diff options
| author | Alan Mishchenko <alanmi@berkeley.edu> | 2021-05-16 20:33:53 -0700 |
|---|---|---|
| committer | Alan Mishchenko <alanmi@berkeley.edu> | 2021-05-16 20:33:53 -0700 |
| commit | 0ce11851bcb364abfd5d65685ab779faed4398ec (patch) | |
| tree | 6f27c9298744dddc0964cd609e9f1353d608a6ac | |
| parent | 610a3d3fc2a7e593c52a2532dc31d67cbd8af6ce (diff) | |
| download | abc-0ce11851bcb364abfd5d65685ab779faed4398ec.tar.gz abc-0ce11851bcb364abfd5d65685ab779faed4398ec.tar.bz2 abc-0ce11851bcb364abfd5d65685ab779faed4398ec.zip | |
Updating LUT synthesis code.
| -rw-r--r-- | src/aig/gia/giaDup.c | 2 | ||||
| -rw-r--r-- | src/aig/gia/giaMinLut.c | 226 | ||||
| -rw-r--r-- | src/base/abc/abcNtk.c | 9 | ||||
| -rw-r--r-- | src/base/abci/abc.c | 229 | ||||
| -rw-r--r-- | src/base/abci/abcLut.c | 158 | ||||
| -rw-r--r-- | src/base/abci/abcNtbdd.c | 2 | ||||
| -rw-r--r-- | src/base/io/io.c | 20 | ||||
| -rw-r--r-- | src/base/io/ioWriteVerilog.c | 85 |
8 files changed, 604 insertions, 127 deletions
diff --git a/src/aig/gia/giaDup.c b/src/aig/gia/giaDup.c index 9de9e735..0f200bfc 100644 --- a/src/aig/gia/giaDup.c +++ b/src/aig/gia/giaDup.c @@ -3460,6 +3460,8 @@ Gia_Man_t * Gia_ManDupCones( Gia_Man_t * p, int * pPos, int nPos, int fTrimPis ) // create PIs if ( fTrimPis ) { + Gia_ManForEachPi( p, pObj, i ) + pObj->Value = ~0; Vec_PtrForEachEntry( Gia_Obj_t *, vLeaves, pObj, i ) pObj->Value = Gia_ManAppendCi( pNew ); } diff --git a/src/aig/gia/giaMinLut.c b/src/aig/gia/giaMinLut.c index 79bd32fd..9ac9e770 100644 --- a/src/aig/gia/giaMinLut.c +++ b/src/aig/gia/giaMinLut.c @@ -89,15 +89,12 @@ void Vec_WrdReadText( char * pFileName, Vec_Wrd_t ** pvSimI, Vec_Wrd_t ** pvSimO *pvSimO = vSimO; printf( "Read %d words of simulation data for %d inputs and %d outputs (padded %d zero-patterns).\n", nWords, nIns, nOuts, nWords*64-nLines ); } -void Gia_ManSimInfoTransform( int fSmall ) +void Gia_ManSimInfoTransform( char * pFileName, char * pFileOut1, char * pFileOut2, int nIns, int nOuts ) { - int nIns = fSmall ? 32 : 64; - int nOuts = fSmall ? 10 : 35; - char * pFileName = fSmall ? "io_s.txt" : "io_l.txt"; Vec_Wrd_t * vSimI, * vSimO; Vec_WrdReadText( pFileName, &vSimI, &vSimO, nIns, nOuts ); - Vec_WrdDumpBin( Extra_FileNameGenericAppend(pFileName, ".simi"), vSimI, 1 ); - Vec_WrdDumpBin( Extra_FileNameGenericAppend(pFileName, ".simo"), vSimO, 1 ); + Vec_WrdDumpBin( pFileOut1 ? pFileOut1 : Extra_FileNameGenericAppend(pFileName, ".simi"), vSimI, 1 ); + Vec_WrdDumpBin( pFileOut2 ? pFileOut2 : Extra_FileNameGenericAppend(pFileName, ".simo"), vSimO, 1 ); Vec_WrdFree( vSimI ); Vec_WrdFree( vSimO ); } @@ -180,8 +177,25 @@ int Gia_ManSimEvalOne( Gia_Man_t * p, Vec_Wrd_t * vSimO, Vec_Wrd_t * vSimO_new ) Abc_TtOrXor( pSim0, pSimImpl, pSimGold, nWords ); } Count = Abc_TtCountOnesVec( pSim0, nWords ); - printf( "Number of failed patterns is %d (out of %d). The first one is %d.\n", - Count, 64*nWords, Abc_TtFindFirstBit2(pSim0, nWords) ); + printf( "Number of failed patterns is %d (%8.4f %% of %d). The first one is %d.\n", + Count, 100.0*Count/(64*nWords), 64*nWords, Abc_TtFindFirstBit2(pSim0, nWords) ); + ABC_FREE( pSim0 ); + return Count; +} +int Gia_ManSimEvalOne2( Gia_Man_t * p, Vec_Wrd_t * vSimO, Vec_Wrd_t * vSimO_new ) +{ + int i, Count = 0, nWords = Vec_WrdSize(vSimO) / Gia_ManCoNum(p); + word * pSim0 = ABC_CALLOC( word, nWords ); + assert( Vec_WrdSize(vSimO) == Vec_WrdSize(vSimO_new) ); + for ( i = 0; i < Gia_ManCoNum(p); i++ ) + { + word * pSimGold = Vec_WrdEntryP( vSimO, i * nWords ); + word * pSimImpl = Vec_WrdEntryP( vSimO_new, i * nWords ); + Abc_TtXor( pSim0, pSimImpl, pSimGold, nWords, 0 ); + Count += Abc_TtCountOnesVec( pSim0, nWords ); + } + printf( "Number of failed patterns is %d (%8.4f %% of %d). The first one is %d.\n", + Count, 100.0*Count/(64*nWords*Gia_ManCoNum(p)), 64*nWords*Gia_ManCoNum(p), Abc_TtFindFirstBit2(pSim0, nWords) ); ABC_FREE( pSim0 ); return Count; } @@ -204,29 +218,12 @@ Vec_Wrd_t * Gia_ManSimInfoTry( Gia_Man_t * p, Vec_Wrd_t * vSimI ) } int Gia_ManSimInfoEval( Gia_Man_t * p, Vec_Wrd_t * vSimO, Vec_Wrd_t * vSimO_new ) { - int nResult = Gia_ManSimEvalOne(p, vSimO, vSimO_new); - Vec_WrdDumpBin( "temp.simo", vSimO_new, 1 ); + int nResult = Gia_ManSimEvalOne2(p, vSimO, vSimO_new); + //Vec_WrdDumpBin( "temp.simo", vSimO_new, 1 ); printf( "Total errors = %d. ", nResult ); - printf( "Density of output patterns %6.4f.\n", (float)Abc_TtCountOnesVec(Vec_WrdArray(vSimO_new), Vec_WrdSize(vSimO_new))/(64*Vec_WrdSize(vSimO_new)) ); + printf( "Density of output patterns %8.4f.\n", (float)Abc_TtCountOnesVec(Vec_WrdArray(vSimO_new), Vec_WrdSize(vSimO_new))/(64*Vec_WrdSize(vSimO_new)) ); return nResult; } -void Gia_ManSimInfoTryTest( Gia_Man_t * p, int fSmall ) -{ - abctime clk = Abc_Clock(); - char * pFileNameI = fSmall ? "io_s.simi" : "io_l.simi"; - char * pFileNameO = fSmall ? "io_s.simo" : "io_l.simo"; - Vec_Wrd_t * vSimI = Vec_WrdReadBin( pFileNameI, 1 ); - Vec_Wrd_t * vSimO = Vec_WrdReadBin( pFileNameO, 1 ); - Vec_Wrd_t * vSimO_new; - printf( "Density of input patterns %6.4f.\n", (float)Abc_TtCountOnesVec(Vec_WrdArray(vSimI), Vec_WrdSize(vSimI))/(64*Vec_WrdSize(vSimI)) ); - printf( "Density of output patterns %6.4f.\n", (float)Abc_TtCountOnesVec(Vec_WrdArray(vSimO), Vec_WrdSize(vSimO))/(64*Vec_WrdSize(vSimO)) ); - vSimO_new = Gia_ManSimInfoTry( p, vSimI ); - Gia_ManSimInfoEval( p, vSimO, vSimO_new ); - Vec_WrdFree( vSimI ); - Vec_WrdFree( vSimO ); - Vec_WrdFree( vSimO_new ); - Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); -} void Gia_ManSimInfoPassTest( Gia_Man_t * p, char * pFileName, char * pFileName2, int fCompare ) { abctime clk = Abc_Clock(); @@ -234,8 +231,8 @@ void Gia_ManSimInfoPassTest( Gia_Man_t * p, char * pFileName, char * pFileName2, { Vec_Wrd_t * vSim1 = Vec_WrdReadBin( pFileName, 1 ); Vec_Wrd_t * vSim2 = Vec_WrdReadBin( pFileName2, 1 ); - printf( "Density of input patterns %6.4f.\n", (float)Abc_TtCountOnesVec(Vec_WrdArray(vSim1), Vec_WrdSize(vSim1))/(64*Vec_WrdSize(vSim1)) ); - printf( "Density of output patterns %6.4f.\n", (float)Abc_TtCountOnesVec(Vec_WrdArray(vSim2), Vec_WrdSize(vSim2))/(64*Vec_WrdSize(vSim2)) ); + printf( "Density of input patterns %8.4f.\n", (float)Abc_TtCountOnesVec(Vec_WrdArray(vSim1), Vec_WrdSize(vSim1))/(64*Vec_WrdSize(vSim1)) ); + printf( "Density of output patterns %8.4f.\n", (float)Abc_TtCountOnesVec(Vec_WrdArray(vSim2), Vec_WrdSize(vSim2))/(64*Vec_WrdSize(vSim2)) ); Gia_ManSimInfoEval( p, vSim1, vSim2 ); Vec_WrdFree( vSim1 ); Vec_WrdFree( vSim2 ); @@ -244,8 +241,8 @@ void Gia_ManSimInfoPassTest( Gia_Man_t * p, char * pFileName, char * pFileName2, { Vec_Wrd_t * vSimI = Vec_WrdReadBin( pFileName, 1 ); Vec_Wrd_t * vSimO = Gia_ManSimInfoTry( p, vSimI ); - printf( "Density of input patterns %6.4f.\n", (float)Abc_TtCountOnesVec(Vec_WrdArray(vSimI), Vec_WrdSize(vSimI))/(64*Vec_WrdSize(vSimI)) ); - printf( "Density of output patterns %6.4f.\n", (float)Abc_TtCountOnesVec(Vec_WrdArray(vSimO), Vec_WrdSize(vSimO))/(64*Vec_WrdSize(vSimO)) ); + printf( "Density of input patterns %8.4f.\n", (float)Abc_TtCountOnesVec(Vec_WrdArray(vSimI), Vec_WrdSize(vSimI))/(64*Vec_WrdSize(vSimI)) ); + printf( "Density of output patterns %8.4f.\n", (float)Abc_TtCountOnesVec(Vec_WrdArray(vSimO), Vec_WrdSize(vSimO))/(64*Vec_WrdSize(vSimO)) ); Vec_WrdDumpBin( pFileName2, vSimO, 1 ); Vec_WrdFree( vSimI ); Vec_WrdFree( vSimO ); @@ -264,7 +261,7 @@ void Gia_ManSimInfoPassTest( Gia_Man_t * p, char * pFileName, char * pFileName2, SeeAlso [] ***********************************************************************/ -word * Gia_ManCountFraction( Gia_Man_t * p, Vec_Wrd_t * vSimI, Vec_Int_t * vSupp, int Thresh, int fVerbose ) +word * Gia_ManCountFraction( Gia_Man_t * p, Vec_Wrd_t * vSimI, Vec_Int_t * vSupp, int Thresh, int fVerbose, int * pCare ) { Gia_Obj_t * pObj; int i, k, nUsed = 0, nGood = 0; @@ -287,8 +284,8 @@ word * Gia_ManCountFraction( Gia_Man_t * p, Vec_Wrd_t * vSimI, Vec_Int_t * vSupp for ( k = 0; k < nMints; k++ ) { nUsed += (pCounts[k] > 0); - nGood += (pCounts[k] > Thresh); - if ( pCounts[k] > Thresh ) + nGood += (pCounts[k] >= Thresh); + if ( pCounts[k] >= Thresh ) Abc_TtXorBit( pRes, k ); //printf( "%d ", pCounts[k] ); } @@ -297,6 +294,7 @@ word * Gia_ManCountFraction( Gia_Man_t * p, Vec_Wrd_t * vSimI, Vec_Int_t * vSupp printf( "Used %4d and good %4d (out of %4d).\n", nUsed, nGood, nMints ); ABC_FREE( pSims ); ABC_FREE( pCounts ); + *pCare = nGood; return pRes; } void Gia_ManCollectSupp_rec( Gia_Man_t * p, int iObj, Vec_Int_t * vSupp ) @@ -324,7 +322,7 @@ Vec_Int_t * Gia_ManCollectSupp( Gia_Man_t * p, int iOut, int nOuts ) Gia_ManCollectSupp_rec( p, Gia_ObjFaninId0p(p, Gia_ManCo(p, iOut+i)), vSupp ); return vSupp; } -Gia_Man_t * Gia_ManSimInfoSynth( Gia_Man_t * p, char * pFileName, int nIns, int nOuts, int LutSize, int Thresh, int fVerbose ) +Gia_Man_t * Gia_ManPerformLNetOpt( Gia_Man_t * p, char * pFileName, int nIns, int nOuts, int Thresh, int fVerbose ) { extern int Kit_TruthToGia2( Gia_Man_t * p, unsigned * pTruth0, unsigned * pTruth1, int nVars, Vec_Int_t * vMemory, Vec_Int_t * vLeaves, int fHash ); Gia_Man_t * pNew; Gia_Obj_t * pObj; @@ -332,12 +330,12 @@ Gia_Man_t * Gia_ManSimInfoSynth( Gia_Man_t * p, char * pFileName, int nIns, int Vec_Int_t * vLeaves = Vec_IntAlloc( nIns ); Vec_Wrd_t * vSimI = pFileName ? Vec_WrdReadBin( pFileName, 1 ) : NULL; word * pTruth0 = ABC_CALLOC( word, Abc_Truth6WordNum(nIns) ); - word * pTruth1 = ABC_CALLOC( word, Abc_Truth6WordNum(nIns) ); int g, k; + word * pTruth1 = ABC_CALLOC( word, Abc_Truth6WordNum(nIns) ); int g, k; float CareAve = 0; if ( vSimI ) { int nPats = 64*Vec_WrdSize(vSimI)/Gia_ManCiNum(p); - printf( "Density of input patterns %6.4f.\n", (float)Abc_TtCountOnesVec(Vec_WrdArray(vSimI), Vec_WrdSize(vSimI))/(64*Vec_WrdSize(vSimI)) ); - printf( "The number of patterns %d with threshold %d (%6.2f %%).\n", nPats, Thresh, 100.0*Thresh/nPats ); + printf( "Density of input patterns %8.4f.\n", (float)Abc_TtCountOnesVec(Vec_WrdArray(vSimI), Vec_WrdSize(vSimI))/(64*Vec_WrdSize(vSimI)) ); + printf( "Using patterns with count %d and higher as cares (%8.4f %% of all patterns).\n", Thresh, 100.0*Thresh/nPats ); } Gia_ManFillValue( p ); pNew = Gia_ManStart( Gia_ManObjNum(p) ); @@ -351,9 +349,10 @@ Gia_Man_t * Gia_ManSimInfoSynth( Gia_Man_t * p, char * pFileName, int nIns, int for ( g = 0; g < Gia_ManCoNum(p); g += nOuts ) { Vec_Int_t * vSupp = Gia_ManCollectSupp( p, g, nOuts ); - int Temp = fVerbose ? printf( "Group %3d / %3d / %3d : Supp = %3d %s", g, nOuts, Gia_ManCoNum(p), Vec_IntSize(vSupp), vSimI ? "":"\n" ) : 0; - word * pCare = vSimI ? Gia_ManCountFraction( p, vSimI, vSupp, Thresh, fVerbose ) : ABC_FALLOC( word, Abc_Truth6WordNum(Vec_IntSize(vSupp)) ); + int Care, Temp = fVerbose ? printf( "Group %3d / %3d / %3d : Supp = %3d %s", g, nOuts, Gia_ManCoNum(p), Vec_IntSize(vSupp), vSimI ? "":"\n" ) : 0; + word * pCare = vSimI ? Gia_ManCountFraction( p, vSimI, vSupp, Thresh, fVerbose, &Care ) : ABC_FALLOC( word, Abc_Truth6WordNum(Vec_IntSize(vSupp)) ); int nWords = Abc_Truth6WordNum( Vec_IntSize(vSupp) ); + CareAve += 100.0*Care/(1 << nIns); assert( Vec_IntSize(vSupp) <= nIns ); Vec_IntClear( vLeaves ); Gia_ManForEachObjVec( vSupp, p, pObj, k ) @@ -376,6 +375,8 @@ Gia_Man_t * Gia_ManSimInfoSynth( Gia_Man_t * p, char * pFileName, int nIns, int Vec_IntFree( vSupp ); Temp = 0; } + CareAve /= Gia_ManCoNum(p)/nOuts; + printf( "Average size of the care set = %8.4f %%.\n", CareAve ); Gia_ManHashStop( pNew ); Gia_ManForEachCo( p, pObj, k ) pObj->Value = Gia_ManAppendCo( pNew, pObj->Value ); @@ -430,14 +431,15 @@ Gia_Man_t * Gia_ManDoMuxTransform( Gia_Man_t * p, int fReorder ) { extern Gia_Man_t * Abc_NtkStrashToGia( Abc_Ntk_t * pNtk ); extern Abc_Ntk_t * Abc_NtkFromAigPhase( Aig_Man_t * pMan ); - extern int Abc_NtkBddToMuxesPerformGlo( Abc_Ntk_t * pNtk, Abc_Ntk_t * pNtkNew, int Limit, int fReorder ); + extern int Abc_NtkBddToMuxesPerformGlo( Abc_Ntk_t * pNtk, Abc_Ntk_t * pNtkNew, int Limit, int fReorder, int fUseAdd ); Gia_Man_t * pRes = NULL; Aig_Man_t * pMan = Gia_ManToAig( p, 0 ); Abc_Ntk_t * pNtk = Abc_NtkFromAigPhase( pMan ); Abc_Ntk_t * pNtkNew = Abc_NtkStartFrom( pNtk, ABC_NTK_LOGIC, ABC_FUNC_SOP ); pNtk->pName = Extra_UtilStrsav( pMan->pName ); Aig_ManStop( pMan ); - if ( Abc_NtkBddToMuxesPerformGlo( pNtk, pNtkNew, 1000000, fReorder ) ) + //pNtkNew = Abc_NtkBddToMuxes( pNtk, 1, 1000000, 1 ); + if ( Abc_NtkBddToMuxesPerformGlo( pNtk, pNtkNew, 1000000, fReorder, 0 ) ) { Abc_Ntk_t * pStrash = Abc_NtkStrash( pNtkNew, 1, 1, 0 ); pRes = Abc_NtkStrashToGia( pStrash ); @@ -457,37 +459,135 @@ int Gia_ManDoTest1( Gia_Man_t * p, int fReorder ) Gia_ManStop( pNew ); return Res; } -Gia_Man_t * Gia_ManPerformMinLut( Gia_Man_t * p, int GroupSize, int LutSize, int fVerbose ) +Abc_Ntk_t * Gia_ManDoTest2( Gia_Man_t * p, int fReorder ) { - Gia_Man_t * pNew = NULL; + extern Abc_Ntk_t * Abc_NtkFromMappedGia( Gia_Man_t * p, int fFindEnables, int fUseBuffs ); + Abc_Ntk_t * pNtkNew; + Gia_Man_t * pTemp, * pNew; + pNew = Gia_ManDoMuxTransform( p, fReorder ); + pNew = Gia_ManDoMuxMapping( pTemp = pNew ); + Gia_ManStop( pTemp ); + pNtkNew = Abc_NtkFromMappedGia( pNew, 0, 0 ); + pNtkNew->pName = Extra_UtilStrsav(p->pName); + Gia_ManStop( pNew ); + Abc_NtkToSop( pNtkNew, 1, ABC_INFINITY ); + return pNtkNew; +} +Abc_Ntk_t * Abc_NtkMapTransform( Gia_Man_t * p, int nOuts, int fUseFixed, int fVerbose ) +{ + extern Abc_Ntk_t * Abc_NtkSpecialMapping( Abc_Ntk_t * pNtk, int fVerbose ); + int i, k, g, nGroups = Gia_ManCoNum(p) / nOuts, CountsAll[3] = {0}; + Abc_Obj_t * pObjNew, * pFaninNew; Gia_Obj_t * pObj; + Abc_Ntk_t * pNtkNew = Abc_NtkAlloc( ABC_NTK_LOGIC, ABC_FUNC_SOP, 1 ); + assert( Gia_ManCoNum(p) % nOuts == 0 ); + pNtkNew->pName = Extra_UtilStrsav(p->pName); + pNtkNew->pSpec = Extra_UtilStrsav(p->pSpec); + Gia_ManFillValue( p ); + Gia_ManForEachPi( p, pObj, i ) + Abc_NtkCreatePi( pNtkNew ); + Gia_ManForEachPo( p, pObj, i ) + Abc_NtkCreatePo( pNtkNew ); + assert( nOuts <= 64 ); + for ( g = 0; g < nGroups; g++ ) + { + Gia_Man_t * pNew; Aig_Man_t * pMan; + Abc_Ntk_t * pNtk, * pNtkRes, * pNtkMap; + int pPos[64], Counter = 0, Counts[3] = {0}; + for ( i = 0; i < nOuts; i++ ) + pPos[i] = g*nOuts+i; + pNew = Gia_ManDupCones( p, pPos, nOuts, 1 ); + if ( !fUseFixed ) + pNtkMap = Gia_ManDoTest2( pNew, 1 ); + else + { + pMan = Gia_ManToAig( pNew, 0 ); + pNtk = Abc_NtkFromAigPhase( pMan ); + Aig_ManStop( pMan ); + pNtkRes = Abc_NtkBddToMuxes( pNtk, 1, 1000000, 1 ); + Abc_NtkDelete( pNtk ); + pNtkMap = Abc_NtkSpecialMapping( pNtkRes, 0 ); + Abc_NtkDelete( pNtkRes ); + } + Gia_ManStop( pNew ); + Gia_ManForEachCi( p, pObj, i ) + if ( ~pObj->Value ) + Abc_NtkCi(pNtkMap, Counter++)->pCopy = Abc_NtkCi(pNtkNew, i); + assert( Counter == Abc_NtkCiNum(pNtkMap) ); + Abc_NtkForEachNode( pNtkMap, pObjNew, i ) + { + pObjNew->pCopy = Abc_NtkDupObj( pNtkNew, pObjNew, 0 ); + pObjNew->pCopy->fPersist = pObjNew->fPersist; + if ( pObjNew->fPersist ) + Counts[1]++; + else + Counts[0]++; + Abc_ObjForEachFanin( pObjNew, pFaninNew, k ) + Abc_ObjAddFanin( pObjNew->pCopy, pFaninNew->pCopy ); + } + Abc_NtkForEachCo( pNtkMap, pObjNew, i ) + Abc_ObjAddFanin( Abc_NtkCo(pNtkNew, g*nOuts+i), Abc_ObjFanin0(pObjNew)->pCopy ); + Abc_NtkDelete( pNtkMap ); + + if ( fVerbose ) + { + printf( "%3d / %3d : ", g, nGroups ); + printf( "Test = %4d ", Counts[0] ); + printf( "MarkA = %4d ", Counts[1] ); + printf( "MarkB = %4d ", Counts[2] ); + printf( "\n" ); + } + + CountsAll[0] += Counts[0]; + CountsAll[1] += Counts[1]; + CountsAll[2] += Counts[2]; + } + if ( fVerbose ) + printf( "Total LUT count = %5d. MarkA = %5d. MarkB = %5d.\n", CountsAll[0], CountsAll[1], CountsAll[2] ); + // create names + Abc_NtkAddDummyPiNames( pNtkNew ); + Abc_NtkAddDummyPoNames( pNtkNew ); + Abc_NtkAddDummyBoxNames( pNtkNew ); + // check the resulting AIG + if ( !Abc_NtkCheck( pNtkNew ) ) + Abc_Print( 1, "Abc_NtkFromMappedGia(): Network check has failed.\n" ); + return pNtkNew; +} + +Abc_Ntk_t * Gia_ManPerformLNetMap( Gia_Man_t * p, int GroupSize, int fUseFixed, int fVerbose ) +{ + int fPrintOnly = 0; int Res1, Res2, Result = 0; int g, nGroups = Gia_ManCoNum(p) / GroupSize; assert( Gia_ManCoNum(p) % GroupSize == 0 ); assert( GroupSize <= 64 ); - for ( g = 0; g < nGroups; g++ ) + if ( fPrintOnly ) { - Gia_Man_t * pNew;//, * pTemp; - int fTrimPis = 0; - int o, pPos[64]; - for ( o = 0; o < GroupSize; o++ ) - pPos[o] = g*GroupSize+o; - pNew = Gia_ManDupCones( p, pPos, GroupSize, fTrimPis ); - printf( "%3d / %3d : ", g, nGroups ); - printf( "Test1 = %4d ", Res1 = Gia_ManDoTest1(pNew, 0) ); - printf( "Test2 = %4d ", Res2 = Gia_ManDoTest1(pNew, 1) ); - printf( "Test = %4d ", Abc_MinInt(Res1, Res2) ); - printf( "\n" ); - Result += Abc_MinInt(Res1, Res2); - //Gia_ManPrintStats( pNew, NULL ); - Gia_ManStop( pNew ); + for ( g = 0; g < nGroups; g++ ) + { + Gia_Man_t * pNew; + int o, pPos[64]; + for ( o = 0; o < GroupSize; o++ ) + pPos[o] = g*GroupSize+o; + pNew = Gia_ManDupCones( p, pPos, GroupSize, 0 ); + printf( "%3d / %3d : ", g, nGroups ); + printf( "Test1 = %4d ", Res1 = Gia_ManDoTest1(pNew, 0) ); + printf( "Test2 = %4d ", Res2 = Gia_ManDoTest1(pNew, 1) ); + printf( "Test = %4d ", Abc_MinInt(Res1, Res2) ); + printf( "\n" ); + Result += Abc_MinInt(Res1, Res2); + //Gia_ManPrintStats( pNew, NULL ); + Gia_ManStop( pNew ); + } + printf( "Total LUT count = %d.\n", Result ); + return NULL; + } - printf( "Total LUT count = %d.\n", Result ); - return pNew; + return Abc_NtkMapTransform( p, GroupSize, fUseFixed, fVerbose ); } #else -Gia_Man_t * Gia_ManPerformMinLut( Gia_Man_t * p, int GroupSize, int LutSize, int fVerbose ) +Gia_Man_t * Gia_ManPerformLNetMap( Gia_Man_t * p, int GroupSize, int fUseFixed, int fVerbose ) { return NULL; } diff --git a/src/base/abc/abcNtk.c b/src/base/abc/abcNtk.c index 7c54f3c4..f8e40b41 100644 --- a/src/base/abc/abcNtk.c +++ b/src/base/abc/abcNtk.c @@ -1286,6 +1286,7 @@ void Abc_NtkDelete( Abc_Ntk_t * pNtk ) Abc_Obj_t * pObj; void * pAttrMan; int TotalMemory, i; + int fWarning = 0; // int LargePiece = (4 << ABC_NUM_STEPS); if ( pNtk == NULL ) return; @@ -1310,9 +1311,11 @@ void Abc_NtkDelete( Abc_Ntk_t * pNtk ) // ABC_FREE( pObj->vFanouts.pArray ); // these flags should be always zero // if this is not true, something is wrong somewhere - assert( pObj->fMarkA == 0 ); - assert( pObj->fMarkB == 0 ); - assert( pObj->fMarkC == 0 ); +// assert( pObj->fMarkA == 0 ); +// assert( pObj->fMarkB == 0 ); +// assert( pObj->fMarkC == 0 ); + if ( !fWarning && (pObj->fMarkA || pObj->fMarkB || pObj->fMarkC) ) + { printf( "Flags A, B, or C are not zero.\n" ), fWarning = 1; } } // free the nodes if ( pNtk->pMmStep == NULL ) diff --git a/src/base/abci/abc.c b/src/base/abci/abc.c index 84734e6f..ab80eef3 100644 --- a/src/base/abci/abc.c +++ b/src/base/abci/abc.c @@ -485,8 +485,9 @@ static int Abc_CommandAbc9Of ( Abc_Frame_t * pAbc, int argc, cha static int Abc_CommandAbc9Pack ( Abc_Frame_t * pAbc, int argc, char ** argv ); static int Abc_CommandAbc9Edge ( Abc_Frame_t * pAbc, int argc, char ** argv ); static int Abc_CommandAbc9SatLut ( Abc_Frame_t * pAbc, int argc, char ** argv ); -static int Abc_CommandAbc9MinLut ( Abc_Frame_t * pAbc, int argc, char ** argv ); -static int Abc_CommandAbc9MinSim ( Abc_Frame_t * pAbc, int argc, char ** argv ); +static int Abc_CommandAbc9LNetSim ( Abc_Frame_t * pAbc, int argc, char ** argv ); +static int Abc_CommandAbc9LNetOpt ( Abc_Frame_t * pAbc, int argc, char ** argv ); +static int Abc_CommandAbc9LNetMap ( Abc_Frame_t * pAbc, int argc, char ** argv ); static int Abc_CommandAbc9Unmap ( Abc_Frame_t * pAbc, int argc, char ** argv ); static int Abc_CommandAbc9Struct ( Abc_Frame_t * pAbc, int argc, char ** argv ); static int Abc_CommandAbc9Trace ( Abc_Frame_t * pAbc, int argc, char ** argv ); @@ -1210,8 +1211,9 @@ void Abc_Init( Abc_Frame_t * pAbc ) Cmd_CommandAdd( pAbc, "ABC9", "&pack", Abc_CommandAbc9Pack, 0 ); Cmd_CommandAdd( pAbc, "ABC9", "&edge", Abc_CommandAbc9Edge, 0 ); Cmd_CommandAdd( pAbc, "ABC9", "&satlut", Abc_CommandAbc9SatLut, 0 ); - Cmd_CommandAdd( pAbc, "ABC9", "&minlut", Abc_CommandAbc9MinLut, 0 ); - Cmd_CommandAdd( pAbc, "ABC9", "&minsim", Abc_CommandAbc9MinSim, 0 ); + Cmd_CommandAdd( pAbc, "ABC9", "&lnetsim", Abc_CommandAbc9LNetSim, 0 ); + Cmd_CommandAdd( pAbc, "ABC9", "&lnetopt", Abc_CommandAbc9LNetOpt, 0 ); + Cmd_CommandAdd( pAbc, "ABC9", "&lnetmap", Abc_CommandAbc9LNetMap, 0 ); Cmd_CommandAdd( pAbc, "ABC9", "&unmap", Abc_CommandAbc9Unmap, 0 ); Cmd_CommandAdd( pAbc, "ABC9", "&struct", Abc_CommandAbc9Struct, 0 ); Cmd_CommandAdd( pAbc, "ABC9", "&trace", Abc_CommandAbc9Trace, 0 ); @@ -10411,7 +10413,7 @@ int Abc_CommandPutOnTop( Abc_Frame_t * pAbc, int argc, char ** argv ) { extern Abc_Ntk_t * Abc_NtkPutOnTop( Abc_Ntk_t * pNtk, Abc_Ntk_t * pNtk2 ); - Abc_Ntk_t * pNtk, * pNtk2, * pNtkRes; + Abc_Ntk_t * pNtk, * pNtk2, * pNtkRes = NULL; char * FileName; int fComb = 0; int c; @@ -10431,6 +10433,39 @@ int Abc_CommandPutOnTop( Abc_Frame_t * pAbc, int argc, char ** argv ) } } + if ( argc > globalUtilOptind + 1 ) + { + Abc_Ntk_t * pStrash; + for ( c = 1; c < argc; c++ ) + { + Abc_Ntk_t * pTemp, * pLogic = Io_Read( argv[c], Io_ReadFileType(argv[c]), 1, 0 ); + if ( pLogic == NULL ) + return 1; + if ( Abc_NtkIsStrash(pLogic) ) + { + pLogic = Abc_NtkToLogic( pTemp = pLogic ); + Abc_NtkDelete( pTemp ); + } + if ( pLogic == NULL ) + return 1; + if ( pNtkRes == NULL ) + pNtkRes = pLogic; + else + { + pNtkRes = Abc_NtkPutOnTop( pTemp = pNtkRes, pLogic ); + Abc_NtkDelete( pTemp ); + Abc_NtkDelete( pLogic ); + if ( pNtkRes == NULL ) + return 1; + } + } + assert( Abc_NtkIsLogic(pNtkRes) ); + pStrash = Abc_NtkStrash( pNtkRes, 1, 1, 0 ); + Abc_FrameReplaceCurrentNetwork( pAbc, pStrash ); + Abc_NtkDelete( pNtkRes ); + return 0; + } + // get the second network if ( argc != globalUtilOptind + 1 ) { @@ -10492,6 +10527,7 @@ usage: Abc_Print( -2, "\t connects PIs of network in <file> to POs of current network\n" ); Abc_Print( -2, "\t-h : print the command usage\n"); Abc_Print( -2, "\t<file> : file name with the second network\n"); + Abc_Print( -2, "\t : (given several files, all networks are stacked on top of each other)\n"); return 1; } @@ -14054,6 +14090,12 @@ int Abc_CommandTest( Abc_Frame_t * pAbc, int argc, char ** argv ) //Dau_NetworkEnumTest(); //Extra_SimulationTest( nDivMax, nNumOnes, fNewOrder ); //Mnist_ExperimentWithScaling( nDecMax ); + if ( Abc_FrameReadNtk(pAbc) ) + { + extern Abc_Ntk_t * Abc_NtkSpecialMapping( Abc_Ntk_t * pNtk, int fVerbose ); + Abc_Ntk_t * pNtkRes = Abc_NtkSpecialMapping( Abc_FrameReadNtk(pAbc), 0 ); + Abc_FrameReplaceCurrentNetwork( pAbc, pNtkRes ); + } return 0; usage: Abc_Print( -2, "usage: test [-CKDNM] [-aovwh] <file_name>\n" ); @@ -40838,15 +40880,12 @@ usage: SeeAlso [] ***********************************************************************/ -int Abc_CommandAbc9MinLut( Abc_Frame_t * pAbc, int argc, char ** argv ) +int Abc_CommandAbc9LNetSim( Abc_Frame_t * pAbc, int argc, char ** argv ) { - extern Gia_Man_t * Gia_ManSimInfoSynth( Gia_Man_t * p, char * pFileName, int nIns, int nOuts, int LutSize, int Thresh, int fVerbose ); - //extern Gia_Man_t * Gia_ManPerformMinLut( Gia_Man_t * p, int GroupSize, int LutSize, int fVerbose ); - Gia_Man_t * pTemp; - char * pFileName = NULL; - int c, nIns = 6, nOuts = 2, LutSize = 6, Limit = -1, fVerbose = 0; + extern void Gia_ManSimInfoPassTest( Gia_Man_t * p, char * pFileName, char * pFileName2, int fCompare ); + int c, nIns = 6, nOuts = 2, fCompare = 0, fVerbose = 0; Extra_UtilGetoptReset(); - while ( ( c = Extra_UtilGetopt( argc, argv, "IOKLvh" ) ) != EOF ) + while ( ( c = Extra_UtilGetopt( argc, argv, "IOcvh" ) ) != EOF ) { switch ( c ) { @@ -40868,19 +40907,94 @@ int Abc_CommandAbc9MinLut( Abc_Frame_t * pAbc, int argc, char ** argv ) nOuts = atoi(argv[globalUtilOptind]); globalUtilOptind++; break; - case 'K': + case 'c': + fCompare ^= 1; + break; + case 'v': + fVerbose ^= 1; + break; + case 'h': + default: + goto usage; + } + } + if ( argc == globalUtilOptind + 3 ) + { + extern void Gia_ManSimInfoTransform( char * pFileName, char * pFileOut1, char * pFileOut2, int nIns, int nOuts ); + Gia_ManSimInfoTransform( argv[globalUtilOptind], argv[globalUtilOptind+1], argv[globalUtilOptind+2], nIns, nOuts ); + return 0; + } + if ( pAbc->pGia == NULL ) + { + Abc_Print( -1, "Empty GIA network.\n" ); + return 1; + } + if ( argc != globalUtilOptind + 2 ) + { + Abc_Print( -1, "Expecting two file names on the command line.\n" ); + return 1; + } + Gia_ManSimInfoPassTest( pAbc->pGia, argv[globalUtilOptind], argv[globalUtilOptind+1], fCompare ); + return 0; + +usage: + Abc_Print( -2, "usage: &lnetsim [-IO num] [-cvh] <file> <file2> <file3>\n" ); + Abc_Print( -2, "\t performs specialized AIG simulation\n" ); + Abc_Print( -2, "\t-I num : the input support size [default = %d]\n", nIns ); + Abc_Print( -2, "\t-O num : the output group size [default = %d]\n", nOuts ); + Abc_Print( -2, "\t-c : toggles comparing simulation patterns [default = %s]\n", fCompare? "yes": "no" ); + Abc_Print( -2, "\t-v : toggles verbose output [default = %s]\n", fVerbose? "yes": "no" ); + Abc_Print( -2, "\t-h : prints the command usage\n"); + Abc_Print( -2, "\t<file> : file name with simulation information\n"); + Abc_Print( -2, "\t<file2> : file name with simulation information\n"); + Abc_Print( -2, "\t<file3> : file name with simulation information (optional)\n"); + return 1; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Abc_CommandAbc9LNetOpt( Abc_Frame_t * pAbc, int argc, char ** argv ) +{ + extern Gia_Man_t * Gia_ManPerformLNetOpt( Gia_Man_t * p, char * pFileName, int nIns, int nOuts, int Thresh, int fVerbose ); + Gia_Man_t * pTemp; + char * pFileName = NULL; + int c, nIns = 6, nOuts = 2, Limit = 0, fVerbose = 0; + Extra_UtilGetoptReset(); + while ( ( c = Extra_UtilGetopt( argc, argv, "IORvh" ) ) != EOF ) + { + switch ( c ) + { + case 'I': if ( globalUtilOptind >= argc ) { - Abc_Print( -1, "Command line switch \"-K\" should be followed by a positive integer.\n" ); + Abc_Print( -1, "Command line switch \"-I\" should be followed by a positive integer.\n" ); goto usage; } - LutSize = atoi(argv[globalUtilOptind]); + nIns = atoi(argv[globalUtilOptind]); globalUtilOptind++; break; - case 'L': + case 'O': if ( globalUtilOptind >= argc ) { - Abc_Print( -1, "Command line switch \"-L\" should be followed by a positive integer.\n" ); + Abc_Print( -1, "Command line switch \"-O\" should be followed by a positive integer.\n" ); + goto usage; + } + nOuts = atoi(argv[globalUtilOptind]); + globalUtilOptind++; + break; + case 'R': + if ( globalUtilOptind >= argc ) + { + Abc_Print( -1, "Command line switch \"-R\" should be followed by a positive integer.\n" ); goto usage; } Limit = atoi(argv[globalUtilOptind]); @@ -40894,6 +41008,10 @@ int Abc_CommandAbc9MinLut( Abc_Frame_t * pAbc, int argc, char ** argv ) goto usage; } } + if ( argc > globalUtilOptind + 1 ) + { + return 0; + } if ( pAbc->pGia == NULL ) { Abc_Print( -1, "Empty GIA network.\n" ); @@ -40910,20 +41028,17 @@ int Abc_CommandAbc9MinLut( Abc_Frame_t * pAbc, int argc, char ** argv ) fclose( pFile ); pFileName = argv[globalUtilOptind]; } - //pTemp = Gia_ManPerformMinLut( pAbc->pGia, GroupSize, LutSize, fVerbose ); - //Abc_FrameUpdateGia( pAbc, pTemp ); - pTemp = Gia_ManSimInfoSynth( pAbc->pGia, pFileName, nIns, nOuts, LutSize, Limit, fVerbose ); + pTemp = Gia_ManPerformLNetOpt( pAbc->pGia, pFileName, nIns, nOuts, Limit, fVerbose ); Abc_FrameUpdateGia( pAbc, pTemp ); return 0; usage: - Abc_Print( -2, "usage: &minlut [-IOKL num] [-vh] <file>\n" ); - Abc_Print( -2, "\t performs specialized LUT mapping\n" ); - Abc_Print( -2, "\t-I num : the input support size [default = %d]\n", nIns ); - Abc_Print( -2, "\t-O num : the output group size [default = %d]\n", nOuts ); - Abc_Print( -2, "\t-K num : the LUT size for mapping [default = %d]\n", LutSize ); - Abc_Print( -2, "\t-L num : patterns count after this limit [default = %d]\n", Limit ); - Abc_Print( -2, "\t-v : toggles verbose output [default = %s]\n", fVerbose? "yes": "no" ); + Abc_Print( -2, "usage: &lnetopt [-IOR num] [-vh] <file>\n" ); + Abc_Print( -2, "\t performs specialized AIG optimization\n" ); + Abc_Print( -2, "\t-I num : the input support size [default = %d]\n", nIns ); + Abc_Print( -2, "\t-O num : the output group size [default = %d]\n", nOuts ); + Abc_Print( -2, "\t-R num : patterns are cares starting this value [default = %d]\n", Limit ); + Abc_Print( -2, "\t-v : toggles verbose output [default = %s]\n", fVerbose? "yes": "no" ); Abc_Print( -2, "\t-h : prints the command usage\n"); Abc_Print( -2, "\t<file> : file name with simulation information\n"); return 1; @@ -40940,17 +41055,37 @@ usage: SeeAlso [] ***********************************************************************/ -int Abc_CommandAbc9MinSim( Abc_Frame_t * pAbc, int argc, char ** argv ) +int Abc_CommandAbc9LNetMap( Abc_Frame_t * pAbc, int argc, char ** argv ) { - extern void Gia_ManSimInfoPassTest( Gia_Man_t * p, char * pFileName, char * pFileName2, int fCompare ); - int c, fCompare = 0, fVerbose = 0; + extern Abc_Ntk_t * Gia_ManPerformLNetMap( Gia_Man_t * p, int GroupSize, int fUseFixed, int fVerbose ); + Abc_Ntk_t * pTemp; + char * pFileName = NULL; + int c, nIns = 6, nOuts = 2, fUseFixed = 0, fVerbose = 0; Extra_UtilGetoptReset(); - while ( ( c = Extra_UtilGetopt( argc, argv, "cvh" ) ) != EOF ) + while ( ( c = Extra_UtilGetopt( argc, argv, "IOfvh" ) ) != EOF ) { switch ( c ) { - case 'c': - fCompare ^= 1; + case 'I': + if ( globalUtilOptind >= argc ) + { + Abc_Print( -1, "Command line switch \"-I\" should be followed by a positive integer.\n" ); + goto usage; + } + nIns = atoi(argv[globalUtilOptind]); + globalUtilOptind++; + break; + case 'O': + if ( globalUtilOptind >= argc ) + { + Abc_Print( -1, "Command line switch \"-O\" should be followed by a positive integer.\n" ); + goto usage; + } + nOuts = atoi(argv[globalUtilOptind]); + globalUtilOptind++; + break; + case 'f': + fUseFixed ^= 1; break; case 'v': fVerbose ^= 1; @@ -40965,22 +41100,30 @@ int Abc_CommandAbc9MinSim( Abc_Frame_t * pAbc, int argc, char ** argv ) Abc_Print( -1, "Empty GIA network.\n" ); return 1; } - if ( argc != globalUtilOptind + 2 ) + if ( argc == globalUtilOptind + 1 ) { - Abc_Print( -1, "Expecting two file names on the command line.\n" ); - return 1; + FILE * pFile = fopen( argv[globalUtilOptind], "rb" ); + if ( pFile == NULL ) + { + Abc_Print( -1, "Abc_CommandAbc9BCore(): Cannot open file \"%s\" for writing the proof.\n", argv[globalUtilOptind] ); + return 0; + } + fclose( pFile ); + pFileName = argv[globalUtilOptind]; } - Gia_ManSimInfoPassTest( pAbc->pGia, argv[globalUtilOptind], argv[globalUtilOptind+1], fCompare ); + pTemp = Gia_ManPerformLNetMap( pAbc->pGia, nOuts, fUseFixed, fVerbose ); + Abc_FrameReplaceCurrentNetwork( pAbc, pTemp ); return 0; usage: - Abc_Print( -2, "usage: &minsim [-cvh] <file> <file2>\n" ); - Abc_Print( -2, "\t performs specialized AIG simulation\n" ); - Abc_Print( -2, "\t-c : toggles comparing simulation patterns [default = %s]\n", fCompare? "yes": "no" ); - Abc_Print( -2, "\t-v : toggles verbose output [default = %s]\n", fVerbose? "yes": "no" ); + Abc_Print( -2, "usage: &lnetmap [-IO num] [-fvh] <file>\n" ); + Abc_Print( -2, "\t performs specialized LUT mapping\n" ); + Abc_Print( -2, "\t-I num : the input support size [default = %d]\n", nIns ); + Abc_Print( -2, "\t-O num : the output group size [default = %d]\n", nOuts ); + Abc_Print( -2, "\t-f : toggles using fixed primitives [default = %s]\n", fUseFixed? "yes": "no" ); + Abc_Print( -2, "\t-v : toggles verbose output [default = %s]\n", fVerbose? "yes": "no" ); Abc_Print( -2, "\t-h : prints the command usage\n"); Abc_Print( -2, "\t<file> : file name with simulation information\n"); - Abc_Print( -2, "\t<file2> : file name with simulation information\n"); return 1; } @@ -48562,7 +48705,6 @@ usage: ***********************************************************************/ int Abc_CommandAbc9Test( Abc_Frame_t * pAbc, int argc, char ** argv ) { - extern void Gia_ManSimInfoTryTest( Gia_Man_t * p, int fSmall ); extern void Gia_RsbEnumerateWindows( Gia_Man_t * p, int nInputsMax, int nLevelsMax ); extern int Gia_ManSumTotalOfSupportSizes( Gia_Man_t * p ); int c, fVerbose = 0; @@ -48626,7 +48768,6 @@ int Abc_CommandAbc9Test( Abc_Frame_t * pAbc, int argc, char ** argv ) // return 1; // } // Abc_FrameUpdateGia( pAbc, Abc_Procedure(pAbc->pGia) ); - Gia_ManSimInfoTryTest( pAbc->pGia, fSwitch ); // printf( "AIG in \"%s\" has the sum of output support sizes equal to %d.\n", pAbc->pGia->pSpec, Gia_ManSumTotalOfSupportSizes(pAbc->pGia) ); return 0; usage: diff --git a/src/base/abci/abcLut.c b/src/base/abci/abcLut.c index edc2b7de..8dc84ba0 100644 --- a/src/base/abci/abcLut.c +++ b/src/base/abci/abcLut.c @@ -783,6 +783,164 @@ int Abc_NodeDecomposeStep( Abc_ManScl_t * p ) return 1; } +/**Function************************************************************* + + Synopsis [Performs specialized mapping.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static word s__Truths6[6] = { + ABC_CONST(0xAAAAAAAAAAAAAAAA), + ABC_CONST(0xCCCCCCCCCCCCCCCC), + ABC_CONST(0xF0F0F0F0F0F0F0F0), + ABC_CONST(0xFF00FF00FF00FF00), + ABC_CONST(0xFFFF0000FFFF0000), + ABC_CONST(0xFFFFFFFF00000000) +}; +word Abc_ObjComputeTruth( Abc_Obj_t * pObj, Vec_Int_t * vSupp ) +{ + int Index; word t0, t1, tc; + assert( Vec_IntSize(vSupp) <= 6 ); + if ( (Index = Vec_IntFind(vSupp, Abc_ObjId(pObj))) >= 0 ) + return s__Truths6[Index]; + assert( Abc_ObjIsNode(pObj) ); + if ( Abc_ObjFaninNum(pObj) == 0 ) + return Abc_NodeIsConst0(pObj) ? (word)0 : ~(word)0; + assert( Abc_ObjFaninNum(pObj) == 3 ); + t0 = Abc_ObjComputeTruth( Abc_ObjFanin(pObj, 2), vSupp ); + t1 = Abc_ObjComputeTruth( Abc_ObjFanin(pObj, 1), vSupp ); + tc = Abc_ObjComputeTruth( Abc_ObjFanin(pObj, 0), vSupp ); + return (tc & t1) | (~tc & t0); +} +Abc_Obj_t * Abc_NtkSpecialMap_rec( Abc_Ntk_t * pNew, Abc_Obj_t * pObj, Vec_Wec_t * vSupps, Vec_Int_t * vCover ) +{ + if ( pObj->pCopy ) + return pObj->pCopy; + if ( Abc_ObjFaninNum(pObj) == 0 ) + return NULL; + assert( Abc_ObjFaninNum(pObj) == 3 ); + if ( pObj->fMarkA || pObj->fMarkB ) + { + Abc_Obj_t * pFan0 = Abc_NtkSpecialMap_rec( pNew, Abc_ObjFanin(pObj, 2), vSupps, vCover ); + Abc_Obj_t * pFan1 = Abc_NtkSpecialMap_rec( pNew, Abc_ObjFanin(pObj, 1), vSupps, vCover ); + Abc_Obj_t * pFanC = Abc_NtkSpecialMap_rec( pNew, Abc_ObjFanin(pObj, 0), vSupps, vCover ); + if ( pFan0 == NULL ) + pFan0 = Abc_NodeIsConst0(Abc_ObjFanin(pObj, 2)) ? Abc_NtkCreateNodeConst0(pNew) : Abc_NtkCreateNodeConst1(pNew); + if ( pFan1 == NULL ) + pFan1 = Abc_NodeIsConst0(Abc_ObjFanin(pObj, 1)) ? Abc_NtkCreateNodeConst0(pNew) : Abc_NtkCreateNodeConst1(pNew); + pObj->pCopy = Abc_NtkCreateNodeMux( pNew, pFanC, pFan1, pFan0 ); + pObj->pCopy->fMarkA = pObj->fMarkA; + pObj->pCopy->fMarkB = pObj->fMarkB; + } + else + { + Abc_Obj_t * pTemp; int i; word Truth; + Vec_Int_t * vSupp = Vec_WecEntry( vSupps, Abc_ObjId(pObj) ); + Abc_NtkForEachObjVec( vSupp, pObj->pNtk, pTemp, i ) + Abc_NtkSpecialMap_rec( pNew, pTemp, vSupps, vCover ); + pObj->pCopy = Abc_NtkCreateNode( pNew ); + Abc_NtkForEachObjVec( vSupp, pObj->pNtk, pTemp, i ) + Abc_ObjAddFanin( pObj->pCopy, pTemp->pCopy ); + Truth = Abc_ObjComputeTruth( pObj, vSupp ); + pObj->pCopy->pData = Abc_SopCreateFromTruthIsop( (Mem_Flex_t *)pNew->pManFunc, Vec_IntSize(vSupp), &Truth, vCover ); + assert( Abc_SopGetVarNum((char *)pObj->pCopy->pData) == Vec_IntSize(vSupp) ); + } + return pObj->pCopy; +} +Abc_Ntk_t * Abc_NtkSpecialMapping( Abc_Ntk_t * pNtk, int fVerbose ) +{ + Abc_Ntk_t * pNtkNew; + Vec_Int_t * vCover = Vec_IntAlloc( 1 << 16 ); + Vec_Wec_t * vSupps = Vec_WecStart( Abc_NtkObjNumMax(pNtk) ); + Abc_Obj_t * pObj, * pFan0, * pFan1, * pFanC; int i, Count[2] = {0}; + Abc_NtkForEachCi( pNtk, pObj, i ) + Vec_IntPush( Vec_WecEntry(vSupps, i), i ); + Abc_NtkForEachNode( pNtk, pObj, i ) + { + Vec_Int_t * vSupp = Vec_WecEntry(vSupps, i); + if ( Abc_ObjFaninNum(pObj) == 0 ) + continue; + assert( Abc_ObjFaninNum(pObj) == 3 ); + pFan0 = Abc_ObjFanin( pObj, 2 ); + pFan1 = Abc_ObjFanin( pObj, 1 ); + pFanC = Abc_ObjFanin0( pObj ); + assert( Abc_ObjIsCi(pFanC) ); + if ( pFan0->fMarkA && pFan1->fMarkA ) + { + pObj->fMarkB = 1; + Vec_IntPush( vSupp, Abc_ObjId(pObj) ); + continue; + } + Vec_IntTwoMerge2( Vec_WecEntry(vSupps, Abc_ObjId(pFan0)), Vec_WecEntry(vSupps, Abc_ObjId(pFan1)), vSupp ); + assert( Vec_IntFind(vSupp, Abc_ObjId(pFanC)) == -1 ); + Vec_IntPushOrder( vSupp, Abc_ObjId(pFanC) ); + if ( Vec_IntSize(vSupp) <= 6 ) + continue; + Vec_IntClear( vSupp ); + if ( !pFan0->fMarkA && !pFan1->fMarkA ) + { + pObj->fMarkA = 1; + Vec_IntPush( vSupp, Abc_ObjId(pObj) ); + } + else + { + Vec_IntPushOrder( vSupp, Abc_ObjId(pFan0) ); + Vec_IntPushOrder( vSupp, Abc_ObjId(pFan1) ); + Vec_IntPushOrder( vSupp, Abc_ObjId(pFanC) ); + } + } + + if ( fVerbose ) + Abc_NtkForEachNode( pNtk, pObj, i ) + { + printf( "Node %4d : ", i ); + if ( pObj->fMarkA ) + printf( " MarkA " ); + else + printf( " " ); + if ( pObj->fMarkB ) + printf( " MarkB " ); + else + printf( " " ); + Vec_IntPrint( Vec_WecEntry(vSupps, i) ); + } + + Abc_NtkCleanCopy( pNtk ); + pNtkNew = Abc_NtkStartFrom( pNtk, ABC_NTK_LOGIC, ABC_FUNC_SOP ); + Abc_NtkForEachCo( pNtk, pObj, i ) + if ( Abc_ObjFaninNum(Abc_ObjFanin0(pObj)) == 0 ) + Abc_ObjFanin0(pObj)->pCopy = Abc_NodeIsConst0(Abc_ObjFanin0(pObj)) ? Abc_NtkCreateNodeConst0(pNtkNew) : Abc_NtkCreateNodeConst1(pNtkNew); + else + Abc_NtkSpecialMap_rec( pNtkNew, Abc_ObjFanin0(pObj), vSupps, vCover ); + Abc_NtkFinalize( pNtk, pNtkNew ); + Abc_NtkCleanMarkAB( pNtk ); + Vec_WecFree( vSupps ); + Vec_IntFree( vCover ); + + Abc_NtkForEachNode( pNtkNew, pObj, i ) + { + Count[0] += pObj->fMarkA, + Count[1] += pObj->fMarkB; + pObj->fPersist = pObj->fMarkA | pObj->fMarkB; + pObj->fMarkA = pObj->fMarkB = 0; + } + //printf( "Total = %3d. Nodes = %3d. MarkA = %3d. MarkB = %3d.\n", Abc_NtkNodeNum(pNtkNew), + // Abc_NtkNodeNum(pNtkNew) - Count[0] - Count[1], Count[0], Count[1] ); + + if ( !Abc_NtkCheck( pNtkNew ) ) + { + printf( "Abc_NtkSpecialMapping: The network check has failed.\n" ); + Abc_NtkDelete( pNtkNew ); + return NULL; + } + return pNtkNew; +} + //////////////////////////////////////////////////////////////////////// /// END OF FILE /// //////////////////////////////////////////////////////////////////////// diff --git a/src/base/abci/abcNtbdd.c b/src/base/abci/abcNtbdd.c index 3c28ce4f..cbf4bbb8 100644 --- a/src/base/abci/abcNtbdd.c +++ b/src/base/abci/abcNtbdd.c @@ -274,7 +274,7 @@ int Abc_NtkBddToMuxesPerformGlo( Abc_Ntk_t * pNtk, Abc_Ntk_t * pNtkNew, int Limi Abc_Obj_t * pObj, * pObjNew; int i; st__table * tBdd2Node; assert( Abc_NtkIsStrash(pNtk) ); - dd = (DdManager *)Abc_NtkBuildGlobalBdds( pNtk, Limit, 1, 1, fReorder, 0 ); + dd = (DdManager *)Abc_NtkBuildGlobalBdds( pNtk, Limit, 1, fReorder, 0, 0 ); if ( dd == NULL ) { printf( "Construction of global BDDs has failed.\n" ); diff --git a/src/base/io/io.c b/src/base/io/io.c index dec5ee45..5cf74ef9 100644 --- a/src/base/io/io.c +++ b/src/base/io/io.c @@ -2982,13 +2982,13 @@ usage: ***********************************************************************/ int IoCommandWriteVerilog( Abc_Frame_t * pAbc, int argc, char **argv ) { - extern void Io_WriteVerilogLut( Abc_Ntk_t * pNtk, char * pFileName, int nLutSize ); + extern void Io_WriteVerilogLut( Abc_Ntk_t * pNtk, char * pFileName, int nLutSize, int fFixed, int fNoModules ); char * pFileName; - int c, fOnlyAnds = 0; + int c, fFixed = 0, fOnlyAnds = 0, fNoModules = 0; int nLutSize = -1; Extra_UtilGetoptReset(); - while ( ( c = Extra_UtilGetopt( argc, argv, "Kah" ) ) != EOF ) + while ( ( c = Extra_UtilGetopt( argc, argv, "Kfamh" ) ) != EOF ) { switch ( c ) { @@ -3003,9 +3003,15 @@ int IoCommandWriteVerilog( Abc_Frame_t * pAbc, int argc, char **argv ) if ( nLutSize < 2 || nLutSize > 6 ) goto usage; break; + case 'f': + fFixed ^= 1; + break; case 'a': fOnlyAnds ^= 1; break; + case 'm': + fNoModules ^= 1; + break; case 'h': goto usage; default: @@ -3019,6 +3025,8 @@ int IoCommandWriteVerilog( Abc_Frame_t * pAbc, int argc, char **argv ) } if ( argc != globalUtilOptind + 1 ) goto usage; + if ( fFixed ) + nLutSize = 6; // get the output file name pFileName = argv[globalUtilOptind]; // call the corresponding file writer @@ -3031,16 +3039,18 @@ int IoCommandWriteVerilog( Abc_Frame_t * pAbc, int argc, char **argv ) Abc_NtkDelete( pNtkTemp ); } else if ( nLutSize >= 2 && nLutSize <= 6 ) - Io_WriteVerilogLut( pAbc->pNtkCur, pFileName, nLutSize ); + Io_WriteVerilogLut( pAbc->pNtkCur, pFileName, nLutSize, fFixed, fNoModules ); else Io_Write( pAbc->pNtkCur, pFileName, IO_FILE_VERILOG ); return 0; usage: - fprintf( pAbc->Err, "usage: write_verilog [-K num] [-ah] <file>\n" ); + fprintf( pAbc->Err, "usage: write_verilog [-K num] [-famh] <file>\n" ); fprintf( pAbc->Err, "\t writes the current network in Verilog format\n" ); fprintf( pAbc->Err, "\t-K num : write the network using instances of K-LUTs (2 <= K <= 6) [default = not used]\n" ); + fprintf( pAbc->Err, "\t-f : toggle using fixed format [default = %s]\n", fFixed? "yes":"no" ); fprintf( pAbc->Err, "\t-a : toggle writing expressions with only ANDs (without XORs and MUXes) [default = %s]\n", fOnlyAnds? "yes":"no" ); + fprintf( pAbc->Err, "\t-m : toggle writing additional modules [default = %s]\n", !fNoModules? "yes":"no" ); fprintf( pAbc->Err, "\t-h : print the help massage\n" ); fprintf( pAbc->Err, "\tfile : the name of the file to write\n" ); return 1; diff --git a/src/base/io/ioWriteVerilog.c b/src/base/io/ioWriteVerilog.c index 4c55b599..e05aed2e 100644 --- a/src/base/io/ioWriteVerilog.c +++ b/src/base/io/ioWriteVerilog.c @@ -639,10 +639,8 @@ int Io_WriteVerilogWiresCount( Abc_Ntk_t * pNtk ) char * Io_WriteVerilogGetName( char * pName ) { static char Buffer[500]; - int Length, i; - Length = strlen(pName); - // consider the case of a signal having name "0" or "1" - if ( !(Length == 1 && (pName[0] == '0' || pName[0] == '1')) ) + int i, Length = strlen(pName); + if ( pName[0] < '0' || pName[0] > '9' ) { for ( i = 0; i < Length; i++ ) if ( !((pName[i] >= 'a' && pName[i] <= 'z') || @@ -679,7 +677,39 @@ void Io_WriteLutModule( FILE * pFile, int nLutSize ) fprintf( pFile, " assign out = TT[in];\n" ); fprintf( pFile, "endmodule\n\n" ); } -void Io_WriteVerilogObjectsLut( FILE * pFile, Abc_Ntk_t * pNtk, int nLutSize ) +void Io_WriteFixedModules( FILE * pFile ) +{ + fprintf( pFile, "module LUT6 #( parameter INIT = 64\'h0000000000000000 ) (\n" ); + fprintf( pFile, " output O,\n" ); + fprintf( pFile, " input I0,\n" ); + fprintf( pFile, " input I1,\n" ); + fprintf( pFile, " input I2,\n" ); + fprintf( pFile, " input I3,\n" ); + fprintf( pFile, " input I4,\n" ); + fprintf( pFile, " input I5\n" ); + fprintf( pFile, ");\n" ); + fprintf( pFile, " assign O = INIT[ {I5, I4, I3, I2, I1, I0} ];\n" ); + fprintf( pFile, "endmodule\n\n" ); + + fprintf( pFile, "module MUXF7 (\n" ); + fprintf( pFile, " output O,\n" ); + fprintf( pFile, " input I0,\n" ); + fprintf( pFile, " input I1,\n" ); + fprintf( pFile, " input S\n" ); + fprintf( pFile, ");\n" ); + fprintf( pFile, " assign O = S ? I1 : I0;\n" ); + fprintf( pFile, "endmodule\n\n" ); + + fprintf( pFile, "module MUXF8 (\n" ); + fprintf( pFile, " output O,\n" ); + fprintf( pFile, " input I0,\n" ); + fprintf( pFile, " input I1,\n" ); + fprintf( pFile, " input S\n" ); + fprintf( pFile, ");\n" ); + fprintf( pFile, " assign O = S ? I1 : I0;\n" ); + fprintf( pFile, "endmodule\n\n" ); +} +void Io_WriteVerilogObjectsLut( FILE * pFile, Abc_Ntk_t * pNtk, int nLutSize, int fFixed ) { Abc_Ntk_t * pNtkBox; Abc_Obj_t * pObj, * pTerm; @@ -719,6 +749,34 @@ void Io_WriteVerilogObjectsLut( FILE * pFile, Abc_Ntk_t * pNtk, int nLutSize ) // write LUT instances nDigits = Abc_Base10Log( Abc_NtkNodeNum(pNtk) ); Counter = 0; + if ( fFixed ) + Abc_NtkForEachNode( pNtk, pObj, i ) + { + if ( pObj->fPersist ) + { + int One = Abc_ObjFanin0(Abc_ObjFanin(pObj, 1))->fPersist && Abc_ObjFanin0(Abc_ObjFanin(pObj, 2))->fPersist; + fprintf( pFile, " MUXF%d ", 7+One ); + fprintf( pFile, " mux_%0*d (", nDigits, Counter++ ); + fprintf( pFile, " %*s", Length, Io_WriteVerilogGetName(Abc_ObjName(Abc_ObjFanout0(pObj))) ); + for ( k = Abc_ObjFaninNum(pObj) - 1; k >= 0; k-- ) + fprintf( pFile, ", %*s", Length, Io_WriteVerilogGetName(Abc_ObjName(Abc_ObjFanin(pObj, k))) ); + fprintf( pFile, " );\n" ); + } + else + { + word Truth = Abc_SopToTruth( (char *)pObj->pData, Abc_ObjFaninNum(pObj) ); + fprintf( pFile, " LUT6 #(64\'h" ); + fprintf( pFile, "%08x%08x", (unsigned)(Truth >> 32), (unsigned)Truth ); + fprintf( pFile, ") lut_%0*d (", nDigits, Counter++ ); + fprintf( pFile, " %*s", Length, Io_WriteVerilogGetName(Abc_ObjName(Abc_ObjFanout0(pObj))) ); + for ( k = 0; k < Abc_ObjFaninNum(pObj); k++ ) + fprintf( pFile, ", %*s", Length, Io_WriteVerilogGetName(Abc_ObjName(Abc_ObjFanin(pObj, k))) ); + for ( ; k < 6; k++ ) + fprintf( pFile, ", %*s", Length, "1\'b0" ); + fprintf( pFile, " );\n" ); + } + } + else Abc_NtkForEachNode( pNtk, pObj, i ) { word Truth = Abc_SopToTruth( (char *)pObj->pData, Abc_ObjFaninNum(pObj) ); @@ -735,7 +793,7 @@ void Io_WriteVerilogObjectsLut( FILE * pFile, Abc_Ntk_t * pNtk, int nLutSize ) fprintf( pFile, "}, %*s );\n", Length, Io_WriteVerilogGetName(Abc_ObjName(Abc_ObjFanout0(pObj))) ); } } -void Io_WriteVerilogLutInt( FILE * pFile, Abc_Ntk_t * pNtk, int nLutSize ) +void Io_WriteVerilogLutInt( FILE * pFile, Abc_Ntk_t * pNtk, int nLutSize, int fFixed ) { // write inputs and outputs // fprintf( pFile, "module %s ( gclk,\n ", Abc_NtkName(pNtk) ); @@ -786,7 +844,7 @@ void Io_WriteVerilogLutInt( FILE * pFile, Abc_Ntk_t * pNtk, int nLutSize ) fprintf( pFile, ";\n\n" ); } // write nodes - Io_WriteVerilogObjectsLut( pFile, pNtk, nLutSize ); + Io_WriteVerilogObjectsLut( pFile, pNtk, nLutSize, fFixed ); // write registers if ( Abc_NtkLatchNum(pNtk) > 0 ) { @@ -797,7 +855,7 @@ void Io_WriteVerilogLutInt( FILE * pFile, Abc_Ntk_t * pNtk, int nLutSize ) // finalize the file fprintf( pFile, "\nendmodule\n\n" ); } -void Io_WriteVerilogLut( Abc_Ntk_t * pNtk, char * pFileName, int nLutSize ) +void Io_WriteVerilogLut( Abc_Ntk_t * pNtk, char * pFileName, int nLutSize, int fFixed, int fNoModules ) { FILE * pFile; Abc_Ntk_t * pNtkTemp; @@ -827,11 +885,16 @@ void Io_WriteVerilogLut( Abc_Ntk_t * pNtk, char * pFileName, int nLutSize ) // write the equations for the network fprintf( pFile, "// Benchmark \"%s\" written by ABC on %s\n", pNtk->pName, Extra_TimeStamp() ); fprintf( pFile, "\n" ); - Io_WriteLutModule( pFile, nLutSize ); - + if ( !fNoModules ) + { + if ( fFixed ) + Io_WriteFixedModules( pFile ); + else + Io_WriteLutModule( pFile, nLutSize ); + } pNtkTemp = Abc_NtkToNetlist( pNtk ); Abc_NtkToSop( pNtkTemp, -1, ABC_INFINITY ); - Io_WriteVerilogLutInt( pFile, pNtkTemp, nLutSize ); + Io_WriteVerilogLutInt( pFile, pNtkTemp, nLutSize, fFixed ); Abc_NtkDelete( pNtkTemp ); fprintf( pFile, "\n" ); |
