObjNum(p->pGia); i++ ) + { + assert( i == Vec_IntSize(p->vMirrors) ); + Vec_IntPush( p->vMirrors, -1 ); + Sbd_StoRefObj( p->pSto, i, i == Gia_ManObjNum(p->pGia)-1 ? Pivot : -1 ); + } + Sbd_StoDerefObj( p->pSto, Pivot ); + for ( i = iObjLast; i < Gia_ManObjNum(p->pGia); i++ ) + { + //Gia_Obj_t * pObjI = Gia_ManObj( p->pGia, i ); + abctime clk = Abc_Clock(); + int Delay = Sbd_StoComputeCutsNode( p->pSto, i ); + p->timeCut += Abc_Clock() - clk; + assert( i == Vec_IntSize(p->vLutLevs) ); + Vec_IntPush( p->vLutLevs, Delay ); + //Vec_IntPush( p->vLevs, 1+Abc_MaxInt(Vec_IntEntry(p->vLevs, Gia_ObjFaninId0(pObjI, i)), Vec_IntEntry(p->vLevs, Gia_ObjFaninId1(pObjI, i))) ); + Vec_IntPush( p->vObj2Var, 0 ); + Vec_IntFillExtra( p->vLutCuts, Vec_IntSize(p->vLutCuts) + p->pPars->nLutSize + 1, 0 ); + Sbd_StoSaveBestDelayCut( p->pSto, i, Sbd_ObjCut(p, i) ); + //Sbd_ManFindCut( p, i, p->vLits ); + for ( k = 0; k < 4; k++ ) + for ( w = 0; w < p->pPars->nWords; w++ ) + Vec_WrdPush( p->vSims[k], 0 ); + } + // make sure delay reduction is achieved + iNewLev = Vec_IntEntry( p->vLutLevs, Abc_Lit2Var(iLit) ); + assert( !iNewLev || iNewLev < iCurLev ); + // update delay of the initial node + //pObj = Gia_ManObj( p->pGia, Pivot ); + assert( Vec_IntEntry(p->vLutLevs, Pivot) == iCurLev ); + Vec_IntWriteEntry( p->vLutLevs, Pivot, iNewLev ); + //Vec_IntWriteEntry( p->vLevs, Pivot, Pivot ? 1+Abc_MaxInt(Vec_IntEntry(p->vLevs, Gia_ObjFaninId0(pObj, Pivot)), Vec_IntEntry(p->vLevs, Gia_ObjFaninId1(pObj, Pivot))) : 0 ); return 0; } @@ -1370,6 +1942,70 @@ int Sbd_ManImplement( Sbd_Man_t * p, int Pivot, word Truth ) SeeAlso [] ***********************************************************************/ +void Sbd_ManDeriveMapping_rec( Sbd_Man_t * p, Gia_Man_t * pNew, int iObj ) +{ + Gia_Obj_t * pObj; int k, * pCut; + if ( !iObj || Gia_ObjIsTravIdCurrentId(pNew, iObj) ) + return; + Gia_ObjSetTravIdCurrentId(pNew, iObj); + pObj = Gia_ManObj( pNew, iObj ); + if ( Gia_ObjIsCi(pObj) ) + return; + assert( Gia_ObjIsAnd(pObj) ); + pCut = Sbd_ObjCut2( p, iObj ); + for ( k = 1; k <= pCut[0]; k++ ) + Sbd_ManDeriveMapping_rec( p, pNew, pCut[k] ); + // add mapping + Vec_IntWriteEntry( pNew->vMapping, iObj, Vec_IntSize(pNew->vMapping) ); + for ( k = 0; k <= pCut[0]; k++ ) + Vec_IntPush( pNew->vMapping, pCut[k] ); + Vec_IntPush( pNew->vMapping, iObj ); +} +void Sbd_ManDeriveMapping( Sbd_Man_t * p, Gia_Man_t * pNew ) +{ + Gia_Obj_t * pObj, * pFan; + int i, k, iFan, iObjNew, iFanNew, * pCut, * pCutNew; + Vec_Int_t * vLeaves = Vec_IntAlloc( 100 ); + // derive cuts for the new manager + p->vLutCuts2 = Vec_IntStart( Gia_ManObjNum(pNew) * (p->pPars->nLutSize + 1) ); + Gia_ManForEachAnd( p->pGia, pObj, i ) + { + if ( Vec_IntEntry(p->vMirrors, i) >= 0 ) + continue; + if ( pObj->Value == ~0 ) + continue; + iObjNew = Abc_Lit2Var( pObj->Value ); + if ( !Gia_ObjIsAnd(Gia_ManObj(pNew, iObjNew)) ) + continue; + pCutNew = Sbd_ObjCut2( p, iObjNew ); + pCut = Sbd_ObjCut( p, i ); + Vec_IntClear( vLeaves ); + for ( k = 1; k <= pCut[0]; k++ ) + { + iFan = Vec_IntEntry(p->vMirrors, pCut[k]) >= 0 ? Abc_Lit2Var(Vec_IntEntry(p->vMirrors, pCut[k])) : pCut[k]; + pFan = Gia_ManObj( p->pGia, iFan ); + if ( pFan->Value == ~0 ) + continue; + iFanNew = Abc_Lit2Var( pFan->Value ); + if ( iFanNew == 0 || iFanNew == iObjNew ) + continue; + Vec_IntPushUniqueOrder( vLeaves, iFanNew ); + } + assert( Vec_IntSize(vLeaves) <= p->pPars->nLutSize ); + //assert( Vec_IntSize(vLeaves) > 1 ); + pCutNew[0] = Vec_IntSize(vLeaves); + memcpy( pCutNew+1, Vec_IntArray(vLeaves), sizeof(int) * Vec_IntSize(vLeaves) ); + } + Vec_IntFree( vLeaves ); + // create new mapping + Vec_IntFreeP( &pNew->vMapping ); + pNew->vMapping = Vec_IntAlloc( (p->pPars->nLutSize + 2) * Gia_ManObjNum(pNew) ); + Vec_IntFill( pNew->vMapping, Gia_ManObjNum(pNew), 0 ); + Gia_ManIncrementTravId( pNew ); + Gia_ManForEachCo( pNew, pObj, i ) + Sbd_ManDeriveMapping_rec( p, pNew, Gia_ObjFaninId0p(pNew, pObj) ); + Vec_IntFreeP( &p->vLutCuts2 ); +} void Sbd_ManDerive_rec( Gia_Man_t * pNew, Gia_Man_t * p, int Node, Vec_Int_t * vMirrors ) { Gia_Obj_t * pObj; @@ -1391,9 +2027,9 @@ void Sbd_ManDerive_rec( Gia_Man_t * pNew, Gia_Man_t * p, int Node, Vec_Int_t * v if ( Obj != Node ) Gia_ManObj(p, Node)->Value = Abc_LitNotCond( pObj->Value, Abc_LitIsCompl(Vec_IntEntry(vMirrors, Node)) ); } -Gia_Man_t * Sbd_ManDerive( Gia_Man_t * p, Vec_Int_t * vMirrors ) +Gia_Man_t * Sbd_ManDerive( Sbd_Man_t * pMan, Gia_Man_t * p, Vec_Int_t * vMirrors ) { - Gia_Man_t * pNew; + Gia_Man_t * pNew, * pTemp; Gia_Obj_t * pObj; int i; Gia_ManFillValue( p ); @@ -1413,6 +2049,13 @@ Gia_Man_t * Sbd_ManDerive( Gia_Man_t * p, Vec_Int_t * vMirrors ) Gia_ManHashStop( pNew ); Gia_ManSetRegNum( pNew, Gia_ManRegNum(p) ); Gia_ManTransferTiming( pNew, p ); + if ( pMan->pPars->fMapping ) + Sbd_ManDeriveMapping( pMan, pNew ); + // remove dangling nodes + pNew = Gia_ManCleanup( pTemp = pNew ); + Gia_ManTransferTiming( pNew, pTemp ); + Gia_ManTransferMapping( pNew, pTemp ); + Gia_ManStop( pTemp ); return pNew; } @@ -1429,81 +2072,147 @@ Gia_Man_t * Sbd_ManDerive( Gia_Man_t * p, Vec_Int_t * vMirrors ) ***********************************************************************/ void Sbd_NtkPerformOne( Sbd_Man_t * p, int Pivot ) { - int RetValue; word Truth = 0; - if ( Sbd_ManMergeCuts( p, Pivot ) ) + Sbd_Str_t Strs[SBD_DIV_MAX]; word Truth = 0; + int RetValue, nStrs = 0; + if ( !p->pSto && Sbd_ManMergeCuts( p, Pivot ) ) return; - //if ( Pivot != 344 ) - // continue; - if ( p->pPars->fVerbose ) - printf( "\nLooking at node %d\n", Pivot ); - if ( Sbd_ManWindow( p, Pivot ) ) + if ( !Sbd_ManWindow( p, Pivot ) ) return; + //if ( Vec_IntSize(p->vWinObjs) > 100 ) + // printf( "Obj %d : Win = %d TFO = %d. Roots = %d.\n", Pivot, Vec_IntSize(p->vWinObjs), Vec_IntSize(p->vTfo), Vec_IntSize(p->vRoots) ); + p->nTried++; + p->nUsed++; RetValue = Sbd_ManCheckConst( p, Pivot ); if ( RetValue >= 0 ) + { Vec_IntWriteEntry( p->vMirrors, Pivot, RetValue ); - else if ( Sbd_ManExplore( p, Pivot, &Truth ) ) - Sbd_ManImplement( p, Pivot, Truth ); + //if ( p->pPars->fVerbose ) printf( "Node %5d: Detected constant %d.\n", Pivot, RetValue ); + } + else if ( p->pPars->fFindDivs && p->pPars->nLutNum >= 1 && Sbd_ManExplore2( p, Pivot, &Truth ) ) + { + int i; + Strs->fLut = 1; + Strs->nVarIns = Vec_IntSize( p->vDivSet ); + for ( i = 0; i < Strs->nVarIns; i++ ) + Strs->VarIns[i] = i; + Strs->Res = Truth; + Sbd_ManImplement2( p, Pivot, 1, Strs ); + //if ( p->pPars->fVerbose ) printf( "Node %5d: Detected LUT%d\n", Pivot, p->pPars->nLutSize ); + } + else if ( p->pPars->nLutNum >= 2 && Sbd_ManExplore3( p, Pivot, &nStrs, Strs ) ) + { + Sbd_ManImplement2( p, Pivot, nStrs, Strs ); + if ( !p->pPars->fVerbose ) + return; + //if ( Vec_IntSize(p->vDivSet) <= 4 ) + // printf( "Node %5d: Detected %d\n", Pivot, p->pPars->nLutSize ); + //else if ( Vec_IntSize(p->vDivSet) <= 6 || (Vec_IntSize(p->vDivSet) == 7 && nStrs == 2) ) + // printf( "Node %5d: Detected %d%d\n", Pivot, p->pPars->nLutSize, p->pPars->nLutSize ); + //else + // printf( "Node %5d: Detected %d%d%d\n", Pivot, p->pPars->nLutSize, p->pPars->nLutSize, p->pPars->nLutSize ); + } + else + p->nUsed--; } Gia_Man_t * Sbd_NtkPerform( Gia_Man_t * pGia, Sbd_Par_t * pPars ) { Gia_Man_t * pNew; Gia_Obj_t * pObj; + Vec_Bit_t * vPath; Sbd_Man_t * p = Sbd_ManStart( pGia, pPars ); - int nNodesOld = Gia_ManObjNum(pGia);//, Count = 0; + int nNodesOld = Gia_ManObjNum(pGia); int k, Pivot; assert( pPars->nLutSize <= 6 ); - //Sbd_ManMergeTest( p ); + // prepare references + Gia_ManForEachObj( p->pGia, pObj, Pivot ) + Sbd_StoRefObj( p->pSto, Pivot, -1 ); //return NULL; + vPath = (pPars->fUsePath && Gia_ManHasMapping(pGia)) ? Sbc_ManCriticalPath(pGia) : NULL; if ( pGia->pManTime != NULL && Tim_ManBoxNum((Tim_Man_t*)pGia->pManTime) ) { Vec_Int_t * vNodes = Gia_ManOrderWithBoxes( pGia ); Tim_Man_t * pTimOld = (Tim_Man_t *)pGia->pManTime; pGia->pManTime = Tim_ManDup( pTimOld, 1 ); + //Tim_ManPrint( pGia->pManTime ); Tim_ManIncrementTravId( (Tim_Man_t *)pGia->pManTime ); Gia_ManForEachObjVec( vNodes, pGia, pObj, k ) { Pivot = Gia_ObjId( pGia, pObj ); if ( Pivot >= nNodesOld ) - continue; + break; if ( Gia_ObjIsAnd(pObj) ) - Sbd_NtkPerformOne( p, Pivot ); + { + abctime clk = Abc_Clock(); + int Delay = Sbd_StoComputeCutsNode( p->pSto, Pivot ); + Sbd_StoSaveBestDelayCut( p->pSto, Pivot, Sbd_ObjCut(p, Pivot) ); + p->timeCut += Abc_Clock() - clk; + Vec_IntWriteEntry( p->vLutLevs, Pivot, Delay ); + if ( Delay > 1 && (!vPath || Vec_BitEntry(vPath, Pivot)) ) + Sbd_NtkPerformOne( p, Pivot ); + } else if ( Gia_ObjIsCi(pObj) ) { int arrTime = Tim_ManGetCiArrival( (Tim_Man_t*)pGia->pManTime, Gia_ObjCioId(pObj) ); Vec_IntWriteEntry( p->vLutLevs, Pivot, arrTime ); + Sbd_StoComputeCutsCi( p->pSto, Pivot, arrTime, arrTime ); } else if ( Gia_ObjIsCo(pObj) ) { int arrTime = Vec_IntEntry( p->vLutLevs, Gia_ObjFaninId0(pObj, Pivot) ); Tim_ManSetCoArrival( (Tim_Man_t*)pGia->pManTime, Gia_ObjCioId(pObj), arrTime ); } - else if ( !Gia_ObjIsConst0(pObj) ) - assert( 0 ); + else if ( Gia_ObjIsConst0(pObj) ) + Sbd_StoComputeCutsConst0( p->pSto, 0 ); + else assert( 0 ); } - //Tim_ManPrint( pGia->pManTime ); Tim_ManStop( (Tim_Man_t *)pGia->pManTime ); pGia->pManTime = pTimOld; Vec_IntFree( vNodes ); } else { - Gia_ManForEachAndId( pGia, Pivot ) - if ( Pivot < nNodesOld ) - Sbd_NtkPerformOne( p, Pivot ); + Sbd_StoComputeCutsConst0( p->pSto, 0 ); + Gia_ManForEachObj( pGia, pObj, Pivot ) + { + if ( Pivot >= nNodesOld ) + break; + if ( Gia_ObjIsCi(pObj) ) + Sbd_StoComputeCutsCi( p->pSto, Pivot, 0, 0 ); + else if ( Gia_ObjIsAnd(pObj) ) + { + abctime clk = Abc_Clock(); + int Delay = Sbd_StoComputeCutsNode( p->pSto, Pivot ); + Sbd_StoSaveBestDelayCut( p->pSto, Pivot, Sbd_ObjCut(p, Pivot) ); + p->timeCut += Abc_Clock() - clk; + Vec_IntWriteEntry( p->vLutLevs, Pivot, Delay ); + if ( Delay > 1 && (!vPath || Vec_BitEntry(vPath, Pivot)) ) + Sbd_NtkPerformOne( p, Pivot ); + } + //if ( nNodesOld != Gia_ManObjNum(pGia) ) + // break; + } } - printf( "Found %d constants and %d replacements with delay %d. ", p->nConsts, p->nChanges, Sbd_ManDelay(p) ); + Vec_BitFreeP( &vPath ); p->timeTotal = Abc_Clock() - p->timeTotal; - Abc_PrintTime( 1, "Time", p->timeTotal ); - pNew = Sbd_ManDerive( pGia, p->vMirrors ); + if ( p->pPars->fVerbose ) + { + printf( "K = %d. S = %d. N = %d. P = %d. ", + p->pPars->nLutSize, p->pPars->nLutNum, p->pPars->nCutSize, p->pPars->nCutNum ); + printf( "Try = %d. Use = %d. C = %d. 1 = %d. 2 = %d. 3a = %d. 3b = %d. Lev = %d. ", + p->nTried, p->nUsed, p->nLuts[0], p->nLuts[1], p->nLuts[2], p->nLuts[3], p->nLuts[4], Sbd_ManDelay(p) ); + Abc_PrintTime( 1, "Time", p->timeTotal ); + } + pNew = Sbd_ManDerive( p, pGia, p->vMirrors ); // print runtime statistics - p->timeOther = p->timeTotal - p->timeWin - p->timeCnf - p->timeSat - p->timeCov - p->timeEnu; - if ( 0 ) + p->timeOther = p->timeTotal - p->timeWin - p->timeCut - p->timeCov - p->timeCnf - p->timeSat - p->timeQbf; + if ( p->pPars->fVerbose ) { ABC_PRTP( "Win", p->timeWin , p->timeTotal ); + ABC_PRTP( "Cut", p->timeCut , p->timeTotal ); + ABC_PRTP( "Cov", p->timeCov , p->timeTotal ); ABC_PRTP( "Cnf", p->timeCnf , p->timeTotal ); ABC_PRTP( "Sat", p->timeSat , p->timeTotal ); - ABC_PRTP( "Cov", p->timeCov , p->timeTotal ); - ABC_PRTP( "Enu", p->timeEnu , p->timeTotal ); + ABC_PRTP( "Qbf", p->timeQbf , p->timeTotal ); ABC_PRTP( "Oth", p->timeOther, p->timeTotal ); ABC_PRTP( "ALL", p->timeTotal, p->timeTotal ); } diff --git a/src/opt/sbd/sbdCut.c b/src/opt/sbd/sbdCut.c new file mode 100644 index 00000000..59505c98 --- /dev/null +++ b/src/opt/sbd/sbdCut.c @@ -0,0 +1,872 @@ +/**CFile**************************************************************** + + FileName [sbdCut.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [SAT-based optimization using internal don't-cares.] + + Synopsis [Cut computation.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 20, 2005.] + + Revision [$Id: sbdCut.c,v 1.00 2005/06/20 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include "sbdInt.h" + +ABC_NAMESPACE_IMPL_START + + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +#define SBD_MAX_CUTSIZE 10 +#define SBD_MAX_CUTNUM 501 +#define SBD_MAX_TT_WORDS ((SBD_MAX_CUTSIZE > 6) ? 1 << (SBD_MAX_CUTSIZE-6) : 1) + +#define SBD_CUT_NO_LEAF 0xF + +typedef struct Sbd_Cut_t_ Sbd_Cut_t; +struct Sbd_Cut_t_ +{ + word Sign; // signature + int iFunc; // functionality + int Cost; // cut cost + int CostLev; // cut cost + unsigned nTreeLeaves : 9; // tree leaves + unsigned nSlowLeaves : 9; // slow leaves + unsigned nTopLeaves : 10; // top leaves + unsigned nLeaves : 4; // leaf count + int pLeaves[SBD_MAX_CUTSIZE]; // leaves +}; + +struct Sbd_Sto_t_ +{ + int nLutSize; + int nCutSize; + int nCutNum; + int fCutMin; + int fVerbose; + Gia_Man_t * pGia; // user's AIG manager (will be modified by adding nodes) + Vec_Int_t * vMirrors; // mirrors for each node + Vec_Int_t * vDelays; // delays for each node + Vec_Int_t * vLevels; // levels for each node + Vec_Int_t * vRefs; // refs for each node + Vec_Wec_t * vCuts; // cuts for each node + Vec_Mem_t * vTtMem; // truth tables + Sbd_Cut_t pCuts[3][SBD_MAX_CUTNUM]; // temporary cuts + Sbd_Cut_t * ppCuts[SBD_MAX_CUTNUM]; // temporary cut pointers + int nCutsR; // the number of cuts + int Pivot; // current object + int iCutBest; // best-delay cut + int nCutsSpec; // special cuts + int nCutsOver; // overflow cuts + int DelayMin; // minimum delay + double CutCount[4]; // cut counters + abctime clkStart; // starting time +}; + +static inline word * Sbd_CutTruth( Sbd_Sto_t * p, Sbd_Cut_t * pCut ) { return Vec_MemReadEntry(p->vTtMem, Abc_Lit2Var(pCut->iFunc)); } + +#define Sbd_ForEachCut( pList, pCut, i ) for ( i = 0, pCut = pList + 1; i < pList[0]; i++, pCut += pCut[0] + 2 ) + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/**Function************************************************************* + + Synopsis [Check correctness of cuts.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline word Sbd_CutGetSign( Sbd_Cut_t * pCut ) +{ + word Sign = 0; int i; + for ( i = 0; i < (int)pCut->nLeaves; i++ ) + Sign |= ((word)1) << (pCut->pLeaves[i] & 0x3F); + return Sign; +} +static inline int Sbd_CutCheck( Sbd_Cut_t * pBase, Sbd_Cut_t * pCut ) // check if pCut is contained in pBase +{ + int nSizeB = pBase->nLeaves; + int nSizeC = pCut->nLeaves; + int i, * pB = pBase->pLeaves; + int k, * pC = pCut->pLeaves; + for ( i = 0; i < nSizeC; i++ ) + { + for ( k = 0; k < nSizeB; k++ ) + if ( pC[i] == pB[k] ) + break; + if ( k == nSizeB ) + return 0; + } + return 1; +} +static inline int Sbd_CutSetCheckArray( Sbd_Cut_t ** ppCuts, int nCuts ) +{ + Sbd_Cut_t * pCut0, * pCut1; + int i, k, m, n, Value; + assert( nCuts > 0 ); + for ( i = 0; i < nCuts; i++ ) + { + pCut0 = ppCuts[i]; + assert( pCut0->nLeaves <= SBD_MAX_CUTSIZE ); + assert( pCut0->Sign == Sbd_CutGetSign(pCut0) ); + // check duplicates + for ( m = 0; m < (int)pCut0->nLeaves; m++ ) + for ( n = m + 1; n < (int)pCut0->nLeaves; n++ ) + assert( pCut0->pLeaves[m] < pCut0->pLeaves[n] ); + // check pairs + for ( k = 0; k < nCuts; k++ ) + { + pCut1 = ppCuts[k]; + if ( pCut0 == pCut1 ) + continue; + // check containments + Value = Sbd_CutCheck( pCut0, pCut1 ); + assert( Value == 0 ); + } + } + return 1; +} + + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline int Sbd_CutMergeOrder( Sbd_Cut_t * pCut0, Sbd_Cut_t * pCut1, Sbd_Cut_t * pCut, int nCutSize ) +{ + int nSize0 = pCut0->nLeaves; + int nSize1 = pCut1->nLeaves; + int i, * pC0 = pCut0->pLeaves; + int k, * pC1 = pCut1->pLeaves; + int c, * pC = pCut->pLeaves; + // the case of the largest cut sizes + if ( nSize0 == nCutSize && nSize1 == nCutSize ) + { + for ( i = 0; i < nSize0; i++ ) + { + if ( pC0[i] != pC1[i] ) return 0; + pC[i] = pC0[i]; + } + pCut->nLeaves = nCutSize; + pCut->iFunc = -1; + pCut->Sign = pCut0->Sign | pCut1->Sign; + return 1; + } + // compare two cuts with different numbers + i = k = c = 0; + if ( nSize0 == 0 ) goto FlushCut1; + if ( nSize1 == 0 ) goto FlushCut0; + while ( 1 ) + { + if ( c == nCutSize ) return 0; + if ( pC0[i] < pC1[k] ) + { + pC[c++] = pC0[i++]; + if ( i >= nSize0 ) goto FlushCut1; + } + else if ( pC0[i] > pC1[k] ) + { + pC[c++] = pC1[k++]; + if ( k >= nSize1 ) goto FlushCut0; + } + else + { + pC[c++] = pC0[i++]; k++; + if ( i >= nSize0 ) goto FlushCut1; + if ( k >= nSize1 ) goto FlushCut0; + } + } + +FlushCut0: + if ( c + nSize0 > nCutSize + i ) return 0; + while ( i < nSize0 ) + pC[c++] = pC0[i++]; + pCut->nLeaves = c; + pCut->iFunc = -1; + pCut->Sign = pCut0->Sign | pCut1->Sign; + return 1; + +FlushCut1: + if ( c + nSize1 > nCutSize + k ) return 0; + while ( k < nSize1 ) + pC[c++] = pC1[k++]; + pCut->nLeaves = c; + pCut->iFunc = -1; + pCut->Sign = pCut0->Sign | pCut1->Sign; + return 1; +} +static inline int Sbd_CutMergeOrder2( Sbd_Cut_t * pCut0, Sbd_Cut_t * pCut1, Sbd_Cut_t * pCut, int nCutSize ) +{ + int x0, i0 = 0, nSize0 = pCut0->nLeaves, * pC0 = pCut0->pLeaves; + int x1, i1 = 0, nSize1 = pCut1->nLeaves, * pC1 = pCut1->pLeaves; + int xMin, c = 0, * pC = pCut->pLeaves; + while ( 1 ) + { + x0 = (i0 == nSize0) ? ABC_INFINITY : pC0[i0]; + x1 = (i1 == nSize1) ? ABC_INFINITY : pC1[i1]; + xMin = Abc_MinInt(x0, x1); + if ( xMin == ABC_INFINITY ) break; + if ( c == nCutSize ) return 0; + pC[c++] = xMin; + if (x0 == xMin) i0++; + if (x1 == xMin) i1++; + } + pCut->nLeaves = c; + pCut->iFunc = -1; + pCut->Sign = pCut0->Sign | pCut1->Sign; + return 1; +} +static inline int Sbd_CutSetCutIsContainedOrder( Sbd_Cut_t * pBase, Sbd_Cut_t * pCut ) // check if pCut is contained in pBase +{ + int i, nSizeB = pBase->nLeaves; + int k, nSizeC = pCut->nLeaves; + if ( nSizeB == nSizeC ) + { + for ( i = 0; i < nSizeB; i++ ) + if ( pBase->pLeaves[i] != pCut->pLeaves[i] ) + return 0; + return 1; + } + assert( nSizeB > nSizeC ); + if ( nSizeC == 0 ) + return 1; + for ( i = k = 0; i < nSizeB; i++ ) + { + if ( pBase->pLeaves[i] > pCut->pLeaves[k] ) + return 0; + if ( pBase->pLeaves[i] == pCut->pLeaves[k] ) + { + if ( ++k == nSizeC ) + return 1; + } + } + return 0; +} +static inline int Sbd_CutSetLastCutIsContained( Sbd_Cut_t ** pCuts, int nCuts ) +{ + int i; + for ( i = 0; i < nCuts; i++ ) + if ( pCuts[i]->nLeaves <= pCuts[nCuts]->nLeaves && (pCuts[i]->Sign & pCuts[nCuts]->Sign) == pCuts[i]->Sign && Sbd_CutSetCutIsContainedOrder(pCuts[nCuts], pCuts[i]) ) + return 1; + return 0; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline int Sbd_CutCompare( Sbd_Cut_t * pCut0, Sbd_Cut_t * pCut1 ) +{ + if ( pCut0->nLeaves <= 4 && pCut1->nLeaves <= 4 ) + { + if ( pCut0->nLeaves < pCut1->nLeaves ) return -1; + if ( pCut0->nLeaves > pCut1->nLeaves ) return 1; + if ( pCut0->Cost < pCut1->Cost ) return -1; + if ( pCut0->Cost > pCut1->Cost ) return 1; + if ( pCut0->CostLev < pCut1->CostLev ) return -1; + if ( pCut0->CostLev > pCut1->CostLev ) return 1; + } + else if ( pCut0->nLeaves <= 4 ) + return -1; + else if ( pCut1->nLeaves <= 4 ) + return 1; + else + { + if ( pCut0->nTreeLeaves < pCut1->nTreeLeaves ) return -1; + if ( pCut0->nTreeLeaves > pCut1->nTreeLeaves ) return 1; + if ( pCut0->Cost < pCut1->Cost ) return -1; + if ( pCut0->Cost > pCut1->Cost ) return 1; + if ( pCut0->CostLev < pCut1->CostLev ) return -1; + if ( pCut0->CostLev > pCut1->CostLev ) return 1; + if ( pCut0->nLeaves < pCut1->nLeaves ) return -1; + if ( pCut0->nLeaves > pCut1->nLeaves ) return 1; + } + return 0; +} +static inline int Sbd_CutCompare2( Sbd_Cut_t * pCut0, Sbd_Cut_t * pCut1 ) +{ + assert( pCut0->nLeaves > 4 && pCut1->nLeaves > 4 ); + if ( pCut0->nSlowLeaves < pCut1->nSlowLeaves ) return -1; + if ( pCut0->nSlowLeaves > pCut1->nSlowLeaves ) return 1; + if ( pCut0->nTreeLeaves < pCut1->nTreeLeaves ) return -1; + if ( pCut0->nTreeLeaves > pCut1->nTreeLeaves ) return 1; + if ( pCut0->Cost < pCut1->Cost ) return -1; + if ( pCut0->Cost > pCut1->Cost ) return 1; + if ( pCut0->CostLev < pCut1->CostLev ) return -1; + if ( pCut0->CostLev > pCut1->CostLev ) return 1; + if ( pCut0->nLeaves < pCut1->nLeaves ) return -1; + if ( pCut0->nLeaves > pCut1->nLeaves ) return 1; + return 0; +} + +static inline int Sbd_CutSetLastCutContains( Sbd_Cut_t ** pCuts, int nCuts ) +{ + int i, k, fChanges = 0; + for ( i = 0; i < nCuts; i++ ) + if ( pCuts[nCuts]->nLeaves < pCuts[i]->nLeaves && (pCuts[nCuts]->Sign & pCuts[i]->Sign) == pCuts[nCuts]->Sign && Sbd_CutSetCutIsContainedOrder(pCuts[i], pCuts[nCuts]) ) + pCuts[i]->nLeaves = SBD_CUT_NO_LEAF, fChanges = 1; + if ( !fChanges ) + return nCuts; + for ( i = k = 0; i <= nCuts; i++ ) + { + if ( pCuts[i]->nLeaves == SBD_CUT_NO_LEAF ) + continue; + if ( k < i ) + ABC_SWAP( Sbd_Cut_t *, pCuts[k], pCuts[i] ); + k++; + } + return k - 1; +} +static inline void Sbd_CutSetSortByCost( Sbd_Cut_t ** pCuts, int nCuts ) +{ + int i; + for ( i = nCuts; i > 0; i-- ) + { + if ( Sbd_CutCompare(pCuts[i - 1], pCuts[i]) < 0 )//!= 1 ) + return; + ABC_SWAP( Sbd_Cut_t *, pCuts[i - 1], pCuts[i] ); + } +} +static inline int Sbd_CutSetAddCut( Sbd_Cut_t ** pCuts, int nCuts, int nCutNum ) +{ + if ( nCuts == 0 ) + return 1; + nCuts = Sbd_CutSetLastCutContains(pCuts, nCuts); + assert( nCuts >= 0 ); + Sbd_CutSetSortByCost( pCuts, nCuts ); + // add new cut if there is room + return Abc_MinInt( nCuts + 1, nCutNum - 1 ); +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline int Sbd_CutComputeTruth6( Sbd_Sto_t * p, Sbd_Cut_t * pCut0, Sbd_Cut_t * pCut1, int fCompl0, int fCompl1, Sbd_Cut_t * pCutR, int fIsXor ) +{ + int nOldSupp = pCutR->nLeaves, truthId, fCompl; word t; + word t0 = *Sbd_CutTruth(p, pCut0); + word t1 = *Sbd_CutTruth(p, pCut1); + if ( Abc_LitIsCompl(pCut0->iFunc) ^ fCompl0 ) t0 = ~t0; + if ( Abc_LitIsCompl(pCut1->iFunc) ^ fCompl1 ) t1 = ~t1; + t0 = Abc_Tt6Expand( t0, pCut0->pLeaves, pCut0->nLeaves, pCutR->pLeaves, pCutR->nLeaves ); + t1 = Abc_Tt6Expand( t1, pCut1->pLeaves, pCut1->nLeaves, pCutR->pLeaves, pCutR->nLeaves ); + t = fIsXor ? t0 ^ t1 : t0 & t1; + if ( (fCompl = (int)(t & 1)) ) t = ~t; + pCutR->nLeaves = Abc_Tt6MinBase( &t, pCutR->pLeaves, pCutR->nLeaves ); + assert( (int)(t & 1) == 0 ); + truthId = Vec_MemHashInsert(p->vTtMem, &t); + pCutR->iFunc = Abc_Var2Lit( truthId, fCompl ); + assert( (int)pCutR->nLeaves <= nOldSupp ); + return (int)pCutR->nLeaves < nOldSupp; +} +static inline int Sbd_CutComputeTruth( Sbd_Sto_t * p, Sbd_Cut_t * pCut0, Sbd_Cut_t * pCut1, int fCompl0, int fCompl1, Sbd_Cut_t * pCutR, int fIsXor ) +{ + if ( p->nCutSize <= 6 ) + return Sbd_CutComputeTruth6( p, pCut0, pCut1, fCompl0, fCompl1, pCutR, fIsXor ); + { + word uTruth[SBD_MAX_TT_WORDS], uTruth0[SBD_MAX_TT_WORDS], uTruth1[SBD_MAX_TT_WORDS]; + int nOldSupp = pCutR->nLeaves, truthId; + int nCutSize = p->nCutSize, fCompl; + int nWords = Abc_Truth6WordNum(nCutSize); + word * pTruth0 = Sbd_CutTruth(p, pCut0); + word * pTruth1 = Sbd_CutTruth(p, pCut1); + Abc_TtCopy( uTruth0, pTruth0, nWords, Abc_LitIsCompl(pCut0->iFunc) ^ fCompl0 ); + Abc_TtCopy( uTruth1, pTruth1, nWords, Abc_LitIsCompl(pCut1->iFunc) ^ fCompl1 ); + Abc_TtExpand( uTruth0, nCutSize, pCut0->pLeaves, pCut0->nLeaves, pCutR->pLeaves, pCutR->nLeaves ); + Abc_TtExpand( uTruth1, nCutSize, pCut1->pLeaves, pCut1->nLeaves, pCutR->pLeaves, pCutR->nLeaves ); + if ( fIsXor ) + Abc_TtXor( uTruth, uTruth0, uTruth1, nWords, (fCompl = (int)((uTruth0[0] ^ uTruth1[0]) & 1)) ); + else + Abc_TtAnd( uTruth, uTruth0, uTruth1, nWords, (fCompl = (int)((uTruth0[0] & uTruth1[0]) & 1)) ); + pCutR->nLeaves = Abc_TtMinBase( uTruth, pCutR->pLeaves, pCutR->nLeaves, nCutSize ); + assert( (uTruth[0] & 1) == 0 ); +//Kit_DsdPrintFromTruth( uTruth, pCutR->nLeaves ), printf("\n" ), printf("\n" ); + truthId = Vec_MemHashInsert(p->vTtMem, uTruth); + pCutR->iFunc = Abc_Var2Lit( truthId, fCompl ); + assert( (int)pCutR->nLeaves <= nOldSupp ); + return (int)pCutR->nLeaves < nOldSupp; + } +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline int Sbd_CutCountBits( word i ) +{ + i = i - ((i >> 1) & 0x5555555555555555); + i = (i & 0x3333333333333333) + ((i >> 2) & 0x3333333333333333); + i = ((i + (i >> 4)) & 0x0F0F0F0F0F0F0F0F); + return (i*(0x0101010101010101))>>56; +} +static inline int Sbd_CutCost( Sbd_Sto_t * p, Sbd_Cut_t * pCut ) +{ + int i, Cost = 0; + for ( i = 0; i < (int)pCut->nLeaves; i++ ) + Cost += Vec_IntEntry( p->vDelays, pCut->pLeaves[i] ); + return Cost; +} +static inline int Sbd_CutCostLev( Sbd_Sto_t * p, Sbd_Cut_t * pCut ) +{ + int i, Cost = 0; + for ( i = 0; i < (int)pCut->nLeaves; i++ ) + Cost += Vec_IntEntry( p->vLevels, pCut->pLeaves[i] ); + return Cost; +} +static inline int Sbd_CutTreeLeaves( Sbd_Sto_t * p, Sbd_Cut_t * pCut ) +{ + int i, Cost = 0; + for ( i = 0; i < (int)pCut->nLeaves; i++ ) + Cost += Vec_IntEntry( p->vRefs, pCut->pLeaves[i] ) == 1; + return Cost; +} +static inline int Sbd_CutSlowLeaves( Sbd_Sto_t * p, int iObj, Sbd_Cut_t * pCut ) +{ + int i, Count = 0, Delay = Vec_IntEntry(p->vDelays, iObj); + for ( i = 0; i < (int)pCut->nLeaves; i++ ) + Count += (Vec_IntEntry(p->vDelays, pCut->pLeaves[i]) - Delay >= -1); + return Count; +} +static inline int Sbd_CutTopLeaves( Sbd_Sto_t * p, int iObj, Sbd_Cut_t * pCut ) +{ + int i, Count = 0, Delay = Vec_IntEntry(p->vDelays, iObj); + for ( i = 0; i < (int)pCut->nLeaves; i++ ) + Count += (Vec_IntEntry(p->vDelays, pCut->pLeaves[i]) - Delay == -2); + return Count; +} +static inline void Sbd_CutAddUnit( Sbd_Sto_t * p, int iObj ) +{ + Vec_Int_t * vThis = Vec_WecEntry( p->vCuts, iObj ); + if ( Vec_IntSize(vThis) == 0 ) + Vec_IntPush( vThis, 1 ); + else + Vec_IntAddToEntry( vThis, 0, 1 ); + Vec_IntPush( vThis, 1 ); + Vec_IntPush( vThis, iObj ); + Vec_IntPush( vThis, 2 ); +} +static inline void Sbd_CutAddZero( Sbd_Sto_t * p, int iObj ) +{ + Vec_Int_t * vThis = Vec_WecEntry( p->vCuts, iObj ); + assert( Vec_IntSize(vThis) == 0 ); + Vec_IntPush( vThis, 1 ); + Vec_IntPush( vThis, 0 ); + Vec_IntPush( vThis, 0 ); +} +static inline int Sbd_StoPrepareSet( Sbd_Sto_t * p, int iObj, int Index ) +{ + Vec_Int_t * vThis = Vec_WecEntry( p->vCuts, iObj ); + int i, v, * pCut, * pList = Vec_IntArray( vThis ); + Sbd_ForEachCut( pList, pCut, i ) + { + Sbd_Cut_t * pCutTemp = &p->pCuts[Index][i]; + pCutTemp->nLeaves = pCut[0]; + for ( v = 1; v <= pCut[0]; v++ ) + pCutTemp->pLeaves[v-1] = pCut[v]; + pCutTemp->iFunc = pCut[pCut[0]+1]; + pCutTemp->Sign = Sbd_CutGetSign( pCutTemp ); + pCutTemp->Cost = Sbd_CutCost( p, pCutTemp ); + pCutTemp->CostLev = Sbd_CutCostLev( p, pCutTemp ); + pCutTemp->nTreeLeaves = Sbd_CutTreeLeaves( p, pCutTemp ); + pCutTemp->nSlowLeaves = Sbd_CutSlowLeaves( p, iObj, pCutTemp ); + pCutTemp->nTopLeaves = Sbd_CutTopLeaves( p, iObj, pCutTemp ); + } + return pList[0]; +} +static inline void Sbd_StoInitResult( Sbd_Sto_t * p ) +{ + int i; + for ( i = 0; i < SBD_MAX_CUTNUM; i++ ) + p->ppCuts[i] = &p->pCuts[2][i]; +} +static inline void Sbd_StoStoreResult( Sbd_Sto_t * p, int iObj, Sbd_Cut_t ** pCuts, int nCuts ) +{ + int i, v; + Vec_Int_t * vList = Vec_WecEntry( p->vCuts, iObj ); + Vec_IntPush( vList, nCuts ); + for ( i = 0; i < nCuts; i++ ) + { + Vec_IntPush( vList, pCuts[i]->nLeaves ); + for ( v = 0; v < (int)pCuts[i]->nLeaves; v++ ) + Vec_IntPush( vList, pCuts[i]->pLeaves[v] ); + Vec_IntPush( vList, pCuts[i]->iFunc ); + } +} +static inline void Sbd_StoComputeDelay( Sbd_Sto_t * p, int iObj, Sbd_Cut_t ** pCuts, int nCuts ) +{ + int i, v, Delay, DelayMin = ABC_INFINITY; + assert( nCuts > 0 ); + p->iCutBest = -1; + for ( i = 0; i < nCuts; i++ ) + { + if ( (int)pCuts[i]->nLeaves > p->nLutSize ) + continue; + Delay = 0; + for ( v = 0; v < (int)pCuts[i]->nLeaves; v++ ) + Delay = Abc_MaxInt( Delay, Vec_IntEntry(p->vDelays, pCuts[i]->pLeaves[v]) ); + //DelayMin = Abc_MinInt( DelayMin, Delay ); + if ( DelayMin > Delay ) + { + DelayMin = Delay; + p->iCutBest = i; + } + else if ( DelayMin == Delay && p->iCutBest >= 0 && pCuts[p->iCutBest]->nLeaves > pCuts[i]->nLeaves ) + p->iCutBest = i; + } + assert( p->iCutBest >= 0 ); + assert( DelayMin < ABC_INFINITY ); + DelayMin = (nCuts > 1 || pCuts[0]->nLeaves > 1) ? DelayMin + 1 : DelayMin; + Vec_IntWriteEntry( p->vDelays, iObj, DelayMin ); + p->DelayMin = Abc_MaxInt( p->DelayMin, DelayMin ); +} +static inline void Sbd_StoComputeSpec( Sbd_Sto_t * p, int iObj, Sbd_Cut_t ** pCuts, int nCuts ) +{ + int i; + for ( i = 0; i < nCuts; i++ ) + { + pCuts[i]->nTopLeaves = Sbd_CutTopLeaves( p, iObj, pCuts[i] ); + pCuts[i]->nSlowLeaves = Sbd_CutSlowLeaves( p, iObj, pCuts[i] ); + p->nCutsSpec += (pCuts[i]->nSlowLeaves == 0); + } +} +static inline void Sbd_CutPrint( Sbd_Sto_t * p, int iObj, Sbd_Cut_t * pCut ) +{ + int i, nDigits = Abc_Base10Log(Gia_ManObjNum(p->pGia)); + int Delay = Vec_IntEntry(p->vDelays, iObj); + if ( pCut == NULL ) { printf( "No cut.\n" ); return; } + printf( "%d {", pCut->nLeaves ); + for ( i = 0; i < (int)pCut->nLeaves; i++ ) + printf( " %*d", nDigits, pCut->pLeaves[i] ); + for ( ; i < (int)p->nCutSize; i++ ) + printf( " %*s", nDigits, " " ); + printf( " } Cost = %3d CostL = %3d Tree = %d Slow = %d Top = %d ", + pCut->Cost, pCut->CostLev, pCut->nTreeLeaves, pCut->nSlowLeaves, pCut->nTopLeaves ); + printf( "%c ", pCut->nSlowLeaves == 0 ? '*' : ' ' ); + for ( i = 0; i < (int)pCut->nLeaves; i++ ) + printf( "%3d ", Vec_IntEntry(p->vDelays, pCut->pLeaves[i]) - Delay ); + printf( "\n" ); +} +void Sbd_StoMergeCuts( Sbd_Sto_t * p, int iObj ) +{ + Gia_Obj_t * pObj = Gia_ManObj(p->pGia, iObj); + int fIsXor = Gia_ObjIsXor(pObj); + int nCutSize = p->nCutSize; + int nCutNum = p->nCutNum; + int Lit0m = p->vMirrors ? Vec_IntEntry( p->vMirrors, Gia_ObjFaninId0(pObj, iObj) ) : -1; + int Lit1m = p->vMirrors ? Vec_IntEntry( p->vMirrors, Gia_ObjFaninId1(pObj, iObj) ) : -1; + int fComp0 = Gia_ObjFaninC0(pObj) ^ (Lit0m >= 0 && Abc_LitIsCompl(Lit0m)); + int fComp1 = Gia_ObjFaninC1(pObj) ^ (Lit1m >= 0 && Abc_LitIsCompl(Lit1m)); + int Fan0 = Lit0m >= 0 ? Abc_Lit2Var(Lit0m) : Gia_ObjFaninId0(pObj, iObj); + int Fan1 = Lit1m >= 0 ? Abc_Lit2Var(Lit1m) : Gia_ObjFaninId1(pObj, iObj); + int nCuts0 = Sbd_StoPrepareSet( p, Fan0, 0 ); + int nCuts1 = Sbd_StoPrepareSet( p, Fan1, 1 ); + int i, k, nCutsR = 0; + Sbd_Cut_t * pCut0, * pCut1, ** pCutsR = p->ppCuts; + assert( !Gia_ObjIsBuf(pObj) ); + assert( !Gia_ObjIsMux(p->pGia, pObj) ); + Sbd_StoInitResult( p ); + p->CutCount[0] += nCuts0 * nCuts1; + for ( i = 0, pCut0 = p->pCuts[0]; i < nCuts0; i++, pCut0++ ) + for ( k = 0, pCut1 = p->pCuts[1]; k < nCuts1; k++, pCut1++ ) + { + if ( (int)(pCut0->nLeaves + pCut1->nLeaves) > nCutSize && Sbd_CutCountBits(pCut0->Sign | pCut1->Sign) > nCutSize ) + continue; + p->CutCount[1]++; + if ( !Sbd_CutMergeOrder(pCut0, pCut1, pCutsR[nCutsR], nCutSize) ) + continue; + if ( Sbd_CutSetLastCutIsContained(pCutsR, nCutsR) ) + continue; + p->CutCount[2]++; + if ( p->fCutMin && Sbd_CutComputeTruth(p, pCut0, pCut1, fComp0, fComp1, pCutsR[nCutsR], fIsXor) ) + pCutsR[nCutsR]->Sign = Sbd_CutGetSign(pCutsR[nCutsR]); + pCutsR[nCutsR]->Cost = Sbd_CutCost( p, pCutsR[nCutsR] ); + pCutsR[nCutsR]->CostLev = Sbd_CutCostLev( p, pCutsR[nCutsR] ); + pCutsR[nCutsR]->nTreeLeaves = Sbd_CutTreeLeaves( p, pCutsR[nCutsR] ); + nCutsR = Sbd_CutSetAddCut( pCutsR, nCutsR, nCutNum ); + } + Sbd_StoComputeDelay( p, iObj, pCutsR, nCutsR ); + Sbd_StoComputeSpec( p, iObj, pCutsR, nCutsR ); + p->CutCount[3] += nCutsR; + p->nCutsOver += nCutsR == nCutNum-1; + p->nCutsR = nCutsR; + p->Pivot = iObj; + // debug printout + if ( 0 ) + { + printf( "*** Obj = %4d Delay = %4d NumCuts = %4d\n", iObj, Vec_IntEntry(p->vDelays, iObj), nCutsR ); + for ( i = 0; i < nCutsR; i++ ) + if ( (int)pCutsR[i]->nLeaves <= p->nLutSize || pCutsR[i]->nSlowLeaves < 2 ) + Sbd_CutPrint( p, iObj, pCutsR[i] ); + printf( "\n" ); + } + // verify + assert( nCutsR > 0 && nCutsR < nCutNum ); + assert( Sbd_CutSetCheckArray(pCutsR, nCutsR) ); + // store the cutset + Sbd_StoStoreResult( p, iObj, pCutsR, nCutsR ); + if ( nCutsR > 1 || pCutsR[0]->nLeaves > 1 ) + Sbd_CutAddUnit( p, iObj ); +} + +/**Function************************************************************* + + Synopsis [Incremental cut computation.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Sbd_Sto_t * Sbd_StoAlloc( Gia_Man_t * pGia, Vec_Int_t * vMirrors, int nLutSize, int nCutSize, int nCutNum, int fCutMin, int fVerbose ) +{ + Sbd_Sto_t * p; + assert( nLutSize <= nCutSize ); + assert( nCutSize < SBD_CUT_NO_LEAF ); + assert( nCutSize > 1 && nCutSize <= SBD_MAX_CUTSIZE ); + assert( nCutNum > 1 && nCutNum < SBD_MAX_CUTNUM ); + p = ABC_CALLOC( Sbd_Sto_t, 1 ); + p->clkStart = Abc_Clock(); + p->nLutSize = nLutSize; + p->nCutSize = nCutSize; + p->nCutNum = nCutNum; + p->fCutMin = fCutMin; + p->fVerbose = fVerbose; + p->pGia = pGia; + p->vMirrors = vMirrors; + p->vDelays = Vec_IntStart( Gia_ManObjNum(pGia) ); + p->vLevels = Vec_IntStart( Gia_ManObjNum(pGia) ); + p->vRefs = Vec_IntAlloc( Gia_ManObjNum(pGia) ); + p->vCuts = Vec_WecStart( Gia_ManObjNum(pGia) ); + p->vTtMem = fCutMin ? Vec_MemAllocForTT( nCutSize, 0 ) : NULL; + return p; +} +void Sbd_StoFree( Sbd_Sto_t * p ) +{ + Vec_IntFree( p->vDelays ); + Vec_IntFree( p->vLevels ); + Vec_IntFree( p->vRefs ); + Vec_WecFree( p->vCuts ); + if ( p->fCutMin ) + Vec_MemHashFree( p->vTtMem ); + if ( p->fCutMin ) + Vec_MemFree( p->vTtMem ); + ABC_FREE( p ); +} +void Sbd_StoComputeCutsObj( Sbd_Sto_t * p, int iObj, int Delay, int Level ) +{ + if ( iObj < Vec_IntSize(p->vDelays) ) + { + Vec_IntWriteEntry( p->vDelays, iObj, Delay ); + Vec_IntWriteEntry( p->vLevels, iObj, Level ); + } + else + { + assert( iObj == Vec_IntSize(p->vDelays) ); + assert( iObj == Vec_IntSize(p->vLevels) ); + assert( iObj == Vec_WecSize(p->vCuts) ); + Vec_IntPush( p->vDelays, Delay ); + Vec_IntPush( p->vLevels, Level ); + Vec_WecPushLevel( p->vCuts ); + } +} +void Sbd_StoComputeCutsConst0( Sbd_Sto_t * p, int iObj ) +{ + Sbd_StoComputeCutsObj( p, iObj, 0, 0 ); + Sbd_CutAddZero( p, iObj ); +} +void Sbd_StoComputeCutsCi( Sbd_Sto_t * p, int iObj, int Delay, int Level ) +{ + Sbd_StoComputeCutsObj( p, iObj, Delay, Level ); + Sbd_CutAddUnit( p, iObj ); +} +int Sbd_StoComputeCutsNode( Sbd_Sto_t * p, int iObj ) +{ + Gia_Obj_t * pObj = Gia_ManObj(p->pGia, iObj); + int Lev0 = Vec_IntEntry( p->vLevels, Gia_ObjFaninId0(pObj, iObj) ); + int Lev1 = Vec_IntEntry( p->vLevels, Gia_ObjFaninId1(pObj, iObj) ); + Sbd_StoComputeCutsObj( p, iObj, -1, 1 + Abc_MaxInt(Lev0, Lev1) ); + Sbd_StoMergeCuts( p, iObj ); + return Vec_IntEntry( p->vDelays, iObj ); +} +void Sbd_StoSaveBestDelayCut( Sbd_Sto_t * p, int iObj, int * pCut ) +{ + Sbd_Cut_t * pCutBest = p->ppCuts[p->iCutBest]; int i; + assert( iObj == p->Pivot ); + pCut[0] = pCutBest->nLeaves; + for ( i = 0; i < (int)pCutBest->nLeaves; i++ ) + pCut[i+1] = pCutBest->pLeaves[i]; +} +int Sbd_StoObjRefs( Sbd_Sto_t * p, int iObj ) +{ + return Vec_IntEntry(p->vRefs, iObj); +} +void Sbd_StoRefObj( Sbd_Sto_t * p, int iObj, int iMirror ) +{ + Gia_Obj_t * pObj = Gia_ManObj(p->pGia, iObj); + assert( iObj == Vec_IntSize(p->vRefs) ); + assert( iMirror < iObj ); + Vec_IntPush( p->vRefs, 0 ); +//printf( "Ref %d\n", iObj ); + if ( iMirror > 0 ) + { + Vec_IntWriteEntry( p->vRefs, iObj, Vec_IntEntry(p->vRefs, iMirror) ); + Vec_IntWriteEntry( p->vRefs, iMirror, 1 ); + } + if ( Gia_ObjIsAnd(pObj) ) + { + int Lit0m = Vec_IntEntry( p->vMirrors, Gia_ObjFaninId0(pObj, iObj) ); + int Lit1m = Vec_IntEntry( p->vMirrors, Gia_ObjFaninId1(pObj, iObj) ); + int Fan0 = Lit0m >= 0 ? Abc_Lit2Var(Lit0m) : Gia_ObjFaninId0(pObj, iObj); + int Fan1 = Lit1m >= 0 ? Abc_Lit2Var(Lit1m) : Gia_ObjFaninId1(pObj, iObj); + Vec_IntAddToEntry( p->vRefs, Fan0, 1 ); + Vec_IntAddToEntry( p->vRefs, Fan1, 1 ); + } + else if ( Gia_ObjIsCo(pObj) ) + { + int Lit0m = Vec_IntEntry( p->vMirrors, Gia_ObjFaninId0(pObj, iObj) ); + assert( Lit0m == -1 ); + Vec_IntAddToEntry( p->vRefs, Gia_ObjFaninId0(pObj, iObj), 1 ); + } +} +void Sbd_StoDerefObj( Sbd_Sto_t * p, int iObj ) +{ + Gia_Obj_t * pObj; + int Lit0m, Lit1m, Fan0, Fan1; + return; + + pObj = Gia_ManObj(p->pGia, iObj); + if ( Vec_IntEntry(p->vRefs, iObj) == 0 ) + printf( "Ref count mismatch at node %d\n", iObj ); + assert( Vec_IntEntry(p->vRefs, iObj) > 0 ); + Vec_IntAddToEntry( p->vRefs, iObj, -1 ); + if ( Vec_IntEntry( p->vRefs, iObj ) > 0 ) + return; + if ( Gia_ObjIsCi(pObj) ) + return; +//printf( "Deref %d\n", iObj ); + assert( Gia_ObjIsAnd(pObj) ); + Lit0m = Vec_IntEntry( p->vMirrors, Gia_ObjFaninId0(pObj, iObj) ); + Lit1m = Vec_IntEntry( p->vMirrors, Gia_ObjFaninId1(pObj, iObj) ); + Fan0 = Lit0m >= 0 ? Abc_Lit2Var(Lit0m) : Gia_ObjFaninId0(pObj, iObj); + Fan1 = Lit1m >= 0 ? Abc_Lit2Var(Lit1m) : Gia_ObjFaninId1(pObj, iObj); + if ( Fan0 ) Sbd_StoDerefObj( p, Fan0 ); + if ( Fan1 ) Sbd_StoDerefObj( p, Fan1 ); +} +int Sbd_StoObjBestCut( Sbd_Sto_t * p, int iObj, int nSize, int * pLeaves ) +{ + int fVerbose = 0; + Sbd_Cut_t * pCutBest = NULL; int i; + assert( p->Pivot == iObj ); + if ( fVerbose && iObj % 1000 == 0 ) + printf( "Node %6d : \n", iObj ); + for ( i = 0; i < p->nCutsR; i++ ) + { + if ( fVerbose && iObj % 1000 == 0 ) + Sbd_CutPrint( p, iObj, p->ppCuts[i] ); + if ( nSize && (int)p->ppCuts[i]->nLeaves != nSize ) + continue; + if ( (int)p->ppCuts[i]->nLeaves > p->nLutSize && + (int)p->ppCuts[i]->nSlowLeaves <= 1 && + (int)p->ppCuts[i]->nTopLeaves <= p->nLutSize-1 && + (pCutBest == NULL || Sbd_CutCompare2(pCutBest, p->ppCuts[i]) == 1) ) + pCutBest = p->ppCuts[i]; + } + if ( fVerbose && iObj % 1000 == 0 ) + { + printf( "Best cut of size %d:\n", nSize ); + Sbd_CutPrint( p, iObj, pCutBest ); + } + if ( pCutBest == NULL ) + return -1; + assert( pCutBest->nLeaves <= SBD_DIV_MAX ); + for ( i = 0; i < (int)pCutBest->nLeaves; i++ ) + pLeaves[i] = pCutBest->pLeaves[i]; + return pCutBest->nLeaves; +} +void Sbd_StoComputeCutsTest( Gia_Man_t * pGia ) +{ + Sbd_Sto_t * p = Sbd_StoAlloc( pGia, NULL, 4, 8, 100, 1, 1 ); + Gia_Obj_t * pObj; + int i, iObj; + // prepare references + Gia_ManForEachObj( p->pGia, pObj, iObj ) + Sbd_StoRefObj( p, iObj, -1 ); + // compute cuts + Sbd_StoComputeCutsConst0( p, 0 ); + Gia_ManForEachCiId( p->pGia, iObj, i ) + Sbd_StoComputeCutsCi( p, iObj, 0, 0 ); + Gia_ManForEachAnd( p->pGia, pObj, iObj ) + Sbd_StoComputeCutsNode( p, iObj ); + if ( p->fVerbose ) + { + printf( "Running cut computation with LutSize = %d CutSize = %d CutNum = %d:\n", p->nLutSize, p->nCutSize, p->nCutNum ); + printf( "CutPair = %.0f ", p->CutCount[0] ); + printf( "Merge = %.0f (%.2f %%) ", p->CutCount[1], 100.0*p->CutCount[1]/p->CutCount[0] ); + printf( "Eval = %.0f (%.2f %%) ", p->CutCount[2], 100.0*p->CutCount[2]/p->CutCount[0] ); + printf( "Cut = %.0f (%.2f %%) ", p->CutCount[3], 100.0*p->CutCount[3]/p->CutCount[0] ); + printf( "Cut/Node = %.2f ", p->CutCount[3] / Gia_ManAndNum(p->pGia) ); + printf( "\n" ); + printf( "Spec = %4d ", p->nCutsSpec ); + printf( "Over = %4d ", p->nCutsOver ); + printf( "Lev = %4d ", p->DelayMin ); + Abc_PrintTime( 0, "Time", Abc_Clock() - p->clkStart ); + } + Sbd_StoFree( p ); +} + + + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + diff --git a/src/opt/sbd/sbdCut2.c b/src/opt/sbd/sbdCut2.c new file mode 100644 index 00000000..b4a8be74 --- /dev/null +++ b/src/opt/sbd/sbdCut2.c @@ -0,0 +1,431 @@ +/**CFile**************************************************************** + + FileName [sbdCut2.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [SAT-based optimization using internal don't-cares.] + + Synopsis [Cut computation.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 20, 2005.] + + Revision [$Id: sbdCut2.c,v 1.00 2005/06/20 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include "sbdInt.h" + +ABC_NAMESPACE_IMPL_START + + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +#define SBD_MAX_CUTSIZE 10 +#define SBD_MAX_CUTNUM 501 + +#define SBD_CUT_NO_LEAF 0xF + +typedef struct Sbd_Cut_t_ Sbd_Cut_t; +struct Sbd_Cut_t_ +{ + word Sign; // signature + int iFunc; // functionality + int Cost; // cut cost + int CostLev; // cut cost + unsigned nTreeLeaves : 9; // tree leaves + unsigned nSlowLeaves : 9; // slow leaves + unsigned nTopLeaves : 10; // top leaves + unsigned nLeaves : 4; // leaf count + int pLeaves[SBD_MAX_CUTSIZE]; // leaves +}; + +struct Sbd_Srv_t_ +{ + int nLutSize; + int nCutSize; + int nCutNum; + int fVerbose; + Gia_Man_t * pGia; // user's AIG manager (will be modified by adding nodes) + Vec_Int_t * vMirrors; // mirrors for each node + Vec_Int_t * vLutLevs; // delays for each node + Vec_Int_t * vLevs; // levels for each node + Vec_Int_t * vRefs; // refs for each node + Sbd_Cut_t pCuts[SBD_MAX_CUTNUM]; // temporary cuts + Sbd_Cut_t * ppCuts[SBD_MAX_CUTNUM]; // temporary cut pointers + abctime clkStart; // starting time + Vec_Int_t * vCut0; // current cut + Vec_Int_t * vCut; // current cut + Vec_Int_t * vCutTop; // current cut + Vec_Int_t * vCutBot; // current cut +}; + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Sbd_Srv_t * Sbd_ManCutServerStart( Gia_Man_t * pGia, Vec_Int_t * vMirrors, + Vec_Int_t * vLutLevs, Vec_Int_t * vLevs, Vec_Int_t * vRefs, + int nLutSize, int nCutSize, int nCutNum, int fVerbose ) +{ + Sbd_Srv_t * p; + assert( nLutSize <= nCutSize ); + assert( nCutSize < SBD_CUT_NO_LEAF ); + assert( nCutSize > 1 && nCutSize <= SBD_MAX_CUTSIZE ); + assert( nCutNum > 1 && nCutNum < SBD_MAX_CUTNUM ); + p = ABC_CALLOC( Sbd_Srv_t, 1 ); + p->clkStart = Abc_Clock(); + p->nLutSize = nLutSize; + p->nCutSize = nCutSize; + p->nCutNum = nCutNum; + p->fVerbose = fVerbose; + p->pGia = pGia; + p->vMirrors = vMirrors; + p->vLutLevs = vLutLevs; + p->vLevs = vLevs; + p->vRefs = vRefs; + p->vCut0 = Vec_IntAlloc( 100 ); + p->vCut = Vec_IntAlloc( 100 ); + p->vCutTop = Vec_IntAlloc( 100 ); + p->vCutBot = Vec_IntAlloc( 100 ); + return p; +} +void Sbd_ManCutServerStop( Sbd_Srv_t * p ) +{ + Vec_IntFree( p->vCut0 ); + Vec_IntFree( p->vCut ); + Vec_IntFree( p->vCutTop ); + Vec_IntFree( p->vCutBot ); + ABC_FREE( p ); +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Sbd_ManCutIsTopo_rec( Gia_Man_t * p, Vec_Int_t * vMirrors, int iObj ) +{ + Gia_Obj_t * pObj; + int Ret0, Ret1; + if ( Vec_IntEntry(vMirrors, iObj) >= 0 ) + iObj = Abc_Lit2Var(Vec_IntEntry(vMirrors, iObj)); + if ( !iObj || Gia_ObjIsTravIdCurrentId(p, iObj) ) + return 1; + Gia_ObjSetTravIdCurrentId(p, iObj); + pObj = Gia_ManObj( p, iObj ); + if ( Gia_ObjIsCi(pObj) ) + return 0; + assert( Gia_ObjIsAnd(pObj) ); + Ret0 = Sbd_ManCutIsTopo_rec( p, vMirrors, Gia_ObjFaninId0(pObj, iObj) ); + Ret1 = Sbd_ManCutIsTopo_rec( p, vMirrors, Gia_ObjFaninId1(pObj, iObj) ); + return Ret0 && Ret1; +} +int Sbd_ManCutIsTopo( Gia_Man_t * p, Vec_Int_t * vMirrors, Vec_Int_t * vCut, int iObj ) +{ + int i, Entry, RetValue; + Gia_ManIncrementTravId( p ); + Vec_IntForEachEntry( vCut, Entry, i ) + Gia_ObjSetTravIdCurrentId( p, Entry ); + RetValue = Sbd_ManCutIsTopo_rec( p, vMirrors, iObj ); + if ( RetValue == 0 ) + printf( "Cut of node %d is not tological\n", iObj ); + assert( RetValue ); + return RetValue; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline int Sbd_ManCutExpandOne( Gia_Man_t * p, Vec_Int_t * vMirrors, Vec_Int_t * vLutLevs, Vec_Int_t * vCut, int iThis, int iObj ) +{ + int Lit0m, Lit1m, Fan0, Fan1, iPlace0, iPlace1; + int LutLev = Vec_IntEntry( vLutLevs, iObj ); + Gia_Obj_t * pObj = Gia_ManObj(p, iObj); + if ( Gia_ObjIsCi(pObj) ) + return 0; + assert( Gia_ObjIsAnd(pObj) ); + Lit0m = Vec_IntEntry( vMirrors, Gia_ObjFaninId0(pObj, iObj) ); + Lit1m = Vec_IntEntry( vMirrors, Gia_ObjFaninId1(pObj, iObj) ); + Fan0 = Lit0m >= 0 ? Abc_Lit2Var(Lit0m) : Gia_ObjFaninId0(pObj, iObj); + Fan1 = Lit1m >= 0 ? Abc_Lit2Var(Lit1m) : Gia_ObjFaninId1(pObj, iObj); + iPlace0 = Vec_IntFind( vCut, Fan0 ); + iPlace1 = Vec_IntFind( vCut, Fan1 ); + if ( iPlace0 == -1 && iPlace1 == -1 ) + return 0; + if ( Vec_IntEntry(vLutLevs, Fan0) > LutLev || Vec_IntEntry(vLutLevs, Fan1) > LutLev ) + return 0; + Vec_IntDrop( vCut, iThis ); + if ( iPlace0 == -1 && Fan0 ) + Vec_IntPushOrder( vCut, Fan0 ); + if ( iPlace1 == -1 && Fan1 ) + Vec_IntPushOrder( vCut, Fan1 ); + return 1; +} +void Vec_IntIsOrdered( Vec_Int_t * vCut ) +{ + int i, Prev, Entry; + Prev = Vec_IntEntry( vCut, 0 ); + Vec_IntForEachEntryStart( vCut, Entry, i, 1 ) + { + assert( Prev < Entry ); + Prev = Entry; + } +} +void Sbd_ManCutExpand( Gia_Man_t * p, Vec_Int_t * vMirrors, Vec_Int_t * vLutLevs, Vec_Int_t * vCut ) +{ + int i, Entry; + do + { + Vec_IntForEachEntry( vCut, Entry, i ) + if ( Sbd_ManCutExpandOne( p, vMirrors, vLutLevs, vCut, i, Entry ) ) + break; + } + while ( i < Vec_IntSize(vCut) ); +} +void Sbd_ManCutReload( Vec_Int_t * vMirrors, Vec_Int_t * vLutLevs, int LevStop, Vec_Int_t * vCut, Vec_Int_t * vCutTop, Vec_Int_t * vCutBot ) +{ + int i, Entry; + Vec_IntClear( vCutTop ); + Vec_IntClear( vCutBot ); + Vec_IntForEachEntry( vCut, Entry, i ) + { + assert( Entry ); + assert( Vec_IntEntry(vMirrors, Entry) == -1 ); + assert( Vec_IntEntry(vLutLevs, Entry) <= LevStop ); + if ( Vec_IntEntry(vLutLevs, Entry) == LevStop ) + Vec_IntPush( vCutTop, Entry ); + else + Vec_IntPush( vCutBot, Entry ); + } + Vec_IntIsOrdered( vCut ); +} +int Sbd_ManCutCollect_rec( Gia_Man_t * p, Vec_Int_t * vMirrors, int iObj, int LevStop, Vec_Int_t * vLutLevs, Vec_Int_t * vCut ) +{ + Gia_Obj_t * pObj; + int Ret0, Ret1; + if ( Vec_IntEntry(vMirrors, iObj) >= 0 ) + iObj = Abc_Lit2Var(Vec_IntEntry(vMirrors, iObj)); + if ( !iObj || Gia_ObjIsTravIdCurrentId(p, iObj) ) + return 1; + Gia_ObjSetTravIdCurrentId(p, iObj); + pObj = Gia_ManObj( p, iObj ); + if ( Gia_ObjIsCi(pObj) || Vec_IntEntry(vLutLevs, iObj) <= LevStop ) + { + Vec_IntPush( vCut, iObj ); + return Vec_IntEntry(vLutLevs, iObj) <= LevStop; + } + assert( Gia_ObjIsAnd(pObj) ); + Ret0 = Sbd_ManCutCollect_rec( p, vMirrors, Gia_ObjFaninId0(pObj, iObj), LevStop, vLutLevs, vCut ); + Ret1 = Sbd_ManCutCollect_rec( p, vMirrors, Gia_ObjFaninId1(pObj, iObj), LevStop, vLutLevs, vCut ); + return Ret0 && Ret1; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Sbd_ManCutReduceTop( Gia_Man_t * p, Vec_Int_t * vMirrors, int iObj, Vec_Int_t * vLutLevs, Vec_Int_t * vCut, Vec_Int_t * vCutTop, int nCutSize ) +{ + int i, Entry, Lit0m, Lit1m, Fan0, Fan1; + int LevStop = Vec_IntEntry(vLutLevs, iObj) - 2; + Vec_IntIsOrdered( vCut ); + Vec_IntForEachEntryReverse( vCutTop, Entry, i ) + { + Gia_Obj_t * pObj = Gia_ManObj( p, Entry ); + if ( Gia_ObjIsCi(pObj) ) + continue; + assert( Gia_ObjIsAnd(pObj) ); + assert( Vec_IntEntry(vLutLevs, Entry) == LevStop ); + Lit0m = Vec_IntEntry( vMirrors, Gia_ObjFaninId0(pObj, Entry) ); + Lit1m = Vec_IntEntry( vMirrors, Gia_ObjFaninId1(pObj, Entry) ); + Fan0 = Lit0m >= 0 ? Abc_Lit2Var(Lit0m) : Gia_ObjFaninId0(pObj, Entry); + Fan1 = Lit1m >= 0 ? Abc_Lit2Var(Lit1m) : Gia_ObjFaninId1(pObj, Entry); + if ( Vec_IntEntry(vLutLevs, Fan0) > LevStop || Vec_IntEntry(vLutLevs, Fan1) > LevStop ) + continue; + assert( Vec_IntEntry(vLutLevs, Fan0) <= LevStop ); + assert( Vec_IntEntry(vLutLevs, Fan1) <= LevStop ); + if ( Vec_IntEntry(vLutLevs, Fan0) == LevStop && Vec_IntEntry(vLutLevs, Fan1) == LevStop ) + continue; + Vec_IntRemove( vCut, Entry ); + if ( Fan0 ) Vec_IntPushUniqueOrder( vCut, Fan0 ); + if ( Fan1 ) Vec_IntPushUniqueOrder( vCut, Fan1 ); + //Sbd_ManCutIsTopo( p, vMirrors, vCut, iObj ); + return 1; + } + return 0; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Sbd_ManCutServerFirst( Sbd_Srv_t * p, int iObj, int * pLeaves ) +{ + int RetValue, LevStop = Vec_IntEntry(p->vLutLevs, iObj) - 2; + + Vec_IntClear( p->vCut ); + Gia_ManIncrementTravId( p->pGia ); + RetValue = Sbd_ManCutCollect_rec( p->pGia, p->vMirrors, iObj, LevStop, p->vLutLevs, p->vCut ); + if ( RetValue == 0 ) // cannot build delay-improving cut + return -1; + // check if the current cut is good + Vec_IntSort( p->vCut, 0 ); +/* + Sbd_ManCutReload( p->vMirrors, p->vLutLevs, LevStop, p->vCut, p->vCutTop, p->vCutBot ); + if ( Vec_IntSize(p->vCut) <= p->nCutSize && Vec_IntSize(p->vCutTop) <= p->nLutSize-1 ) + { + //printf( "%d ", Vec_IntSize(p->vCut) ); + memcpy( pLeaves, Vec_IntArray(p->vCut), sizeof(int) * Vec_IntSize(p->vCut) ); + return Vec_IntSize(p->vCut); + } +*/ + // try to expand the cut + Sbd_ManCutExpand( p->pGia, p->vMirrors, p->vLutLevs, p->vCut ); + Sbd_ManCutReload( p->vMirrors, p->vLutLevs, LevStop, p->vCut, p->vCutTop, p->vCutBot ); + if ( Vec_IntSize(p->vCut) <= p->nCutSize && Vec_IntSize(p->vCutTop) <= p->nLutSize-1 ) + { + //printf( "1=(%d,%d) ", Vec_IntSize(p->vCutTop), Vec_IntSize(p->vCutBot) ); + //printf( "%d ", Vec_IntSize(p->vCut) ); + memcpy( pLeaves, Vec_IntArray(p->vCut), sizeof(int) * Vec_IntSize(p->vCut) ); + return Vec_IntSize(p->vCut); + } + + // try to reduce the topmost + Vec_IntClear( p->vCut0 ); + Vec_IntAppend( p->vCut0, p->vCut ); + if ( Vec_IntSize(p->vCut) < p->nCutSize && Sbd_ManCutReduceTop( p->pGia, p->vMirrors, iObj, p->vLutLevs, p->vCut, p->vCutTop, p->nCutSize ) ) + { + Sbd_ManCutExpand( p->pGia, p->vMirrors, p->vLutLevs, p->vCut ); + Sbd_ManCutReload( p->vMirrors, p->vLutLevs, LevStop, p->vCut, p->vCutTop, p->vCutBot ); + assert( Vec_IntSize(p->vCut) <= p->nCutSize ); + if ( Vec_IntSize(p->vCutTop) <= p->nLutSize-1 ) + { + //printf( "%d -> %d (%d + %d)\n", Vec_IntSize(p->vCut0), Vec_IntSize(p->vCut), Vec_IntSize(p->vCutTop), Vec_IntSize(p->vCutBot) ); + memcpy( pLeaves, Vec_IntArray(p->vCut), sizeof(int) * Vec_IntSize(p->vCut) ); + return Vec_IntSize(p->vCut); + } + // try again + if ( Vec_IntSize(p->vCut) < p->nCutSize && Sbd_ManCutReduceTop( p->pGia, p->vMirrors, iObj, p->vLutLevs, p->vCut, p->vCutTop, p->nCutSize ) ) + { + Sbd_ManCutExpand( p->pGia, p->vMirrors, p->vLutLevs, p->vCut ); + Sbd_ManCutReload( p->vMirrors, p->vLutLevs, LevStop, p->vCut, p->vCutTop, p->vCutBot ); + assert( Vec_IntSize(p->vCut) <= p->nCutSize ); + if ( Vec_IntSize(p->vCutTop) <= p->nLutSize-1 ) + { + //printf( "* %d -> %d (%d + %d)\n", Vec_IntSize(p->vCut0), Vec_IntSize(p->vCut), Vec_IntSize(p->vCutTop), Vec_IntSize(p->vCutBot) ); + memcpy( pLeaves, Vec_IntArray(p->vCut), sizeof(int) * Vec_IntSize(p->vCut) ); + return Vec_IntSize(p->vCut); + } + // try again + if ( Vec_IntSize(p->vCut) < p->nCutSize && Sbd_ManCutReduceTop( p->pGia, p->vMirrors, iObj, p->vLutLevs, p->vCut, p->vCutTop, p->nCutSize ) ) + { + Sbd_ManCutExpand( p->pGia, p->vMirrors, p->vLutLevs, p->vCut ); + Sbd_ManCutReload( p->vMirrors, p->vLutLevs, LevStop, p->vCut, p->vCutTop, p->vCutBot ); + assert( Vec_IntSize(p->vCut) <= p->nCutSize ); + if ( Vec_IntSize(p->vCutTop) <= p->nLutSize-1 ) + { + //printf( "** %d -> %d (%d + %d)\n", Vec_IntSize(p->vCut0), Vec_IntSize(p->vCut), Vec_IntSize(p->vCutTop), Vec_IntSize(p->vCutBot) ); + memcpy( pLeaves, Vec_IntArray(p->vCut), sizeof(int) * Vec_IntSize(p->vCut) ); + return Vec_IntSize(p->vCut); + } + // try again + if ( Vec_IntSize(p->vCut) < p->nCutSize && Sbd_ManCutReduceTop( p->pGia, p->vMirrors, iObj, p->vLutLevs, p->vCut, p->vCutTop, p->nCutSize ) ) + { + Sbd_ManCutExpand( p->pGia, p->vMirrors, p->vLutLevs, p->vCut ); + Sbd_ManCutReload( p->vMirrors, p->vLutLevs, LevStop, p->vCut, p->vCutTop, p->vCutBot ); + assert( Vec_IntSize(p->vCut) <= p->nCutSize ); + if ( Vec_IntSize(p->vCutTop) <= p->nLutSize-1 ) + { + //printf( "*** %d -> %d (%d + %d)\n", Vec_IntSize(p->vCut0), Vec_IntSize(p->vCut), Vec_IntSize(p->vCutTop), Vec_IntSize(p->vCutBot) ); + memcpy( pLeaves, Vec_IntArray(p->vCut), sizeof(int) * Vec_IntSize(p->vCut) ); + return Vec_IntSize(p->vCut); + } + } + } + } + } + + // recompute the cut + Vec_IntClear( p->vCut ); + Gia_ManIncrementTravId( p->pGia ); + RetValue = Sbd_ManCutCollect_rec( p->pGia, p->vMirrors, iObj, LevStop-1, p->vLutLevs, p->vCut ); + if ( RetValue == 0 ) // cannot build delay-improving cut + return -1; + // check if the current cut is good + Vec_IntSort( p->vCut, 0 ); +/* + Sbd_ManCutReload( p->vMirrors, p->vLutLevs, LevStop, p->vCut, p->vCutTop, p->vCutBot ); + if ( Vec_IntSize(p->vCut) <= p->nCutSize && Vec_IntSize(p->vCutTop) <= p->nLutSize-1 ) + { + //printf( "%d ", Vec_IntSize(p->vCut) ); + memcpy( pLeaves, Vec_IntArray(p->vCut), sizeof(int) * Vec_IntSize(p->vCut) ); + return Vec_IntSize(p->vCut); + } +*/ + // try to expand the cut + Sbd_ManCutExpand( p->pGia, p->vMirrors, p->vLutLevs, p->vCut ); + Sbd_ManCutReload( p->vMirrors, p->vLutLevs, LevStop, p->vCut, p->vCutTop, p->vCutBot ); + if ( Vec_IntSize(p->vCut) <= p->nCutSize && Vec_IntSize(p->vCutTop) <= p->nLutSize-1 ) + { + //printf( "2=(%d,%d) ", Vec_IntSize(p->vCutTop), Vec_IntSize(p->vCutBot) ); + //printf( "%d ", Vec_IntSize(p->vCut) ); + memcpy( pLeaves, Vec_IntArray(p->vCut), sizeof(int) * Vec_IntSize(p->vCut) ); + return Vec_IntSize(p->vCut); + } + + return -1; +} + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + diff --git a/src/opt/sbd/sbdInt.h b/src/opt/sbd/sbdInt.h index 4c553fb4..eabe5355 100644 --- a/src/opt/sbd/sbdInt.h +++ b/src/opt/sbd/sbdInt.h @@ -52,10 +52,26 @@ ABC_NAMESPACE_HEADER_START #define SBD_SAT_UNDEC 0x1234567812345678 #define SBD_SAT_SAT 0x8765432187654321 +#define SBD_LUTS_MAX 2 +#define SBD_SIZE_MAX 4 +#define SBD_DIV_MAX 10 +#define SBD_FVAR_MAX 100 + //////////////////////////////////////////////////////////////////////// /// BASIC TYPES /// //////////////////////////////////////////////////////////////////////// +typedef struct Sbd_Sto_t_ Sbd_Sto_t; +typedef struct Sbd_Srv_t_ Sbd_Srv_t; + +typedef struct Sbd_Str_t_ Sbd_Str_t; +struct Sbd_Str_t_ +{ + int fLut; // LUT or SEL + int nVarIns; // input count + int VarIns[SBD_DIV_MAX]; // input vars + word Res; // result of solving +}; //////////////////////////////////////////////////////////////////////// /// MACRO DEFINITIONS /// @@ -66,7 +82,38 @@ ABC_NAMESPACE_HEADER_START /// FUNCTION DECLARATIONS /// //////////////////////////////////////////////////////////////////////// -/*=== sbdCnf.c ==========================================================*/ +/*=== sbdCut.c ==========================================================*/ +extern Sbd_Sto_t * Sbd_StoAlloc( Gia_Man_t * pGia, Vec_Int_t * vMirrors, int nLutSize, int nCutSize, int nCutNum, int fCutMin, int fVerbose ); +extern void Sbd_StoFree( Sbd_Sto_t * p ); +extern int Sbd_StoObjRefs( Sbd_Sto_t * p, int iObj ); +extern void Sbd_StoRefObj( Sbd_Sto_t * p, int iObj, int iMirror ); +extern void Sbd_StoDerefObj( Sbd_Sto_t * p, int iObj ); +extern void Sbd_StoComputeCutsConst0( Sbd_Sto_t * p, int iObj ); +extern void Sbd_StoComputeCutsObj( Sbd_Sto_t * p, int iObj, int Delay, int Level ); +extern void Sbd_StoComputeCutsCi( Sbd_Sto_t * p, int iObj, int Delay, int Level ); +extern int Sbd_StoComputeCutsNode( Sbd_Sto_t * p, int iObj ); +extern void Sbd_StoSaveBestDelayCut( Sbd_Sto_t * p, int iObj, int * pCut ); +extern int Sbd_StoObjBestCut( Sbd_Sto_t * p, int iObj, int nSize, int * pLeaves ); +/*=== sbdCut2.c ==========================================================*/ +extern Sbd_Srv_t * Sbd_ManCutServerStart( Gia_Man_t * pGia, Vec_Int_t * vMirrors, + Vec_Int_t * vLutLevs, Vec_Int_t * vLevs, Vec_Int_t * vRefs, + int nLutSize, int nCutSize, int nCutNum, int fVerbose ); +extern void Sbd_ManCutServerStop( Sbd_Srv_t * p ); +extern int Sbd_ManCutServerFirst( Sbd_Srv_t * p, int iObj, int * pLeaves ); +/*=== sbdWin.c ==========================================================*/ +extern word Sbd_ManSolve( sat_solver * pSat, int PivotVar, int FreeVar, Vec_Int_t * vDivSet, Vec_Int_t * vDivVars, Vec_Int_t * vDivValues, Vec_Int_t * vTemp ); +extern sat_solver * Sbd_ManSatSolver( sat_solver * pSat, Gia_Man_t * p, Vec_Int_t * vMirrors, int Pivot, Vec_Int_t * vWinObjs, Vec_Int_t * vObj2Var, Vec_Int_t * vTfo, Vec_Int_t * vRoots, int fQbf ); +extern int Sbd_ManCollectConstants( sat_solver * pSat, int nCareMints[2], int PivotVar, word * pVarSims[], Vec_Int_t * vInds ); +extern int Sbd_ManCollectConstantsNew( sat_solver * pSat, Vec_Int_t * vDivVars, int nConsts, int PivotVar, word * pOnset, word * pOffset ); +/*=== sbdPath.c ==========================================================*/ +extern Vec_Bit_t * Sbc_ManCriticalPath( Gia_Man_t * p ); +/*=== sbdQbf.c ==========================================================*/ +extern int Sbd_ProblemSolve( + Gia_Man_t * p, Vec_Int_t * vMirrors, + int Pivot, Vec_Int_t * vWinObjs, Vec_Int_t * vObj2Var, + Vec_Int_t * vTfo, Vec_Int_t * vRoots, + Vec_Int_t * vDivSet, int nStrs, Sbd_Str_t * pStr0 + ); ABC_NAMESPACE_HEADER_END diff --git a/src/opt/sbd/sbdLut.c b/src/opt/sbd/sbdLut.c new file mode 100644 index 00000000..ffcb71f8 --- /dev/null +++ b/src/opt/sbd/sbdLut.c @@ -0,0 +1,311 @@ +/**CFile**************************************************************** + + FileName [sbdLut.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [SAT-based optimization using internal don't-cares.] + + Synopsis [CNF computation.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 20, 2005.] + + Revision [$Id: sbdLut.c,v 1.00 2005/06/20 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include "sbdInt.h" +#include "misc/util/utilTruth.h" + +ABC_NAMESPACE_IMPL_START + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +// count the number of parameter variables in the structure +int Sbd_ProblemCountParams( int nStrs, Sbd_Str_t * pStr0 ) +{ + Sbd_Str_t * pStr; int nPars = 0; + for ( pStr = pStr0; pStr < pStr0 + nStrs; pStr++ ) + nPars += pStr->fLut ? 1 << pStr->nVarIns : pStr->nVarIns; + return nPars; +} +// add clauses for the structure +int Sbd_ProblemAddClauses( sat_solver * pSat, int nVars, int nStrs, int * pVars, Sbd_Str_t * pStr0 ) +{ + // variable order: inputs, structure outputs, parameters + Sbd_Str_t * pStr; + int VarOut = nVars; + int VarPar = nVars + nStrs; + int m, k, n, status, pLits[SBD_SIZE_MAX+2]; +//printf( "Start par = %d. ", VarPar ); + for ( pStr = pStr0; pStr < pStr0 + nStrs; pStr++, VarOut++ ) + { + if ( pStr->fLut ) + { + int nMints = 1 << pStr->nVarIns; + assert( pStr->nVarIns <= 6 ); + for ( m = 0; m < nMints; m++, VarPar++ ) + { + for ( k = 0; k < pStr->nVarIns; k++ ) + pLits[k] = Abc_Var2Lit( pVars[pStr->VarIns[k]], (m >> k) & 1 ); + for ( n = 0; n < 2; n++ ) + { + pLits[pStr->nVarIns] = Abc_Var2Lit( pVars[VarPar], n ); + pLits[pStr->nVarIns+1] = Abc_Var2Lit( pVars[VarOut], !n ); + status = sat_solver_addclause( pSat, pLits, pLits + pStr->nVarIns + 2 ); + if ( !status ) + return 0; + } + } + } + else + { + assert( pStr->nVarIns <= SBD_DIV_MAX ); + for ( k = 0; k < pStr->nVarIns; k++, VarPar++ ) + { + for ( n = 0; n < 2; n++ ) + { + pLits[0] = Abc_Var2Lit( pVars[VarPar], 1 ); + pLits[1] = Abc_Var2Lit( pVars[VarOut], n ); + pLits[2] = Abc_Var2Lit( pVars[pStr->VarIns[k]], !n ); + status = sat_solver_addclause( pSat, pLits, pLits + 3 ); + if ( !status ) + return 0; + } + } + } + } + return 1; +} +void Sbd_ProblemAddClausesInit( sat_solver * pSat, int nVars, int nStrs, int * pVars, Sbd_Str_t * pStr0 ) +{ + Sbd_Str_t * pStr; + int VarPar = nVars + nStrs; + int m, m2, status, pLits[SBD_DIV_MAX]; + // make sure selector parameters are mutually exclusive + for ( pStr = pStr0; pStr < pStr0 + nStrs; VarPar += pStr->fLut ? 1 << pStr->nVarIns : pStr->nVarIns, pStr++ ) + { + if ( pStr->fLut ) + continue; + // one variable should be selected + assert( pStr->nVarIns <= SBD_DIV_MAX ); + for ( m = 0; m < pStr->nVarIns; m++ ) + pLits[m] = Abc_Var2Lit( pVars[VarPar + m], 0 ); + status = sat_solver_addclause( pSat, pLits, pLits + pStr->nVarIns ); + assert( status ); + // two variables cannot be selected + for ( m = 0; m < pStr->nVarIns; m++ ) + for ( m2 = m+1; m2 < pStr->nVarIns; m2++ ) + { + pLits[0] = Abc_Var2Lit( pVars[VarPar + m], 1 ); + pLits[1] = Abc_Var2Lit( pVars[VarPar + m2], 1 ); + status = sat_solver_addclause( pSat, pLits, pLits + 2 ); + assert( status ); + } + } +} +void Sbd_ProblemPrintSolution( int nStrs, Sbd_Str_t * pStr0, Vec_Int_t * vLits ) +{ + Sbd_Str_t * pStr; + int m, nIters, iLit = 0; + printf( "Solution found:\n" ); + for ( pStr = pStr0; pStr < pStr0 + nStrs; pStr++ ) + { + nIters = pStr->fLut ? 1 << pStr->nVarIns : pStr->nVarIns; + printf( "%s%d : ", pStr->fLut ? "LUT":"SEL", (int)(pStr-pStr0) ); + for ( m = 0; m < nIters; m++, iLit++ ) + printf( "%d", !Abc_LitIsCompl(Vec_IntEntry(vLits, iLit)) ); + printf( " {" ); + for ( m = 0; m < pStr->nVarIns; m++ ) + printf( " %d", pStr->VarIns[m] ); + printf( " }\n" ); + } + assert( iLit == Vec_IntSize(vLits) ); +} +void Sbd_ProblemCollectSolution( int nStrs, Sbd_Str_t * pStr0, Vec_Int_t * vLits ) +{ + Sbd_Str_t * pStr; + int m, nIters, iLit = 0; + for ( pStr = pStr0; pStr < pStr0 + nStrs; pStr++ ) + { + pStr->Res = 0; + if ( pStr->fLut ) + { + nIters = 1 << pStr->nVarIns; + for ( m = 0; m < nIters; m++, iLit++ ) + if ( !Abc_LitIsCompl(Vec_IntEntry(vLits, iLit)) ) + Abc_TtSetBit( &pStr->Res, m ); + pStr->Res = Abc_Tt6Stretch( pStr->Res, pStr->nVarIns ); + } + else + { + nIters = 0; + for ( m = 0; m < pStr->nVarIns; m++, iLit++ ) + if ( !Abc_LitIsCompl(Vec_IntEntry(vLits, iLit)) ) + { + pStr->Res = pStr->VarIns[m]; + nIters++; + } + assert( nIters == 1 ); + } + } + assert( iLit == Vec_IntSize(vLits) ); +} + +/**Function************************************************************* + + Synopsis [Solves QBF problem for the given window.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Sbd_ProblemSolve( Gia_Man_t * p, Vec_Int_t * vMirrors, + int Pivot, Vec_Int_t * vWinObjs, Vec_Int_t * vObj2Var, + Vec_Int_t * vTfo, Vec_Int_t * vRoots, + Vec_Int_t * vDivSet, int nStrs, Sbd_Str_t * pStr0 ) // divisors, structures +{ + extern sat_solver * Sbd_ManSatSolver( sat_solver * pSat, Gia_Man_t * p, Vec_Int_t * vMirrors, int Pivot, Vec_Int_t * vWinObjs, Vec_Int_t * vObj2Var, Vec_Int_t * vTfo, Vec_Int_t * vRoots, int fQbf ); + + int fVerbose = 0; + abctime clk = Abc_Clock(); + Vec_Int_t * vLits = Vec_IntAlloc( 100 ); + sat_solver * pSatCec = Sbd_ManSatSolver( NULL, p, vMirrors, Pivot, vWinObjs, vObj2Var, vTfo, vRoots, 1 ); + sat_solver * pSatQbf = sat_solver_new(); + + int nVars = Vec_IntSize( vDivSet ); + int nPars = Sbd_ProblemCountParams( nStrs, pStr0 ); + + int VarCecOut = Vec_IntSize(vWinObjs) + Vec_IntSize(vTfo) + Vec_IntSize(vRoots); + int VarCecPar = VarCecOut + nStrs; + + int VarQbfPar = 0; + int VarQbfFree = nPars; + + int pVarsCec[256]; + int pVarsQbf[256]; + int i, iVar, iLit, nIters; + int RetValue = 0; + + assert( Vec_IntSize(vDivSet) <= SBD_DIV_MAX ); + assert( nVars + nStrs + nPars <= 256 ); + + // collect CEC variables + Vec_IntForEachEntry( vDivSet, iVar, i ) + pVarsCec[i] = iVar; + for ( i = 0; i < nStrs; i++ ) + pVarsCec[nVars + i] = VarCecOut + i; + for ( i = 0; i < nPars; i++ ) + pVarsCec[nVars + nStrs + i] = VarCecPar + i; + + // collect QBF variables + for ( i = 0; i < nVars + nStrs; i++ ) + pVarsQbf[i] = -1; + for ( i = 0; i < nPars; i++ ) + pVarsQbf[nVars + nStrs + i] = VarQbfPar + i; + + // add clauses to the CEC problem + Sbd_ProblemAddClauses( pSatCec, nVars, nStrs, pVarsCec, pStr0 ); + + // create QBF solver + sat_solver_setnvars( pSatQbf, 1000 ); + Sbd_ProblemAddClausesInit( pSatQbf, nVars, nStrs, pVarsQbf, pStr0 ); + + // assume all parameter variables are 0 + Vec_IntClear( vLits ); + for ( i = 0; i < nPars; i++ ) + Vec_IntPush( vLits, Abc_Var2Lit(VarCecPar + i, 1) ); + for ( nIters = 0; nIters < (1 << nVars); nIters++ ) + { + // check if these parameters solve the problem + int status = sat_solver_solve( pSatCec, Vec_IntArray(vLits), Vec_IntLimit(vLits), 0, 0, 0, 0 ); + if ( status == l_False ) // solution found + break; + assert( status == l_True ); + + if ( fVerbose ) + { + printf( "Iter %3d : ", nIters ); + for ( i = 0; i < nPars; i++ ) + printf( "%d", !Abc_LitIsCompl(Vec_IntEntry(vLits, i)) ); + printf( " " ); + } + + Vec_IntClear( vLits ); + // create new QBF variables + for ( i = 0; i < nVars + nStrs; i++ ) + pVarsQbf[i] = VarQbfFree++; + // set their values + Vec_IntForEachEntry( vDivSet, iVar, i ) + { + iLit = Abc_Var2Lit( pVarsQbf[i], !sat_solver_var_value(pSatCec, iVar) ); + status = sat_solver_addclause( pSatQbf, &iLit, &iLit + 1 ); + assert( status ); + if ( fVerbose ) + printf( "%d", sat_solver_var_value(pSatCec, iVar) ); + } + iLit = Abc_Var2Lit( pVarsQbf[nVars], sat_solver_var_value(pSatCec, VarCecOut) ); + status = sat_solver_addclause( pSatQbf, &iLit, &iLit + 1 ); + assert( status ); + if ( fVerbose ) + printf( " %d\n", !sat_solver_var_value(pSatCec, VarCecOut) ); + // add clauses to the QBF problem + if ( !Sbd_ProblemAddClauses( pSatQbf, nVars, nStrs, pVarsQbf, pStr0 ) ) + break; // solution does not exist + // check if solution still exists + status = sat_solver_solve( pSatQbf, NULL, NULL, 0, 0, 0, 0 ); + if ( status == l_False ) // solution does not exist + break; + assert( status == l_True ); + // find the new values of parameters + assert( Vec_IntSize(vLits) == 0 ); + for ( i = 0; i < nPars; i++ ) + Vec_IntPush( vLits, Abc_Var2Lit(VarCecPar + i, !sat_solver_var_value(pSatQbf, VarQbfPar + i)) ); + } + if ( Vec_IntSize(vLits) > 0 ) + { + //Sbd_ProblemPrintSolution( nStrs, pStr0, vLits ); + Sbd_ProblemCollectSolution( nStrs, pStr0, vLits ); + RetValue = 1; + } + sat_solver_delete( pSatCec ); + sat_solver_delete( pSatQbf ); + Vec_IntFree( vLits ); + + if ( fVerbose ) + Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); + return RetValue; +} + + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + diff --git a/src/opt/sbd/sbdPath.c b/src/opt/sbd/sbdPath.c new file mode 100644 index 00000000..270c81c8 --- /dev/null +++ b/src/opt/sbd/sbdPath.c @@ -0,0 +1,197 @@ +/**CFile**************************************************************** + + FileName [sbdPath.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [SAT-based optimization using internal don't-cares.] + + Synopsis [Critical path.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 20, 2005.] + + Revision [$Id: sbdPath.c,v 1.00 2005/06/20 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include "sbdInt.h" +#include "misc/tim/tim.h" + +ABC_NAMESPACE_IMPL_START + + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Sbc_ManAddInternalToPath_rec( Gia_Man_t * p, int iObj, Vec_Bit_t * vPath ) +{ + Gia_Obj_t * pObj; + int k, iFan, Value = 0; + if ( Gia_ObjIsTravIdCurrentId(p, iObj) ) + return Vec_BitEntry(vPath, iObj); + Gia_ObjSetTravIdCurrentId(p, iObj); + pObj = Gia_ManObj( p, iObj ); + if ( Gia_ObjIsCi(pObj) ) + return Vec_BitEntry(vPath, iObj); + assert( Gia_ObjIsAnd(pObj) ); + Gia_LutForEachFanin( p, iObj, iFan, k ) + Value |= Sbc_ManAddInternalToPath_rec( p, iFan, vPath ); + if ( Value ) + Vec_BitWriteEntry( vPath, iObj, 1 ); + return Value; +} +void Sbc_ManAddInternalToPath( Gia_Man_t * p, Vec_Bit_t * vPath ) +{ + int k, iFan, iObj; + Gia_ManForEachLut( p, iObj ) + { + if ( !Vec_BitEntry(vPath, iObj) ) + continue; + Gia_ManIncrementTravId( p ); + Gia_LutForEachFanin( p, iObj, iFan, k ) + Gia_ObjSetTravIdCurrentId(p, iFan); + Sbc_ManAddInternalToPath_rec( p, iObj, vPath ); + } +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Sbc_ManCriticalPath_rec( Gia_Man_t * p, int * pLevels, int iObj, int LevelFan, Vec_Bit_t * vPath, int Slack ) +{ + Gia_Obj_t * pObj; int k, iFan; + if ( Gia_ObjIsTravIdCurrentId(p, iObj) ) + return; + Gia_ObjSetTravIdCurrentId(p, iObj); + pObj = Gia_ManObj( p, iObj ); + Vec_BitWriteEntry( vPath, iObj, 1 ); + if ( Gia_ObjIsCi(pObj) ) + { + Tim_Man_t * pManTime = (Tim_Man_t *)p->pManTime; + int iBox = pManTime ? Tim_ManBoxForCi( pManTime, Gia_ObjCioId(pObj) ) : -1; + if ( iBox >= 0 ) + { + int curCo = Tim_ManBoxInputFirst( pManTime, iBox ); + int nBoxInputs = Tim_ManBoxInputNum( pManTime, iBox ); + for ( k = 0; k < nBoxInputs; k++ ) + { + Gia_Obj_t * pCo = Gia_ManCo( p, curCo + k ); + int iDriver = Gia_ObjFaninId0p( p, pCo ); + if ( (pLevels[iDriver]+Slack >= LevelFan-1) && iDriver ) + Sbc_ManCriticalPath_rec( p, pLevels, iDriver, pLevels[iDriver], vPath, Abc_MaxInt(0, pLevels[iDriver]+Slack-(LevelFan-1)) ); + } + } + return; + } + assert( Gia_ObjIsAnd(pObj) ); + Gia_LutForEachFanin( p, iObj, iFan, k ) + if ( pLevels[iFan]+Slack >= LevelFan-1 ) + Sbc_ManCriticalPath_rec( p, pLevels, iFan, pLevels[iFan], vPath, Abc_MaxInt(0, pLevels[iFan]+Slack-(LevelFan-1)) ); +} +Vec_Bit_t * Sbc_ManCriticalPath( Gia_Man_t * p ) +{ + int * pLevels = NULL, k, iDriver, Slack = 1; + int nLevels = p->pManTime ? Gia_ManLutLevelWithBoxes(p) : Gia_ManLutLevel(p, &pLevels); + Vec_Bit_t * vPath = Vec_BitStart( Gia_ManObjNum(p) ); + if ( p->pManTime ) + pLevels = Vec_IntArray( p->vLevels ); + Gia_ManIncrementTravId( p ); + Gia_ManForEachCoDriverId( p, iDriver, k ) + if ( (pLevels[iDriver] == nLevels) && iDriver ) + Sbc_ManCriticalPath_rec( p, pLevels, iDriver, pLevels[iDriver], vPath, Slack ); + if ( !p->pManTime ) + ABC_FREE( pLevels ); + Sbc_ManAddInternalToPath( p, vPath ); + return vPath; +} + + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Sbc_ManDelayTrace( Gia_Man_t * p ) +{ + Vec_Bit_t * vPath = Vec_BitStart( Gia_ManObjNum(p) ); + int i, k, iFan, nLevels, * pLevels; + int nLuts = 0, nNodes = 0, nEdges = 0, nEdgesAll = 0; + if ( !Gia_ManHasMapping(p) ) + { + printf( "No mapping is available.\n" ); + return; + } + assert( Gia_ManHasMapping(p) ); + // set critical CO drivers + nLevels = Gia_ManLutLevel( p, &pLevels ); + Gia_ManForEachCoDriverId( p, iFan, i ) + if ( pLevels[iFan] == nLevels ) + Vec_BitWriteEntry( vPath, iFan, 1 ); + // set critical internal nodes + Gia_ManForEachLutReverse( p, i ) + { + nLuts++; + if ( !Vec_BitEntry(vPath, i) ) + continue; + nNodes++; + Gia_LutForEachFanin( p, i, iFan, k ) + { + if ( pLevels[iFan] +1 < pLevels[i] ) + continue; + assert( pLevels[iFan] + 1 == pLevels[i] ); + Vec_BitWriteEntry( vPath, iFan, 1 ); + nEdges++; + //printf( "%d -> %d\n", i, iFan ); + } + } + Gia_ManForEachLut( p, i ) + Gia_LutForEachFanin( p, i, iFan, k ) + nEdgesAll += (Vec_BitEntry(vPath, i) && Vec_BitEntry(vPath, iFan)); + + ABC_FREE( pLevels ); + Vec_BitFree( vPath ); + printf( "AIG = %d. LUT = %d. Lev = %d. Path nodes = %d. Path edges = %d. (%d.)\n", + Gia_ManAndNum(p), nLuts, nLevels, nNodes, nEdges, nEdgesAll ); +} + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + diff --git a/src/opt/sbd/sbdSat.c b/src/opt/sbd/sbdSat.c index ae865627..f0de4dbf 100644 --- a/src/opt/sbd/sbdSat.c +++ b/src/opt/sbd/sbdSat.c @@ -37,10 +37,6 @@ ABC_NAMESPACE_IMPL_START /// FUNCTION DEFINITIONS /// //////////////////////////////////////////////////////////////////////// -#define SBD_LUTS_MAX 2 -#define SBD_SIZE_MAX 4 -#define SBD_DIV_MAX 16 - // new AIG manager typedef struct Sbd_Pro_t_ Sbd_Pro_t; struct Sbd_Pro_t_ diff --git a/src/opt/sbd/sbdWin.c b/src/opt/sbd/sbdWin.c index d722f456..069a4125 100644 --- a/src/opt/sbd/sbdWin.c +++ b/src/opt/sbd/sbdWin.c @@ -39,19 +39,25 @@ ABC_NAMESPACE_IMPL_START a DFS ordered array of objects (vWinObjs) whose indexed in the array (which will be used as SAT variables) are given in array vObj2Var. The TFO nodes are listed as the last ones in vWinObjs. The root nodes - are labeled with Abc_LitIsCompl() in vTfo and also given in vRoots.] + are labeled with Abc_LitIsCompl() in vTfo and also given in vRoots. + If fQbf is 1, returns the instance meant for QBF solving. It is using + the last variable (LastVar) as the placeholder for the second copy + of the pivot node.] SideEffects [] SeeAlso [] ***********************************************************************/ -sat_solver * Sbd_ManSatSolver( sat_solver * pSat, Gia_Man_t * p, Vec_Int_t * vMirrors, int Pivot, Vec_Int_t * vWinObjs, Vec_Int_t * vObj2Var, Vec_Int_t * vTfo, Vec_Int_t * vRoots ) +sat_solver * Sbd_ManSatSolver( sat_solver * pSat, Gia_Man_t * p, Vec_Int_t * vMirrors, + int Pivot, Vec_Int_t * vWinObjs, Vec_Int_t * vObj2Var, + Vec_Int_t * vTfo, Vec_Int_t * vRoots, int fQbf ) { Gia_Obj_t * pObj; int i, iLit = 1, iObj, Fan0, Fan1, Lit0m, Lit1m, Node, fCompl0, fCompl1, RetValue; int TfoStart = Vec_IntSize(vWinObjs) - Vec_IntSize(vTfo); int PivotVar = Vec_IntEntry(vObj2Var, Pivot); + int LastVar = Vec_IntSize(vWinObjs) + Vec_IntSize(vTfo) + Vec_IntSize(vRoots); //Vec_IntPrint( vWinObjs ); //Vec_IntPrint( vTfo ); //Vec_IntPrint( vRoots ); @@ -60,7 +66,7 @@ sat_solver * Sbd_ManSatSolver( sat_solver * pSat, Gia_Man_t * p, Vec_Int_t * vMi pSat = sat_solver_new(); else sat_solver_restart( pSat ); - sat_solver_setnvars( pSat, Vec_IntSize(vWinObjs) + Vec_IntSize(vTfo) + Vec_IntSize(vRoots) + 32 ); + sat_solver_setnvars( pSat, Vec_IntSize(vWinObjs) + Vec_IntSize(vTfo) + Vec_IntSize(vRoots) + SBD_FVAR_MAX ); // create constant 0 clause sat_solver_addclause( pSat, &iLit, &iLit + 1 ); // add clauses for all nodes @@ -100,8 +106,13 @@ sat_solver * Sbd_ManSatSolver( sat_solver * pSat, Gia_Man_t * p, Vec_Int_t * vMi Fan1 = Vec_IntEntry( vObj2Var, Fan1 ); Fan0 = Fan0 < TfoStart ? Fan0 : Fan0 + Vec_IntSize(vTfo); Fan1 = Fan1 < TfoStart ? Fan1 : Fan1 + Vec_IntSize(vTfo); - fCompl0 = Gia_ObjFaninC0(pObj) ^ (Fan0 == PivotVar) ^ (Lit0m >= 0 && Abc_LitIsCompl(Lit0m)); - fCompl1 = Gia_ObjFaninC1(pObj) ^ (Fan1 == PivotVar) ^ (Lit1m >= 0 && Abc_LitIsCompl(Lit1m)); + if ( fQbf ) + { + Fan0 = Fan0 == PivotVar ? LastVar : Fan0; + Fan1 = Fan1 == PivotVar ? LastVar : Fan1; + } + fCompl0 = Gia_ObjFaninC0(pObj) ^ (!fQbf && Fan0 == PivotVar) ^ (Lit0m >= 0 && Abc_LitIsCompl(Lit0m)); + fCompl1 = Gia_ObjFaninC1(pObj) ^ (!fQbf && Fan1 == PivotVar) ^ (Lit1m >= 0 && Abc_LitIsCompl(Lit1m)); if ( Gia_ObjIsXor(pObj) ) sat_solver_add_xor( pSat, Node, Fan0, Fan1, fCompl0 ^ fCompl1 ); else @@ -127,7 +138,18 @@ sat_solver * Sbd_ManSatSolver( sat_solver * pSat, Gia_Man_t * p, Vec_Int_t * vMi sat_solver_delete( pSat ); return NULL; } - assert( sat_solver_nvars(pSat) == nVars + 32 ); + assert( sat_solver_nvars(pSat) == nVars + SBD_FVAR_MAX ); + } + else if ( fQbf ) + { + int n, pLits[2]; + for ( n = 0; n < 2; n++ ) + { + pLits[0] = Abc_Var2Lit( PivotVar, n ); + pLits[1] = Abc_Var2Lit( LastVar, n ); + RetValue = sat_solver_addclause( pSat, pLits, pLits + 2 ); + assert( RetValue ); + } } // finalize RetValue = sat_solver_simplify( pSat ); @@ -143,7 +165,7 @@ sat_solver * Sbd_ManSatSolver( sat_solver * pSat, Gia_Man_t * p, Vec_Int_t * vMi Synopsis [Solves one SAT problem.] - Description [Computes node function for PivotVar with fanins in vDivVars + Description [Computes node function for PivotVar with fanins in vDivSet using don't-care represented in the SAT solver. Uses array vValues to return the values of the first Vec_IntSize(vValues) SAT variables in case the implementation of the node with the given fanins does not exist.] @@ -153,12 +175,13 @@ sat_solver * Sbd_ManSatSolver( sat_solver * pSat, Gia_Man_t * p, Vec_Int_t * vMi SeeAlso [] ***********************************************************************/ -word Sbd_ManSolve( sat_solver * pSat, int PivotVar, int FreeVar, Vec_Int_t * vDivVars, Vec_Int_t * vValues, Vec_Int_t * vTemp ) +word Sbd_ManSolve( sat_solver * pSat, int PivotVar, int FreeVar, Vec_Int_t * vDivSet, Vec_Int_t * vDivVars, Vec_Int_t * vDivValues, Vec_Int_t * vTemp ) { int nBTLimit = 0; word uCube, uTruth = 0; int status, i, iVar, nFinal, * pFinal, pLits[2], nIter = 0; assert( FreeVar < sat_solver_nvars(pSat) ); + assert( Vec_IntSize(vDivVars) == Vec_IntSize(vDivValues) ); pLits[0] = Abc_Var2Lit( PivotVar, 0 ); // F = 1 pLits[1] = Abc_Var2Lit( FreeVar, 0 ); // iNewLit while ( 1 ) @@ -171,12 +194,12 @@ word Sbd_ManSolve( sat_solver * pSat, int PivotVar, int FreeVar, Vec_Int_t * vDi return uTruth; assert( status == l_True ); // remember variable values - for ( i = 0; i < Vec_IntSize(vValues); i++ ) - Vec_IntWriteEntry( vValues, i, 2*sat_solver_var_value(pSat, i) ); + Vec_IntForEachEntry( vDivVars, iVar, i ) + Vec_IntWriteEntry( vDivValues, i, 2*sat_solver_var_value(pSat, iVar) ); // collect divisor literals Vec_IntClear( vTemp ); Vec_IntPush( vTemp, Abc_LitNot(pLits[0]) ); // F = 0 - Vec_IntForEachEntry( vDivVars, iVar, i ) + Vec_IntForEachEntry( vDivSet, iVar, i ) Vec_IntPush( vTemp, sat_solver_var_literal(pSat, iVar) ); // check against offset status = sat_solver_solve( pSat, Vec_IntArray(vTemp), Vec_IntArray(vTemp) + Vec_IntSize(vTemp), nBTLimit, 0, 0, 0 ); @@ -195,7 +218,7 @@ word Sbd_ManSolve( sat_solver * pSat, int PivotVar, int FreeVar, Vec_Int_t * vDi if ( pFinal[i] == pLits[0] ) continue; Vec_IntPush( vTemp, pFinal[i] ); - iVar = Vec_IntFind( vDivVars, Abc_Lit2Var(pFinal[i]) ); assert( iVar >= 0 ); + iVar = Vec_IntFind( vDivSet, Abc_Lit2Var(pFinal[i]) ); assert( iVar >= 0 ); uCube &= Abc_LitIsCompl(pFinal[i]) ? s_Truths6[iVar] : ~s_Truths6[iVar]; } uTruth |= uCube; @@ -205,11 +228,11 @@ word Sbd_ManSolve( sat_solver * pSat, int PivotVar, int FreeVar, Vec_Int_t * vDi } assert( status == l_True ); // store the counter-example - for ( i = 0; i < Vec_IntSize(vValues); i++ ) - Vec_IntAddToEntry( vValues, i, sat_solver_var_value(pSat, i) ); + Vec_IntForEachEntry( vDivVars, iVar, i ) + Vec_IntAddToEntry( vDivValues, i, sat_solver_var_value(pSat, iVar) ); - for ( i = 0; i < Vec_IntSize(vValues); i++ ) - Vec_IntAddToEntry( vValues, i, 0xC ); + for ( i = 0; i < Vec_IntSize(vDivValues); i++ ) + Vec_IntAddToEntry( vDivValues, i, 0xC ); /* // reduce the counter example for ( n = 0; n < 2; n++ ) @@ -232,6 +255,140 @@ word Sbd_ManSolve( sat_solver * pSat, int PivotVar, int FreeVar, Vec_Int_t * vDi /**Function************************************************************* + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Sbd_ManSolve2( sat_solver * pSat, int PivotVar, int FreeVar, Vec_Int_t * vDivVars, Vec_Int_t * vDivValues, Vec_Int_t * vTemp, Vec_Int_t * vSop ) +{ + int nBTLimit = 0; + int status, i, iVar, nFinal, * pFinal, pLits[2], nIter = 0; + assert( FreeVar < sat_solver_nvars(pSat) ); + assert( Vec_IntSize(vDivVars) == Vec_IntSize(vDivValues) ); + pLits[0] = Abc_Var2Lit( PivotVar, 0 ); // F = 1 + pLits[1] = Abc_Var2Lit( FreeVar, 0 ); // iNewLit + Vec_IntClear( vSop ); + while ( 1 ) + { + // find onset minterm + status = sat_solver_solve( pSat, pLits, pLits + 2, nBTLimit, 0, 0, 0 ); + if ( status == l_Undef ) + return 0; + if ( status == l_False ) + return 1; + assert( status == l_True ); + // remember variable values + //for ( i = 0; i < Vec_IntSize(vValues); i++ ) + // Vec_IntWriteEntry( vValues, i, 2*sat_solver_var_value(pSat, i) ); + // collect divisor literals + Vec_IntClear( vTemp ); + Vec_IntPush( vTemp, Abc_LitNot(pLits[0]) ); // F = 0 + //Vec_IntForEachEntry( vDivSet, iVar, i ) + Vec_IntForEachEntry( vDivVars, iVar, i ) + Vec_IntPush( vTemp, sat_solver_var_literal(pSat, iVar) ); + // check against offset + status = sat_solver_solve( pSat, Vec_IntArray(vTemp), Vec_IntArray(vTemp) + Vec_IntSize(vTemp), nBTLimit, 0, 0, 0 ); + if ( status == l_Undef ) + return 0; + if ( status == l_True ) + break; + assert( status == l_False ); + // compute cube and add clause + nFinal = sat_solver_final( pSat, &pFinal ); + Vec_IntClear( vTemp ); + Vec_IntPush( vTemp, Abc_LitNot(pLits[1]) ); // NOT(iNewLit) + for ( i = 0; i < nFinal; i++ ) + { + if ( pFinal[i] == pLits[0] ) + continue; + Vec_IntPush( vTemp, pFinal[i] ); + iVar = Vec_IntFind( vDivVars, Abc_Lit2Var(pFinal[i]) ); assert( iVar >= 0 ); + //uCube &= Abc_LitIsCompl(pFinal[i]) ? s_Truths6[iVar] : ~s_Truths6[iVar]; + Vec_IntPush( vSop, Abc_Var2Lit( iVar, !Abc_LitIsCompl(pFinal[i]) ) ); + } + //uTruth |= uCube; + Vec_IntPush( vSop, -1 ); + status = sat_solver_addclause( pSat, Vec_IntArray(vTemp), Vec_IntArray(vTemp) + Vec_IntSize(vTemp) ); + assert( status ); + nIter++; + } + assert( status == l_True ); + // store the counter-example + //for ( i = 0; i < Vec_IntSize(vValues); i++ ) + // Vec_IntAddToEntry( vValues, i, sat_solver_var_value(pSat, i) ); + return 0; +} + +word Sbd_ManSolverSupp( Vec_Int_t * vSop, int * pInds, int * pnVars ) +{ + word Supp = 0; + int i, Entry, nVars = 0; + Vec_IntForEachEntry( vSop, Entry, i ) + { + if ( Entry == -1 ) + continue; + assert( Abc_Lit2Var(Entry) < 64 ); + if ( (Supp >> Abc_Lit2Var(Entry)) & 1 ) + continue; + pInds[Abc_Lit2Var(Entry)] = nVars++; + Supp |= (word)1 << Abc_Lit2Var(Entry); + } + *pnVars = nVars; + return Supp; +} +void Sbd_ManSolverPrint( Vec_Int_t * vSop ) +{ + int v, i, Entry, nVars, pInds[64]; + word Supp = Sbd_ManSolverSupp( vSop, pInds, &nVars ); + char Cube[65] = {'\0'}; + assert( Cube[nVars] == '\0' ); + for ( v = 0; v < nVars; v++ ) + Cube[v] = '-'; + Vec_IntForEachEntry( vSop, Entry, i ) + { + if ( Entry == -1 ) + { + printf( "%s\n", Cube ); + for ( v = 0; v < nVars; v++ ) + Cube[v] = '-'; + continue; + } + Cube[pInds[Abc_Lit2Var(Entry)]] = '1' - (char)Abc_LitIsCompl(Entry); + } + Supp = 0; +} +void Sbd_ManSolveSelect( Gia_Man_t * p, Vec_Int_t * vMirrors, int Pivot, Vec_Int_t * vDivVars, Vec_Int_t * vDivValues, Vec_Int_t * vWinObjs, Vec_Int_t * vObj2Var, Vec_Int_t * vTfo, Vec_Int_t * vRoots ) +{ + Vec_Int_t * vSop = Vec_IntAlloc( 100 ); + Vec_Int_t * vTemp = Vec_IntAlloc( 100 ); + sat_solver * pSat = Sbd_ManSatSolver( NULL, p, vMirrors, Pivot, vWinObjs, vObj2Var, vTfo, vRoots, 0 ); + int PivotVar = Vec_IntEntry(vObj2Var, Pivot); + int FreeVar = Vec_IntSize(vWinObjs) + Vec_IntSize(vTfo) + Vec_IntSize(vRoots); + int Status = Sbd_ManSolve2( pSat, PivotVar, FreeVar, vDivVars, vDivValues, vTemp, vSop ); + printf( "Pivot = %4d. Divs = %4d. ", Pivot, Vec_IntSize(vDivVars) ); + if ( Status == 0 ) + printf( "UNSAT.\n" ); + else + { + int nVars, pInds[64]; + word Supp = Sbd_ManSolverSupp( vSop, pInds, &nVars ); + //Sbd_ManSolverPrint( vSop ); + printf( "SAT with %d vars and %d cubes.\n", nVars, Vec_IntCountEntry(vSop, -1) ); + Supp = 0; + } + Vec_IntFree( vTemp ); + Vec_IntFree( vSop ); + sat_solver_delete( pSat ); +} + + +/**Function************************************************************* + Synopsis [Returns a bunch of positive/negative random care minterms.] Description [Returns 0/1 if the functions is const 0/1.] @@ -273,6 +430,30 @@ int Sbd_ManCollectConstants( sat_solver * pSat, int nCareMints[2], int PivotVar, return -1; } +int Sbd_ManCollectConstantsNew( sat_solver * pSat, Vec_Int_t * vDivVars, int nConsts, int PivotVar, word * pOnset, word * pOffset ) +{ + int nBTLimit = 0; + int n, i, k, status, iLit, iVar; + word * pPats[2] = {pOnset, pOffset}; + assert( Vec_IntSize(vDivVars) < 64 ); + for ( n = 0; n < 2; n++ ) + for ( i = 0; i < nConsts; i++ ) + { + sat_solver_random_polarity( pSat ); + iLit = Abc_Var2Lit( PivotVar, n ); + status = sat_solver_solve( pSat, &iLit, &iLit + 1, nBTLimit, 0, 0, 0 ); + if ( status == l_Undef ) + return -2; + if ( status == l_False ) + return n; + pPats[n][i] = ((word)!n) << Vec_IntSize(vDivVars); + Vec_IntForEachEntry( vDivVars, iVar, k ) + if ( sat_solver_var_value(pSat, iVar) ) + Abc_TtXorBit(&pPats[n][i], k); + } + return -1; +} + //////////////////////////////////////////////////////////////////////// /// END OF FILE /// diff --git a/src/opt/sfm/sfmCnf.c b/src/opt/sfm/sfmCnf.c index 0ab92258..b4dd11f8 100644 --- a/src/opt/sfm/sfmCnf.c +++ b/src/opt/sfm/sfmCnf.c @@ -45,7 +45,7 @@ ABC_NAMESPACE_IMPL_START ***********************************************************************/ void Sfm_PrintCnf( Vec_Str_t * vCnf ) { - char Entry; + signed char Entry; int i, Lit; Vec_StrForEachEntry( vCnf, Entry, i ) { @@ -153,7 +153,7 @@ Vec_Wec_t * Sfm_CreateCnf( Sfm_Ntk_t * p ) void Sfm_TranslateCnf( Vec_Wec_t * vRes, Vec_Str_t * vCnf, Vec_Int_t * vFaninMap, int iPivotVar ) { Vec_Int_t * vClause; - char Entry; + signed char Entry; int i, Lit; Vec_WecClear( vRes ); vClause = Vec_WecPushLevel( vRes ); diff --git a/src/proof/acec/acec.h b/src/proof/acec/acec.h index c61b4485..fcbd32df 100644 --- a/src/proof/acec/acec.h +++ b/src/proof/acec/acec.h @@ -38,6 +38,22 @@ ABC_NAMESPACE_HEADER_START /// BASIC TYPES /// //////////////////////////////////////////////////////////////////////// +// combinational equivalence checking parameters +typedef struct Acec_ParCec_t_ Acec_ParCec_t; +struct Acec_ParCec_t_ +{ + int nBTLimit; // conflict limit at a node + int TimeLimit; // the runtime limit in seconds + int fMiter; // input circuit is a miter + int fDualOutput; // dual-output miter + int fTwoOutput; // two-output miter + int fBooth; // expecting Booth multiplier + int fSilent; // print no messages + int fVeryVerbose; // verbose stats + int fVerbose; // verbose stats + int iOutFail; // the number of failed output +}; + //////////////////////////////////////////////////////////////////////// /// MACRO DEFINITIONS /// //////////////////////////////////////////////////////////////////////// @@ -50,8 +66,11 @@ ABC_NAMESPACE_HEADER_START /// FUNCTION DECLARATIONS /// //////////////////////////////////////////////////////////////////////// +/*=== acecCl.c ========================================================*/ +extern Gia_Man_t * Acec_ManDecla( Gia_Man_t * pGia, int fBooth, int fVerbose ); /*=== acecCore.c ========================================================*/ -extern int Gia_PolynCec( Gia_Man_t * pGia0, Gia_Man_t * pGia1, Cec_ParCec_t * pPars ); +extern void Acec_ManCecSetDefaultParams( Acec_ParCec_t * p ); +extern int Acec_Solve( Gia_Man_t * pGia0, Gia_Man_t * pGia1, Acec_ParCec_t * pPars ); /*=== acecFadds.c ========================================================*/ extern Vec_Int_t * Gia_ManDetectFullAdders( Gia_Man_t * p, int fVerbose, Vec_Int_t ** vCutsXor2 ); extern Vec_Int_t * Gia_ManDetectHalfAdders( Gia_Man_t * p, int fVerbose ); @@ -60,6 +79,12 @@ extern Vec_Int_t * Gia_PolynReorder( Gia_Man_t * pGia, int fVerbose, int fVery extern Vec_Int_t * Gia_PolynFindOrder( Gia_Man_t * pGia, Vec_Int_t * vFadds, Vec_Int_t * vHadds, int fVerbose, int fVeryVerbose ); /*=== acecPolyn.c ========================================================*/ extern void Gia_PolynBuild( Gia_Man_t * pGia, Vec_Int_t * vOrder, int fSigned, int fVerbose, int fVeryVerbose ); +/*=== acecRe.c ========================================================*/ +extern Vec_Int_t * Ree_ManComputeCuts( Gia_Man_t * p, Vec_Int_t ** pvXors, int fVerbose ); +extern int Ree_ManCountFadds( Vec_Int_t * vAdds ); +extern void Ree_ManPrintAdders( Vec_Int_t * vAdds, int fVerbose ); +/*=== acecTree.c ========================================================*/ +extern Gia_Man_t * Acec_Normalize( Gia_Man_t * pGia, int fBooth, int fVerbose ); ABC_NAMESPACE_HEADER_END diff --git a/src/proof/acec/acecBo.c b/src/proof/acec/acecBo.c new file mode 100644 index 00000000..9cddcd13 --- /dev/null +++ b/src/proof/acec/acecBo.c @@ -0,0 +1,216 @@ +/**CFile**************************************************************** + + FileName [acecBo.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [CEC for arithmetic circuits.] + + Synopsis [Core procedures.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 20, 2005.] + + Revision [$Id: acecBo.c,v 1.00 2005/06/20 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include "acecInt.h" +#include "misc/vec/vecWec.h" +#include "misc/extra/extra.h" + +ABC_NAMESPACE_IMPL_START + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Acec_DetectBoothXorMux( Gia_Man_t * p, Gia_Obj_t * pMux, Gia_Obj_t * pXor, int pIns[3] ) +{ + Gia_Obj_t * pFan0, * pFan1; + Gia_Obj_t * pDat0, * pDat1, * pCtrl; + if ( !Gia_ObjIsMuxType(pMux) || !Gia_ObjIsMuxType(pXor) ) + return 0; + if ( !Gia_ObjRecognizeExor( pXor, &pFan0, &pFan1 ) ) + return 0; + pFan0 = Gia_Regular(pFan0); + pFan1 = Gia_Regular(pFan1); + if ( Gia_ObjId(p, pFan0) > Gia_ObjId(p, pFan1) ) + ABC_SWAP( Gia_Obj_t *, pFan0, pFan1 ); + if ( !(pCtrl = Gia_ObjRecognizeMux( pMux, &pDat0, &pDat1 )) ) + return 0; + pDat0 = Gia_Regular(pDat0); + pDat1 = Gia_Regular(pDat1); + pCtrl = Gia_Regular(pCtrl); + if ( !Gia_ObjIsAnd(pDat0) || !Gia_ObjIsAnd(pDat1) ) + return 0; + if ( Gia_ObjFaninId0p(p, pDat0) != Gia_ObjFaninId0p(p, pDat1) || + Gia_ObjFaninId1p(p, pDat0) != Gia_ObjFaninId1p(p, pDat1) ) + return 0; + if ( Gia_ObjFaninId0p(p, pDat0) != Gia_ObjId(p, pFan0) || + Gia_ObjFaninId1p(p, pDat0) != Gia_ObjId(p, pFan1) ) + return 0; + pIns[0] = Gia_ObjId(p, pFan0); + pIns[1] = Gia_ObjId(p, pFan1); + pIns[2] = Gia_ObjId(p, pCtrl); + return 1; +} +int Acec_DetectBoothXorFanin( Gia_Man_t * p, Gia_Obj_t * pObj, int pIns[5] ) +{ + Gia_Obj_t * pFan0, * pFan1; + //int Id = Gia_ObjId(p, pObj); + if ( !Gia_ObjIsAnd(pObj) ) + return 0; + if ( !Gia_ObjFaninC0(pObj) || !Gia_ObjFaninC1(pObj) ) + return 0; + pFan0 = Gia_ObjFanin0(pObj); + pFan1 = Gia_ObjFanin1(pObj); + if ( !Gia_ObjIsAnd(pFan0) || !Gia_ObjIsAnd(pFan1) ) + return 0; + if ( Acec_DetectBoothXorMux(p, Gia_ObjFanin0(pFan0), Gia_ObjFanin0(pFan1), pIns) ) + { + pIns[3] = Gia_ObjId(p, Gia_ObjFanin1(pFan0)); + pIns[4] = Gia_ObjId(p, Gia_ObjFanin1(pFan1)); + return 1; + } + if ( Acec_DetectBoothXorMux(p, Gia_ObjFanin0(pFan0), Gia_ObjFanin1(pFan1), pIns) ) + { + pIns[3] = Gia_ObjId(p, Gia_ObjFanin1(pFan0)); + pIns[4] = Gia_ObjId(p, Gia_ObjFanin0(pFan1)); + return 1; + } + if ( Acec_DetectBoothXorMux(p, Gia_ObjFanin1(pFan0), Gia_ObjFanin0(pFan1), pIns) ) + { + pIns[3] = Gia_ObjId(p, Gia_ObjFanin0(pFan0)); + pIns[4] = Gia_ObjId(p, Gia_ObjFanin1(pFan1)); + return 1; + } + if ( Acec_DetectBoothXorMux(p, Gia_ObjFanin1(pFan0), Gia_ObjFanin1(pFan1), pIns) ) + { + pIns[3] = Gia_ObjId(p, Gia_ObjFanin0(pFan0)); + pIns[4] = Gia_ObjId(p, Gia_ObjFanin0(pFan1)); + return 1; + } + return 0; +} +int Acec_DetectBoothOne( Gia_Man_t * p, Gia_Obj_t * pObj, int pIns[5] ) +{ + Gia_Obj_t * pFan0, * pFan1; + if ( !Gia_ObjRecognizeExor( pObj, &pFan0, &pFan1 ) ) + return 0; + pFan0 = Gia_Regular(pFan0); + pFan1 = Gia_Regular(pFan1); + if ( Acec_DetectBoothXorFanin( p, pFan0, pIns ) && pIns[2] == Gia_ObjId(p, pFan1) ) + return 1; + if ( Acec_DetectBoothXorFanin( p, pFan1, pIns ) && pIns[2] == Gia_ObjId(p, pFan0) ) + return 1; + return 0; +} + + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Acec_DetectBoothTwoXor( Gia_Man_t * p, Gia_Obj_t * pObj, int pIns[5] ) +{ + Gia_Obj_t * pFan0, * pFan1; + if ( !Gia_ObjIsAnd(pObj) ) + return 0; + if ( Gia_ObjRecognizeExor( Gia_ObjFanin0(pObj), &pFan0, &pFan1 ) ) + { + pIns[0] = Gia_ObjId(p, Gia_Regular(pFan0)); + pIns[1] = Gia_ObjId(p, Gia_Regular(pFan1)); + pIns[2] = -1; + pIns[3] = 0; + pIns[4] = Gia_ObjId(p, Gia_ObjFanin1(pObj)); + return 1; + } + if ( Gia_ObjRecognizeExor( Gia_ObjFanin1(pObj), &pFan0, &pFan1 ) ) + { + pIns[0] = Gia_ObjId(p, Gia_Regular(pFan0)); + pIns[1] = Gia_ObjId(p, Gia_Regular(pFan1)); + pIns[2] = -1; + pIns[3] = 0; + pIns[4] = Gia_ObjId(p, Gia_ObjFanin0(pObj)); + return 1; + } + return 0; +} +int Acec_DetectBoothTwo( Gia_Man_t * p, Gia_Obj_t * pObj, int pIns[5] ) +{ + Gia_Obj_t * pFan0, * pFan1; + if ( !Gia_ObjRecognizeExor( pObj, &pFan0, &pFan1 ) ) + return 0; + pFan0 = Gia_Regular(pFan0); + pFan1 = Gia_Regular(pFan1); + if ( Acec_DetectBoothTwoXor( p, pFan0, pIns ) ) + { + pIns[2] = Gia_ObjId(p, pFan1); + return 1; + } + if ( Acec_DetectBoothTwoXor( p, pFan1, pIns ) ) + { + pIns[2] = Gia_ObjId(p, pFan0); + return 1; + } + return 0; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Acec_DetectBoothTest( Gia_Man_t * p ) +{ + Gia_Obj_t * pObj; + int i, pIns[5]; + Gia_ManForEachAnd( p, pObj, i ) + { + if ( !Acec_DetectBoothOne(p, pObj, pIns) && !Acec_DetectBoothTwo(p, pObj, pIns) ) + continue; + printf( "obj = %4d : b0 = %4d b1 = %4d b2 = %4d a0 = %4d a1 = %4d\n", + i, pIns[0], pIns[1], pIns[2], pIns[3], pIns[4] ); + } +} + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + diff --git a/src/proof/acec/acecCl.c b/src/proof/acec/acecCl.c index b60c2bf9..6185677b 100644 --- a/src/proof/acec/acecCl.c +++ b/src/proof/acec/acecCl.c @@ -127,7 +127,7 @@ Vec_Int_t * Acec_CollectXorTops( Gia_Man_t * p ) break; } Vec_IntPush( vRootXorSet, Gia_ObjId(p, pObj) ); - Vec_IntPush( vRootXorSet, fXor1 ? Gia_ObjId(p, Gia_Regular(pFan1)) : Gia_ObjId(p, Gia_Regular(pFan0)) ); + Vec_IntPush( vRootXorSet, fXor1 ? Gia_ObjId(p, Gia_Regular(pFan0)) : Gia_ObjId(p, Gia_Regular(pFan1)) ); Vec_IntPush( vRootXorSet, fXor1 ? Gia_ObjId(p, Gia_Regular(pFan10)) : Gia_ObjId(p, Gia_Regular(pFan00)) ); Vec_IntPush( vRootXorSet, fXor1 ? Gia_ObjId(p, Gia_Regular(pFan11)) : Gia_ObjId(p, Gia_Regular(pFan01)) ); } @@ -173,10 +173,101 @@ int Acec_DetectLitPolarity( Gia_Man_t * p, int Node, int Leaf ) if ( Lit0 != -1 && Lit1 != -1 ) { assert( Lit0 == Lit1 ); + printf( "Problem for leaf %d\n", Leaf ); return Lit0; } return Lit0 != -1 ? Lit0 : Lit1; } + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Acec_DetectComputeSuppOne_rec( Gia_Man_t * p, Gia_Obj_t * pObj, Vec_Int_t * vSupp, Vec_Int_t * vNods ) +{ + if ( Gia_ObjIsTravIdCurrent(p, pObj) ) + return; + Gia_ObjSetTravIdCurrent(p, pObj); + if ( pObj->fMark0 ) + { + Vec_IntPush( vSupp, Gia_ObjId(p, pObj) ); + return; + } + assert( Gia_ObjIsAnd(pObj) ); + Acec_DetectComputeSuppOne_rec( p, Gia_ObjFanin0(pObj), vSupp, vNods ); + Acec_DetectComputeSuppOne_rec( p, Gia_ObjFanin1(pObj), vSupp, vNods ); + Vec_IntPush( vNods, Gia_ObjId(p, pObj) ); +} +void Acec_DetectComputeSupports( Gia_Man_t * p, Vec_Int_t * vRootXorSet ) +{ + Vec_Int_t * vNods = Vec_IntAlloc( 100 ); + Vec_Int_t * vPols = Vec_IntAlloc( 100 ); + Vec_Int_t * vSupp = Vec_IntAlloc( 100 ); int i, k, Node, Pol; + for ( i = 0; 4*i < Vec_IntSize(vRootXorSet); i++ ) + { + Gia_ManObj( p, Vec_IntEntry(vRootXorSet, 4*i+1) )->fMark0 = 1; + Gia_ManObj( p, Vec_IntEntry(vRootXorSet, 4*i+2) )->fMark0 = 1; + Gia_ManObj( p, Vec_IntEntry(vRootXorSet, 4*i+3) )->fMark0 = 1; + } + for ( i = 1; 4*i < Vec_IntSize(vRootXorSet); i++ ) + { + Vec_IntClear( vSupp ); + Gia_ManIncrementTravId( p ); + + Gia_ManObj( p, Vec_IntEntry(vRootXorSet, 4*i+1) )->fMark0 = 0; + Acec_DetectComputeSuppOne_rec( p, Gia_ManObj( p, Vec_IntEntry(vRootXorSet, 4*i+1) ), vSupp, vNods ); + Gia_ManObj( p, Vec_IntEntry(vRootXorSet, 4*i+1) )->fMark0 = 1; + + Vec_IntSort( vSupp, 0 ); + + printf( "Out %4d : %4d \n", i, Vec_IntEntry(vRootXorSet, 4*i+1) ); + Vec_IntPrint( vSupp ); + + printf( "Cone:\n" ); + Vec_IntForEachEntry( vNods, Node, k ) + Gia_ObjPrint( p, Gia_ManObj(p, Node) ); + + + Vec_IntClear( vPols ); + Vec_IntForEachEntry( vSupp, Node, k ) + Vec_IntPush( vPols, Acec_DetectLitPolarity(p, Vec_IntEntry(vRootXorSet, 4*i+1), Node) ); + + Vec_IntForEachEntryTwo( vSupp, vPols, Node, Pol, k ) + printf( "%d(%d) ", Node, Abc_LitIsCompl(Pol) ); + + printf( "\n" ); + + Vec_IntPrint( vSupp ); + } + for ( i = 0; 4*i < Vec_IntSize(vRootXorSet); i++ ) + { + Gia_ManObj( p, Vec_IntEntry(vRootXorSet, 4*i+1) )->fMark0 = 0; + Gia_ManObj( p, Vec_IntEntry(vRootXorSet, 4*i+2) )->fMark0 = 0; + Gia_ManObj( p, Vec_IntEntry(vRootXorSet, 4*i+3) )->fMark0 = 0; + } + Vec_IntFree( vSupp ); + Vec_IntFree( vPols ); + Vec_IntFree( vNods ); +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ Gia_Man_t * Acec_DetectXorBuildNew( Gia_Man_t * p, Vec_Int_t * vRootXorSet ) { Gia_Man_t * pNew; @@ -215,18 +306,10 @@ Gia_Man_t * Acec_DetectXorBuildNew( Gia_Man_t * p, Vec_Int_t * vRootXorSet ) ***********************************************************************/ Gia_Man_t * Acec_DetectAdditional( Gia_Man_t * p, int fVerbose ) { - extern Vec_Int_t * Ree_ManComputeCuts( Gia_Man_t * p, Vec_Int_t ** pvXors, int fVerbose ); - extern void Ree_ManRemoveTrivial( Gia_Man_t * p, Vec_Int_t * vAdds ); - extern void Ree_ManRemoveContained( Gia_Man_t * p, Vec_Int_t * vAdds ); - extern int Ree_ManCountFadds( Vec_Int_t * vAdds ); - extern void Ree_ManPrintAdders( Vec_Int_t * vAdds, int fVerbose ); - abctime clk = Abc_Clock(); Gia_Man_t * pNew; Vec_Int_t * vRootXorSet; // Vec_Int_t * vXors, * vAdds = Ree_ManComputeCuts( p, &vXors, 0 ); -// Ree_ManRemoveTrivial( p, vAdds ); -// Ree_ManRemoveContained( p, vAdds ); //Ree_ManPrintAdders( vAdds, 1 ); // printf( "Detected %d full-adders and %d half-adders. Found %d XOR-cuts. ", Ree_ManCountFadds(vAdds), Vec_IntSize(vAdds)/6-Ree_ManCountFadds(vAdds), Vec_IntSize(vXors)/4 ); @@ -236,6 +319,8 @@ Gia_Man_t * Acec_DetectAdditional( Gia_Man_t * p, int fVerbose ) vRootXorSet = Acec_CollectXorTops( p ); if ( vRootXorSet ) { + Acec_DetectComputeSupports( p, vRootXorSet ); + pNew = Acec_DetectXorBuildNew( p, vRootXorSet ); Vec_IntFree( vRootXorSet ); } @@ -250,6 +335,107 @@ Gia_Man_t * Acec_DetectAdditional( Gia_Man_t * p, int fVerbose ) return pNew; } +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Vec_Int_t * Acec_RewriteTop( Gia_Man_t * p, Acec_Box_t * pBox ) +{ + Vec_Int_t * vRes = Vec_IntAlloc( Gia_ManCoNum(p) + 1 ); + Vec_Int_t * vLevel; + int i, k, iStart, iLit, Driver, Count = 0; + // determine how much to shift + Driver = Gia_ObjFaninId0p( p, Gia_ManCo(p, 0) ); + Vec_WecForEachLevel( pBox->vRootLits, vLevel, iStart ) + if ( Abc_Lit2Var(Vec_IntEntry(vLevel,0)) == Driver ) + break; + assert( iStart < Gia_ManCoNum(p) ); + //Vec_WecPrintLits( pBox->vRootLits ); + Vec_WecForEachLevelStart( pBox->vRootLits, vLevel, i, iStart ) + { + int In[3] = {0}, Out[2]; + assert( Vec_IntSize(vLevel) > 0 ); + assert( Vec_IntSize(vLevel) <= 3 ); + if ( Vec_IntSize(vLevel) == 1 ) + { + Vec_IntPush( vRes, Vec_IntEntry(vLevel, 0) ); + continue; + } + Vec_IntForEachEntry( vLevel, iLit, k ) + In[k] = iLit; + Acec_InsertFadd( p, In, Out ); + Vec_IntPush( vRes, Out[0] ); + if ( i+1 < Vec_WecSize(pBox->vRootLits) ) + Vec_IntPush( Vec_WecEntry(pBox->vRootLits, i+1), Out[1] ); + else + Vec_IntPush( Vec_WecPushLevel(pBox->vRootLits), Out[1] ); + Count++; + } + assert( Vec_IntSize(vRes) >= Gia_ManCoNum(p) ); + Vec_IntShrink( vRes, Gia_ManCoNum(p) ); + printf( "Added %d adders for replace CLAs. ", Count ); + return vRes; +} +Gia_Man_t * Acec_RewriteReplace( Gia_Man_t * p, Vec_Int_t * vRes ) +{ + Gia_Man_t * pNew, * pTemp; + Gia_Obj_t * pObj; int i; + assert( Gia_ManCoNum(p) == Vec_IntSize(vRes) ); + // create new manager + pNew = Gia_ManStart( Gia_ManObjNum(p) ); + pNew->pName = Abc_UtilStrsav( p->pName ); + pNew->pSpec = Abc_UtilStrsav( p->pSpec ); + Gia_ManFillValue( p ); + Gia_ManConst0(p)->Value = 0; + Gia_ManForEachCi( p, pObj, i ) + pObj->Value = Gia_ManAppendCi(pNew); + Gia_ManForEachAnd( p, pObj, i ) + pObj->Value = Gia_ManAppendAnd( pNew, Gia_ObjFanin0Copy(pObj), Gia_ObjFanin1Copy(pObj) ); + Gia_ManForEachCo( p, pObj, i ) + { + int iLit = Vec_IntEntry( vRes, i ); + Gia_Obj_t * pRepr = Gia_ManObj( p, Abc_Lit2Var(iLit) ); + pObj->Value = Gia_ManAppendCo( pNew, pRepr->Value ); + } + // set correct phase + Gia_ManSetPhase( p ); + Gia_ManSetPhase( pNew ); + Gia_ManForEachCo( pNew, pObj, i ) + if ( Gia_ObjPhase(pObj) != Gia_ObjPhase(Gia_ManCo(p, i)) ) + Gia_ObjFlipFaninC0( pObj ); + // remove dangling nodes + pNew = Gia_ManCleanup( pTemp = pNew ); + Gia_ManStop( pTemp ); + return pNew; +} +Gia_Man_t * Acec_ManDecla( Gia_Man_t * pGia, int fBooth, int fVerbose ) +{ + abctime clk = Abc_Clock(); + Gia_Man_t * pNew = NULL; + Vec_Bit_t * vIgnore = fBooth ? Acec_BoothFindPPG(pGia) : NULL; + Acec_Box_t * pBox = Acec_DeriveBox( pGia, vIgnore, 0, 0, fVerbose ); + Vec_Int_t * vResult; + Vec_BitFreeP( &vIgnore ); + if ( pBox == NULL ) // cannot match + { + printf( "Cannot find arithmetic boxes.\n" ); + return Gia_ManDup( pGia ); + } + vResult = Acec_RewriteTop( pGia, pBox ); + Acec_BoxFreeP( &pBox ); + pNew = Acec_RewriteReplace( pGia, vResult ); + Vec_IntFree( vResult ); + Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); + return pNew; +} + //////////////////////////////////////////////////////////////////////// /// END OF FILE /// //////////////////////////////////////////////////////////////////////// diff --git a/src/proof/acec/acecCo.c b/src/proof/acec/acecCo.c index 1e8ed7bb..a997eb03 100644 --- a/src/proof/acec/acecCo.c +++ b/src/proof/acec/acecCo.c @@ -109,7 +109,7 @@ Vec_Int_t * Gia_PolynCoreOrder_int( Gia_Man_t * pGia, Vec_Int_t * vAdds, Vec_Wec { Vec_Int_t * vOrder = Vec_IntAlloc( 1000 ); Vec_Bit_t * vIsRoot = Vec_BitStart( Gia_ManObjNum(pGia) ); - int i, k, Index, Driver, Entry1, Entry2 = -1; + int i, k, Index = -1, Driver, Entry1, Entry2 = -1; // mark roots Vec_IntForEachEntry( vRoots, Driver, i ) Vec_BitWriteEntry( vIsRoot, Driver, 1 ); diff --git a/src/proof/acec/acecCore.c b/src/proof/acec/acecCore.c index ac7ee67b..a2341704 100644 --- a/src/proof/acec/acecCore.c +++ b/src/proof/acec/acecCore.c @@ -19,6 +19,9 @@ ***********************************************************************/ #include "acecInt.h" +#include "proof/cec/cec.h" +#include "misc/util/utilTruth.h" +#include "misc/extra/extra.h" ABC_NAMESPACE_IMPL_START @@ -27,12 +30,450 @@ ABC_NAMESPACE_IMPL_START /// DECLARATIONS /// //////////////////////////////////////////////////////////////////////// +#define TRUTH_UNUSED 0x1234567812345678 + //////////////////////////////////////////////////////////////////////// /// FUNCTION DEFINITIONS /// //////////////////////////////////////////////////////////////////////// /**Function************************************************************* + Synopsis [This procedure sets default parameters.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Acec_ManCecSetDefaultParams( Acec_ParCec_t * p ) +{ + memset( p, 0, sizeof(Acec_ParCec_t) ); + p->nBTLimit = 1000; // conflict limit at a node + p->TimeLimit = 0; // the runtime limit in seconds + p->fMiter = 0; // input circuit is a miter + p->fDualOutput = 0; // dual-output miter + p->fTwoOutput = 0; // two-output miter + p->fSilent = 0; // print no messages + p->fVeryVerbose = 0; // verbose stats + p->fVerbose = 0; // verbose stats + p->iOutFail = -1; // the number of failed output +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Acec_VerifyClasses( Gia_Man_t * p, Vec_Wec_t * vLits, Vec_Wec_t * vReprs ) +{ + Vec_Ptr_t * vFunc = Vec_PtrAlloc( Vec_WecSize(vLits) ); + Vec_Int_t * vSupp = Vec_IntAlloc( 100 ); + Vec_Wrd_t * vTemp = Vec_WrdStart( Gia_ManObjNum(p) ); + Vec_Int_t * vLevel; + int i, j, k, Entry, Entry2, nOvers = 0, nErrors = 0; + Vec_WecForEachLevel( vLits, vLevel, i ) + { + Vec_Wrd_t * vTruths = Vec_WrdAlloc( Vec_IntSize(vLevel) ); + Vec_IntForEachEntry( vLevel, Entry, k ) + { + word Truth = Gia_ObjComputeTruth6Cis( p, Entry, vSupp, vTemp ); + if ( Vec_IntSize(vSupp) > 6 ) + { + nOvers++; + Vec_WrdPush( vTruths, TRUTH_UNUSED ); + continue; + } + vSupp->nSize = Abc_Tt6MinBase( &Truth, vSupp->pArray, vSupp->nSize ); + if ( Vec_IntSize(vSupp) > 5 ) + { + nOvers++; + Vec_WrdPush( vTruths, TRUTH_UNUSED ); + continue; + } + Vec_WrdPush( vTruths, Truth ); + } + Vec_PtrPush( vFunc, vTruths ); + } + if ( nOvers ) + printf( "Detected %d oversize support nodes.\n", nOvers ); + Vec_IntFree( vSupp ); + Vec_WrdFree( vTemp ); + // verify the classes + Vec_WecForEachLevel( vReprs, vLevel, i ) + { + Vec_Wrd_t * vTruths = (Vec_Wrd_t *)Vec_PtrEntry( vFunc, i ); + Vec_IntForEachEntry( vLevel, Entry, k ) + Vec_IntForEachEntryStart( vLevel, Entry2, j, k+1 ) + { + word Truth = Vec_WrdEntry( vTruths, k ); + word Truth2 = Vec_WrdEntry( vTruths, j ); + if ( Entry == Entry2 ) + { + nErrors++; + if ( Truth != Truth2 && Truth != TRUTH_UNUSED && Truth2 != TRUTH_UNUSED ) + printf( "Rank %d: Lit %d and %d do not pass verification.\n", i, k, j ); + } + if ( Entry == Abc_LitNot(Entry2) ) + { + nErrors++; + if ( Truth != ~Truth2 && Truth != TRUTH_UNUSED && Truth2 != TRUTH_UNUSED ) + printf( "Rank %d: Lit %d and %d do not pass verification.\n", i, k, j ); + } + } + } + if ( nErrors ) + printf( "Total errors in equivalence classes = %d.\n", nErrors ); + Vec_VecFree( (Vec_Vec_t *)vFunc ); +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Gia_Man_t * Acec_CommonStart( Gia_Man_t * pBase, Gia_Man_t * pAdd ) +{ + Gia_Obj_t * pObj; + int i; + Gia_ManFillValue( pAdd ); + Gia_ManConst0(pAdd)->Value = 0; + if ( pBase == NULL ) + { + pBase = Gia_ManStart( Gia_ManObjNum(pAdd) ); + pBase->pName = Abc_UtilStrsav( pAdd->pName ); + pBase->pSpec = Abc_UtilStrsav( pAdd->pSpec ); + Gia_ManForEachCi( pAdd, pObj, i ) + pObj->Value = Gia_ManAppendCi(pBase); + Gia_ManHashAlloc( pBase ); + } + else + { + assert( Gia_ManCiNum(pBase) == Gia_ManCiNum(pAdd) ); + Gia_ManForEachCi( pAdd, pObj, i ) + pObj->Value = Gia_Obj2Lit( pBase, Gia_ManCi(pBase, i) ); + } + Gia_ManForEachAnd( pAdd, pObj, i ) + pObj->Value = Gia_ManHashAnd( pBase, Gia_ObjFanin0Copy(pObj), Gia_ObjFanin1Copy(pObj) ); + return pBase; +} +void Acec_CommonFinish( Gia_Man_t * pBase ) +{ + int Id; + Gia_ManCreateRefs( pBase ); + Gia_ManForEachAndId( pBase, Id ) + if ( Gia_ObjRefNumId(pBase, Id) == 0 ) + Gia_ManAppendCo( pBase, Abc_Var2Lit(Id,0) ); +} +Vec_Int_t * Acec_CountRemap( Gia_Man_t * pAdd, Gia_Man_t * pBase ) +{ + Gia_Obj_t * pObj; int i; + Vec_Int_t * vMapNew = Vec_IntStartFull( Gia_ManObjNum(pAdd) ); + Gia_ManSetPhase( pAdd ); + Vec_IntWriteEntry( vMapNew, 0, 0 ); + Gia_ManForEachCand( pAdd, pObj, i ) + { + int iObjBase = Abc_Lit2Var(pObj->Value); + Gia_Obj_t * pObjBase = Gia_ManObj( pBase, iObjBase ); + int iObjRepr = Abc_Lit2Var(pObjBase->Value); + Vec_IntWriteEntry( vMapNew, i, Abc_Var2Lit(iObjRepr, Gia_ObjPhase(pObj)) ); + } + return vMapNew; +} +void Acec_ComputeEquivClasses( Gia_Man_t * pOne, Gia_Man_t * pTwo, Vec_Int_t ** pvMap1, Vec_Int_t ** pvMap2 ) +{ + abctime clk = Abc_Clock(); + Gia_Man_t * pBase, * pRepr; + pBase = Acec_CommonStart( NULL, pOne ); + pBase = Acec_CommonStart( pBase, pTwo ); + Acec_CommonFinish( pBase ); + //Gia_ManShow( pBase, NULL, 0, 0, 0 ); + pRepr = Gia_ManComputeGiaEquivs( pBase, 100, 0 ); + *pvMap1 = Acec_CountRemap( pOne, pBase ); + *pvMap2 = Acec_CountRemap( pTwo, pBase ); + Gia_ManStop( pBase ); + Gia_ManStop( pRepr ); + printf( "Finished computing equivalent nodes. " ); + Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); +} +void Acec_MatchBoxesSort( int * pArray, int nSize, int * pCostLits ) +{ + int i, j, best_i; + for ( i = 0; i < nSize-1; i++ ) + { + best_i = i; + for ( j = i+1; j < nSize; j++ ) + if ( Abc_Lit2LitL(pCostLits, pArray[j]) > Abc_Lit2LitL(pCostLits, pArray[best_i]) ) + best_i = j; + ABC_SWAP( int, pArray[i], pArray[best_i] ); + } +} +void Acec_MatchPrintEquivLits( Gia_Man_t * p, Vec_Wec_t * vLits, int * pCostLits, int fVerbose ) +{ + Vec_Int_t * vSupp; + Vec_Wrd_t * vTemp; + Vec_Int_t * vLevel; + int i, k, Entry; + printf( "Leaf literals and their classes:\n" ); + Vec_WecForEachLevel( vLits, vLevel, i ) + { + if ( Vec_IntSize(vLevel) == 0 ) + continue; + printf( "Rank %2d : %2d ", i, Vec_IntSize(vLevel) ); + Vec_IntForEachEntry( vLevel, Entry, k ) + printf( "%s%d(%d) ", Abc_LitIsCompl(Entry) ? "-":"+", Abc_Lit2Var(Entry), Abc_Lit2LitL(pCostLits, Entry) ); + printf( "\n" ); + } + if ( !fVerbose ) + return; + vSupp = Vec_IntAlloc( 100 ); + vTemp = Vec_WrdStart( Gia_ManObjNum(p) ); + Vec_WecForEachLevel( vLits, vLevel, i ) + { + //if ( i != 20 ) + // continue; + if ( Vec_IntSize(vLevel) == 0 ) + continue; + Vec_IntForEachEntry( vLevel, Entry, k ) + { + word Truth = Gia_ObjComputeTruth6Cis( p, Entry, vSupp, vTemp ); +/* + { + int iObj = Abc_Lit2Var(Entry); + Gia_Man_t * pGia0 = Gia_ManDupAndCones( p, &iObj, 1, 1 ); + Gia_ManShow( pGia0, NULL, 0, 0, 0 ); + Gia_ManStop( pGia0 ); + } +*/ + printf( "Rank = %4d : ", i ); + printf( "Obj = %4d ", Abc_Lit2Var(Entry) ); + if ( Vec_IntSize(vSupp) > 6 ) + { + printf( "Supp = %d.\n", Vec_IntSize(vSupp) ); + continue; + } + vSupp->nSize = Abc_Tt6MinBase( &Truth, vSupp->pArray, vSupp->nSize ); + if ( Vec_IntSize(vSupp) > 5 ) + { + printf( "Supp = %d.\n", Vec_IntSize(vSupp) ); + continue; + } + Extra_PrintHex( stdout, (unsigned*)&Truth, Vec_IntSize(vSupp) ); + if ( Vec_IntSize(vSupp) == 4 ) printf( " " ); + if ( Vec_IntSize(vSupp) == 3 ) printf( " " ); + if ( Vec_IntSize(vSupp) <= 2 ) printf( " " ); + printf( " " ); + Vec_IntPrint( vSupp ); + } + printf( "\n" ); + } + Vec_IntFree( vSupp ); + Vec_WrdFree( vTemp ); +} +Vec_Wec_t * Acec_MatchCopy( Vec_Wec_t * vLits, Vec_Int_t * vMap ) +{ + Vec_Wec_t * vRes = Vec_WecStart( Vec_WecSize(vLits) ); + Vec_Int_t * vLevel; int i, k, iLit; + Vec_WecForEachLevel( vLits, vLevel, i ) + Vec_IntForEachEntry( vLevel, iLit, k ) + Vec_WecPush( vRes, i, Abc_Lit2LitL(Vec_IntArray(vMap), iLit) ); + return vRes; +} +int Acec_MatchCountCommon( Vec_Wec_t * vLits1, Vec_Wec_t * vLits2, int Shift ) +{ + Vec_Int_t * vRes = Vec_IntAlloc( 100 ); + Vec_Int_t * vLevel1, * vLevel2; + int i, nCommon = 0; + Vec_WecForEachLevel( vLits1, vLevel1, i ) + { + if ( i+Shift < 0 || i+Shift >= Vec_WecSize(vLits2) ) + continue; + vLevel2 = Vec_WecEntry( vLits2, i+Shift ); + nCommon += Vec_IntTwoFindCommonReverse( vLevel1, vLevel2, vRes ); + } + Vec_IntFree( vRes ); + return nCommon; +} +void Vec_IntInsertOrder( Vec_Int_t * vLits, Vec_Int_t * vClasses, int Lit, int Class ) +{ + int i; + for ( i = Vec_IntSize(vClasses)-1; i >= 0; i-- ) + if ( Vec_IntEntry(vClasses,i) >= Class ) + break; + Vec_IntInsert( vLits, i+1, Lit ); + Vec_IntInsert( vClasses, i+1, Class ); +} +void Acec_MoveDuplicates( Vec_Wec_t * vLits, Vec_Wec_t * vClasses ) +{ + Vec_Int_t * vLevel1, * vLevel2; + int i, k, Prev, This, Entry; + Vec_WecForEachLevel( vLits, vLevel1, i ) + { + if ( i == Vec_WecSize(vLits) - 1 ) + break; + vLevel2 = Vec_WecEntry(vClasses, i); + assert( Vec_IntSize(vLevel1) == Vec_IntSize(vLevel2) ); + Prev = -1; + Vec_IntForEachEntry( vLevel2, This, k ) + { + if ( Prev != This ) + { + Prev = This; + continue; + } + Prev = -1; + Entry = Vec_IntEntry( vLevel1, k ); + + Vec_IntDrop( vLevel1, k ); + Vec_IntDrop( vLevel2, k-- ); + + Vec_IntDrop( vLevel1, k ); + Vec_IntDrop( vLevel2, k-- ); + + Vec_IntInsertOrder( Vec_WecEntry(vLits, i+1), Vec_WecEntry(vClasses, i+1), Entry, This ); + + assert( Vec_IntSize(vLevel1) == Vec_IntSize(vLevel2) ); + assert( Vec_IntSize(Vec_WecEntry(vLits, i+1)) == Vec_IntSize(Vec_WecEntry(vClasses, i+1)) ); + } + } +} + +void Acec_MatchCheckShift( Gia_Man_t * pGia0, Gia_Man_t * pGia1, Vec_Wec_t * vLits0, Vec_Wec_t * vLits1, Vec_Int_t * vMap0, Vec_Int_t * vMap1, Vec_Wec_t * vRoots0, Vec_Wec_t * vRoots1 ) +{ + Vec_Wec_t * vRes0 = Acec_MatchCopy( vLits0, vMap0 ); + Vec_Wec_t * vRes1 = Acec_MatchCopy( vLits1, vMap1 ); + int nCommon = Acec_MatchCountCommon( vRes0, vRes1, 0 ); + int nCommonPlus = Acec_MatchCountCommon( vRes0, vRes1, 1 ); + int nCommonMinus = Acec_MatchCountCommon( vRes0, vRes1, -1 ); + if ( nCommonPlus >= nCommonMinus && nCommonPlus > nCommon ) + { + Vec_WecInsertLevel( vLits0, 0 ); + Vec_WecInsertLevel( vRoots0, 0 ); + Vec_WecInsertLevel( vRes0, 0 ); + printf( "Shifted one level up.\n" ); + } + else if ( nCommonMinus > nCommonPlus && nCommonMinus > nCommon ) + { + Vec_WecInsertLevel( vLits1, 0 ); + Vec_WecInsertLevel( vRoots1, 0 ); + Vec_WecInsertLevel( vRes1, 0 ); + printf( "Shifted one level down.\n" ); + } + Acec_MoveDuplicates( vLits0, vRes0 ); + Acec_MoveDuplicates( vLits1, vRes1 ); + + //Vec_WecPrintLits( vLits1 ); + //printf( "Input literals:\n" ); + //Vec_WecPrintLits( vLits0 ); + //printf( "Equiv classes:\n" ); + //Vec_WecPrintLits( vRes0 ); + //printf( "Input literals:\n" ); + //Vec_WecPrintLits( vLits1 ); + //printf( "Equiv classes:\n" ); + //Vec_WecPrintLits( vRes1 ); + //Acec_VerifyClasses( pGia0, vLits0, vRes0 ); + //Acec_VerifyClasses( pGia1, vLits1, vRes1 ); + Vec_WecFree( vRes0 ); + Vec_WecFree( vRes1 ); +} +int Acec_MatchBoxes( Acec_Box_t * pBox0, Acec_Box_t * pBox1 ) +{ + Vec_Int_t * vMap0, * vMap1, * vLevel; + int i, nSize, nTotal; + Acec_ComputeEquivClasses( pBox0->pGia, pBox1->pGia, &vMap0, &vMap1 ); + // sort nodes in the classes by their equivalences + Vec_WecForEachLevel( pBox0->vLeafLits, vLevel, i ) + Acec_MatchBoxesSort( Vec_IntArray(vLevel), Vec_IntSize(vLevel), Vec_IntArray(vMap0) ); + Vec_WecForEachLevel( pBox1->vLeafLits, vLevel, i ) + Acec_MatchBoxesSort( Vec_IntArray(vLevel), Vec_IntSize(vLevel), Vec_IntArray(vMap1) ); + Acec_MatchCheckShift( pBox0->pGia, pBox1->pGia, pBox0->vLeafLits, pBox1->vLeafLits, vMap0, vMap1, pBox0->vRootLits, pBox1->vRootLits ); + + //Acec_MatchPrintEquivLits( pBox0->pGia, pBox0->vLeafLits, Vec_IntArray(vMap0), 0 ); + //Acec_MatchPrintEquivLits( pBox1->pGia, pBox1->vLeafLits, Vec_IntArray(vMap1), 0 ); + //printf( "Outputs:\n" ); + //Vec_WecPrintLits( pBox0->vRootLits ); + //printf( "Outputs:\n" ); + //Vec_WecPrintLits( pBox1->vRootLits ); + + // reorder nodes to have the same order + assert( pBox0->vShared == NULL ); + assert( pBox1->vShared == NULL ); + pBox0->vShared = Vec_WecStart( Vec_WecSize(pBox0->vLeafLits) ); + pBox1->vShared = Vec_WecStart( Vec_WecSize(pBox1->vLeafLits) ); + pBox0->vUnique = Vec_WecStart( Vec_WecSize(pBox0->vLeafLits) ); + pBox1->vUnique = Vec_WecStart( Vec_WecSize(pBox1->vLeafLits) ); + nSize = Abc_MinInt( Vec_WecSize(pBox0->vLeafLits), Vec_WecSize(pBox1->vLeafLits) ); + Vec_WecForEachLevelStart( pBox0->vLeafLits, vLevel, i, nSize ) + Vec_IntAppend( Vec_WecEntry(pBox0->vUnique, i), vLevel ); + Vec_WecForEachLevelStart( pBox1->vLeafLits, vLevel, i, nSize ) + Vec_IntAppend( Vec_WecEntry(pBox1->vUnique, i), vLevel ); + for ( i = 0; i < nSize; i++ ) + { + Vec_Int_t * vShared0 = Vec_WecEntry( pBox0->vShared, i ); + Vec_Int_t * vShared1 = Vec_WecEntry( pBox1->vShared, i ); + Vec_Int_t * vUnique0 = Vec_WecEntry( pBox0->vUnique, i ); + Vec_Int_t * vUnique1 = Vec_WecEntry( pBox1->vUnique, i ); + + Vec_Int_t * vLevel0 = Vec_WecEntry( pBox0->vLeafLits, i ); + Vec_Int_t * vLevel1 = Vec_WecEntry( pBox1->vLeafLits, i ); + int * pBeg0 = Vec_IntArray(vLevel0); + int * pBeg1 = Vec_IntArray(vLevel1); + int * pEnd0 = Vec_IntLimit(vLevel0); + int * pEnd1 = Vec_IntLimit(vLevel1); + while ( pBeg0 < pEnd0 && pBeg1 < pEnd1 ) + { + int Entry0 = Abc_Lit2LitL( Vec_IntArray(vMap0), *pBeg0 ); + int Entry1 = Abc_Lit2LitL( Vec_IntArray(vMap1), *pBeg1 ); + assert( *pBeg0 && *pBeg1 ); + if ( Entry0 == Entry1 ) + { + Vec_IntPush( vShared0, *pBeg0++ ); + Vec_IntPush( vShared1, *pBeg1++ ); + } + else if ( Entry0 > Entry1 ) + Vec_IntPush( vUnique0, *pBeg0++ ); + else + Vec_IntPush( vUnique1, *pBeg1++ ); + } + while ( pBeg0 < pEnd0 ) + Vec_IntPush( vUnique0, *pBeg0++ ); + while ( pBeg1 < pEnd1 ) + Vec_IntPush( vUnique1, *pBeg1++ ); + assert( Vec_IntSize(vShared0) == Vec_IntSize(vShared1) ); + assert( Vec_IntSize(vShared0) + Vec_IntSize(vUnique0) == Vec_IntSize(vLevel0) ); + assert( Vec_IntSize(vShared1) + Vec_IntSize(vUnique1) == Vec_IntSize(vLevel1) ); + } + nTotal = Vec_WecSizeSize(pBox0->vShared); + printf( "Box0: Matched %d entries out of %d.\n", nTotal, Vec_WecSizeSize(pBox0->vLeafLits) ); + printf( "Box1: Matched %d entries out of %d.\n", nTotal, Vec_WecSizeSize(pBox1->vLeafLits) ); + + //Acec_MatchPrintEquivLits( pBox0->pGia, pBox0->vShared, Vec_IntArray(vMap0), 0 ); + //Acec_MatchPrintEquivLits( pBox1->pGia, pBox1->vShared, Vec_IntArray(vMap1), 0 ); + //printf( "\n" ); + + //Acec_MatchPrintEquivLits( pBox0->pGia, pBox0->vUnique, Vec_IntArray(vMap0), 0 ); + //Acec_MatchPrintEquivLits( pBox1->pGia, pBox1->vUnique, Vec_IntArray(vMap1), 0 ); + + Vec_IntFree( vMap0 ); + Vec_IntFree( vMap1 ); + return nTotal; +} + +/**Function************************************************************* + Synopsis [] Description [] @@ -42,15 +483,61 @@ ABC_NAMESPACE_IMPL_START SeeAlso [] ***********************************************************************/ -int Gia_PolynCec( Gia_Man_t * pGia0, Gia_Man_t * pGia1, Cec_ParCec_t * pPars ) -{ - Vec_Int_t * vOrder0 = Gia_PolynReorder( pGia0, pPars->fVerbose, pPars->fVeryVerbose ); - Vec_Int_t * vOrder1 = Gia_PolynReorder( pGia1, pPars->fVerbose, pPars->fVeryVerbose ); - Gia_PolynBuild( pGia0, vOrder0, 0, pPars->fVerbose, pPars->fVeryVerbose ); - Gia_PolynBuild( pGia1, vOrder1, 0, pPars->fVerbose, pPars->fVeryVerbose ); - Vec_IntFree( vOrder0 ); - Vec_IntFree( vOrder1 ); - return 1; +int Acec_Solve( Gia_Man_t * pGia0, Gia_Man_t * pGia1, Acec_ParCec_t * pPars ) +{ + int status = -1; + abctime clk = Abc_Clock(); + Gia_Man_t * pMiter; + Gia_Man_t * pGia0n = pGia0, * pGia1n = pGia1; + Cec_ParCec_t ParsCec, * pCecPars = &ParsCec; + Vec_Bit_t * vIgnore0 = pPars->fBooth ? Acec_BoothFindPPG(pGia0) : NULL; + Vec_Bit_t * vIgnore1 = pPars->fBooth ? Acec_BoothFindPPG(pGia1) : NULL; + Acec_Box_t * pBox0 = Acec_DeriveBox( pGia0, vIgnore0, 0, 0, pPars->fVerbose ); + Acec_Box_t * pBox1 = Acec_DeriveBox( pGia1, vIgnore1, 0, 0, pPars->fVerbose ); + Vec_BitFreeP( &vIgnore0 ); + Vec_BitFreeP( &vIgnore1 ); + if ( pBox0 == NULL || pBox1 == NULL ) // cannot match + printf( "Cannot find arithmetic boxes in both LHS and RHS. Trying regular CEC.\n" ); + else if ( !Acec_MatchBoxes( pBox0, pBox1 ) ) // cannot find matching + printf( "Cannot match arithmetic boxes in LHS and RHS. Trying regular CEC.\n" ); + else + { + pGia0n = Acec_InsertBox( pBox0, 0 ); + pGia1n = Acec_InsertBox( pBox1, 0 ); + printf( "Matching of adder trees in LHS and RHS succeeded. " ); + Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); + // remove the last output + Gia_ManPatchCoDriver( pGia0n, Gia_ManCoNum(pGia0n)-1, 0 ); + Gia_ManPatchCoDriver( pGia1n, Gia_ManCoNum(pGia1n)-1, 0 ); + + Gia_ManPatchCoDriver( pGia0n, Gia_ManCoNum(pGia0n)-2, 0 ); + Gia_ManPatchCoDriver( pGia1n, Gia_ManCoNum(pGia1n)-2, 0 ); + } + // solve regular CEC problem + Cec_ManCecSetDefaultParams( pCecPars ); + pCecPars->nBTLimit = pPars->nBTLimit; + pMiter = Gia_ManMiter( pGia0n, pGia1n, 0, 1, 0, 0, pPars->fVerbose ); + if ( pMiter ) + { + int fDumpMiter = 0; + if ( fDumpMiter ) + { + Abc_Print( 0, "The verification miter is written into file \"%s\".\n", "acec_miter.aig" ); + Gia_AigerWrite( pMiter, "acec_miter.aig", 0, 0 ); + } + status = Cec_ManVerify( pMiter, pCecPars ); + ABC_SWAP( Abc_Cex_t *, pGia0->pCexComb, pMiter->pCexComb ); + Gia_ManStop( pMiter ); + } + else + printf( "Miter computation has failed.\n" ); + if ( pGia0n != pGia0 ) + Gia_ManStop( pGia0n ); + if ( pGia1n != pGia1 ) + Gia_ManStop( pGia1n ); + Acec_BoxFreeP( &pBox0 ); + Acec_BoxFreeP( &pBox1 ); + return status; } //////////////////////////////////////////////////////////////////////// diff --git a/src/proof/acec/acecInt.h b/src/proof/acec/acecInt.h index e761e56e..b8ec2455 100644 --- a/src/proof/acec/acecInt.h +++ b/src/proof/acec/acecInt.h @@ -27,7 +27,6 @@ //////////////////////////////////////////////////////////////////////// #include "aig/gia/gia.h" -#include "proof/cec/cec.h" #include "acec.h" //////////////////////////////////////////////////////////////////////// @@ -38,6 +37,17 @@ ABC_NAMESPACE_HEADER_START +typedef struct Acec_Box_t_ Acec_Box_t; +struct Acec_Box_t_ +{ + Gia_Man_t * pGia; // AIG manager + Vec_Wec_t * vAdds; // adders by rank + Vec_Wec_t * vLeafLits; // leaf literals by rank + Vec_Wec_t * vRootLits; // root literals by rank + Vec_Wec_t * vShared; // shared leaves + Vec_Wec_t * vUnique; // unique leaves +}; + //////////////////////////////////////////////////////////////////////// /// BASIC TYPES /// //////////////////////////////////////////////////////////////////////// @@ -54,10 +64,25 @@ ABC_NAMESPACE_HEADER_START /// FUNCTION DECLARATIONS /// //////////////////////////////////////////////////////////////////////// +/*=== acecCo.c ========================================================*/ +extern Vec_Int_t * Gia_PolynCoreOrder( Gia_Man_t * pGia, Vec_Int_t * vAdds, Vec_Int_t * vAddCos, Vec_Int_t ** pvIns, Vec_Int_t ** pvOuts ); +extern Vec_Wec_t * Gia_PolynCoreOrderArray( Gia_Man_t * pGia, Vec_Int_t * vAdds, Vec_Int_t * vRootBoxes ); +/*=== acecMult.c ========================================================*/ +extern Vec_Int_t * Acec_MultDetectInputs( Gia_Man_t * p, Vec_Wec_t * vLeafLits, Vec_Wec_t * vRootLits ); +extern Vec_Bit_t * Acec_BoothFindPPG( Gia_Man_t * p ); +/*=== acecNorm.c ========================================================*/ +extern void Acec_InsertFadd( Gia_Man_t * pNew, int In[3], int Out[2] ); +extern Gia_Man_t * Acec_InsertBox( Acec_Box_t * pBox, int fAll ); +/*=== acecTree.c ========================================================*/ +extern void Acec_PrintAdders( Vec_Wec_t * vBoxes, Vec_Int_t * vAdds ); +extern Acec_Box_t * Acec_DeriveBox( Gia_Man_t * p, Vec_Bit_t * vIgnore, int fFilterIn, int fFilterOut, int fVerbose ); +extern void Acec_BoxFreeP( Acec_Box_t ** ppBox ); /*=== acecUtil.c ========================================================*/ extern void Gia_PolynAnalyzeXors( Gia_Man_t * pGia, int fVerbose ); extern Vec_Int_t * Gia_PolynCollectLastXor( Gia_Man_t * pGia, int fVerbose ); + + ABC_NAMESPACE_HEADER_END diff --git a/src/proof/acec/acecMult.c b/src/proof/acec/acecMult.c new file mode 100644 index 00000000..d868c399 --- /dev/null +++ b/src/proof/acec/acecMult.c @@ -0,0 +1,550 @@ +/**CFile**************************************************************** + + FileName [acecMult.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [CEC for arithmetic circuits.] + + Synopsis [Multiplier.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 20, 2005.] + + Revision [$Id: acecMult.c,v 1.00 2005/06/20 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include "acecInt.h" +#include "misc/extra/extra.h" +#include "misc/util/utilTruth.h" + +ABC_NAMESPACE_IMPL_START + + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +unsigned s_Classes4a[96] = { + 0xD728, 0xB748, 0x9F60, 0xD278, 0xB478, 0x96F0, 0xC66C, 0x96CC, 0x9C6C, 0x96AA, 0xA66A, 0x9A6A, + 0x28D7, 0x48B7, 0x609F, 0x2D87, 0x4B87, 0x690F, 0x3993, 0x6933, 0x6393, 0x6955, 0x5995, 0x6595, + 0xEB14, 0xED12, 0xF906, 0xE1B4, 0xE1D2, 0xF096, 0xC99C, 0xCC96, 0xC9C6, 0xAA96, 0xA99A, 0xA9A6, + 0x14EB, 0x12ED, 0x06F9, 0x1E4B, 0x1E2D, 0x0F69, 0x3663, 0x3369, 0x3639, 0x5569, 0x5665, 0x5659, + 0x7D82, 0x7B84, 0x6F90, 0x78D2, 0x78B4, 0x69F0, 0x6CC6, 0x69CC, 0x6C9C, 0x69AA, 0x6AA6, 0x6A9A, + 0x827D, 0x847B, 0x906F, 0x872D, 0x874B, 0x960F, 0x9339, 0x9633, 0x9363, 0x9655, 0x9559, 0x9565, + 0xBE41, 0xDE21, 0xF609, 0xB4E1, 0xD2E1, 0xF069, 0x9CC9, 0xCC69, 0xC6C9, 0xAA69, 0x9AA9, 0xA6A9, + 0x41BE, 0x21DE, 0x09F6, 0x4B1E, 0x2D1E, 0x0F96, 0x6336, 0x3396, 0x3936, 0x5596, 0x6556, 0x5956 +}; + +unsigned s_Classes4b[384] = { + 0x35C0, 0x53A0, 0x1DC0, 0x4788, 0x2788, 0x1BA0, 0x3C50, 0x5A30, 0x1CD0, 0x4878, 0x2878, 0x1AB0, + 0x34C4, 0x606C, 0x3C44, 0x660C, 0x268C, 0x286C, 0x606A, 0x52A2, 0x486A, 0x468A, 0x660A, 0x5A22, + 0x3AC0, 0x5CA0, 0x2EC0, 0x7488, 0x7288, 0x4EA0, 0x3CA0, 0x5AC0, 0x2CE0, 0x7848, 0x7828, 0x4AE0, + 0x38C8, 0x6C60, 0x3C88, 0x66C0, 0x62C8, 0x6C28, 0x6A60, 0x58A8, 0x6A48, 0x64A8, 0x66A0, 0x5A88, + 0xC530, 0xA350, 0xD10C, 0x8B44, 0x8D22, 0xB10A, 0xC350, 0xA530, 0xD01C, 0x84B4, 0x82D2, 0xB01A, + 0xC434, 0x909C, 0xC344, 0x990C, 0x8C26, 0x82C6, 0x909A, 0xA252, 0x84A6, 0x8A46, 0x990A, 0xA522, + 0xCA30, 0xAC50, 0xE20C, 0xB844, 0xD822, 0xE40A, 0xC3A0, 0xA5C0, 0xE02C, 0xB484, 0xD282, 0xE04A, + 0xC838, 0x9C90, 0xC388, 0x99C0, 0xC862, 0xC682, 0x9A90, 0xA858, 0xA684, 0xA864, 0x99A0, 0xA588, + 0x530C, 0x350A, 0x4730, 0x1D22, 0x1B44, 0x2750, 0x503C, 0x305A, 0x4370, 0x12D2, 0x14B4, 0x2570, + 0x434C, 0x06C6, 0x443C, 0x0C66, 0x194C, 0x149C, 0x06A6, 0x252A, 0x129A, 0x192A, 0x0A66, 0x225A, + 0xA30C, 0xC50A, 0x8B30, 0xD122, 0xB144, 0x8D50, 0xA03C, 0xC05A, 0x83B0, 0xD212, 0xB414, 0x85D0, + 0x838C, 0xC606, 0x883C, 0xC066, 0x91C4, 0x9C14, 0xA606, 0x858A, 0x9A12, 0x91A2, 0xA066, 0x885A, + 0x5C03, 0x3A05, 0x7403, 0x2E11, 0x4E11, 0x7205, 0x50C3, 0x30A5, 0x7043, 0x21E1, 0x41E1, 0x7025, + 0x4C43, 0x09C9, 0x44C3, 0x0C99, 0x4C19, 0x41C9, 0x09A9, 0x2A25, 0x21A9, 0x2A19, 0x0A99, 0x22A5, + 0xAC03, 0xCA05, 0xB803, 0xE211, 0xE411, 0xD805, 0xA0C3, 0xC0A5, 0xB083, 0xE121, 0xE141, 0xD085, + 0x8C83, 0xC909, 0x88C3, 0xC099, 0xC491, 0xC941, 0xA909, 0x8A85, 0xA921, 0xA291, 0xA099, 0x88A5, + 0xC035, 0xA053, 0xC01D, 0x8847, 0x8827, 0xA01B, 0xC305, 0xA503, 0xC10D, 0x8487, 0x8287, 0xA10B, + 0xC131, 0x9093, 0xC311, 0x9903, 0x8923, 0x8293, 0x9095, 0xA151, 0x8495, 0x8945, 0x9905, 0xA511, + 0xC03A, 0xA05C, 0xC02E, 0x8874, 0x8872, 0xA04E, 0xC30A, 0xA50C, 0xC20E, 0x8784, 0x8782, 0xA40E, + 0xC232, 0x9390, 0xC322, 0x9930, 0x9832, 0x9382, 0x9590, 0xA454, 0x9584, 0x9854, 0x9950, 0xA544, + 0x30C5, 0x50A3, 0x0CD1, 0x448B, 0x228D, 0x0AB1, 0x3C05, 0x5A03, 0x0DC1, 0x484B, 0x282D, 0x0BA1, + 0x31C1, 0x6063, 0x3C11, 0x6603, 0x2389, 0x2839, 0x6065, 0x51A1, 0x4859, 0x4589, 0x6605, 0x5A11, + 0x30CA, 0x50AC, 0x0CE2, 0x44B8, 0x22D8, 0x0AE4, 0x3C0A, 0x5A0C, 0x0EC2, 0x4B48, 0x2D28, 0x0EA4, + 0x32C2, 0x6360, 0x3C22, 0x6630, 0x3298, 0x3928, 0x6560, 0x54A4, 0x5948, 0x5498, 0x6650, 0x5A44, + 0x0C53, 0x0A35, 0x3047, 0x221D, 0x441B, 0x5027, 0x05C3, 0x03A5, 0x3407, 0x212D, 0x414B, 0x5207, + 0x1C13, 0x0939, 0x11C3, 0x0399, 0x4613, 0x4163, 0x0959, 0x1A15, 0x2165, 0x2615, 0x0599, 0x11A5, + 0x0CA3, 0x0AC5, 0x308B, 0x22D1, 0x44B1, 0x508D, 0x0AC3, 0x0CA5, 0x380B, 0x2D21, 0x4B41, 0x580D, + 0x2C23, 0x3909, 0x22C3, 0x3099, 0x6431, 0x6341, 0x5909, 0x4A45, 0x6521, 0x6251, 0x5099, 0x44A5, + 0x035C, 0x053A, 0x0374, 0x112E, 0x114E, 0x0572, 0x053C, 0x035A, 0x0734, 0x121E, 0x141E, 0x0752, + 0x131C, 0x0636, 0x113C, 0x0366, 0x1346, 0x1436, 0x0656, 0x151A, 0x1256, 0x1526, 0x0566, 0x115A, + 0x03AC, 0x05CA, 0x03B8, 0x11E2, 0x11E4, 0x05D8, 0x0A3C, 0x0C5A, 0x0B38, 0x1E12, 0x1E14, 0x0D58, + 0x232C, 0x3606, 0x223C, 0x3066, 0x3164, 0x3614, 0x5606, 0x454A, 0x5612, 0x5162, 0x5066, 0x445A +}; + +unsigned s_Classes4c[768] = { + 0x35C0, 0x53A0, 0x1DC0, 0x4788, 0x2788, 0x1BA0, 0x3C50, 0x5A30, 0x1CD0, 0x4878, 0x2878, 0x1AB0, + 0x34C4, 0x606C, 0x3C44, 0x660C, 0x268C, 0x286C, 0x606A, 0x52A2, 0x486A, 0x468A, 0x660A, 0x5A22, + 0xCA3F, 0xAC5F, 0xE23F, 0xB877, 0xD877, 0xE45F, 0xC3AF, 0xA5CF, 0xE32F, 0xB787, 0xD787, 0xE54F, + 0xCB3B, 0x9F93, 0xC3BB, 0x99F3, 0xD973, 0xD793, 0x9F95, 0xAD5D, 0xB795, 0xB975, 0x99F5, 0xA5DD, + 0x3AC0, 0x5CA0, 0x2EC0, 0x7488, 0x7288, 0x4EA0, 0x3CA0, 0x5AC0, 0x2CE0, 0x7848, 0x7828, 0x4AE0, + 0x38C8, 0x6C60, 0x3C88, 0x66C0, 0x62C8, 0x6C28, 0x6A60, 0x58A8, 0x6A48, 0x64A8, 0x66A0, 0x5A88, + 0xC53F, 0xA35F, 0xD13F, 0x8B77, 0x8D77, 0xB15F, 0xC35F, 0xA53F, 0xD31F, 0x87B7, 0x87D7, 0xB51F, + 0xC737, 0x939F, 0xC377, 0x993F, 0x9D37, 0x93D7, 0x959F, 0xA757, 0x95B7, 0x9B57, 0x995F, 0xA577, + 0xC530, 0xA350, 0xD10C, 0x8B44, 0x8D22, 0xB10A, 0xC350, 0xA530, 0xD01C, 0x84B4, 0x82D2, 0xB01A, + 0xC434, 0x909C, 0xC344, 0x990C, 0x8C26, 0x82C6, 0x909A, 0xA252, 0x84A6, 0x8A46, 0x990A, 0xA522, + 0x3ACF, 0x5CAF, 0x2EF3, 0x74BB, 0x72DD, 0x4EF5, 0x3CAF, 0x5ACF, 0x2FE3, 0x7B4B, 0x7D2D, 0x4FE5, + 0x3BCB, 0x6F63, 0x3CBB, 0x66F3, 0x73D9, 0x7D39, 0x6F65, 0x5DAD, 0x7B59, 0x75B9, 0x66F5, 0x5ADD, + 0xCA30, 0xAC50, 0xE20C, 0xB844, 0xD822, 0xE40A, 0xC3A0, 0xA5C0, 0xE02C, 0xB484, 0xD282, 0xE04A, + 0xC838, 0x9C90, 0xC388, 0x99C0, 0xC862, 0xC682, 0x9A90, 0xA858, 0xA684, 0xA864, 0x99A0, 0xA588, + 0x35CF, 0x53AF, 0x1DF3, 0x47BB, 0x27DD, 0x1BF5, 0x3C5F, 0x5A3F, 0x1FD3, 0x4B7B, 0x2D7D, 0x1FB5, + 0x37C7, 0x636F, 0x3C77, 0x663F, 0x379D, 0x397D, 0x656F, 0x57A7, 0x597B, 0x579B, 0x665F, 0x5A77, + 0x530C, 0x350A, 0x4730, 0x1D22, 0x1B44, 0x2750, 0x503C, 0x305A, 0x4370, 0x12D2, 0x14B4, 0x2570, + 0x434C, 0x06C6, 0x443C, 0x0C66, 0x194C, 0x149C, 0x06A6, 0x252A, 0x129A, 0x192A, 0x0A66, 0x225A, + 0xACF3, 0xCAF5, 0xB8CF, 0xE2DD, 0xE4BB, 0xD8AF, 0xAFC3, 0xCFA5, 0xBC8F, 0xED2D, 0xEB4B, 0xDA8F, + 0xBCB3, 0xF939, 0xBBC3, 0xF399, 0xE6B3, 0xEB63, 0xF959, 0xDAD5, 0xED65, 0xE6D5, 0xF599, 0xDDA5, + 0xA30C, 0xC50A, 0x8B30, 0xD122, 0xB144, 0x8D50, 0xA03C, 0xC05A, 0x83B0, 0xD212, 0xB414, 0x85D0, + 0x838C, 0xC606, 0x883C, 0xC066, 0x91C4, 0x9C14, 0xA606, 0x858A, 0x9A12, 0x91A2, 0xA066, 0x885A, + 0x5CF3, 0x3AF5, 0x74CF, 0x2EDD, 0x4EBB, 0x72AF, 0x5FC3, 0x3FA5, 0x7C4F, 0x2DED, 0x4BEB, 0x7A2F, + 0x7C73, 0x39F9, 0x77C3, 0x3F99, 0x6E3B, 0x63EB, 0x59F9, 0x7A75, 0x65ED, 0x6E5D, 0x5F99, 0x77A5, + 0x5C03, 0x3A05, 0x7403, 0x2E11, 0x4E11, 0x7205, 0x50C3, 0x30A5, 0x7043, 0x21E1, 0x41E1, 0x7025, + 0x4C43, 0x09C9, 0x44C3, 0x0C99, 0x4C19, 0x41C9, 0x09A9, 0x2A25, 0x21A9, 0x2A19, 0x0A99, 0x22A5, + 0xA3FC, 0xC5FA, 0x8BFC, 0xD1EE, 0xB1EE, 0x8DFA, 0xAF3C, 0xCF5A, 0x8FBC, 0xDE1E, 0xBE1E, 0x8FDA, + 0xB3BC, 0xF636, 0xBB3C, 0xF366, 0xB3E6, 0xBE36, 0xF656, 0xD5DA, 0xDE56, 0xD5E6, 0xF566, 0xDD5A, + 0xAC03, 0xCA05, 0xB803, 0xE211, 0xE411, 0xD805, 0xA0C3, 0xC0A5, 0xB083, 0xE121, 0xE141, 0xD085, + 0x8C83, 0xC909, 0x88C3, 0xC099, 0xC491, 0xC941, 0xA909, 0x8A85, 0xA921, 0xA291, 0xA099, 0x88A5, + 0x53FC, 0x35FA, 0x47FC, 0x1DEE, 0x1BEE, 0x27FA, 0x5F3C, 0x3F5A, 0x4F7C, 0x1EDE, 0x1EBE, 0x2F7A, + 0x737C, 0x36F6, 0x773C, 0x3F66, 0x3B6E, 0x36BE, 0x56F6, 0x757A, 0x56DE, 0x5D6E, 0x5F66, 0x775A, + 0xC035, 0xA053, 0xC01D, 0x8847, 0x8827, 0xA01B, 0xC305, 0xA503, 0xC10D, 0x8487, 0x8287, 0xA10B, + 0xC131, 0x9093, 0xC311, 0x9903, 0x8923, 0x8293, 0x9095, 0xA151, 0x8495, 0x8945, 0x9905, 0xA511, + 0x3FCA, 0x5FAC, 0x3FE2, 0x77B8, 0x77D8, 0x5FE4, 0x3CFA, 0x5AFC, 0x3EF2, 0x7B78, 0x7D78, 0x5EF4, + 0x3ECE, 0x6F6C, 0x3CEE, 0x66FC, 0x76DC, 0x7D6C, 0x6F6A, 0x5EAE, 0x7B6A, 0x76BA, 0x66FA, 0x5AEE, + 0xC03A, 0xA05C, 0xC02E, 0x8874, 0x8872, 0xA04E, 0xC30A, 0xA50C, 0xC20E, 0x8784, 0x8782, 0xA40E, + 0xC232, 0x9390, 0xC322, 0x9930, 0x9832, 0x9382, 0x9590, 0xA454, 0x9584, 0x9854, 0x9950, 0xA544, + 0x3FC5, 0x5FA3, 0x3FD1, 0x778B, 0x778D, 0x5FB1, 0x3CF5, 0x5AF3, 0x3DF1, 0x787B, 0x787D, 0x5BF1, + 0x3DCD, 0x6C6F, 0x3CDD, 0x66CF, 0x67CD, 0x6C7D, 0x6A6F, 0x5BAB, 0x6A7B, 0x67AB, 0x66AF, 0x5ABB, + 0x30C5, 0x50A3, 0x0CD1, 0x448B, 0x228D, 0x0AB1, 0x3C05, 0x5A03, 0x0DC1, 0x484B, 0x282D, 0x0BA1, + 0x31C1, 0x6063, 0x3C11, 0x6603, 0x2389, 0x2839, 0x6065, 0x51A1, 0x4859, 0x4589, 0x6605, 0x5A11, + 0xCF3A, 0xAF5C, 0xF32E, 0xBB74, 0xDD72, 0xF54E, 0xC3FA, 0xA5FC, 0xF23E, 0xB7B4, 0xD7D2, 0xF45E, + 0xCE3E, 0x9F9C, 0xC3EE, 0x99FC, 0xDC76, 0xD7C6, 0x9F9A, 0xAE5E, 0xB7A6, 0xBA76, 0x99FA, 0xA5EE, + 0x30CA, 0x50AC, 0x0CE2, 0x44B8, 0x22D8, 0x0AE4, 0x3C0A, 0x5A0C, 0x0EC2, 0x4B48, 0x2D28, 0x0EA4, + 0x32C2, 0x6360, 0x3C22, 0x6630, 0x3298, 0x3928, 0x6560, 0x54A4, 0x5948, 0x5498, 0x6650, 0x5A44, + 0xCF35, 0xAF53, 0xF31D, 0xBB47, 0xDD27, 0xF51B, 0xC3F5, 0xA5F3, 0xF13D, 0xB4B7, 0xD2D7, 0xF15B, + 0xCD3D, 0x9C9F, 0xC3DD, 0x99CF, 0xCD67, 0xC6D7, 0x9A9F, 0xAB5B, 0xA6B7, 0xAB67, 0x99AF, 0xA5BB, + 0x0C53, 0x0A35, 0x3047, 0x221D, 0x441B, 0x5027, 0x05C3, 0x03A5, 0x3407, 0x212D, 0x414B, 0x5207, + 0x1C13, 0x0939, 0x11C3, 0x0399, 0x4613, 0x4163, 0x0959, 0x1A15, 0x2165, 0x2615, 0x0599, 0x11A5, + 0xF3AC, 0xF5CA, 0xCFB8, 0xDDE2, 0xBBE4, 0xAFD8, 0xFA3C, 0xFC5A, 0xCBF8, 0xDED2, 0xBEB4, 0xADF8, + 0xE3EC, 0xF6C6, 0xEE3C, 0xFC66, 0xB9EC, 0xBE9C, 0xF6A6, 0xE5EA, 0xDE9A, 0xD9EA, 0xFA66, 0xEE5A, + 0x0CA3, 0x0AC5, 0x308B, 0x22D1, 0x44B1, 0x508D, 0x0AC3, 0x0CA5, 0x380B, 0x2D21, 0x4B41, 0x580D, + 0x2C23, 0x3909, 0x22C3, 0x3099, 0x6431, 0x6341, 0x5909, 0x4A45, 0x6521, 0x6251, 0x5099, 0x44A5, + 0xF35C, 0xF53A, 0xCF74, 0xDD2E, 0xBB4E, 0xAF72, 0xF53C, 0xF35A, 0xC7F4, 0xD2DE, 0xB4BE, 0xA7F2, + 0xD3DC, 0xC6F6, 0xDD3C, 0xCF66, 0x9BCE, 0x9CBE, 0xA6F6, 0xB5BA, 0x9ADE, 0x9DAE, 0xAF66, 0xBB5A, + 0x035C, 0x053A, 0x0374, 0x112E, 0x114E, 0x0572, 0x053C, 0x035A, 0x0734, 0x121E, 0x141E, 0x0752, + 0x131C, 0x0636, 0x113C, 0x0366, 0x1346, 0x1436, 0x0656, 0x151A, 0x1256, 0x1526, 0x0566, 0x115A, + 0xFCA3, 0xFAC5, 0xFC8B, 0xEED1, 0xEEB1, 0xFA8D, 0xFAC3, 0xFCA5, 0xF8CB, 0xEDE1, 0xEBE1, 0xF8AD, + 0xECE3, 0xF9C9, 0xEEC3, 0xFC99, 0xECB9, 0xEBC9, 0xF9A9, 0xEAE5, 0xEDA9, 0xEAD9, 0xFA99, 0xEEA5, + 0x03AC, 0x05CA, 0x03B8, 0x11E2, 0x11E4, 0x05D8, 0x0A3C, 0x0C5A, 0x0B38, 0x1E12, 0x1E14, 0x0D58, + 0x232C, 0x3606, 0x223C, 0x3066, 0x3164, 0x3614, 0x5606, 0x454A, 0x5612, 0x5162, 0x5066, 0x445A, + 0xFC53, 0xFA35, 0xFC47, 0xEE1D, 0xEE1B, 0xFA27, 0xF5C3, 0xF3A5, 0xF4C7, 0xE1ED, 0xE1EB, 0xF2A7, + 0xDCD3, 0xC9F9, 0xDDC3, 0xCF99, 0xCE9B, 0xC9EB, 0xA9F9, 0xBAB5, 0xA9ED, 0xAE9D, 0xAF99, 0xBBA5 +}; + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + + +/**Function************************************************************* + + Synopsis [Computes NPN-canonical form using brute-force methods.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +unsigned Extra_TruthCanonNPN2( unsigned uTruth, int nVars, Vec_Int_t * vRes ) +{ + static int nVarsOld, nPerms; + static char ** pPerms = NULL; + + unsigned uTruthMin, uTruthC, uPhase, uPerm; + int nMints, k, i; + + if ( pPerms == NULL ) + { + nPerms = Extra_Factorial( nVars ); + pPerms = Extra_Permutations( nVars ); + nVarsOld = nVars; + } + else if ( nVarsOld != nVars ) + { + ABC_FREE( pPerms ); + nPerms = Extra_Factorial( nVars ); + pPerms = Extra_Permutations( nVars ); + nVarsOld = nVars; + } + + nMints = (1 << nVars); + uTruthC = (unsigned)( (~uTruth) & ((~((unsigned)0)) >> (32-nMints)) ); + uTruthMin = 0xFFFFFFFF; + for ( i = 0; i < nMints; i++ ) + { + uPhase = Extra_TruthPolarize( uTruth, i, nVars ); + for ( k = 0; k < nPerms; k++ ) + { + uPerm = Extra_TruthPermute( uPhase, pPerms[k], nVars, 0 ); + Vec_IntPushUnique( vRes, uPerm ); + if ( uTruthMin > uPerm ) + uTruthMin = uPerm; + } + uPhase = Extra_TruthPolarize( uTruthC, i, nVars ); + for ( k = 0; k < nPerms; k++ ) + { + uPerm = Extra_TruthPermute( uPhase, pPerms[k], nVars, 0 ); + Vec_IntPushUnique( vRes, uPerm ); + if ( uTruthMin > uPerm ) + uTruthMin = uPerm; + } + } + return uTruthMin; +} + +void Acec_MultFuncTest5() +{ + Vec_Int_t * vRes = Vec_IntAlloc( 1000 ); + int i, Entry; + + unsigned Truth = 0xF335ACC0; + unsigned Canon = Extra_TruthCanonNPN2( Truth, 5, vRes ); + + Extra_PrintHex( stdout, (unsigned*)&Truth, 5 ); printf( "\n" ); + Extra_PrintHex( stdout, (unsigned*)&Canon, 5 ); printf( "\n" ); + + printf( "Members = %d.\n", Vec_IntSize(vRes) ); + Vec_IntForEachEntry( vRes, Entry, i ) + { + Extra_PrintHex( stdout, (unsigned*)&Entry, 5 ); + printf( ", " ); + if ( i % 8 == 7 ) + printf( "\n" ); + } + + Vec_IntFree( vRes ); +} + +void Acec_MultFuncTest4() +{ + Vec_Int_t * vRes = Vec_IntAlloc( 1000 ); + int i, Entry; + + unsigned Truth = 0x35C0; + //unsigned Truth = 0xD728; + unsigned Canon = Extra_TruthCanonNPN2( Truth, 4, vRes ); + + Extra_PrintHex( stdout, (unsigned*)&Truth, 4 ); printf( "\n" ); + Extra_PrintHex( stdout, (unsigned*)&Canon, 4 ); printf( "\n" ); + + printf( "Members = %d.\n", Vec_IntSize(vRes) ); + Vec_IntForEachEntry( vRes, Entry, i ) + { + Extra_PrintHex( stdout, (unsigned*)&Entry, 4 ); + printf( ", " ); + if ( i % 12 == 11 ) + printf( "\n" ); + } + + Vec_IntFree( vRes ); +} + + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Vec_Int_t * Acec_MultCollectInputs( Vec_Int_t * vPairs, Vec_Int_t * vRanks, int iObj ) +{ + Vec_Int_t * vItems = Vec_IntAlloc( 100 ); + int k, iObj1, iObj2; + // collect all those appearing with this one + Vec_IntForEachEntryDouble( vPairs, iObj1, iObj2, k ) + if ( iObj == iObj1 ) + Vec_IntPushUnique( vItems, iObj2 ); + else if ( iObj == iObj2 ) + Vec_IntPushUnique( vItems, iObj1 ); + // sort items by rank cost + Vec_IntSelectSortCost( Vec_IntArray(vItems), Vec_IntSize(vItems), vRanks ); + return vItems; +} +Vec_Int_t * Acec_MultDetectInputs1( Gia_Man_t * p, Vec_Wec_t * vLeafLits, Vec_Wec_t * vRootLits ) +{ + Vec_Int_t * vInputs = Vec_IntAlloc( 100 ); + Vec_Int_t * vCounts = Vec_IntStart( Gia_ManObjNum(p) ); + Vec_Int_t * vRanks = Vec_IntStart( Gia_ManObjNum(p) ); + Vec_Int_t * vPairs = Vec_IntAlloc( 100 ); + Vec_Int_t * vItems = Vec_IntAlloc( 100 ); + Vec_Int_t * vItems0; + Vec_Int_t * vItems1; + Vec_Int_t * vLevel; + int i, k, iLit, iObj, Count; + // count how many times each input appears + Vec_WecForEachLevel( vLeafLits, vLevel, i ) + Vec_IntForEachEntry( vLevel, iLit, k ) + { + iObj = Abc_Lit2Var(iLit); + Vec_IntAddToEntry( vCounts, Gia_ObjFaninId0(Gia_ManObj(p, iObj), iObj), 1 ); + Vec_IntAddToEntry( vCounts, Gia_ObjFaninId1(Gia_ManObj(p, iObj), iObj), 1 ); +/* + printf( "Rank %2d : Leaf = %4d : (%2d, %2d)\n", i, iObj, + Gia_ObjFaninId0(Gia_ManObj(p, iObj), iObj), Gia_ObjFaninId1(Gia_ManObj(p, iObj), iObj) ); + if ( k == Vec_IntSize(vLevel) - 1 ) + printf( "\n" ); +*/ + } + // count ranks for each one + Vec_WecForEachLevel( vLeafLits, vLevel, i ) + Vec_IntForEachEntry( vLevel, iLit, k ) + { + iObj = Abc_Lit2Var(iLit); + if ( Vec_IntEntry(vCounts, Gia_ObjFaninId0(Gia_ManObj(p, iObj), iObj)) < 2 ) + { + printf( "Skipping %d.\n", iObj ); + continue; + } + if ( Vec_IntEntry(vCounts, Gia_ObjFaninId1(Gia_ManObj(p, iObj), iObj)) < 2 ) + { + printf( "Skipping %d.\n", iObj ); + continue; + } + Vec_IntAddToEntry( vRanks, Gia_ObjFaninId0(Gia_ManObj(p, iObj), iObj), i ); + Vec_IntAddToEntry( vRanks, Gia_ObjFaninId1(Gia_ManObj(p, iObj), iObj), i ); + + Vec_IntPushTwo( vPairs, Gia_ObjFaninId0(Gia_ManObj(p, iObj), iObj), Gia_ObjFaninId1(Gia_ManObj(p, iObj), iObj) ); + } + + // print statistics + Vec_IntForEachEntry( vCounts, Count, i ) + { + if ( !Count ) + continue; + if ( !Vec_IntEntry(vRanks, i) ) + continue; + Vec_IntPush( vItems, i ); + printf( "Obj = %3d Occurs = %3d Ranks = %3d\n", i, Count, Vec_IntEntry(vRanks, i) ); + } + // sort items by rank cost + Vec_IntSelectSortCost( Vec_IntArray(vItems), Vec_IntSize(vItems), vRanks ); + // collect all those appearing with the last one + vItems0 = Acec_MultCollectInputs( vPairs, vRanks, Vec_IntEntryLast(vItems) ); + Vec_IntAppend( vInputs, vItems0 ); + // collect all those appearing with the last one + vItems1 = Acec_MultCollectInputs( vPairs, vRanks, Vec_IntEntryLast(vItems0) ); + Vec_IntAppend( vInputs, vItems1 ); + + Vec_IntPrint( vItems0 ); + Vec_IntPrint( vItems1 ); + + Vec_IntFree( vCounts ); + Vec_IntFree( vRanks ); + Vec_IntFree( vPairs ); + Vec_IntFree( vItems ); + Vec_IntFree( vItems0 ); + Vec_IntFree( vItems1 ); + return vInputs; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Vec_Int_t * Acec_MultDetectInputs( Gia_Man_t * p, Vec_Wec_t * vLeafLits, Vec_Wec_t * vRootLits ) +{ + Vec_Int_t * vInputs = Vec_IntAlloc( 100 ); + Vec_Int_t * vSupp = Vec_IntAlloc( 100 ); + Vec_Wrd_t * vTemp = Vec_WrdStart( Gia_ManObjNum(p) ); + Vec_Int_t * vRanks = Vec_IntStart( Gia_ManObjNum(p) ); + Vec_Int_t * vCounts = Vec_IntStart( Gia_ManObjNum(p) ); + Vec_Int_t * vLevel; + int i, k, iLit, iObj, j, Entry; + + ABC_FREE( p->pRefs ); + Gia_ManCreateRefs( p ); + Gia_ManForEachCiId( p, iObj, i ) + printf( "%d=%d ", iObj, Gia_ObjRefNumId(p, iObj) ); + printf( "\n" ); + Gia_ManForEachAndId( p, iObj ) + if ( Gia_ObjRefNumId(p, iObj) >= 4 ) + printf( "%d=%d ", iObj, Gia_ObjRefNumId(p, iObj) ); + printf( "\n" ); + + Vec_WecForEachLevel( vLeafLits, vLevel, i ) + Vec_IntForEachEntry( vLevel, iLit, k ) + { + word Truth = Gia_ObjComputeTruth6Cis( p, iLit, vSupp, vTemp ); + if ( Vec_IntSize(vSupp) >= 0 ) + { + printf( "Leaf = %4d : ", Abc_Lit2Var(iLit) ); + printf( "Rank = %2d ", i ); + printf( "Supp = %2d ", Vec_IntSize(vSupp) ); + Extra_PrintHex( stdout, (unsigned*)&Truth, Vec_IntSize(vSupp) ); + if ( Vec_IntSize(vSupp) == 4 ) printf( " " ); + if ( Vec_IntSize(vSupp) == 3 ) printf( " " ); + if ( Vec_IntSize(vSupp) <= 2 ) printf( " " ); + printf( " " ); + Vec_IntPrint( vSupp ); + /* + if ( Truth == 0xF335ACC0F335ACC0 ) + { + int iObj = Abc_Lit2Var(iLit); + Gia_Man_t * pGia0 = Gia_ManDupAndCones( p, &iObj, 1, 1 ); + Gia_ManShow( pGia0, NULL, 0, 0, 0 ); + Gia_ManStop( pGia0 ); + } + */ + } + // support rank counts + Vec_IntForEachEntry( vSupp, Entry, j ) + { + Vec_IntAddToEntry( vRanks, Entry, i ); + Vec_IntAddToEntry( vCounts, Entry, 1 ); + } + if ( k == Vec_IntSize(vLevel)-1 ) + printf( "\n" ); + } + + Vec_IntForEachEntry( vCounts, Entry, j ) + if ( Entry ) + printf( "%d=%d(%.2f) ", j, Entry, 1.0*Vec_IntEntry(vRanks, j)/Entry ); + printf( "\n" ); + + Vec_IntFree( vSupp ); + Vec_WrdFree( vTemp ); + Vec_IntFree( vRanks ); + Vec_IntFree( vCounts ); + return vInputs; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Acec_MultFindPPs_rec( Gia_Man_t * p, int iObj, Vec_Int_t * vBold ) +{ + Gia_Obj_t * pObj; + pObj = Gia_ManObj( p, iObj ); + if ( pObj->fMark0 ) + return; + pObj->fMark0 = 1; + if ( !Gia_ObjIsAnd(pObj) ) + return; + Acec_MultFindPPs_rec( p, Gia_ObjFaninId0(pObj, iObj), vBold ); + Acec_MultFindPPs_rec( p, Gia_ObjFaninId1(pObj, iObj), vBold ); + Vec_IntPush( vBold, iObj ); +} +Vec_Int_t * Acec_MultFindPPs( Gia_Man_t * p ) +{ + word Saved[32] = { + ABC_CONST(0xF335ACC0F335ACC0), + ABC_CONST(0x35C035C035C035C0), + ABC_CONST(0xD728D728D728D728), + ABC_CONST(0xFD80FD80FD80FD80), + ABC_CONST(0xACC0ACC0ACC0ACC0), + ABC_CONST(0x7878787878787878), + ABC_CONST(0x2828282828282828), + ABC_CONST(0xD0D0D0D0D0D0D0D0), + ABC_CONST(0x8080808080808080), + ABC_CONST(0x8888888888888888), + ABC_CONST(0xAAAAAAAAAAAAAAAA), + ABC_CONST(0x5555555555555555), + + ABC_CONST(0xD5A8D5A8D5A8D5A8), + ABC_CONST(0x2A572A572A572A57), + ABC_CONST(0xF3C0F3C0F3C0F3C0), + ABC_CONST(0x5858585858585858), + ABC_CONST(0xA7A7A7A7A7A7A7A7), + ABC_CONST(0x2727272727272727), + ABC_CONST(0xD8D8D8D8D8D8D8D8) + }; + + Vec_Int_t * vBold = Vec_IntAlloc( 100 ); + Vec_Int_t * vSupp = Vec_IntAlloc( 100 ); + Vec_Wrd_t * vTemp = Vec_WrdStart( Gia_ManObjNum(p) ); + int i, iObj, nProds = 0; + Gia_ManCleanMark0(p); + Gia_ManForEachAndId( p, iObj ) + { + word Truth = Gia_ObjComputeTruth6Cis( p, Abc_Var2Lit(iObj, 0), vSupp, vTemp ); + if ( Vec_IntSize(vSupp) > 6 ) + continue; + vSupp->nSize = Abc_Tt6MinBase( &Truth, vSupp->pArray, vSupp->nSize ); + if ( Vec_IntSize(vSupp) > 5 ) + continue; + for ( i = 0; i < 32 && Saved[i]; i++ ) + { + if ( Truth == Saved[i] || Truth == ~Saved[i] ) + { + Acec_MultFindPPs_rec( p, iObj, vBold ); + nProds++; + break; + } + } + /* + if ( Saved[i] ) + { + printf( "Obj = %4d ", iObj ); + Extra_PrintHex( stdout, (unsigned*)&Truth, Vec_IntSize(vSupp) ); + if ( Vec_IntSize(vSupp) == 4 ) printf( " " ); + if ( Vec_IntSize(vSupp) == 3 ) printf( " " ); + if ( Vec_IntSize(vSupp) <= 2 ) printf( " " ); + printf( " " ); + Vec_IntPrint( vSupp ); + } + */ + } + Gia_ManCleanMark0(p); + printf( "Collected %d pps and %d nodes.\n", nProds, Vec_IntSize(vBold) ); + + Vec_IntFree( vSupp ); + Vec_WrdFree( vTemp ); + return vBold; +} +Vec_Bit_t * Acec_BoothFindPPG( Gia_Man_t * p ) +{ + Vec_Bit_t * vIgnore = Vec_BitStart( Gia_ManObjNum(p) ); + Vec_Int_t * vMap = Acec_MultFindPPs( p ); + int i, Entry; + Vec_IntForEachEntry( vMap, Entry, i ) + Vec_BitWriteEntry( vIgnore, Entry, 1 ); + Vec_IntFree( vMap ); + return vIgnore; +} +void Acec_MultFindPPsTest( Gia_Man_t * p ) +{ + Vec_Int_t * vBold = Acec_MultFindPPs( p ); + Gia_ManShow( p, vBold, 1, 0, 0 ); + Vec_IntFree( vBold ); +} + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + diff --git a/src/proof/acec/acecNorm.c b/src/proof/acec/acecNorm.c new file mode 100644 index 00000000..f2acb37b --- /dev/null +++ b/src/proof/acec/acecNorm.c @@ -0,0 +1,226 @@ +/**CFile**************************************************************** + + FileName [acecNorm.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [CEC for arithmetic circuits.] + + Synopsis [Adder tree normalization.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 20, 2005.] + + Revision [$Id: acecNorm.c,v 1.00 2005/06/20 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include "acecInt.h" + +ABC_NAMESPACE_IMPL_START + + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Acec_InsertHadd( Gia_Man_t * pNew, int In[2], int Out[2] ) +{ + int And, Or; + Out[1] = Gia_ManAppendAnd2( pNew, In[0], In[1] ); + And = Gia_ManAppendAnd2( pNew, Abc_LitNot(In[0]), Abc_LitNot(In[1]) ); + Or = Gia_ManAppendOr2( pNew, Out[1], And ); + Out[0] = Abc_LitNot( Or ); +} +void Acec_InsertFadd( Gia_Man_t * pNew, int In[3], int Out[2] ) +{ + int In2[2], Out1[2], Out2[2]; + Acec_InsertHadd( pNew, In, Out1 ); + In2[0] = Out1[0]; + In2[1] = In[2]; + Acec_InsertHadd( pNew, In2, Out2 ); + Out[0] = Out2[0]; + Out[1] = Gia_ManAppendOr2( pNew, Out1[1], Out2[1] ); +} +Vec_Int_t * Acec_InsertTree( Gia_Man_t * pNew, Vec_Wec_t * vLeafMap ) +{ + Vec_Int_t * vRootRanks = Vec_IntAlloc( Vec_WecSize(vLeafMap) + 5 ); + Vec_Int_t * vLevel; + int i, In[3], Out[2]; + Vec_WecForEachLevel( vLeafMap, vLevel, i ) + { + if ( Vec_IntSize(vLevel) == 0 ) + { + Vec_IntPush( vRootRanks, 0 ); + continue; + } + while ( Vec_IntSize(vLevel) > 1 ) + { + if ( Vec_IntSize(vLevel) == 2 ) + Vec_IntPush( vLevel, 0 ); + //In[2] = Vec_IntPop( vLevel ); + //In[1] = Vec_IntPop( vLevel ); + //In[0] = Vec_IntPop( vLevel ); + + In[0] = Vec_IntEntry( vLevel, 0 ); + Vec_IntDrop( vLevel, 0 ); + + In[1] = Vec_IntEntry( vLevel, 0 ); + Vec_IntDrop( vLevel, 0 ); + + In[2] = Vec_IntEntry( vLevel, 0 ); + Vec_IntDrop( vLevel, 0 ); + + Acec_InsertFadd( pNew, In, Out ); + Vec_IntPush( vLevel, Out[0] ); + if ( i+1 < Vec_WecSize(vLeafMap) ) + vLevel = Vec_WecEntry(vLeafMap, i+1); + else + vLevel = Vec_WecPushLevel(vLeafMap); + Vec_IntPush( vLevel, Out[1] ); + vLevel = Vec_WecEntry(vLeafMap, i); + } + assert( Vec_IntSize(vLevel) == 1 ); + Vec_IntPush( vRootRanks, Vec_IntEntry(vLevel, 0) ); + } + return vRootRanks; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Acec_InsertBox_rec( Gia_Man_t * pNew, Gia_Man_t * p, Gia_Obj_t * pObj ) +{ + if ( ~pObj->Value ) + return pObj->Value; + assert( Gia_ObjIsAnd(pObj) ); + Acec_InsertBox_rec( pNew, p, Gia_ObjFanin0(pObj) ); + Acec_InsertBox_rec( pNew, p, Gia_ObjFanin1(pObj) ); + return (pObj->Value = Gia_ManAppendAnd2( pNew, Gia_ObjFanin0Copy(pObj), Gia_ObjFanin1Copy(pObj) )); +} +Vec_Int_t * Acec_BuildTree( Gia_Man_t * pNew, Gia_Man_t * p, Vec_Wec_t * vLeafLits, Vec_Int_t * vRootLits ) +{ + Vec_Wec_t * vLeafMap = Vec_WecStart( Vec_WecSize(vLeafLits) ); + Vec_Int_t * vLevel, * vRootRanks; + int i, k, iLit, iLitNew; + // add roo literals + if ( vRootLits ) + Vec_IntForEachEntry( vRootLits, iLit, i ) + { + if ( i < Vec_WecSize(vLeafMap) ) + vLevel = Vec_WecEntry(vLeafMap, i); + else + vLevel = Vec_WecPushLevel(vLeafMap); + Vec_IntPush( vLevel, iLit ); + } + // add other literals + Vec_WecForEachLevel( vLeafLits, vLevel, i ) + Vec_IntForEachEntry( vLevel, iLit, k ) + { + Gia_Obj_t * pObj = Gia_ManObj( p, Abc_Lit2Var(iLit) ); + iLitNew = Acec_InsertBox_rec( pNew, p, pObj ); + iLitNew = Abc_LitNotCond( iLitNew, Abc_LitIsCompl(iLit) ); + Vec_WecPush( vLeafMap, i, iLitNew ); + } + // construct map of root literals + vRootRanks = Acec_InsertTree( pNew, vLeafMap ); + Vec_WecFree( vLeafMap ); + return vRootRanks; +} +Gia_Man_t * Acec_InsertBox( Acec_Box_t * pBox, int fAll ) +{ + Gia_Man_t * p = pBox->pGia; + Gia_Man_t * pNew; + Gia_Obj_t * pObj; + Vec_Int_t * vRootRanks, * vLevel, * vTemp; + int i, k, iLit, iLitNew; + pNew = Gia_ManStart( Gia_ManObjNum(p) ); + pNew->pName = Abc_UtilStrsav( p->pName ); + pNew->pSpec = Abc_UtilStrsav( p->pSpec ); + Gia_ManFillValue(p); + Gia_ManConst0(p)->Value = 0; + Gia_ManForEachCi( p, pObj, i ) + pObj->Value = Gia_ManAppendCi( pNew ); + // implement tree + if ( fAll ) + vRootRanks = Acec_BuildTree( pNew, p, pBox->vLeafLits, NULL ); + else + { + assert( pBox->vShared != NULL ); + assert( pBox->vUnique != NULL ); + vRootRanks = Acec_BuildTree( pNew, p, pBox->vShared, NULL ); + vRootRanks = Acec_BuildTree( pNew, p, pBox->vUnique, vTemp = vRootRanks ); + Vec_IntFree( vTemp ); + } + // update polarity of literals + Vec_WecForEachLevel( pBox->vRootLits, vLevel, i ) + Vec_IntForEachEntry( vLevel, iLit, k ) + { + pObj = Gia_ManObj( p, Abc_Lit2Var(iLit) ); + iLitNew = k ? 0 : Vec_IntEntry( vRootRanks, i ); + pObj->Value = Abc_LitNotCond( iLitNew, Abc_LitIsCompl(iLit) ); + } + Vec_IntFree( vRootRanks ); + // construct the outputs + Gia_ManForEachCo( p, pObj, i ) + Acec_InsertBox_rec( pNew, p, Gia_ObjFanin0(pObj) ); + Gia_ManForEachCo( p, pObj, i ) + pObj->Value = Gia_ManAppendCo( pNew, Gia_ObjFanin0Copy(pObj) ); + Gia_ManSetRegNum( pNew, Gia_ManRegNum(p) ); + return pNew; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Gia_Man_t * Acec_Normalize( Gia_Man_t * pGia, int fBooth, int fVerbose ) +{ + Vec_Bit_t * vIgnore = fBooth ? Acec_BoothFindPPG( pGia ) : NULL; + Acec_Box_t * pBox = Acec_DeriveBox( pGia, vIgnore, 0, 0, fVerbose ); + Gia_Man_t * pNew = Acec_InsertBox( pBox, 1 ); + Acec_BoxFreeP( &pBox ); + Vec_BitFreeP( &vIgnore ); + return pNew; +} + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + diff --git a/src/proof/acec/acecPa.c b/src/proof/acec/acecPa.c index ecaf2047..6b382d91 100644 --- a/src/proof/acec/acecPa.c +++ b/src/proof/acec/acecPa.c @@ -248,11 +248,6 @@ int Pas_ManComputeCuts( Gia_Man_t * p, Vec_Int_t * vAdds, Vec_Int_t * vOrder, Ve ***********************************************************************/ void Pas_ManComputeCutsTest( Gia_Man_t * p ) { - extern Vec_Int_t * Ree_ManComputeCuts( Gia_Man_t * p, Vec_Int_t ** pvXors, int fVerbose ); - extern Vec_Int_t * Gia_PolynCoreOrder( Gia_Man_t * pGia, Vec_Int_t * vAdds, Vec_Int_t * vAddCos, Vec_Int_t ** pvIns, Vec_Int_t ** pvOuts ); - - extern int Ree_ManCountFadds( Vec_Int_t * vAdds ); - extern void Ree_ManPrintAdders( Vec_Int_t * vAdds, int fVerbose ); abctime clk = Abc_Clock(); Vec_Int_t * vAdds = Ree_ManComputeCuts( p, NULL, 1 ); Vec_Int_t * vIns, * vOuts; diff --git a/src/proof/acec/acecPool.c b/src/proof/acec/acecPool.c index 08ee37f2..0868545e 100644 --- a/src/proof/acec/acecPool.c +++ b/src/proof/acec/acecPool.c @@ -303,17 +303,9 @@ void Acec_ManPrintRanks( Vec_Int_t * vPairs ) ***********************************************************************/ void Acec_ManProfile( Gia_Man_t * p, int fVerbose ) { - extern Vec_Int_t * Ree_ManComputeCuts( Gia_Man_t * p, Vec_Int_t ** pvXors, int fVerbose ); - extern void Ree_ManRemoveTrivial( Gia_Man_t * p, Vec_Int_t * vAdds ); - extern void Ree_ManRemoveContained( Gia_Man_t * p, Vec_Int_t * vAdds ); - extern int Ree_ManCountFadds( Vec_Int_t * vAdds ); - extern void Ree_ManPrintAdders( Vec_Int_t * vAdds, int fVerbose ); - abctime clk = Abc_Clock(); Vec_Wec_t * vBoxes; int i; Vec_Int_t * vXors, * vAdds = Ree_ManComputeCuts( p, &vXors, fVerbose ); - Ree_ManRemoveTrivial( p, vAdds ); - Ree_ManRemoveContained( p, vAdds ); //Ree_ManPrintAdders( vAdds, 1 ); printf( "Detected %d full-adders and %d half-adders. Found %d XOR-cuts. ", Ree_ManCountFadds(vAdds), Vec_IntSize(vAdds)/6-Ree_ManCountFadds(vAdds), Vec_IntSize(vXors)/4 ); @@ -396,13 +388,6 @@ Vec_Int_t * Acec_ManPoolTopMost( Gia_Man_t * p, Vec_Int_t * vAdds ) } void Acec_ManPool( Gia_Man_t * p ) { - extern Vec_Int_t * Ree_ManComputeCuts( Gia_Man_t * p, Vec_Int_t ** pvXors, int fVerbose ); - extern Vec_Wec_t * Gia_PolynCoreOrderArray( Gia_Man_t * pGia, Vec_Int_t * vAdds, Vec_Int_t * vRootBoxes ); - - extern int Ree_ManCountFadds( Vec_Int_t * vAdds ); - extern void Ree_ManPrintAdders( Vec_Int_t * vAdds, int fVerbose ); - extern void Ree_ManRemoveTrivial( Gia_Man_t * p, Vec_Int_t * vAdds ); - extern void Ree_ManRemoveContained( Gia_Man_t * p, Vec_Int_t * vAdds ); Vec_Int_t * vTops, * vTree; Vec_Wec_t * vTrees; @@ -413,8 +398,6 @@ void Acec_ManPool( Gia_Man_t * p ) Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); clk = Abc_Clock(); - Ree_ManRemoveTrivial( p, vAdds ); - Ree_ManRemoveContained( p, vAdds ); nFadds = Ree_ManCountFadds( vAdds ); printf( "Detected %d FAs and %d HAs. ", nFadds, Vec_IntSize(vAdds)/6-nFadds ); Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); diff --git a/src/proof/acec/acecRe.c b/src/proof/acec/acecRe.c index 26faad00..5e5ca688 100644 --- a/src/proof/acec/acecRe.c +++ b/src/proof/acec/acecRe.c @@ -147,6 +147,7 @@ static inline int Ree_ManCutFind( int iObj, int * pCut ) } static inline int Ree_ManCutNotFind( int iObj1, int iObj2, int * pCut ) { + assert( pCut[0] == 3 ); if ( pCut[3] != iObj1 && pCut[3] != iObj2 ) return 0; if ( pCut[2] != iObj1 && pCut[2] != iObj2 ) return 1; if ( pCut[1] != iObj1 && pCut[1] != iObj2 ) return 2; @@ -162,13 +163,19 @@ static inline int Ree_ManCutTruthOne( int * pCut0, int * pCut ) Truth0 = fComp0 ? ~Truth0 : Truth0; if ( pCut0[0] == 2 ) { - int Truths[3][8] = { - { 0x00, 0x11, 0x22, 0x33, 0x44, 0x55, 0x66, 0x77 }, // {0,1,-} - { 0x00, 0x05, 0x0A, 0x0F, 0x50, 0x55, 0x5A, 0x5F }, // {0,-,1} - { 0x00, 0x03, 0x0C, 0x0F, 0x30, 0x33, 0x3C, 0x3F } // {-,0,1} - }; - int Truth = Truths[Ree_ManCutNotFind(pCut0[1], pCut0[2], pCut)][Truth0 & 0x7]; - return 0xFF & (fComp0 ? ~Truth : Truth); + if ( pCut[0] == 3 ) + { + int Truths[3][8] = { + { 0x00, 0x11, 0x22, 0x33, 0x44, 0x55, 0x66, 0x77 }, // {0,1,-} + { 0x00, 0x05, 0x0A, 0x0F, 0x50, 0x55, 0x5A, 0x5F }, // {0,-,1} + { 0x00, 0x03, 0x0C, 0x0F, 0x30, 0x33, 0x3C, 0x3F } // {-,0,1} + }; + int Truth = Truths[Ree_ManCutNotFind(pCut0[1], pCut0[2], pCut)][Truth0 & 0x7]; + return 0xFF & (fComp0 ? ~Truth : Truth); + } + assert( pCut[0] == 2 ); + assert( pCut[1] == pCut0[1] && pCut[2] == pCut0[2] ); + return pCut0[pCut0[0]+1]; } if ( pCut0[0] == 1 ) { @@ -236,10 +243,10 @@ int Ree_ObjComputeTruth( Gia_Man_t * p, int iObj, int * pCut ) SeeAlso [] ***********************************************************************/ -void Ree_ManCutPrint( int * pCut, int Count, word Truth ) +void Ree_ManCutPrint( int * pCut, int Count, word Truth, int iObj ) { int c; - printf( "%d : ", Count ); + printf( "%d : %d : ", Count, iObj ); for ( c = 1; c <= pCut[0]; c++ ) printf( "%3d ", pCut[c] ); for ( ; c <= 4; c++ ) @@ -290,7 +297,7 @@ void Ree_ManCutMerge( Gia_Man_t * p, int iObj, int * pList0, int * pList1, Vec_I Vec_IntPushThree( vData, iObj, Value, TruthC ); } if ( fVerbose ) - Ree_ManCutPrint( pCut, ++Count, TruthC ); + Ree_ManCutPrint( pCut, ++Count, TruthC, iObj ); } if ( !vXors ) return; @@ -370,7 +377,7 @@ Vec_Int_t * Ree_ManDeriveAdds( Hash_IntMan_t * p, Vec_Int_t * vData, int fVerbos Vec_IntForEachEntryDouble( vXorOne, iObj, Truth, j ) Vec_IntForEachEntryDouble( vMajOne, iObj2, Truth2, k ) { - int SignAnd[8] = {0x88, 0x44, 0x22, 0x11, 0xEE, 0xDD, 0xBB, 0x77}; + int SignAnd[8] = {0x88, 0x44, 0x22, 0x11, 0x77, 0xBB, 0xDD, 0xEE}; int SignMaj[8] = {0xE8, 0xD4, 0xB2, 0x71, 0x8E, 0x4D, 0x2B, 0x17}; int n, SignXor = (Truth == 0x99 || Truth == 0x69) << 3; for ( n = 0; n < 8; n++ ) @@ -390,8 +397,18 @@ Vec_Int_t * Ree_ManDeriveAdds( Hash_IntMan_t * p, Vec_Int_t * vData, int fVerbos Vec_WecFree( vMajMap ); return vAdds; } +int Ree_ManCompare( int * pCut0, int * pCut1 ) +{ + if ( pCut0[3] < pCut1[3] ) return -1; + if ( pCut0[3] > pCut1[3] ) return 1; + if ( pCut0[4] < pCut1[4] ) return -1; + if ( pCut0[4] > pCut1[4] ) return 1; + return 0; +} Vec_Int_t * Ree_ManComputeCuts( Gia_Man_t * p, Vec_Int_t ** pvXors, int fVerbose ) { + extern void Ree_ManRemoveTrivial( Gia_Man_t * p, Vec_Int_t * vAdds ); + extern void Ree_ManRemoveContained( Gia_Man_t * p, Vec_Int_t * vAdds ); Gia_Obj_t * pObj; int * pList0, * pList1, i, nCuts = 0; Hash_IntMan_t * pHash = Hash_IntManStart( 1000 ); @@ -425,11 +442,15 @@ Vec_Int_t * Ree_ManComputeCuts( Gia_Man_t * p, Vec_Int_t ** pvXors, int fVerbose Vec_IntFree( vTemp ); Vec_IntFree( vCuts ); vAdds = Ree_ManDeriveAdds( pHash, vData, fVerbose ); + qsort( Vec_IntArray(vAdds), Vec_IntSize(vAdds)/6, 24, (int (*)(const void *, const void *))Ree_ManCompare ); if ( fVerbose ) printf( "Adders = %d. Total cuts = %d. Hashed cuts = %d. Hashed/Adders = %.2f.\n", Vec_IntSize(vAdds)/6, Vec_IntSize(vData)/3, Hash_IntManEntryNum(pHash), 6.0*Hash_IntManEntryNum(pHash)/Vec_IntSize(vAdds) ); Vec_IntFree( vData ); Hash_IntManStop( pHash ); + Ree_ManRemoveTrivial( p, vAdds ); + Ree_ManRemoveContained( p, vAdds ); + //Ree_ManPrintAdders( vAdds, 1 ); return vAdds; } @@ -503,6 +524,10 @@ void Ree_ManRemoveTrivial( Gia_Man_t * p, Vec_Int_t * vAdds ) { pObjX = Gia_ManObj( p, Vec_IntEntry(vAdds, 6*i+3) ); pObjM = Gia_ManObj( p, Vec_IntEntry(vAdds, 6*i+4) ); + // rule out if MAJ is a fanout of XOR + //if ( pObjX == Gia_ObjFanin0(pObjM) || pObjX == Gia_ObjFanin1(pObjM) ) + // continue; + // rule out if MAJ is a fanin of XOR and has no other fanouts if ( (pObjM == Gia_ObjFanin0(pObjX) || pObjM == Gia_ObjFanin1(pObjX)) && Gia_ObjRefNum(p, pObjM) == 1 ) continue; } diff --git a/src/proof/acec/acecSt.c b/src/proof/acec/acecSt.c index 63aa8131..d97dadc9 100644 --- a/src/proof/acec/acecSt.c +++ b/src/proof/acec/acecSt.c @@ -21,6 +21,8 @@ #include "acecInt.h" #include "misc/vec/vecWec.h" #include "misc/extra/extra.h" +#include "aig/aig/aig.h" +#include "opt/dar/dar.h" ABC_NAMESPACE_IMPL_START diff --git a/src/proof/acec/acecTree.c b/src/proof/acec/acecTree.c new file mode 100644 index 00000000..2461c89b --- /dev/null +++ b/src/proof/acec/acecTree.c @@ -0,0 +1,754 @@ +/**CFile**************************************************************** + + FileName [acecTree.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [CEC for arithmetic circuits.] + + Synopsis [Adder tree construction.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 20, 2005.] + + Revision [$Id: acecTree.c,v 1.00 2005/06/20 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include "acecInt.h" + +ABC_NAMESPACE_IMPL_START + + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +static inline int Acec_SignBit( Vec_Int_t * vAdds, int iBox, int b ) { return (Vec_IntEntry(vAdds, 6*iBox+5) >> b) & 1; } +static inline int Acec_SignBit2( Vec_Int_t * vAdds, int iBox, int b ) { return (Vec_IntEntry(vAdds, 6*iBox+5) >> (16+b)) & 1; } + +static inline void Acec_SignSetBit( Vec_Int_t * vAdds, int iBox, int b, int v ) { if ( v ) *Vec_IntEntryP(vAdds, 6*iBox+5) |= (1 << b); } +static inline void Acec_SignSetBit2( Vec_Int_t * vAdds, int iBox, int b, int v ) { if ( v ) *Vec_IntEntryP(vAdds, 6*iBox+5) |= (1 << (16+b)); } + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Acec_BoxFree( Acec_Box_t * pBox ) +{ + Vec_WecFreeP( &pBox->vAdds ); + Vec_WecFreeP( &pBox->vLeafLits ); + Vec_WecFreeP( &pBox->vRootLits ); + Vec_WecFreeP( &pBox->vUnique ); + Vec_WecFreeP( &pBox->vShared ); + ABC_FREE( pBox ); +} +void Acec_BoxFreeP( Acec_Box_t ** ppBox ) +{ + if ( *ppBox ) + Acec_BoxFree( *ppBox ); + *ppBox = NULL; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Acec_VerifyBoxLeaves( Acec_Box_t * pBox, Vec_Bit_t * vIgnore ) +{ + Vec_Int_t * vLevel; + int i, k, iLit, Count = 0; + if ( vIgnore == NULL ) + return; + Vec_WecForEachLevel( pBox->vLeafLits, vLevel, i ) + Vec_IntForEachEntry( vLevel, iLit, k ) + if ( Gia_ObjIsAnd(Gia_ManObj(pBox->pGia, Abc_Lit2Var(iLit))) && !Vec_BitEntry(vIgnore, Abc_Lit2Var(iLit)) ) + printf( "Internal node %d of rank %d is not part of PPG.\n", Abc_Lit2Var(iLit), i ), Count++; + printf( "Detected %d suspicious leaves.\n", Count ); +} + +/**Function************************************************************* + + Synopsis [Filters trees by removing TFO of roots.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Acec_TreeFilterOne( Gia_Man_t * p, Vec_Int_t * vAdds, Vec_Int_t * vTree ) +{ + Vec_Bit_t * vIsRoot = Vec_BitStart( Gia_ManObjNum(p) ); + Vec_Bit_t * vMarked = Vec_BitStart( Gia_ManObjNum(p) ) ; + Gia_Obj_t * pObj; + int i, k = 0, Box, Rank; + // mark roots + Vec_IntForEachEntryDouble( vTree, Box, Rank, i ) + { + Vec_BitWriteEntry( vIsRoot, Vec_IntEntry(vAdds, 6*Box+3), 1 ); + Vec_BitWriteEntry( vIsRoot, Vec_IntEntry(vAdds, 6*Box+4), 1 ); + } + Vec_IntForEachEntryDouble( vTree, Box, Rank, i ) + { + Vec_BitWriteEntry( vIsRoot, Vec_IntEntry(vAdds, 6*Box+0), 0 ); + Vec_BitWriteEntry( vIsRoot, Vec_IntEntry(vAdds, 6*Box+1), 0 ); + Vec_BitWriteEntry( vIsRoot, Vec_IntEntry(vAdds, 6*Box+2), 0 ); + } + // iterate through nodes to detect TFO of roots + Gia_ManForEachAnd( p, pObj, i ) + { + if ( Vec_BitEntry(vIsRoot, Gia_ObjFaninId0(pObj,i)) || Vec_BitEntry(vIsRoot, Gia_ObjFaninId1(pObj,i)) || + Vec_BitEntry(vMarked, Gia_ObjFaninId0(pObj,i)) || Vec_BitEntry(vMarked, Gia_ObjFaninId1(pObj,i)) ) + Vec_BitWriteEntry( vMarked, i, 1 ); + } + // remove those that overlap with roots + Vec_IntForEachEntryDouble( vTree, Box, Rank, i ) + { + // special case of the first bit +// if ( i == 0 ) +// continue; + +/* + if ( Vec_IntEntry(vAdds, 6*Box+3) == 24 && Vec_IntEntry(vAdds, 6*Box+4) == 22 ) + { + printf( "**** removing special one \n" ); + continue; + } + if ( Vec_IntEntry(vAdds, 6*Box+3) == 48 && Vec_IntEntry(vAdds, 6*Box+4) == 49 ) + { + printf( "**** removing special one \n" ); + continue; + } +*/ + if ( Vec_BitEntry(vMarked, Vec_IntEntry(vAdds, 6*Box+3)) || Vec_BitEntry(vMarked, Vec_IntEntry(vAdds, 6*Box+4)) ) + { + printf( "Removing box %d=(%d,%d) of rank %d.\n", Box, Vec_IntEntry(vAdds, 6*Box+3), Vec_IntEntry(vAdds, 6*Box+4), Rank ); + continue; + } + Vec_IntWriteEntry( vTree, k++, Box ); + Vec_IntWriteEntry( vTree, k++, Rank ); + } + Vec_IntShrink( vTree, k ); + Vec_BitFree( vIsRoot ); + Vec_BitFree( vMarked ); +} +void Acec_TreeFilterTrees( Gia_Man_t * p, Vec_Int_t * vAdds, Vec_Wec_t * vTrees ) +{ + Vec_Int_t * vLevel; + int i; + Vec_WecForEachLevel( vTrees, vLevel, i ) + Acec_TreeFilterOne( p, vAdds, vLevel ); +} + +/**Function************************************************************* + + Synopsis [Filters trees by removing TFO of roots.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Acec_TreeMarkTFI_rec( Gia_Man_t * p, int Id, Vec_Bit_t * vMarked ) +{ + Gia_Obj_t * pObj = Gia_ManObj(p, Id); + if ( Vec_BitEntry(vMarked, Id) ) + return; + Vec_BitWriteEntry( vMarked, Id, 1 ); + if ( !Gia_ObjIsAnd(pObj) ) + return; + Acec_TreeMarkTFI_rec( p, Gia_ObjFaninId0(pObj, Id), vMarked ); + Acec_TreeMarkTFI_rec( p, Gia_ObjFaninId1(pObj, Id), vMarked ); +} +void Acec_TreeFilterOne2( Gia_Man_t * p, Vec_Int_t * vAdds, Vec_Int_t * vTree ) +{ + Vec_Bit_t * vIsLeaf = Vec_BitStart( Gia_ManObjNum(p) ); + Vec_Bit_t * vMarked = Vec_BitStart( Gia_ManObjNum(p) ) ; + Gia_Obj_t * pObj; + int i, k = 0, Box, Rank; + // mark leaves + Vec_IntForEachEntryDouble( vTree, Box, Rank, i ) + { + Vec_BitWriteEntry( vIsLeaf, Vec_IntEntry(vAdds, 6*Box+0), 1 ); + Vec_BitWriteEntry( vIsLeaf, Vec_IntEntry(vAdds, 6*Box+1), 1 ); + Vec_BitWriteEntry( vIsLeaf, Vec_IntEntry(vAdds, 6*Box+2), 1 ); + } + Vec_IntForEachEntryDouble( vTree, Box, Rank, i ) + { + Vec_BitWriteEntry( vIsLeaf, Vec_IntEntry(vAdds, 6*Box+3), 0 ); + Vec_BitWriteEntry( vIsLeaf, Vec_IntEntry(vAdds, 6*Box+4), 0 ); + } + // mark TFI of leaves + Gia_ManForEachAnd( p, pObj, i ) + if ( Vec_BitEntry(vIsLeaf, i) ) + Acec_TreeMarkTFI_rec( p, i, vMarked ); + // additional one +//if ( 10942 < Gia_ManObjNum(p) ) +// Acec_TreeMarkTFI_rec( p, 10942, vMarked ); + // remove those that overlap with the marked TFI + Vec_IntForEachEntryDouble( vTree, Box, Rank, i ) + { + if ( Vec_BitEntry(vMarked, Vec_IntEntry(vAdds, 6*Box+3)) || Vec_BitEntry(vMarked, Vec_IntEntry(vAdds, 6*Box+4)) ) + { + printf( "Removing box %d=(%d,%d) of rank %d.\n", Box, Vec_IntEntry(vAdds, 6*Box+3), Vec_IntEntry(vAdds, 6*Box+4), Rank ); + continue; + } + Vec_IntWriteEntry( vTree, k++, Box ); + Vec_IntWriteEntry( vTree, k++, Rank ); + } + Vec_IntShrink( vTree, k ); + Vec_BitFree( vIsLeaf ); + Vec_BitFree( vMarked ); +} +void Acec_TreeFilterTrees2( Gia_Man_t * p, Vec_Int_t * vAdds, Vec_Wec_t * vTrees ) +{ + Vec_Int_t * vLevel; + int i; + Vec_WecForEachLevel( vTrees, vLevel, i ) + Acec_TreeFilterOne2( p, vAdds, vLevel ); +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Acec_TreeVerifyPhaseOne_rec( Gia_Man_t * p, Gia_Obj_t * pObj ) +{ + int Truth0, Truth1; + if ( Gia_ObjIsTravIdCurrent(p, pObj) ) + return pObj->Value; + Gia_ObjSetTravIdCurrent(p, pObj); + assert( Gia_ObjIsAnd(pObj) ); + assert( !Gia_ObjIsXor(pObj) ); + Truth0 = Acec_TreeVerifyPhaseOne_rec( p, Gia_ObjFanin0(pObj) ); + Truth1 = Acec_TreeVerifyPhaseOne_rec( p, Gia_ObjFanin1(pObj) ); + Truth0 = Gia_ObjFaninC0(pObj) ? 0xFF & ~Truth0 : Truth0; + Truth1 = Gia_ObjFaninC1(pObj) ? 0xFF & ~Truth1 : Truth1; + return (pObj->Value = Truth0 & Truth1); +} +void Acec_TreeVerifyPhaseOne( Gia_Man_t * p, Vec_Int_t * vAdds, int iBox ) +{ + Gia_Obj_t * pObj; + unsigned TruthXor, TruthMaj, Truths[3] = { 0xAA, 0xCC, 0xF0 }; + int k, iObj, fFadd = Vec_IntEntry(vAdds, 6*iBox+2) > 0; + int fFlip = !fFadd && Acec_SignBit2(vAdds, iBox, 2); + + Gia_ManIncrementTravId( p ); + for ( k = 0; k < 3; k++ ) + { + iObj = Vec_IntEntry( vAdds, 6*iBox+k ); + if ( iObj == 0 ) + continue; + pObj = Gia_ManObj( p, iObj ); + pObj->Value = (Acec_SignBit2(vAdds, iBox, k) ^ fFlip) ? 0xFF & ~Truths[k] : Truths[k]; + Gia_ObjSetTravIdCurrent( p, pObj ); + } + + iObj = Vec_IntEntry( vAdds, 6*iBox+3 ); + TruthXor = Acec_TreeVerifyPhaseOne_rec( p, Gia_ManObj(p, iObj) ); + TruthXor = (Acec_SignBit2(vAdds, iBox, 3) ^ fFlip) ? 0xFF & ~TruthXor : TruthXor; + + iObj = Vec_IntEntry( vAdds, 6*iBox+4 ); + TruthMaj = Acec_TreeVerifyPhaseOne_rec( p, Gia_ManObj(p, iObj) ); + TruthMaj = (Acec_SignBit2(vAdds, iBox, 4) ^ fFlip) ? 0xFF & ~TruthMaj : TruthMaj; + + if ( fFadd ) // FADD + { + if ( TruthXor != 0x96 ) + printf( "Fadd %d sum %d is wrong.\n", iBox, Vec_IntEntry( vAdds, 6*iBox+3 ) ); + if ( TruthMaj != 0xE8 ) + printf( "Fadd %d carry %d is wrong.\n", iBox, Vec_IntEntry( vAdds, 6*iBox+4 ) ); + } + else + { + //printf( "Sign1 = %d%d%d %d\n", Acec_SignBit(vAdds, iBox, 0), Acec_SignBit(vAdds, iBox, 1), Acec_SignBit(vAdds, iBox, 2), Acec_SignBit(vAdds, iBox, 3) ); + //printf( "Sign2 = %d%d%d %d%d\n", Acec_SignBit2(vAdds, iBox, 0), Acec_SignBit2(vAdds, iBox, 1), Acec_SignBit2(vAdds, iBox, 2), Acec_SignBit2(vAdds, iBox, 3), Acec_SignBit2(vAdds, iBox, 4) ); + if ( TruthXor != 0x66 ) + printf( "Hadd %d sum %d is wrong.\n", iBox, Vec_IntEntry( vAdds, 6*iBox+3 ) ); + if ( TruthMaj != 0x88 ) + printf( "Hadd %d carry %d is wrong.\n", iBox, Vec_IntEntry( vAdds, 6*iBox+4 ) ); + } +} +void Acec_TreeVerifyPhases( Gia_Man_t * p, Vec_Int_t * vAdds, Vec_Wec_t * vBoxes ) +{ + Vec_Int_t * vLevel; + int i, k, Box; + Vec_WecForEachLevel( vBoxes, vLevel, i ) + Vec_IntForEachEntry( vLevel, Box, k ) + Acec_TreeVerifyPhaseOne( p, vAdds, Box ); +} +void Acec_TreeVerifyPhases2( Gia_Man_t * p, Vec_Int_t * vAdds, Vec_Wec_t * vBoxes ) +{ + Vec_Bit_t * vPhase = Vec_BitStart( Gia_ManObjNum(p) ); + Vec_Bit_t * vRoots = Vec_BitStart( Gia_ManObjNum(p) ); + Vec_Int_t * vLevel; + int i, k, n, Box; + // mark all output points and their values + Vec_WecForEachLevel( vBoxes, vLevel, i ) + Vec_IntForEachEntry( vLevel, Box, k ) + { + Vec_BitWriteEntry( vRoots, Vec_IntEntry( vAdds, 6*Box+3 ), 1 ); + Vec_BitWriteEntry( vRoots, Vec_IntEntry( vAdds, 6*Box+4 ), 1 ); + Vec_BitWriteEntry( vPhase, Vec_IntEntry( vAdds, 6*Box+3 ), Acec_SignBit2(vAdds, Box, 3) ); + Vec_BitWriteEntry( vPhase, Vec_IntEntry( vAdds, 6*Box+4 ), Acec_SignBit2(vAdds, Box, 4) ); + } + // compare with input points + Vec_WecForEachLevel( vBoxes, vLevel, i ) + Vec_IntForEachEntry( vLevel, Box, k ) + for ( n = 0; n < 3; n++ ) + { + if ( !Vec_BitEntry(vRoots, Vec_IntEntry(vAdds, 6*Box+n)) ) + continue; + if ( Vec_BitEntry(vPhase, Vec_IntEntry(vAdds, 6*Box+n)) == Acec_SignBit2(vAdds, Box, n) ) + continue; + printf( "Phase of input %d=%d is mismatched in box %d=(%d,%d).\n", + n, Vec_IntEntry(vAdds, 6*Box+n), Box, Vec_IntEntry(vAdds, 6*Box+3), Vec_IntEntry(vAdds, 6*Box+4) ); + } + Vec_BitFree( vPhase ); + Vec_BitFree( vRoots ); +} + +/**Function************************************************************* + + Synopsis [Creates polarity.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Vec_Int_t * Acec_TreeCarryMap( Gia_Man_t * p, Vec_Int_t * vAdds, Vec_Wec_t * vBoxes ) +{ + Vec_Int_t * vMap = Vec_IntStartFull( Gia_ManObjNum(p) ); + Vec_Int_t * vLevel; + int i, k, Box; + Vec_WecForEachLevel( vBoxes, vLevel, i ) + Vec_IntForEachEntry( vLevel, Box, k ) + Vec_IntWriteEntry( vMap, Vec_IntEntry(vAdds, 6*Box+4), Box ); + return vMap; +} +void Acec_TreePhases_rec( Gia_Man_t * p, Vec_Int_t * vAdds, Vec_Int_t * vMap, int Node, int fPhase, Vec_Bit_t * vVisit ) +{ + int k, iBox, iXor, fXorPhase, fPhaseThis; + assert( Node != 0 ); + iBox = Vec_IntEntry( vMap, Node ); + if ( iBox == -1 ) + return; + assert( Node == Vec_IntEntry( vAdds, 6*iBox+4 ) ); + if ( Vec_BitEntry(vVisit, iBox) ) + return; + Vec_BitWriteEntry( vVisit, iBox, 1 ); + iXor = Vec_IntEntry( vAdds, 6*iBox+3 ); + fXorPhase = Acec_SignBit(vAdds, iBox, 3); + if ( Vec_IntEntry(vAdds, 6*iBox+2) == 0 ) + { + //fPhaseThis = Acec_SignBit( vAdds, iBox, 2 ) ^ fPhase; + //fXorPhase ^= fPhaseThis; + //Acec_SignSetBit2( vAdds, iBox, 2, fPhaseThis ); // complemented HADD -- create const1 input + fPhase ^= Acec_SignBit( vAdds, iBox, 2 ); + fXorPhase ^= fPhase; + Acec_SignSetBit2( vAdds, iBox, 2, fPhase ); // complemented HADD -- create const1 input + } + for ( k = 0; k < 3; k++ ) + { + int iObj = Vec_IntEntry( vAdds, 6*iBox+k ); + if ( iObj == 0 ) + continue; + fPhaseThis = Acec_SignBit(vAdds, iBox, k) ^ fPhase; + fXorPhase ^= fPhaseThis; + Acec_TreePhases_rec( p, vAdds, vMap, iObj, fPhaseThis, vVisit ); + Acec_SignSetBit2( vAdds, iBox, k, fPhaseThis ); + } + Acec_SignSetBit2( vAdds, iBox, 3, fXorPhase ); + Acec_SignSetBit2( vAdds, iBox, 4, fPhase ); +} + +/**Function************************************************************* + + Synopsis [Find internal cut points with exactly one adder fanin/fanout.] + + Description [Returns a map of point into its input/output adder.] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Acec_TreeAddInOutPoint( Vec_Int_t * vMap, int iObj, int iAdd, int fOut ) +{ + int * pPlace = Vec_IntEntryP( vMap, Abc_Var2Lit(iObj, fOut) ); + if ( *pPlace == -1 ) + *pPlace = iAdd; + else if ( *pPlace >= 0 ) + *pPlace = -2; +} +Vec_Int_t * Acec_TreeFindPoints( Gia_Man_t * p, Vec_Int_t * vAdds, Vec_Bit_t * vIgnore ) +{ + Vec_Int_t * vMap = Vec_IntStartFull( 2*Gia_ManObjNum(p) ); + int i; + for ( i = 0; 6*i < Vec_IntSize(vAdds); i++ ) + { + if ( vIgnore && (Vec_BitEntry(vIgnore, Vec_IntEntry(vAdds, 6*i+3)) || Vec_BitEntry(vIgnore, Vec_IntEntry(vAdds, 6*i+4))) ) + continue; + Acec_TreeAddInOutPoint( vMap, Vec_IntEntry(vAdds, 6*i+0), i, 0 ); + Acec_TreeAddInOutPoint( vMap, Vec_IntEntry(vAdds, 6*i+1), i, 0 ); + Acec_TreeAddInOutPoint( vMap, Vec_IntEntry(vAdds, 6*i+2), i, 0 ); + Acec_TreeAddInOutPoint( vMap, Vec_IntEntry(vAdds, 6*i+3), i, 1 ); + Acec_TreeAddInOutPoint( vMap, Vec_IntEntry(vAdds, 6*i+4), i, 1 ); + } + return vMap; +} + +/**Function************************************************************* + + Synopsis [Find adder trees as groups of adders connected vis cut-points.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Acec_TreeWhichPoint( Vec_Int_t * vAdds, int iAdd, int iObj ) +{ + int k; + for ( k = 0; k < 5; k++ ) + if ( Vec_IntEntry(vAdds, 6*iAdd+k) == iObj ) + return k; + assert( 0 ); + return -1; +} +void Acec_TreeFindTrees2_rec( Vec_Int_t * vAdds, Vec_Int_t * vMap, int iAdd, int Rank, Vec_Int_t * vTree, Vec_Bit_t * vFound ) +{ + extern void Acec_TreeFindTrees_rec( Vec_Int_t * vAdds, Vec_Int_t * vMap, int iObj, int Rank, Vec_Int_t * vTree, Vec_Bit_t * vFound ); + int k; + if ( Vec_BitEntry(vFound, iAdd) ) + return; + Vec_BitWriteEntry( vFound, iAdd, 1 ); + Vec_IntPush( vTree, iAdd ); + Vec_IntPush( vTree, Rank ); + //printf( "Assigning rank %d to (%d:%d).\n", Rank, Vec_IntEntry(vAdds, 6*iAdd+3), Vec_IntEntry(vAdds, 6*iAdd+4) ); + for ( k = 0; k < 5; k++ ) + Acec_TreeFindTrees_rec( vAdds, vMap, Vec_IntEntry(vAdds, 6*iAdd+k), k == 4 ? Rank + 1 : Rank, vTree, vFound ); +} +void Acec_TreeFindTrees_rec( Vec_Int_t * vAdds, Vec_Int_t * vMap, int iObj, int Rank, Vec_Int_t * vTree, Vec_Bit_t * vFound ) +{ + int In = Vec_IntEntry( vMap, Abc_Var2Lit(iObj, 1) ); + int Out = Vec_IntEntry( vMap, Abc_Var2Lit(iObj, 0) ); + if ( In < 0 || Out < 0 ) + return; + Acec_TreeFindTrees2_rec( vAdds, vMap, In, Acec_TreeWhichPoint(vAdds, In, iObj) == 4 ? Rank-1 : Rank, vTree, vFound ); + Acec_TreeFindTrees2_rec( vAdds, vMap, Out, Rank, vTree, vFound ); +} +Vec_Wec_t * Acec_TreeFindTrees( Gia_Man_t * p, Vec_Int_t * vAdds, Vec_Bit_t * vIgnore, int fFilterIn, int fFilterOut ) +{ + Vec_Wec_t * vTrees = Vec_WecAlloc( 10 ); + Vec_Int_t * vMap = Acec_TreeFindPoints( p, vAdds, vIgnore ); + Vec_Bit_t * vFound = Vec_BitStart( Vec_IntSize(vAdds)/6 ); + Vec_Int_t * vTree; + int i, k, In, Out, Box, Rank, MinRank; + // go through the cut-points + Vec_IntForEachEntryDouble( vMap, In, Out, i ) + { + if ( In < 0 || Out < 0 ) + continue; + assert( Vec_BitEntry(vFound, In) == Vec_BitEntry(vFound, Out) ); + if ( Vec_BitEntry(vFound, In) ) + continue; + vTree = Vec_WecPushLevel( vTrees ); + Acec_TreeFindTrees_rec( vAdds, vMap, i/2, 0, vTree, vFound ); + // normalize rank + MinRank = ABC_INFINITY; + Vec_IntForEachEntryDouble( vTree, Box, Rank, k ) + MinRank = Abc_MinInt( MinRank, Rank ); + Vec_IntForEachEntryDouble( vTree, Box, Rank, k ) + Vec_IntWriteEntry( vTree, k+1, Rank - MinRank ); + } + Vec_BitFree( vFound ); + Vec_IntFree( vMap ); + // filter trees + if ( fFilterIn ) + Acec_TreeFilterTrees2( p, vAdds, vTrees ); + else if ( fFilterOut ) + Acec_TreeFilterTrees( p, vAdds, vTrees ); + // sort by size + Vec_WecSort( vTrees, 1 ); + return vTrees; +} +void Acec_TreeFindTreesTest( Gia_Man_t * p ) +{ + Vec_Wec_t * vTrees; + + abctime clk = Abc_Clock(); + Vec_Int_t * vAdds = Ree_ManComputeCuts( p, NULL, 1 ); + int nFadds = Ree_ManCountFadds( vAdds ); + printf( "Detected %d adders (%d FAs and %d HAs). ", Vec_IntSize(vAdds)/6, nFadds, Vec_IntSize(vAdds)/6-nFadds ); + Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); + + clk = Abc_Clock(); + vTrees = Acec_TreeFindTrees( p, vAdds, NULL, 0, 0 ); + printf( "Collected %d trees with %d adders in them. ", Vec_WecSize(vTrees), Vec_WecSizeSize(vTrees)/2 ); + Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); + Vec_WecPrint( vTrees, 0 ); + + Vec_WecFree( vTrees ); + Vec_IntFree( vAdds ); +} + + +/**Function************************************************************* + + Synopsis [Derives one adder tree.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Acec_PrintAdders( Vec_Wec_t * vBoxes, Vec_Int_t * vAdds ) +{ + Vec_Int_t * vLevel; + int i, k, iBox; + Vec_WecForEachLevel( vBoxes, vLevel, i ) + { + printf( " %4d : %2d {", i, Vec_IntSize(vLevel) ); + Vec_IntForEachEntry( vLevel, iBox, k ) + { + printf( " %s%d=(%d,%d)", Vec_IntEntry(vAdds, 6*iBox+2) == 0 ? "*":"", iBox, + Vec_IntEntry(vAdds, 6*iBox+3), Vec_IntEntry(vAdds, 6*iBox+4) ); + //printf( "(%d,%d,%d)", Vec_IntEntry(vAdds, 6*iBox+0), Vec_IntEntry(vAdds, 6*iBox+1), Vec_IntEntry(vAdds, 6*iBox+2) ); + } + printf( " }\n" ); + } +} +void Acec_PrintBox( Acec_Box_t * pBox, Vec_Int_t * vAdds ) +{ + printf( "Adders:\n" ); + Acec_PrintAdders( pBox->vAdds, vAdds ); + printf( "Inputs:\n" ); + Vec_WecPrintLits( pBox->vLeafLits ); + printf( "Outputs:\n" ); + Vec_WecPrintLits( pBox->vRootLits ); +} + +int Acec_CreateBoxMaxRank( Vec_Int_t * vTree ) +{ + int k, Box, Rank, MaxRank = 0; + Vec_IntForEachEntryDouble( vTree, Box, Rank, k ) + MaxRank = Abc_MaxInt( MaxRank, Rank ); + return MaxRank; +} +Acec_Box_t * Acec_CreateBox( Gia_Man_t * p, Vec_Int_t * vAdds, Vec_Int_t * vTree ) +{ + int MaxRank = Acec_CreateBoxMaxRank(vTree); + Vec_Bit_t * vVisit = Vec_BitStart( Vec_IntSize(vAdds)/6 ); + Vec_Bit_t * vIsLeaf = Vec_BitStart( Gia_ManObjNum(p) ); + Vec_Bit_t * vIsRoot = Vec_BitStart( Gia_ManObjNum(p) ); + Vec_Int_t * vLevel, * vMap; + int i, j, k, Box, Rank;//, Count = 0; + + Acec_Box_t * pBox = ABC_CALLOC( Acec_Box_t, 1 ); + pBox->pGia = p; + pBox->vAdds = Vec_WecStart( MaxRank + 1 ); + pBox->vLeafLits = Vec_WecStart( MaxRank + 1 ); + pBox->vRootLits = Vec_WecStart( MaxRank + 2 ); + + // collect boxes; mark inputs/outputs + Vec_IntForEachEntryDouble( vTree, Box, Rank, i ) + { +// if ( 37 == Box && 6 == Rank ) +// { +// printf( "Skipping one adder...\n" ); +// continue; +// } + Vec_BitWriteEntry( vIsLeaf, Vec_IntEntry(vAdds, 6*Box+0), 1 ); + Vec_BitWriteEntry( vIsLeaf, Vec_IntEntry(vAdds, 6*Box+1), 1 ); + Vec_BitWriteEntry( vIsLeaf, Vec_IntEntry(vAdds, 6*Box+2), 1 ); + Vec_BitWriteEntry( vIsRoot, Vec_IntEntry(vAdds, 6*Box+3), 1 ); + Vec_BitWriteEntry( vIsRoot, Vec_IntEntry(vAdds, 6*Box+4), 1 ); + Vec_WecPush( pBox->vAdds, Rank, Box ); + } + // sort each level + Vec_WecForEachLevel( pBox->vAdds, vLevel, i ) + Vec_IntSort( vLevel, 0 ); + + // set phases starting from roots + vMap = Acec_TreeCarryMap( p, vAdds, pBox->vAdds ); + Vec_WecForEachLevelReverse( pBox->vAdds, vLevel, i ) + Vec_IntForEachEntry( vLevel, Box, k ) + if ( !Vec_BitEntry( vIsLeaf, Vec_IntEntry(vAdds, 6*Box+4) ) ) + { + //printf( "Pushing phase of output %d of box %d\n", Vec_IntEntry(vAdds, 6*Box+4), Box ); + Acec_TreePhases_rec( p, vAdds, vMap, Vec_IntEntry(vAdds, 6*Box+4), Vec_IntEntry(vAdds, 6*Box+2) != 0, vVisit ); + } + Acec_TreeVerifyPhases( p, vAdds, pBox->vAdds ); + Acec_TreeVerifyPhases2( p, vAdds, pBox->vAdds ); + Vec_BitFree( vVisit ); + Vec_IntFree( vMap ); + + // collect inputs/outputs + Vec_BitWriteEntry( vIsRoot, 0, 1 ); + Vec_WecForEachLevel( pBox->vAdds, vLevel, i ) + Vec_IntForEachEntry( vLevel, Box, j ) + { + for ( k = 0; k < 3; k++ ) + if ( !Vec_BitEntry( vIsRoot, Vec_IntEntry(vAdds, 6*Box+k) ) ) + Vec_WecPush( pBox->vLeafLits, i, Abc_Var2Lit(Vec_IntEntry(vAdds, 6*Box+k), Acec_SignBit2(vAdds, Box, k)) ); + for ( k = 3; k < 5; k++ ) + if ( !Vec_BitEntry( vIsLeaf, Vec_IntEntry(vAdds, 6*Box+k) ) ) + { + //if ( Vec_IntEntry(vAdds, 6*Box+k) == 10942 ) + //{ + // printf( "++++++++++++ Skipping special\n" ); + // continue; + //} + Vec_WecPush( pBox->vRootLits, k == 4 ? i + 1 : i, Abc_Var2Lit(Vec_IntEntry(vAdds, 6*Box+k), Acec_SignBit2(vAdds, Box, k)) ); + } + if ( Vec_IntEntry(vAdds, 6*Box+2) == 0 && Acec_SignBit2(vAdds, Box, 2) ) + Vec_WecPush( pBox->vLeafLits, i, 1 ); + } + Vec_BitFree( vIsLeaf ); + Vec_BitFree( vIsRoot ); + // sort each level + Vec_WecForEachLevel( pBox->vLeafLits, vLevel, i ) + Vec_IntSort( vLevel, 0 ); + Vec_WecForEachLevel( pBox->vRootLits, vLevel, i ) + Vec_IntSort( vLevel, 1 ); + //return pBox; +/* + // push literals forward + //Vec_WecPrint( pBox->vLeafLits, 0 ); + Vec_WecForEachLevel( pBox->vLeafLits, vLevel, i ) + { + int This, Prev = Vec_IntEntry(vLevel, 0); + Vec_IntForEachEntryStart( vLevel, This, j, 1 ) + { + if ( Prev != This ) + { + Prev = This; + continue; + } + if ( i+1 >= Vec_WecSize(pBox->vLeafLits) ) + continue; + Vec_IntPushOrder( Vec_WecEntry(pBox->vLeafLits, i+1), This ); + Vec_IntDrop( vLevel, j-- ); + Vec_IntDrop( vLevel, j-- ); + Prev = -1; + Count++; + } + } + printf( "Pushed forward %d input literals.\n", Count ); +*/ + //Vec_WecPrint( pBox->vLeafLits, 0 ); + return pBox; +} +void Acec_CreateBoxTest( Gia_Man_t * p ) +{ + Acec_Box_t * pBox; + Vec_Wec_t * vTrees; + Vec_Int_t * vTree; + + abctime clk = Abc_Clock(); + Vec_Int_t * vAdds = Ree_ManComputeCuts( p, NULL, 1 ); + int i, nFadds = Ree_ManCountFadds( vAdds ); + printf( "Detected %d adders (%d FAs and %d HAs). ", Vec_IntSize(vAdds)/6, nFadds, Vec_IntSize(vAdds)/6-nFadds ); + Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); + + clk = Abc_Clock(); + vTrees = Acec_TreeFindTrees( p, vAdds, NULL, 0, 0 ); + printf( "Collected %d trees with %d adders in them. ", Vec_WecSize(vTrees), Vec_WecSizeSize(vTrees)/2 ); + Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); + //Vec_WecPrint( vTrees, 0 ); + + Vec_WecForEachLevel( vTrees, vTree, i ) + { + pBox = Acec_CreateBox( p, vAdds, Vec_WecEntry(vTrees, i) ); + printf( "Processing tree %d: Ranks = %d. Adders = %d. Leaves = %d. Roots = %d.\n", + i, Vec_WecSize(pBox->vAdds), Vec_WecSizeSize(pBox->vAdds), + Vec_WecSizeSize(pBox->vLeafLits), Vec_WecSizeSize(pBox->vRootLits) ); + Acec_PrintBox( pBox, vAdds ); + Acec_BoxFreeP( &pBox ); + } + + Vec_WecFree( vTrees ); + Vec_IntFree( vAdds ); +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Acec_Box_t * Acec_DeriveBox( Gia_Man_t * p, Vec_Bit_t * vIgnore, int fFilterIn, int fFilterOut, int fVerbose ) +{ + Acec_Box_t * pBox = NULL; + Vec_Int_t * vAdds = Ree_ManComputeCuts( p, NULL, fVerbose ); + Vec_Wec_t * vTrees = Acec_TreeFindTrees( p, vAdds, vIgnore, fFilterIn, fFilterOut ); + if ( vTrees && Vec_WecSize(vTrees) > 0 ) + { + pBox = Acec_CreateBox( p, vAdds, Vec_WecEntry(vTrees, 0) ); + Acec_VerifyBoxLeaves( pBox, vIgnore ); + } + if ( pBox )//&& fVerbose ) + printf( "Processing tree %d: Ranks = %d. Adders = %d. Leaves = %d. Roots = %d.\n", + 0, Vec_WecSize(pBox->vAdds), Vec_WecSizeSize(pBox->vAdds), + Vec_WecSizeSize(pBox->vLeafLits), Vec_WecSizeSize(pBox->vRootLits) ); + if ( pBox && fVerbose ) + Acec_PrintBox( pBox, vAdds ); + //Acec_PrintAdders( pBox0->vAdds, vAdds ); + //Acec_MultDetectInputs( p, pBox->vLeafLits, pBox->vRootLits ); + Vec_WecFreeP( &vTrees ); + Vec_IntFree( vAdds ); + return pBox; +} + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + diff --git a/src/proof/acec/acecUtil.c b/src/proof/acec/acecUtil.c index 191856cf..be12afef 100644 --- a/src/proof/acec/acecUtil.c +++ b/src/proof/acec/acecUtil.c @@ -90,6 +90,29 @@ void Gia_PolynAnalyzeXors( Gia_Man_t * pGia, int fVerbose ) Vec_IntFree( vXors ); } +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Gia_Man_t * Gia_ManDupTopMostRange( Gia_Man_t * p ) +{ + Gia_Man_t * pNew; + Vec_Int_t * vTops = Vec_IntAlloc( 10 ); + int i; + for ( i = 45; i < 52; i++ ) + Vec_IntPush( vTops, Gia_ObjId( p, Gia_ObjFanin0(Gia_ManCo(p, i)) ) ); + pNew = Gia_ManDupAndConesLimit( p, Vec_IntArray(vTops), Vec_IntSize(vTops), 100 ); + Vec_IntFree( vTops ); + return pNew; +} + //////////////////////////////////////////////////////////////////////// /// END OF FILE /// //////////////////////////////////////////////////////////////////////// diff --git a/src/proof/acec/module.make b/src/proof/acec/module.make index df6db695..dbf86ac2 100644 --- a/src/proof/acec/module.make +++ b/src/proof/acec/module.make @@ -1,13 +1,17 @@ SRC += src/proof/acec/acecCl.c \ src/proof/acec/acecCore.c \ src/proof/acec/acecCo.c \ + src/proof/acec/acecBo.c \ src/proof/acec/acecRe.c \ src/proof/acec/acecPa.c \ src/proof/acec/acecPo.c \ src/proof/acec/acecPool.c \ src/proof/acec/acecCover.c \ src/proof/acec/acecFadds.c \ + src/proof/acec/acecMult.c \ + src/proof/acec/acecNorm.c \ src/proof/acec/acecOrder.c \ src/proof/acec/acecPolyn.c \ src/proof/acec/acecSt.c \ + src/proof/acec/acecTree.c \ src/proof/acec/acecUtil.c diff --git a/src/proof/cec/cecCec.c b/src/proof/cec/cecCec.c index 77a6ed4a..f7e45c57 100644 --- a/src/proof/cec/cecCec.c +++ b/src/proof/cec/cecCec.c @@ -85,7 +85,7 @@ int Cec_ManVerifyOld( Gia_Man_t * pMiter, int fVerbose, int * piOutFail, abctime { if ( !fSilent ) { - Abc_Print( 1, "Networks are equivalent. " ); + Abc_Print( 1, "Networks are equivalent. " ); Abc_PrintTime( 1, "Time", Abc_Clock() - clkTotal ); } } @@ -93,7 +93,7 @@ int Cec_ManVerifyOld( Gia_Man_t * pMiter, int fVerbose, int * piOutFail, abctime { if ( !fSilent ) { - Abc_Print( 1, "Networks are NOT EQUIVALENT. " ); + Abc_Print( 1, "Networks are NOT EQUIVALENT. " ); Abc_PrintTime( 1, "Time", Abc_Clock() - clkTotal ); } if ( pMiterCec->pData == NULL ) @@ -120,7 +120,7 @@ int Cec_ManVerifyOld( Gia_Man_t * pMiter, int fVerbose, int * piOutFail, abctime } else if ( !fSilent ) { - Abc_Print( 1, "Networks are UNDECIDED. " ); + Abc_Print( 1, "Networks are UNDECIDED. " ); Abc_PrintTime( 1, "Time", Abc_Clock() - clkTotal ); } fflush( stdout ); diff --git a/src/proof/fra/fraCec.c b/src/proof/fra/fraCec.c index 130036a6..84f37930 100644 --- a/src/proof/fra/fraCec.c +++ b/src/proof/fra/fraCec.c @@ -547,17 +547,17 @@ int Fra_FraigCecTop( Aig_Man_t * pMan1, Aig_Man_t * pMan2, int nConfLimit, int n // report the miter if ( RetValue == 1 ) { - printf( "Networks are equivalent. " ); + printf( "Networks are equivalent. " ); ABC_PRT( "Time", Abc_Clock() - clkTotal ); } else if ( RetValue == 0 ) { - printf( "Networks are NOT EQUIVALENT. " ); + printf( "Networks are NOT EQUIVALENT. " ); ABC_PRT( "Time", Abc_Clock() - clkTotal ); } else { - printf( "Networks are UNDECIDED. " ); + printf( "Networks are UNDECIDED. " ); ABC_PRT( "Time", Abc_Clock() - clkTotal ); } fflush( stdout ); diff --git a/src/proof/fra/fraSec.c b/src/proof/fra/fraSec.c index 06011d2e..7e382fc8 100644 --- a/src/proof/fra/fraSec.c +++ b/src/proof/fra/fraSec.c @@ -606,7 +606,7 @@ finish: { if ( !pParSec->fSilent ) { - printf( "Networks are equivalent. " ); + printf( "Networks are equivalent. " ); ABC_PRT( "Time", Abc_Clock() - clkTotal ); } if ( pParSec->fReportSolution && !pParSec->fRecursive ) @@ -630,7 +630,7 @@ ABC_PRT( "Time", Abc_Clock() - clkTotal ); } if ( !pParSec->fSilent ) { - printf( "Networks are NOT EQUIVALENT. " ); + printf( "Networks are NOT EQUIVALENT. " ); ABC_PRT( "Time", Abc_Clock() - clkTotal ); } if ( pParSec->fReportSolution && !pParSec->fRecursive ) diff --git a/src/proof/pdr/pdrCore.c b/src/proof/pdr/pdrCore.c index c020c56a..c625e366 100644 --- a/src/proof/pdr/pdrCore.c +++ b/src/proof/pdr/pdrCore.c @@ -922,10 +922,9 @@ int Pdr_ManSolve( Aig_Man_t * pAig, Pdr_Par_t * pPars ) } if ( p->pPars->fDumpInv ) { - Abc_FrameSetCnf( Pdr_ManDeriveInfinityClauses( p, RetValue!=1 ) ); - Abc_FrameSetStr( Pdr_ManDumpString(p) ); - Abc_FrameSetInv( Pdr_ManCountFlopsInv(p) ); - Pdr_ManDumpClauses( p, (char *)"inv.pla", RetValue==1 ); + char * pFileName = Extra_FileNameGenericAppend(p->pAig->pName, "_inv.pla"); + Abc_FrameSetInv( Pdr_ManDeriveInfinityClauses( p, RetValue!=1 ) ); + Pdr_ManDumpClauses( p, pFileName, RetValue==1 ); } p->tTotal += Abc_Clock() - clk; Pdr_ManStop( p ); diff --git a/src/proof/pdr/pdrInv.c b/src/proof/pdr/pdrInv.c index 02b90a36..f29b792c 100644 --- a/src/proof/pdr/pdrInv.c +++ b/src/proof/pdr/pdrInv.c @@ -605,9 +605,237 @@ Vec_Int_t * Pdr_ManDeriveInfinityClauses( Pdr_Man_t * p, int fReduce ) //Vec_PtrFree( vCubes ); Vec_PtrFreeP( &p->vInfCubes ); p->vInfCubes = vCubes; + Vec_IntPush( vResult, Aig_ManRegNum(p->pAig) ); return vResult; } + + +/**Function************************************************************* + + Synopsis [Remove clauses while maintaining the invariant.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +#define Pdr_ForEachCube( pList, pCut, i ) for ( i = 0, pCut = pList + 1; i < pList[0]; i++, pCut += pCut[0] + 1 ) + +extern Cnf_Dat_t * Mf_ManGenerateCnf( Gia_Man_t * pGia, int nLutSize, int fCnfObjIds, int fAddOrCla, int fVerbose ); + +Vec_Int_t * Pdr_InvMap( Vec_Int_t * vCounts ) +{ + int i, k = 0, Count; + Vec_Int_t * vMap = Vec_IntStart( Vec_IntSize(vCounts) ); + Vec_IntForEachEntry( vCounts, Count, i ) + if ( Count ) + Vec_IntWriteEntry( vMap, i, k++ ); + return vMap; +} +Vec_Int_t * Pdr_InvCounts( Vec_Int_t * vInv ) +{ + int i, k, * pCube, * pList = Vec_IntArray(vInv); + Vec_Int_t * vCounts = Vec_IntStart( Vec_IntEntryLast(vInv) ); + Pdr_ForEachCube( pList, pCube, i ) + for ( k = 0; k < pCube[0]; k++ ) + Vec_IntAddToEntry( vCounts, Abc_Lit2Var(pCube[k+1]), 1 ); + return vCounts; +} +int Pdr_InvUsedFlopNum( Vec_Int_t * vInv ) +{ + Vec_Int_t * vCounts = Pdr_InvCounts( vInv ); + int nZeros = Vec_IntCountZero( vCounts ); + Vec_IntFree( vCounts ); + return Vec_IntEntryLast(vInv) - nZeros; +} + +Vec_Str_t * Pdr_InvPrintStr( Vec_Int_t * vInv, Vec_Int_t * vCounts ) +{ + Vec_Str_t * vStr = Vec_StrAlloc( 1000 ); + Vec_Int_t * vMap = Pdr_InvMap( vCounts ); + int nVars = Vec_IntSize(vCounts) - Vec_IntCountZero(vCounts); + int i, k, * pCube, * pList = Vec_IntArray(vInv); + char * pBuffer = ABC_ALLOC( char, nVars ); + for ( i = 0; i < nVars; i++ ) + pBuffer[i] = '-'; + Pdr_ForEachCube( pList, pCube, i ) + { + for ( k = 0; k < pCube[0]; k++ ) + pBuffer[Vec_IntEntry(vMap, Abc_Lit2Var(pCube[k+1]))] = '0' + !Abc_LitIsCompl(pCube[k+1]); + for ( k = 0; k < nVars; k++ ) + Vec_StrPush( vStr, pBuffer[k] ); + Vec_StrPush( vStr, ' ' ); + Vec_StrPush( vStr, '1' ); + Vec_StrPush( vStr, '\n' ); + for ( k = 0; k < pCube[0]; k++ ) + pBuffer[Vec_IntEntry(vMap, Abc_Lit2Var(pCube[k+1]))] = '-'; + } + Vec_StrPush( vStr, '\0' ); + ABC_FREE( pBuffer ); + Vec_IntFree( vMap ); + return vStr; +} +void Pdr_InvPrint( Vec_Int_t * vInv ) +{ + Vec_Int_t * vCounts = Pdr_InvCounts( vInv ); + Vec_Str_t * vStr = Pdr_InvPrintStr( vInv, vCounts ); + printf( "Invariant contains %d clauses with %d literals and %d flops (out of %d).\n", Vec_IntEntry(vInv, 0), Vec_IntSize(vInv)-Vec_IntEntry(vInv, 0)-2, Pdr_InvUsedFlopNum(vInv), Vec_IntEntryLast(vInv) ); + printf( "%s", Vec_StrArray( vStr ) ); + Vec_IntFree( vCounts ); + Vec_StrFree( vStr ); +} + +void Pdr_InvCheck( Gia_Man_t * p, Vec_Int_t * vInv ) +{ + int nBTLimit = 0; + int i, k, status, nFailed = 0; + // create SAT solver + Cnf_Dat_t * pCnf = Mf_ManGenerateCnf( p, 8, 0, 0, 0 ); + sat_solver * pSat = (sat_solver *)Cnf_DataWriteIntoSolver( pCnf, 1, 0 ); + // collect cubes + int * pCube, * pList = Vec_IntArray(vInv), nCubes = pList[0]; + // create variables + Vec_Int_t * vLits = Vec_IntAlloc(100); + int nVars = Gia_ManRegNum(p); + int iFoVarBeg = pCnf->nVars - Gia_ManRegNum(p); + int iFiVarBeg = 1 + Gia_ManPoNum(p); + assert( Gia_ManPoNum(p) == 1 ); + // add cubes + Pdr_ForEachCube( pList, pCube, i ) + { + // collect literals + Vec_IntClear( vLits ); + for ( k = 0; k < pCube[0]; k++ ) + Vec_IntPush( vLits, Abc_Var2Lit(iFoVarBeg + Abc_Lit2Var(pCube[k+1]), !Abc_LitIsCompl(pCube[k+1])) ); + // add it to the solver + status = sat_solver_addclause( pSat, Vec_IntArray(vLits), Vec_IntLimit(vLits) ); + assert( status == 1 ); + } + // iterate through cubes in the direct order + Pdr_ForEachCube( pList, pCube, i ) + { + // collect cube + Vec_IntClear( vLits ); + for ( k = 0; k < pCube[0]; k++ ) + Vec_IntPush( vLits, Abc_Var2Lit(iFiVarBeg + Abc_Lit2Var(pCube[k+1]), Abc_LitIsCompl(pCube[k+1])) ); + // check if this cube intersects with the complement of other cubes in the solver + // if it does not intersect, then it is redundant and can be skipped + status = sat_solver_solve( pSat, Vec_IntArray(vLits), Vec_IntLimit(vLits), nBTLimit, 0, 0, 0 ); + if ( status == l_Undef ) // timeout + break; + if ( status == l_False ) // unsat -- correct + continue; + assert( status == l_True ); + nFailed++; + } + if ( nFailed ) + printf( "Invariant verification failed for %d clauses (out of %d).\n", nFailed, nCubes ); + else + printf( "Invariant verification passes.\n" ); + Cnf_DataFree( pCnf ); + sat_solver_delete( pSat ); + Vec_IntFree( vLits ); +} + +Vec_Int_t * Pdr_InvMinimize( Gia_Man_t * p, Vec_Int_t * vInv ) +{ + int nBTLimit = 0; + int n, i, k, status, nLits, fFailed = 0, fCannot = 0, nRemoved = 0; + Vec_Int_t * vRes = NULL; + // create SAT solver + Cnf_Dat_t * pCnf = Mf_ManGenerateCnf( p, 8, 0, 0, 0 ); + sat_solver * pSat = (sat_solver *)Cnf_DataWriteIntoSolver( pCnf, 1, 0 ); + int * pCube, * pList = Vec_IntArray(vInv), nCubes = pList[0]; + // create variables + Vec_Int_t * vLits = Vec_IntAlloc(100); + Vec_Bit_t * vRemoved = Vec_BitStart( nCubes ); + int nVars = Gia_ManRegNum(p); + int iFoVarBeg = pCnf->nVars - Gia_ManRegNum(p); + int iFiVarBeg = 1 + Gia_ManPoNum(p); + int iAuxVarBeg = sat_solver_nvars(pSat); + assert( Gia_ManPoNum(p) == 1 ); + // allocate auxiliary variables + sat_solver_setnvars( pSat, sat_solver_nvars(pSat) + nCubes ); + // add clauses + Pdr_ForEachCube( pList, pCube, i ) + { + // collect literals + Vec_IntFill( vLits, 1, Abc_Var2Lit(iAuxVarBeg + i, 1) ); // neg aux literal + for ( k = 0; k < pCube[0]; k++ ) + Vec_IntPush( vLits, Abc_Var2Lit(iFoVarBeg + Abc_Lit2Var(pCube[k+1]), !Abc_LitIsCompl(pCube[k+1])) ); + // add it to the solver + status = sat_solver_addclause( pSat, Vec_IntArray(vLits), Vec_IntLimit(vLits) ); + assert( status == 1 ); + } + // iterate through clauses + Pdr_ForEachCube( pList, pCube, i ) + { + if ( Vec_BitEntry(vRemoved, i) ) + continue; + // collect aux literals for remaining clauses + Vec_IntClear( vLits ); + for ( k = 0; k < nCubes; k++ ) + if ( k != i && !Vec_BitEntry(vRemoved, k) ) // skip this cube and already removed cubes + Vec_IntPush( vLits, Abc_Var2Lit(iAuxVarBeg + k, 0) ); // pos aux literal + nLits = Vec_IntSize( vLits ); + // try removing other clauses + fCannot = 0; + Pdr_ForEachCube( pList, pCube, n ) + { + if ( Vec_BitEntry(vRemoved, n) || n == i ) + continue; + // collect cube + Vec_IntShrink( vLits, nLits ); + for ( k = 0; k < pCube[0]; k++ ) + Vec_IntPush( vLits, Abc_Var2Lit(iFiVarBeg + Abc_Lit2Var(pCube[k+1]), Abc_LitIsCompl(pCube[k+1])) ); + // check if this cube intersects with the complement of other cubes in the solver + // if it does not intersect, then it is redundant and can be skipped + status = sat_solver_solve( pSat, Vec_IntArray(vLits), Vec_IntLimit(vLits), nBTLimit, 0, 0, 0 ); + if ( status == l_Undef ) // timeout + { + fFailed = 1; + break; + } + if ( status == l_False ) // unsat -- correct + continue; + assert( status == l_True ); + // cannot remove + fCannot = 1; + break; + } + if ( fFailed ) + break; + if ( fCannot ) + continue; + printf( "Removing clause %d.\n", i ); + Vec_BitWriteEntry( vRemoved, i, 1 ); + nRemoved++; + } + if ( nRemoved ) + printf( "Invariant minimization reduced %d clauses (out of %d).\n", nRemoved, nCubes ); + else + printf( "Invariant minimization did not change the invariant.\n" ); + // cleanup cover + if ( !fFailed && nRemoved > 0 ) // finished without timeout and removed some cubes + { + vRes = Vec_IntAlloc( 1000 ); + Vec_IntPush( vRes, nCubes-nRemoved ); + Pdr_ForEachCube( pList, pCube, i ) + if ( !Vec_BitEntry(vRemoved, i) ) + for ( k = 0; k <= pCube[0]; k++ ) + Vec_IntPush( vRes, pCube[k] ); + Vec_IntPush( vRes, Vec_IntEntryLast(vInv) ); + } + Cnf_DataFree( pCnf ); + sat_solver_delete( pSat ); + Vec_BitFree( vRemoved ); + Vec_IntFree( vLits ); + return vRes; +} + //////////////////////////////////////////////////////////////////////// /// END OF FILE /// //////////////////////////////////////////////////////////////////////// diff --git a/src/proof/pdr/pdrUtil.c b/src/proof/pdr/pdrUtil.c index 53a8a54a..32e97772 100644 --- a/src/proof/pdr/pdrUtil.c +++ b/src/proof/pdr/pdrUtil.c @@ -284,7 +284,7 @@ void Pdr_SetPrintStr( Vec_Str_t * vStr, Pdr_Set_t * p, int nRegs, Vec_Int_t * vF } Vec_StrPushBuffer( vStr, pBuff, k ); Vec_StrPush( vStr, ' ' ); - Vec_StrPush( vStr, '0' ); + Vec_StrPush( vStr, '1' ); Vec_StrPush( vStr, '\n' ); ABC_FREE( pBuff ); } diff --git a/src/sat/bsat/satSolver.h b/src/sat/bsat/satSolver.h index 7ef2c9e8..162b91e5 100644 --- a/src/sat/bsat/satSolver.h +++ b/src/sat/bsat/satSolver.h @@ -229,7 +229,12 @@ static void sat_solver_compress(sat_solver* s) (void) RetValue; } } - +static void sat_solver_delete_p( sat_solver ** ps ) +{ + if ( *ps ) + sat_solver_delete( *ps ); + *ps = NULL; +} static void sat_solver_clean_polarity(sat_solver* s, int * pVars, int nVars ) { int i; |